DETHERM database directory

Systems with 1 component(s): 70001 - 80000

The given links are permalinks. The order of the systems and the system number instead can change anytime.

  1. octanedioic acid didecyl ester
  2. octanedioic acid didodecyl ester
  3. octanedioic acid diethyl ester
  4. octanedioic acid diheptadecyl ester
  5. octanedioic acid diheptyl ester
  6. octanedioic acid dihexadecyl ester
  7. octanedioic acid dihexyl ester
  8. octanedioic acid dimethyl ester
  9. octanedioic acid dioctadecyl ester
  10. octanedioic acid dipentadecyl ester
  11. octanedioic acid dipropyl ester
  12. octanedioic acid ditetradecyl ester
  13. octanedioic acid ditridecyl ester
  14. octanedioic acid diundecyl ester
  15. octanedioyl dichloride
  16. octanenitrile
  17. octaneperoxoic acid
  18. octanoic acid
  19. octanoic acid (2E)-3,7-dimethyl-2,6-octadienyl ester
  20. octanoic acid 1,1-dimethylethyl ester
  21. octanoic acid 1,10-decanediyl ester
  22. octanoic acid 1,2,3-propanetriyl ester
  23. octanoic acid 1-methylethyl ester
  24. octanoic acid 1-methylheptyl ester
  25. octanoic acid 1-methylhexyl ester
  26. octanoic acid 1-methylpropyl ester
  27. octanoic acid 1-phenylethyl ester
  28. octanoic acid 2,2,2-trifluoroethyl ester
  29. octanoic acid 2,2-bis(((1-oxooctyl)oxy)methyl)-1,3-propanediyl ester
  30. octanoic acid 2,3-dihydroxypropyl ester
  31. octanoic acid 2-(hexyloxy)ethyl ester
  32. octanoic acid 2-butoxyethyl ester
  33. Octanoic acid 2-chloroprop-2-enyl ester
  34. octanoic acid 2-ethoxyethyl ester
  35. octanoic acid 2-ethylhexyl ester
  36. octanoic acid 2-methoxyethyl ester
  37. octanoic acid 2-methyl-2-(((1-oxooctyl)oxy)methyl)-1,3-propanediyl ester
  38. Octanoic acid 2-methylprop-2-enyl ester
  39. octanoic acid 2-propenyl ester
  40. octanoic acid 2-propoxyethyl ester
  41. octanoic acid 3,6-dihydroxy-1,2,4,5-benzenetetrayl ester
  42. octanoic acid 4-((4-nitrophenyl)azoxy)phenyl ester
  43. octanoic acid 4-methylphenyl ester
  44. octanoic acid ammonium salt
  45. Octanoic acid but-3-en-2-yl ester
  46. octanoic acid butyl ester
  47. octanoic acid cadmium(2+) salt
  48. octanoic acid calcium salt
  49. octanoic acid cerium(3+) salt
  50. octanoic acid cobalt(2+) salt
  51. octanoic acid copper(2+) salt
  52. octanoic acid cyclohexyl ester
  53. octanoic acid docosyl ester
  54. octanoic acid dodecyl ester
  55. octanoic acid eicosyl ester
  56. octanoic acid ethyl ester
  57. Octanoic acid furan-2-ylmethyl ester
  58. octanoic acid gadolinium(3+) salt
  59. octanoic acid heneicosyl ester
  60. octanoic acid heptadecyl ester
  61. octanoic acid heptyl ester
  62. octanoic acid hexadecyl ester
  63. octanoic acid hexyl ester
  64. octanoic acid lead(2+) salt
  65. octanoic acid lithium salt
  66. octanoic acid mercury(2+) salt
  67. octanoic acid methyl ester
  68. octanoic acid N,N-diphenylamide
  69. octanoic acid nonadecyl ester
  70. octanoic acid octadecyl ester
  71. octanoic acid octyl ester
  72. octanoic acid pentadecyl ester
  73. octanoic acid pentyl ester
  74. octanoic acid phenyl ester
  75. octanoic acid potassium salt
  76. octanoic acid propyl ester
  77. octanoic acid samarium(3+) salt
  78. octanoic acid sodium salt
  79. octanoic acid tetradecyl ester
  80. octanoic acid thallium(1+) salt
  81. octanoic acid tridecyl ester
  82. octanoic acid undecyl ester
  83. octanoic acid zinc(2+) salt
  84. octanoic acid, p-[(p-butoxybenzylidene)amino]phenyl ester
  85. octanonacontane
  86. octanoyl chloride
  87. octanoyl octaneperoxoate
  88. octaoctacontane
  89. octapentacontane
  90. octaphenoxycyclotetraphosphazene
  91. octaphenylcyclotetrasiloxane
  92. octaphenylpentacyclo[9.5.1.1(3,9)1(5,15).1(7,13)]octasiloxane
  93. octaphenyltrisiloxane
  94. Octapotassium dilanthanum(III) sulfate monohydrate
  95. Octasodium hexaneodymium sulfate hexahydrate
  96. Octasodium pentatitanium(IV) oxide
  97. octasodium sulfide dithioantimonate nonahydrate
  98. octasodium sulfide dithioantimonate pentahydrate
  99. octasodium sulfide dithioantimonate tetrahydrate
  100. octasodium sulfide dithioantimonite dihydrate
  101. octasodium sulfide hexathioindate monohydrate
  102. octasodium sulfide trithiotellurite tetrahydrate
  103. octasodium tricadmium sulfate trihydrate
  104. octasodium trizinc sulfate
  105. octatetracontafluorooctatetracontahydro(5,6)fullerene-C60-Ih
  106. octatetracontane
  107. Octatriacontabismuth zinc(II) oxide
  108. octatriacontan-1-ol
  109. octatriacontane
  110. octatriacontanoic acid
  111. Octatriacontanoic acid ethyl ester
  112. octatriacontanoic acid methyl ester
  113. octa[(naphthalen-2-yl)oxy]cyclotetraphosphazene
  114. Octene
  115. Octyl 2,14-dimethyl-4,12-dioxo-3,5,8,11,13-pentaoxapentadecane-1,15-dioate
  116. Octyl 2-butoxycarbonyloxypropanoate
  117. Octyl 2-ethoxycarbonyloxypropanoate
  118. Octyl 3,5-dinitrobenzoate
  119. Octyl 4-methylbenzenesulfonate
  120. Octyl 6-[(octoxycarbonyl)amino]hexanoate
  121. Octyl nicotinate
  122. Octyl nitrite
  123. Octyl nonanoate
  124. octyl triethyl phosphonium 1,2,3-triazolide
  125. octyl triethyl phosphonium 2-methyl-5-nitropyrazolide
  126. octyl triethyl phosphonium 4-nitroimidazolide
  127. octyl triethyl phosphonium 4-nitropyrazolide
  128. octyl-β-D-glucopyranoside
  129. octyl-18-crown-6
  130. Octyl-allylmalonic acid diethyl ester
  131. octyl-tributylphosphonium 2-cyanopyrrolide
  132. octyl-triethylammonium 2-cyanopyrrolide
  133. octyl-triethylphosphonium 2-cyanopyrrolide
  134. octyl-tripropylphosphonium 2-cyanopyrrolide
  135. octylbenzene
  136. octylboronic acid dioctyl ester
  137. octylcycloheptane
  138. octylcyclohexane
  139. octylimidazolium DL-lactate
  140. octylimidazolium L-lactate
  141. Octylmalonic acid diethyl ester
  142. octyloxirane
  143. octylpentaethyleneglycol
  144. octylphosphane
  145. octylphosphonic acid dipropyl ester
  146. octylphosphonous dichloride
  147. octylpropanedioic acid
  148. octylurea
  149. oil
  150. oil fraction
  151. oil vapor-52
  152. oil xf-22
  153. Olaparib
  154. oleanolic acid
  155. Oleum
  156. oligochloro organosiloxane
  157. oligofluoro organosiloxane
  158. oligotrifluorochloroethylene
  159. olive oil
  160. olive oil
  161. olive oil biodiesel
  162. omeprazole
  163. orange peel oil
  164. orites 270 DS
  165. Orotic acid
  166. ortho sodium antimonate hexahydrate
  167. ortho-deuterium
  168. ortho-dideuterobenzene
  169. ortho-hydrogen
  170. Orthoacetic acid diethyl ester-phenyl ester
  171. Orthoacetic acid diphenyl ester-ethyl ester
  172. Orthobenzoic acid triethenyl ester
  173. Orthoformic acid diethyl ester-phenyl ester
  174. Orthoformic acid tri-(3-chlorobutan-2-yl) ester
  175. Orthoformic acid tris(3-chloroprop-1-en-2-yl) ester
  176. Orthoformic acid tris(3-ethoxyprop-1-en-2-yl) ester
  177. Orthoformic acid tris(3-methoxyprop-1-en-2-yl) ester
  178. Orthoformic acid tris(3-prop-2-yloxyprop-1-en-2-yl) ester
  179. Orthoformic acid tris(but-2-en-2-yl) ester
  180. osmium
  181. Osmium diantimony
  182. osmium fluoride oxide (OsF5O)
  183. osmium oxide (OsO2)
  184. Osmium(IV) tetrakis(N-methylcyclohexyl dithiocarbamate)
  185. Ovalene
  186. oxacyclododecan-2-one
  187. oxacycloheptadecan-2-one
  188. oxacycloheptadecane-2,10-dione
  189. oxacycloheptadecane-2,13-dione
  190. oxacyclohexadecan-2-one
  191. oxacyclooctadecan-2-one
  192. oxacyclopentadecan-2-one
  193. oxacyclotetradecan-2-one
  194. oxacyclotetradecane-2,10-dione
  195. oxacyclotridecane-2-one
  196. oxacycloundecan-2-one
  197. Oxalate (2-) Anion
  198. oxaldehydic acid
  199. oxalic acid monohydrate
  200. Oxaline (DES)
  201. Oxan-2-ol
  202. Oxaprozin
  203. oxazole
  204. oxazole-4,5-dicarboxylic acid diethyl ester
  205. Oxcarbazepine
  206. oxepane
  207. oxepin
  208. oxetane
  209. oxido-(3-sulfophenyl)-(3-sulfophenyl)iminoazanium
  210. oxido-(trifluoromethyl)-(trifluoromethylimino)azanium
  211. oxiran-2-ylmethyl 3,5-dinitrobenzoate
  212. Oxiran-2-ylmethyl acetate
  213. oxirane
  214. oxirane compd. with nitrogen fluoride (HNF2) (1:1)
  215. oxirane-2-carbaldehyde
  216. oxirane-d4
  217. oxiranemethanol
  218. oxiranemethanol phenylcarbamate
  219. oxiranepropanoic acid methyl ester
  220. oxiranetetracarbonitrile
  221. oxirene
  222. oxo(sulfato(2-)-O)vanadium
  223. oxo(sulfato(2-)-O)vanadium trihydrate
  224. oxo(sulphato(2-)-κO,κO')titanium
  225. Oxo-bis(difluorophosphine)
  226. oxoacetic acid monohydrate
  227. oxoaluminum(1+)
  228. oxobis(2,4-pentanedionato)vanadium
  229. oxobis(8-quinolinolato-κN1,κO8)vanadium
  230. oxobis(propanoato-O)hafnium
  231. oxobis(propanoato-O)zirconium
  232. Oxobis(tri(m-tolyl)(2,4-dinitrobenzenesulfonato)antimony)
  233. oxobis(trifluoromethanolato)bis(trifluoromethyl)sulfur
  234. oxobismuth hydrochloride
  235. oxoborane
  236. oxobutanedioic acid
  237. oxobutanedioic acid diethyl ester
  238. oxocane
  239. oxodialuminate(1+)
  240. oxodinitrogen(1+)
  241. Oxolan-2-ylmethyl 2-butoxycarbonyloxypropanoate
  242. Oxolan-2-ylmethyl 2-decoxycarbonyloxypropanoate
  243. Oxolan-2-ylmethyl 2-dodecoxycarbonyloxypropanoate
  244. Oxolan-2-ylmethyl 2-ethoxycarbonyloxypropanoate
  245. oxolan-2-ylmethyl 2-hexoxycarbonyloxypropanoate
  246. Oxolan-2-ylmethyl 2-octoxycarbonyloxypropanoate
  247. oxolan-3-ol
  248. Oxolane-2-carboxylic acid
  249. Oxolane-2-carboxylic acid ethyl ester
  250. oxolane-3,4-diol
  251. oxomethyl
  252. oxonium
  253. oxonium tetrafluoroborate(1-)
  254. oxoniumylidene
  255. oxopropanedinitrile
  256. oxopropanedioic acid monohydrate
  257. Oxovanadium(2+) sulfate hydrate (1:1:5)
  258. oxo[C,C,C,2-tetrakis(1,1-dimethylethyl)-29H,31H-phthalocyaninato(2-)-κN29,κN30,κN31,κN32]vanadium
  259. oxyapatite
  260. oxyapatite (Ca10(PO4)6O)
  261. oxybis((difluoromethoxy)difluoromethane)
  262. oxybis(chloromethane)
  263. oxybis(diethylborane)
  264. oxybis(difluoromethane)
  265. oxybis(methane-d3)
  266. oxybis(methoxymethane)
  267. oxybis(methoxypropane)
  268. oxybis(trifluoromethane)
  269. oxybismethane
  270. oxybismethane compd. with nitrogen fluoride (HNF2) (1:1)
  271. oxybismethanol
  272. oxybispropanediol
  273. oxybispropanol
  274. oxybispropanol
  275. oxybis[(5-formyl-2-furanyl)methane]
  276. oxybis[bis(trifluoromethyl)]arsine
  277. Oxyclozanide
  278. oxygen
  279. oxygen fluoride ((O2)F2)
  280. oxygen fluoride ((O3)F2)
  281. oxygen fluoride ((O4)F2)
  282. oxygen fluoride (O2F)
  283. oxygen fluoride (OF)
  284. oxygen fluoride (OF2)
  285. oxygen ion (O(1-))
  286. oxygen(-2) anion; terbium(+3) cation
  287. ozone
  288. p,p'-dibutylazoxybenzene
  289. p,p'-dihexylazoxybenzene
  290. p,p'-dipentoxyazoxybenzene
  291. p,p'-dipentylazoxybenzene
  292. p,p'-dipropylazoxybenzene
  293. P,P-bis(trifluoromethyl)phosphinothioic amide
  294. p-(1,1-dimethylethyl)calix(8)arene
  295. p-(3-Hydroxypropyloxy)-p'-cyanobiphenyl
  296. p-(6-Hydroxyhexyloxy)-p'-cyanobiphenyl
  297. p-(8-Hydroxyoctyloxy)-p'-cyanobiphenyl
  298. P-(chloromethyl)-N,N'-bis(1-methylpropyl)phosphonothioic diamide
  299. P-(chloromethyl)-N-(1-methylethyl)phosphonamidothioic acid O-(2,4,5-trichlorophenyl) ester
  300. P-(chloromethyl)-N-(1-methylethyl)phosphonamidothioic acid O-(2,4-dichlorophenyl) ester
  301. P-(chloromethyl)-N-(1-methylpropyl)phosphonamidothioic acid O-(2-chloro-4-methylphenyl) ester
  302. P-Acetamidophenyl 4-morpholinoacetate hydrochloride
  303. p-Acetamidophenyl butyrate
  304. p-Acetamidophenyl chloroethylcarbonate
  305. p-Acetamidophenyl hexylcarbonate
  306. p-Acetamidophenyl hydrogen succinate
  307. p-Aminodiphenyl ether
  308. p-anisic acid, bicyclo[2,2,2]oct-1,4-ylene ester
  309. p-Azoanisolephenetole
  310. p-biphenyltrimethylammonium bromide
  311. p-bromophenylmercuric acetate
  312. p-butoxy-p'-pentylazobenzene
  313. p-butoxybenzoic acid, p-phenylene ester
  314. p-chloroacetoxy-2-chloroacetanilide
  315. p-Chlorobenzoic acid, p-phenylene ester
  316. p-Chlorophenylhydrazonoterephthalilydenaminophthalimide
  317. p-cyclopentylcyclohexanol
  318. p-Dimethylaminobenzyl phenylselenide
  319. p-ethoxybenzoic acid, p-phenylene ester
  320. P-ethyl-P-phenylphosphinic acid methyl ester
  321. p-Ethylbenzaldehyde
  322. p-fluorophenylacetonitrile
  323. p-iodoacetoxy-2-iodoacetanilide
  324. p-iodophenyl p-bromobenzenesulfonate
  325. p-menthan-8,9-diol
  326. p-Methoxybenzyl benzylethanedithioamide
  327. p-Methoxydiphenyl ether
  328. P-methyl-P-(trifluoromethyl)phosphinous amide
  329. p-Methyldiphenyl ether
  330. p-n-Butoxybenzyliden-p'-n-hexyloxyaniline
  331. p-n-Ethoxybenzyliden-p'-n-hexyloxyaniline
  332. p-n-Heptoxybenzyliden-p'-n-hexyloxyaniline
  333. p-n-Hexyloxybenzyliden-p'-n-hexyloxyaniline
  334. p-n-Methoxybenzyliden-p'-n-hexyloxyaniline
  335. p-n-Octoxybenzyliden-p'-n-hexyloxyaniline
  336. p-n-Pentoxybenzyliden-p'-n-hexyloxyaniline
  337. p-n-Propoxybenzyliden-p'-n-hexyloxyaniline
  338. p-n-Propyloxy benylidene-p-aminobenzoic acid
  339. p-Nitro-m'-acethylaminodiphenyl selenide
  340. p-Nitro-m'-aminodiphenyl selenide
  341. p-Nitro-m'-dimethylaminodiphenyl selenide
  342. p-Nitro-m'-hydroxydiphenyl selenide
  343. p-Nitro-m'-methoxydiphenyl selenide
  344. p-Nitro-p'-acethylaminodiphenyl selenide
  345. p-Nitro-p'-aminodiphenyl selenide
  346. p-Nitro-p'-dimethylaminodiphenyl selenide
  347. p-Nitro-p'-hydroxydiphenyl selenide
  348. p-Nitro-p'-methoxydiphenyl selenide
  349. p-Nitroaniline perchlorate
  350. p-nitroazobenzene
  351. p-Nitrobenzoic acid L-bornylester
  352. p-nitrobenzyl N,N-diphenylcarbamate
  353. p-Nitrodiphenyl selenide
  354. p-Nitrophenyl -p'-acetylaminobenzyl selenide
  355. p-Nitrophenyl -p'-aminobenzyl selenide
  356. p-Nitrophenyl -p'-dimethylaminobenzyl selenide
  357. p-Nitrophenyl -p'-metoxybenzyl selenide
  358. p-Nitrophenyl benzyl selenide
  359. p-octyloxybenzoic acid, bicyclo[2,2,2]oct-1,4-ylene ester
  360. p-propoxybenzoic acid, bicyclo[2,2,2]oct-1,4-ylene ester
  361. p-propoxybenzoic acid, p-phenylene ester
  362. p-Propylphenyl trans-p-(4-pentylcyclohexyl)benzoate
  363. p-terphenyl-D14
  364. p-Toluenesulfonic acid monohydrate
  365. p-Tolyl-carbamic acid i-butyl ester
  366. p-Tolyl-carbamic acid n-butyl ester
  367. p-Tolyl-carbamic acid s-butyl ester
  368. p-Xylyl-bis(1-methylimidazolium) bis(trifluoromethylsulfonyl)imide
  369. p-[(p-Decyloxybenzylidene)amino]cinnamic acid, isopentyl ester
  370. p-[(p-Decyloxybenzylidene)amino]cinnamic acid, pentyl ester
  371. p-[(p-Dodecyloxybenzylidene)amino]cinnamic acid, isopentyl ester
  372. p-[(p-Dodecyloxyphenyl)azo]acetophenone
  373. p-[(p-Ethoxybenzylidene)amino]benzoic acid, trimethylene ester
  374. p-[(p-Ethoxybenzylidene)amino]cinnamic acid, methyl ester
  375. p-[(p-ethoxyphenyl)azo]benzoic acid, butyl ester
  376. p-[(p-Ethylthiobenzylidene)amino]cinnamic acid, ethyl ester
  377. p-[(p-Ethylthiobenzylidene)amino]cinnamic acid, methyl ester
  378. p-[(p-Hydroxyphenyl)azo]cinnamic acid, ethyl ester, acetate
  379. p-[(p-Hydroxyphenyl)azo]cinnamic acid, ethyl ester, benzoate
  380. p-[(p-Hydroxyphenyl)azo]cinnamic acid, ethyl ester, ethyl carbonate
  381. p-[(p-methoxybenzylidene)amino]α-methylcinnamic acid, propyl ester
  382. p-[(p-Methoxybenzylidene)amino]cinnamic acid, ethyl ester
  383. p-[(p-Methoxybenzylidene)amino]cinnamic acid, methyl ester
  384. p-[(p-Methoxyphenyl)azo]cinnamic acid, ethyl ester
  385. p-[(p-Nonyloxybenzylidene)amino]cinnamic acid, pentyl ester
  386. p-[(p-Octyloxybenzylidene)amino]cinnamic acid, isopentyl ester
  387. p-[(p-Phenylbenzylidene)amino]cinnamic acid, ethyl ester
  388. Paclobutrazol
  389. Pagodan
  390. Palbociclib
  391. palladium
  392. palladium (hydrate)(N,N-dimethylbenzylamino)(10-phenyl-10H-9-thia-10-phosphaanthracene-9,9-dioxide) hexafluoroantimonate
  393. palladium (hydrate)(N,N-dimethylbenzylamino)(10-phenyl-10H-9-thia-10-phosphaanthracene-9,9-dioxide) hexfluorophosphate
  394. palladium (trifluoromethanesulfonate)(N,N-dimethylbenzylamino)(10-phenyl-10H-9-thia-10-phosphaanthracene-9,9-dioxide)
  395. palladium alloy base Pd 76,Si 18,Cu 6
  396. Palladium bis-(2,2,6,6-tetramethyl-3,5-heptanedionate)
  397. palladium chloride (PdCl2)
  398. palladium compd. with thulium (1:1)
  399. palladium compd. with ytterbium (1:1)
  400. Palladium Gallium (PdGa)
  401. palladium oxide (PdO)
  402. Palladium(II) 2,6-diacetylpyridine-mono(cabohydrazone) dichloride dihydrate
  403. Palladium(II) 3-dimethylaminomethyl indole salicylaldehydeoxime chloride
  404. Palladium(II) 8-ethyltheophyline dichloride
  405. Palladium(II) 8-isopropyltheophyline dichloride
  406. Palladium(II) 8-pentyltheophyline dichloride
  407. Palladium(II) 8-propyltheophyline dichloride
  408. Palladium(II) bis(α-nitroso-β-naphthate)
  409. Palladium(II) bis(1,3,8-trimethylxanthine) dichloride
  410. Palladium(II) bis(1,4-dithiane) dichloride
  411. Palladium(II) bis(1,4-thioxane) dichloride
  412. Palladium(II) bis(3,8-dimethylxanthine) dichloride
  413. Palladium(II) bis(4,6-dimethyl-2-thiopyrimidine) dichloride
  414. Palladium(II) bis(4-pentylpyridine) dichloride
  415. Palladium(II) bis(caffeine) dichloride
  416. Palladium(II) bis(dibutyldithiocarbamate)
  417. Palladium(II) bis(diethyldithiocarbamate)
  418. Palladium(II) bis(diisobutyldithiocarbamate)
  419. Palladium(II) bis(dipentyldithiocarbamate)
  420. Palladium(II) bis(dipropyldithiocarbamate)
  421. Palladium(II) bis(morpholine) dichloride
  422. Palladium(II) bis(N,N'-dimethylpiperazine) dichloride
  423. Palladium(II) bis(N-methylcyclohexyl dithiocarbamate)
  424. Palladium(II) bis(N-methylmorpholine) dichloride
  425. Palladium(II) bis(O-methyl dithiocarbonate)
  426. Palladium(II) bis(piperidine chloride)
  427. Palladium(II) bis(theobromine) dichloride
  428. Palladium(II) bis(theophylline) dichloride
  429. Palladium(II) bis(xanthine) dichloride
  430. Palladium(II) salicylaldehydeoxime chloride
  431. palladiummonochloride(N,N-dimethylbenzylamino)(10-phenyl-10H-9-thia-10-phosphaanthracene-9,9-dioxide)
  432. palm kernel oil
  433. palm oil
  434. palm Oil Biodiesel
  435. palm oil ethyl ester
  436. Palmatine chloride
  437. Pandermite
  438. para-deuterium
  439. para-hydrogen
  440. paracelsian strontium (Al2Sr(SiO4)2)
  441. paraffin
  442. paraffin wax
  443. paraffin wax
  444. paraffin wax
  445. paraffin wax
  446. paraffin wax
  447. paraffin wax
  448. paraffin wax
  449. paraffin wax
  450. paraffin wax
  451. paraffinic mineral oil
  452. paraformaldehyde
  453. Paraxanthin
  454. Patchoulene
  455. Patulin
  456. Pazopanib
  457. Pb (2+) cation
  458. peace river bitumen
  459. peace river bitumen
  460. peanut oil biodiesel
  461. Pent-1-en-1-yl trifluoromethanesulfonate
  462. Pent-1-en-3-yl acetate
  463. pent-1-enylbenzene
  464. pent-1-yn-3-ol
  465. Pent-2-en-1-ol
  466. Pent-2-en-3-ylbenzene
  467. Pent-2-enenitrile
  468. Pent-2-enyl acetate
  469. pent-2-yne-1,4-diol
  470. Pent-3-en-2-yl acetate
  471. Pent-3-yn-2-one
  472. pent-4-en-1-amine
  473. pent-4-en-1-ynylbenzene
  474. pent-4-en-2-yl acetate
  475. Pent-4-en-2-yn-1-ol
  476. Pent-4-yn-1-ol
  477. Pent-4-yn-1-yl 4-methylbenzene-1-sulfonate
  478. Pent-4-ynoic acid propyl ester
  479. penta(cerium(IV) dihydroxo sulfate) cerium(IV) hydroxide pentahydrate
  480. penta(lead(II) oxide) tri(potassium sodium tartrate)
  481. pentaaluminium triiodate hexasulfate 42-hydrate
  482. pentaammonium antimony chloride
  483. pentaammonium silver thiocyanate
  484. Pentaantipyrine copper(II) perchlorate
  485. Pentaantipyrine copper(II) tetrafluoroborate
  486. Pentaantipyrine uranyl perchlorate
  487. Pentaaqua tris(4-propyl-1,2,4-triazole) iron(II) trifluoromethanesulfonate
  488. pentaaqua(l-threoninato-κO,κO1)holmium(2+) dichloride hydrochloride
  489. pentaaquabis(l-prolinato-κN1,κO2)erbium(3+) trichloride
  490. Pentabarium tris(manganate(V)) chloride
  491. Pentabasic lead(II) styphnate dihydrate
  492. pentaborane(11)
  493. pentaborane(9)
  494. pentaborane(9)-d9
  495. Pentabromobenzene
  496. pentabromomethoxybenzene
  497. pentabromomethylbenzene
  498. pentabromophosphorane
  499. pentacadmium diyttrium (III) chloride hexacosahydrate
  500. pentacadmium neodymium(III) chloride tridecahydrate
  501. pentacalcium ammonium nitrate decahydrate
  502. pentacalcium ammonium sulfate monohydrate
  503. Pentacalcium cesium nitrate decahydrate
  504. pentacalcium diammonium sulfate monohydrate
  505. pentacalcium dipotassium sulfate monohydrate
  506. pentacalcium disodium sulfate trihydrate
  507. pentacalcium potassium nitrate decahydrate
  508. Pentacarbonyl(triphenylphosphine)molybdenum
  509. Pentacarbonyl-N-methylcyano molybdenum
  510. pentacarbonylsilylmanganese
  511. pentacene
  512. pentacesium diantimony(III) chloride
  513. pentacesium dicerium bromide 22-hydrate
  514. pentacesium dieuropium bromide eicosahydrate
  515. pentacesium dilanthanum bromide 22-hydrate
  516. pentacesium dineodymium bromide docosahydrate
  517. pentacesium disamarium bromide docosahydrate
  518. Pentacesium dysprosium octachloride hexahydrate
  519. pentacesium holmium(III) chloride tetrahydrate
  520. pentacesium terbium chloride hexahydrate
  521. pentacesium tridysprosium bromide tetracosahydrate
  522. pentachloro(trichloroethenyl)benzene
  523. pentachloro-1,1'-biphenyl
  524. pentachloro-pentafluoro-cyclopentane
  525. pentachlorobenzene
  526. pentachlorobenzene-d1
  527. pentachlorobuta-1,3-diene
  528. pentachlorodecane
  529. pentachlorododecane
  530. pentachloroethane
  531. pentachloroethylbenzene
  532. pentachlorofluoroethane
  533. pentachloromethylbenzene
  534. pentachloromethyldisilane
  535. pentachloronitrobenzene
  536. pentachlorophenol
  537. pentachlorophenol ion(1-)
  538. pentachlorophenol sodium salt
  539. pentachlorophenoxybenzene
  540. pentachlorophosphorane
  541. pentachloropyridine
  542. pentachloroundecane
  543. Pentachromium trisilicide
  544. pentacobalt chloride tetrasulfate octaurea heptadecahydrate
  545. pentacontafluoro-2,5,8,11,14,17,20,23,26,29,32,35-dodecaoxahexatriacontane
  546. pentacontafluorotetracosane
  547. Pentacontan-1-ol
  548. pentacontane
  549. Pentacontanoic acid propyl ester
  550. pentacontylbenzene
  551. pentacontylcyclohexane
  552. Pentacopper dibismuth tetraboron oxide
  553. Pentacosabismuth trilutetium dirhenium oxide
  554. Pentacosabismuth(III) gallium(III) oxide
  555. Pentacosabismuth(III) iron(III) oxide
  556. pentacosane
  557. pentacosanenitrile
  558. pentacosanoic acid
  559. pentacosanoic acid ethyl ester
  560. pentacosanoic acid methyl ester
  561. pentacosylbenzene
  562. pentacosylcyclohexane
  563. pentacyclo(3.3.0.0(2,4).0(3,7).0(6,8))octane-2,6-dicarboxylic acid dimethyl ester
  564. pentacyclo(4.4.0.0(2,5).0(3,8).0(4,7))dec-9-ene
  565. pentacyclo[19.3.1.1(3,7).1(9,13).1(15,19)]octacosa-1(25),3,5,7(28),9,11,13(27),15,17,19(26),21,23-dodecaene-25,26,27,28-tetrol
  566. pentacyclo[4.2.0.0(2,5).0(3,8).0(4,7)]octane
  567. pentacyclo[4.2.0.0(2,5).0(3,8).0(4,7)]octane-1,4-dicarboxylic acid
  568. pentacyclo[4.2.0.0(2,5).0(3,8).0(4,7)]octane-1,4-dicarboxylic acid dimethyl ester
  569. pentacyclo[4.3.0.0(2,5).0(3,8).0(4,7)]nonane-4-carboxylic acid
  570. pentacyclo[4.3.0.0(2,5).0(3,8).0(4,7)]nonane-4-carboxylic acid methyl ester
  571. Pentacyclo[8.2.1.14,7.02,9.03,8]tetradecane
  572. Pentadec-2-enoic amide
  573. Pentadec-6-yn-8-one
  574. Pentadec-7-ene
  575. pentadecafluoro-N-(3-hydroxyphenyl)octanamide
  576. pentadecafluoroheptyl perchlorate
  577. pentadecafluorooctanal
  578. pentadecafluorooctanoic acid ammonium salt
  579. pentadecafluorooctanoic acid methyl ester
  580. pentadecafluorooctanoyl chloride
  581. Pentadecalithium tetrasilicide
  582. pentadecamethylenimine
  583. pentadecan-1-al
  584. pentadecan-1-amine hydrochloride
  585. pentadecan-3-one
  586. pentadecan-4-ol
  587. pentadecan-4-one
  588. pentadecan-5-one
  589. pentadecan-6-ol
  590. Pentadecan-6-one
  591. pentadecan-7-ol
  592. Pentadecan-7-one
  593. pentadecan-8-ol
  594. pentadecanamide
  595. pentadecane
  596. pentadecanedioic acid
  597. Pentadecanedioic acid dimethyl ester
  598. pentadecanedioic acid dipropyl ester
  599. Pentadecanedioic acid monomethyl ester
  600. pentadecanenitrile
  601. pentadecanoic acid
  602. pentadecanoic acid 1,10-decanediyl ester
  603. pentadecanoic acid 1,2,3-propanetriyl ester
  604. pentadecanoic acid 1,3-propanediyl ester
  605. pentadecanoic acid 1,4-butanediyl ester
  606. pentadecanoic acid 1,5-pentanediyl ester
  607. pentadecanoic acid 1,6-hexanediyl ester
  608. pentadecanoic acid 1,7-heptanediyl ester
  609. pentadecanoic acid 1,8-octanediyl ester
  610. pentadecanoic acid 1,9-nonanediyl ester
  611. pentadecanoic acid butyl ester
  612. pentadecanoic acid decyl ester
  613. pentadecanoic acid docosyl ester
  614. pentadecanoic acid dodecyl ester
  615. pentadecanoic acid eicosyl ester
  616. pentadecanoic acid ethyl ester
  617. pentadecanoic acid heneicosyl ester
  618. pentadecanoic acid heptadecyl ester
  619. pentadecanoic acid heptyl ester
  620. pentadecanoic acid hexadecyl ester
  621. pentadecanoic acid hexyl ester
  622. pentadecanoic acid lithium salt
  623. pentadecanoic acid methyl ester
  624. pentadecanoic acid nonadecyl ester
  625. pentadecanoic acid nonyl ester
  626. pentadecanoic acid octadecyl ester
  627. pentadecanoic acid octyl ester
  628. pentadecanoic acid pentadecyl ester
  629. pentadecanoic acid pentyl ester
  630. pentadecanoic acid propyl ester
  631. pentadecanoic acid sodium salt
  632. pentadecanoic acid tetradecyl ester
  633. pentadecanoic acid tricosyl ester
  634. pentadecanoic acid tridecyl ester
  635. pentadecanoic acid undecyl ester
  636. Pentadecanoyl chloride
  637. pentadecarubidium tetraneodymium nitrate
  638. Pentadecyl benzoate
  639. Pentadecyl N-naphthalen-1-ylcarbamate
  640. pentadecylazanium acetate
  641. pentadecylbenzene
  642. pentadecylcyclohexane
  643. pentadecylcyclopentane
  644. Pentaerythritol 2-methylpropionate
  645. Pentaerythritol dibromide
  646. pentaerythritol ester lubricants
  647. Pentaerythritol tetra-3-methylbutanoate
  648. pentaerythritol tetra-cis-9-octadecenoate
  649. pentaerythritol tetraacrylate
  650. pentaerythritol tetradodecanoate
  651. pentaerythritol tetraoctadecanoate
  652. pentaerythritol tetratetradecanoate
  653. pentaethylbenzene
  654. pentaethylgermanamine
  655. pentaethylsilanamine
  656. pentaethylstannanamine
  657. Pentafluoro(1,1,2,2,2-pentafluoroethyl)-sulfane
  658. pentafluoro(1,1,2,2-tetrafluoroethoxy)ethane
  659. pentafluoro(1,2,2,2-tetrafluoro-1-((fluorosulfonyl)oxy)ethyl)sulfur
  660. pentafluoro(1,2,2,2-tetrafluoroethyl)sulfur
  661. pentafluoro(2,2,2-trifluoro-1-((fluorosulfonyl)oxy)-1-(trifluoromethyl)ethyl)sulfur
  662. pentafluoro(2,2,2-trifluoro-1-(trifluoromethyl)ethyl)sulfur
  663. pentafluoro(2,2,2-trifluoroethoxy)ethane
  664. pentafluoro(2,2,2-trifluoroethyl)sulfur
  665. pentafluoro(2,2,3,3,4,4,5-heptafluoro-5-oxopentaneperoxoato)sulfur
  666. pentafluoro(3,3,3-trifluoro-1-propynyl)benzene
  667. pentafluoro(3,3,4,4,5,5,5-heptafluoro-1-pentynyl)benzene
  668. pentafluoro(difluoromethyl)benzene
  669. pentafluoro(fluoromethyl)benzene
  670. pentafluoro(pentafluoropropaneperoxoato)sulfur
  671. pentafluoro(trifluoroethaneperoxoato)sulfur
  672. pentafluoro(trifluoromethoxy)ethane
  673. pentafluoro(trifluoromethyl)benzene
  674. Pentafluoro-(1-bromo-2,2,2-trifluoroethyl)sulfur
  675. pentafluoro-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluoro-1-nonynyl)benzene
  676. pentafluoro-1-propanol
  677. pentafluoro-2-propenylbenzene
  678. pentafluoroacetamide
  679. pentafluoroarsorane
  680. pentafluorobenzaldehyde
  681. pentafluorobenzene
  682. pentafluorobenzoic acid
  683. pentafluorobenzonitrile
  684. pentafluorobenzoyl chloride
  685. pentafluoroethane
  686. pentafluoroethane mixt. with 1,1,1,2-tetrafluoroethane and 1,1,1-trifluoroethane
  687. pentafluoroethane mixt. with 1,1,1-trifluoroethane
  688. pentafluoroethane mixt. with difluoromethane
  689. pentafluoroethane mixt. with difluoromethane and 1,1,1,2-tetrafluoroethane
  690. pentafluoroethaneselenenyl chloride
  691. pentafluoroethanesulfinyl chloride
  692. pentafluoroethanesulfinyl fluoride
  693. pentafluoroguanidine
  694. pentafluoroiodobenzene
  695. pentafluoroiodoethane
  696. pentafluoroisocyanatoethane
  697. pentafluoromethanamine
  698. pentafluoromethoxyethane
  699. pentafluoromethylbenzene
  700. pentafluoronitrobenzene
  701. pentafluoronitrosobenzene
  702. pentafluorophenol
  703. pentafluorophenyl 3,5-dinitrobenzoate
  704. pentafluorophosphorane
  705. pentafluoropropanoic acid
  706. pentafluoropropanoic acid 3-methylphenyl ester
  707. pentafluoropropanoic acid 4-methylphenyl ester
  708. pentafluoropropanoic acid anhydride with hypofluorous acid
  709. pentafluoropropanoic acid butyl ester
  710. pentafluoropropanoic acid cyclohexyl ester
  711. pentafluoropropanoic acid methyl ester
  712. pentafluoropyridine
  713. pentafluoroselenium hypofluorite
  714. pentafluorosulfurfluorosulfonate
  715. Pentafluorovinylsulfur
  716. Pentafluoroxenonium tetrafluoroborate
  717. Pentahafnium triantimony
  718. pentahectane
  719. pentaheptacontane
  720. pentaheptacontylbenzene
  721. pentaheptacontylcyclohexane
  722. pentahexacontane
  723. pentahexacontylbenzene
  724. pentahexacontylcyclohexane
  725. pentahydrogen (T-4)-bis(μ-oxotetraoxodiborato(4-))borate(5-) compd. with 1,3,5,7-tetraazatricyclo(3.3.1.1(3,7))decane hydrate (2:2:1)
  726. pentahydroxycyclohexane
  727. Pentailead(II) selen(IV) oxide
  728. pentakis (biuret) tetrahydrate
  729. pentakis(dimethylammonium) di-my3-chloro-tri-my2-chlorohexachlorotricadmate(II)
  730. pentakis(dimethylammonium) tricadmium undecachloride
  731. pentakis(heptafluoropropyl)cyclopentaphosphane
  732. pentakis(pentafluorethyl)cyclopentaphosphine
  733. pentakis(sodium oxide) di(aluminium oxide) octacosahydrate(2.5Na2O*Al2O3*14H2O)
  734. pentakis(trifluoromethyl)pentaphospholane
  735. pentakis(trifluoromethyl)triphosphine
  736. pentalead trigermanium undecaoxide
  737. Pentalead(II) tellurium(IV) oxide
  738. Pentalithium(I) dinitrosyl fluoride
  739. pentamagnesium oxide magnesium chloride heptadecahydrate
  740. pentamanganese aluminium sulfate 23-hydrate
  741. pentamethyl(pentamethyldisilanyl)disiloxane
  742. Pentamethyl-(2-phenylethyl)-1,3,5-triazine-2,4,6-triamine
  743. pentamethylarsinous diamide
  744. pentamethylbenzene
  745. pentamethylbenzoic acid
  746. Pentamethylcyclopentadienylrhodium(III) aniline
  747. Pentamethylcyclopentadienylrhodium(III) p-bromoaniline
  748. Pentamethylcyclopentadienylrhodium(III) p-chloroaniline
  749. Pentamethylcyclopentadienylrhodium(III) p-methoxyaniline
  750. Pentamethylcyclopentadienylrhodium(III) p-methylaniline
  751. pentamethyldisilanecarbonitrile
  752. pentamethyldisilanyl isocyanate
  753. pentamethyldisiloxanol acetate
  754. pentamethylene glycoldimethyl ether
  755. pentamethylphenol
  756. pentamethylphenylcyclotrisiloxane
  757. pentamethylphenyldisiloxane
  758. pentamethylsilanamine
  759. pentamethyltriphenyltrisiloxane
  760. pentamine zinc sulfate
  761. pentamminezinc iodide monohydrate
  762. Pentan-2-yl 3,5-dinitrobenzoate
  763. pentanal
  764. pentanamide
  765. pentane
  766. Pentane-1,5-diyl bis(2-ethylbutanoate)
  767. Pentane-1,5-diyl bis(2-ethylhexanoate)
  768. Pentane-1,5-diyl bis(2-methylpentanoate)
  769. Pentane-2,4-diyl dihexanoate
  770. pentane-d12
  771. pentanedial
  772. pentanediamide
  773. pentanedinitrile
  774. pentanedioic acid
  775. pentanedioic acid 2-(trimethylaminium)ethyl ester chloride
  776. pentanedioic acid bis(1,1-dimethylethyl) ester
  777. pentanedioic acid bis(1-(2-methylpropyl)-4-ethyloctyl) ester
  778. pentanedioic acid bis(1-methylethyl) ester
  779. pentanedioic acid bis(2-ethylhexyl) ester
  780. Pentanedioic acid bis(2-methylpentyl) ester
  781. Pentanedioic acid bis(3,5,5-trimethylhexyl) ester
  782. pentanedioic acid bis(4-ethyl-1-methyloctyl) ester
  783. pentanedioic acid dibutyl ester
  784. pentanedioic acid dicyclohexyl ester
  785. pentanedioic acid didecyl ester
  786. pentanedioic acid didodecyl ester
  787. pentanedioic acid diethenyl ester
  788. pentanedioic acid diethyl ester
  789. pentanedioic acid diheptadecyl ester
  790. pentanedioic acid dihexadecyl ester
  791. pentanedioic acid dimethyl ester
  792. pentanedioic acid dinonyl ester
  793. pentanedioic acid dioctadecyl ester
  794. pentanedioic acid dipentadecyl ester
  795. pentanedioic acid dipropyl ester
  796. pentanedioic acid ditetradecyl ester
  797. pentanedioic acid ditridecyl ester
  798. pentanedioic acid diundecyl ester
  799. pentanedioic acid ethenyl methyl ester
  800. pentanedioic acid monoammonium salt
  801. pentanedioic acid monoethyl ester
  802. pentanedioic acid monomethyl ester
  803. pentanedioic acid monooctadecyl ester
  804. pentanedioyl dichloride
  805. pentanenitrile
  806. pentanickel dihydrogen tetraarsenate octahydrate
  807. Pentanitrophenol
  808. pentanoic acid
  809. pentanoic acid 1,2,3-propanetriyl ester
  810. pentanoic acid 1,2-ethanediyl ester
  811. pentanoic acid 1-methylbutyl ester
  812. pentanoic acid 1-methyldecyl ester
  813. pentanoic acid 1-methylethyl ester
  814. pentanoic acid 1-methylheptyl ester
  815. pentanoic acid 1-methylhexyl ester
  816. pentanoic acid 1-methylpentyl ester
  817. pentanoic acid 1-methylpropyl ester
  818. pentanoic acid 1-phenylethyl ester
  819. pentanoic acid 2,2,2-trifluoroethyl ester
  820. pentanoic acid 2,2-bis(((1-oxopentyl)oxy)methyl)-1,3-propanediyl ester
  821. pentanoic acid 2,3-dihydroxypropyl ester
  822. pentanoic acid 2-(acetyloxy)-1-(chloromethyl)ethyl ester
  823. pentanoic acid 2-butyne-1,4-diyl ester
  824. pentanoic acid 2-methyl-2-(((1-oxopentyl)oxy)methyl)-1,3-propanediyl ester
  825. pentanoic acid 2-methylpropyl ester
  826. pentanoic acid 2-propynyl ester
  827. pentanoic acid 3-fluoropropyl ester
  828. pentanoic acid 3-methylbutyl ester
  829. pentanoic acid ammonium salt
  830. pentanoic acid anhydride
  831. pentanoic acid butyl ester
  832. pentanoic acid calcium salt
  833. pentanoic acid cyclohexyl ester
  834. pentanoic acid d-1-methylpropyl ester
  835. pentanoic acid ethyl ester
  836. pentanoic acid heptadecyl ester
  837. pentanoic acid heptyl ester
  838. pentanoic acid hexyl ester
  839. pentanoic acid lithium salt
  840. pentanoic acid methyl ester
  841. pentanoic acid monoester with 1,2,3-propanetriol
  842. pentanoic acid octyl ester
  843. pentanoic acid pentyl ester
  844. pentanoic acid phenyl ester
  845. pentanoic acid potassium salt
  846. Pentanoic acid prop-2-enyl ester
  847. pentanoic acid propyl ester
  848. pentanoic acid samarium(3+) salt
  849. pentanoic acid silver(1+) salt
  850. pentanoic acid sodium salt
  851. pentanoic acid thallium(1+) salt
  852. pentanoic acid thiobis(2,1-ethanediyl) ester
  853. pentanoic acid triethylsilyl ester
  854. pentanoic acid trimethylsilyl ester
  855. pentanoic acid undecyl ester
  856. pentanoic acid zinc salt (2:1)
  857. pentanoic acid, 4-[(4-methoxyphenyl)iminomethyl]phenyl ester
  858. pentanoic acid, p-[(p-methoxybenzylidene)amino]phenyl ester
  859. pentanonacontane
  860. pentanonacontylbenzene
  861. pentanonacontylcyclohexane
  862. pentanoyl chloride
  863. pentanoyl iodide
  864. pentaoctacontane
  865. pentaoctacontylbenzene
  866. pentaoctacontylcyclohexane
  867. pentapentacontane
  868. pentapentacontylbenzene
  869. pentapentacontylcyclohexane
  870. pentaphenylantimony
  871. pentapotassium dicerium(IV) fluoride
  872. pentapotassium dihydroxy arsenate octahydrate
  873. pentapotassium erbium(III)formate
  874. pentapotassium pentanickel chloride nonahydrate
  875. pentapotassium tetrahydrogen triphosphate monohydrate
  876. Pentapotassium tetrazinc chloride trihydrate
  877. Pentapotassium thorium nonafluoride
  878. pentapotassium tricerium(IV) fluoride
  879. pentapotassium trihydrogen sulfate
  880. pentapotassium trihydrogen sulfate pentahydrate
  881. pentapotassium trimanganese chloride
  882. pentapotassium yttrium (III) formate
  883. pentarubidium dineodymium nitrate dihydrate
  884. pentarubidium dipraseodymium nitrate
  885. pentarubidium fluoride bis(tungsten(VI)oxide) dihydrate
  886. Pentarubidium fluoride tetra(acetic acid)
  887. pentarubidium tetraneodymium nitrate
  888. pentarubidium tetrapraseodymium nitrate
  889. pentasilane
  890. Pentasodium dibismut bromide dodecahydrate
  891. pentasodium dizirconium fluoride
  892. pentasodium lanthanum tetramolybdate
  893. pentasodium perchlorate bis(hexamethylene tetramine) dihydrate
  894. pentasodium sulfide thioantimonate monohydrate
  895. pentasodium sulfide thioantimonite hexahydrate
  896. pentasodium sulfide thioantimonite nonahydrate
  897. pentasodium sulfide thioantimonite trihydrate
  898. Pentasodium titanium triphosphate
  899. pentasodium trialuminium fluoride (Chiolite)
  900. pentasodium tricerium(IV) fluoride
  901. pentasodium trisilver tetrathiosulfate dihydrate
  902. Pentasodium zinc chloride semihydrate
  903. Pentasol
  904. pentastrontium acetate penta(acetic acid) nonahydrate
  905. pentastrontium dihydrogen tetraarsenate dihydrate
  906. pentastrontium octanitrite dihydroxide octahydrate
  907. pentatetracontane
  908. pentatetracontylbenzene
  909. pentatetracontylcyclohexane
  910. pentathallium(I) thallium(III) sulfate
  911. pentathionic acid diammonium salt
  912. pentathionic acid dipotassium salt
  913. pentathionic acid disodium salt
  914. pentatriacontane
  915. pentatriacontanoic acid
  916. pentatriacontylbenzene
  917. pentatriacontylcyclohexane
  918. pentatricontafluoro-5,8,11,14,17,20,23,26-octakis(trifluoromethyl)-3,6,9,12,15,18,21,24,27-nonaoxatriacontane
  919. pentazirconium tetrasilicide
  920. pentlandite
  921. Pentoxyverine citrate
  922. pentyl 10-acetyloxydecanoate
  923. pentyl 10-hydroxydecanoate
  924. pentyl 2-hydroxyacetate
  925. Pentyl 2-pentoxycarbonyloxypropanoate
  926. Pentyl 3,5-dinitrobenzoate
  927. Pentyl 3-phenylpropanoate
  928. pentyl dipentoxy phosphine
  929. pentyl N,N-diphenylcarbamate
  930. pentyl(nitrato-κO)mercury
  931. pentyl-tris-pentafluoropropanoyloxy-silane
  932. Pentylamine trimethylborane
  933. pentylarsonous dichloride
  934. pentylbenzene
  935. Pentylboronic acid diethanolamine ester
  936. pentylcyclohexane
  937. pentylcyclopentane
  938. pentylcyclopropane
  939. pentylimidazolium DL-lactate
  940. pentylimidazolium L-lactate
  941. pentylnaphthalene
  942. pentyloxirane
  943. pentyloxyacetic acid pentyl ester
  944. pentylphosphonic acid dipropyl ester
  945. pentylphosphonous dichloride
  946. pentylpropanedinitrile
  947. pentylpropanedioic acid
  948. pentylpropanedioic acid dibutyl ester
  949. pentylpropanedioic acid diethyl ester
  950. pentylpropanedioic acid dimethyl ester
  951. pentylpropanedioic acid dipropyl ester
  952. pentylsilane
  953. pentylzinc
  954. perboric acid (HBO(O2)) sodium salt
  955. perboric acid (HBO(O2)) sodium salt tetrahydrate
  956. perbromic acid ammonium salt
  957. perbromic acid potassium salt
  958. perbromyl fluoride
  959. perchlorate
  960. perchloric acid
  961. perchloric acid 1,2,2-trichloro-1,2-difluoroethyl ester
  962. perchloric acid 1,2-dichloro-1,2,2-trifluoroethyl ester
  963. perchloric acid 2-bromo-1,1,2,3,3,3-hexafluoropropyl ester
  964. perchloric acid 2-bromo-1-chloro-1,2,2-trifluoroethyl ester
  965. perchloric acid 2-chloro-1,1,2,2-tetrafluoroethyl ester
  966. perchloric acid 2-chloro-1,1,2,3,3,3-hexafluoropropyl ester
  967. perchloric acid aluminum salt
  968. perchloric acid ammonium salt
  969. perchloric acid barium salt
  970. perchloric acid beryllium salt
  971. perchloric acid cadmium salt
  972. perchloric acid cadmium salt dihydrate
  973. perchloric acid cadmium salt hexahydrate
  974. perchloric acid calcium salt
  975. perchloric acid calcium salt tetrahydrate
  976. perchloric acid cerium(3+) salt
  977. perchloric acid cesium salt
  978. perchloric acid chromium(3+) salt nonahydrate
  979. perchloric acid cobalt(2+) salt
  980. perchloric acid cobalt(2+) salt hexahydrate
  981. perchloric acid copper(2+) salt
  982. perchloric acid copper(2+) salt hexahydrate
  983. Perchloric acid diacetamide
  984. perchloric acid dihydrate
  985. perchloric acid dysprosium(3+) salt
  986. perchloric acid erbium(3+) salt
  987. perchloric acid europium(3+) salt
  988. perchloric acid gadolinium(3+) salt
  989. perchloric acid gallium(3+) salt
  990. perchloric acid hexahydrate
  991. perchloric acid holmium(3+) salt
  992. perchloric acid indium(3+) salt
  993. perchloric acid iron(2+) salt
  994. perchloric acid iron(3+) salt
  995. perchloric acid lanthanum(3+) 1H-inidazolium salt (7:1:4) compd. with 1H-imidazolium L-glutamate (2:1) (1:1) tetrahydrate
  996. perchloric acid lanthanum(3+) salt
  997. perchloric acid lanthanum(3+) salt octahydrate
  998. perchloric acid lead(2+) salt
  999. perchloric acid lithium salt
  1000. perchloric acid lithium salt compd. with N,N-dimethylformamide (1:2)
  1001. perchloric acid lithium salt dihydrate
  1002. perchloric acid lithium salt monohydrate
  1003. perchloric acid lithium salt trihydrate
  1004. perchloric acid lutetium(3+) salt
  1005. perchloric acid magnesium salt
  1006. perchloric acid magnesium salt hexahydrate
  1007. perchloric acid manganese(2+) salt
  1008. perchloric acid mercury(2+) salt
  1009. Perchloric acid monoacetamide
  1010. perchloric acid monohydrate
  1011. perchloric acid neodymium(3+) salt
  1012. perchloric acid nickel(2+) salt
  1013. perchloric acid nickel(2+) salt hexahydrate
  1014. perchloric acid pentafluoroethyl ester
  1015. perchloric acid potassium salt
  1016. perchloric acid potassium salt
  1017. perchloric acid praseodymium(3+) salt
  1018. perchloric acid rubidium salt
  1019. perchloric acid samarium(3+) salt
  1020. perchloric acid scandium(3+) salt
  1021. perchloric acid silver(1+) salt
  1022. perchloric acid silver(1+) salt compd. with benzene (1:1)
  1023. perchloric acid silver(1+) salt monohydrate
  1024. perchloric acid sodium salt
  1025. perchloric acid strontium salt
  1026. perchloric acid strontium salt trihydrate
  1027. perchloric acid terbium(3+) salt
  1028. perchloric acid tetrahydrate
  1029. perchloric acid thallium(1+) salt
  1030. perchloric acid thulium(3+) salt
  1031. perchloric acid trifluoromethyl ester
  1032. perchloric acid trihydrate
  1033. perchloric acid uranium(4+) salt
  1034. perchloric acid ytterbium(3+) salt
  1035. perchloric acid ytterbium(3+) salt octahydrate
  1036. perchloric acid yttrium(3+) salt
  1037. perchloric acid zinc salt
  1038. perchloryl fluoride ((ClO3)F)
  1039. perdeutero-o-xylene
  1040. perdeuterodecane
  1041. Perfluidone
  1042. Perfluoro(1,2,2,6,6-pentamethylpiperidine)
  1043. Perfluoro(1,2-di-tert-butoxyethane)
  1044. Perfluoro(2,2,5-trimethyltetrahydrofuran)
  1045. Perfluoro(2,2,5-trimethyltetrahydropyran)
  1046. perfluoro(2,3-dichloro-1-methylazetidine)
  1047. perfluoro(4,5-dichloro-2-methyl-3,4,5,6-tetrahydro-2H-1,2-oxazine)
  1048. Perfluoro(cyclohexyl neopentyl ether)
  1049. Perfluoro-(1,3-diethoxy-2,2-dimethylpropane)
  1050. Perfluoro-(pentaerythrityltetramethyl ether)
  1051. Perfluoro-1,3-diethoxypropane
  1052. Perfluoro-1,4-diethoxybutane
  1053. perfluoro-1-(2-cyclobutylcyclobutyl)cyclobut-1-ene
  1054. Perfluoro-1-aza-4-methylcyclohexene-1
  1055. Perfluoro-2,4,6,8,10,13,15,17,19,21-decaoxy-n-docosane
  1056. Perfluoro-2,4,6,8,11,13,15,17-octaoxy-n-octadecane
  1057. Perfluoro-2,4,6,9,11,13-hexaoxy-n-tetradecane
  1058. perfluoro-2-(tetrafluoro-2-nitroethyl)-1,2-oxazetidine
  1059. perfluoro-2-methyl-3-methylene-1,2-oxazetidine
  1060. perfluoro-2-methyl-4-methylimino-1,2-oxazetidine
  1061. Perfluoro-5,8,11,14-tetramethyl-3,6,9,12,15-oxaoctadecane
  1062. perfluoro-di-n-hexylether
  1063. perfluorobutyl phosphonic acid
  1064. perfluorobutyl sulfonic acid
  1065. Perfluorodiglyme
  1066. Perfluorodimethylnaphthalane
  1067. perfluorodioxecan
  1068. perfluoroheptan-1-ol acrylate
  1069. Perfluoropentaethylene glycol di(difluoromethyl) ether
  1070. perfluoropolyether
  1071. perfluoropolyether oil
  1072. Perfluorotetraethylene glycol di(difluoromethyl) ether
  1073. Perfluorotetraglyme
  1074. Perfluorotriethyleneglycol di(difluoromethyl)ether
  1075. Perfluorotriglyme
  1076. Perfluorovinyl mercury bromide
  1077. Perfluorovinyl mercury chloride
  1078. perfluorovinylsulfur pentafluoride
  1079. perhydro(bisxylyltoluol)
  1080. perhydrodecacene
  1081. perhydrodibenzyltoluene
  1082. perhydroheptacene
  1083. perhydrohexacene
  1084. perhydrononacene
  1085. perhydrooctacene
  1086. perhydropentacene
  1087. Perhydrophenalene
  1088. perilla oils
  1089. periodate (IO4(1-))
  1090. periodic acid (H3IO5) beryllium salt (2:3)
  1091. periodic acid (H3IO5) trisilver(1+) salt
  1092. periodic acid (H4I2O9) tetrapotassium salt nonahydrate
  1093. periodic acid (H5IO6)
  1094. periodic acid (H5IO6) compd. with nitrourea (1:2)
  1095. periodic acid (H5IO6) diammonium salt
  1096. periodic acid (H5IO6) dipotassium salt
  1097. periodic acid (H5IO6) disilver(1+) salt
  1098. periodic acid (H5IO6) pentalithium salt
  1099. periodic acid (HIO4)
  1100. periodic acid (HIO4) ammonium salt
  1101. periodic acid (HIO4) cesium salt
  1102. periodic acid (HIO4) compd. with pyridine (1:1)
  1103. periodic acid (HIO4) potassium salt
  1104. periodic acid (HIO4) rubidium salt
  1105. periodic acid (HIO4) sodium salt
  1106. permanganic acid (HMnO4) cesium salt
  1107. permanganic acid (HMnO4) lithium salt
  1108. permanganic acid (HMnO4) potassium salt
  1109. permanganic acid (HMnO4) rubidium salt
  1110. permanganic acid (HMnO4) silver(1+) salt
  1111. permanganic acid (HMnO4) sodium salt
  1112. peroxydicarbonic acid dicyclohexyl ester
  1113. peroxydicarbonic difluoride
  1114. peroxydisulfuric acid (((HO)S(O)2)2O2) barium salt (1:1)
  1115. peroxydisulfuric acid (((HO)S(O)2)2O2) dicesium salt
  1116. peroxydisulfuric acid (((HO)S(O)2)2O2) dirubidium salt
  1117. peroxydisulfuryl difluoride
  1118. peroxyhypochlorous acid trifluoromethyl ester
  1119. peroxyhypofluorous acid trifluoromethyl ester
  1120. peroxymonosulfuric acid bis(trifluoromethyl) ester
  1121. peroxymonosulfuric acid monopotassium salt
  1122. peroxynitric acid trifluoromethyl ester
  1123. peroxyphosphorodifluoric acid trifluormethyl ester
  1124. perylene
  1125. perylene-D12
  1126. Petalite
  1127. petroleum ether
  1128. petroleum ether
  1129. petroleum products from fluid catalytic cracking (FCC)
  1130. PFMS 6
  1131. PFMS 6
  1132. PFMS-4
  1133. phen-d5-ol
  1134. phenaleno[1,9-gh]quinoline
  1135. Phenanthren-3-yl acetate
  1136. phenanthrene
  1137. phenanthrene
  1138. phenanthrene compd. with 2,4,6-trinitrophenol (1:1)
  1139. Phenanthrene-1-carboxylic acid
  1140. Phenanthrene-1-carboxylic acid methyl ester
  1141. phenanthrene-2-carboxylic acid
  1142. Phenanthrene-9-carbaldehyde
  1143. phenanthrene-d10
  1144. phenanthridine
  1145. Phenanthridine cobalt(II) dichloride
  1146. Phenanthridine copper(II) dichloride
  1147. Phenanthridine nickel(II) dibromide
  1148. Phenanthridine zinc(II) dichloride
  1149. phenanthro(1.10.9.8-opqra)perylene
  1150. phenanthroline
  1151. phenanthro[4,5-bcd]thiophene
  1152. phenazine
  1153. phenazine 5,10-dioxide
  1154. phenazine 5-oxide
  1155. Phenethyl thioglycolic acid
  1156. Phenformin
  1157. phenol
  1158. phenol barium salt
  1159. phenol calcium salt
  1160. phenol lithium salt
  1161. phenol magnesium salt
  1162. phenol potassium salt
  1163. phenol rubidium salt
  1164. phenol sodium salt
  1165. phenol strontium salt
  1166. phenol-d
  1167. phenol-d6
  1168. phenoxathiin
  1169. phenoxyacetamide
  1170. phenoxyacetic acid
  1171. phenoxyacetic acid compd. with 4,6-dimethyl-N-phenyl-2-pyrimidinamine (1:1)
  1172. phenoxyacetic acid ethyl ester
  1173. phenoxyacetic acid methyl ester
  1174. phenoxyethyne
  1175. phenoxypropanedioic acid
  1176. Phenyl (2,3,4,5,6-pentachlorophenyl) oxalate
  1177. phenyl 2-methoxypiperidine-1-carboxylate
  1178. phenyl 2-methoxypyrrolidine-1-carboxylate
  1179. phenyl 3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate
  1180. Phenyl 4-(4-phenoxycarbonylphenyl)benzoate
  1181. Phenyl 4-chloro-3-[(phenoxycarbonyl)oxy]phenyl carbonate
  1182. phenyl 6-hydroxyhexanoate
  1183. phenyl acrylate
  1184. phenyl benzenesulfonate
  1185. phenyl cyanoformate
  1186. Phenyl dimethyl N,N-dimethylamino silane
  1187. phenyl ester 2-phenoxybenzoic acid
  1188. phenyl hex-5-enoate
  1189. Phenyl mercuric acetate 2,2,2-nitrilotrisethanol
  1190. Phenyl methacrylate
  1191. phenyl N,N'-bis(p-methoxyphenyl)phosphorodiamidite
  1192. phenyl N,N-di-sec-butylcarbamate
  1193. phenyl N,N-diisobutylcarbamate
  1194. phenyl N-(2,4-dimethoxyphenyl)carbamate
  1195. phenyl N-(2-aminopyridin-3-yl)carbamate hydrochloride
  1196. phenyl N-(3,4,5-trimethoxyphenyl)carbamate
  1197. phenyl N-(4-hydroxyphenyl)carbamate
  1198. phenyl N-(4-methoxyphenyl)carbamate
  1199. phenyl N-(4-methylsulfonylphenyl)carbamate
  1200. phenyl N-butyl-N-phenylcarbamate
  1201. phenyl N-ethyl-N-phenylcarbamate
  1202. phenyl N-isopentyl-N-phenylcarbamate
  1203. phenyl N-isopropyl-N-phenylcarbamate
  1204. phenyl N-propyl-N-phenylcarbamate
  1205. phenyl N-[(2-dimethylamino)phenyl]carbamate hydrochloride
  1206. phenyl N-[(4-diethylamino)-2-methylphenyl]carbamate
  1207. phenyl N-[(4-diethylamino)-2-methylphenyl]carbamate hydrochloride
  1208. phenyl N-[(4-diethylamino)phenyl]carbamate
  1209. phenyl N-[(4-dimethylamino)phenyl]carbamate
  1210. phenyl N-[(4-methylsulfanyl)phenyl]carbamate
  1211. phenyl N-[2-(phenylthiolcarbonato)ethyl]carbamate
  1212. phenyl N-[3-(dimethylamino)propyl]-N-phenylcarbamate hydrochloride
  1213. phenyl N-[4-(phenoxycarbonylamino)phenyl]carbamate
  1214. Phenyl P,P-dibutyl phosponoundecanoate
  1215. Phenyl P,P-diethylphosphonostearate
  1216. phenyl pyridin-2-ylcarbamate
  1217. phenyl pyridin-3-ylcarbamate
  1218. phenyl pyridin-3-ylcarbamate hydrochloride
  1219. phenyl pyridin-4-ylcarbamate
  1220. phenyl pyrrolidine-1-carboxylate
  1221. Phenyl quinolin-8-yl carbonate
  1222. phenyl(2,4,5-trimethylphenyl)methanone
  1223. phenyl(2,4,6-trimethylphenyl)methanone
  1224. phenyl(2,4,6-tris(1-methylethyl)phenyl)methanone
  1225. phenyl(2-pyridinyl)methanone 2-quinolynylhydrazone
  1226. phenyl(2-pyridinyl)methanone 6-chloro-4-pyridinylhydrazone
  1227. phenyl(2-pyridyl)acetamide
  1228. Phenyl(dipropyl)arsane
  1229. phenyl(phenyl(phenylhydrazono)methyl)diazene
  1230. Phenyl(pyridin-4-yl)methanol
  1231. Phenyl(pyridin-4-yl)methyl 4,5-dichloroisothiazole-3-carboxylate
  1232. Phenyl(pyridin-4-yl)methyl 5-(p-tolyl)isoxazole-3-carboxylate
  1233. Phenyl(pyridin-4-yl)methyl 5-phenylisoxazole-3-carboxylate
  1234. Phenyl-(4,4,9,9-tetraphenyl-3,8-dioxa-6-azatricyclo[5.2.0.02,5]nonan-6-yl)methanone
  1235. phenyl-18-crown-6
  1236. phenyl-2-pyridinylmethanone
  1237. phenyl-4-pyridinylmethanone
  1238. Phenyl-acetaldehyde phenylhydrazone
  1239. Phenyl-carbamic acid isobutyl ester
  1240. phenyl-piperidin-1-ylmethanone
  1241. phenyl-piperidin-2-ylmethanol
  1242. phenyl-pyridin-2-ylmethanol
  1243. phenyl-pyridin-3-ylmethanone
  1244. phenyl-pyrrolidin-1-ylmethanone
  1245. phenyl-tripropoxysilane
  1246. phenyl-tris-difluoroacetoxy-silane
  1247. phenyl-tris-heptafluorobutanoyloxy-silane
  1248. phenyl-tris-pentafluoropropanoyloxy-silane
  1249. phenyl-tris-trifluoroacetoxy-silane
  1250. Phenyl-[4-[6-(4-phenyldiazenylphenoxy)hexoxy]phenyl]diazene
  1251. Phenyl-[4-[6-[4-[(4-propylphenyl)diazenyl]phenoxy]hexoxy]phenyl]diazene
  1252. Phenylacetaldehyde oxime
  1253. phenylalanine 2-amino-1-oxopropyl ester
  1254. phenylalanine 2-amino-3-methyl-1-oxobutyl ester
  1255. Phenylalanine hydrobromide
  1256. Phenylalanine hydrochloride
  1257. Phenylalanine hydrofluoride
  1258. phenylamino-propylmercaptane
  1259. Phenylammonium oxalate
  1260. phenylarsonic acid
  1261. phenylarsonous dichloride
  1262. Phenylazanium sulfate
  1263. phenylazanium; 2,4,6-trinitrophenolate
  1264. phenylboronic acid
  1265. phenylboronic acid bis(1,1-dimethylpropyl) ester
  1266. phenylboronic acid bis(1-methylethyl) ester
  1267. phenylboronic acid bis(1-methylheptyl) ester
  1268. phenylboronic acid bis(1-methylpropyl) ester
  1269. phenylboronic acid bis(2-chloroethyl) ester
  1270. phenylboronic acid bis(2-methylphenyl) ester
  1271. phenylboronic acid bis(2-methylpropyl) ester
  1272. phenylboronic acid bis(phenylmethyl) ester
  1273. phenylboronic acid dibutyl ester
  1274. phenylboronic acid diethyl ester
  1275. phenylboronic acid dimethyl ester
  1276. phenylboronic acid dioctyl ester
  1277. phenylboronic acid dipropyl ester
  1278. Phenylboronic acid N-butyldiethanolamine ester
  1279. Phenylboronic acid pinacol ester
  1280. phenylbutanedioic acid
  1281. phenylcarbamic acid 1-methylethyl ester
  1282. phenylcarbamic acid 2-methylcyclohexyl ester
  1283. phenylcarbamic acid 2-phenylethyl ester
  1284. phenylcarbamic acid butyl ester
  1285. phenylcarbamic acid ethyl ester
  1286. phenylcarbamic acid hexyl ester
  1287. phenylcarbamic acid methyl ester
  1288. phenylcarbamic acid nonyl ester
  1289. phenylcarbamic acid octadecyl ester
  1290. phenylcarbamic acid pentyl ester
  1291. phenylcarbamic acid phenylmethyl ester
  1292. phenylcarbamic acid propyl ester
  1293. phenylcarbamic chloride
  1294. phenylcarbamimidothioic acid 1,4,5,6-tetrahydro-1-(4-methylphenyl)-4,6-dioxo-2-pyrimidinyl ester monohydrochloride
  1295. phenylcarbamimidothioic acid 1-(4-chlorophenyl)-1,4,5,6-tetrahydro-4,6-dioxo-2-pyrimidinyl ester monohydrochloride
  1296. phenylcarbonimidic dichloride
  1297. phenyldiazenecarboxaldehyde phenylhydrazone
  1298. Phenyldifluoroarsine
  1299. Phenyldithiopyrylmethane
  1300. phenylenebis[2-(chlorodimethylsilyl)ethan]
  1301. phenylethanedithioamide
  1302. phenylethanolamine
  1303. phenylhydrazine
  1304. phenylhydrazine monohydrochloride
  1305. Phenylhydrazonoterephthalilydenaminophthalimide
  1306. phenylimidosulfurous difluoride
  1307. Phenylmalonamic acid
  1308. phenylmercuric nitrate
  1309. Phenylmercuric triethanolammonium lactate
  1310. Phenylmercury butyrate
  1311. Phenylmercury methacrylate
  1312. Phenylmercury propionate
  1313. phenylmercury(1+) acetate
  1314. Phenylmethanaminium 2-((4,5-dibromo-1-(thietan-3-yl)-1H-imidazol-2-yl)sulfanyl)acetate
  1315. phenylmethanediol diacetate
  1316. Phenylmethanediol dipropanoate
  1317. phenylmethyl
  1318. phenylmethyl 2-methoxypiperidine-1-carboxylate
  1319. phenylmethyl 3,5-dinitrobenzoate
  1320. phenylmethyl 4-methylbenzenesulfinate
  1321. phenylmethylsulfanylmethylsulfanylmethylbenzene
  1322. phenylmethylsulfinylmethylsulfinylmethylbenzene
  1323. Phenylnorbornane
  1324. phenyloxirane
  1325. phenylphosphinic acid
  1326. phenylphosphonic acid
  1327. phenylphosphonic acid 4-bromo-2,5-dichlorophenyl methyl ester
  1328. phenylphosphonic acid diethyl ester
  1329. phenylphosphonic dichloride
  1330. phenylphosphonochloridothioic acid, O-phenyl ester
  1331. phenylphosphonothioic acid O-(4-bromo-2,5-dichlorophenyl) O-methyl ester
  1332. phenylphosphonothioic acid O-ethyl O-(4-nitrophenyl) ester
  1333. phenylphosphonothioic dichloride
  1334. phenylphosphonous acid diethyl ester
  1335. phenylphosphonous dichloride
  1336. phenylpropanal
  1337. phenylsilane
  1338. phenylsilanetriol triacetate
  1339. phenylsulfonyl 2,2,2-trifluoroacetate
  1340. phenylsulfonylacetic acid methyl ester
  1341. phenylsulfur pentafluoride
  1342. phenylthiourea
  1343. phenyltri-2-propenylsilane
  1344. phenylurea
  1345. Phloracetophenone
  1346. phoshoric acid O,O-diethyl O-(2,6-dichloro-4-(methylsulfonyl)phenyl) ester
  1347. phoshoric acid O,O-diethyl O-(2,6-dichloro-4-(methylthio)phenyl) ester
  1348. phoshoric acid O,O-diethyl O-(2-chloro-4-(methylthio)phenyl) ester
  1349. phoshoric acid O,O-diethyl O-(2-methyl-4-(methylsulfonyl)phenyl) ester
  1350. phoshoric acid O,O-diethyl O-(2-nitro-4-(methylsulfonyl)phenyl) ester
  1351. phoshoric acid O,O-diethyl O-(3-chloro-4-(methylthio)phenyl) ester
  1352. phoshoric acid O,O-diethyl O-(3-methyl-4-(methylthio)phenyl) ester
  1353. phoshoric acid O-(2-nitro-4-(methylthio)phenyl) ester
  1354. phosphane (red)
  1355. phosphane (red)
  1356. phosphane (red)
  1357. phosphane (red)
  1358. phosphanylidynemanganese
  1359. phosphate
  1360. phosphenothious fluoride
  1361. phosphenyl phenylhydrazone
  1362. phosphine
  1363. phosphine-d3
  1364. phosphinic acid
  1365. phosphinic acid barium salt (2:1)
  1366. phosphinic acid calcium salt
  1367. phosphinic acid manganese(2+) salt (2:1)
  1368. phosphinic acid monoammonium salt
  1369. phosphinic acid monopotassium salt
  1370. phosphinic acid scandium(3+) salt (3:1)
  1371. phosphinic acid sodium salt
  1372. phosphinic acid thallium(1+) salt
  1373. phosphinidene
  1374. phosphino
  1375. phospholane
  1376. Phosphomolybdic acid hexahydrate
  1377. phosphonato phosphate; rubidium(+1) cation
  1378. phosphonic acid barium salt (2:1)
  1379. phosphonic acid bis(1-methylethyl) ester
  1380. phosphonic acid bis(2-(heptyloxy)ethyl) ester
  1381. phosphonic acid bis(2-(hexyloxy)ethyl) ester
  1382. phosphonic acid bis(2-butoxyethyl) ester
  1383. phosphonic acid bis(2-ethoxyethyl) ester
  1384. phosphonic acid bis(2-methylpropyl) ester
  1385. phosphonic acid bis(2-propoxyethyl) ester
  1386. phosphonic acid calcium salt (1:1)
  1387. phosphonic acid calcium salt (2:1)
  1388. phosphonic acid dibutyl ester
  1389. phosphonic acid diethyl ester
  1390. phosphonic acid diheptyl ester
  1391. phosphonic acid dihexyl ester
  1392. phosphonic acid dilithium salt
  1393. phosphonic acid dimethyl ester
  1394. phosphonic acid dimethyl propyl ester
  1395. phosphonic acid dioctyl ester
  1396. phosphonic acid dipentyl ester
  1397. phosphonic acid dipotassium salt
  1398. phosphonic acid disodium salt
  1399. phosphonic acid magnesium salt (1:1)
  1400. phosphonic acid magnesium salt (2:1)
  1401. phosphonic acid monolithium salt
  1402. phosphonic acid strontium salt (1:1)
  1403. phosphonic acid strontium salt (2:1)
  1404. phosphonic acid thallium(1+) salt (1:2)
  1405. Phosphonic difluoride
  1406. phosphonium bromide ((PH4)Br)
  1407. phosphonium chloride ((PH4)Cl)
  1408. phosphonium iodide ((PH4)I)
  1409. Phosphonothioic difluoride
  1410. Phosphoramidic acid, N,N'-1,2-ethanediylbis-P,P,P',P'-tetrakis(2,6-dimethyl)phenyl ester
  1411. Phosphoramidic acid, N,N'-dimethyl-N,N'-1,2-ethanediylbis-P,P,P',P'-tetrakis(2,6-dimethyl)phenyl ester
  1412. phosphoramidic acid, N-(phenylmethyl)-, diphenyl ester
  1413. phosphoramidothioic acid O,S-diethyl ester
  1414. phosphoramidothioic acid O,S-dimethyl ester
  1415. phosphoramidothioic acid O,S-dipropyl ester
  1416. phosphoric acid
  1417. phosphoric acid (2-ethylhexyl) methyl 3,6-dioxa-1,4,7-trimethyl-1,8-octanediyl ester (2:2:2:1)
  1418. phosphoric acid (2-ethylhexyl) methyl 3,6-dioxa-1,8-octanediyl ester (2:2:2:1)
  1419. phosphoric acid (Z)-2-chloro-1-(2,4,5-trichlorophenyl)ethenyl dimethyl ester
  1420. phosphoric acid 1,4-butanediyl tetrabutyl ester
  1421. phosphoric acid 1,4-phenylene tetrabutyl ester
  1422. phosphoric acid 2,2-dichloroethenyl dimethyl ester
  1423. phosphoric acid 2-chloro-1-(2,4-dichlorophenyl)ethenyl diethyl ester
  1424. phosphoric acid 2-chloro-3-(diethylamino)-1-methyl-3-oxo-1-propenyl dimethyl ester
  1425. phosphoric acid 2-ethylhexyl diphenyl ester
  1426. phosphoric acid 4-(1-methylethyl)phenyl diphenyl ester
  1427. phosphoric acid 4-(methylthio)phenyl dipropyl ester
  1428. phosphoric acid aluminum salt (1:1)
  1429. phosphoric acid ammonium magnesium salt (1:1:1) monohydrate
  1430. phosphoric acid ammonium salt (2:3)
  1431. phosphoric acid barium zirconium(4+) salt (2:1:1)
  1432. phosphoric acid barium zirconium(4+) salt (6:1:4)
  1433. phosphoric acid bis(2-ethylhexyl) ester
  1434. phosphoric acid bis(2-methyl-5-(1-methylethyl)phenyl) 2-methylphenyl ester
  1435. phosphoric acid bis(2-methyl-5-(1-methylethyl)phenyl)-6-chloro(1,1'-biphenyl)-2-yl ester
  1436. phosphoric acid butyl bis(methylphenyl) ester
  1437. phosphoric acid butyl diethyl ester
  1438. phosphoric acid butyl diphenyl ester
  1439. phosphoric acid calcium salt (1:1)
  1440. phosphoric acid calcium salt (2:1)
  1441. phosphoric acid calcium salt (2:1) monohydate
  1442. phosphoric acid calcium salt (2:3)
  1443. phosphoric acid cerium(3+) salt (1:1)
  1444. phosphoric acid cerium(4+) salt (4:3)
  1445. phosphoric acid cesium magnesium salt (1:1:1)
  1446. phosphoric acid cesium zirconium(4+) salt (3:1:2)
  1447. phosphoric acid cobalt(2+) salt (2:3)
  1448. phosphoric acid copper(1+) salt (1:2)
  1449. phosphoric acid copper(2+) salt (1:1)
  1450. phosphoric acid copper(2+) salt (2:3)
  1451. phosphoric acid copper(2+) salt (2:3) trihydrate
  1452. phosphoric acid decyl diethyl ester
  1453. phosphoric acid diammonium salt
  1454. phosphoric acid dibutyl ester
  1455. phosphoric acid dibutyl ester cerium(3+) salt
  1456. phosphoric acid dibutyl ester gadolinium(3+) salt (3:1)
  1457. phosphoric acid dibutyl ester holmium(3+) salt (3:1)
  1458. phosphoric acid dibutyl ester lanthanum(3+) salt (3:1)
  1459. phosphoric acid dibutyl ester neodymium(3+) salt (3:1)
  1460. phosphoric acid dibutyl ester praseodymium(3+) salt (3:1)
  1461. phosphoric acid dibutyl ester terbium(3+) salt (3:1)
  1462. phosphoric acid dibutyl ester ytterbium(3+) salt (3:1)
  1463. phosphoric acid dibutyl ester yttrium(3+) salt (3:1)
  1464. phosphoric acid dibutyl ethyl ester
  1465. phosphoric acid dibutyl hexyl ester
  1466. phosphoric acid dibutyl methyl ester
  1467. phosphoric acid dibutyl methylphenyl ester
  1468. phosphoric acid dibutyl octyl ester
  1469. phosphoric acid diethyl 1-[2-(methyl)phenyl)ethylideneamino ester
  1470. phosphoric acid diethyl 2-methyl-4-(methylthio)phenyl ester
  1471. phosphoric acid diethyl 2-methylpropyl ester
  1472. phosphoric acid diethyl 4-(methylthio)phenyl ester
  1473. phosphoric acid diethyl 4-nitrophenyl ester
  1474. phosphoric acid diethyl 6-methyl-2-(1-methylethyl)-4-pyrimidinyl ester
  1475. phosphoric acid diethyl pentyl ester
  1476. phosphoric acid diethyl phenyl ester
  1477. phosphoric acid dilithium salt
  1478. phosphoric acid dimethyl 4-nitrophenyl ester
  1479. phosphoric acid dimethyl ester cerium(3+) salt (3:1)
  1480. phosphoric acid dimethyl ester erbium(3+) salt (3:1)
  1481. phosphoric acid dimethyl ester gadolinium(3+) salt
  1482. phosphoric acid dimethyl ester lanthanum(3+) salt (3:1)
  1483. phosphoric acid dimethyl ester neodymium(3+) salt (3:1)
  1484. phosphoric acid dimethyl ester praseodymium(3+) salt (3:1)
  1485. phosphoric acid dimethyl ester samarium(3+) salt (3:1)
  1486. phosphoric acid dimethyl ester ytterbium(3+) salt
  1487. phosphoric acid dimethyl ester yttrium(3+) salt (3:1)
  1488. phosphoric acid dioctadecyl ester sodium salt
  1489. phosphoric acid dipentyl ester lanthanum(3+) salt (3:1)
  1490. phosphoric acid dipentyl ester terbium(3+) salt (3:1)
  1491. phosphoric acid dipotassium salt
  1492. phosphoric acid dipropyl ester lanthanum(3+) salt (3:1)
  1493. phosphoric acid dipropyl ester terbium(3+) salt (3:1)
  1494. phosphoric acid dipropyl ester yttrium(3+) salt (3:1)
  1495. phosphoric acid disodium salt
  1496. phosphoric acid disodium salt dodecahydrate
  1497. phosphoric acid disodium salt hexahydrate
  1498. phosphoric acid dysprosium(3+) salt (1:1)
  1499. phosphoric acid erbium(3+) salt (1:1)
  1500. phosphoric acid europium(3+) salt (1:1)
  1501. phosphoric acid europium(3+) zirconium(4+) salt (9:1:6)
  1502. phosphoric acid gadolinium(3+) salt (1:1)
  1503. phosphoric acid gallium salt (1:1)
  1504. phosphoric acid hafnium(4+) sodium salt (3:1:5)
  1505. phosphoric acid hafnium(4+) sodium salt (3:2:1)
  1506. phosphoric acid holmium(3+) salt (1:1)
  1507. phosphoric acid hydrate (2:1)
  1508. phosphoric acid isooctyl diphenyl ester
  1509. phosphoric acid lanthanum(3+) salt (1:1)
  1510. phosphoric acid lanthanum(3+) zirconium(4+) salt (9:1:6)
  1511. phosphoric acid lead(2+) salt (2:3)
  1512. phosphoric acid lithium zirconium(4+) salt (3:1:2)
  1513. phosphoric acid lutetium(3+) salt
  1514. phosphoric acid lutetium(3+) zirconium(4+) salt (9:1:6)
  1515. phosphoric acid magnesium potassium salt (1:1:1) hexahydrate
  1516. phosphoric acid magnesium salt (2:1)
  1517. phosphoric acid magnesium salt (2:3)
  1518. phosphoric acid magnesium sodium salt (2:1:4)
  1519. phosphoric acid manganese(2+) salt (1:1)
  1520. phosphoric acid methyl diphenyl ester
  1521. phosphoric acid monoammonium monosodium salt tetrahydrate
  1522. phosphoric acid monoammonium salt
  1523. phosphoric acid monoammonium salt
  1524. phosphoric acid monoammonium salt
  1525. phosphoric acid monobutyl ester
  1526. phosphoric acid monohexyl ester
  1527. phosphoric acid monolithium salt
  1528. phosphoric acid monopotassium salt
  1529. phosphoric acid monopotassium salt labeled with deuterium
  1530. phosphoric acid monorubidium salt
  1531. phosphoric acid monosodium salt
  1532. phosphoric acid monosodium salt dihydrate
  1533. phosphoric acid monothallium(1+) salt
  1534. phosphoric acid N-acetyl-4-bromoanilinium salt (1:1)
  1535. phosphoric acid neodymium(3+) salt (1:1)
  1536. phosphoric acid neodymium(3+) zirconium(4+) salt (9:1:6)
  1537. phosphoric acid nickel(2+) salt (2:3)
  1538. phosphoric acid nickel(2+) zirconium(4+) salt (6:1:4)
  1539. phosphoric acid plutonium(3+) salt (1:1)
  1540. phosphoric acid potassium zirconium(4+) salt (3:1:2)
  1541. phosphoric acid rubidium zirconium(4+) salt (3:1:2)
  1542. phosphoric acid samarium(3+) salt (1:1)
  1543. phosphoric acid scandium(3+) salt (1:1)
  1544. phosphoric acid sodium titanium(4+) salt (3:1:2)
  1545. phosphoric acid sodium titanium(4+) salt (3:5:1)
  1546. phosphoric acid sodium zirconium(4+) salt (3:5:1)
  1547. phosphoric acid strontium zirconium(4+) salt (6:1:4)
  1548. phosphoric acid thulium(3+) salt (1:1)
  1549. phosphoric acid triammonium salt
  1550. phosphoric acid tributyl ester
  1551. phosphoric acid tridodecyl ester
  1552. phosphoric acid triethyl ester
  1553. phosphoric acid triheptyl ester
  1554. phosphoric acid trihexyl ester
  1555. phosphoric acid trilithium salt
  1556. phosphoric acid trimethyl ester
  1557. phosphoric acid trioctyl ester
  1558. phosphoric acid tripentyl ester
  1559. phosphoric acid triphenyl ester
  1560. phosphoric acid tripotassium salt
  1561. phosphoric acid tripropyl ester
  1562. phosphoric acid trirubidium salt
  1563. phosphoric acid tris(1-methylethyl) ester
  1564. phosphoric acid tris(2-chlorophenyl) ester
  1565. phosphoric acid tris(2-ethylhexyl) ester
  1566. phosphoric acid tris(2-methylphenyl) ester
  1567. phosphoric acid tris(2-methylpropyl) ester
  1568. phosphoric acid tris(3-chlorophenyl) ester
  1569. phosphoric acid tris(3-methylphenyl) ester
  1570. phosphoric acid tris(4-chlorophenyl) ester
  1571. phosphoric acid tris(4-methylphenyl) ester
  1572. phosphoric acid tris(decyl) ester
  1573. phosphoric acid tris(methylphenyl) ester
  1574. phosphoric acid tris(methylphenyl) ester
  1575. phosphoric acid trisilver(1+) salt
  1576. phosphoric acid trisodium salt
  1577. phosphoric acid trisodium salt decahydrate
  1578. phosphoric acid trisodium salt dodecahydrate
  1579. phosphoric acid trithallium(1+) salt
  1580. phosphoric acid yttrium(3+) salt (1:1)
  1581. phosphoric acid zinc salt (1:1) dihydrate
  1582. phosphoric acid zinc salt (1:1) tetrahydrate
  1583. phosphoric acid zinc salt (2:3)
  1584. phosphoric acid zirconium(4+) salt (4:3)
  1585. phosphoric acid, P,P'-1,4-phenylene P,P,P',P'-tetraphenyl ester
  1586. phosphoric acid-d2 monothallium(1+) salt
  1587. phosphoric acid; N'-propan-2-ylpyridine-4-carbohydrazide
  1588. phosphoric acid; quinolin-8-ol
  1589. phosphoric acid; sodium; hydrate
  1590. phosphoric dichloride fluoride
  1591. phosphoric triamide
  1592. phosphorinane
  1593. phosphorisocyanatic difluoride
  1594. phosphorochloridic acid diethyl ester
  1595. phosphorochloridic acid diphenyl ester
  1596. phosphorochloridothioic acid O,O-diethyl ester
  1597. phosphorochloridothioic acid O,O-dimethyl ester
  1598. phosphorochloridous acid diethyl ester
  1599. phosphorochloridousfluoridous acid methyl ester
  1600. phosphorodichloridic acid (1,1'-biphenyl)-2-yl ester
  1601. phosphorodichloridic acid 4-(1,1-dimethylethyl)phenyl ester
  1602. phosphorodichloridic acid methyl ester
  1603. phosphorodichloridothious acid trifluoromethyl ester
  1604. phosphorodichloridous acid butyl ester
  1605. phosphorodichloridous acid ethyl ester
  1606. phosphorodichloridous acid methyl ester
  1607. phosphorodichloridous acid phenyl ester
  1608. phosphorodichloridous acid propyl ester
  1609. phosphorodifluoric acid trifluormethyl ester
  1610. phosphorodifluoridic acid
  1611. phosphorodifluoridic acid potassium salt
  1612. phosphorodifluoridodithioic acid methyl ester
  1613. phosphorodifluoridothioic acid S-(trifluoromethyl) ester
  1614. phosphorodifluoridothioic acid S-methyl ester
  1615. phosphorodifluoridothious acid trifluoromethyl ester
  1616. phosphorodifluoridous acid methyl ester
  1617. phosphorodithioic acid O,O-bis(1-methylethyl) S-[2-[(phenylsulfonyl)amino]ethyl] ester
  1618. phosphorodithioic acid O,O-diethyl S-((4-oxo-1,2,3-benzotriazin-3(4H)-yl)methyl) ester
  1619. phosphorodithioic acid O,O-diethyl S-((ethylsulfinyl)methyl) ester
  1620. phosphorodithioic acid O,O-diethyl S-((ethylsulfonyl)methyl) ester
  1621. phosphorodithioic acid O,O-diethyl S-(2-(ethylsulfinyl)ethyl) ester
  1622. phosphorodithioic acid O,O-diethyl S-(2-(ethylsulfonyl)ethyl) ester
  1623. phosphorodithioic acid O,O-diethyl S-(2-(ethylthio)ethyl) ester
  1624. phosphorodithioic acid O,O-diethyl S-(ethylthio)methyl ester
  1625. phosphorodithioic acid O,O-dimethyl S-((4-oxo-1,2,3-benzotriazin-3(4H)-yl)methyl) ester
  1626. phosphorodithioic acid O,O-dimethyl S-(2-(methylamino)-2-oxoethyl) ester
  1627. phosphorodithioic acid O-(2,4-dichlorophenyl) O-ethyl S-propyl ester
  1628. phosphorodithioic acid O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl ester
  1629. phosphorodithioic acid O-ethyl S,S-diphenyl ester
  1630. phosphorodithioic acid S-(((1,1-dimethylethyl)sulfinyl)methyl) O,O-diethyl ester
  1631. phosphorodithioic acid S-(((1,1-dimethylethyl)sulfonyl)methyl) O,O-diethyl ester
  1632. phosphorodithioic acid S-(((1,1-dimethylethyl)thio)methyl) O,O-diethyl ester
  1633. phosphorodithioic acid S-(((4-chlorophenyl)thio)methyl) O,O-dimethyl ester
  1634. phosphorodithioic acid S-((1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)methyl) O,O-dimethyl ester
  1635. phosphorodithioic acid S-((5-methoxy-2-oxo-1,3,4-thiadiazol-3(2H)-yl)methyl) O,O-dimethyl ester
  1636. phosphorodithioic acid S-((6-chloro-2-oxo-3(2H)-benzoxazolyl)methyl) O,O-diethyl ester
  1637. phosphorodithioic acid S-(2-chloro-1-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)ethyl) O,O-diethyl ester
  1638. phosphorodithioic acid S-[2-(ethylthio)ethyl] O,O-dimethyl ester
  1639. phosphorodithioic aicd S-(2-(2-methyl-1-piperidinyl)-2-oxoethyl) O,O-dipropyl ester
  1640. phosphorofluoridic acid bis(1-methylethyl) ester
  1641. phosphorofluoridic acid diethyl ester
  1642. phosphorotetrathioic acid cadmium salt (2:3)
  1643. phosphorothioic acid O,O,O-triethyl ester
  1644. phosphorothioic acid O,O,O-trimethyl ester
  1645. phosphorothioic acid O,O,O-triphenyl ester
  1646. phosphorothioic acid O,O,O-tris(2,4-dimethylphenyl) ester
  1647. phosphorothioic acid O,O,O-tris(4-chlorophenyl) ester
  1648. phosphorothioic acid O,O,O-tris(4-methylphenyl) ester
  1649. phosphorothioic acid O,O,S-triethyl ester
  1650. phosphorothioic acid O,O-bis(1-methylethyl) ester comdp. with diethylamine (1:1)
  1651. phosphorothioic acid O,O-bis(1-methylethyl) S-(phenylmethyl) ester
  1652. phosphorothioic acid O,O-diethyl O-(1-phenyl-1H-1,2,4-triazol-3-yl) ester
  1653. phosphorothioic acid O,O-diethyl O-(2,6-dichloro-4-(methylsulfonyl)phenyl) ester
  1654. phosphorothioic acid O,O-diethyl O-(2,6-dichloro-4-methylthiophenyl) ester
  1655. phosphorothioic acid O,O-diethyl O-(2-(ethylthio)ethyl) ester
  1656. phosphorothioic acid O,O-diethyl O-(2-chloro-4-methylthiophenyl) ester
  1657. phosphorothioic acid O,O-diethyl O-(2-methyl-4-methylthiophenyl) ester
  1658. phosphorothioic acid O,O-diethyl O-(2-nitro-4-(methylsulfonyl)phenyl) ester
  1659. phosphorothioic acid O,O-diethyl O-(2-nitro-4-methylthiophenyl) ester
  1660. phosphorothioic acid O,O-diethyl O-(3,5,6-trichloro-2-pyridyl) ester
  1661. phosphorothioic acid O,O-diethyl O-(4-(methylsulfinyl)phenyl) ester
  1662. phosphorothioic acid O,O-diethyl O-(4-(methylsulfonyl)phenyl) ester
  1663. phosphorothioic acid O,O-diethyl O-(4-(methylthio)phenyl) ester
  1664. phosphorothioic acid O,O-diethyl O-(4-nitrophenyl) ester
  1665. phosphorothioic acid O,O-diethyl O-(5-phenyl-3-isoxazolyl) ester
  1666. phosphorothioic acid O,O-diethyl O-(6-methyl-2-(1-methylethyl)-4-pyrimidinyl) ester
  1667. phosphorothioic acid O,O-diethyl O-phenyl ester
  1668. phosphorothioic acid O,O-diethyl S-((4-oxo-1,2,3-benzotriazin-3(4H)-yl)methyl) ester
  1669. phosphorothioic acid O,O-diethyl S-(2-(ethylthio)ethyl) ester
  1670. phosphorothioic acid O,O-diethyl S-(4-nitrophenyl) ester
  1671. phosphorothioic acid O,O-dimethyl O-(2,4,5-trichlorophenyl) ester
  1672. phosphorothioic acid O,O-dimethyl O-(3,5,6-trichloro-2-pyridinyl) ester
  1673. phosphorothioic acid O,O-dimethyl O-(3-methyl-4-(methylthio)phenyl) ester
  1674. phosphorothioic acid O,O-dimethyl O-(3-methyl-4-nitrophenyl) ester
  1675. phosphorothioic acid O,O-dimethyl O-(4-nitrophenyl) ester
  1676. phosphorothioic acid O,O-dimethyl O-phenyl ester
  1677. phosphorothioic acid O,O-dimethyl O-[4-(methylsulfanyl)phenyl] ester
  1678. phosphorothioic acid O,O-dimethyl S-((4-oxo-1,2,3-benzotriazin-3(4H)-yl)methyl) ester
  1679. phosphorothioic acid O,S-diethyl O-(4-nitrophenyl) ester
  1680. phosphorothioic acid O-(1,6-dihydro-6-oxo-1-phenyl-3-pyridazinyl) O,O-diethyl ester
  1681. phosphorothioic acid O-(2,4-dichlorophenyl) O,O-diethyl ester
  1682. phosphorothioic acid O-(2,5-dichloro-4-iodophenyl) O,O-dimethyl ester
  1683. phosphorothioic acid O-(2,6-dichloro-4-methylphenyl) O,O-dimethyl ester
  1684. phosphorothioic acid O-(2-(diethylamino)-6-methyl-4-pyrimidinyl) O,O-diethyl ester
  1685. phosphorothioic acid O-(2-(diethylamino)-6-methyl-4-pyrimidinyl) O,O-dimethyl ester
  1686. phosphorothioic acid O-(2-(ethylthio)ethyl) O,O-dimethyl ester
  1687. phosphorothioic acid O-(2-chloro-4-nitrophenyl) O,O-dimethyl ester
  1688. phosphorothioic acid O-(3-chloro-4-methyl-2-oxo-2H-1-benzopyran-7-yl) O,O-diethyl ester
  1689. phosphorothioic acid O-(3-chloro-4-nitrophenyl) O,O-dimethyl ester
  1690. phosphorothioic acid O-(4-aminophenyl) O,O-diethyl ester
  1691. phosphorothioic acid O-(4-bromo-2,5-dichlorophenyl) O,O-diethyl ester
  1692. phosphorothioic acid O-(4-bromo-2,5-dichlorophenyl) O,O-dimethyl ester
  1693. phosphorothioic acid O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl ester
  1694. phosphorothioic acid O-(4-chloro-2-cyanophenyl) O,O-dimethyl ester
  1695. phosphorothioic acid O-(4-cyanophenyl) O,O-dimethyl ester
  1696. phosphorothioic acid O-(5-chloro-1-(1-methylethyl)-1H-1,2,4-triazol-3-yl) O,O-diethyl ester
  1697. phosphorothioic acid O-(6-ethoxy-2-ethyl-4-pyrimidinyl) O,O-dimethyl ester
  1698. phosphorothioic acid S-(2-(ethylthio)ethyl) O,O-dimethyl ester
  1699. phosphorothioic acid tributyl ester
  1700. Phosphorothioic dichloride fluoride
  1701. phosphorothious acid S-(2-(bis(1-methylethyl)amino)ethyl) O-ethyl O-methyl ester
  1702. phosphorotrithious acid triethyl ester
  1703. phosphorous acid
  1704. phosphorous acid propyl propylene ester
  1705. phosphorous acid tributyl ester
  1706. phosphorous acid triethyl ester
  1707. phosphorous acid triheptyl ester
  1708. phosphorous acid trihexyl ester
  1709. phosphorous acid trimethyl ester
  1710. phosphorous acid trioctyl ester
  1711. phosphorous acid tripentyl ester
  1712. phosphorous acid triphenyl ester
  1713. phosphorous acid tripropyl ester
  1714. phosphorous acid tris(1-methylethyl) ester
  1715. phosphorous acid tris(2-chlorophenyl) ester
  1716. phosphorous acid tris(2-methylphenyl) ester
  1717. phosphorous acid tris(3-chlorophenyl) ester
  1718. phosphorous acid tris(3-methylphenyl) ester
  1719. phosphorous acid tris(4-chlorophenyl) ester
  1720. phosphorous acid tris(4-methylphenyl) ester
  1721. phosphorous bis(trifluoromethyl)nitroxide difluoride
  1722. phosphorous bis[bis(trifluoromethyl)nitroxide] trifluoride
  1723. phosphorous bromide difluoride
  1724. phosphorous chloride difluoride
  1725. phosphorous dibromide fluoride
  1726. phosphorous dichloride fluoride
  1727. phosphorous nitride
  1728. phosphorous oxide (PO2)
  1729. phosphorous tribromide
  1730. phosphorous trichloride
  1731. phosphorous tricyanide
  1732. phosphorous trifluoride
  1733. phosphorous triiodide
  1734. phosphorous triisocyanate
  1735. phosphorous tris[bis(trifluoromethyl)nitroxide]difluoride
  1736. phosphorus (violet)
  1737. phosphorus chloride (PCl)
  1738. phosphorus mol. (P4)
  1739. phosphorus mol. (P4)
  1740. phosphorus nitride (P3N5)
  1741. phosphorus oxide (P2O3)
  1742. phosphorus oxide (P2O5)
  1743. phosphorus oxide (P4O6)
  1744. phosphorus oxide (PO)
  1745. phosphorus pentasulfide
  1746. phosphorus sulfide (PS)
  1747. phosphorus(black)
  1748. Phosphorus(III) tris(dipropyldithiocarbamate)
  1749. phosphoryl bis(trifluoromethyl)nitroxide difluoride
  1750. phosphoryl bromide
  1751. Phosphoryl bromide chloride fluoride
  1752. phosphoryl bromide difluoride
  1753. phosphoryl chloride
  1754. phosphoryl chloride fluoride (POClF2)
  1755. Phosphoryl dichlorothiocyanate
  1756. phosphoryl fluoride
  1757. phosphorylbromide fluoride (POBr2F)
  1758. phosphrofluoridic acid dimethyl ester
  1759. phosporic acid dimethyl (1E)-1-methyl-3-(methylamino)-3-oxo-1-propenyl ester
  1760. phosporic acid ethyl dimethyl ester
  1761. phosporic acid manganese(2+) salt (2:3)
  1762. phosporic acid monocesium salt
  1763. phthalazine
  1764. Phthalic acid 2,4-dimethylhex-3-yl ester
  1765. Phthalic acid bis(1H,1H,5H-octafluoropentyl) ester
  1766. Phthalic acid hept-3-yl ester
  1767. phthalic acid mono-ethyl mono-vinyl ester
  1768. Phthalimidine
  1769. Phytosterines
  1770. phytosterol
  1771. picene
  1772. Picotamide
  1773. Pidotimod
  1774. Pindone
  1775. Pinic acid bis(1H,1H,7H-dodecafluoroheptyl) ester
  1776. Pinic acid diheptyl ester
  1777. Pinonic acid
  1778. piperazine
  1779. piperazine dihydrochloride
  1780. piperazine hexahydrate
  1781. piperazine sulfate(1:1)
  1782. piperazinium dichloride monohydrate
  1783. piperazinium dinitrate
  1784. piperidin-1-yl-[3-(trifluoromethyl)phenyl]methanone
  1785. piperidine
  1786. piperidine compd. with 2,4,6-trinitrophenol (1:1)
  1787. piperidine conjugate acid
  1788. piperidine hydrochloride
  1789. piperidine nitrate
  1790. Piperidine pentamethylenedithiocarbamate
  1791. Piperidinium 2-((4,5-dibromo-1-(thietan-3-yl)-1H-imidazol-2-yl)sulfanyl)acetate
  1792. piperidinium propionate
  1793. Piperidinium tetrakis(1,3-diphenyl-1,3-propanediono)europium(III)
  1794. Piperidinium tetrakis(1,3-diphenyl-1,3-propanediono)europium(III) trihydrate
  1795. Piperidinium tetrakis(1-phenyl-1,3-butanediono)europium(III)
  1796. Piperidinium tetrakis(1-phenyl-1,3-butanediono)europium(III) hydrate
  1797. Plalladium(II) diethyldithiocarbamate chloride
  1798. Plalladium(II) dimethyldithiocarbamate bromide
  1799. Plalladium(II) dimethyldithiocarbamate chloride
  1800. Plalladium(II) methyldiethyldithiocarbamate dichloride
  1801. Plalladium(II) methyldimethyldithiocarbamate dibromide
  1802. Plalladium(II) methyldimethyldithiocarbamate dichloride
  1803. plasminogen
  1804. platinum
  1805. platinum (IV) chloride trihydrate
  1806. Platinum (IV) oxide
  1807. platinum alloy base Pt 90,Rh 10
  1808. platinum chloride (PtCl2)
  1809. Platinum diantimony
  1810. platinum iodide (PtI)
  1811. platinum iodide (PtI2)
  1812. platinum iodide (PtI3)
  1813. Platinum(II) 3-dimethylaminomethyl indole salicylaldehydeoxime chloride
  1814. Platinum(II) bis(4,6-dimethyl-2-thiopyrimidine) dichloride
  1815. Platinum(II) bis(4-aminophenazone dithiocarbamate)
  1816. Platinum(II) bis(diethyldithiocarbamate)
  1817. Platinum(II) bis(N-methylcyclohexyl dithiocarbamate)
  1818. Platinum(II) dimethyldithiocarbamate bromide
  1819. Platinum(II) dimethyldithiocarbamate chloride
  1820. Platinum(II) dimethyldithiocarbamate diethyldithiocarbamate
  1821. Platinum(II) methyl bis(diethyldithiocarbamate) chloride
  1822. Platinum(II) methyldimethyldithiocarbamate dibromide
  1823. Platinum(II) methyldimethyldithiocarbamate dichloride
  1824. Platinum(II) methyldimethyldithiocarbamate diethyldithiocarbamate chloride
  1825. Platinum(II) salicylaldehydeoxime chloride
  1826. Platinum(II) tetrakis(1-hexanamine) dibromide
  1827. Platinum(II) tetrakis(1-hexanamine) dichloride
  1828. Platinum(II) tris(1-hexanamine) dibromide
  1829. Platinum(II) tris(1-hexanamine) dichloride
  1830. Platinum(IV) bis(6-amino-5-nitrosopyrimidine-2,4-diol) antipyrine dichloride
  1831. Platinum(IV) bis(6-amino-5-nitrosopyrimidine-2,4-diol) dichloride
  1832. platinum(IV) chloride pentahydrate
  1833. plumbane
  1834. plumbylidyne
  1835. plutonium
  1836. plutonium alloy base Pu 99,Zr 1
  1837. plutonium carbide (PuC)
  1838. plutonium chloride (PuCl3)
  1839. plutonium fluoride ((242)PuF4)
  1840. plutonium fluoride (PuF3)
  1841. plutonium fluoride (PuF4)
  1842. plutonium nitride (PuN)
  1843. plutonium oxide (Pu2O3)
  1844. plutonium oxide (PuO)
  1845. plutonium oxide (PuO2)
  1846. plutonium telluride (PuTe)
  1847. plutonium(III) bromide
  1848. plutonium(IV) oxalate hexahydrate
  1849. plutonium(VI) fluoride
  1850. plutonyl fluoride
  1851. Plutonyl fluoride dihydrate
  1852. PMS-100
  1853. PMS-1000
  1854. PMS-200
  1855. PMS-400
  1856. PMS-476
  1857. PMS-50
  1858. PMS-700
  1859. POE85 lubricant oil
  1860. pollucite (Cs0.77Na0.14Rb0.04Al0.91Si2.08O6*0.34H2O)
  1861. pollucite (Cs0.84Na0.11Al0.88Si2.10O6*0.17H2O)
  1862. polonium
  1863. poly((1,3-diphenyl-1,3:1,3-disiloxanediylidene)-1,3-bis(oxy))
  1864. poly((8-amino-1,3,4,6,7,9,9b-heptaazaphenalene-2,5-diyl)imino)
  1865. poly((bis(4-methoxyphenyl)germylene)-1,3-butadiyne-1,4-diyl)
  1866. poly(1-heptene-1,7-diyl)
  1867. poly(1-phenylethylene)
  1868. poly(1-phenylethylene)
  1869. poly(1-vinylpyrrolidone-co-vinyl acetate)
  1870. poly(2,2'',3,3'',6,6''-hexaphenyl(1,1':4',1'':ar'',1'''-quaterphenyl)-ar,4'''-diyl)
  1871. Poly(butyl(4-ethylbenzyl)imidazolium chloride)
  1872. Poly(butylethylbenzyl)imidazolium bis(trifluoromethyl sulfonyl)imide)
  1873. Poly(butylethylbenzyl)imidazolium bromide)
  1874. poly(carbonate) bisphenol-A
  1875. poly(dimethylsiloxane)
  1876. poly(dimethylsiloxane)
  1877. poly(dimethylsiloxane)
  1878. poly(dimethylsiloxane)
  1879. poly(dimethylsiloxane)
  1880. poly(dimethylsiloxane)
  1881. poly(ethylene glycol) butyl ether
  1882. poly(ethylene glycol) diacrylate
  1883. poly(ethylene glycol) mono p-(1,1,3,3-tetramethylbutyl)-phenyl ether
  1884. poly(ethylene glycol) mono-4-octylphenyl ether
  1885. poly(ethylene oxide)-block-poly(propylene oxide)-block-poly(ethylene oxide)
  1886. poly(hexahydro-2H-azepin-2-one)
  1887. poly(nitrilo(bis(2,2,2-trifluoroethoxy)phosphoranylidyne))
  1888. poly(oxy(1,4-dioxo-1,4-butanediyl)oxy-1,4-butanediyl]
  1889. poly(oxy(methylsilylene))
  1890. poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl)
  1891. poly(oxy-1,4-phenylenesulfonyl-1,4-phenylene)
  1892. poly(oxycarbonylimino-1,5-pentanediyl)
  1893. poly(oxycarbonylimino-1,6-hexanediyl)
  1894. poly(tetramethylene oxide)
  1895. poly(vinyl alcohol)
  1896. poly(vinyl chloride)
  1897. Poly-α-olefin (PAO)
  1898. polyalkylene glycol
  1899. Polyalphaolefin 20
  1900. Polyalphaolefin 32
  1901. Polyalphaolefin 40
  1902. Polyalphaolefin 6
  1903. Polyaluminium chloride (PAC)
  1904. polycarbonates
  1905. polyester
  1906. polyethylene
  1907. polyethylene
  1908. polyethylene
  1909. polyethylene glycol 35
  1910. polyethylene glycol monooleyl ether
  1911. polymethyl siloxane
  1912. polyol ester
  1913. Polyol ester POE ISO 10
  1914. Polyol ester POE ISO 22
  1915. Polyoxymethylene dimethyl ether
  1916. polyphosphoric acid (H3O14P5) lanthanum(3+) salt (1:1)
  1917. polypropylene
  1918. poly[imino(1-oxo-1,11-undecanediyl)]
  1919. poly[oxy(1-oxo-1,6-hexanediyl)]
  1920. poly[oxy(ethylsilylene)]
  1921. poly[oxy-1,4-phenylenesulfonyl-1,4-phenyleneoxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene]
  1922. Pomalidomide
  1923. porfiromycin
  1924. Posaconazole
  1925. potassate (KO(1-))
  1926. potassium
  1927. potassium μ-chlorotetrachlorodiplumbate(1-)
  1928. potassium μ-oxodioxo(trioxovanadate)uranate(1-)
  1929. potassium (1R)-1,2,3,4,5,6-hexadydro-1,5-methano-8H-pyrido(1,2-a)(1,5)diazocin-8-onedithiocarbamate
  1930. potassium (OC-6-11)-hexachloroniobate(1-)
  1931. potassium (OC-6-11)-hexachloroniobate(2-)
  1932. potassium (OC-6-11)-hexachlorotantalate(1-)
  1933. potassium (OC-6-11)-hexafluoroantimonate(1-)
  1934. potassium (OC-6-11)-hexafluoroniobate(1-)
  1935. potassium (OC-6-11)-hexafluorotantalate(1-)
  1936. potassium (orthoarsenato(3-)-κO)dioxouranate(1-)
  1937. potassium (T-4)-rhenate (ReO4(1-))
  1938. potassium (T-4)-technetate (TcO4(1-))
  1939. potassium (T-4)-tetrachloroaluminate(1-)
  1940. potassium (T-4)-tetrafluoroaluminate(1-)
  1941. potassium (T-4)-tetrahydroaluminate(1-)
  1942. potassium (T-4)-trifluoromethoxyborate(1-)
  1943. Potassium 1-anthraquinonesulfonate
  1944. Potassium 2,2,6,6-tetramethyl-3,5-heptanedione
  1945. potassium 2,3,4,5,6-pentafluorophenolate
  1946. potassium 2,3,5,6-tetrachloro-2,5-cyclohexadiene-1,4-dione radical ion(1-)
  1947. Potassium 2-anthraquinonesulfonate
  1948. potassium 3-ethoxy-3-oxopropanoate
  1949. potassium 3-methoxy-3-oxopropanoate
  1950. Potassium 3-nitro-1,2,4-triazol-5-onate
  1951. potassium 4-hydroxybenzoate trihydrate
  1952. Potassium 4-hydroxybutan-1-olate
  1953. potassium 4-methylbenzenesulfonate
  1954. Potassium 5-chlor-anthraquinone-1-sulfonate
  1955. Potassium 6-chlor-anthraquinone-1-sulfonate
  1956. Potassium 7-chlor-anthraquinone-1-sulfonate
  1957. Potassium 8-chlor-anthraquinone-1-sulfonate
  1958. potassium acetate bis(acetic acid)
  1959. Potassium acetate dihydrate
  1960. potassium acetic acid acetate
  1961. potassium alloy base K 63,Cs 37
  1962. potassium alloy base K 63,Na 37
  1963. potassium alloy base K 77,Na 23
  1964. potassium alloy base K 78,Na 22
  1965. potassium alloy base K 87,Na 13
  1966. potassium aluminate (AlO2(1-))
  1967. potassium aluminate dihydrate
  1968. potassium aluminate trihydrate
  1969. potassium aluminium nitrate nonahydrate
  1970. Potassium aluminium selenate
  1971. potassium aluminium selenate dodecahydrate
  1972. potassium ammonium dimanganese sulfate
  1973. potassium ammonium paratungstate hexahydrate
  1974. potassium ammonium paratungstate undecahydrate
  1975. potassium ammonium trihydrogen orthoperiodate
  1976. Potassium anthraquinone-1,6-disulfonate
  1977. Potassium anthraquinone-1,7-disulfonate
  1978. Potassium anthraquinone-2,6-sulfonate
  1979. Potassium anthraquinone-2,7-sulfonate
  1980. Potassium antimony fluoride
  1981. potassium arsenate decahydrate
  1982. potassium arsenate heptahydrate
  1983. potassium arsenate monohydrate
  1984. potassium arsenate trihydrate
  1985. potassium azide (K(N3))
  1986. Potassium B-paratungstate
  1987. potassium benzoate dihydrate
  1988. potassium benzoate tetrahydrate
  1989. potassium biarsenate pentahydrate
  1990. Potassium bis(2-amino-1-butanol) imidazolate
  1991. Potassium bis(2-amino-2-methyl-1-propanol) imidazolate
  1992. potassium bis(cyano-C)argentate(1-)
  1993. potassium bis(diethyldithiocarbamodithioato-κS,κS')dioxouranate(1-)
  1994. Potassium bis(DL-1-amino-2-propanol) imidazolate
  1995. Potassium bis(monoethanolamine) imidazolate
  1996. potassium borate hydrogen peroxide
  1997. potassium bromide (KBr)
  1998. potassium bromide (KBr)
  1999. potassium bromide dodecahydrododecaborate
  2000. potassium bromide tetraammonia
  2001. potassium bromomethanedisulfonate
  2002. potassium bromomethanedisulfonate hydrate
  2003. potassium cadmium formate
  2004. potassium cadmium nitrite
  2005. potassium calcium nitrite dihydrate
  2006. potassium carbonate hexahydrate
  2007. Potassium carbonate hydrogencarbonate 1.5 hydrate
  2008. potassium carbonate pentahydrate
  2009. potassium carbonate sodium hydrogencarbonate dihydrate
  2010. potassium carbonate tetrahydrate
  2011. potassium cerium(IV) fluoride
  2012. potassium cesium dichromate
  2013. potassium chlorate triacontaperchlorate
  2014. potassium chloride (K2Cl2)
  2015. potassium chloride (KCl)
  2016. potassium chloride iodide
  2017. potassium chloride magnesium sulfate trihydrate (Kainit)
  2018. potassium chloride mono(selenium oxychloride)
  2019. potassium chloride monohydrate
  2020. potassium chloride tetrahydrate
  2021. potassium chlorohexafluorozirconate
  2022. potassium chloromethanedisulfonate
  2023. potassium chloromethanedisulfonate dihydrate
  2024. potassium chromium(+3) cation disulfate dodecahydrate
  2025. potassium cobalt acetate
  2026. potassium Copper heptaborate nonohydrate
  2027. potassium copper(I) chloride monohydrate
  2028. potassium copper(I) cyanide
  2029. potassium copper(II) bromide
  2030. potassium cyanide (K(CN))
  2031. Potassium D-gluconate
  2032. potassium deuteroxide di(deuterium oxide)
  2033. potassium di-meso-periodate
  2034. Potassium diantimony fluoride
  2035. potassium dibromoiodate(1-)
  2036. Potassium dicalcium sodium tetraniobate
  2037. Potassium dicesium lanthanum(III) hexachloride
  2038. potassium dichloroiodate(1-)
  2039. potassium dicopper(I) cyanide monohydrate
  2040. potassium dicopper(II) acetate di(acetic acid)
  2041. potassium dideuterium orthophosphate
  2042. potassium dideuterium orthophosphate bis(dipotassium deuterium orthophosphate) deuterium oxide
  2043. potassium dideuterium phosphate trideuterophosphoric acid
  2044. Potassium difluorobromoacetate
  2045. Potassium difluorochloroacetate
  2046. Potassium digadolinium(III) heptafluoride
  2047. Potassium dihydrogen arsenide
  2048. potassium dihydrogen phosphate orthophosphoric acid
  2049. Potassium dimagnesium(II) hexaboron(III) oxide
  2050. Potassium dinitramide
  2051. potassium dioxo(phosphato(3-)-κO)uranate(1-)
  2052. potassium dioxo(phosphato(3-)-κO)uranate(1-) trihydrate
  2053. Potassium dioxouranium phosphate hexahydrate
  2054. Potassium dirubidium lanthanum(III) hexachloride
  2055. Potassium disilicate
  2056. potassium disilver cyanide monohydrate
  2057. potassium dithorium triphosphate
  2058. potassium erbium(III) diphosphate
  2059. potassium erbium(III)formate monohydrate
  2060. potassium ethanesulfonate
  2061. potassium ethanethiolate
  2062. potassium fluoride (K(HF2))
  2063. potassium fluoride (KF)
  2064. potassium fluoride (KF) tetrahydrate
  2065. potassium fluoride 0.3-hydrate
  2066. Potassium fluoride acetic acid
  2067. potassium fluoride di(acetic acid)
  2068. potassium fluoride di(hydrogen fluoride)
  2069. potassium fluoride dihydrate
  2070. potassium fluoride hexafluorosilicate(2-) (3:1:1)
  2071. Potassium fluoride semi(acetic acid)
  2072. Potassium fluoride sulfate
  2073. potassium fluoride sulfate (K3F(SO4))
  2074. potassium fluoride tetra(hydrogen fluoride)
  2075. potassium fluoride tri(hydrogen fluoride)
  2076. potassium fluoride tris(hydrogen peroxide)
  2077. potassium formate 1.5-hydrate
  2078. potassium formate di(formic acid)
  2079. potassium formate tris(formic acid)
  2080. Potassium gadolinium(III) tetrafluoride
  2081. potassium gallium(III) disulfate dodecahydrate
  2082. potassium gold(I) cyanide
  2083. potassium hafnium fluoride monohydrate
  2084. Potassium heptafluorodiantimonate(III)
  2085. potassium heptaiodide monohydrate
  2086. Potassium hexafluoronickelate(IV)
  2087. Potassium hexafluorophosphate mono(formic acid)
  2088. potassium hexafluorophosphate monoacetic acid
  2089. Potassium hexafluorophosphate semi(formic acid)
  2090. potassium hexafluorophosphate(1-)
  2091. potassium hexahydroxoaluminate
  2092. potassium hexaiodotellurate(IV)
  2093. potassium hexaniobate decahydrate
  2094. potassium hexapermanganate tetrafluoroborate
  2095. potassium hydride (KH)
  2096. potassium hydrogen (orthosilicato(4-)-κO)dioxouranate(2-) monohydrate
  2097. potassium hydrogen pyrophosphate trihydrate
  2098. potassium hydrogen pyrosulfate
  2099. potassium hydrogen succinate tetrahydrate
  2100. potassium hydrogen sulfate mono(sulfuric acid) monohydrate
  2101. potassium hydrogen sulfate monohydrate
  2102. potassium hydroxide (K(OD))
  2103. potassium hydroxide (K(OH))
  2104. potassium hydroxide (K(OH)) dihydrate
  2105. potassium hydroxide (K(OH)) monohydrate
  2106. potassium hydroxide (K2(OH)2)
  2107. potassium hydroxide tetrahydrate
  2108. potassium indium disulfate dihydrate
  2109. potassium iodate di(iodic acid)
  2110. potassium iodic acid iodate
  2111. potassium iodide (K(I3))
  2112. potassium iodide (K(I7))
  2113. potassium iodide (KI)
  2114. potassium iodide bismuth triiodide
  2115. potassium iodide hexaammonia
  2116. potassium iodide mono(dimethylformamide)
  2117. potassium iodide tetraammonia
  2118. potassium iodide tris(dimethylformamide)
  2119. potassium ion (K(1+))
  2120. Potassium Iron Phosphate hexahydrate
  2121. potassium iron titanium oxide (K2Fe2Ti6O16)
  2122. potassium iron(II) chloride dihydrate
  2123. Potassium iron(III) sulfate tetrahydrate
  2124. Potassium isocyanate
  2125. potassium lanthanum(III) sulfate dihydrate
  2126. potassium lead(II) selenocyanate
  2127. potassium lithium hexafluorosilicate
  2128. Potassium lutetium molybdate
  2129. potassium magnesium bromide hexahydrate
  2130. potassium magnesium chloride dihydrate
  2131. potassium magnesium decavanadate hexadecahydrate
  2132. Potassium magnesium dihydrogen fluoride
  2133. potassium magnesium hydrogen carbonate tetrahydrate
  2134. Potassium magnesium hydrogen fluoride
  2135. potassium magnesium manganese neodymium oxide (K3Mg3Mn4NdO12)
  2136. potassium mandelate dimandelic acid
  2137. potassium mandelate monomandelic acid
  2138. potassium mandelate trimandelic acid
  2139. potassium manganese triformate
  2140. potassium manganese(II) sulfate hexahydrate
  2141. potassium mercury thiocyanate
  2142. potassium mercury(II) iodide
  2143. potassium mercury(II) iodide ethanol
  2144. potassium mercury(II) iodide monohydrate
  2145. potassium metaborate monohydrate
  2146. potassium metaborate monourea
  2147. potassium metaborate tetrahydrate
  2148. potassium metavanadate monohydrate
  2149. potassium metavanadate trihydrate
  2150. Potassium methanesulfonate
  2151. potassium methyl sulfate
  2152. potassium morpholinedithiocarbamate
  2153. potassium neodymium (III) chloride pentahydrate
  2154. potassium nickel chloride
  2155. potassium nickel fluoride monohydrate
  2156. potassium nickel formate
  2157. potassium nickel(+2) cation sulfate hexahydrate
  2158. potassium niobate(NbO3(1-))
  2159. potassium niobium uranium oxide (KNbUO6) hydrate (2:3)
  2160. Potassium niobium(V) tellurium hexaoxide
  2161. potassium nitrate * Dinitric acid
  2162. potassium nitrate * Nitric acid
  2163. potassium octacyanomolybdate(IV)
  2164. potassium orthophosphate hepta(deuterium oxide)
  2165. potassium orthophosphate metavanadate pentadecahydrate
  2166. potassium orthophosphate metavanadate undecahydrate
  2167. potassium orthophosphate sulfate nonahydrate
  2168. potassium orthophosphate sulfate pentadecahydrate
  2169. potassium orthophosphate sulfate undecahydrate
  2170. potassium orthophosphate tri(deuterium oxide)
  2171. potassium orthovanadate hexahydrate
  2172. potassium orthovanadate pentahydrate
  2173. potassium orthovanadate trihydrate
  2174. potassium oxalate monohydrogen peroxidate
  2175. potassium oxide (K2O)
  2176. potassium oxide (KO)
  2177. potassium oxide bis(boric oxide) tetrahydrate
  2178. potassium oxide penta(boric oxide) octahydrate
  2179. Potassium p-aminobenzoate
  2180. potassium paratungstate (5K2O*12WO3)
  2181. potassium paratungstate decahydrate (5K2O*12WO3*10H2O)
  2182. potassium paratungstate undecahydrate
  2183. potassium pentafluorozirconate monohydrate
  2184. potassium pentafluorozirconate(1-)
  2185. potassium perchlorate dimethylformamide
  2186. potassium perchlorate ditetrafluoroborate
  2187. potassium perchlorate octa(tetrafluoroborate)
  2188. potassium peroxide (K2(O2))
  2189. potassium phosphate octahydrate
  2190. Potassium phosphide
  2191. potassium platinocyanide dihydrate
  2192. potassium platinocyanide monohydrate
  2193. potassium platinocyanide pentahydrate
  2194. potassium platinocyanide trihydrate
  2195. Potassium pyrazine-2-carboxylate
  2196. potassium pyrophosphate dihydrate
  2197. potassium pyrophosphate trihydrate
  2198. potassium pyrovanadate tetrahydrate
  2199. potassium salicylate monohydrate
  2200. potassium samarium(3+) 2,2',2'',2'''-(ethane-1,2-diyldinitrilo)tetraacetate
  2201. potassium samarium(III) ethylenediamine tetraacetate octahydrate
  2202. potassium selenite tetrahydrate
  2203. potassium selenite tri(potassium hydrogenselenite)
  2204. Potassium silver nitrate
  2205. potassium silver thiocyanate
  2206. potassium sodium calcium thorium silicate
  2207. potassium sodium magnesium chromate heptahydrate
  2208. potassium sodium magnesium sulfate nitrate hexahydrate (Humberstonit)
  2209. potassium sodium nitrate
  2210. potassium sodium tartrate trihydrate
  2211. Potassium sodium thorium(IV) hexafluoride
  2212. potassium sulfate copper(II) chloride
  2213. potassium sulfate dizinc chloride pentahydrate
  2214. potassium sulfate hexa(hydrogen sulfate)
  2215. potassium sulfate hexa(hydrogen sulfate) monohydrate
  2216. potassium sulfate monohydrate
  2217. potassium sulfate pentahydrate
  2218. potassium sulfate phosphate (2:1:1)
  2219. potassium sulfate tetra(hydrogen sulfate) monohydrate
  2220. potassium sulfate tetrahydrate
  2221. potassium sulfate tri(hydrogen sulfate)
  2222. potassium sulfate tri(hydrogen sulfate) dihydrate
  2223. potassium sulfide (K2S)
  2224. potassium superoxide (K(O2))
  2225. potassium tantalate(TaO3(1-))
  2226. potassium telluride (K2(Te2))
  2227. potassium telluride (K2(Te3))
  2228. potassium telluride (K2Te)
  2229. potassium telluride (K5Te3)
  2230. potassium terbium molybdate phosphate
  2231. Potassium tetraarsenate
  2232. potassium tetraborate hexahydrate
  2233. potassium tetraborate octahydrate
  2234. potassium tetraborate pentahydrate
  2235. potassium tetrachloroiodate monohydrate
  2236. potassium tetrachloroiodate(1-)
  2237. potassium tetrachlorooxoniobate(1-)
  2238. potassium tetrachromate
  2239. potassium tetrafluoroborate(1-)
  2240. potassium tetrahydroborate monohydrate
  2241. potassium tetrahydroborate tetrahydrate
  2242. potassium tetrahydroborate trihydrate
  2243. potassium tetrahydroborate(1-)
  2244. Potassium tetrantimony fluoride
  2245. potassium tetraphenylborate(1-)
  2246. Potassium tetrasilicate
  2247. potassium tetrastrontium orthoborate
  2248. potassium thallium cyanide
  2249. potassium thiocyanate dimethylformamide
  2250. potassium thiocyanate monourea
  2251. potassium thulium tellurite
  2252. potassium titanium oxide (K2TiO3)
  2253. potassium titanium oxide phosphate (KTiO(PO4))
  2254. Potassium titanyl arsenate
  2255. potassium titanyl oxalate dihydrate
  2256. Potassium triarsenate
  2257. potassium triarsenate tetrahydrate
  2258. potassium tribromocadmate(1-)
  2259. potassium trichlorocadmate(1-)
  2260. potassium trichlorocalciate(1-)
  2261. potassium trichlorocuprate(1-)
  2262. potassium trichlorocuprate(1-) dihydrate
  2263. potassium trichloromagnesate(1-)
  2264. potassium trichloromagnesate(1-) dihydrate
  2265. potassium trichloromagnesate(1-) hexahydrate
  2266. potassium trichloroplumbate(1-) hydrate (3:1)
  2267. potassium trichromate
  2268. potassium trifluoroacetate mono(trifluoroacetic acid)
  2269. potassium trifluorocadmate(1-)
  2270. potassium trifluorocalciate(1-)
  2271. potassium trifluorocobaltate(1-)
  2272. potassium trifluoromanganate(1-)
  2273. potassium trifluoromethanesulfonate
  2274. potassium trifluoronickelate(1-)
  2275. potassium trifluorozincate(1-)
  2276. potassium trihydroxyfluorborate
  2277. potassium triiodide monohydrate
  2278. potassium tripolyphosphate dihydrate
  2279. potassium tris(nitrato-κO)dioxouranate(1-)
  2280. potassium tungsten oxide (K2W2O7)
  2281. potassium tungsten oxide (K2W3O10)
  2282. potassium tungsten uranium oxide (K2W2UO10)
  2283. Potassium undecanoate
  2284. potassium uranate (UO3(1-))
  2285. potassium uranium arsenate oxide (KU(AsO4)O2)
  2286. potassium uranium arsenate oxide (KU(AsO4)O2) hydrate (2:1)
  2287. potassium uranium arsenate oxide (KU(AsO4)O2) trihydrate
  2288. potassium uranium borate oxide (KU(BO3)O2)
  2289. potassium uranium borate oxide (KU(BO3)O2) monohydrate
  2290. potassium uranium oxide (K2U4O12)
  2291. potassium uranium oxide (K2U4O13)
  2292. Potassium uranoniobate
  2293. potassium uranyl molybdate
  2294. potassium vanadate (VO3(1-))
  2295. potassium ytterbium(3+) molybdate (MoO4(2-)) (1:1:2)
  2296. potassium ytterbium(III)nitrate dihydrate
  2297. potassium yttrium (III) formate monohydrate
  2298. Potassium yttrium(III) formate
  2299. Potassium yttrium(III) tetra(1,1,1-trifluoro-5,5,5-trimethylacetylacetonate)
  2300. potassium zinc chloride (K5Zn4Cl13)
  2301. potassium zinc chloride dihydrate
  2302. potassium zinc chloride monohydrate
  2303. Potassium zirconium sulfate dihydrate
  2304. Potassium(I) benzo-15-crown-5 thiocyanate
  2305. potassium; 2-hydroxy-2-oxoacetate; oxalic acid; dihydrate
  2306. potassium; hydrogen sulfate; sulfuric acid
  2307. Potasssium iron triiodide
  2308. Praesodymium(III) β-resorcylate
  2309. Praseodimium(III) chloride di(methylenediacetamide) dihydrate
  2310. praseodymium
  2311. praseodymium (III) bromate nonahydrate
  2312. praseodymium (III) fluorosulfide
  2313. praseodymium (III) nitrate trihydrate
  2314. praseodymium (III) orthovanadate
  2315. praseodymium (III) trichloroacetate trihydrate
  2316. Praseodymium acetate triurea
  2317. Praseodymium acetate triurea sesquihydrate
  2318. praseodymium bromid heptahydrate
  2319. praseodymium bromide (PrBr3)
  2320. Praseodymium calcium germanate
  2321. praseodymium carbide (Pr2C3)
  2322. praseodymium carbide (PrC2)
  2323. praseodymium cesium sulfate octahydrate
  2324. praseodymium chloride (PrCl3)
  2325. praseodymium chloride (PrCl3) comp. with L-alanine (1:3) trihydrate
  2326. praseodymium chloride (PrCl3) heptahydrate
  2327. praseodymium chloride (PrCl3) hexahydrate
  2328. praseodymium chloride oxide (PrClO)
  2329. Praseodymium di(8-methylquinolinium) nitrate dihydrate
  2330. praseodymium fluoride (PrF3)
  2331. Praseodymium hafnate
  2332. praseodymium hydride (PrH2)
  2333. praseodymium hydrogen diselenite
  2334. praseodymium hydrogen selenite
  2335. Praseodymium hydrogen uranosilicate
  2336. Praseodymium hydrogen uranosilicate decahydrate
  2337. praseodymium hydroxide (Pr(OH)3)
  2338. praseodymium iodide (PrI3)
  2339. Praseodymium nitrilotriacetate
  2340. Praseodymium nitrilotriacetate trihydrate
  2341. praseodymium oxide (Pr2O3)
  2342. praseodymium oxide (Pr6O11)
  2343. praseodymium pentapotassium sulfate monohydrate
  2344. Praseodymium perchlorate dithiourea decahydrate
  2345. praseodymium phosphide (PrP)
  2346. praseodymium pyrostannate
  2347. praseodymium rubidium sulfate octahydrate
  2348. praseodymium selenide
  2349. praseodymium selenide (Pr3Se4)
  2350. praseodymium selenite monohydrate
  2351. praseodymium silicide (Pr5Si3)
  2352. praseodymium silicide (Pr5Si4)
  2353. praseodymium sulfide (Pr2S3)
  2354. praseodymium sulfide (Pr2S3)
  2355. praseodymium sulfide (Pr3S4)
  2356. praseodymium sulfide (PrS)
  2357. praseodymium sulfide (PrS2)
  2358. praseodymium tellurium oxide (Pr2TeO6)
  2359. praseodymium tetra(triethylammonium) nitrate
  2360. praseodymium tetraboride
  2361. praseodymium tetrapotassium sulfate monohydrate
  2362. praseodymium trifluoroacetate tri(trifluoroacetic acid)
  2363. praseodymium triniobium nonaoxide
  2364. praseodymium tripotassium sulfate dihydrate
  2365. praseodymium(+3) cation phosphate
  2366. praseodymium(+3) cation trinitrate pentahydrate
  2367. praseodymium(3+) acetate (1:3) compd. with thiourea (1:1) monohydrate
  2368. praseodymium(3+) sodium 2,2',2'',2'''-(ethane-1,2-diyldinitrilo)tetraacetate
  2369. praseodymium(3+) vanadate (V6O17(4-)) (4:3)
  2370. praseodymium(3+) vanadate (VO3(1-)) (1:3)
  2371. praseodymium(III) arsenite trihydrate
  2372. Praseodymium(III) bis(1,10-phenanthroline 1-oxide) trichloride
  2373. praseodymium(III) chloride 4.5-hydrate
  2374. praseodymium(III) chloride dihydrate
  2375. praseodymium(III) chloride dipropanol
  2376. praseodymium(III) chloride hexaurea
  2377. praseodymium(III) chloride tetra(trimethylammoniumchloride)
  2378. praseodymium(III) chloride tetraurea
  2379. praseodymium(III) chloride tris(dimethylammoniumchloride)
  2380. praseodymium(III) chromate octahydrate
  2381. praseodymium(III) ethylsulfate
  2382. Praseodymium(III) histidine trinitrate monohydrate
  2383. praseodymium(III) metaborate hexahydrate
  2384. praseodymium(III) metavanadate tetrahydrate
  2385. praseodymium(III) nitrate ethylenediammonium nitrate tetrahydrate
  2386. praseodymium(III) nitrate hexahydrate
  2387. praseodymium(III) nitrate monohydrate
  2388. Praseodymium(III) nitrate tetracyclohexylammonium nitrate
  2389. praseodymium(III) nitrate tri(hydrazine dinitrate)
  2390. praseodymium(III) perchlorate heptahydrate
  2391. Praseodymium(III) perchlorate hexahydrate
  2392. Praseodymium(III) perchlorate hexaurea
  2393. Praseodymium(III) perchlorate nonahydrate
  2394. Praseodymium(III) perchlorate nonaurea
  2395. Praseodymium(III) perchlorate tetraurea
  2396. praseodymium(III) pyrophosphate tetracosahydrate
  2397. praseodymium(III) rubidium chloride pentahydrate
  2398. praseodymium(III) rubidium chloride tetrahydrate
  2399. praseodymium(III) selenate dodecahydrate
  2400. praseodymium(III) selenate monohydrate
  2401. praseodymium(III) selenate pentahydrate
  2402. praseodymium(III) sulfate hexahydrate
  2403. praseodymium(III) sulfate hexaurea
  2404. praseodymium(III) sulfate octahydrate
  2405. praseodymium(III) sulfate pentahydrate
  2406. praseodymium(III) sulfosalicylate heptahydrate
  2407. Praseodymium(III) tetrakis(5,6-benzoquinoline) trinitrate
  2408. Praseodymium(III) triindium(I)
  2409. Praseodymium(III) triisothiocyanate tris(2,6-Dimethylpicoline-N-oxide)
  2410. Praseodymium(III) trilead
  2411. Praseodymium(III) tripotassium hexabromide
  2412. Praseodymium(III) triquinolinium nitrate monohydrate
  2413. Praseodymium(III) tris(1,4-thioxane-S-oxide trifluoroacetate)
  2414. Praseodymium(III) tris(2,6-dichlorobenzoic acid)
  2415. Praseodymium(III) tris(3-Methoxybenzoate)
  2416. Praseodymium(III) tris(3-nitro-1,2,4-triazol-5-onate)
  2417. Praseodymium(III) tris(3-nitro-1,2,4-triazol-5-onate) heptahydrate
  2418. Praseodymium(III) tris(indole-3-acetate)
  2419. Praseodymium(III) tris(N-phenylbenzohydroxamate)
  2420. Praseodymium(III) tris(salicylate)
  2421. Praseodymium(III) tris(salicylidene-β-alanine)
  2422. Praseodymium(III) trithallium(I)
  2423. Praseodymium(III) trithiocyanate heptahydrate
  2424. Praseodymium(III) tritin
  2425. Praseodymium(III)-2,5-dihydroxybenzoate
  2426. praseodymium(III)iodide nonahydrate
  2427. praseodymium(III)iodide pentaurea
  2428. Praseodymium(III)trifluoromethanesulphonate octa(4-picoline-N-oxide)
  2429. Praseodymium(IV) tetrakis(hydrogen-3-nitro-1,2,4-triazol-5-onate hydrate) dihydrate
  2430. Praseodymium(IV) tetrakis(hydrogen-3-nitro-1,2,4-triazol-5-onate)
  2431. Prazepam
  2432. prazosin
  2433. precirol Ato5
  2434. pregabalin
  2435. pregn-4-ene-3,20-dione
  2436. Pregnenolone acetate
  2437. Primene JM-T
  2438. Proline, 1-(N-(trifluoroacetyl)-1-leucyl)methyl ester
  2439. promethium fluoride (PmF3)
  2440. promethium sulfide (Pm2S3)
  2441. Prop-2-enyl (2,4,5-trichlorophenyl) carbonate
  2442. Prop-2-enyl 2-benzyl-4-chlorophenyl carbonate
  2443. Prop-2-enyl 2-prop-2-enoxycarbonyloxypropanoate
  2444. prop-2-enyl 3,5-dinitrobenzoate
  2445. prop-2-enyl N-naphthalen-1-ylcarbamate
  2446. prop-2-enyl nitrate
  2447. Prop-2-enyl quinolin-8-yl carbonate
  2448. prop-2-ynoic acid (1-methylethylidene)di-4,1-phenylene ester
  2449. prop-2-ynoic acid 1,4-phenylene ester
  2450. prop-2-ynoic acid 1,5-naphthalenediyl ester
  2451. prop-2-ynoic acid 1,7-naphthalenediyl ester
  2452. prop-2-ynoic acid 2,7-naphthalenediyl ester
  2453. prop-2-ynoic acid oxydi-4,1-phenylene ester
  2454. prop-2-ynoic acid sulfonyldi-4,1-phenylene ester
  2455. prop-2-ynoic acid thiodi-4,1-phenylene ester
  2456. prop-2-ynoic acid [1,1'-biphenyl]-4,4'-diyl ester
  2457. prop-2-ynoic acid [2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]di-4,1-phenylene ester
  2458. Prop-2-ynoxybenzene
  2459. prop-2-ynyl (2E,4E)-3,7,11-trimethyldodeca-2,4-dienoate
  2460. Prop-2-ynylbenzene
  2461. Propacetamol hydrochloride
  2462. propafenone Hydrochloride
  2463. Propan-2-yl (2S)-2-hydroxy-2-phenylacetate
  2464. propan-2-yl 2,2-dimethylpropanoate
  2465. Propan-2-yl 2-acetoxypropanoate
  2466. propan-2-yl 3,5-dinitrobenzoate
  2467. Propan-2-ylboronic acid
  2468. Propan-2-ylidenecyclopentane
  2469. propanal
  2470. propanal dipropylhydrazone
  2471. propanal oxime
  2472. propanal propylhydrazone
  2473. propanamide
  2474. Propanaminium p-toluenesulfonate
  2475. propane
  2476. propane hydrate
  2477. propane(dithioic) acid ethyl ester
  2478. Propane-1,1,3,3-tetracarboxylic acid tetraethyl ester
  2479. Propane-1,2,3-trithiol
  2480. Propane-1,3-diyl bis(2-ethylhexanoate)
  2481. Propane-2-methyl-1,1,3,3-tetracarboxylic acid tetraethyl ester
  2482. Propane-2-phenyl-1,1,3,3-tetracarboxylic acid tetraethyl ester
  2483. Propane-d8
  2484. propanediamide
  2485. propanedinitrile
  2486. propanedioate; tris(2-hydroxyethyl)azanium
  2487. propanedioic acid
  2488. propanedioic acid barium salt
  2489. propanedioic acid bis(1,1-dimethylethyl) ester
  2490. propanedioic acid bis(1-methylethyl) ester
  2491. propanedioic acid bis(2-methylbutyl) ester
  2492. propanedioic acid calcium salt
  2493. propanedioic acid dibutyl ester
  2494. propanedioic acid dicyclohexyl ester
  2495. propanedioic acid didecyl ester
  2496. propanedioic acid didodecyl ester
  2497. propanedioic acid diethyl ester
  2498. propanedioic acid diheptadecyl ester
  2499. propanedioic acid dihexadecyl ester
  2500. propanedioic acid dihydrazide
  2501. propanedioic acid dimethyl ester
  2502. propanedioic acid dioctadecyl ester
  2503. propanedioic acid dipentadecyl ester
  2504. propanedioic acid dipentyl ester
  2505. propanedioic acid dipotassium salt
  2506. propanedioic acid dipropyl ester
  2507. propanedioic acid ditetradecyl ester
  2508. propanedioic acid ditridecyl ester
  2509. propanedioic acid ethyl hexadecyl ester
  2510. Propanedioic acid monoethyl ester
  2511. propanedioic acid monopotassium salt
  2512. propanedioic acid monosodium salt
  2513. propanedioic acid strontium salt (1:1)
  2514. propanedioic-d2 acid-d2
  2515. propanediol
  2516. propanedioyl dichloride
  2517. Propanehydrazide
  2518. Propanehydrazide hydrogen chloride
  2519. propanenitrile
  2520. propaneperoxoic acid
  2521. Propanesulfonic acid propyl ester
  2522. propanesulfonic acid trimethylsilyl ester
  2523. propanethioic acid O-ethyl ester
  2524. propanethioic acid S-trifluoromethyl ester
  2525. propanoic acid
  2526. propanoic acid (2-propenyl)cyclohexyl ester
  2527. propanoic acid 1,1-dimethylethyl ester
  2528. propanoic acid 1-methyldecyl ester
  2529. propanoic acid 1-methylethyl ester
  2530. propanoic acid 1-methylhexyl ester
  2531. propanoic acid 1-methylpentyl ester
  2532. propanoic acid 1-methylpropyl ester
  2533. propanoic acid 1-methylpropyl ester
  2534. Propanoic acid 1-phenylvinyl ester
  2535. propanoic acid 2-(1-oxopropyl)hydrazide
  2536. propanoic acid 2-butyne-1,4-diyl ester
  2537. propanoic acid 2-methylpropyl ester
  2538. propanoic acid 2-propenyl ester
  2539. propanoic acid 3,3-dimethylbutyl ester
  2540. propanoic acid 3,3-dimethylpentyl ester
  2541. propanoic acid 3-chloropropenyl ester
  2542. propanoic acid ammonium salt
  2543. propanoic acid anhydride
  2544. propanoic acid barium salt
  2545. propanoic acid barium salt monohydrate
  2546. propanoic acid butyl ester
  2547. propanoic acid cadmium salt
  2548. propanoic acid calcium salt
  2549. propanoic acid cerium(3+) salt
  2550. propanoic acid cesium salt
  2551. propanoic acid compd. with formamide (1:1)
  2552. propanoic acid compd. with formamide (1:2)
  2553. propanoic acid cyclohexyl ester
  2554. propanoic acid d-1-methylheptyl ester
  2555. propanoic acid erbium(3+) salt
  2556. propanoic acid ethenyl ester
  2557. propanoic acid ethyl ester
  2558. propanoic acid gadolinium(3+) salt
  2559. propanoic acid heptyl ester
  2560. propanoic acid hexyl ester
  2561. propanoic acid lanthanum(3+) salt
  2562. propanoic acid lead(2+) salt
  2563. propanoic acid lithium salt
  2564. propanoic acid magnesium salt
  2565. propanoic acid methyl ester
  2566. propanoic acid neodymium(3+) salt
  2567. propanoic acid nonyl ester
  2568. propanoic acid octyl ester
  2569. propanoic acid pentyl ester
  2570. propanoic acid phenyl ester
  2571. propanoic acid phenylmethyl ester
  2572. propanoic acid potassium salt
  2573. propanoic acid praseodymium(3+) salt
  2574. propanoic acid propyl ester
  2575. propanoic acid rubidium salt
  2576. propanoic acid samarium(3+) salt
  2577. propanoic acid silver(1+) salt
  2578. propanoic acid sodium salt
  2579. propanoic acid thallium(1+) salt
  2580. propanoic acid triethylsilyl ester
  2581. propanoic acid trimethylsilyl ester
  2582. propanoic acid tripropylsilyl ester
  2583. propanoic acid, 2,3-dichloro-
  2584. Propanoic acid, 3,3-dimethylhex-1-en-2-yl ester
  2585. Propanoic acid, 3-ethyl-3-methylpent-1-en-2-yl ester
  2586. propanoic acid, 4-[(4-methoxyphenyl)iminomethyl]phenyl ester
  2587. propanoic-3,3,3-d3 acid methyl ester
  2588. propanoyl bromide
  2589. propanoyl chloride
  2590. propanoyl fluoride
  2591. propanoyl iodide
  2592. Propenyl-δ'-cyclohexenyl-ethynylcarbinol
  2593. Propenyl-δ'-cyclohexenylcarbinol
  2594. Propenyl-isopropenyl-ethynylcarbinol
  2595. Propenyl-isopropenyl-vinylethynylcarbinol
  2596. Propenylisopropenylcarbinol
  2597. propionatepentaamminecobalt(III) bromide
  2598. propionatepentaamminecobalt(III) chloride
  2599. propionatepentaamminecobalt(III) iodide
  2600. propionatepentaamminecobalt(III) nitrate
  2601. propionic acid, p-[(p-butoxybenzylidene)amino]phenyl ester
  2602. propionic acid, p-[(p-ethoxybenzylidene)amino]phenyl ester
  2603. propionic acid, p-[(p-methoxybenzylidene)amino]phenyl ester
  2604. propionic acid, p-[(p-pentoxybenzylidene)amino]phenyl ester
  2605. propionic acid, p-[(p-propoxybenzylidene)amino]phenyl ester
  2606. Propoxy acetamide
  2607. propoxybenzene
  2608. propoxydiethylaluminum dimer
  2609. Propoxymethylbenzene
  2610. propoxypropanol
  2611. propoxypyrazine
  2612. Propyl (2S)-2-hydroxy-2-phenylacetate
  2613. propyl (E)-3-(phenoxy)prop-2-enoate
  2614. Propyl 1,8-dimethylnaphthalene-4-carboxylate
  2615. Propyl 2-benzyl-4-chlorophenyl carbonate
  2616. Propyl 2-propoxycarbonyloxypropanoate
  2617. Propyl 3,5-dinitrobenzoate
  2618. propyl 3-chloropropanoate
  2619. Propyl 5-benzoyl-2-(methoxycarbonylamino)benzimidazole-1-carboxylate
  2620. Propyl 6-benzoyl-2-(methoxycarbonylamino)benzimidazole-1-carboxylate
  2621. propyl hydroperoxide
  2622. propyl N-carbamoylcarbamate
  2623. propyl N-propylcarbamate
  2624. Propyl quinolin-8-yl carbonate
  2625. propyl(1-methoxybutyl)propanedioic acid diethyl ester
  2626. propyl(nitrato-κO)mercury
  2627. propyl-2-propynylcarbamothioic acid S-ethyl ester
  2628. Propyl-cyclohexyl-ethylcarbinol
  2629. Propyl-isobutyl-β-methoxyethylcarbinol
  2630. Propyl-isopropyl-butylcarbinol
  2631. propyl-tris-pentafluorobutanoyloxy-silane
  2632. propyl-tris-pentafluoropropanoyloxy-silane
  2633. propylammonium formate
  2634. Propylammonium hydrogen sulphate
  2635. propylarsonous dichloride
  2636. propylbenzene
  2637. propylbenzenesulfonic acid sodium salt
  2638. Propylboronic acid
  2639. Propylboronic acid diethanolamine ester
  2640. propylcyclohexane
  2641. Propylcyclohexylcarbinol
  2642. propylcyclopentane
  2643. Propyldiammonium iron(II) tetrachloride
  2644. Propyldiborane
  2645. Propyldithiopyrylmethane
  2646. propylferrocene
  2647. propylidenecyclopentane
  2648. propylimidazolium DL-lactate
  2649. propylimidazolium L-lactate
  2650. propylmercury hydroxide
  2651. propylphosphonic acid dibutyl ester
  2652. propylphosphonic acid diethyl ester
  2653. propylphosphonic acid dipropyl ester
  2654. propylphosphonic dichloride
  2655. propylphosphonous dichloride
  2656. propylpropanedioic acid
  2657. propylpropanedioic acid dibutyl ester
  2658. propylpropanedioic acid diethyl ester
  2659. propylpropanedioic acid dimethyl ester
  2660. propylpropanedioic acid dipropyl ester
  2661. propylselenophosphonic acid diethyl ester
  2662. propylselenophosphonic acid dipropyl ester
  2663. propylsilane
  2664. propylthiophosphonic acid diethyl ester
  2665. propylthiophosphonic acid dipropyl ester
  2666. propylurea
  2667. protactinium iodide (PaI5)
  2668. Protopine
  2669. proustite (Ag3(AsS3))
  2670. pseudo malachite
  2671. pseudowollastonite (Ca(SiO3))
  2672. Ptassium magnesium trihydrogen
  2673. Pterostilbene
  2674. PVE68
  2675. pyran
  2676. pyranthrene
  2677. pyrazinamine
  2678. pyrazine
  2679. Pyrazine-2,3-dicarboxylic acid
  2680. pyrazinecarbonitrile
  2681. pyrazinecarboxamide
  2682. pyrazinecarboxylic acid
  2683. pyrazinecarboxylic acid ethyl ester
  2684. pyrazinecarboxylic acid methyl ester
  2685. pyrene
  2686. pyrene, 1-methyl-
  2687. Pyrethrine I semicarbazone
  2688. Pyrethrolone
  2689. Pyrethrolone acetate
  2690. pyridazine
  2691. pyridin tetrahydrochloride
  2692. Pyridin-1-ium formate
  2693. Pyridin-1-ium propanoate
  2694. pyridine
  2695. pyridine 1-oxide
  2696. pyridine acetate
  2697. Pyridine borane
  2698. pyridine compd. with 2,4,6-trinitrophenol (1:1)
  2699. pyridine compd. with silicon chloride (SiCl4) (2:1)
  2700. pyridine compd. with sulfur dioxide (1:1)
  2701. pyridine hydrobromide
  2702. pyridine hydrobromide compd. with thiourea (1:2)
  2703. pyridine hydrochloride
  2704. pyridine nitrate
  2705. pyridine perchlorate
  2706. pyridine sulfate (1:1)
  2707. pyridine-2,3-dicarboxylic acid
  2708. Pyridine-3,4-dicarboxylic acid
  2709. pyridine-3-carboxylic acid benzylidenehydrazide
  2710. pyridine-3-carboxylic acid N-oxide
  2711. pyridine-d5
  2712. pyridinium 1-cyano-2-ethoxy-2-oxoethylide
  2713. pyridinium 2-ethoxy-1-(ethoxycarbonyl)-2-oxoethylide
  2714. Pyridinium dibromoiodide
  2715. pyridinium dicyanomethylide
  2716. pyridinium ethoxyethylsulfate
  2717. pyridinium pentafluorotellurate
  2718. Pyridinium pentafluorotellurate(IV)
  2719. Pyrido(2,3-f)(1,7)phenanthroline
  2720. Pyrido(3,2-f)(1,7)phenanthroline
  2721. Pyridoxal-5-phosphate monohydrate
  2722. Pyrimethamine
  2723. pyrimethanil butanedioic salt
  2724. Pyrimethanil fumaric salt
  2725. Pyrimethanil maleic salt
  2726. pyrimethanil phenoxyacetate
  2727. pyrimidin-5-amine
  2728. pyrimidine
  2729. pyrimidine-2,5-diamine
  2730. pyrimidine-2-carbonitrile
  2731. pyrite (FeS2)
  2732. Pyrope
  2733. pyrosulfuryl fluoride isocyanate
  2734. pyroxene-group minerals
  2735. pyrrolidine
  2736. pyrrolidine acetate
  2737. pyrrolidine heptanoate
  2738. pyrrolidine hexanoate
  2739. pyrrolidine hydrochloride
  2740. pyrrolidine nonanoate
  2741. pyrrolidine octanoate
  2742. pyrrolidine trifluoroacetate
  2743. Pyrrolidine-1-carbonyl chloride
  2744. pyrrolidinium formate
  2745. Pyrrolidinium heptafluorobutyrate
  2746. pyrrolidinium hydrogen sulfate
  2747. pyrrolidinium nitrate
  2748. Pyrrolidonium bisulfate
  2749. Pyruvaldehyde N-aminophthalimide dihydrazone
  2750. quartz (SiO2)
  2751. quaternary ammonium compounds, tri-C8-10-alkylmethyl, chlorides
  2752. Quetiapine fumarate
  2753. quinazoline
  2754. quinolin-8-yl acetate
  2755. quinoline
  2756. quinoline 1-oxide
  2757. quinoline compd. with hexafluorobenzene (1:1)
  2758. quinoline formate
  2759. quinoline hydrochloride
  2760. quinoline nitrate
  2761. quinoline perchlorate
  2762. quinoline phosphate (1:1)
  2763. quinoline salt with chromic acid (H2CrO4) (1:1)
  2764. quinoline-2,4-dicarboxylic acid
  2765. Quinoline-2-carboxylic acid
  2766. quinoline-8-sulfonamide
  2767. quinoline-8-sulfonic acid anilide
  2768. Quinoline-N-oxide hydrate
  2769. quinolinium dipraseodymium(III) chloride trihydrate
  2770. quinoxaline
  2771. Quinoxaline-2-carboxylic acid
  2772. Quizalofop-p-ethyl
  2773. R-(+)-Binol
  2774. R-(+)-menthofuran
  2775. R-(2-(2,2,4,6-tetramethyl-1-piperidinyl)ethyl)-R-phenyl-2-pyridineacetamide
  2776. R-(2-(4-methyl-1-piperidinyl)ethyl)-R-phenyl-2-pridineacetamide
  2777. R-(2-(bis(1-methylethyl)amino)ethyl)-N-cyclohexyl-R-phenyl-2-pyridineacetamide
  2778. R-(2-(bis(1-methylethyl)amino)ethyl)-R-(3,4-dimethoxyphenyl)-2-pyridineacetamide
  2779. R-(2-(bis(1-methylethyl)amino)ethyl)-R-(3-methylphenyl)-2-pyridineacetamide
  2780. R-(2-(bis(1-methylethyl)amino)ethyl)-R-(4-chlorophenyl)-2-pyridineacetamide
  2781. R-(2-(bis(1-methylethyl)amino)ethyl)-R-(4-fluorophenyl)-2-pyridineacetamide
  2782. R-(2-(bis(1-methylethyl)amino)ethyl)-R-(4-methylphenyl)-2-pyridineacetamide
  2783. R-(2-(bis(1-methylethyl)amino)ethyl)-R-phenyl-1-naphthaleneacetamide
  2784. R-(2-(bis(1-methylethyl)amino)ethyl)-R-phenyl-2-pyridineacetic acid (1-methylethylidene)hydrazide
  2785. R-(2-(bis(1-methylethyl)amino)ethyl)-R-phenyl-3-pyridineacetamide
  2786. R-(2-(bis(1-methylethyl)amino)ethyl)-R-phenyl-4-pyridineacetamide
  2787. R-(2-(bis(1-methylethyl)amino)ethyl)-R-phenyl-N-2-pyridinyl-2-pyridineacetamide
  2788. R-(2-(bis(2-propenyl)amino)ethyl)-R-phenyl-2-pyridineacetamide
  2789. R-(2-(dimethylamino)ethyl)-R-phenyl-2-pyridineacetamide
  2790. R-(2-(dipropylamino)ethyl)-R-phenyl-2-pyridineacetamide
  2791. R-(2-(methyl(phenylmethyl)amino)ethyl)-R-phenyl-2-pyridineacetamide
  2792. R-phenyl-R-2-pyridinyl-3-azabicyclo[3.2.2]nonane-3-butanamide
  2793. R-phenyl-R-2-pyridinyl-3-azabicyclo[3.2.2]nonane-3-pentanamide
  2794. R-phenyl-R-2-pyridinyl-4-morpholinebutanamide
  2795. R-phenyl-R-2-pyridinyl-7-azabicyclo[2.2.1]heptane-7-butanamide
  2796. rabbeth spindle oil
  2797. rac-(1R,2R,5R,6R)-1,2,5,6-Tetrabromocyclooctane
  2798. racemic-2,3-Di-tert-butylsuccinic anhydride
  2799. racemic-2,3-Diethylsuccinonitrile
  2800. racemic-2-Octyl nitrate
  2801. racemic-3,4-Diphenylhexane-2,5-dione
  2802. racemic-Desmotroposantonin
  2803. radium bromide (RaBr2)
  2804. radium chloride (RaCl2)
  2805. radon
  2806. ramol 350
  2807. rape oil
  2808. rape oil
  2809. rape oil Me ester
  2810. rapeseed oil biodiesel
  2811. Rat fat
  2812. Rebaudioside A
  2813. red oil
  2814. Refined grape seed oil
  2815. refined sunflower oil
  2816. Regorafenib
  2817. rel-((1R)-1-((1R)-1-methylpropoxy)ethyl)benzene
  2818. rel-((1R)-1-((1S)-1-methylpropoxy)ethyl)benzene
  2819. rel-1,1'-((1R,2R)-1,2-dimethyl-1,2-ethanediyl)bisbenzene
  2820. rel-1,1'-((1R,2S)-1,2-dimethyl-1,2-ethanediyl)bisbenzene
  2821. rel-1-((2R)-1-methyl-2-pyrrolidinyl)-3-((2S)-1-methyl-2-pyrrolidinyl)-2-propanone
  2822. rel-2,2-dichloro-N-((1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl)acetamide
  2823. reserpine
  2824. reservoir Fluid
  2825. Resorcinol bis(cyclic 2,2-dimethyl-1,3-propanediol phosphate)
  2826. retinol
  2827. retinol acetate
  2828. retinol hexadecanoate
  2829. Retrorsine
  2830. rhenium
  2831. rhenium chloride (ReCl3)
  2832. rhenium chloride (ReCl5)
  2833. rhenium chloride oxide (ReCl4O)
  2834. rhenium fluoride (ReF4)
  2835. rhenium fluoride (ReF5)
  2836. rhenium fluoride oxide (ReF4O)
  2837. rhenium iodide (ReI3)
  2838. rhenium oxide (Re2O7)
  2839. rhenium silicide (ReSi2)
  2840. rhenium sulfide (ReS2)
  2841. rhenium tribromide
  2842. rhodium
  2843. Rhodium (IV) oxide
  2844. Rhodium antimony
  2845. rhodium chloride (RhCl3)
  2846. rhodium fluoride (RhF3)
  2847. Rhodium triantimony
  2848. Rhodium uranoniobate
  2849. Rhodium(III) 3-dimethylaminomethyl indole bis(salicylaldehydeoxime) chloride
  2850. Rhodium(III) bis(salicylaldehydeoxime) chloride
  2851. Rhodium(III) bis(triethanolamine) trichloride
  2852. Rhodium(III) tris(N-methylcyclohexyl dithiocarbamate)
  2853. ribaric acid
  2854. Ribavirin
  2855. ribitol
  2856. riboflavine
  2857. rice bran oil ethyl ester
  2858. rice wax
  2859. Ricebran biodiesel
  2860. rifampicin
  2861. rifamycin SV
  2862. Riluzole
  2863. Rimantadine hydrochloride
  2864. rivaroxaban
  2865. RL 32H lubricant oil
  2866. RL 68H lubricant oil
  2867. Rock
  2868. Rocket Propellant 1
  2869. Roflumilast
  2870. Rosin amine D acetate
  2871. RP 2
  2872. RP-5 jet fuel
  2873. rubber
  2874. rubber
  2875. Rubidate
  2876. rubidium
  2877. rubidium μ-oxodioxo(trioxovanadate)uranate(1-)
  2878. rubidium (orthoarsenato(3-)-κO)dioxouranate(1-)
  2879. rubidium (orthoarsenato(3-)-κO)oxotitanate(1-)
  2880. rubidium (T-4)-rhenate (ReO4(1-))
  2881. rubidium (T-4)-tetrahydroaluminate(1-)
  2882. Rubidium 2-hydroxyethanolate
  2883. rubidium 3-hydroxybenzoate monohydrate
  2884. rubidium 4-hydroxybenzoate monohydrate
  2885. Rubidium aluminium selenate
  2886. rubidium aluminium selenate dodecahydrate
  2887. rubidium aluminium sulfate dodecahydrate
  2888. rubidium antimonate (O3Sb(1-))
  2889. rubidium antimony (III) chloride monohydrate
  2890. Rubidium antimony fluoride
  2891. rubidium azide (Rb(N3))
  2892. rubidium bis(diethyldithiocarbamodithioato-κS,κS')dioxouranate(1-)
  2893. rubidium borate (BO2(1-))
  2894. rubidium bromide (RbBr)
  2895. rubidium bromochlorobromate(1-)
  2896. rubidium bromochloroiodate(1-)
  2897. rubidium bromoiodochloride monohydrate
  2898. rubidium cadmium fluoride
  2899. Rubidium calcium chloride
  2900. Rubidium calcium fluoride
  2901. rubidium carbonate dihydrate
  2902. rubidium carbonate hexa(hydrogen peroxide)
  2903. rubidium carbonate nonahydrate
  2904. rubidium carbonate octahydrate
  2905. rubidium carbonate tetrahydrate
  2906. rubidium carbonate tri(hydrogen peroxide)
  2907. Rubidium cerium oxide
  2908. rubidium chloride (RbCl)
  2909. rubidium chloride mono(selenium oxychloride)
  2910. rubidium chloromethanedisulfonate
  2911. rubidium chromium chloride
  2912. rubidium chromium(III) sulfate dodecahydrate
  2913. rubidium cobalt chloride dihydrate
  2914. rubidium cobalt fluoride monohydrate
  2915. rubidium cyanide (Rb(CN))
  2916. Rubidium diantimony fluoride
  2917. rubidium dibarium nitrite
  2918. rubidium diberyllium fluoride
  2919. rubidium dibromoiodate(1-)
  2920. Rubidium dicadmium pentachloride monohydrate
  2921. Rubidium dicesium lanthanum(III) hexachloride
  2922. rubidium dichloroiodate(1-)
  2923. Rubidium difluoro vanadium(IV) oxide monohydrate
  2924. rubidium dilithium chloride tetrahydrate
  2925. rubidium dimagnesium sulfate
  2926. rubidium dioxo(phosphato(3-)-κO)uranate(1-)
  2927. Rubidium dioxouranium phosphate trihydrate
  2928. Rubidium ditellurium(IV) oxide
  2929. rubidium fluoride (Rb(HF2))
  2930. rubidium fluoride (RbF)
  2931. rubidium fluoride (RbF) hydrate (2:3)
  2932. Rubidium fluoride bis(bromine trifluoride)
  2933. rubidium fluoride bis(hydrogen fluoride)
  2934. Rubidium fluoride di(acetic acid)
  2935. rubidium fluoride dihydrate
  2936. Rubidium fluoride mono(acetic acid)
  2937. Rubidium fluoride mono(bromine trifluoride)
  2938. rubidium fluoride tetrahydrate
  2939. rubidium fluoride trihydrate
  2940. rubidium fluoride tris(hydrogen fluoride)
  2941. rubidium formate monohydrate
  2942. rubidium gadolinium(III) chloride tetrahydrate
  2943. rubidium gallium(III) fluoride dihydrate
  2944. rubidium hafnium fluoride monohydrate
  2945. rubidium hexachloro titanate
  2946. rubidium hexafluoroarsenate
  2947. rubidium hexaiodotellurate(IV)
  2948. rubidium hydride (RbH)
  2949. rubidium hydrogen (orthosilicato(4-)-κO)dioxouranate(2-) monohydrate
  2950. rubidium hydrogen oxalate
  2951. rubidium hydrogen sulfate monosulfuric acid
  2952. rubidium hydrogen sulfate trisulfuric acid
  2953. Rubidium hydrogen uranosilicate monohydrate
  2954. rubidium hydrogenselenite
  2955. rubidium hydrogenselenite monoselenious acid
  2956. rubidium hydroxide (Rb(OH))
  2957. rubidium hydroxide (Rb(OH))
  2958. rubidium hydroxide 1/3 hydrate
  2959. rubidium hydroxide monohydrate
  2960. rubidium hydroxide tetrahydrate
  2961. rubidium hydroxide trihydrate
  2962. rubidium indium disulfate trihydrate
  2963. rubidium indium pyrophosphate tetrahydrate
  2964. rubidium indium(III) fluoride dihydrate
  2965. Rubidium indium(III) selenate tetrahydrate
  2966. rubidium iodate bis iodic acid
  2967. rubidium iodide (Rb(I3))
  2968. rubidium iodide (RbI)
  2969. rubidium iodide hexaammonia
  2970. rubidium ion (Rb(1+))
  2971. rubidium iron(II) sulfate hexahydrate
  2972. rubidium lanthanum(III) chloride pentahydrate
  2973. rubidium lanthanum(III) chloride tetrahydrate
  2974. rubidium lithium hexafluorosilicate
  2975. rubidium magnesium bromide
  2976. rubidium magnesium chloride
  2977. rubidium magnesium chloride hexahydrate
  2978. rubidium magnesium nitrite trihydrate
  2979. rubidium magnesium sulfate hexahydrate
  2980. rubidium magnesium sulfate tetrahydrate
  2981. Rubidium mandelate
  2982. Rubidium mandelate monomandelic acid
  2983. Rubidium mandelate trimandelic acid
  2984. rubidium manganese bromide hexahydrate
  2985. rubidium mercury(II)chloride monohydrate
  2986. rubidium methanedisulfonate
  2987. rubidium nickel bromide hexahydrate
  2988. rubidium nickel chloride dihydrate
  2989. rubidium nickel fluoride monohydrate
  2990. rubidium niobate(NbO3(1-))
  2991. rubidium nitrate * Dinitric acid
  2992. rubidium nitrate * Nitric acid
  2993. rubidium oxalate monohydrate
  2994. rubidium pentaborate
  2995. rubidium pentaborate tetrahydrate
  2996. rubidium pentamercury(II)chloride
  2997. rubidium perbromate
  2998. Rubidium phosphide
  2999. rubidium salicylate monohydrate
  3000. rubidium samarium(III) chloride tetrahydrate
  3001. Rubidium sulfamate
  3002. rubidium sulfide (Rb2(S2))
  3003. rubidium superoxide (Rb(O2))
  3004. rubidium tantalate(TaO3(1-))
  3005. Rubidium tetraantimony fluoride
  3006. rubidium tetrachloro oxotitanate monohydrate
  3007. rubidium tetrachloroiodate(1-)
  3008. rubidium tetrafluoroborate(1-)
  3009. rubidium tetrahydroborate(1-)
  3010. rubidium tetrahydroxopentaborate(III) dihydrate
  3011. rubidium tetraphenylborate(1-)
  3012. Rubidium titanyl arsenate
  3013. rubidium tri-μ-iododiiodotetraargentate(1-)
  3014. Rubidium triantimony fluoride
  3015. rubidium tribromocadmate(1-)
  3016. rubidium trichlorocadmate(1-)
  3017. rubidium trifluoroberyllate(1-)
  3018. rubidium trifluorocadmate(1-)
  3019. rubidium trifluorocalciate(1-)
  3020. rubidium trifluorocobaltate(1-)
  3021. rubidium trifluoromagnesate(1-)
  3022. rubidium trifluoromanganate(1-)
  3023. rubidium trifluoronickelate(1-)
  3024. rubidium trihydrogen oxalate dihydrate
  3025. rubidium uranium arsenate oxide (RbU(AsO4)O2)
  3026. rubidium uranium arsenate oxide (RbU(AsO4)O2) hydrate (2:1)
  3027. rubidium uranium arsenate oxide (RbU(AsO4)O2) monohydrate
  3028. rubidium uranium arsenate oxide (RbU(AsO4)O2) trihydrate
  3029. rubidium uranium borate oxide (RbU(BO3)O2)
  3030. rubidium uranium borate oxide (RbU(BO3)O2) monohydrate
  3031. rubidium uranyl molybdate
  3032. rubidium vanadate (VO3(1-))
  3033. rubidium vanadium(III) sulfate dodecahydrate
  3034. rubidium ytterbium (III) nitrate trihydrate
  3035. rubidium zinc borophosphate
  3036. rubidium zirconium fluoride monohydrate
  3037. rubidium(+1) cation hydroxide dihydrate
  3038. rubidium(+1) cation tetraborate
  3039. Rubidium(I) difluorobromoacetate
  3040. Rubidium(I) difluorochloroacetate
  3041. Rubidium(I) tetrafluoroiodate
  3042. ruthenium
  3043. Ruthenium diantimony
  3044. ruthenium carbonyl (Ru(CO)5)
  3045. ruthenium fluoride (RuF5)
  3046. ruthenium fluoride oxide (RuF4O)
  3047. ruthenium oxide (RuO2)
  3048. ruthenium strontium oxide (RuSrO3)
  3049. ruthenium(+3) cation; (Z)-1,1,1-trifluoro-4-oxopent-2-en-2-olate
  3050. Ruthenium(II) cadmium(II) tris(2,2'-dipyridyl) tetrabromide
  3051. Ruthenium(II) cadmium(II) tris(2,2'-dipyridyl) tetrachloride
  3052. Ruthenium(II) cadmium(II) tris(2,2'-dipyridyl) tetraiodide
  3053. Ruthenium(II) dicadmium(II) tris(2,2'-dipyridyl) hexabromide
  3054. Ruthenium(II) dicadmium(II) tris(2,2'-dipyridyl) hexachloride
  3055. Ruthenium(II) dicadmium(II) tris(2,2'-dipyridyl) hexaiodide
  3056. Ruthenium(II) pentacadmium(II) tris(2,2'-dipyridyl) dodecachloride
  3057. Ruthenium(II) tetracadmium(II) tris(2,2'-dipyridyl) decachloride
  3058. Ruthenium(II) tricadmium(II) tris(2,2'-dipyridyl) octachloride
  3059. Ruthenium(III) bis(6-amino-5-nitrosopyrimidine-2,4-diol) antipyrine chloride
  3060. Ruthenium(III) bis(6-amino-5-nitrosopyrimidine-2,4-diol) chloride
  3061. Ruthenium(III) bis(triethanolamine) trichloride
  3062. Ruthenium(III) tris(N-methylcyclohexyl dithiocarbamate)
  3063. ruthenocene
  3064. S 20 (standard fluid)
  3065. S(+)-Fenfluramine hydrochloride
  3066. S,S'-methylenephosphorodithioic acid O,O,O',O'-tetraethyl ester
  3067. S,S-bis(pentafluoroethyl)sulfoximine
  3068. S,S-bis(trifluoromethyl)-N-((trifluoromethyl)sulfinyl)sulfoximine
  3069. S,S-bis(trifluoromethyl)-N-((trifluoromethyl)thio)sulfoxime
  3070. S,S-bis(trifluoromethyl)-N-(2,2,2-trifluoro-1-(trifluoromethyl)-1-((2,2,2-trifluoro-1-(trifluoromethyl)ethylidene)amino)ethyl)sulfilimine
  3071. S,S-bis(trifluoromethyl)-N-(trimethylsilyl)sulfoximine
  3072. S,S-bis(trifluoromethyl)sulfoximine
  3073. S,S-dichloro-N-(tetrafluoro-1-(trifluoromethyl)ethyl)sulfilimine
  3074. S,S-dichloro-N-heptafluoropropylsulfilimine
  3075. S,S-dipropyl-N-diethylamidodithiophosphite
  3076. S-(((4-chlorophenyl)thio)methyl)phosphorodithioic acid O,O-diethyl ester
  3077. S-(+)-2,6-Dimethyloctane
  3078. S-(-)-2-chloropropanoic acid
  3079. S-(-)-Binol
  3080. S-(2,4-dichlorobenzenamino) butyl thiocarbonate
  3081. S-(2-acetamido-3-oxobutyl) ethanethioate
  3082. S-(2-methylanilino) butyl thiocarbonate
  3083. S-(2-methylbenzoyl)sulfanyl 2-methylbenzenecarbothioate
  3084. S-(2-Methylmercaptophenyl)-N,N-diphenylthiocarbamate
  3085. S-(2-Methylmercaptophenyl)-N-naphthalen-1-ylthiocarbamate
  3086. S-(2-Methylmercaptophenyl)-N-phenylthiocarbamate
  3087. S-(2-methylphenyl) [[(E)-2-[(2-methylphenyl)sulfanylcarbonylamino]ethenyl]amino]methanethioate
  3088. S-(2-trifluoromethylphenyl) benzenecarbothioate
  3089. S-(4-chloroanilino) butyl thiocarbonate
  3090. S-(4-cyclohexylamino-anilino) butyl thiocarbononate
  3091. S-(4-methylbenzenamino) butyl thiocarbonate
  3092. S-(4-methylbenzoyl)sulfanyl 4-methylbenzenecarbothioate
  3093. S-(4-morpholinyl) butyl thiocarbonate
  3094. S-(benzoylsulfanyl) benzenecarbothioate
  3095. S-(carboxydecyl)-2,4-dioxa-3,3-dimethyl-[3.3.0]bicyclooctane-7-sulfonium perchlorate
  3096. S-(carboxydecyl)-2-methyltetrahydrothiophene compd. with perchloric acid
  3097. S-(carboxydecyl)ethylmethylsulfonium perchlorate
  3098. S-(carboxydecyl)methylphenylsulfonium perchlorate
  3099. S-(carboxydecyl)tetrahydro-2H-thiopyran compd. with perchloric acid
  3100. S-(carboxydecyl)tetrahydrothiophene compd. with perchloric acid
  3101. S-(carboxydodecyl)-2-methyltetrahydrothiophene compd. with perchloric acid
  3102. S-(carboxydodecyl)tetrahydro-2H-thiopyran compd. with perchloric acid
  3103. S-(carboxydodecyl)tetrahydrothiophene compd. with perchloric acid
  3104. S-(carboxytetradecyl)diphenylsulfonium perchlorate
  3105. S-(carboxytridecyl)-2-methyltetrahydrothiophene compd. with perchloric acid
  3106. S-(carboxytridecyl)tetrahydro-2H-thiopyran compd. with perchloric acid
  3107. S-(carboxytridecyl)tetrahydrothiophene compd. with perchloric acid
  3108. S-(carboxyundecyl)-2-methyltetrahydrothiophene compd. with perchloric acid
  3109. S-(carboxyundecyl)tetrahydro-2H-thiopyran compd. with perchloric acid
  3110. S-(carboxyundecyl)tetrahydrothiophene compd. with perchloric acid
  3111. S-(pentafluoroethyl)-S-(trifluoromethyl)sulfoximine
  3112. S-(trifluoromethylsulfanyl) 2,2,2-trifluoroethanethioate
  3113. S-(trifluoromethylsulfanyl) 2-fluoro-2-oxoethanethioate
  3114. S-Benzyloxycarbonyl-2-aminoethanethiol hydrobromide
  3115. S-Benzyloxycarbonyl-2-aminoethanethiol hydrochloride
  3116. S-Benzyloxycarbonyl-2-aminoethanethiol hydroiodide
  3117. S-bis (5,5-dimethyl-1,3-dioxaphosphorinanyl-2-oxy phosphate ester)
  3118. S-butyl (phenylamino)methanethioate
  3119. S-butyl N-pentylcarbamothioate
  3120. S-butyl [[(E)-2-(butylsulfanylcarbonylamino)ethenyl]amino]methanethioate
  3121. S-Butyl-N,N'-bis((S)-1-phenylethyl)thiouronium bis(trifluoromethylsulfonyl)imide
  3122. S-Butyl-N,N'-bis((S)-1-phenylethyl)thiouronium bromide
  3123. S-Butyl-N,N'-bis((S)-1-phenylethyl)thiouronium hexafluorophosphate
  3124. S-Butyl-N,N'-bis((S)-1-phenylethyl)thiouronium iodide
  3125. S-Butyltetrahydrothiophenium iodide
  3126. S-Butyltetrahydrothiophenium tetraphenylborate
  3127. S-Chloro-S-(1-chloro-3-methylbutyl)-N-ethyloxathiaziridine
  3128. S-Chloro-S-3-methylbutyl-N-ethyloxathiaziridine
  3129. S-Chloro-S-butyl-N-ethyloxathiaziridine
  3130. S-Chloro-S-cyclohexyl-N-ethyloxathiaziridine
  3131. S-Decyl-N,N'-bis((S)-1-phenylethyl)thiouronium bis(trifluoromethylsulfonyl)imide
  3132. S-Decyl-N,N'-bis((S)-1-phenylethyl)thiouronium iodide
  3133. S-Decyltetrahydrothiophenium bis(trifluoromethylsulfonyl)imide
  3134. S-Decyltetrahydrothiophenium iodide
  3135. S-Decyltetrahydrothiophenium tetraphenylborate
  3136. S-dodecyl [[(E)-2-(dodecylsulfanylcarbonylamino)ethenyl]amino]methanethioate
  3137. S-Dodecyl-N,N'-bis((S)-1-phenylethyl)thiouronium bis(trifluoromethylsulfonyl)imide
  3138. S-Dodecyl-N,N'-bis((S)-1-phenylethyl)thiouronium iodide
  3139. S-Ethyl benzenecarbothioate
  3140. S-ethyl-N'-(methylbenzenesulfonyl)-N-(1-methylpropyl)carbamimidothioic acid
  3141. S-ethyl-N'-(methylbenzenesulfonyl)-N-(2-methylpropyl)carbamimidothioic acid
  3142. S-ethyl-N'-(methylbenzenesulfonyl)-N-octylcarbamimidothioic acid
  3143. S-ethyl-N'-(methylbenzenesulfonyl)carbamimidothioic acid
  3144. S-Ethyl-N,N'-bis((S)-1-phenylethyl)thiouronium bis(trifluoromethylsulfonyl)imide
  3145. S-Ethyl-N,N'-bis((S)-1-phenylethyl)thiouronium bromide
  3146. S-Ethyl-N,N'-bis((S)-1-phenylethyl)thiouronium iodide
  3147. S-ethyl-N-(1-methylethyl)-N'-(methylbenzenesulfonyl)carbamimidothioic acid
  3148. S-ethyl-N-hexyl-N'-(methylbenzenesulfonyl)carbamimidothioic acid
  3149. S-ethyl-N-methyl-N'-(methylbenzenesulfonyl)carbamimidothioic acid
  3150. S-ethyl-N-propyl-N'-(methylbenzenesulfonyl)carbamimidothioic acid
  3151. S-fluoro-N,S-bis(trifluoromethyl)sulfoximine
  3152. S-Heptyltetrahydrothiophenium bis(trifluoromethylsulfonyl)imide
  3153. S-Heptyltetrahydrothiophenium iodide
  3154. S-Heptyltetrahydrothiophenium tetraphenylborate
  3155. S-Hexadecyl-N,N'-bis((S)-1-phenylethyl)thiouronium bis(trifluoromethylsulfonyl)imide
  3156. S-Hexadecyl-N,N'-bis((S)-1-phenylethyl)thiouronium iodide
  3157. S-hexyl-1,1,3,3-tetramethylthiouronium bis(trifluoromethylsulfonyl)imide
  3158. S-Hexyl-N,N'-bis((S)-1-phenylethyl)thiouronium bis(trifluoromethylsulfonyl)imide
  3159. S-Hexyl-N,N'-bis((S)-1-phenylethyl)thiouronium iodide
  3160. S-Hexyltetrahydrothiophenium bis(trifluoromethylsulfonyl)imide
  3161. S-Hexyltetrahydrothiophenium iodide
  3162. S-Hexyltetrahydrothiophenium tetraphenylborate
  3163. S-isopropyl N-2,5-Dichlorophenylcarbamothioate
  3164. S-Methyl dimethylthioformamidium trifluoromethanesulfonate
  3165. S-methyl-N'-(methylbenzenesulfonyl)-N-(1-methylethyl)carbamimidothioic acid
  3166. S-methyl-N'-(methylbenzenesulfonyl)-N-(phenylmethyl)carbamimidothioic acid
  3167. S-methyl-N'-(methylbenzenesulfonyl)-N-octylcarbamimidothioic acid
  3168. S-methyl-N'-(methylbenzenesulfonyl)-N-phenylcarbamimidothioic acid
  3169. S-methyl-N'-(methylbenzenesulfonyl)-N-propylcarbamimidothioic acid
  3170. S-methyl-N'-(methylbenzenesulfonyl)carbamimidothioic acid
  3171. S-Methyl-N,N'-bis((S)-1-phenylethyl)thiouronium bis(trifluoromethylsulfonyl)imide
  3172. S-Methyl-N,N'-bis((S)-1-phenylethyl)thiouronium iodide
  3173. S-Methyl-N,N'-dimethylthiourea trifluoromethanesulfonate
  3174. S-Methyl-N,N,N',N'-tetramethylthiourea trifluoromethanesulfonate
  3175. S-Methyl-N,N,N'-trimethylthiourea trifluoromethanesulfonate
  3176. S-methyl-N-(1,1-dimethylethyl)-N'-(methylbenzenesulfonyl)carbamimidothioic acid
  3177. S-methyl-N-(1-methylpropyl)-N'-(methylbenzenesulfonyl)carbamimidothioic acid
  3178. S-methyl-N-(2-methylpropyl)-N'-(methylbenzenesulfonyl)carbamimidothioic acid
  3179. S-Methyl-N-methylthiourea trifluoromethanesulfonate
  3180. S-methyl-N-pentyl-N'-(methylbenzenesulfonyl)carbamimidothioic acid
  3181. S-Nonyltetrahydrothiophenium bis(trifluoromethylsulfonyl)imide
  3182. S-Nonyltetrahydrothiophenium iodide
  3183. S-Nonyltetrahydrothiophenium tetraphenylborate
  3184. S-octyl-1,1,3,3-tetramethylthiouronium bis(trifluoromethylsulfonyl)imide
  3185. S-Octyl-N,N'-bis((S)-1-phenylethyl)thiouronium bis(trifluoromethylsulfonyl)imide
  3186. S-Octyl-N,N'-bis((S)-1-phenylethyl)thiouronium iodide
  3187. S-Octyltetrahydrothiophenium bis(trifluoromethylsulfonyl)imide
  3188. S-Octyltetrahydrothiophenium iodide
  3189. S-Octyltetrahydrothiophenium tetraphenylborate
  3190. S-Pentyltetrahydrothiophenium iodide
  3191. S-Pentyltetrahydrothiophenium tetraphenylborate
  3192. S-phenyl (pentylamino)methanethioate
  3193. S-phenyl (propan-2-ylamino)methanethioate
  3194. S-phenyl N-2-methylphenylcarbamothioate
  3195. S-phenyl N-3-methylphenylcarbamothioate
  3196. S-phenyl N-4-methylphenylcarbamothioate
  3197. S-phenyl N-di-sec-butylcarbamothioate
  3198. S-phenyl N-diisobutylcarbamothioate
  3199. S-phenyl propylaminomethanethioate
  3200. S-phenyl [[(E)-2-(phenylsulfanylcarbonylamino)ethenyl]amino]methanethioate
  3201. S-Prop-2-enyltetrahydrothiophenium bis(trifluoromethylsulfonyl)imide
  3202. S-Propyl-N,N'-bis((S)-1-phenylethyl)thiouronium bis(trifluoromethylsulfonyl)imide
  3203. S-Propyl-N,N'-bis((S)-1-phenylethyl)thiouronium iodide
  3204. s-triazine-2,4,6-tricarbonitrile
  3205. S-vinyloxybutyl N,N-diethyldithiocarbamate
  3206. S-vinyloxyethyl N,N-diethyldithiocarbamate
  3207. Saccharose octanitrate
  3208. safflower oil
  3209. sal oil biodiesel (Shorea robusta biodiesel)
  3210. Salicylalazine
  3211. Salicylaldehyd S-methylisothiosemicarbazone dimethylsulfoxide molybdenum(VI) dioxide
  3212. Salicylaldehyd S-methylisothiosemicarbazone ethanol molybdenum(VI) dioxide
  3213. Salicylaldehyd S-methylisothiosemicarbazone methanol molybdenum(VI) dioxide
  3214. Salicylaldehyd S-methylisothiosemicarbazone molybdenum(VI) dioxide
  3215. Salicylaldehyd S-methylisothiosemicarbazone N,N-dimethylformamide molybdenum(VI) dioxide
  3216. Salicylaldehyd S-methylisothiosemicarbazone pyridine molybdenum(VI) dioxide
  3217. Salicylaldehyde triacetate
  3218. salicylic acid 1-butoxyethyl ester
  3219. salicylic acid 1-ethoxyethyl ester
  3220. salinazid
  3221. salsoline salsolinodithiocarbamate
  3222. samarium
  3223. samarium (III) chloride tetraethylammonium chloride hexahydrate
  3224. samarium (III) fluorosulfide
  3225. samarium (III) iron garnet
  3226. samarium (III) orthovanadate
  3227. Samarium acetate triurea
  3228. Samarium acetate triurea sesquihydrate
  3229. Samarium barium oxide
  3230. samarium bromide (SmBr3)
  3231. samarium bromide oxide (SmBrO)
  3232. samarium carbide (Sm2C3)
  3233. samarium carbide (SmC2)
  3234. samarium chloride (SmCl2)
  3235. samarium chloride (SmCl3)
  3236. samarium chloride (SmCl3) trihydrate
  3237. samarium chloride bis(acetylcholine chloride) hexahydrate
  3238. samarium chloride oxide (SmClO)
  3239. Samarium chloride tetraacetamide dihydrate
  3240. samarium chloride tris(chlorocholine chloride) pentahydrate
  3241. Samarium chromium tantalate
  3242. Samarium cobalt(III) oxide
  3243. samarium copper oxide
  3244. samarium disulfide
  3245. samarium fluoride (SmF3)
  3246. Samarium hafnate
  3247. samarium hexapyridinium chloride
  3248. Samarium hydrogen uranosilicate
  3249. Samarium hydrogen uranosilicate decahydrate
  3250. samarium iodide (PrI3)
  3251. samarium iodide (SmI2)
  3252. Samarium iron tantalate
  3253. Samarium manganite
  3254. samarium molybdate
  3255. samarium nitrate pentahydrate
  3256. samarium nitrate trihydrate
  3257. samarium nitrate tris(6-methylquinoline nitrate) tetrahydrate
  3258. samarium perchlorate bis(N,N'-diantipyrylthiourea) octahydrate
  3259. samarium phosphide (SmP)
  3260. samarium pyridinium chloride hexahydrate
  3261. samarium pyrostannate
  3262. samarium selenium bromide oxide (SmSe3BrO7)
  3263. samarium silicide (SmSi2)
  3264. samarium sodium sulfate dihydrate
  3265. samarium sulfide (Sm2S3)
  3266. samarium sulfide (SmS)
  3267. Samarium tantalate
  3268. samarium tetra(dimethylammonium) chloride
  3269. Samarium titanate
  3270. samarium tri(trimethylammonium) chloride
  3271. Samarium tris-pivalate
  3272. samarium uranium oxide (Sm6UO12)
  3273. samarium(+3) cation trinitrate hexahydrate
  3274. samarium(3+) bis(nicotinate)-8-hydroxyquinolate
  3275. samarium(3+) vanadate (V6O17(4-)) (4:3)
  3276. samarium(3+) vanadate (VO3(1-)) (1:3)
  3277. samarium(II) fluoride
  3278. samarium(III) β-resorcylate monohydrate
  3279. samarium(III) arsenite trihydrate
  3280. Samarium(III) bis(1,10-phenanthroline 1-oxide) trichloride
  3281. samarium(III) bromide hexahydrate
  3282. samarium(III) chloride (SmCl3) hexahydrate
  3283. samarium(III) chloride 3.5-hydrate
  3284. Samarium(III) chloride di(methylenediacetamide) dihydrate
  3285. samarium(III) chloride hexaurea
  3286. samarium(III) chloride tetraurea
  3287. Samarium(III) chromate heptahydrate
  3288. samarium(III) chromate octahydrate
  3289. Samarium(III) dichromate decahydrate
  3290. samarium(III) ethyl sulfate nonahydrate
  3291. samarium(III) hexavanadate 48-hydrate
  3292. Samarium(III) histidine trinitrate monohydrate
  3293. samarium(III) iodate dihydrate
  3294. samarium(III) iodide dithiourea decahydrate
  3295. samarium(III) iodide nonahydrate
  3296. Samarium(III) iodide pentaurea
  3297. samarium(III) iodide tetrahydrate
  3298. samarium(III) laurate
  3299. samarium(III) metaborate hexahydrate
  3300. Samarium(III) nitrate di(methylenediacetamide) dihydrate
  3301. samarium(III) nitrate mono(alanine) hydrate
  3302. samarium(III) nitrate tetra(alanine) hydrate
  3303. samarium(III) nitrate tetrahydrate
  3304. Samarium(III) orthotantalate
  3305. samarium(III) oxide
  3306. Samarium(III) oxyfluoride
  3307. samarium(III) perchlorate bis(4-(2-Chloroacetyl)-antipyrine) hexahydrate
  3308. samarium(III) perchlorate heptahydrate
  3309. samarium(III) perchlorate nonahydrate
  3310. samarium(III) perchlorate triacetylantipyrine dihydrate
  3311. samarium(III) perchlorate tris(4-(2-Chloroacetyl)-antipyrine) octahydrate
  3312. samarium(III) pyrophosphate tetracosahydrate
  3313. samarium(III) selenate octahydrate
  3314. Samarium(III) selenide
  3315. Samarium(III) sodium disulfate
  3316. samarium(III) sulfate heptaurea
  3317. samarium(III) sulfate hexahydrate
  3318. samarium(III) sulfate octahydrate
  3319. samarium(III) sulfosalicylate octadecahydrate
  3320. Samarium(III) tetrakis(5,6-benzoquinoline) trinitrate
  3321. samarium(III) trichloracetate dihydrate
  3322. samarium(III) trichloracetate hexahydrate
  3323. samarium(III) trichloracetate monohydrate
  3324. samarium(III) trichloracetate trihydrate
  3325. Samarium(III) triindium(I)
  3326. Samarium(III) trilead
  3327. Samarium(III) tripotassium hexabromide
  3328. Samarium(III) trirubidium hexabromide
  3329. Samarium(III) trirubidium hexachloride
  3330. Samarium(III) tris(1,4-thioxane-S-oxide trifluoroacetate)
  3331. Samarium(III) tris(2,6-dichlorobenzoic acid)
  3332. Samarium(III) tris(3-bromolawsonemonoxime) dihydrate
  3333. Samarium(III) tris(3-chlorolawsonemonoxime) dihydrate
  3334. Samarium(III) tris(3-iodolawsonemonoxime) heptahydrate
  3335. Samarium(III) tris(3-Methoxybenzoate)
  3336. Samarium(III) tris(3-nitro-1,2,4-triazol-5-onate)
  3337. Samarium(III) tris(3-nitro-1,2,4-triazol-5-onate) heptahydrate
  3338. Samarium(III) tris(N-phenylbenzohydroxamate)
  3339. Samarium(III) tris(salicylidene-β-alanine)
  3340. Samarium(III) tris(salicylidene-β-alanine) trihydrate
  3341. Samarium(III) trithallium(I)
  3342. Samarium(III) trithiocyanate hexahydrate
  3343. Samarium(III) tritin
  3344. Samarium(III) undecaiodide pentaurea decahydrate
  3345. Samarium(III)-2,5-dihydroxybenzoate
  3346. samarium(III)borohydride bis(tetrahydrofuran)
  3347. samarium(III)borohydride tetrakis(tetrahydrofuran)
  3348. Samarium(III)trifluoromethanesulphonate octa(4-picoline-N-oxide)
  3349. samarum(III) metavanadate tetrahydrate
  3350. sample 2093 cb
  3351. sample 2093 cb-2
  3352. sample 2093 cb-4
  3353. sample 2093 cb-6
  3354. sample 2094 cb
  3355. sample 2128 cb
  3356. sandstone
  3357. sandstone
  3358. Santalyl butanoate
  3359. santotherm 55
  3360. santotherm 66
  3361. Santowax R
  3362. sapphire (Al2O3)
  3363. sarafloxacin
  3364. Sarpogrelate hydrochloride
  3365. Satranidazole
  3366. saxoline
  3367. scandium
  3368. scandium 1,1,1-trifluoro-5,5-dimethyl-2,4-hexanedionate
  3369. scandium 2,2,6,6-tetramethyl-4-fluoro-3,5-heptanedionate
  3370. scandium bromide (ScBr3)
  3371. scandium chloride (ScCl3)
  3372. scandium dihydrogen pentanitrate
  3373. scandium fluoride (ScF3)
  3374. scandium hydrogen selenite
  3375. scandium hydroxide (Sc(OH)3)
  3376. scandium hydroxynitrate (Sc(OH)(NO3)2)
  3377. scandium iodate
  3378. scandium iodate tetraiodic acid octadecahydrate
  3379. scandium iodate octadecahydrate
  3380. scandium iodide (ScI3)
  3381. scandium nitrate dihydrate
  3382. scandium nitrate tetrahydrate
  3383. scandium nitrate trihydrate
  3384. scandium oxide (Sc2O3)
  3385. scandium sulfide (Sc2S3)
  3386. scandium tricyclopentadienide
  3387. scandium vanadium oxide (ScVO4)
  3388. scandium(3+) tris(fluoromethanesulphonate) compd. with 2,6-dimethylpyridine-1-oxide (1:6) hydrate
  3389. scandium(3+) tris(fluoromethanesulphonate) compd. with 2-methylpyridine-1-oxide (1:6)
  3390. scandium(3+) tris(fluoromethanesulphonate) compd. with 3-methylpyridine-1-oxide (1:6)
  3391. scandium(3+) tris(fluoromethanesulphonate) compd. with 4-methylpyridine-1-oxide (1:6)
  3392. scandium(3+) tris(fluoromethanesulphonate) compd. with pyridine-1-oxide (1:6)
  3393. scandium(III) bromide pentahydrate
  3394. scandium(III) chloride hexahydrate
  3395. scandium(III) chloride nonahydrate
  3396. scandium(III) hydroxosulfate dihydrate
  3397. scandium(III) hydroxydinitrate trihydrate
  3398. scandium(III) nitrate hexahydrate
  3399. scandium(III) perchlorate heptahydrate
  3400. scandium(III) perchlorate hexahydrate
  3401. scandium(III) perchlorate nonahydrate
  3402. scandium(III) sulfate decaurea
  3403. scandium(III) sulfate disulfuric acid
  3404. scandium(III) sulfate pentahydrate
  3405. scandium(III) sulfate pentaurea
  3406. scandium(III) sulfate tetrahydrate
  3407. scandium(III) sulfate trisulfuric acid
  3408. scapolithe (Na0.34K0.13Ca3.48Fe0.01)(Si6.47Al5.53)O24.01(Cl0.06(CO3)0.91(SO4)0.02)
  3409. scapolithe (Na1.65K0.13Ca2.16Fe0.01)(Si7.51Al4.49)O23.96(Cl0.30(CO3)0.57(SO4)0.14)
  3410. scapolithe (Na2.13K0.09Ca1.75Fe0.01)(Si7.73Al4.27)O23.97(Cl0.42(CO3)0.47(SO4)0.07)
  3411. scapolithe (Na2.62K0.28Ca1.10Fe0.02)(Si8.14Al3.86)O24.00(Cl0.70(CO3)0.23(SO4)0.07)
  3412. scopolamine
  3413. sea water
  3414. sea water
  3415. Sebacic acid bis(1-octoxy-1-oxopropan-2-yl) ester
  3416. sec-Butenylnaphtalene
  3417. sec-Butyl phenylcarbamate
  3418. sec-butyl triallyl orthosilicate
  3419. sec-Butylammonium methanoate
  3420. sec-Butylmesitylene
  3421. sec-octylmercuric bromide
  3422. Second generation carbosilane dendrimer
  3423. Second generation poly(phenylene-pyridyl) dendrimer
  3424. secondary sodium para-periodate
  3425. sekaninaite (Al4Fe2O3(SiO3)5)
  3426. selanylidenesilicon
  3427. selenate
  3428. selenic acid
  3429. selenic acid aluminum cesium salt (2:1:1)
  3430. selenic acid aluminum potassium salt (2:1:1)
  3431. selenic acid aluminum rubidium salt (2:1:1)
  3432. selenic acid ammonium magnesium salt (2:2:1)
  3433. selenic acid barium salt (1:1)
  3434. selenic acid cadmium(2+) salt
  3435. selenic acid calcium salt (1:1)
  3436. selenic acid cobalt(2+) salt (1:1)
  3437. selenic acid copper(2+) salt (1:1)
  3438. selenic acid diammonium salt
  3439. selenic acid dicesium salt
  3440. selenic acid dilithium salt
  3441. selenic acid dilithium salt monohydrate
  3442. selenic acid dipotassium salt
  3443. selenic acid dirubidium salt
  3444. selenic acid disodium salt
  3445. selenic acid disodium salt decahydrate
  3446. selenic acid dithallium(1+) salt
  3447. selenic acid europium(3+) salt (3:2)
  3448. selenic acid indium(3+) salt (3:2)
  3449. selenic acid lanthanum(3+) salt (3:2)
  3450. selenic acid magnesium potassium salt (2:1:2)
  3451. selenic acid magnesium salt (1:1)
  3452. selenic acid manganese(2+) salt
  3453. selenic acid mercury(2+) salt
  3454. selenic acid monoammonium salt
  3455. selenic acid monosodium salt
  3456. selenic acid neodymium(3+) salt (3:2)
  3457. selenic acid nickel(2+) salt (1:1)
  3458. selenic acid nickel(2+) salt (1:1) hexahydrate
  3459. selenic acid praseodymium(3+) salt (3:2)
  3460. selenic acid samarium(3+) salt (3:2)
  3461. selenic acid strontium salt (1:1)
  3462. selenic acid ytterbium(3+) salt (3:2)
  3463. selenic acid zinc salt (1:1)
  3464. seleninyl chloride
  3465. seleninyl fluoride
  3466. selenious acid
  3467. selenious acid (H2SeO3) zinc salt (1:1)
  3468. selenious acid ammonium salt (2:1)
  3469. selenious acid barium salt (1:1)
  3470. selenious acid cadmium salt (1:1)
  3471. selenious acid compd. with nitrourea (1:1)
  3472. selenious acid diammonium salt
  3473. selenious acid dicesium salt
  3474. selenious acid dilithium salt
  3475. selenious acid dipotassium salt
  3476. selenious acid dirubidium salt
  3477. selenious acid disodium salt
  3478. selenious acid monopotassium salt
  3479. selenious acid monosodium salt
  3480. selenious acid potassium salt (2:1)
  3481. selenious acid scandium(3+) salt (3:2)
  3482. selenious acid sodium salt (2:1)
  3483. selenious acid zirconium(4+) salt (2:1)
  3484. selenium
  3485. selenium chloride (Se2Cl2)
  3486. Selenium dioxide difluoride
  3487. selenium oxide (SeO2)
  3488. selenium oxide (SeO3)
  3489. selenium; thallium
  3490. selenobismethane
  3491. selenocyanic acid cadmium salt
  3492. selenocyanic acid lead(2+) salt
  3493. selenocyanic acid pentafluoroethyl ester
  3494. selenocyanic acid potassium salt
  3495. selenocyanic acid trifluoromethyl ester
  3496. selenohypophosphoric acid (((HSe)2P(Se))2) lead(2+) salt (1:2)
  3497. selenoisocyanic acid trifluoromethyl ester
  3498. selenophene
  3499. selenoseleniumcyanic acid trifluoromethyl ester
  3500. selenosilicic acid (H4SiSe4) copper(1+) mercury(2+) salt (1:2:1)
  3501. Senecionine
  3502. Seneciphylline
  3503. Senkirkine
  3504. separator gas
  3505. Separator liquid
  3506. Sepasolv MPE
  3507. Sertraline hydrochloride
  3508. sesame fats and glyceridic oils
  3509. Seventh generation carbosilane dendrimers
  3510. Shale oil
  3511. silacyclopropane
  3512. silane
  3513. silane-d2
  3514. silane-d3
  3515. silane-d4
  3516. silanecarbonitrile
  3517. silanediimine magnesium salt (1:1)
  3518. silanol acetate
  3519. silanol formate
  3520. silica
  3521. silica vitreous
  3522. silicic acid (H2Si2O5) dilithium salt
  3523. silicic acid (H2Si2O5) dipotassium salt
  3524. silicic acid (H2Si2O5) disodium salt
  3525. silicic acid (H2SiO2) barium salt (1:1)
  3526. silicic acid (H2SiO3)
  3527. silicic acid (H2SiO3) aluminum salt
  3528. silicic acid (H2SiO3) barium salt (1:1)
  3529. silicic acid (H2SiO3) cadmium salt (1:1)
  3530. silicic acid (H2SiO3) calcium salt (1:1)
  3531. silicic acid (H2SiO3) dicesium salt
  3532. silicic acid (H2SiO3) dilithium salt
  3533. silicic acid (H2SiO3) dipotassium salt
  3534. silicic acid (H2SiO3) disodium salt
  3535. silicic acid (H2SiO3) iron(2+) salt (1:1)
  3536. silicic acid (H2SiO3) lead(2+) salt (1:1)
  3537. silicic acid (H2SiO3) magnesium salt (1:1)
  3538. silicic acid (H2SiO3) strontium salt (1:1)
  3539. silicic acid (H2SiO3) zinc salt (1:1)
  3540. silicic acid (H4Si2O7) hexakis(2-methylpropyl) ester
  3541. silicic acid (H4SiO4)
  3542. silicic acid (H4SiO4) 2-ethylbutyl tris(2-ethylhexyl) ester
  3543. silicic acid (H4SiO4) aluminum barium salt (2:2:1)
  3544. silicic acid (H4SiO4) aluminum lithium salt (1:1:1)
  3545. silicic acid (H4SiO4) aluminum strontium salt (2:2:1)
  3546. silicic acid (H4SiO4) beryllium salt
  3547. silicic acid (H4SiO4) bis(2-ethylhexyl) bis(1,1-dimethylpropyl) ester
  3548. silicic acid (H4SiO4) butyl tris(1,1-dimethylethyl) ester
  3549. silicic acid (H4SiO4) calcium salt (1:2)
  3550. silicic acid (H4SiO4) disodium salt
  3551. silicic acid (H4SiO4) iron(2+) salt (1:2)
  3552. silicic acid (H4SiO4) lead(2+) salt (1:2)
  3553. silicic acid (H4SiO4) lithium salt
  3554. silicic acid (H4SiO4) magnesium salt (1:2)
  3555. silicic acid (H4SiO4) magnesium strontium salt (2:1:3)
  3556. silicic acid (H4SiO4) tetrabutyl ester
  3557. silicic acid (H4SiO4) tetradodecyl ester
  3558. silicic acid (H4SiO4) tetraethyl ester
  3559. silicic acid (H4SiO4) tetraheptyl ester
  3560. silicic acid (H4SiO4) tetrahexyl ester
  3561. silicic acid (H4SiO4) tetrakis(1,3-dimethylbutyl)ester
  3562. silicic acid (H4SiO4) tetrakis(1-methylbutyl) ester
  3563. silicic acid (H4SiO4) tetrakis(1-methylethyl) ester
  3564. silicic acid (H4SiO4) tetrakis(1-methylheptyl) ester
  3565. silicic acid (H4SiO4) tetrakis(1-methylhexyl) ester
  3566. silicic acid (H4SiO4) tetrakis(1-methylpropyl) ester
  3567. silicic acid (H4SiO4) tetrakis(2,2,3,3,3-pentafluoropropyl) ester
  3568. silicic acid (H4SiO4) tetrakis(2,2,3,3,4,4,4-heptafluorobutyl) ester
  3569. silicic acid (H4SiO4) tetrakis(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononyl) ester
  3570. silicic acid (H4SiO4) tetrakis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl) ester
  3571. silicic acid (H4SiO4) tetrakis(2,2,3,3,4,4,5,5-octafluoropentyl) ester
  3572. silicic acid (H4SiO4) tetrakis(2,2,3,3-tetrafluoropropyl) ester
  3573. silicic acid (H4SiO4) tetrakis(2,6-dimethylphenyl) ester
  3574. silicic acid (H4SiO4) tetrakis(2-chloroethyl) ester
  3575. silicic acid (H4SiO4) tetrakis(2-ethylbutyl) ester
  3576. silicic acid (H4SiO4) tetrakis(2-ethylhexyl) ester
  3577. silicic acid (H4SiO4) tetrakis(2-methylphenyl) ester
  3578. silicic acid (H4SiO4) tetrakis(2-methylpropyl) ester
  3579. silicic acid (H4SiO4) tetrakis(3-methylbutyl) ester
  3580. silicic acid (H4SiO4) tetrakis(3-methylphenyl) ester
  3581. silicic acid (H4SiO4) tetrakis(4-methoxyphenyl)ester
  3582. silicic acid (H4SiO4) tetrakis(4-methylphenyl) ester
  3583. silicic acid (H4SiO4) tetrakis(4-methylphenyl) ester
  3584. silicic acid (H4SiO4) tetrakis(decyl) ester
  3585. silicic acid (H4SiO4) tetralithium salt
  3586. silicic acid (H4SiO4) tetramethyl ester
  3587. silicic acid (H4SiO4) tetranonyl ester
  3588. silicic acid (H4SiO4) tetraoctyl ester
  3589. silicic acid (H4SiO4) tetrapentyl ester
  3590. silicic acid (H4SiO4) tetraphenyl ester
  3591. silicic acid (H4SiO4) tetrapropyl ester
  3592. silicic acid (H4SiO4) tetrasodium salt
  3593. silicic acid (H4SiO4) tris(1,1-dimethylethyl) 1-methylpropyl ester
  3594. silicic acid (H4SiO4) trisodium salt
  3595. silicic acid (H4SiO4) zirconium(4+) salt
  3596. silicic acid (H6Si2O7) cerium(3+) salt (1:2)
  3597. silicic acid (H6Si2O7) cerium(3+) salt (1:2)
  3598. silicic acid (H6Si2O7) dysprosium(3+) salt (1:2)
  3599. silicic acid (H6Si2O7) hexakis(1,3-dimethylbutyl) ester
  3600. silicic acid (H6Si2O7) hexakis(1-methylethyl) ester
  3601. silicic acid (H6Si2O7) lanthanum(3+) salt (1:2)
  3602. silicic acid (H6Si2O7) strontium zirconium(4+) salt (1:1:1)
  3603. silicic acid (H6Si2O7) yttrium(3+) salt (1:2)
  3604. Silicic acid tetrakis(1,3-dichloropropan-2-yl) ester
  3605. Silicomolybdic acid
  3606. Silicomolybdic acid hexahydrate
  3607. silicon
  3608. silicon arsenide
  3609. silicon arsenide (SiAs)
  3610. silicon carbide (Si2C)
  3611. silicon carbide (SiC)
  3612. silicon carbide (SiC)
  3613. silicon carbide (SiC)
  3614. silicon carbide (SiC2)
  3615. silicon chloride (SiCl)
  3616. silicon fluoride (SiF2)
  3617. silicon ion (Si(1+))
  3618. silicon nitride (Si2N)
  3619. silicon nitride (Si3N4)
  3620. silicon nitride (Si3N4)
  3621. silicon nitride (SiN)
  3622. silicon oil
  3623. silicon oxide (SiO)
  3624. silicon oxynitride
  3625. silicon phosphide
  3626. silicon sulfide (SiS)
  3627. silicon sulfide (SiS2)
  3628. silicon tetrathiocyanate
  3629. Silicon(IV) tetrachloride tris(acetoacet-m-anisidide)
  3630. Silicon(IV) tetrachloride tris(acetoacet-m-toluidide)
  3631. Silicon(IV) tetrachloride tris(acetoacet-o-anisidide)
  3632. Silicon(IV) tetrachloride tris(acetoacet-o-toluidide)
  3633. Silicon(IV) tetrachloride tris(acetoacet-p-anisidide)
  3634. Silicon(IV) tetrachloride tris(acetoacet-p-toluidide)
  3635. Silicon(IV) tetrachloride tris(acetoacetanilide)
  3636. Silicon(IV) tetrachloride tris(m-chloroacetoacetanilide)
  3637. Silicon(IV) tetrachloride tris(o-chloroacetoacetanilide)
  3638. Silicon(IV) tetrachloride tris(p-bromoacetoacetanilide)
  3639. Silicon(IV) tetrachloride tris(p-chloroacetoacetanilide)
  3640. Silicon(IV) tetrachloride tris(p-fluoroacetoacetanilide)
  3641. Silicon(IV) tetrachloride tris(p-iodoacetoacetanilide)
  3642. Silicotungstic acid
  3643. Silicotungstic acid hexahydrate
  3644. silidyne
  3645. sillimanite (Al2O(SiO4))
  3646. siloxanes and Silicones
  3647. siloxanes and silicones di-Et
  3648. siloxanes and silicones di-Et
  3649. siloxanes and silicones di-Et
  3650. siloxanes and silicones di-Et
  3651. siloxanes and silicones di-Et
  3652. siloxanes and silicones di-Et
  3653. siloxanes and silicones di-Et PES-2
  3654. siloxanes and silicones di-Et PES-3
  3655. siloxanes and silicones di-Et PES-4
  3656. siloxanes and silicones di-Et PES-5
  3657. siloxanes and silicones di-Me 1
  3658. siloxanes and silicones di-Me 2
  3659. siloxanes and silicones di-Me PMS-1.5
  3660. siloxanes and silicones di-Me PMS-10
  3661. siloxanes and silicones Di-Me PMS-100
  3662. siloxanes and silicones Di-Me PMS-100
  3663. siloxanes and silicones Di-Me PMS-1000
  3664. siloxanes and silicones Di-Me PMS-1000
  3665. siloxanes and silicones di-Me PMS-200
  3666. siloxanes and silicones di-Me PMS-400
  3667. siloxanes and silicones Di-Me PMS-476
  3668. siloxanes and silicones Di-Me PMS-476
  3669. siloxanes and silicones Di-Me PMS-5
  3670. siloxanes and silicones Di-Me PMS-5
  3671. siloxanes and silicones Di-Me PMS-50
  3672. siloxanes and silicones Di-Me PMS-50
  3673. siloxanes and silicones Di-Me PMS-50
  3674. siloxanes and silicones Di-Me PMS-700
  3675. siloxanes and silicones Di-Me PMS-700
  3676. siloxanes and silicones Me-Ph PFMS-2-5p
  3677. siloxanes and silicones Me-Ph PFMS-4
  3678. siltherm-800
  3679. silver
  3680. Silver α-nitroso-β-naphthate
  3681. Silver 3-nitro-1,2,4-triazol-5-onate
  3682. silver acetylide (Ag2(C2))
  3683. silver ammonium nitrate
  3684. silver arsenic disulfide
  3685. silver barium thiocyanate dihydrate
  3686. silver bismuth disulfide
  3687. silver bromide (AgBr)
  3688. silver bromide metaphosphate (AgBr0.45(PO3)0.55)
  3689. silver bromide metaphosphate (AgBr0.55(PO3)0.45)
  3690. silver cesium nitrate
  3691. silver chloride (AgCl)
  3692. silver chloride bis(thiourea)
  3693. silver chloride dipyridine
  3694. silver chloride monopyridine
  3695. silver chloride tris(thiourea)
  3696. silver cyanide (Ag(CN))
  3697. silver dihydrogen phosphate
  3698. silver dimolybdate
  3699. silver dipotassium iodide
  3700. silver fluoride (AgF)
  3701. silver fluoride (AgF2)
  3702. silver fluoride di(hydrogen fluoride)
  3703. silver fluoride dihydrate
  3704. silver fluoride mono(hydrogen fluoride)
  3705. silver fluoride monohydrate
  3706. silver fluoride penta(hydrogen fluoride)
  3707. silver fluoride tetrahydrate
  3708. silver fluoride tri(hydrogen fluoride)
  3709. silver hydrogen orthophosphate
  3710. silver hydroxide (Ag(OH))
  3711. silver iodide (AgI)
  3712. silver ion (Ag(1+))
  3713. Silver methanesulfonate
  3714. silver nitrate diurea
  3715. silver nitrate diurea hexahydrate
  3716. silver nitrate diurea tetrahydrate
  3717. silver nitrate hexapyridine
  3718. silver nitrate monodioxanate
  3719. silver nitrate monourea
  3720. silver nitrate tripyridine
  3721. silver oxide (Ag2O)
  3722. silver perchlorate monobenzen
  3723. silver perchlorate monotoluene
  3724. Silver potassium iodide
  3725. silver pyridine nitrate
  3726. silver selenide (Ag2.01Se)
  3727. silver selenide (Ag2Se)
  3728. silver selenide (Ag2Se1.01)
  3729. silver selenide sulfide (Ag4Se&subS;)
  3730. silver sodium bromate
  3731. silver sodium iodide trihydrate
  3732. silver sulfide (Ag2S)
  3733. silver telluride
  3734. silver telluride (Ag2Te)
  3735. silver tellurite
  3736. silver tetrafluoroborate
  3737. silver thallium nitrate
  3738. silver thiocyanate monoammonia
  3739. Silver thiophosphate
  3740. silver tin selenide (Ag33.3Sn16.7Se50)
  3741. silver tin selenide (Ag8SnSe6)
  3742. Silver trifluoromethanesulfonate
  3743. silver tungsten oxide (Ag2WO4)
  3744. silver(1+) (T-4)-rhenate (ReO4(1-))
  3745. silver(1+) (T-4)-tetraiodobismutate(1-)
  3746. silver(1+) compd. with N,N-dimethylbenzamide salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:2:1)
  3747. Silver(I) (2-(2,4,6-trinitroanilino)acetate
  3748. Silver(I) 4-aminophenazone dithiocarbamate
  3749. Silver(I) 8-ethyltheophyline
  3750. Silver(I) 8-isopropyltheophyline
  3751. Silver(I) 8-phenyltheophyline
  3752. Silver(I) 8-propyltheophyline
  3753. Silver(I) aluminum(III) diselenide
  3754. Silver(I) aluminum(III) disulfide
  3755. Silver(I) aluminum(III) ditelluride
  3756. Silver(I) antimony(III) diselenide
  3757. Silver(I) bismuth(III) diselenide
  3758. Silver(I) bismuth(III) ditelluride
  3759. silver(I) cyanate
  3760. Silver(I) diazoaminobenzene
  3761. silver(I) hexacyanocobaltate
  3762. Silver(I) indium(III) disulfide
  3763. Silver(I) iron(III) diselenide
  3764. Silver(I) iron(III) ditelluride
  3765. Silver(I) thallium(III) diselenide
  3766. Silver(I) thallium(III) ditelluride
  3767. Silver(I) theophyllinate
  3768. silver(I)/propylamine bis(trifluoromethylsulfonyl)imide
  3769. Silyl trifluoromethyl selenide
  3770. Silyl Trifluoromethyl Sulfide
  3771. silylene
  3772. Silylenebis(tetracarbonylcobalt)
  3773. silyliumylidene
  3774. Sitostanol
  3775. slag
  3776. sodalite (Na4(Al3Cl(SiO4)3))
  3777. sodate (NaO(1-))
  3778. sodiotellanylsodium
  3779. sodium
  3780. sodium (1R)-1,2,3,4,5,6-hexadydro-1,5-methano-8H-pyrido(1,2-a)(1,5)diazocin-8-one dithiocarbamate
  3781. sodium (2-carboxylatophenyl)sulfanyl-ethylmercury
  3782. sodium (4R)-4-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate
  3783. sodium (6R,7R)-7-[[(2R)-2-formyloxy-2-phenylacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate
  3784. sodium (dioxovanadate)di-mu-oxodioxouranate(1-) dihydrate
  3785. sodium (OC-6-11)-hexachloroniobate(2-)
  3786. sodium (orthoarsenato(3-)-κO)dioxouranate(1-)
  3787. sodium (T-4)-aluminate (Al(OH)4(1-))
  3788. sodium (T-4)-rhenate (ReO4(1-))
  3789. sodium (T-4)-technetate (TcO4(1-))
  3790. sodium (T-4)-tetrachloroaluminate(1-)
  3791. sodium (T-4)-tetrafluoroaluminate(1-)
  3792. sodium (T-4)-tetrafluorolanthanate(1-)
  3793. sodium (T-4)-tetrahydroaluminate(1-)
  3794. sodium 1,3,5-triphenylpentanetrisulfonate
  3795. sodium 1-amino-4-ethylamino-9,10-dioxoanthracene-2-sulfonate
  3796. Sodium 2,2,6,6-tetramethyl-3,5-heptanedione
  3797. sodium 2,3,4-trihydroxy-4-oxobutanoate hydrate
  3798. sodium 2,3-dimercaptopropanesulfonate dihydrate
  3799. Sodium 2,4,6-trinitrophenolate
  3800. Sodium 2-(2,4-dichlorophenoxy)ethyl sulfate
  3801. sodium 2-(phenylsulfonylamino)benzoate
  3802. Sodium 2-hydroxyethanesulfonate
  3803. Sodium 2-keto-L-gulonate monohydrate
  3804. sodium 2-[1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]acetate
  3805. sodium 3,4-dimethylbenzenesulfonate
  3806. sodium 3-hydroxynaphthalene-2-carboxylate
  3807. Sodium 3-nitro-1,2,4-triazol-5-onate
  3808. Sodium 3-nitro-1,2,4-triazol-5-onate monohydrate
  3809. sodium 3-nitrobenzenesulfonate Sodium 4-nitrobenzenesulfonate (adduct 1:1)
  3810. sodium 4-(dibutylamino)azobenzene-4'-sulfonate
  3811. sodium 4-(diethylamino)azobenzene-4'-sulfonate
  3812. sodium 4-(dipropylamino)azobenzene-4'-sulfonate
  3813. Sodium 4-aminophenazone dithiocarbamate
  3814. sodium 4-bromobenzenesulfonate
  3815. sodium 4-hydroxybenzoate pentahydrate
  3816. Sodium 4-hydroxybutan-1-olate
  3817. sodium 4-phenylbenzenesulfonate
  3818. sodium 4-phenylbenzoate
  3819. sodium 4-phenylphenolate
  3820. sodium 5,5-di(prop-2-enyl)pyrimidin-3-ide-2,4,6-trione
  3821. sodium 5,5-diethyl-4,6-dioxo-1H-pyrimidin-2-olate
  3822. Sodium 5-chlor-anthraquinone-1-sulfonate
  3823. sodium 5-ethyl-5-(3-methylbutyl)-2,4,6-trioxotetrahydro-2H-pyrimidin-1-ide
  3824. Sodium 8-chlor-anthraquinone-1-sulfonate
  3825. sodium acetate bis(acetic acid)
  3826. sodium acetate diformamide dimethanol
  3827. sodium acetate formamide dipropanol
  3828. sodium acetate monoformamide hexahydrate
  3829. sodium acetate monoformamide tetrahydrate
  3830. sodium acetate semihydrate
  3831. sodium acetic acid acetate
  3832. sodium acetylide (Na(C2H))
  3833. sodium acetylide (Na2(C2))
  3834. sodium alloy base Na 54,K 46
  3835. sodium aluminate (AlO2(1-))
  3836. sodium aluminium oxide 2.5-hydrate (Sodium aluminate 2.5-hydrate)
  3837. sodium aluminium sulfate 24-hydrate
  3838. sodium aluminium sulfate hexahydrate
  3839. sodium aluminium sulfate tetradecahydrate
  3840. Sodium aluminum(III) disilicon oxide monohydrate
  3841. Sodium aluminum(III) trisilicon oxide
  3842. sodium amide (Na(NH2))
  3843. sodium ammonium sulfate dihydrate
  3844. Sodium anthraquinone-1,5-disulfonate
  3845. Sodium anthraquinone-1,7-disulfonate
  3846. Sodium anthraquinone-1,8-disulfonate
  3847. Sodium anthraquinone-2,6-sulfonate
  3848. Sodium anthraquinone-2,7-sulfonate
  3849. Sodium antimony(III) diselenium(II)
  3850. sodium arsenate heptasodium hydrogencarbonate
  3851. sodium azide (Na(N3))
  3852. Sodium B-paratungstate
  3853. Sodium B-paratungstate heptacosahydrate
  3854. sodium benzenesulfinate
  3855. Sodium benzyl bis(phenylmethoxy)phosphoryl phosphate
  3856. sodium bis(diethyldithiocarbamodithioato-κS,κS')dioxouranate(1-)
  3857. sodium borate hydrogen peroxide
  3858. sodium borohydride di(dimethylformamide)
  3859. sodium borohydride mono(dimethylformamide)
  3860. sodium borohydride tetra(dimethylformamide)
  3861. sodium bromide (NaBr)
  3862. sodium bromide (NaBr) dihydrate
  3863. sodium bromide chloride
  3864. sodium bromide chloride dihydrate
  3865. sodium bromide diacetamide
  3866. sodium bromide dideuterium oxide
  3867. sodium bromide monourea monohydrate
  3868. sodium bromide pentahydrate
  3869. sodium bromide tetrahydrate
  3870. sodium butane-1-thiolate
  3871. sodium cadmate
  3872. sodium cadmium formate
  3873. sodium cadmium nitrite dihydrate
  3874. sodium calcium nitrite dihydrate
  3875. sodium calcium pentaborate pentahydrate (Ulexit)
  3876. Sodium calcium pentaborate pentahydrate (Ulexite)
  3877. sodium carbonate dihydrate
  3878. sodium carbonate dihydrogen peroxidate monohydrate
  3879. sodium carbonate disulfate (Burkeite)
  3880. sodium carbonate hexahydrate
  3881. sodium carbonate hydrogencarbonate dihydrate (Trona)
  3882. sodium carbonate tetrahydrate
  3883. sodium carbonate trihydrate
  3884. sodium carbonate trihydrogencarbonate
  3885. sodium cesium chromate tetrahydrate
  3886. sodium cesium dichromate
  3887. sodium chloride (Na2Cl2)
  3888. sodium chloride (NaCl)
  3889. sodium chloride (NaCl) dihydrate
  3890. sodium chloride diglucose hydrate
  3891. sodium chloride iodide
  3892. sodium chloride monourea monohydrate
  3893. sodium chloride pentaammonia
  3894. sodium chloride sodium metaborate dihydrate
  3895. Sodium chlorite trihydrate
  3896. sodium chloromethanedisulfonate
  3897. sodium chloromethanedisulfonate hydrate
  3898. sodium chromate hexaurea tetrahydrate
  3899. sodium copper chloride dihydrate
  3900. sodium Copper heptaborate nonohydrate
  3901. sodium copper(I) cyanide
  3902. sodium cyanate
  3903. sodium cyanide (Na(CN))
  3904. sodium cyanide dihydrate
  3905. sodium cyanide hydroxide
  3906. sodium decane-1-sulfonate
  3907. sodium diammonium nitrate
  3908. sodium diborotrihydroxyglutarate tetrahydrate
  3909. sodium diborotrihydroxyglutarate trihydrate
  3910. sodium dicalcium sulfate trihydrate
  3911. Sodium dicesium lanthanum(III) hexachloride
  3912. sodium dichloroargentate(1-)
  3913. Sodium difluorobromoacetate
  3914. Sodium difluorochloroacetate
  3915. sodium dihydrogen arsenate dihydrate
  3916. sodium dihydrogen arsenate monohydrate
  3917. sodium dihydrogen phosphate mono(phosphoric acid)
  3918. sodium dihydroxohexaaluminate pentadecahydrate
  3919. sodium dihydroxy nitrate
  3920. sodium diiodate tribromide decahydrate
  3921. sodium diiodate tribromide pentadecahydrate
  3922. sodium diiodate triiodide decahydrate
  3923. sodium diiodate triiodide eicosahydrate
  3924. sodium diiodate triiodide pentadecahydrate
  3925. sodium diiodide trihydrate
  3926. sodium dimolybdate hexahydrate
  3927. sodium dioxo(phosphato(3-)-κO)uranate(1-)
  3928. Sodium dioxouranium phosphate trihydrate
  3929. sodium disulfite heptahydrate
  3930. sodium disulfite hexa(sodium sulfate)
  3931. sodium disulfite hexahydrate
  3932. sodium ditellurite trihydrate
  3933. sodium dithiomolybdate
  3934. sodium dithionate dihydrate
  3935. sodium dithiotungstate
  3936. sodium dizirconium (IV) orthophosphate
  3937. sodium DL-aspartate
  3938. sodium dodecane-1-sulfonate
  3939. sodium ethanethiol
  3940. sodium fluoride (Na(HF2))
  3941. sodium fluoride (NaF)
  3942. Sodium fluoride acetic acid
  3943. sodium fluoride bis(hydrogen fluoride)
  3944. sodium fluoride compd. with tin fluoride (SnF2) (1:1)
  3945. sodium fluoride compd. with tin fluoride (SnF2) (1:2)
  3946. sodium fluoride compd. with tin fluoride (SnF2) (2:1)
  3947. sodium fluoride sulfate
  3948. sodium fluoride sulfate (Na3F(SO4))
  3949. sodium fluoride tetrakis(hydrogen fluoride)
  3950. sodium fluoride tris(hydrogen fluoride)
  3951. sodium formate bis(acetic acid)
  3952. sodium formate bis(formic acid)
  3953. sodium formate dihydrate
  3954. sodium formate monoacetic acid
  3955. sodium formate trihydrate
  3956. sodium formic acid formate
  3957. Sodium fusidate
  3958. sodium gadolinium titanate
  3959. sodium hexafluorophosphate(1-)
  3960. sodium hexafluorosilicate potassium hexafluorosilicate
  3961. sodium hexahydroxodialuminate heptahydrate
  3962. sodium hexamethyleniminecarbodithioate dihydrate
  3963. sodium hexavanadate dodecahydrate
  3964. sodium hydride (NaH)
  3965. sodium hydrogen (orthosilicato(4-)-κO)dioxouranate(2-) monohydrate
  3966. sodium hydrogen 2,3,4-trihydroxyglutarate monohydrate
  3967. Sodium hydrogen carbonate tetrakis(trimethylene tetraurea)
  3968. sodium hydrogen oxalate monohydrate
  3969. sodium hydrogen pentaborate dihydrate
  3970. sodium hydrogen pentaborate trihydrate
  3971. sodium hydrogen plumbate hexahydate
  3972. Sodium hydrogen succinate trihydrate
  3973. sodium hydrogen sulfate * Sodium sulfate
  3974. sodium hydrogen sulfate * sulfuric acid
  3975. sodium hydrogen sulfate * sulfuric acid * monohydrate
  3976. sodium hydrogen sulfate hydrate
  3977. sodium hydrogen sulfate sodium sulfate monohydrate
  3978. sodium hydrogen tungstate dihydrate
  3979. sodium hydrogencarbonate dihydrate
  3980. sodium hydrogencarbonate monomethylolurea
  3981. sodium hydrogenselenite tri(selenious acid)
  3982. sodium hydrogenselenite trihydrate
  3983. sodium hydrosulfite dihydrate
  3984. sodium hydroxide (Na(OH))
  3985. sodium hydroxide (Na(OH))
  3986. sodium hydroxide (Na(OH))
  3987. sodium hydroxide (Na2(OH)2)
  3988. sodium hydroxide di(sodium tartrate)
  3989. sodium hydroxide dihydrate
  3990. sodium hydroxide heptahydrate
  3991. sodium hydroxide monohydrate
  3992. sodium hydroxide nitrite (Na(OH)0.5(NO2)0.5)
  3993. sodium hydroxide pentahydrate
  3994. sodium hydroxide tetrahydrate
  3995. sodium hydroxide trihydrate
  3996. sodium hydroxy nitrate
  3997. sodium hydroxyacetate
  3998. sodium hydroxymethanesulfinate dihydrate
  3999. Sodium hypochlorite pentahydrate
  4000. sodium hypophosphite monohydrate
  4001. sodium indium(III) diselenate hexahydrate
  4002. sodium iodate 1.5-hydrate
  4003. sodium iodate bis(iodic acid)
  4004. sodium iodate tetra(sodium sulfate)
  4005. sodium iodate tri(sodium sulfate)
  4006. sodium iodide (NaI)
  4007. sodium iodide (NaI) dihydrate
  4008. sodium iodide dideuterium oxide
  4009. sodium iodide diurea monohydrate
  4010. sodium iodide hexaammonia
  4011. sodium iodide pentahydrate
  4012. sodium iodide triacetone
  4013. sodium iodide trimethanol
  4014. sodium iodide tris (N,N-dimethylformamide)
  4015. sodium iodide tris(2-butanone)
  4016. sodium iodide tris(ethylenediamine)
  4017. sodium iodide trisformamide
  4018. sodium ion (Na(1+))
  4019. sodium L-aspartate
  4020. Sodium lanthanum (III) titanate
  4021. Sodium lanthanum chromate
  4022. sodium lanthanum(III) ethylenediamine tetraacetate nonahydrate
  4023. sodium lanthanum(III) ethylenediamine tetraacetate octahydrate
  4024. sodium lanthanum(III) ethylenediamine tetraacetate trihydrate
  4025. sodium lead bromide (3NaBr.4PbBr2) dodekahydrate
  4026. sodium lithium dioxido(oxo)silane
  4027. sodium lithium hexafluorosilicate
  4028. sodium lutetium molybdate phosphate (Na2Lu(MoO4)(PO4))
  4029. Sodium magnesium chlorocarbonate
  4030. sodium magnesium chromate dihydrate
  4031. sodium magnesium hypophosphite
  4032. sodium magnesium manganese neodymium oxide (Na3Mg3Mn4NdO12)
  4033. sodium mandelate monomandelic acid
  4034. sodium mandelate trimandelic acid
  4035. sodium mercury(II)chloride dihydrate
  4036. sodium metaborate dihydrate
  4037. sodium metaborate monohydrate
  4038. sodium metaborate perborate tetrahydrate
  4039. sodium metaborate sodium hydroxide
  4040. sodium metagermanate heptahydrate
  4041. sodium metathiogermanate decahydrate
  4042. sodium metavanadate (V) dihydrate
  4043. Sodium methanesulfonate octahydrate
  4044. Sodium methyl sulfate
  4045. sodium methylsulfonate
  4046. sodium molybdate decahydrate
  4047. sodium monothiomolybdate
  4048. sodium monothiotungstate
  4049. sodium mu-chlorotetrachlorodimagnesate(1-)
  4050. sodium mu-chlorotetrachlorodimagnesate(1-) dodecahydrate
  4051. sodium mu-chlorotetrachlorodimagnesate(1-) octahydrate
  4052. sodium mu-chlorotetrachlorodimagnesate(1-) tetrahydrate
  4053. sodium N,N'-dicyano-4-chlorobenzamidine
  4054. sodium N,N'-dicyano-4-methylbenzamidine
  4055. sodium N,N'-dicyanobenzamidine
  4056. sodium naphthalene-1-sulfonate
  4057. sodium naphthalene-2-carboxylate
  4058. Sodium neodymium chromate
  4059. sodium neodymium titanate
  4060. sodium neodymium tungstate
  4061. sodium niobate(NbO3(1-))
  4062. sodium nitrate compd. with sodium hydroxide (1:2)
  4063. sodium nitrate monobiuret
  4064. sodium nitrate sodium sulfate dihydrate
  4065. sodium nitrate sodium sulfate monohydrate (Darapskit)
  4066. sodium nitrite semihydrate
  4067. sodium octaoxodimolybdatelanthanate(1-)
  4068. sodium octaoxoditungstateneodymate(1-)
  4069. sodium orthophosphate metaborate octadecahydrate
  4070. sodium orthovanadate decahydrate
  4071. sodium orthovanadate dodecahydrate
  4072. sodium orthovanadate heptahydrate
  4073. sodium orthovanadate octahydrate
  4074. sodium ortothiogermanate pentahydrate
  4075. sodium oxalate hydrogen peroxidate
  4076. sodium oxalate oxalic acid dihydrate
  4077. sodium oxide (Na2O)
  4078. sodium oxide (NaO)
  4079. sodium oxide monohydrate
  4080. sodium oxido-oxoborane
  4081. sodium oxolinate dihydrate
  4082. sodium p-anisole sulfonate
  4083. Sodium p-methylphenolate hydrate
  4084. sodium p-sulfonylphenyl hippurate
  4085. Sodium p-toluenesulfonate dihydrate
  4086. Sodium paratungstate
  4087. Sodium paratungstate octacosahydrate
  4088. sodium pentaborate dibasic dihydrate
  4089. sodium pentaborate dibasic monohydrate
  4090. sodium pentaborate dibasic tetrahydrate
  4091. sodium pentaborate monohydrate
  4092. sodium pentaborate pentahydrate
  4093. sodium pentathionate dihydrate
  4094. sodium perborate trihydrate
  4095. sodium perchlorate dimethylformamide
  4096. sodium perchlorate diurea
  4097. Sodium perchlorate hydrate
  4098. sodium perchlorate mono(hexamethylene tetramine)
  4099. sodium perchlorate perchloric acid
  4100. sodium perchlorate tris(ethylenediamine)
  4101. sodium periodate trihydrate
  4102. sodium permanganate monohydrate
  4103. sodium permanganate trihydrate
  4104. sodium peroxide (Na2(O2))
  4105. sodium phenol sulfonate dihydrate
  4106. Sodium phosphide
  4107. sodium plumbite
  4108. sodium potassium carbonate dodecahydrate
  4109. sodium potassium carbonate monohydrate
  4110. Sodium potassium hydrogen phosphate pentahydrate
  4111. sodium potassium metavanadate
  4112. Sodium praseodymium chromate
  4113. sodium praseodymium(III) ethylenediamine tetraacetate octahydrate
  4114. sodium pyroiodate
  4115. sodium pyrovanadate ocatdecahydrate
  4116. sodium pyruvate
  4117. sodium rubidium tetraborate (NaRb(B4O5(OH)4)) tetrahydrate
  4118. sodium salicylate hexahydrate
  4119. Sodium samarium chromate
  4120. sodium selenide (Na2(Se2))
  4121. sodium selenide (Na2(Se3))
  4122. sodium selenide (Na2(Se4))
  4123. sodium selenite octahydrate
  4124. sodium selenite pentahydrate
  4125. sodium silicate hexahydrate
  4126. sodium silicate monohydrate
  4127. sodium silicate nonahydrate
  4128. sodium silicate octahydrate
  4129. sodium silicate pentahydrate
  4130. sodium silicate tris(potassium silicate)heptadecahydrate
  4131. sodium silver dinitrite
  4132. sodium silver thiocyanate dihydrate
  4133. sodium silver thiosulfate dihydrate
  4134. sodium stannate deca(hydrogen peroxide)
  4135. sodium strontium orthoborate
  4136. Sodium succinate hexahydrate
  4137. Sodium succinate monohydrate
  4138. sodium sulfamate monohydrate
  4139. Sodium sulfapyridine
  4140. sodium sulfate carbonate potassium chloride(Hanksite)
  4141. sodium sulfate chloride hydroxide
  4142. sodium sulfate decadeuterium oxide
  4143. sodium sulfate diphosphate
  4144. sodium sulfate heptadeuterium oxide
  4145. sodium sulfate sodium hydrogen sulfate pentahydrate
  4146. sodium sulfate sodium hydroxide
  4147. sodium sulfate tetrahydrate
  4148. sodium sulfate tri(hydrogen peroxidate)
  4149. sodium sulfathiazole hexahydrate
  4150. sodium sulfide (Na2(S4))
  4151. sodium sulfide (Na2(S5))
  4152. sodium sulfide (Na2S)
  4153. sodium sulfide (NaSH)
  4154. sodium sulfide decahydrate
  4155. sodium sulfide hexahydrate
  4156. sodium sulfide monohydrate
  4157. sodium sulfide pentahydrate
  4158. sodium sulfide semihydrate
  4159. sodium sulfite decahydrate
  4160. sodium sulfo sulfate
  4161. sodium superoxide (Na(O2))
  4162. sodium tantalate (TaO3(1-))
  4163. sodium taurochenodeoxycholate
  4164. sodium tellurite pentahydrate
  4165. sodium terbium molybdate phosphate
  4166. sodium tetraborate tris (2-hydroxyethylhydrazine) dihydrate
  4167. sodium tetrachlorooxoniobate(1-)
  4168. sodium tetrachromate tetrahydrate
  4169. sodium tetradecane-1-sulfonate
  4170. sodium tetrafluoroborate(1-)
  4171. sodium tetrahydroborate dihydrate
  4172. sodium tetrahydroborate tripyridine
  4173. sodium tetrahydroborate(1-)
  4174. sodium tetraiodoplumbate(2-) hexahydrate
  4175. Sodium tetrametaphosphate
  4176. sodium tetramolybdate heptahydrate
  4177. sodium tetraphenylborate(1-)
  4178. sodium tetratellurite pentahydrate
  4179. sodium tetrathionate dihydrate
  4180. Sodium tetrazolate
  4181. sodium thiocyanate bis(N,N-dimethylacetamide)
  4182. sodium thiocyanate dihydrate
  4183. sodium thiocyanate dimethylformamide
  4184. sodium thiocyanate mono(N,N-dimethylacetamide)
  4185. sodium thiocyanate monoacetonate
  4186. sodium thiocyanate monohydrate
  4187. sodium thiodigermanate undecahydrate
  4188. Sodium thioglycolate
  4189. sodium thiosulfate hexahydrate
  4190. sodium thulium tellurite
  4191. sodium titanium oxide (Na2Ti3O7)
  4192. sodium titanium oxide (Na2Ti6O13)
  4193. sodium triarsenate
  4194. sodium tricesium bromide
  4195. sodium trichromate monohydrate
  4196. sodium trifluoromanganate(1-)
  4197. sodium triiodoplumbate(1-) tetrahydrate
  4198. Sodium trimetaphosphate
  4199. sodium trimethyl-oxidosilane
  4200. Sodium trimolybdate
  4201. sodium trimolybdate heptahydrate
  4202. sodium trinitrate tetrasulfate
  4203. sodium tripolyphosphate hexahydrate
  4204. sodium tripotassium molybdate
  4205. sodium tris-carbonatocobaltate(III) trihydrate
  4206. sodium trisilver dithiosulfate dihydrate
  4207. sodium tritellurite pentahydrate
  4208. sodium trithallium(I) sulfite
  4209. sodium trithiomolybdate
  4210. sodium trithionate trihydrate
  4211. sodium tungstate bis(sodium 2,3-dimercaptopropanesulfonate) trihydrate
  4212. sodium tungstate decahydrate
  4213. sodium tungstate sodium 2,3-dimercaptopropanesulfonate dihydrate
  4214. sodium tungsten oxide (Na0.49WO3)
  4215. sodium tungsten oxide (Na0.68WO3)
  4216. sodium tungsten oxide (Na0.79WO3)
  4217. sodium tungsten oxide (Na0.7WO3)
  4218. sodium tungsten oxide (Na2W2O7)
  4219. sodium tungsten oxide (Na2W4O13)
  4220. sodium uranate (UO3(1-))
  4221. sodium uranium arsenate oxide (NaU(AsO4)O2)
  4222. sodium uranium arsenate oxide (NaU(AsO4)O2) hydrate (2:3)
  4223. sodium uranium arsenate oxide (NaU(AsO4)O2) monohydrate
  4224. sodium uranium arsenate oxide (NaU(AsO4)O2) trihydrate
  4225. sodium uranium borate oxide (NaU(BO3)O2)
  4226. sodium uranium borate oxide (NaU(BO3)O2) monohydrate
  4227. sodium uranium vanadium oxide (NaUVO6)
  4228. Sodium uranoniobate
  4229. sodium uranyl molybdate
  4230. sodium vanadate (VO3(1-))
  4231. sodium vanadate (VO3(1-))
  4232. sodium vanadium oxide (NaV6O15)
  4233. Sodium warfarinate semi(isopropanol)
  4234. sodium yttrium (III) formate monohydrate
  4235. Sodium yttrium(III) formate
  4236. Sodium yttrium(III) tetra(1,1,1-trifluoro-5,5,5-trimethylacetylacetonate)
  4237. sodium zincate tetrahydrate
  4238. sodium zirconium fluoride monohydrate
  4239. sodium [carbonato(2-)-κO]dioxoneptunate(1-)
  4240. Sodium-2-keto-L-gulonate
  4241. sodium-3-phenylprop-2-enoate
  4242. sodium-potassium alloy
  4243. Sofosbuvir
  4244. solar oil
  4245. sour Natural Gas
  4246. Soya oil 2-Ethylhexyl ester
  4247. soybean oil
  4248. soybean oil
  4249. soybean-oil fatty acids Et esters
  4250. soybean-oil fatty acids Et esters
  4251. spectinomycin dihydrochloride pentahydrate
  4252. Spent coffee grounds biodiesel
  4253. spermaceti
  4254. spindle oil
  4255. spiro(4.5)decan-6-ol
  4256. spiro(bicyclo[6.1.0]nonane-9,1'-cyclopropane)
  4257. spiro(cyclopropane-1,2'-tricyclo(7.1.0.0(1,3))decane)
  4258. spiropentane
  4259. spirophosphorane
  4260. Spirotetramat
  4261. Spiro[1,3-dithiolane-2,9'-fluorene]
  4262. spiro[2,4,5,6-tetrahydro-1H-indene-3,1'-cyclohexane]-1-one
  4263. spiro[2-Carboxyamidomethyl-1,4,5,6-tetrachlorobicyclo[2.2.1]hept-5-ene-7,2'-(N-2-hydroxyethyl)oxazolidine]
  4264. spiro[2-hydroxymethyl-1,4,5,6-tetrachlorobicyclo[2.2.1]hept-5-ene-7,2'-(N-2-hydroxyethyl)oxazolidine]
  4265. spiro[2-phenyl-1,4,5,6-tetrachlorobicyclo[2.2.1]hept-5-ene-7,2'-(N-2-hydroxyethyl)oxazolidine]
  4266. spiro[2.3]hexane
  4267. spiro[4,5,6,7-tetrahydro-2H-indene-3,1'-cyclohexane]-1-one
  4268. spiro[4-ethyl-2,5-dihydro-5-methyl-1H-imidazole-2,1'-cyclohexane]
  4269. spiro[4.4]nonane
  4270. spiro[4.5]decane
  4271. spiro[5.5]undecan-1-ol
  4272. spiro[5.5]undecane
  4273. Spiro[5.6]dodecan-7-one
  4274. spiro[5.6]dodecane
  4275. spiro[bicyclo[2.2.1]heptane-7,2'-(1,3)dioxolane]
  4276. spiro[cyclopropane-1,6'-tricyclo[3.2.1.0(2,4)]octane]
  4277. spodumene
  4278. SRC-I naphtha
  4279. SRC-I naphtha
  4280. SRC-II middle distillate
  4281. SRC-II middle distillate
  4282. SRC-II middle distillate sample
  4283. SRC-II naphtha
  4284. SRC-II syncrude
  4285. Stainless Steel Alloy (Type 316L)
  4286. stannane
  4287. steel
  4288. stereoisomer A of 1,2,3,4-tetrahydro-N-methyl-1,4-methanonaphthalen-9-amine
  4289. stereoisomer B of 1,2,3,4-tetrahydro-N-methyl-1,4-methanonaphthalen-9-amin
  4290. stereomer B of 1,2,3,4-tetrahydro-1,4-methanonaphthalen-9-amin
  4291. Sterigmatocystin
  4292. stibine
  4293. Stigmastanol acetate
  4294. stilbene dichloride
  4295. strengite (Fe(PO4).2H2O)
  4296. strontium
  4297. strontium
  4298. Strontium (2+) cation
  4299. strontium (OC-6-11)-hexakis(cyano-κC)ferrate(3-) (3:2)
  4300. strontium (T-4)-molybdate (MoO4(2-)) (1:1)
  4301. strontium (T-4)-tetrafluorostannate(1-)
  4302. strontium (T-4)-tungstate (WO4(2-)) (1:1)
  4303. strontium (T-4)-uranate (UO4(2-)) (1:1)
  4304. Strontium 1-anthraquinonesulfonate
  4305. strontium 2,2',2'',2'''-(1,2-ethanediyldiammonio)tetraacetate
  4306. Strontium 2-anthraquinonesulfonate
  4307. strontium acetate di(acetic acid) dihydrate
  4308. strontium acetate mono(acetic acid)
  4309. strontium acetate monoformamide
  4310. strontium acetate tetrahydrate
  4311. Strontium anthraquinone-1,5-disulfonate
  4312. Strontium anthraquinone-1,8-disulfonate
  4313. Strontium anthraquinone-2,6-sulfonate
  4314. Strontium anthraquinone-2,7-sulfonate
  4315. strontium antimonate (SbO3(1-)) (1:2)
  4316. strontium arsenate dihydrate
  4317. strontium arsenate heptadecahydrate
  4318. strontium azide (Sr(N3)2)
  4319. strontium bis(diethyldithiocarbamodithioato-κS,κS')dioxouranate(1-) (1:2)
  4320. strontium bismuth oxide (SrBi2O4)
  4321. strontium bismuthate (Bi2O5(4-)) (2:1)
  4322. strontium bis[ethanedioato(2-)-κO,κO']oxotitanate(2-) (1:1)
  4323. strontium borohydride
  4324. strontium borohydride di(tetrahydrofuran)
  4325. strontium bromide (SrBr)
  4326. strontium bromide (SrBr2)
  4327. strontium bromide (SrBr2) hexahydrate
  4328. strontium bromide (SrBr2) monohydrate
  4329. strontium bromide hemimethanol
  4330. strontium bromide heptaurea
  4331. Strontium bromide hydroxide
  4332. strontium bromide hydroxide (SrBr(OH))
  4333. strontium bromide monoacetic acid
  4334. strontium bromide sesquimethanol
  4335. strontium bromide tetra (diacetone alcohol)
  4336. strontium bromide triurea
  4337. strontium cadmium chloride pentahydrate
  4338. strontium cerium tellurite
  4339. strontium chloride (SrCl)
  4340. strontium chloride (SrCl2)
  4341. strontium chloride (SrCl2) dihydrate
  4342. strontium chloride (SrCl2) hexahydrate
  4343. strontium chloride (SrCl2) hydrate (2:1)
  4344. strontium chloride (SrCl2) monohydrate
  4345. strontium chloride bis(hexamethylenetetramine) octahydrate
  4346. strontium chloride di(deuterium oxide)
  4347. strontium chloride diurea monohydrate
  4348. strontium chloride hexa(deuterium oxide)
  4349. Strontium chloride hydroxide
  4350. strontium chloride hydroxide (SrCl(OH))
  4351. strontium chloride mono(deuterium oxide)
  4352. strontium chloride tetraurea
  4353. strontium chloride tris(dimethyl sulfoxide)
  4354. strontium chromate (CrO3(2-)) (1:1)
  4355. strontium chromate (SrCrO2)
  4356. Strontium diacetate
  4357. Strontium dicalcium propionate
  4358. strontium diethoxide
  4359. strontium diethoxide diethanol
  4360. strontium diethoxide tetraethanol
  4361. strontium dihydrogen phosphate
  4362. strontium diiodide hexahydrate
  4363. strontium dimandelate dimandelic acid
  4364. strontium diniobium oxide
  4365. strontium dirubidium nitrite
  4366. strontium dirubidium nitrite monohydrate
  4367. strontium dithionate tetrahydrate
  4368. strontium ferrate (SrFeO2)
  4369. strontium fluoride (SrF)
  4370. strontium fluoride (SrF2)
  4371. strontium fluoride di(hydrogen fluoride)
  4372. strontium fluoride mono(acetic acid)
  4373. strontium fluoride mono(hydrogen fluoride)
  4374. strontium fluoride tri(hydrogen fluoride)
  4375. strontium formate dihydrate
  4376. strontium germanate
  4377. strontium hexafluorosilicate dihydrate
  4378. strontium hexafluorosilicate(2-) (1:1)
  4379. strontium hydrogen arsenate monohydrate
  4380. Strontium hydrogen phosphate
  4381. strontium hydrogen selenite
  4382. strontium hydroxide (Sr(OH))
  4383. strontium hydroxide (Sr(OH)2)
  4384. strontium hydroxide (Sr(OH)2) octahydrate
  4385. strontium hydroxide iodide (Sr(OH)I)
  4386. strontium hydroxide monohydrate
  4387. Strontium iodate monodeuterium oxide
  4388. strontium iodide (SrI)
  4389. strontium iodide (SrI2)
  4390. strontium iodide di(methyl isobutyl ketone)
  4391. strontium iodide di(strontium hydroxide) heptahydrate
  4392. strontium iodide dihydrate
  4393. strontium iodide dodecahydrate
  4394. Strontium iodide hydroxide
  4395. strontium iodide tetra(mesityl oxide)
  4396. strontium iodide triurea
  4397. strontium ion (Sr(2+))
  4398. Strontium mercury dioxide
  4399. strontium methanolate
  4400. strontium molybdate (MoO3(2-)) (1:1)
  4401. strontium monoarsenite
  4402. strontium niobate(Nb2O7(4-)) (2:1)
  4403. strontium nitrate dihydrate
  4404. strontium nitrate monohydrate
  4405. strontium nitrite monohydrate
  4406. strontium nitrite tetrahydrate
  4407. strontium oxalate hydrate
  4408. strontium oxide (SrO)
  4409. Strontium pentaoxoditellurate(IV)
  4410. strontium perchlorate bisurea
  4411. strontium perchlorate dihydrate
  4412. strontium perchlorate hexahydrate
  4413. strontium perchlorate hexamethanol
  4414. strontium perchlorate octa-methanol
  4415. strontium perchlorate octahydrate
  4416. strontium perchlorate pentaurea
  4417. strontium perchlorate tetrahydrate
  4418. strontium perchlorate urea monohydrate
  4419. strontium phosphate chloride (Sr10(PO4)6Cl2)
  4420. strontium plumbate (PbO3(2-)) (1:1)
  4421. Strontium selenide
  4422. strontium selenite
  4423. strontium sulfate trihydrate
  4424. Strontium sulfide
  4425. Strontium telluride
  4426. strontium tetrafluoroborate(1-)
  4427. strontium tetrahydrogen diarsenate
  4428. strontium thallium nitrite trihydrate
  4429. strontium titanate (SrTiO4)
  4430. strontium titanium oxide (Sr2TiO4)
  4431. strontium titanium oxide (SrTiO3)
  4432. strontium titanosilicate
  4433. strontium trimercury(II) chloride octahydrate
  4434. strontium uranium arsenate oxide (SrU2(AsO4)2O4) octahydrate
  4435. strontium uranium borate oxide (SrU2(BO3)2O4) dihydrate
  4436. strontium uranium oxide (Sr3U11O36)
  4437. strontium uranium oxide (Sr3U2O9)
  4438. strontium uranium oxide phosphate (SrU2O4(PO4)2) octahydrate
  4439. strontium uranyl oxalate tetrahydrate
  4440. strontium vanadate (V2O6(2-)) (1:1)
  4441. strontium zinc chloride pentahydrate
  4442. strontium zirconium oxide (Sr3Zr2O7)
  4443. strontium zirconium oxide (Sr4Zr3O10)
  4444. strontium zirconium oxide (SrZrO3)
  4445. Strontium zirconium phosphate
  4446. Strontium(II) 8-hydroxyquinolinate
  4447. Strontium(II) bis(3-nitro-1,2,4-triazol-5-onate) hexahydrate
  4448. Strontium(II) hydrogen nitrilotriacetate
  4449. Strontium(II) hydrogen nitrilotriacetate dihydrate
  4450. Strontium(II) zirconium(II) silicon oxide
  4451. Strontium-praseodymium oxysilicate
  4452. Strophanthidin
  4453. strychnidin-10-one
  4454. Styryl sulfone
  4455. Succinic acid bicyclo[2.2.1]hept-2-yl ethyl ester
  4456. Succinic acid bicyclo[2.2.1]hept-2-yl heptyl ester
  4457. Succinic acid bicyclo[2.2.1]hept-2-yl isopropyl ester
  4458. succinic acid diurea
  4459. Succinic acid mono-bicyclo[2.2.1]hept-2-yl ester
  4460. Sucrose distearate
  4461. sucrose monopalmitate blend
  4462. sucrose monostearate blend
  4463. Sulfamethazine monohydrate
  4464. Sulfamethazine salicylic acid co-crystal (1:1)
  4465. Sulfamethazine-Saccharin Cocrystal (1:1)
  4466. sulfamic acid
  4467. sulfamic acid barium salt (2:1)
  4468. sulfamic acid cobalt(2+) salt (2:1)
  4469. sulfamic acid lead(2+) salt (2:1)
  4470. sulfamic acid lithium salt
  4471. sulfamic acid magnesium salt (2:1)
  4472. sulfamic acid monoammonium salt
  4473. sulfamic acid monopotassium salt
  4474. sulfamic acid monosodium salt
  4475. sulfamic acid nickel(2+) salt (2:1)
  4476. sulfamic calcium acid salt (2:1)
  4477. Sulfamonomethoxine monohydrate
  4478. sulfanylideneiron
  4479. sulfate
  4480. Sulfide anion
  4481. sulfinylbis(methane-d3)
  4482. sulfinylbis(trifluoromethane)
  4483. sulfinylbismethane
  4484. Sulfite (2-) Anion
  4485. sulfoacetic acid barium salt (1:1)
  4486. sulfobutanedioic acid 1,4-bis(2,2,3,3,3-pentafluoropropyl)ester sodium salt
  4487. sulfobutanedioic acid 1,4-bis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl) ester
  4488. sulfobutanedioic acid 1,4-bis(2,2,3,3,4,4,5,5-octafluoropentyl) ester
  4489. sulfobutanedioic acid 1,4-bis(2,2,3,3-tetrafluoropropyl) ester
  4490. sulfobutanedioic acid 1,4-bis(2,2,3,3-tetrafluoropropyl)ester sodium salt
  4491. sulfobutanedioic acid 1,4-bis(2,2,3,4,4,4-hexafluorobutyl)ester sodium salt
  4492. sulfobutanedioic acid 1,4-bis(2-ethylhexyl) ester
  4493. sulfobutanedioic acid 1,4-bis(3,3,4,4,5,5,6,6,6-nonafluorohexyl)ester sodium salt
  4494. sulfobutanedioic acid 1,4-dibutyl ester
  4495. sulfobutanedioic acid 1,4-didecyl ester
  4496. sulfobutanedioic acid 1,4-dihexyl ester
  4497. sulfobutanedioic acid 1,4-dioctyl ester
  4498. sulfonylbis(chloromethane)
  4499. sulfonylbis(dichloromethane)
  4500. sulfonylbis(trichloromethane)
  4501. sulfonylbis-1,3-isobenzofurandione
  4502. sulfonylbismethane
  4503. Sulfonyldiacetic Acid
  4504. sulfur
  4505. sulfur bromide (S2Br2)
  4506. sulfur chloride (S2Cl2)
  4507. sulfur chloride (SCl2)
  4508. sulfur dioxide
  4509. sulfur dioxide-18O
  4510. sulfur fluoride (S2F10)
  4511. sulfur fluoride (S2F2) isomer FS2F
  4512. sulfur fluoride (S2F2) isomer SSF2
  4513. sulfur fluoride (SF)
  4514. sulfur fluoride (SF2)
  4515. sulfur fluoride (SF3)
  4516. sulfur fluoride (SF5)
  4517. sulfur fluoride fluorosulfate (SF4(SFO3)2)
  4518. sulfur oxide (S2O)
  4519. sulfur oxide (SO)
  4520. sulfur(VI) trioxide
  4521. sulfuric acid
  4522. sulfuric acid aluminum ammonium salt (2:1:1)
  4523. sulfuric acid aluminum ammonium salt (2:1:1) dodecahydrate
  4524. sulfuric acid aluminum ammonium salt (4:2:2)
  4525. sulfuric acid aluminum cesium salt (2:1:1)
  4526. sulfuric acid aluminum lithium salt (2:1:1)
  4527. sulfuric acid aluminum magnesium salt (4:2:1)
  4528. sulfuric acid aluminum potassium salt (2:1:1)
  4529. sulfuric acid aluminum potasssium salt (2:1:1) dodecahydrate
  4530. sulfuric acid aluminum rubidium salt (2:1:1)
  4531. sulfuric acid aluminum salt (2:1) compd. with hydrazine (1:1)
  4532. sulfuric acid aluminum salt (2:1) compd. with N-methylmethanamine (1:1) hexahydrate
  4533. sulfuric acid aluminum salt (3:2)
  4534. sulfuric acid aluminum salt (3:2) hydrate (1:16.3)
  4535. sulfuric acid aluminum sodium salt (2:1:1) dodecahydrate
  4536. sulfuric acid aluminum thallium(1+) salt (2:1:1)
  4537. sulfuric acid aluminum zinc(2+) salt (4:2:1)
  4538. sulfuric acid ammonium cadmium salt (2:2:1)
  4539. sulfuric acid ammonium cadmium salt (2:2:1) hexahydrate
  4540. sulfuric acid ammonium cadmium salt (3:2:2)
  4541. sulfuric acid ammonium chromium(3+) salt (2:1:1)
  4542. sulfuric acid ammonium cobalt(2+) salt (2:2:1)
  4543. sulfuric acid ammonium cobalt(2+) salt (2:2:1) hexahydrate
  4544. sulfuric acid ammonium copper(2+) salt (2:2:1)
  4545. sulfuric acid ammonium iron(2+) salt (2:2:1)
  4546. sulfuric acid ammonium iron(2+) salt (2:2:1) hexahydrate
  4547. sulfuric acid ammonium iron(3+) salt (2:1:1)
  4548. sulfuric acid ammonium lithium salt
  4549. sulfuric acid ammonium lithium salt (2:2:2)
  4550. sulfuric acid ammonium magnesium salt (2:2:1)
  4551. sulfuric acid ammonium magnesium salt (2:2:1) hexahydrate
  4552. sulfuric acid ammonium manganese(2+) salt (2:2:1)
  4553. sulfuric acid ammonium manganese(2+) salt (2:2:1) hexahydrate
  4554. sulfuric acid ammonium nickel(2+) salt (2:2:1)
  4555. sulfuric acid ammonium scandium(3+) salt (2:1:1)
  4556. sulfuric acid ammonium vanadium(3+) salt (2:1:1)
  4557. sulfuric acid ammonium zinc salt (2:2:1) hexahydrate
  4558. sulfuric acid ammonium zinc(2+) salt (2:2:1)
  4559. sulfuric acid barium salt (1:1)
  4560. sulfuric acid beryllium salt (1:1)
  4561. sulfuric acid beryllium salt (1:1)
  4562. sulfuric acid beryllium salt (1:1)
  4563. sulfuric acid beryllium salt (1:1)
  4564. sulfuric acid beryllium salt (1:1) dihydrat
  4565. sulfuric acid beryllium salt (1:1) tetrahydrate
  4566. sulfuric acid beryllium salt (1:1)hexahydrat
  4567. sulfuric acid bis(1-methylethyl) ester
  4568. sulfuric acid cadmium cesium salt (2:1:2)
  4569. sulfuric acid cadmium potassium salt (2:1:2)
  4570. sulfuric acid cadmium potassium salt (3:2:2)
  4571. sulfuric acid cadmium salt (1:1)
  4572. sulfuric acid cadmium salt (1:1) hydrate (3:8)
  4573. sulfuric acid cadmium salt (1:1) monohydrate
  4574. sulfuric acid cadmium(2+) rubidium salt (2:1:2)
  4575. sulfuric acid calcium potassium salt (3:2:2)
  4576. sulfuric acid calcium salt (1:1)
  4577. sulfuric acid calcium salt (1:1)
  4578. sulfuric acid calcium salt (1:1) dihydrate
  4579. sulfuric acid calcium salt hydrate (2:2:1)
  4580. sulfuric acid cerium(3+) salt (3:2)
  4581. sulfuric acid cesium chromium(3+) salt (2:1:1)
  4582. sulfuric acid cesium cobalt(2+) salt (2:2:1)
  4583. sulfuric acid cesium copper(2+) salt (2:2:1)
  4584. sulfuric acid cesium indium salt (2:1:1)
  4585. sulfuric acid cesium iron(2+) salt (2:2:1)
  4586. sulfuric acid cesium iron(3+) salt (2:1:1)
  4587. sulfuric acid cesium lithium salt
  4588. sulfuric acid cesium magnesium salt (2:2:1)
  4589. sulfuric acid cesium manganese(2+) salt (2:2:1)
  4590. sulfuric acid cesium nickel(2+) salt (2:2:1)
  4591. sulfuric acid cesium scandium(3+) salt (2:1:1)
  4592. sulfuric acid cesium vanadium(3+) salt (2:1:1)
  4593. sulfuric acid cesium zinc salt (2:2:1)
  4594. sulfuric acid chromium(2+) salt (1:1)
  4595. sulfuric acid chromium(3+) potassium salt (2:1:1)
  4596. sulfuric acid chromium(3+) rubidium salt (2:1:1)
  4597. sulfuric acid chromium(3+) salt (3:2)
  4598. sulfuric acid chromium(3+) salt (3:2) octadecahydrate
  4599. sulfuric acid chromium(3+) thallium(1+) salt (2:1:1)
  4600. sulfuric acid cobalt potassium salt (2:1:2) hexahydrate
  4601. sulfuric acid cobalt(2+) potassium salt (2:1:2)
  4602. sulfuric acid cobalt(2+) rubidium salt (2:1:2)
  4603. sulfuric acid cobalt(2+) salt (1:1)
  4604. sulfuric acid cobalt(2+) salt (1:1) heptahydrate
  4605. sulfuric acid cobalt(2+) salt (1:1) hexahydrate
  4606. sulfuric acid cobalt(2+) salt (1:1) monohydrate
  4607. sulfuric acid copper(2+) potassium salt (2:1:2)
  4608. sulfuric acid copper(2+) potassium salt (2:1:2) hexahydrate
  4609. sulfuric acid copper(2+) rubidium salt (2:1:2)
  4610. sulfuric acid copper(2+) salt (1:1)
  4611. sulfuric acid copper(2+) salt (1:1) pentahydrate
  4612. sulfuric acid copper(2+) salt compd. with L-glutamic acid and L-arginine (1:1:1:1) pentahydrate
  4613. sulfuric acid copper(2+) salt dihydrate
  4614. sulfuric acid copper(2+) thallium(1+) salt (2:1:2)
  4615. sulfuric acid diammonium salt
  4616. sulfuric acid diammonium salt
  4617. sulfuric acid diammonium salt
  4618. sulfuric acid dibutyl ester
  4619. sulfuric acid dicesium salt
  4620. sulfuric acid dicopper(1+) salt
  4621. sulfuric acid diethyl ester
  4622. sulfuric acid diheptyl ester
  4623. sulfuric acid dihexyl ester
  4624. sulfuric acid dihydrate
  4625. sulfuric acid dilithium salt
  4626. sulfuric acid dilithium salt monohydrate
  4627. sulfuric acid dimercury(1+) salt
  4628. sulfuric acid dimethyl ester
  4629. sulfuric acid dipentyl ester
  4630. sulfuric acid dipotassium salt
  4631. sulfuric acid dipropyl ester
  4632. sulfuric acid dirubidium salt
  4633. sulfuric acid disilver(1+) salt
  4634. sulfuric acid disodium manganese salt dihydrate
  4635. sulfuric acid disodium salt
  4636. sulfuric acid disodium salt
  4637. sulfuric acid disodium salt
  4638. sulfuric acid disodium salt
  4639. sulfuric acid disodium salt
  4640. sulfuric acid disodium salt decahydrate
  4641. sulfuric acid disodium salt heptahydrate
  4642. sulfuric acid dithallium(1+) salt
  4643. sulfuric acid dysprosium(3+) salt (3:2)
  4644. sulfuric acid erbium(3+) salt (3:2)
  4645. sulfuric acid europium(2+) salt (1:1)
  4646. sulfuric acid europium(3+) salt (3:2)
  4647. sulfuric acid gadolinium(3+) salt (3:2)
  4648. sulfuric acid gallium(3+) salt (3:2)
  4649. sulfuric acid hafnium(4+) salt (2:1)
  4650. sulfuric acid holmium(3+) salt (3:2)
  4651. sulfuric acid indium(3+) salt (3:2)
  4652. sulfuric acid indium(3+) salt (3:2) nonahydrate
  4653. sulfuric acid iron(2+) potassium salt (2:1:2)
  4654. sulfuric acid iron(2+) potassium salt (2:1:2) hexahydrate
  4655. sulfuric acid iron(2+) rubidium salt (2:1:2)
  4656. sulfuric acid iron(2+) salt (1:1)
  4657. sulfuric acid iron(2+) salt (1:1) heptahydrate
  4658. sulfuric acid iron(2+) salt (1:1) monohydrate
  4659. sulfuric acid iron(2+) salt (1:1) tetrahydrate
  4660. sulfuric acid iron(2+) sodium salt (2:1:2) tetrahydrate
  4661. sulfuric acid iron(3+) potassium salt (2:1:1) heptahydrate
  4662. sulfuric acid iron(3+) rubidium salt (2:1:1)
  4663. sulfuric acid iron(3+) rubidium salt (2:1:1) dodecahydrate
  4664. sulfuric acid iron(3+) salt (3:2)
  4665. sulfuric acid iron(3+) salt (3:2) nonahydrate
  4666. sulfuric acid iron(3+) thallium(1+) salt (2:1:1)
  4667. sulfuric acid lanthanum(3+) salt (3:2)
  4668. sulfuric acid lead(2+) salt (1:1)
  4669. sulfuric acid lithium potassium salt
  4670. sulfuric acid lithium potassium salt (2:2:2)
  4671. sulfuric acid lutetium(3+) salt (3:2)
  4672. sulfuric acid magnesium potassium salt (2:1:2)
  4673. sulfuric acid magnesium potassium salt (2:1:2) hexahydrate
  4674. sulfuric acid magnesium rubidium salt (2:1:2)
  4675. sulfuric acid magnesium salt (1:1)
  4676. sulfuric acid magnesium salt (1:1) dodecahydrate
  4677. sulfuric acid magnesium salt (1:1) heptahydrate
  4678. sulfuric acid magnesium salt (1:1) hexahydrate
  4679. sulfuric acid magnesium salt (1:1) hydrate (4:5)
  4680. sulfuric acid magnesium salt (1:1) monohydrate
  4681. sulfuric acid magnesium salt (1:1) pentahydrate
  4682. sulfuric acid magnesium salt (1:1) tetrahydrate
  4683. sulfuric acid magnesium sodium salt (2:1:2)
  4684. sulfuric acid magnesium sodium salt (4:1:6)
  4685. sulfuric acid manganese(2+) potassium salt (2:1:2) tetrahydrate
  4686. sulfuric acid manganese(2+) potassium salt (3:2:2)
  4687. sulfuric acid manganese(2+) rubidium salt (3:2:2)
  4688. sulfuric acid manganese(2+) salt (1:1)
  4689. sulfuric acid manganese(2+) salt (1:1) dihydrate
  4690. sulfuric acid manganese(2+) salt (1:1) monohydrate
  4691. sulfuric acid manganese(2+) salt (1:1) pentahydrate
  4692. sulfuric acid manganese(2+) salt (1:1) tetrahydrate
  4693. sulfuric acid mercury(2+) salt (1:1)
  4694. sulfuric acid mixt. with sulfur trioxide
  4695. sulfuric acid mono(2-butoxyethyl) ester sodium salt
  4696. sulfuric acid mono(2-ethoxyethyl) ester sodium salt
  4697. sulfuric acid mono(2-methoxyethyl) ester sodium salt
  4698. sulfuric acid mono(2-propoxyethyl) ester sodium salt
  4699. sulfuric acid monoammonium salt
  4700. sulfuric acid monocesium salt
  4701. sulfuric acid monodecyl ester sodium salt
  4702. sulfuric acid monododecyl ester sodium salt
  4703. sulfuric acid monoethyl ester
  4704. sulfuric acid monoethyl ester erbium(3+) salt
  4705. sulfuric acid monoethyl ester holmium(3+) salt
  4706. sulfuric acid monoethyl ester lanthanum(3+) salt
  4707. sulfuric acid monoethyl ester neodymium(3+) salt
  4708. sulfuric acid monoethyl ester samarium(3+) salt
  4709. sulfuric acid monoethyl ester yttrium(3+) salt
  4710. sulfuric acid monohydrate
  4711. sulfuric acid monolithium salt
  4712. sulfuric acid monomethyl ester
  4713. sulfuric acid monooctadecyl ester ion(1-)
  4714. sulfuric acid monopotassium salt
  4715. sulfuric acid monorubidium salt
  4716. sulfuric acid monosodium salt
  4717. sulfuric acid mono[2-(2-butoxyethoxy)ethyl] ester sodium salt
  4718. sulfuric acid mono[2-(2-methoxyethoxy)ethyl] ester sodium salt
  4719. sulfuric acid neodymium(3+) salt (3:2)
  4720. sulfuric acid nickel sodium salt (2:1:2)
  4721. sulfuric acid nickel(2+) potassium salt (2:1:2)
  4722. sulfuric acid nickel(2+) rubidium salt (2:1:2)
  4723. sulfuric acid nickel(2+) salt (1:1)
  4724. sulfuric acid nickel(2+) salt (1:1) heptahydrate
  4725. sulfuric acid nickel(2+) salt (1:1) hexahydrate
  4726. sulfuric acid nickel(2+) salt (1:1) monohydrate
  4727. sulfuric acid nickel(2+) thallium(1+) salt (2:1:2)
  4728. sulfuric acid phenyl ester barium salt (2:1)
  4729. sulfuric acid potassium scandium(3+) salt (2:1:1)
  4730. sulfuric acid potassium sodium salt (2:3:1)
  4731. sulfuric acid potassium zinc salt (2:2:1)
  4732. sulfuric acid praseodymium(3+) salt (3:2)
  4733. sulfuric acid radium salt (1:1)
  4734. sulfuric acid rubidium scandium(3+) salt (2:1:1)
  4735. sulfuric acid rubidium uranium(4+) salt (3:2:1)
  4736. sulfuric acid rubidium vanadium(3+) salt (2:1:1)
  4737. sulfuric acid rubidium zinc salt (2:2:1)
  4738. sulfuric acid samarium(3+) salt (3:2)
  4739. sulfuric acid scandium(3+) salt (3:2)
  4740. sulfuric acid scandium(3+) sodium salt (3:1:3)
  4741. sulfuric acid sodium yttrium(3+) salt (4:2:2) dihydrate
  4742. sulfuric acid sodium zinc salt (2:2:1)
  4743. sulfuric acid sodium zinc(2+) salt (2:2:1) tetrahydrate
  4744. sulfuric acid strontium salt (1:1)
  4745. sulfuric acid terbium(3+) salt
  4746. sulfuric acid tetrahydrate
  4747. sulfuric acid thallium(1+) vanadium(3+) salt (2:1:1)
  4748. sulfuric acid thallium(1+) zinc salt (2:2:1)
  4749. sulfuric acid thallium(3+) salt (3:2)
  4750. sulfuric acid thorium(4+) salt (2:1)
  4751. sulfuric acid tin(2+) salt (1:1)
  4752. sulfuric acid trihydrate
  4753. sulfuric acid uranium(4+) salt (2:1)
  4754. sulfuric acid ytterbium(3+) salt (3:2)
  4755. sulfuric acid yttrium(3+) salt (3:2)
  4756. sulfuric acid zinc salt (1:1)
  4757. sulfuric acid zinc salt (1:1) heptahydrate
  4758. sulfuric acid zinc salt (1:1) hexahydrate
  4759. sulfuric acid zinc salt (1:1) monohydrate
  4760. sulfuric acid zirconium(4+) salt (2:1)
  4761. sulfuric acid-d2
  4762. sulfuric acid; urea
  4763. sulfurid acid monoammonium salt compd. with nitric acid ammonium salt
  4764. sulfurofluoridic acid fluoride
  4765. sulfurous aci bis(2,3-dichloropropyl) ester
  4766. sulfurous acid
  4767. sulfurous acid 2-(4-(1,1-dimethylethyl)phenoxy)cyclohexyl 2-propynyl ester
  4768. sulfurous acid barium salt (1:1)
  4769. sulfurous acid bis(1-methylethyl) ester
  4770. sulfurous acid bis(2,2,3,3,4,4,5,5-octafluoropentyl) ester
  4771. sulfurous acid bis(2,2-dimethylpropyl) ester
  4772. sulfurous acid bis(2-bromoethyl) ester
  4773. sulfurous acid bis(2-methylpropyl) ester
  4774. sulfurous acid bis(3-chloropropyl) ester
  4775. sulfurous acid bis[1-(1-methylethyl)-2,2-dimethylpropyl] ester
  4776. sulfurous acid cadmium salt (1:1)
  4777. sulfurous acid calcium salt (1:1)
  4778. sulfurous acid diammonium salt
  4779. sulfurous acid dibutyl ester
  4780. sulfurous acid dicesium salt
  4781. sulfurous acid dicyclohexyl ester
  4782. sulfurous acid diethyl ester
  4783. sulfurous acid diheptyl ester
  4784. sulfurous acid dihexyl ester
  4785. sulfurous acid dimethyl ester
  4786. sulfurous acid dipentyl ester
  4787. sulfurous acid diphenyl ester
  4788. sulfurous acid dipotassium salt
  4789. sulfurous acid dipropyl ester
  4790. sulfurous acid dirubidium salt
  4791. sulfurous acid disilver(1+) salt
  4792. sulfurous acid disodium salt
  4793. sulfurous acid disodium salt heptahydrate
  4794. sulfurous acid dithallium(1+) salt
  4795. sulfurous acid ethyl methyl ester
  4796. sulfurous acid magnesium salt (1:1)
  4797. sulfurous acid magnesium salt (2:1)
  4798. sulfurous acid monoammonium salt
  4799. sulfurous acid monopotassium salt
  4800. sulfurous acid monosodium salt
  4801. sulfurous acid zinc salt (1:1)
  4802. sulfurous acid zinc salt (2:1)
  4803. sulfuryl bromide fluoride
  4804. sulfuryl chloride
  4805. sulfuryl chloride fluoride
  4806. sulfuryl fluoride
  4807. sulfuryl fluoride isocyanate
  4808. sunflower oil
  4809. sunflower oil
  4810. sunflower oil
  4811. Sunitinib malate
  4812. superoxide
  4813. swine lard oil biodiesel
  4814. sym-(n-Decyl)-dibenzo-16-crown-5-oxyacetic acid
  4815. sym-(n-Tetradecane)-dibenzo-16-crown-5-oxyacetic acid
  4816. sym-(tetraethyl diallyl disilicate)
  4817. sym-N-trifluoroacetylphenylalanine anhydride
  4818. syn-3-(1-acetylamino-2-methyl-3-oxo-3-phenylpropyl)phenol acetate
  4819. syn-Dechlorane plus
  4820. syn-N-(2-methyl-3-oxo-1,3-diphenylpropyl)acetamide
  4821. syn-N-1-[2-methyl-3-oxo-1-phenylbutyl]acetamide
  4822. syn-N-[1-(4-chlorophenyl)-2-methyl-3-oxo-3-phenylpropyl]acetamide
  4823. syn-N-[2-methyl-1-(4-methylphenyl)-3-oxo-3-phenylpropyl]acetamide
  4824. syn-N-[2-methyl-1-(4-methylphenyl)-3-oxo-butyl]acetamide
  4825. synephrine
  4826. synthetic crude oil
  4827. synthetic Natural Gas Mixture
  4828. synthetic oil
  4829. synthoil distillate
  4830. synthoil distillate
  4831. Syringyl alcohol
  4832. systol T 124
  4833. talc (Mg3H2(SiO3)4)
  4834. Tallium mandelate monomandelic acid
  4835. tallow
  4836. tallow fatty acids Et esters
  4837. tamoxifen
  4838. Tangeritin
  4839. Tanium(IV)(di(2,4-dihydroxybenzly)-benzidine trichloride)
  4840. tantalum
  4841. tantalum boride (TaB2)
  4842. tantalum bromide (TaBr5)
  4843. tantalum carbide
  4844. tantalum chloride (TaCl4)
  4845. tantalum chloride (TaCl5)
  4846. tantalum fluoride (TaF)
  4847. tantalum fluoride (TaF2)
  4848. tantalum fluoride (TaF3)
  4849. tantalum fluoride (TaF4)
  4850. tantalum fluoride (TaF5)
  4851. tantalum hydride (Ta2D)
  4852. tantalum iodide (TaI5)
  4853. tantalum oxide (Ta2O5)
  4854. tantalum oxide (TaO)
  4855. tantalum oxide (TaO2)
  4856. tantalum silicide (TaSi2)
  4857. Tantalum(V) nitrosyl fluoride
  4858. tantalum(V) pentapropoxide
  4859. tar oil
  4860. tar oil
  4861. taranakite (Al5K3H6(PO4)8.xH2O)
  4862. Taraxasterol
  4863. TAS 130
  4864. TAS 155
  4865. TAS 160
  4866. TAS 183s
  4867. TAS 190
  4868. Tb (3+) Cation
  4869. technetium fluoride (TcF5)
  4870. telluric acid (H2Te2O5)
  4871. telluric acid (H2Te2O5) copper(2+) salt (1:1)
  4872. telluric acid (H2Te2O5) magnesium salt (1:1)
  4873. telluric acid (H2Te2O5) manganese(2+) salt (1:1)
  4874. telluric acid (H2TeO3)
  4875. telluric acid (H2TeO3) barium salt (1:1)
  4876. telluric acid (H2TeO3) cadmium magnesium salt (2:1:1)
  4877. telluric acid (H2TeO3) cadmium salt (1:1)
  4878. telluric acid (H2TeO3) calcium cadmium salt (2:1:1)
  4879. telluric acid (H2TeO3) cerium(4+) salt (2:1)
  4880. telluric acid (H2TeO3) cobalt(2+) salt (1:1)
  4881. telluric acid (H2TeO3) dilithium salt
  4882. telluric acid (H2TeO3) dipotassium salt
  4883. telluric acid (H2TeO3) dirubidium salt
  4884. telluric acid (H2TeO3) disodium salt
  4885. telluric acid (H2TeO3) dysprosium(3+) salt (3:2)
  4886. telluric acid (H2TeO3) erbium(3+) salt (3:2)
  4887. telluric acid (H2TeO3) gadolinium(3+) salt (3:2)
  4888. telluric acid (H2TeO3) gallium salt (3:2)
  4889. telluric acid (H2TeO3) holmium(3+) salt (3:2)
  4890. telluric acid (H2TeO3) indium(3+) salt (3:2)
  4891. telluric acid (H2TeO3) lanthanum(3+) salt (3:2)
  4892. telluric acid (H2TeO3) magnesium salt (1:1)
  4893. telluric acid (H2TeO3) manganese(2+) salt (1:1)
  4894. telluric acid (H2TeO3) strontium salt (1:1)
  4895. telluric acid (H2TeO3) terbium(3+) salt (3:2)
  4896. telluric acid (H2TeO3) thallium(3+) salt
  4897. telluric acid (H2TeO3) thorium(4+) salt (2:1)
  4898. telluric acid (H2TeO3) thulium(3+) salt (3:2)
  4899. telluric acid (H2TeO3) ytterbium(3+) salt (3:2)
  4900. telluric acid (H2TeO3) yttrium(3+) salt (3:2)
  4901. telluric acid (H2TeO3) zinc salt (1:1)
  4902. telluric acid (H2TeO4) dicopper(1+) salt
  4903. telluric acid (H2TeO4) dipotassium salt
  4904. telluric acid (H2TeO4) disodium salt
  4905. telluric acid (H2TeO4) zinc salt (1:1)
  4906. tellurim fluoride (Te2F10)
  4907. tellurium
  4908. tellurium 85, silicium 15 (atomic)
  4909. tellurium alloy base Te 83,Pb 17
  4910. tellurium alloy base Te 85,Bi 15
  4911. tellurium alloy base Te 86,Sn 14
  4912. tellurium alloy base Te 91,Ge 9.1
  4913. tellurium alloy base, Te 89,Sb 11
  4914. tellurium chloride (TeCl2)
  4915. tellurium chloride oxide (Te6Cl2O11)
  4916. tellurium oxide (TeO2)
  4917. tellurium terbium oxide (Te4Tb2O11)
  4918. tellurium thulium oxide (Te4Tm2O11)
  4919. tellurium tin oxide (Te3SnO8)
  4920. tellurium titanium oxide (Te3TiO8)
  4921. tellurium ytterbium oxide (Te4Yb2O11)
  4922. tellurium yttrium oxide (Te4Y2O11)
  4923. tellurium zinc oxide (Te3Zn2O8)
  4924. Tellurium(I) monoiodide
  4925. Tellurium(IV) ammonium pentafluoride
  4926. tellurobismethane
  4927. telluroxo(tetratelluro)zirconium
  4928. terbium
  4929. terbium (III) iron garnet
  4930. Terbium (III) nitrate dihydrate
  4931. Terbium (III) nitrate monohydrate
  4932. Terbium (III) nitrate tetrahydrate
  4933. terbium (III) orthovanadate
  4934. Terbium (III) trisulfide
  4935. terbium acetate tetrahydrate
  4936. terbium boride (TbB2)
  4937. terbium bromide (TbBr3)
  4938. terbium chloride (TbCl3)
  4939. terbium chloride oxide (TbClO)
  4940. Terbium cobalt(III) oxide
  4941. terbium cuprate
  4942. terbium ferroborate
  4943. Terbium Hafnate
  4944. Terbium hydrogen uranosilicate
  4945. Terbium hydrogen uranosilicate decahydrate
  4946. terbium hydroxide (Tb(OH)3)
  4947. terbium iodide (TbI3)
  4948. Terbium manganite
  4949. Terbium orthotantalate
  4950. Terbium perchlorate dithiourea decahydrate
  4951. Terbium perchlorate nonahydrate
  4952. terbium propionate
  4953. terbium tetraethylammonium nitrate
  4954. terbium(+3) cation trichloride hexahydrate
  4955. terbium(+3) cation trifluoride
  4956. terbium(+3) cation trinitrate hexahydrate
  4957. terbium(3+) phosphate
  4958. Terbium(III) β-resorcylate
  4959. Terbium(III) bis(1,10-phenanthroline 1-oxide) trichloride
  4960. Terbium(III) bromide hexahydrate
  4961. terbium(III) diquinolinium nitrate trihydrate
  4962. terbium(III) ethylsulfate
  4963. Terbium(III) histidine trinitrate monohydrate
  4964. terbium(III) potassium sulfate dihydrate
  4965. terbium(III) sulfate octahydrate
  4966. Terbium(III) tetrakis(5,6-benzoquinoline) trinitrate
  4967. Terbium(III) triindium(I)
  4968. Terbium(III) triisothiocyanate tris(2,6-Dimethylpicoline-N-oxide)
  4969. Terbium(III) trilead
  4970. Terbium(III) tris(1,4-thioxane-S-oxide trifluoroacetate)
  4971. Terbium(III) tris(2,6-dichlorobenzoic acid)
  4972. Terbium(III) tris(3-Methoxybenzoate)
  4973. Terbium(III) tris(3-nitro-1,2,4-triazol-5-onate)
  4974. Terbium(III) tris(3-nitro-1,2,4-triazol-5-onate) pentahydrate
  4975. Terbium(III) tris(salicylate)
  4976. Terbium(III) trithallium(I)
  4977. Terbium(III)-2,5-dihydroxybenzoate
  4978. Terbium(III)-2,6-dihydroxybenzoate
  4979. terbium(III)chloride hexa(pyridine) hydrochloride
  4980. terbium(III)iodide bisthiourea decahydrate
  4981. terbium(III)iodide nonahydrate
  4982. Terbium(III)trifluoromethanesulphonate hepta(4-picoline-N-oxide)
  4983. Terbium-2,2-bipyridine tris(3,4-dimethylbenzoate) complex
  4984. Terephthalic acid, bis (p-butoxyphenyl) ester
  4985. Terephthalic acid, bis (p-chlorophenyl) ester
  4986. Terephthalic acid, bis (p-ethoxyphenyl) ester
  4987. Terephthalic acid, bis (p-heptyloxyphenyl) ester
  4988. Terephthalic acid, bis (p-hexyloxyphenyl) ester
  4989. Terephthalic acid, bis (p-methoxyphenyl) ester
  4990. Terephthalic acid, bis (p-propoxyphenyl) ester
  4991. termolan
  4992. Terpenylic acid
  4993. Terpenylic acid ethylester
  4994. terpineol
  4995. terpinol diformate
  4996. tert-amylmercuric bromide
  4997. tert-Butanol dimer
  4998. tert-Butyl 1-methylcyclohex-1-yl peroxide
  4999. tert-butyl 2-cyanoacetate
  5000. tert-butyl 3,5-dinitrobenzoate
  5001. tert-Butyl 4-(4-cyano-2-(dimethylamino)-1,3-oxazole-5-yl)piperazine-1-carboxylate
  5002. tert-Butyl 4-(4-cyano-2-(methylamino)-1,3-oxazol-5-yl)piperazine-1-carboxylate
  5003. tert-Butyl diethylacetate
  5004. tert-Butyl hydrogen phthalate
  5005. tert-Butyl pentamethylethyl peroxide
  5006. tert-butyl tert-amyl disulfide
  5007. tert-butyl triallyl orthosilicate
  5008. tert-Butyl(cyclohexylmethoxy)dimethylsilane
  5009. tert-Butyl(cyclohexyloxy)silane
  5010. tert-butyl(propan-2-yl)mercury
  5011. tert-Butyl(trifluorosilyl)amine
  5012. tert-butyl-(3S)-3-[(1R,2R,3S,5R)-(pinanediyldioxy)boryl]butanoate
  5013. tert-butyl-(oxiran-2-ylmethylidene)amine
  5014. Tert-butyl-2-[N-(tert-butyloxymethyl)-2-picolyamino]acetate
  5015. Tert-butyl-2-[N-octyl-2-picolyamino]acetate
  5016. tert-Butyl-dimethyl-prop-2-enylsilane
  5017. tert-Butylcyanoacetic acid
  5018. tert-Butylcyanoacetic acid methyl ester
  5019. tert-butyliminotantalum; ethyl-methylazanide
  5020. tert-butylmercuric bromide
  5021. tert-butylphenoxyacetic acid
  5022. tert-Butylphthalonitrile
  5023. tert-Butyltetralin
  5024. tert-Nitrosobutane dimer
  5025. tert.-Butylboronic acid diethanolamine ester
  5026. tert.-Butylmercapto-(bis-trifluormethyl)phosphin
  5027. Testosterone benzoate
  5028. testosterone buanoate
  5029. testosterone pentanoate
  5030. Testosterone phenylacetate
  5031. Testosterone phenylbutyrate
  5032. Testosterone phenylvalerate
  5033. tetafluorooxirane
  5034. Tetra(1,1,1-Trifluoropentane-2,4-dione) potassium praseodymium(III)
  5035. Tetra(1,1,1-Trifluoropentane-2,4-dione) sodium praseodymium(III)
  5036. Tetra(4-Picoline) cadmium(II) diiodide
  5037. tetra(5,5-dimethyl-1,3-dioxaphosphorinanyl-2-oxy)neopentane
  5038. tetra(ammonium sulfate)monosulfuric acid
  5039. tetra(gadolinium(III) phosphate) phosphoric acid octahydrate
  5040. tetra(oxiran-2-ylmethyl) benzene-1,2,4,5-tetracarboxylate
  5041. tetra(potassium hydrogen sulfate) tri(sulfuric acid) dihydrate
  5042. tetra(potassium hydrogen sulfate) tri(sulfuric acid) monohydrate
  5043. tetra(potassium sulfate) mono sulfuric acid monohydrate
  5044. tetra(silver nitrate) succinonitrile
  5045. tetra(sodium phosphate) sodium hydroxide 48-hydrate
  5046. tetra(sodium sulfate) sodium chloride dihydrogen peroxide
  5047. tetra(triphenylgermyl) tricadmium dinickel bis(cyclopentadienyl)
  5048. tetra(undecyl)silane
  5049. tetra(yttrium (III) perchlorate) tris(benzo-15-crown-5) dodecahydrate dodecamethanol
  5050. tetra-μ3-carbonyldodecacarbonyloctahedrohexarhodium
  5051. tetra-(2,2,6,6-tetramethylheptane-3,5-dionato) zirconium
  5052. tetra-2-propenylsilane
  5053. tetra-i-amylammonium bromide Dihydrate
  5054. tetra-i-amylammonium bromide Dotriacontahydrate
  5055. tetra-i-amylammonium bromide Hexacosahydrate
  5056. tetra-i-amylammonium bromide Octatriacontahydrate
  5057. tetra-i-amylammonium chloride dihydrate
  5058. tetra-i-amylammonium chloride dotriacontahydrate
  5059. tetra-i-amylammonium chloride heptacosahydrate
  5060. tetra-i-amylammonium chloride oktatriacontahydrate
  5061. tetra-i-amylammonium iodide Dihydrate
  5062. tetra-i-amylammonium iodide Dotriacontahydrate
  5063. tetra-i-amylammonium iodide Hexatriacontahydrate
  5064. tetra-mu-chlorotetrachloro(tin)dialuminum
  5065. Tetra-N-butylammonium hexanesulfonate
  5066. Tetra-N-butylammonium pentanesulfonate
  5067. Tetra-N-butylammonium propanesulfonate
  5068. Tetra-n-butylarsonium iodide
  5069. Tetra-n-butylphosphonium iodide
  5070. tetra-n-hexylphosphonium iodide
  5071. tetra-n-octylphosphonium iodide
  5072. tetra-N-pyrrolylgermanium
  5073. Tetra-o-cyclohexylphenoxysilane
  5074. Tetra-p-biphenyloxysilane
  5075. Tetra-tert-butylorthothiogermanate
  5076. tetraacetylethylenediamine
  5077. tetraammonium (OC-6-11)-hexabromocadmate(4-)
  5078. tetraammonium (OC-6-11)-hexakis(cyano-C)ferrate(4-)
  5079. tetraammonium calcium thiocyanate dihydrate
  5080. tetraammonium molybdate trinitrate
  5081. tetraammonium thorium sulfate dihydrate
  5082. tetraammonium tricalcium chromate trihydrate
  5083. Tetraaqua tris(4-propyl-1,2,4-triazole) iron(II) bromide
  5084. tetraaqua-L-hexaprolinatopraseodymium(III) perchlorate
  5085. tetraaquabis(mu-(glycinato-κO:κO'))bis(mu-(glycinato-κO:κO,κO'))bis(glycinato-κO)diholmium hexaperchlorate dihydrate
  5086. tetraaquahexa-L-prolinatoerbium(III) perchlorate
  5087. tetraaquahexa-L-prolinegadolinium(III)-perchlorate
  5088. tetraaquahexa-L-prolineneodymium(III)-perchlorate
  5089. Tetraaquahexaglycineerbium(III) diaquadisodiumoctaperchlorate tetrahydrate complex
  5090. tetraaquahexakis(glycinato)digadolinium hexaperchlorate pentahydrate compd. with tetraaquahexakis(glycinato)gadoliniumyttrium hexaperchlorate pentahydrate (1:2)
  5091. tetraaquatetrakis(mu-(glycinato-κO:κO'))bis(glycinato-κO,κO')dilanthanum hexaperchlorate
  5092. tetraaquatetrakis(mu-(glycinato-O:O'))bis(glycinato-O)dierbium hexaperchlorate pentahydrate
  5093. tetraaquatetrakis(mu-(glycinato-O:O'))bis(glycinato-O)dipraseodymium hexaperchlorate pentahydrate
  5094. tetraaquatetrakis(mu-(L-prolinato-κO2:κO2'))bis(L-prolinato-κO2)digadolinium hexaperchlorate
  5095. tetraaquatetrakis(mu-(L-prolinato-κO2:κO2'))bis(L-prolinato-κO2)dineodymium hexaperchlorate
  5096. tetraarsenic tetrasulfide
  5097. tetraarsenic triselenide
  5098. tetraarsenic trisulfide
  5099. tetrabenzo(a,cd,j,lm)perylene
  5100. tetrabenzo(de,hi,op,st)pentacene
  5101. tetrabenzo-24-crown-8
  5102. tetrabenzyltitanium
  5103. tetrabenzylzirconium
  5104. tetraborane(10)
  5105. tetrabromoborate(1-)
  5106. Tetrabromocyclohexane
  5107. tetrabromoethene
  5108. tetrabromogermane
  5109. tetrabromomethane
  5110. tetrabromooctadecanoic acid
  5111. Tetrabromopentan-2-one
  5112. tetrabromoplumbane
  5113. tetrabromosilane
  5114. tetrabromostannane
  5115. tetrabromothiophene
  5116. tetrabromotris(triphenylphosphine)diiron
  5117. Tetrabutylammonium β-alaninate
  5118. Tetrabutylammonium 2-(2-(2-methoxyethoxy)ethoxy)acetate
  5119. tetrabutylammonium 2-(bis(2-hydroxyethyl)amino)ethanesulfonate
  5120. Tetrabutylammonium 2-(cyclohexylamino)ethanesulfonate
  5121. Tetrabutylammonium 2-(morpholin-4-yl)ethane-1-sulfonate
  5122. Tetrabutylammonium 2-acrylamido-2-methylpropanesulfonate
  5123. Tetrabutylammonium 2-furoate
  5124. tetrabutylammonium 2-hydroxy-3-morpholinopropanesulfonate
  5125. Tetrabutylammonium 2-[(2-amino-2-oxoethyl)amino]ethanesulfonate
  5126. Tetrabutylammonium 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethane-1-sulfonate
  5127. tetrabutylammonium 3-(cyclohexylamino)-2-hydroxypropanesulfonate
  5128. Tetrabutylammonium 3-{[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino}propane-1-sulfonate
  5129. Tetrabutylammonium acyclovir
  5130. tetrabutylammonium bromide 24-hydrate
  5131. tetrabutylammonium bromide 32-hydrate
  5132. tetrabutylammonium bromide 36-hydrate
  5133. tetrabutylammonium bromide dihydrate
  5134. tetrabutylammonium bromide trihydrate
  5135. Tetrabutylammonium bromoborate
  5136. tetrabutylammonium copper(II) bromide
  5137. Tetrabutylammonium D-phenylalaninate
  5138. Tetrabutylammonium L-alanine
  5139. Tetrabutylammonium L-argininate
  5140. Tetrabutylammonium L-glutamate
  5141. Tetrabutylammonium L-histidinate
  5142. Tetrabutylammonium L-leucinate
  5143. Tetrabutylammonium L-phenylalaninate
  5144. Tetrabutylammonium L-prolinate
  5145. Tetrabutylammonium L-serinate
  5146. Tetrabutylammonium perrhenate
  5147. Tetrabutylammonium R-10-camphor-sulfonate
  5148. Tetrabutylammonium tetracyanoborate
  5149. Tetrabutylammonium tetrahydro-2-furoate
  5150. Tetrabutylammonium thiophene-2-caboxylate
  5151. tetrabutylammonium trifluoro(heptafluoropropyl)borate
  5152. tetrabutylammonium trifluoro(nonafluorobutyl)borate
  5153. tetrabutylammonium trifluoro(pentafluoroethyl)borate
  5154. tetrabutylammonium trifluoro(tridecafluorohexyl)borate
  5155. Tetrabutylammonium trifluoroacetate
  5156. Tetrabutylammonium valinate
  5157. Tetrabutylamonium glycinate
  5158. tetrabutylarsonium salt with 2,4,6-trinitrophenol (1:1)
  5159. tetrabutylazanium acetate
  5160. tetrabutylborate(1-)
  5161. tetrabutylgermane
  5162. tetrabutylhydrazine
  5163. tetrabutylphosphanium chloride
  5164. Tetrabutylphosphonium 2,2-dimethylbutyrate
  5165. tetrabutylphosphonium 2,3,4-trihydroxybutanoate
  5166. tetrabutylphosphonium 2,6-diaminohexanoate
  5167. Tetrabutylphosphonium 2-(2-(2-methoxyethoxy)ethoxy)acetate
  5168. tetrabutylphosphonium 2-(bis(2-hydroxyethyl)amino)ethanesulfonate
  5169. tetrabutylphosphonium 2-amino-3-hydroxypropanoate
  5170. tetrabutylphosphonium 2-amino-3-methylbutanoate
  5171. tetrabutylphosphonium 2-amino-3-sulfanylpropanoate
  5172. tetrabutylphosphonium 2-aminoethanesulfonate
  5173. Tetrabutylphosphonium 2-butyloctanoate
  5174. Tetrabutylphosphonium 2-ethylbutyrate
  5175. Tetrabutylphosphonium 2-ethylhexanoate
  5176. Tetrabutylphosphonium 2-furoate
  5177. Tetrabutylphosphonium 2-hexyldecanoate
  5178. tetrabutylphosphonium 2-hydroxy-3-morpholinopropanesulfonate
  5179. tetrabutylphosphonium 3-(cyclohexylamino)-2-hydroxypropanesulfonate
  5180. Tetrabutylphosphonium 4-ethyloctanoate
  5181. Tetrabutylphosphonium acetate
  5182. Tetrabutylphosphonium acyclovir
  5183. tetrabutylphosphonium bis(2,4,4-trimethylpentyl)phosphinate
  5184. tetrabutylphosphonium bromide
  5185. tetrabutylphosphonium caprylate
  5186. tetrabutylphosphonium formate
  5187. tetrabutylphosphonium glycinate
  5188. tetrabutylphosphonium glycine ion(1-)
  5189. tetrabutylphosphonium hexafluorophosphate(1-)
  5190. Tetrabutylphosphonium isostearate
  5191. tetrabutylphosphonium l-alanine ion(1-)
  5192. tetrabutylphosphonium l-arginine ion(1-)
  5193. tetrabutylphosphonium l-asparagine ion(1-)
  5194. tetrabutylphosphonium l-aspartic acid ion(1-)
  5195. tetrabutylphosphonium l-cysteine ion(1-)
  5196. tetrabutylphosphonium l-glutamic acid ion(1-)
  5197. tetrabutylphosphonium l-histidine ion(1-)
  5198. tetrabutylphosphonium l-isoleucine ion(1-)
  5199. tetrabutylphosphonium L-leucine ion(1-)
  5200. tetrabutylphosphonium l-lysine ion(1-)
  5201. tetrabutylphosphonium l-methionine ion(1-)
  5202. tetrabutylphosphonium l-phenylalanine ion(1-)
  5203. tetrabutylphosphonium l-proline ion(1-)
  5204. tetrabutylphosphonium l-serine ion(1-)
  5205. tetrabutylphosphonium l-threonine ion(1-)
  5206. tetrabutylphosphonium l-valine ion(1-)
  5207. tetrabutylphosphonium N-((trifluoromethyl)sulfonyl)-L-alanine methyl ester ion(1-)
  5208. tetrabutylphosphonium N-((trifluoromethyl)sulfonyl)-L-leucine methyl ester ion(1-)
  5209. tetrabutylphosphonium N-((trifluoromethyl)sulfonyl)-L-valine methyl ester ion(1-)
  5210. Tetrabutylphosphonium N-[tris(hydroxymethyl)methyl]-3-amino-2-hydroxypropanesulfonate
  5211. Tetrabutylphosphonium nitrate
  5212. Tetrabutylphosphonium propionate
  5213. tetrabutylphosphonium pyrrolidine-2-carboxylate
  5214. tetrabutylphosphonium salt with (2E)-2-butenedioic acid (1:1)
  5215. tetrabutylphosphonium salt with (2Z)-2-butenedioic acid (1:1)
  5216. tetrabutylphosphonium salt with 2,4,6-trinitrophenol (1:1)
  5217. tetrabutylphosphonium salt with 4-methylbenzenesulfonic acid (1:1)
  5218. tetrabutylphosphonium salt with alanin
  5219. tetrabutylphosphonium salt with methanesulfonic acid (1:1)
  5220. Tetrabutylphosphonium tetracyanoborate
  5221. tetrabutylphosphonium tetrafluoroborate(1-)
  5222. Tetrabutylphosphonium tetrahydro-2-furoate
  5223. Tetrabutylphosphonium thiophene-2-carboxylate
  5224. Tetrabutylphosphonium trifluoroacetate
  5225. Tetrabutylphosphonium tris(pentafluoroethyl) trifluorophosphate
  5226. Tetrabutylplumbane
  5227. tetrabutylsilane
  5228. tetrabutylstannane
  5229. tetrabutylurea
  5230. tetracadmium cerium(III) chloride dodecahydrate
  5231. tetracadmium cobalt chloride decahydrate
  5232. tetracadmium europium(III) chloride tetradecahydrate
  5233. tetracadmium holmium chloride tetradecahydrate
  5234. tetracadmium lanthanum(III) chloride dodecahydrate
  5235. tetracadmium manganese bromide decahydrate
  5236. tetracadmium manganese chloride decahydrate
  5237. tetracadmium neodymium(III) chloride dodecahydrate
  5238. tetracadmium nickel chloride decahydrate
  5239. tetracadmium praseodymium(III) chloride dodecahydrate
  5240. tetracadmium samarium(III) chloride dodecahydrate
  5241. tetracadmium trisodium chloride tetradecahydrate
  5242. tetracadmium yttrium (III) chloride tridecahydrate
  5243. Tetracalcium aluminium oxide trihydrate
  5244. Tetracalcium decaboron(III) oxide
  5245. tetracalcium hexahydroxide dichlorate dodecahydrate
  5246. tetracalcium phosphate tetrahydrate
  5247. tetracarbonylbis(η5-2,4-cyclopentadien-1-yl)diiron (Fe-Fe)
  5248. tetracarbonylsilylcobalt
  5249. tetracesium (HB-5-22111'1'1''1'')-tris[carbonato(2-)-κO,κO']dioxouranate(4-)
  5250. tetracesium antimony(III) chloride
  5251. tetracesium bismuth chloride
  5252. Tetracesium diiron(III) sulfate dodecahydrate
  5253. Tetracesium disamarium(III) pentaselenate
  5254. tetracesium gadolinium(III) chloride monohydrate
  5255. Tetracesium lead iodide
  5256. tetracesium lithium trihydrogen tetraselenate
  5257. tetracesium lutetium(III) chloride pentahydrate
  5258. tetracesium oxalate trioxalic acid
  5259. tetracesium tricopper(II) chloride dihydrate
  5260. tetracesium ytterbium (III) chloride tetrahydrate
  5261. Tetracesium ytterbium(III) heptachloride
  5262. tetrachloro-1,1'-biphenyl
  5263. Tetrachloro-1,3-benzodioxol-2-one
  5264. tetrachlorobis(1,2-ethanediamine)cobalt(2+) chloride
  5265. Tetrachlorobis(n-propylammonium) lead (II)
  5266. tetrachlorobis(pyridine)titanium
  5267. tetrachloroborate(1-)
  5268. tetrachlorocyclopropene
  5269. tetrachlorodecane
  5270. tetrachlorodiborane(4)
  5271. tetrachlorodifluoroethane
  5272. tetrachlorodifluoroethane
  5273. tetrachlorodimethyl sulfide
  5274. tetrachloroethane
  5275. tetrachloroethene
  5276. tetrachlorogermane
  5277. tetrachlorohexadiene
  5278. tetrachloroiodic acid tetrahydrate
  5279. tetrachloromethane
  5280. tetrachloronaphthalene
  5281. tetrachlorooxirane
  5282. tetrachlorophenol
  5283. tetrachloroplumbane (PbCl4)
  5284. tetrachloropyrimidine
  5285. tetrachlorosilane
  5286. tetrachlorostannane
  5287. tetrachlorostannane compd. with benzoic acid (1:2)
  5288. tetrachlorothiophene
  5289. tetracontane
  5290. tetracontastrontium(II) dotriacontairon(III)octaiiron(IV) oxide
  5291. tetracontylbenzene
  5292. tetracontylcyclohexane
  5293. tetracopper(II) hexahydroxo chloride dihydrate
  5294. tetracopper(II) hexahydroxo sulfate monohydrate
  5295. Tetracosa bismut digallium oxide
  5296. tetracosadecanedioic acid bis(2-methylpropyl) ester
  5297. tetracosafluorotetradecahydroanthracene
  5298. tetracosafluorotetradecahydrophenanthrene
  5299. tetracosafluoroundecane
  5300. tetracosamethylcyclododecasiloxane
  5301. tetracosamethylundecasiloxane
  5302. Tetracosan-11-ol
  5303. Tetracosan-12-ol
  5304. Tetracosan-6-ol
  5305. Tetracosan-6-one
  5306. Tetracosan-6-yl acetate
  5307. tetracosan-7-one
  5308. tetracosanamide
  5309. tetracosanedioic acid bis(1-methylethyl) ester
  5310. tetracosanedioic acid dibutyl ester
  5311. tetracosanedioic acid dipentyl ester
  5312. tetracosanedioic acid dipropyl ester
  5313. tetracosanenitrile
  5314. tetracosanoic acid
  5315. tetracosanoic acid 1-methylethyl ester
  5316. tetracosanoic acid ethyl ester
  5317. tetracosanoic acid methyl ester
  5318. tetracosanoic acid pentyl ester
  5319. tetracosanoic acid propyl ester
  5320. Tetracosanoic anhydride
  5321. Tetracosyl acetate
  5322. tetracosylbenzene
  5323. tetracyanatosilane
  5324. Tetracyclo(4.4.1(2,5).1(7,10).0(1,6))dodec-3-ylacrylate
  5325. tetracyclo(8.1.0.0(1,3).0(3,5))undecane
  5326. tetracyclododecane
  5327. tetracyclododecane
  5328. tetracyclopropylbutanedinitrile
  5329. tetracyclo[3.2.0.0(2,7).0(4,6)]heptane
  5330. Tetracyclo[6.2.1.13,6.02,7]dodec-2(7)-ene
  5331. tetradec-1-yn-3-ol
  5332. Tetradec-7-yn-6-one
  5333. Tetradeca-1,13-diene
  5334. tetradeca-9,11-dienyl acetate
  5335. tetradecaethylhexasiloxane
  5336. tetradecafluoro-[1,1']azoxypropane
  5337. tetradecafluorohexane
  5338. tetradecahydroanthracene
  5339. tetradecahydrophenanthrene
  5340. tetradecahydrophenanthrene
  5341. tetradecamethylcycloheptasiloxane
  5342. tetradecamethylenimine
  5343. tetradecamethylhexasiloxane
  5344. tetradecan-1-amine hydrochloride
  5345. tetradecan-2-ol
  5346. tetradecan-4-ol
  5347. tetradecan-6-ol
  5348. Tetradecan-6-one
  5349. tetradecanal
  5350. tetradecanamide
  5351. tetradecane
  5352. Tetradecane-3,12-dione
  5353. tetradecanediamide
  5354. tetradecanedinitrile
  5355. tetradecanedioic acid
  5356. tetradecanedioic acid didocosyl ester
  5357. tetradecanedioic acid diethyl ester
  5358. tetradecanedioic acid dimethyl ester
  5359. tetradecanedioic acid dioctadecyl ester
  5360. tetradecanedioic acid dipropyl ester
  5361. tetradecanenitrile
  5362. tetradecaneperoxoic acid
  5363. tetradecanethioic acid S-decyl ester
  5364. tetradecanethioic acid S-hexadecyl ester
  5365. tetradecanethioic acid S-hexyl ester
  5366. tetradecanethioic acid S-octadecyl ester
  5367. tetradecanethioic acid S-octyl ester
  5368. tetradecanethioic acid S-pentadecyl ester
  5369. tetradecanethioic acid S-tetradecyl ester
  5370. tetradecanethioic acid S-tridecyl ester
  5371. tetradecanethioic acid S-undecyl ester
  5372. tetradecanoic acid
  5373. tetradecanoic acid (1R)-1-((((2,3-dihydroxypropoxy)hydroxyphosphinyl)oxy)methyl)-1,2-ethanediyl ester monosodium salt
  5374. tetradecanoic acid 1,1-dimethylethyl ester
  5375. tetradecanoic acid 1,10-decanediyl ester
  5376. tetradecanoic acid 1,2,3-propanetriyl ester
  5377. tetradecanoic acid 1,2-ethanediyl ester
  5378. tetradecanoic acid 1,3-propanediyl ester
  5379. tetradecanoic acid 1,4-butanediyl ester
  5380. tetradecanoic acid 1,5-pentanediyl ester
  5381. tetradecanoic acid 1,6-hexanediyl ester
  5382. tetradecanoic acid 1,7-heptanediyl ester
  5383. tetradecanoic acid 1,8-octanediyl ester
  5384. tetradecanoic acid 1,9-nonanediyl ester
  5385. tetradecanoic acid 1-methyldecyl ester
  5386. tetradecanoic acid 1-methylethyl ester
  5387. tetradecanoic acid 1-methylheptyl ester
  5388. tetradecanoic acid 1-methylhexyl ester
  5389. tetradecanoic acid 1-methylpentyl ester
  5390. tetradecanoic acid 1-methylpropyl ester
  5391. tetradecanoic acid 2,3-dihydroxypropyl ester
  5392. tetradecanoic acid 2-(hexyloxy)ethyl ester
  5393. Tetradecanoic acid 2-chloroprop-2-enyl ester
  5394. tetradecanoic acid 2-hydroxy-1,3-propanediyl ester
  5395. tetradecanoic acid 2-hydroxy-1-(hydroxymethyl)ethyl ester
  5396. Tetradecanoic acid 2-methylprop-2-enyl ester
  5397. tetradecanoic acid 2-methylpropyl ester
  5398. tetradecanoic acid 2-phenyl-1,3-dioxan-5-yl ester
  5399. tetradecanoic acid 2-phosphonoethyl ester diethyl ester
  5400. tetradecanoic acid 2-propoxyethyl ester
  5401. tetradecanoic acid 3-[(1-oxodecyl)oxy]-2-[(1-oxododecyl)oxy]propyl ester
  5402. tetradecanoic acid 4-methylphenyl ester
  5403. tetradecanoic acid ammonium salt
  5404. Tetradecanoic acid but-3-en-2-yl ester
  5405. tetradecanoic acid butyl ester
  5406. tetradecanoic acid cerium(3+) salt
  5407. tetradecanoic acid chromium(3+) salt
  5408. tetradecanoic acid compd. with 4,6-dimethyl-N-phenyl-2-pyrimidinamine (1:1)
  5409. tetradecanoic acid decyl ester
  5410. tetradecanoic acid docosyl ester
  5411. tetradecanoic acid dodecyl ester
  5412. tetradecanoic acid eicosyl ester
  5413. tetradecanoic acid ethyl ester
  5414. Tetradecanoic acid furan-2-ylmethyl ester
  5415. tetradecanoic acid heneicosyl ester
  5416. tetradecanoic acid heptadecyl ester
  5417. tetradecanoic acid heptyl ester
  5418. tetradecanoic acid hexadecyl ester
  5419. tetradecanoic acid hexyl ester
  5420. tetradecanoic acid lead(2+) salt
  5421. tetradecanoic acid lithium salt
  5422. tetradecanoic acid mercury(2+) salt
  5423. tetradecanoic acid methyl ester
  5424. tetradecanoic acid nonadecyl ester
  5425. tetradecanoic acid nonyl ester
  5426. tetradecanoic acid octadecyl ester
  5427. tetradecanoic acid octyl ester
  5428. tetradecanoic acid pentadecyl ester
  5429. tetradecanoic acid pentyl ester
  5430. tetradecanoic acid phenyl ester
  5431. Tetradecanoic acid prop-2-enyl ester
  5432. tetradecanoic acid propyl ester
  5433. tetradecanoic acid sodium salt
  5434. tetradecanoic acid tetracosyl ester
  5435. tetradecanoic acid tetradecyl ester
  5436. tetradecanoic acid thallium(1+) salt
  5437. tetradecanoic acid tricosyl ester
  5438. tetradecanoic acid tridecyl ester
  5439. tetradecanoic acid undecyl ester
  5440. tetradecanoic acid zinc salt
  5441. tetradecanoyl chloride
  5442. tetradecapotassium dithorium sulfate
  5443. tetradecasamarium (III) tetratungsten (VI) oxide
  5444. Tetradecyl formate
  5445. tetradecylβinium dicyanamide
  5446. tetradecylβinium methanesulfonate
  5447. tetradecylβinium perchlorate
  5448. tetradecylβinium S-lactate monohydrate
  5449. tetradecylβinium tetrafluoroborate
  5450. tetradecylbenzene
  5451. tetradecylcyclohexane
  5452. tetradecylcyclopentane
  5453. tetradecylcyclopropane
  5454. tetradecylphosphonium L-leucine ion(1-)
  5455. tetradecylpropanedioic acid
  5456. Tetradeutero ammonium chloride-15N
  5457. Tetradeutero ammonium chloride-35Cl
  5458. tetradodecylphosphonium L-leucine ion(1-)
  5459. tetradodecylsilane
  5460. tetradodecylstannane
  5461. tetraethenylsilane
  5462. tetraethenylstannane
  5463. tetraethoxydiborane(4)
  5464. tetraethyl citrate
  5465. Tetraethyl ethane-1,1,2,2-tetracarboxylate
  5466. tetraethyl ranelate
  5467. tetraethyl-μ-oxodialuminum
  5468. Tetraethylammonium β-alaninate
  5469. tetraethylammonium 2,2,2-trifluoro-N-(trifluoromethylsulfonyl)acetamide
  5470. Tetraethylammonium 2-(cyclohexylamino)ethanesulfonate
  5471. Tetraethylammonium 2-acrylamido-2-methylpropanesulfonate
  5472. Tetraethylammonium 2-hydroxy-4-morpholinopropanesulfonate
  5473. Tetraethylammonium 2-[bis(2-hydroxyethyl)amino]ethanesulfonate
  5474. Tetraethylammonium alaninate
  5475. tetraethylammonium chloride tetrahydrate
  5476. Tetraethylammonium cobalt(II) tribromide
  5477. Tetraethylammonium cobalt(II) trichloride
  5478. tetraethylammonium copper(II) bromide
  5479. Tetraethylammonium copper(II) trichloride
  5480. Tetraethylammonium dibromoiodide
  5481. Tetraethylammonium dicobalt(II) pentabromide
  5482. Tetraethylammonium dicobalt(II) pentachloride
  5483. Tetraethylammonium glycinate
  5484. Tetraethylammonium lysinate
  5485. tetraethylammonium pentacyanopropenide
  5486. tetraethylamonium ampicillin
  5487. tetraethylbis(μ-(1H-pyrazolato-κN1:κN2))diboron
  5488. tetraethylbutanedinitrile
  5489. tetraethylbutanedioic acid
  5490. tetraethyldiamidodibutyldithiopyrophosphate
  5491. tetraethyldiamidophosphonylfluoride
  5492. tetraethyldiborane(6)
  5493. tetraethyldistibine
  5494. tetraethylene glycol diacrylate
  5495. Tetraethylenepentamine 2-methoxyphenolate
  5496. Tetraethylenepentamine acetate
  5497. Tetraethylenepentamine phenolate
  5498. tetraethylethanediamide
  5499. tetraethylgermane
  5500. tetraethylhydrazine
  5501. tetraethylmmonium ethanesulfonate
  5502. tetraethylmmonium methanesulfonate
  5503. tetraethylphosphonium 2,2,2-trifluoro-N-(trifluoromethylsulfonyl)acetamide
  5504. Tetraethylphosphonium 2-cyanopyrrolide
  5505. tetraethylphosphonium bis(trifluoromethylsulfonyl)imide
  5506. tetraethylphosphorodiamidous acid
  5507. tetraethylphosphorodiamidous chloride
  5508. tetraethylplumbane
  5509. tetraethylsilane
  5510. tetraethylstannane
  5511. tetraethylsulfamide
  5512. tetraethylsulfurous diamide
  5513. tetraethylurea
  5514. tetraeuropium(III) hexapotassium sulfate octahydrate
  5515. tetrafluoro(1,1,1-trifluoromethanaminato)(trifluoromethyl)sulfur
  5516. tetrafluoro(1,1,2,2,2-pentafluoroethanaminato)(trifluoromethyl)sulfur
  5517. tetrafluoro(2,2,2-trifluoroethanimidoyl chloridato)(trifluoromethyl)sulfur
  5518. tetrafluoro(fluoromethyl)(trifluoromethyl)sulfur
  5519. tetrafluoro(N,1,1,1-tetrafluoromethanaminato)(trifluoromethyl)sulfur
  5520. tetrafluoro(N,1,1,2,2,2-hexafluoroethanaminato)(trifluoromethyl)sulfur
  5521. tetrafluoro(trifluoromethoxy)((trifluoromethyl)dioxy)sulfur
  5522. tetrafluoro-1-propanol
  5523. tetrafluoro-1-propanol carbonate (2:1)
  5524. Tetrafluoro-bis(1,1,2,2,2-pentafluoroethyl)-sulfane
  5525. tetrafluoroborate(1-)
  5526. tetrafluorobutanedioic acid
  5527. tetrafluorobutanedioic acid diethyl ester
  5528. tetrafluorobutanedioic acid dimethyl ester
  5529. tetrafluorodi-μ-oxotritellurium
  5530. tetrafluorodiborane(4)
  5531. tetrafluorodibutanedioic acid monoethylester
  5532. tetrafluoroethene
  5533. tetrafluorogermane
  5534. tetrafluoromethane
  5535. tetrafluoroplumbane
  5536. tetrafluoropyrimidine
  5537. tetrafluorosilane
  5538. tetrafluorostannane (SnF4)
  5539. tetrafluorosuccinanilic acid
  5540. Tetrafluoroxyplutonic acid tetrahydrate (H2PuO2F4*4H2O)
  5541. tetraglycinetrinitratoholmium(III) monohydrate
  5542. tetrahafnyl dihydroxo trisulfate dodecahydrate
  5543. tetrahafnyl dihydroxo trisulfate tetradecahydrate
  5544. tetrahdro-2-propyl-4H-pyran-4-one
  5545. tetraheptacontane
  5546. tetraheptylgermane
  5547. Tetraheptylstannane
  5548. tetrahexacontane
  5549. Tetrahexadecylsilane
  5550. tetrahexlammonium oleate
  5551. Tetrahexyl phosphonium hexafluorophosphate
  5552. tetrahexylammonium chloride
  5553. Tetrahexylammonium hexadecanoate
  5554. Tetrahexylammonium octanoate
  5555. tetrahexylammonium trifluoro(heptafluoropropyl)borate
  5556. tetrahexylammonium trifluoro(nonafluorobutyl)borate
  5557. tetrahexylammonium trifluoro(pentafluoroethyl)borate
  5558. tetrahexylammonium trifluoro(tridecafluorohexyl)borate
  5559. tetrahexylgermane
  5560. tetrahexylphosphonium bromide
  5561. tetrahexylphosphonium L-leucine ion(1-)
  5562. Tetrahexylsilane
  5563. Tetrahexylstannane
  5564. tetrahydro-α,α-dimethyl-2H-pyran-2-methanol
  5565. tetrahydro-α,α-dimethylpyran-2-propanol
  5566. tetrahydro-α,α-diphenylpyran-2-propanol
  5567. tetrahydro-α-methyl-α-phenyl-2-furanmethanol
  5568. tetrahydro-α-methyl-α-phenylpyran-2-methanol
  5569. tetrahydro-α-methyl-2-furanmethanol
  5570. tetrahydro-α-methyl-2H-pyran-2-methanol
  5571. tetrahydro-α-tri-cyclopentadiene
  5572. tetrahydro-β-tri-cyclopentadiene
  5573. tetrahydro-1,3,4,6-tetramethylimidazo(4,5-d)imidazole-2,5(1H,3H)-dione
  5574. tetrahydro-1,3-diethyl-2(1H)-pyrimidinethione
  5575. tetrahydro-1,3-dimethyl-2(1H)-pyrimidinone
  5576. tetrahydro-1,3-dipropyl-2(1H)-pyrimidinethione
  5577. tetrahydro-2(1H)-pyrimidinone
  5578. tetrahydro-2,2,5,5-tetramethylfuran
  5579. tetrahydro-2,2,6,6-tetramethyl-4H-thiopyran-4-one
  5580. tetrahydro-2,2-dimethyl-2H-pyran-4-ol
  5581. tetrahydro-2,2-dimethyl-5-oxo-3-furancarboxylic acid
  5582. tetrahydro-2,3,4-trimethylthiophene
  5583. tetrahydro-2,3,5-trimethylthiophene
  5584. tetrahydro-2,3-dimethylthiophene
  5585. tetrahydro-2,3-dipropyl-2(1H)-pyrimidinone
  5586. tetrahydro-2,4,6-trimethyl-2H-pyran-4-ol
  5587. tetrahydro-2,4-dimethylthiophene
  5588. tetrahydro-2,4-dimethylthiophene 1,1-dioxide
  5589. tetrahydro-2,5-dimethoxyfuran
  5590. tetrahydro-2,5-dimethylfuran
  5591. tetrahydro-2,5-dioxo-N-phenyl-3-furanacetamide
  5592. tetrahydro-2,6-diphenyl-4H-thiopyran-4-one
  5593. tetrahydro-2-(1-methoxy-2-methyl-1-propenyl)furan
  5594. tetrahydro-2-(1-methylethylidene)pyran
  5595. tetrahydro-2-(1-methylpropyl)furan
  5596. tetrahydro-2-(2,2,2-trichloroethoxy)-2H-pyran
  5597. tetrahydro-2-(3-methylbutyl)-2H-pyran
  5598. tetrahydro-2-(3-methylbutyl)furan
  5599. tetrahydro-2-(3-methylpentyl)-2H-pyran
  5600. tetrahydro-2-(methoxyethenyl)furan
  5601. tetrahydro-2-(methylphenylmethylidene)pyran
  5602. tetrahydro-2-(triiodovinyl)furan
  5603. tetrahydro-2-furancarboxaldehyde
  5604. tetrahydro-2-furanmethanamine
  5605. tetrahydro-2-furanmethanol
  5606. tetrahydro-2-furanmethanol acetate
  5607. tetrahydro-2-furanmethanol benzoate
  5608. tetrahydro-2-furanol
  5609. tetrahydro-2-iodoethynylpyran
  5610. tetrahydro-2-methoxy-2H-pyran
  5611. tetrahydro-2-methyl-2-pentylfuran
  5612. tetrahydro-2-methyl-2H-pyran
  5613. tetrahydro-2-methyl-2H-pyran-4-ol
  5614. tetrahydro-2-methyl-2H-thiopyran
  5615. tetrahydro-2-methyl-2H-thiopyran
  5616. tetrahydro-2-methyl-2H-thiopyran 1,1-dioxide
  5617. tetrahydro-2-methyl-4H-pyran-4-one
  5618. tetrahydro-2-methyl-6-(triethylgermyl)-2H-1,2-thiazine 1,1-dioxide
  5619. tetrahydro-2-methylfuran
  5620. tetrahydro-2-methylthiophene
  5621. tetrahydro-2-methylthiophene 1,1-dioxide
  5622. tetrahydro-2-naphthalenol
  5623. tetrahydro-2-phenyl-2H-pyran-4-ol
  5624. tetrahydro-2-phenyl-4H-pyran-4-one
  5625. tetrahydro-2-propyl-2H-pyran
  5626. tetrahydro-2-propyl-2H-pyran-3,4-diol
  5627. tetrahydro-2-propyl-2H-pyran-4-ol
  5628. tetrahydro-2-thiophenecarboxylic acid
  5629. tetrahydro-2H-1,3-oxazin-2-one
  5630. tetrahydro-2H-pyran
  5631. tetrahydro-2H-pyran-2-methanol
  5632. tetrahydro-2H-pyran-2-one
  5633. tetrahydro-2H-pyran-2-one
  5634. tetrahydro-2H-pyran-4-ol
  5635. tetrahydro-2H-pyran-4-ol acetate
  5636. tetrahydro-2H-thiopyran
  5637. tetrahydro-2H-thiopyran 1,1-dioxide
  5638. tetrahydro-2H-thiopyran 1-oxide
  5639. tetrahydro-3-(1-methylethyl)furan
  5640. tetrahydro-3-(1-methylethyl)thiophene
  5641. tetrahydro-3-(1-methylpropyl)furan
  5642. tetrahydro-3-(phenylmethyl)-2H-1,3-thiazine
  5643. tetrahydro-3-iodo-2H-pyran-2-one
  5644. tetrahydro-3-iodofuran
  5645. tetrahydro-3-methoxythiophene 1,1-dioxide
  5646. tetrahydro-3-methyl-2H-pyran
  5647. tetrahydro-3-methyl-2H-pyran-4-ol
  5648. tetrahydro-3-methyl-2H-pyran-4-ol acetate
  5649. tetrahydro-3-methyl-2H-pyran-4-ol benzoate
  5650. tetrahydro-3-methyl-2H-pyran-4-ol butanoat
  5651. tetrahydro-3-methyl-2H-pyran-4-ol chloroacetate
  5652. tetrahydro-3-methyl-2H-thiopyran
  5653. tetrahydro-3-methyl-2H-thiopyran 1,1-dioxide
  5654. tetrahydro-3-methyl-4H-pyran-4-one
  5655. tetrahydro-3-methylfuran
  5656. tetrahydro-3-methylthiophene
  5657. tetrahydro-3-methylthiophene 1,1-dioxide
  5658. tetrahydro-3-pentyl-2H-pyran-4-ol
  5659. tetrahydro-3-pentyl-2H-pyran-4-ol acetate
  5660. tetrahydro-3a,6a-di-2-quinolinylimidazo(4,5-d)imidazole-2,5(1H,3H)-dione
  5661. tetrahydro-4-hydroxy-2H-pyran-3-methanol
  5662. tetrahydro-4-hydroxy-4-methyl-2H-pyran-3-methanol
  5663. tetrahydro-4-methyl-2H-pyran-4-ol
  5664. tetrahydro-4-methyl-2H-thiopyran
  5665. tetrahydro-4-methyl-2H-thiopyran 1,1-dioxide
  5666. tetrahydro-4-methyl-3-furanol
  5667. tetrahydro-4H-pyran-4,4-dipropanoic acid
  5668. tetrahydro-4H-pyran-4-one
  5669. tetrahydro-4H-thiopyran-4-one
  5670. tetrahydro-5-methyl-2H-pyran-2-one
  5671. tetrahydro-6-methyl-2H-pyran-2-one
  5672. tetrahydro-6-pentyl-2H-pyran-2-one
  5673. tetrahydro-6-propyl-2H-pyran-2-one
  5674. tetrahydro-d4-furan-d4
  5675. Tetrahydro-tri-cyclopentadiene
  5676. Tetrahydroabietic acid
  5677. tetrahydrobis(μ-(1H-pyrazolato-κN1:κN2))diboron
  5678. tetrahydrofuran
  5679. tetrahydrofuran heptadecahydrate
  5680. Tetrahydrofurfuryl decyl diglycolate
  5681. Tetrahydrofurfuryl decyl phthalate
  5682. Tetrahydrofurfuryl decyl sebacate
  5683. Tetrahydrofurfuryl isooctyl diglycolate
  5684. Tetrahydrofurfuryl isooctyl phthalate
  5685. Tetrahydrofurfuryl isooctyl succinate
  5686. tetrahydrofurfuryl tetrahydro-2-furyl ketone
  5687. Tetrahydrofuryl bromide
  5688. tetrahydromethyl-1H-indene
  5689. tetrahydromethylene-2H-pyran
  5690. Tetrahydropyrethrolone
  5691. Tetrahydropyrethrone
  5692. Tetrahydropyrethrone Isoxime
  5693. Tetrahydropyrethrone semicarbazone
  5694. tetrahydrothiophene
  5695. tetrahydrothiophene 1,1-dioxide
  5696. tetrahydrothiophene 1-oxide
  5697. Tetrahydroxoborate sodalite
  5698. tetrahydroxodiborane(4)
  5699. tetraiodoborate(1-)
  5700. tetraiodogermane
  5701. tetraiodomethane
  5702. tetraiodoplumbane
  5703. tetraiodosilane
  5704. tetraiodostannane
  5705. tetraiodothiophene
  5706. tetrairon(III) dihydroxo pentasulfate heptadecahydrate(α-Copiapit)
  5707. tetrairon(III) dihydroxo pentasulfate hexadecahydrate
  5708. tetrairon(III) dihydroxo pentasulfate tridecahydrate
  5709. tetraisocyanatogermane
  5710. tetraisocyanatosilane
  5711. Tetrakis(ε-caprolactam) mercury(II) diiodide
  5712. tetrakis(μ-(acetato-κO:κO'))dicopper
  5713. tetrakis(μ-(L-alaninato-κO:κO'))octaaquadiholmium(3+) hexachloride
  5714. tetrakis(μ-(L-alaninato-κO:κO'))octaaquadiyttrium(2+) stereoisomer diperchlorate tetraperchlorate
  5715. tetrakis(μ-(L-alaninato-κO:κO'))tetraaqua(tetraaquayttrium)erbium(2+) stereoisomer diperchlorate tetraperchlorate
  5716. tetrakis(μ-(L-alaninato-κO:κO'))tetraaqua(tetraaquayttrium)erbium(2+) stereoisomer diperchlorate tetraperchlorate
  5717. tetrakis(μ-(octanoato-κO:κO'))bis(pyridine)dicopper (Cu-Cu)
  5718. tetrakis(1,1,1,2,2,3,3-Heptafluoro-7,7-dimethyloctane-4,6-dione)neptunium(IV)
  5719. tetrakis(1,1,1,2,2,3,3-Heptafluoro-7,7-dimethyloctane-4,6-dione)plutonium(IV)
  5720. tetrakis(1,1,1,2,2,3,3-Heptafluoro-7,7-dimethyloctane-4,6-dione)thorium (IV)
  5721. tetrakis(1,1,1,2,2,3,3-Heptafluoro-7,7-dimethyloctane-4,6-dione)uranium(IV)
  5722. tetrakis(1,1,1-trifluoro-2,4-pentanedionato-O,O')hafnium
  5723. tetrakis(1,1,1-trifluoro-2,4-pentanedionato-O,O')zirconium
  5724. tetrakis(1,1,1-trifluoro-5,5-dimethyl-2,4-hexanedionato-O,O')hafnium
  5725. tetrakis(1,1-dimethylethyl)germane
  5726. tetrakis(1-methylethyl)benzene
  5727. tetrakis(1-methylethyl)benzene
  5728. tetrakis(1-methylethyl)stannane
  5729. tetrakis(2,2,6,6-Tetramethyl-3,5-heptanedionato)uranium(IV)
  5730. tetrakis(2,2,6,6-tetramethyl-3,5-heptanedionato-O,O')hafnium
  5731. tetrakis(2,2,6,6-Tetramethylheptane-3,5-dionato)thorium(IV)
  5732. tetrakis(2-(hydroxy-κO)benzaldehydato-κO)tetrakis(methanol)tetra-my3-methoxytetranickel
  5733. tetrakis(2-chloro-N-(2,3-dihydro-1,5-dimethyl-3-(oxo-κO)-2-phenyl-1H-pyrazol-4-yl)benzamide-κO)ytterbium(3+) triperchlorate dihydrate
  5734. Tetrakis(2-chloroethoxy)methane
  5735. tetrakis(2-fluoro-2,2-dinitroethyl) propane-1,1,3,3,-tetracarboxylate
  5736. Tetrakis(2-hydroxyethyl)ammonium chloride
  5737. tetrakis(2-methylpropyl)-μ-oxodialuminum
  5738. tetrakis(2-methylpropyl)butanedinitrile
  5739. tetrakis(2-methylpropyl)plumbane
  5740. tetrakis(2-methylpropyl)stannane
  5741. tetrakis(2-phenylethenyl)silane
  5742. Tetrakis(2-phenylethyl)stannane
  5743. tetrakis(2-propenyl)stannane
  5744. tetrakis(3-(methyldi-2-propenylsilyl)propyl)silane
  5745. Tetrakis(3-methyl-2-phenylpyridine) tricobalt hexachloride
  5746. tetrakis(3-methylbutyl) borate(1-)
  5747. tetrakis(3-methylbutyl)germane
  5748. tetrakis(3-methylbutyl)plumbane
  5749. Tetrakis(3-methylbutyl)silane
  5750. Tetrakis(3-Picoline) cobalt(II) diiodide
  5751. tetrakis(4-butylphenoxy)silane
  5752. tetrakis(4-chlorophenoxy)silane
  5753. tetrakis(4-methylphenyl)germane
  5754. tetrakis(4-methylpyridine)bis(thiocyanato-κS)nickel
  5755. tetrakis(4-methylpyridine)bis(thiocyanato-κS)nickel compd. with1,4-dimethylbenzene (1:1)
  5756. tetrakis(4-methylpyridine)bis(thiocyanato-κS)nickel compd. with1,4-dimethylbenzene-d10 (1:1)
  5757. Tetrakis(4-Picoline) cobalt(II) diiodide
  5758. Tetrakis(acetonitrile) tetrafluoborate copper(I)
  5759. tetrakis(aqua)hexakis(glycinato-κO,κ-O')dierbium(3+) hexaperchlorate pentahydrate
  5760. tetrakis(bis(trifluoromethyl)phosphinoxy)silane
  5761. tetrakis(boric acid) trisulfuric acid
  5762. tetrakis(diethylamino)hafnium
  5763. tetrakis(dodecylthio)stannane
  5764. tetrakis(heptafluoropropyl)cyclotetraphosphine
  5765. tetrakis(hexyloxy)germane
  5766. Tetrakis(imidazole) copper (II) diperchlorate
  5767. Tetrakis(iron(III) oxide) selenide oxide (4Fe2O3*SeO2)
  5768. tetrakis(isopropylammonium)tricadmium decachloride
  5769. tetrakis(magnesium carbonate) magnesium hydroxide pentahydrate
  5770. tetrakis(magnesium carbonate) magnesium hydroxide tetrahydrate
  5771. tetrakis(methanol)tetra-my3-methoxytetrakis(2,4-pentanedionato-κO,κO')tetranickel stereoisomer
  5772. tetrakis(methylthio)methane
  5773. tetrakis(mu-(2,2-dimethylpropanoato))bis(2,2-dimethylpropanoato)dieuropium
  5774. tetrakis(mu-(2,2-dimethylpropanoato))bis(2,2-dimethylpropanoato)dilanthanum
  5775. tetrakis(mu-(2,2-dimethylpropanoato))bis(2,2-dimethylpropanoato)disamarium
  5776. tetrakis(mu-(alaninato-κO:κO'))octaaquadierbium(2+) stereoisomer diperchlorate tetraperchlorate
  5777. tetrakis(mu-(alaninato-κO:κO'))octaaquadieuropium(2+) stereoisomer diperchlorate tetraperchlorate
  5778. tetrakis(mu-(butane(dithioato)-κS:κS'))iododiplatinum (Pt-Pt)
  5779. tetrakis(mu-(decanoato-κO:κO'))bis(pyridine)dicopper (Cu-Cu)
  5780. tetrakis(mu-(dodecanoato-κO:κO'))bis(pyridine)dicopper (Cu-Cu)
  5781. tetrakis(mu-(ethane(dithioato)-κS:κS'))iododiplatinum (Pt-Pt)
  5782. tetrakis(mu-(heptanoato-κO:κO'))bis(pyridine)dicopper (Cu-Cu)
  5783. tetrakis(mu-(hexanoato-κO:κO'))bis(hexanoato-κO,κO')bis(1,10-phenanthroline-κN1,κN10)dieuropium stereoisomer
  5784. tetrakis(mu-(l-alaninato-κO:κO'))octaaquadiholmium(2+) dichloride tetrahydrochloride
  5785. tetrakis(mu-(nonanoato-κO:κO'))bis(pyridine)dicopper (Cu-Cu)
  5786. tetrakis(N,N-diethylamino)zirconium
  5787. tetrakis(N,N-dimethylamino)zirconium
  5788. tetrakis(N,N-dimethylformamide)tris(2,6-naphthalenedicarboxylato)trimanganese
  5789. tetrakis(neopentyl)hafnium
  5790. tetrakis(neopentyl)titanium
  5791. tetrakis(neopentyl)zirconium
  5792. Tetrakis(p-tolylsulfanyl)germane
  5793. tetrakis(pentafluorophenyl)silane
  5794. tetrakis(pentyloxy)germane
  5795. tetrakis(phenylmethyl)germane
  5796. tetrakis(Potassium chloride magnesium sulfate)undecahydrate
  5797. tetrakis(rubidium nitrate) rubidium sodium chloride
  5798. tetrakis(silver nitrate di(succinonitrile)) monohydrate
  5799. tetrakis(sodium oxide) aluminum oxide dodecahydrate
  5800. tetrakis(trifluormethyl)distibane
  5801. tetrakis(trifluoromethyl)tetraphosphetane
  5802. tetrakis(trimethylsilyl)silane
  5803. tetrakis(trimethylsilylmethyl)titanium
  5804. tetrakis(trimethylsilylmethyl)zirconium
  5805. Tetrakis(triphenylarsine)platinum
  5806. Tetrakis(triphenylphosphine) tetrafluoborate copper(I)
  5807. Tetrakis(triphenylphosphine)platinum
  5808. tetrakis-(tetramethylammonium)-molybdene-(IV)-cyanide
  5809. Tetrakispotassium calcium phosphate
  5810. tetrakis[μ-methoxo-2,4-pentanedionato(methanol)nickel(2+)]
  5811. Tetrakis[(3-fluorophenyl)methyl]silane
  5812. Tetrakis[(4-bromophenyl)sulfanyl]germane
  5813. Tetrakis[3-(bis(3-(bis(3-(bis(3-(p-1,3-dioxolanylphenyldimethylsilyl)propyl)methylsilyl)propyl)methylsilyl)propyl)methylsilyl)propyl]silane
  5814. Tetrakis[3-(bis(3-(p-1,3-dioxolanylphenyldimethylsilyl)propyl)methylsilyl)propyl]silane
  5815. tetralead (II) divanadium (V) nonaoxide
  5816. tetralead mono-oxy hexacetate trihydrate
  5817. tetralis(cyclohexyloxy)germane
  5818. tetralithium (OC-6-11)-hexachlorocobaltate(4-) decahydrate
  5819. tetralithium (OC-6-11)-hexachloromanganate decahydrat
  5820. tetralithium (OC-6-11)-hexachloronickelate(4-) decahydrate
  5821. tetralithium chloride dimethylacetamide
  5822. tetralithium chloride dimethylformamide
  5823. tetralithium chloride trihydroxide
  5824. Tetralithium diboron pentaoxide
  5825. tetralithium disodium diammonium sulfate tetrahydrate
  5826. tetralithium disodium dipotassium sulfate
  5827. tetralithium titanate (Ti5O12(4-))
  5828. tetralithium triuranyl selenate hexadecahydrate
  5829. tetralithium tungstate (VI)
  5830. tetramanganese(II) acetate triurea dihydrate
  5831. tetramercury(II) hexapotassiumchloride trihydrate
  5832. tetramercury(II) tetrapotassiumchloride trihydrate
  5833. tetramethoxydiborane(4)
  5834. tetramethoxymethane
  5835. Tetramethyl 1,4,5,8-naphthalenetetracarboxylate
  5836. tetramethyl benzene-1,2,3,4-tetracarboxylate
  5837. Tetramethyl titanate
  5838. tetramethyl-μ-oxodialuminum
  5839. Tetramethyl-2-tetrazene
  5840. Tetramethylammonium β-alaninate
  5841. tetramethylammonium 2,2,2-trifluoro-N-(trifluoromethylsulfonyl)acetamide
  5842. Tetramethylammonium 2-(cyclohexylamino)ethanesulfonate
  5843. Tetramethylammonium 2-acrylamido-2-methylpropanesulfonate
  5844. Tetramethylammonium 2-hydroxy-4-morpholinopropanesulfonate
  5845. Tetramethylammonium 2-[bis(2-hydroxyethyl)amino]ethanesulfonate
  5846. Tetramethylammonium alaninate
  5847. Tetramethylammonium calcium tribromide octahydrate
  5848. Tetramethylammonium dicalcium pentabromide tetradecahydrate
  5849. tetramethylammonium hexacyanotrimethylenecyclopropanide
  5850. tetramethylammonium hydrogen selenate monohydrate
  5851. Tetramethylammonium lead iodide
  5852. Tetramethylammonium lysinate
  5853. tetramethylammonium selenate
  5854. tetramethylammonium selenate tetrahydrate
  5855. Tetramethylammonium trifluoroacetate
  5856. Tetramethylammonium valinate
  5857. tetramethylarsonium bis(trifluoromethylsulfonyl)imide
  5858. tetramethylbutanedinitrile
  5859. tetramethylbutanedioic acid
  5860. tetramethyldiborane(6)
  5861. tetramethyldiphosphine
  5862. Tetramethyldiphosphine diborane adduct
  5863. tetramethyldisiloxane
  5864. tetramethyldistibine
  5865. tetramethylene glycoldimethyl ether
  5866. tetramethylgermane
  5867. Tetramethylguanidine acetate
  5868. Tetramethylguanidine ethoxyacetate
  5869. Tetramethylguanidine methoxyacetate
  5870. tetramethylguanidinium 4-fluorophenolate
  5871. tetramethylguanidinium 4-methoxyphenolate
  5872. tetramethylguanidinium 4-methylphenolate
  5873. Tetramethylguanidinium bis(perfluoroethylsulfonyl)imide
  5874. Tetramethylguanidinium butanoate
  5875. Tetramethylguanidinium decanoate
  5876. Tetramethylguanidinium heptanoate
  5877. Tetramethylguanidinium hexanoate
  5878. Tetramethylguanidinium laurate
  5879. Tetramethylguanidinium octanoate
  5880. Tetramethylguanidinium pentanoate
  5881. tetramethylguanidinium phenolate
  5882. tetramethylhydrazine
  5883. tetramethylmmonium ethanesulfonate
  5884. tetramethylmmonium methanesulfonate
  5885. tetramethylphosphinous amide
  5886. tetramethylphosphonium bis(trifluoromethylsulfonyl)imide
  5887. tetramethylphosphorodiamidic acid ethyl ester
  5888. tetramethylphosphorodiamidic chloride
  5889. tetramethylphosphorodiamidic fluoride
  5890. tetramethylphosphorodiamidothionic fluoride
  5891. tetramethylphosphorodiamidous chloride
  5892. tetramethylpiperazine
  5893. tetramethylplumbane
  5894. tetramethylpyrazine
  5895. tetramethylpyrazine 1,4-dioxide
  5896. tetramethylpyrazine dihydrate
  5897. tetramethylsilane
  5898. tetramethylstannane
  5899. tetramethylsulfamide
  5900. tetramethylsulfoxylic diamide
  5901. tetramethylsulfurous diamide
  5902. tetramethylthioperoxydicarbonic diamide (((H2N)C(S))2S2)
  5903. tetramethylthiophene
  5904. tetramethylthiourea
  5905. Tetramethylthiourea antimony(III) triiodide
  5906. Tetramethylthiourea bismuth(III) triiodide
  5907. tetramethylurea
  5908. tetramine zinc sulfate
  5909. tetramine zinc sulfate dihydrate
  5910. tetrammine zinc bromide
  5911. tetramminedichoroplatinum
  5912. tetramminezinc iodide monohydrate
  5913. tetrammmonium pyrophosphate monohydrate
  5914. tetrammonium nitrate diammine monohydrate
  5915. tetrammonium nitrate monoammine monohydrate
  5916. tetrammonium pyrophosphate monohydrate
  5917. tetrammonium uranyl oxalate
  5918. tetraneodymium(III) hexapotassium sulfate octahydrate
  5919. Tetranitro-1,3-bishhomocubane
  5920. Tetranitroglycoluril
  5921. tetranitromethane
  5922. tetranitrosotetramethylenetetramine
  5923. tetranonacontane
  5924. tetraoctacontane
  5925. Tetraoctadecylsilane
  5926. Tetraoctylammonium dioctyl-diglycolamate
  5927. tetraoctylammonium oleate
  5928. Tetraoctylammonium tetrafluoroborate
  5929. Tetraoctylammonium-di(2-ethylhexyl)-oxamate
  5930. tetraoctylgermane
  5931. Tetraoctylphosphonium bis{(trifluomethyl)sulfonyl}imide
  5932. tetraoctylphosphonium bromide
  5933. Tetraoctylphosphonium chloride
  5934. tetraoctylphosphonium glycine ion(1-)
  5935. tetraoctylphosphonium L-alanine ion(1-)
  5936. tetraoctylphosphonium L-aspartate (1:1)
  5937. tetraoctylphosphonium L-glutamate (1:1)
  5938. tetraoctylphosphonium L-isoleucine ion(1-)
  5939. tetraoctylphosphonium L-leucine ion(1-)
  5940. tetraoctylphosphonium L-lysine ion(1-)
  5941. tetraoctylphosphonium L-phenylalanine ion(1-)
  5942. tetraoctylphosphonium L-proline ion(1-)
  5943. tetraoctylphosphonium L-serine ion(1-)
  5944. tetraoctylphosphonium L-valine ion(1-)
  5945. Tetraoctylphosphonium nonafluorobutane-1-sulfonate
  5946. tetraoctylstannane
  5947. tetrapalladium selenide
  5948. tetrapalladium sulfide
  5949. tetrapentacontane
  5950. Tetrapentylammonium 4-toluenesulfonate
  5951. tetrapentylammonium picrate
  5952. tetrapentylazanium chloride
  5953. tetrapentylgermane
  5954. tetrapentylphosphonium L-leucine ion(1-)
  5955. Tetrapentylplumbane
  5956. tetrapentylstannane
  5957. tetraphenoxygermane
  5958. tetraphenyl arsonium tetraphenyl borate
  5959. tetraphenyl(4-methylphenyl)phosphorus
  5960. tetraphenyl(trityl)phosphorus
  5961. tetraphenylammonium perchlorate
  5962. Tetraphenylantimony 1-adamantanecarboxylate
  5963. Tetraphenylantimony benzoate
  5964. Tetraphenylantimony phenylpropiolate
  5965. tetraphenylarsonium
  5966. tetraphenylarsonium iodide
  5967. tetraphenylarsonium perchlorate
  5968. tetraphenylarsonium salt with 2,4,6-trinitrophenol (1:1)
  5969. tetraphenylborate(1-)
  5970. tetraphenylgermane
  5971. tetraphenylhydrazine
  5972. tetraphenylphosphonium
  5973. tetraphenylphosphonium (mu-(ethanedioato(2-)-κO1,κO2':κO1',κO2))(ethanedioato(2-)-κO1,κO2)((ethanedioato(2-)-κO1,κO2)manganate)chromate(1-)
  5974. Tetraphenylphosphonium bis(trifluoromethylsulfonyl)imide
  5975. tetraphenylphosphonium bromide
  5976. tetraphenylphosphonium chloride
  5977. tetraphenylphosphonium iodide
  5978. tetraphenylphosphonium perchlorate
  5979. tetraphenylphosphonium phosphorus hexachloride
  5980. tetraphenylphosphonium salt with trifluoromethanesulfonic acid (1:1)
  5981. Tetraphenylphosphonium tetracyanoborate
  5982. tetraphenylphosphonium tribromide
  5983. tetraphenylphosphonium triiodie
  5984. tetraphenylplumbane
  5985. tetraphenylsilane
  5986. tetraphenylstannane
  5987. tetraphenylstibonium
  5988. tetraphenylstibonium salt with N-hydroxy-1,1-diphenylmethanimine (1:1)
  5989. tetraphenylstiboranyl compd with 1-phenylethanone oxime
  5990. tetraphenylthiophene
  5991. tetraphenylurea
  5992. tetraphosphoric acid calcium salt (1:3)
  5993. tetraphosphoric acid dilithium salt
  5994. tetraphosphoric acid hexaammonium salt
  5995. tetraphosphoric acid hexapotassium salt
  5996. tetraphosphoric acid hexasodium salt
  5997. tetraphosphoric acid monoammonium salt
  5998. tetraphosphoric acid monopotassium salt
  5999. tetraphosphorus trisulfide
  6000. tetrapotassium (HB-5-22111'1'1''1'')-tris[carbonato(2-)-κO,κO']dioxouranate(4-)
  6001. tetrapotassium (OC-6-11)-hexakis(cyano-κC)ferrate(4-)
  6002. Tetrapotassium 1,1,2,2-tetranitramidoethane
  6003. Tetrapotassium 1,1,2,2-tetranitramidoethane dihydrate
  6004. tetrapotassium calcium formate
  6005. tetrapotassium calcium nitrate
  6006. tetrapotassium decachlorooxorhenate(4-)
  6007. tetrapotassium heptanickel chloride tetradecahydrate
  6008. tetrapotassium hexaammonium penta(hydrogen sulfate dihydrogen phosphate)
  6009. tetrapotassium hexacyanoferrate trihydrate
  6010. tetrapotassium hydrogen triphosphate
  6011. tetrapotassium hydrogen triphosphate monohydrate
  6012. tetrapotassium hydrogen tripolyphosphate monohydrate
  6013. tetrapotassium iron(III) sulfate 14-hydrate
  6014. tetrapotassium lead(II) selenocyanate
  6015. tetrapotassium nickel manganese sulfate decahydrate
  6016. tetrapotassium nickel nitrite
  6017. tetrapotassium pentamanganese chloride
  6018. tetrapotassium thorium oxalate tetrahydrate
  6019. tetrapotassium thorium sulfate dihydrate
  6020. Tetrapotassium trititanium(IV) oxide
  6021. Tetrapotassium uranyl tricarbonate
  6022. tetrapotassium wolfram (IV) cyanide
  6023. tetrapraseodymium octadecapotassium sulfate
  6024. Tetrapropylammonium 2-(bis(2-hydroxyethyl)amino)ethanesulfonate
  6025. Tetrapropylammonium 2-acrylamido-2-methylpropanesulfonate
  6026. tetrapropylammonium bis(trifluoromethanesulfonyl)imide
  6027. Tetrapropylammonium tetrakis(4,4,4-trifluoro-1-(2-thienyl)-1,3-diphenyl-1,3-butanediono)europium(III)
  6028. tetrapropylbis(μ-(1H-pyrazolato-κN1:κN2))diboron
  6029. tetrapropylgermane
  6030. tetrapropylhydrazine
  6031. tetrapropylplumbane
  6032. tetrapropylsilane
  6033. tetrapropylstannane
  6034. tetrarubidium (HB-5-22111'1'1''1'')-tris[carbonato(2-)-κO,κO']dioxouranate(4-)
  6035. tetrarubidium (OC-6-11)-hexabromocadmate(4-)
  6036. tetrarubidium (OC-6-11)-hexachlorocadmate(4-)
  6037. Tetrarubidium diiron(III) sulfate dodecahydrate
  6038. tetrasamarium pentasodium sulfate octahydrate
  6039. tetrasilane
  6040. tetrasodium (HB-8-22-111'1'1''1'')-tris(carbonato(2-)-κO,κO')dioxouranate(4-)
  6041. tetrasodium (OC-6-11)-hexakis(cyano-κC)ferrate(4-)
  6042. Tetrasodium 1,1,2,2-tetranitramidoethane monohydrate
  6043. tetrasodium arsenite
  6044. tetrasodium arsenite heptahydrate
  6045. tetrasodium cadmium sulfate
  6046. tetrasodium chromate (CrO5(4-))
  6047. tetrasodium copper(I) cyanide
  6048. tetrasodium dihydroxo plumbate(II) hexadecahydrate
  6049. tetrasodium ethylenediamine tetraacetate dihydrate
  6050. tetrasodium hafnium sulfate dihydrate
  6051. tetrasodium hexacyanoferrate(II) decahydrate
  6052. tetrasodium hypophosphate decahydrate
  6053. tetrasodium phosphonato phosphate decahydrate
  6054. tetrasodium pyrophosphate deca(hydrogen peroxide)
  6055. tetrasodium pyrophosphate hexa(hydrogen peroxide)
  6056. tetrasodium thorium(IV) oxalate hexahydrate
  6057. tetrasodium uranyl carbonate
  6058. Tetrasodium uranyl tricarbonate
  6059. tetrasodium vanadate (V2O7(4-))
  6060. tetrasodium [[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] phosphate
  6061. tetrasodiumchromate tridecahydrate
  6062. tetraspiro[2.0.0.0.2.1.1.1]undecane
  6063. tetraspiro[2.0.2.0.2.0.2.0]dodecane
  6064. tetrastrontium dihydroxy diarsenate
  6065. tetratetracontane
  6066. Tetrathallium manganese hexaiodide
  6067. tetrathionic acid diammonium salt
  6068. tetrathionic acid dipotassium salt
  6069. tetrathionic acid disodium salt
  6070. tetrathorium oxalate chloride 20-hydrate
  6071. tetratriacontafluorohexadecane
  6072. tetratriacontane
  6073. tetratriacontanoic acid
  6074. tetratriacontanoic acid ethyl ester
  6075. tetratriacontanoic acid methyl ester
  6076. Tetratriacontanoyl chloride
  6077. tetraurea tetrahydronitrate calcium nitrate
  6078. Tetravanadium heptoxide
  6079. tetrazirconium hexahydroxy decafluoride trihydrate
  6080. tetrazirconium(IV) trisulfate decahydroxide decahydrate
  6081. thalicarpine
  6082. thallium
  6083. thallium (I) hydrogensulfate
  6084. thallium (I) metathiogermanate
  6085. thallium (I) orthothiogermanate
  6086. thallium aluminium sulfate dodecahydrate
  6087. thallium antimony selenide
  6088. thallium antimony telluride
  6089. thallium arsenic diselenide
  6090. thallium arsenic disulfide
  6091. thallium arsenic ditelluride
  6092. thallium azide (Tl(N3))
  6093. thallium bromide (TlBr)
  6094. thallium bromide (TlBr3)
  6095. thallium bromide selenide (Tl5BrSe2)
  6096. thallium bromomethanedisulfonate
  6097. thallium chloride (TlCl)
  6098. thallium chloride (TlCl3)
  6099. thallium chloromethanedisulfonate
  6100. thallium chromium(III) sulfate dodecahydrate
  6101. thallium cyanide (Tl(CN))
  6102. thallium fluoride (Tl(HF2))
  6103. thallium fluoride (TlF)
  6104. thallium fluoride (TlF)
  6105. thallium fluoride (TlF)
  6106. thallium fluoride (TlF3)
  6107. thallium hydroxide (Tl(OH))
  6108. thallium hydroxide (Tl(OH)3)
  6109. thallium indium(III) fluoride dihydrate
  6110. thallium iodide (TlI)
  6111. thallium iodide (TlI3)
  6112. thallium iodide selenide (Tl5ISe2)
  6113. thallium iodide selenide (Tl6I4Se)
  6114. thallium iodide sulfide (Tl6I4S)
  6115. thallium ion (Tl(1+))
  6116. thallium iron(III) sulfate dodecahydrate
  6117. Thallium mandelate
  6118. thallium methanedisulfonate
  6119. thallium natrolite (Tl1.87Na0.05Mg0.03(Al1.98Si3.02O10).2.33H2O)
  6120. thallium nitrate di(nitric acid)
  6121. thallium oxide (Tl2O)
  6122. thallium selenide (Tl2Se)
  6123. Thallium sulfamate
  6124. thallium sulfate hydrogen sulfate
  6125. thallium sulfide (Tl2S)
  6126. thallium telluride
  6127. thallium telluride (Tl2Te)
  6128. thallium vanadium(III) sulfate dodecahydrate
  6129. thallium zirconium sulfide (Tl2ZrS3)
  6130. thallium zirconium sulfide (Tl4ZrS4)
  6131. thallium(+1) cation bromate
  6132. thallium(1+) (OC-6-11)-hexafluoroantimonate(1-)
  6133. thallium(1+) (T-4)-rhenate (ReO4(1-))
  6134. thallium(1+) tetraphenylborate(1-)
  6135. thallium(I) cadmium chloride
  6136. Thallium(I) indium(III) desulfide
  6137. Thallium(I) metavanadate
  6138. Thallium(I) neodymium sulfate octahydrate
  6139. Thallium(I) neodymium sulfate trihydrate
  6140. Thallium(I) pivalate
  6141. Thallium(I) styphnic acid
  6142. Thallium(I) tellurium bromide
  6143. thallium(I) thiomolybdate
  6144. thallium(I) thiosulfate
  6145. thallium(III) chloride tetrahydrate
  6146. thallium(III) dicesium chloride dihydrate
  6147. Thallium(III) glycolate
  6148. thallium(III) hydrogen disulfate
  6149. thallium(III) hydrogen disulfate tetrahydrate
  6150. thallium(III) hydroxosulfate dihydrate
  6151. Thallium(III) lactate
  6152. Thallium(III) mandelate
  6153. Thallium(III) oxide
  6154. Thallium(III) tellurite
  6155. thallium(III) tricesium chloride
  6156. thallium(III) tricesium chloride monohydrate
  6157. thallium(III)bromide thallium(I) bromide
  6158. thallium(III)bromide tris(thallium(I) bromide)
  6159. thallium(III)chloride thallium(I) chloride
  6160. thallium(III)chloride tris(thallium(I) chloride)
  6161. Theophylline-7-acetic acid
  6162. Therminol 55
  6163. therminol 75
  6164. Thiamethoxam
  6165. Thian-2-one
  6166. thianthrene
  6167. thianthrene 5,10-dioxide
  6168. thiazole
  6169. thiazyl fluoride ((SN)F)
  6170. thieno(2,3-b)thiophene
  6171. thiepane
  6172. thietane
  6173. thietane 1-oxide
  6174. thiirane
  6175. thiirene
  6176. Thio-bis(difluorophosphine)
  6177. Thioacetamide bismuth(III) triiodide
  6178. Thioacetazone
  6179. thioacetic acid S-trifluoromethyl ester
  6180. thioantimonic acid (H3SbS3) trisodium salt
  6181. thiobis((methylthio)methane)
  6182. thiobis(chloromethane)
  6183. thiobis(dichlorofluoromethane)
  6184. thiobis(dichloromethane)
  6185. thiobis(trichloromethane)
  6186. thiobis(trifluoromethane)
  6187. thiobismethane
  6188. thiobismethane compd. with borane (1:1)
  6189. thioboric acid (H3BS3) tributyl ester
  6190. thioboric acid (H3BS3) trimethyl ester
  6191. thioboric acid (H3BS3) tripentyl ester
  6192. thioboric acid (H3BS3) triphenyl ester
  6193. thioboric acid (H3BS3) tripropyl ester
  6194. thioboric acid (H3BS3) tris(trifluoromethyl) ester
  6195. thiocyanate
  6196. thiocyanic acid
  6197. thiocyanic acid (2-benzothiazolylthio)methyl ester
  6198. thiocyanic acid 1,1,2-trichloro-2-phenoxyethyl ester
  6199. thiocyanic acid 1,2-dichloro-2-(4-chlorophenoxy)ethyl ester
  6200. thiocyanic acid 1,2-dichloro-2-phenoxyethyl ester
  6201. thiocyanic acid 1-chloro-2-(4-chlorophenoxy)ethenyl ester
  6202. thiocyanic acid 1-chloro-2-phenoxyethenyl ester
  6203. thiocyanic acid 2-(2,4,6-trichlorophenoxy)ethenyl ester
  6204. thiocyanic acid 2-(2,4-dichlorophenoxy)ethenyl ester
  6205. thiocyanic acid 2-(phenylthio)ethenyl ester
  6206. thiocyanic acid 2-butene-1,4-diyl ester
  6207. thiocyanic acid 2-butoxyethenyl ester
  6208. thiocyanic acid 2-propenyl ester
  6209. thiocyanic acid 4-chlorophenyl ester
  6210. thiocyanic acid ammonium salt
  6211. thiocyanic acid barium salt
  6212. thiocyanic acid beryllium salt
  6213. thiocyanic acid butyl ester
  6214. thiocyanic acid cadmium salt
  6215. thiocyanic acid calcium salt
  6216. thiocyanic acid cesium salt
  6217. thiocyanic acid cobalt(2+) salt
  6218. thiocyanic acid compd. with 1,2-ethanediamine (2:1)
  6219. thiocyanic acid compd. with guanidine (1:1)
  6220. thiocyanic acid compd. with hydrazine (1:1)
  6221. thiocyanic acid compd. with N,N-dibutyl-1-butanamine (1:1)
  6222. thiocyanic acid compd. with piperazine (1:1)
  6223. thiocyanic acid compd. with piperidine (1:1)
  6224. thiocyanic acid copper(1+) salt
  6225. thiocyanic acid copper(2+) salt
  6226. thiocyanic acid ethyl ester
  6227. thiocyanic acid lead(2+) salt
  6228. thiocyanic acid lithium salt
  6229. thiocyanic acid magnesium salt
  6230. thiocyanic acid mercury(2+) salt
  6231. thiocyanic acid methyl ester
  6232. thiocyanic acid nickel(2+) salt
  6233. thiocyanic acid pentyl ester
  6234. thiocyanic acid phenyl ester
  6235. thiocyanic acid phenylmethyl ester
  6236. thiocyanic acid potassium salt
  6237. thiocyanic acid propyl ester
  6238. thiocyanic acid rubidium salt
  6239. thiocyanic acid silver(1+) salt
  6240. thiocyanic acid sodium salt
  6241. thiocyanic acid strontium salt
  6242. thiocyanic acid thallium(1+) salt
  6243. thiocyanic acid trifluoromethyl ester
  6244. thiocyanic acid zinc salt
  6245. thiodiphosphoric acid (((HO)2P(S))2O) tetraethyl ester
  6246. thiohypophosphoric acid (((HS)2P(S))2) cadmium sodium salt (2:3:2) octahydrate
  6247. thiohypophosphoric acid (((HS)2P(S))2) cadmium sodium salt (2:3:2) tetrahydrate
  6248. thiomorpholine
  6249. thionitrous acid S-(trifluoromethyl) ester
  6250. thionyl bromide
  6251. thionyl chloride
  6252. thionyl chloride fluoride
  6253. thionyl fluoride
  6254. thioperoxydicarbonic acid (((HO)C(O))2S2) bis(2-methylpropyl) ester
  6255. thioperoxydicarbonic acid (((HO)C(O))2S2) dibutyl ester
  6256. thioperoxydicarbonic acid (((HO)C(O))2S2) diethyl ester
  6257. thioperoxydicarbonic acid (((HO)C(O))2S2) dimethyl ester
  6258. Thiophen-2-ylmethylidenehydrazine
  6259. thiophene
  6260. Thiophene-2-carboxylic acid ethenyl ester
  6261. thiophosphonyl chloride fluoride ((PS)ClF2)
  6262. thiophosphoric acid tris(2-chlorophenyl) ester
  6263. thiophosphoryl bromide
  6264. thiophosphoryl chloride
  6265. thiophosphoryl fluoride
  6266. thiophosporic acid diphenyl (2-methylphenyl) ester
  6267. thiosilicic acid (H4SiS4) tetramethyl ester
  6268. thiosulfuric acid (H2S2O3) barium salt (1:1)
  6269. thiosulfuric acid (H2S2O3) calcium salt (1:1)
  6270. thiosulfuric acid (H2S2O3) diammonium salt
  6271. thiosulfuric acid (H2S2O3) dipotassium salt
  6272. thiosulfuric acid (H2S2O3) disilver(1+) salt
  6273. thiosulfuric acid (H2S2O3) disodium salt
  6274. thiosulfuric acid (H2S2O3) disodium salt dihydrate
  6275. thiosulfuric acid (H2S2O3) disodium salt dihydrate
  6276. thiosulfuric acid (H2S2O3) disodium salt monohydrate
  6277. thiosulfuric acid (H2S2O3) disodium salt pentahydrate
  6278. thiosulfuric acid (H2S2O3) disodium salt pentahydrate
  6279. thiosulfuric acid (H2S2O3) disodium salt tetrahydrate
  6280. thiosulfuric acid (H2S2O3) magnesium salt (1:1)
  6281. thiosulfuric acid (H2S2O3) magnesium salt (1:1) hexahydrate
  6282. thiotelluric acid (H2TeS3) disodium salt
  6283. thiourea
  6284. thiourea compd. with 2,2-dimethylbutane (3:1)
  6285. thiourea compd. with cycloheptane (3:1)
  6286. thiourea compd. with cyclohexane (3:1)
  6287. thiourea compd. with cyclooctane (3:1)
  6288. thiourea compd. with hexachloroethane (59:20)
  6289. thiourea mononitrate
  6290. thioxoborane
  6291. thorium
  6292. Thorium (I) fluoride
  6293. Thorium (II) fluoride
  6294. Thorium (II) oxyfluoride
  6295. Thorium (III) fluoride
  6296. thorium bromide (ThBr4)
  6297. thorium chloride (ThCl4)
  6298. thorium diliturate eicosahydrate
  6299. thorium disodium sulfate hexahydrate
  6300. thorium fluoride (ThF4)
  6301. thorium fluoride hydrogen fluoride monohydrate
  6302. thorium fluoride tetra(hydrogen fluoride)
  6303. thorium hydride (Th4H15)
  6304. thorium hydride (ThH2)
  6305. thorium iodide (ThI4)
  6306. thorium nitrate pentahydrate
  6307. thorium oxalate hexahydrate
  6308. thorium oxide (ThO2)
  6309. thorium phosphate diphosphate
  6310. thorium phosphate hydrogenphosphate
  6311. thorium phosphate hydrogenphosphate hydrate
  6312. thorium sulfate octahydrate
  6313. thorium sulfate tetrahydrate
  6314. thorium tetrasodium sulfate tetrahydrate
  6315. thorium uranium oxide (Th0.1U0.9O2)
  6316. thorium uranium oxide (Th0.5U0.5O2)
  6317. thorium uranium oxide (Th0.9U0.1O2)
  6318. Thorium(IV) 4-cyanopyridine-N-oxide tetrabromide
  6319. Thorium(IV) 4-cyanopyridine-N-oxide tetrachloride
  6320. Thorium(IV) 4-cyanopyridine-N-oxide tetranitrate
  6321. Thorium(IV) 4-cyanopyridine-N-oxide tetrathiocyanate
  6322. thorium(IV) acetate
  6323. Thorium(IV) bis(4-cyanopyridine-N-oxide) tetrabromide
  6324. Thorium(IV) bis(4-cyanopyridine-N-oxide) tetrachloride
  6325. Thorium(IV) bis(4-cyanopyridine-N-oxide) tetranitrate
  6326. Thorium(IV) bis(4-cyanopyridine-N-oxide) tetraperchlorate
  6327. Thorium(IV) bis(4-cyanopyridine-N-oxide) tetrathiocyanate
  6328. Thorium(IV) bis(5,6-benzoquinoline) tetrabromide
  6329. Thorium(IV) bis(5,6-benzoquinoline) tetrachloride
  6330. Thorium(IV) bis(5,6-benzoquinoline) tetranitrate
  6331. Thorium(IV) bis(5,6-benzoquinoline) tetrathiocyanate
  6332. thorium(IV) chloride octahydrate
  6333. Thorium(IV) hexakis(5,6-benzoquinoline) tetraperchlorate
  6334. Thorium(IV) N-(2-methoxyphenyl)-1-pyridin-2-ylmethanimine tetranitrate
  6335. Thorium(IV) N-(2-methoxyphenyl)-1-pyridin-2-ylmethanimine tetrathiocyanate
  6336. Thorium(IV) N-(2-methylphenyl)-2-pyridylmethanimine tetranitrate
  6337. Thorium(IV) N-(2-methylphenyl)-2-pyridylmethanimine tetrathiocyanate
  6338. Thorium(IV) N-(3-chlorophenyl)-1-pyridin-2-ylmethanimine tetranitrate
  6339. Thorium(IV) N-(3-methylphenyl)-2-pyridylmethanimine tetranitrate
  6340. Thorium(IV) N-(3-methylphenyl)-2-pyridylmethanimine tetrathiocyanate
  6341. Thorium(IV) N-(4-ethoxyphenyl)-1-pyridin-2-ylmethanimine tetranitrate
  6342. Thorium(IV) N-(4-ethoxyphenyl)-1-pyridin-2-ylmethanimine tetrathiocyanate
  6343. Thorium(IV) N-(4-methoxyphenyl)-1-pyridin-2-ylmethanimine tetranitrate
  6344. Thorium(IV) N-(4-methoxyphenyl)-1-pyridin-2-ylmethanimine tetrathiocyanate
  6345. Thorium(IV) N-(4-methylphenyl)-2-pyridylmethanimine tetranitrate
  6346. Thorium(IV) N-(4-methylphenyl)-2-pyridylmethanimine tetrathiocyanate
  6347. Thorium(IV) N-phenyl-2-pyridylmethanimine tetranitrate
  6348. Thorium(IV) N-phenyl-2-pyridylmethanimine tetrathiocyanate
  6349. Thorium(IV) tetrakis(5,6-benzoquinoline) tetrabromide
  6350. Thorium(IV) tetrakis(5,6-benzoquinoline) tetrachloride
  6351. Thorium(IV) tetrakis(5,6-benzoquinoline) tetrathiocyanate
  6352. Thorium(IV) tetrathiocyanate
  6353. threo-1-isopropyl-1,2-propanediol
  6354. threo-1-t-butyl-1,2-propanediol
  6355. threo-10,11-dihydroxyoctadecanoic acid
  6356. threo-11,12-dihydroxyoctadecanoic acid
  6357. threo-12,13-dihydroxyoctadecanoic acid
  6358. threo-2-bromo-3-fluoro-butane
  6359. threo-3-bromo-2-fluoro-4-methyl-pentane
  6360. threo-3-bromo-4-fluoro-hexane
  6361. threo-3-Hydroxy-2-methyl-3-phenylpropanoic acid methyl ester
  6362. threo-5,5,5-trichloro-4-hydroxy-3-ethylpentan-2-one
  6363. threo-6,7-Dihydroxydodecanedioic acid
  6364. threo-6,7-Dihydroxyoctadecanoic acid
  6365. threo-7,8-dihydroxyoctadecanoic acid
  6366. threo-8,9-dihydroxyoctadecanoic acid
  6367. threo-ethyl 3-(2,4-dichlorophenyl)-5-oxo-4,5-diphenylpentanoate
  6368. threo-ethyl 3-(4-bromophenyl)-5-oxo-4,5-diphenylpentanoate
  6369. threo-ethyl 3-(4-chlorophenyl)-5-oxo-4,5-diphenylpentanoate
  6370. threo-ethyl 3-(4-methylphenyl)-5-oxo-4,5-diphenylpentanoate
  6371. threo-N-(2-hydroxyethyl)-9,10-dihydroxyoctadecanamide
  6372. threo-N-decyl-9,10-dihydroxyoctadecanamide
  6373. threo-N-octadecyl-9,10-dihydroxyoctadecanamide
  6374. threo-N-pentyl-9,10-dihydroxyoctadecanamide
  6375. threonine compd. with sulfuric acid zinc salt hydrate (1:1:1:1)
  6376. thujamenthol
  6377. thujamenthon
  6378. thulium
  6379. thulium (III) orthovanadate
  6380. thulium bromide (TmBr3)
  6381. thulium bromide octahydrate
  6382. thulium chloride (TmCl2)
  6383. thulium chloride (TmCl3)
  6384. Thulium chloride trinicotinamide hexahydrate
  6385. thulium cuprate
  6386. Thulium digermanate
  6387. thulium fluoride (TmF3)
  6388. Thulium hydrogen uranosilicate
  6389. Thulium hydrogen uranosilicate decahydrate
  6390. Thulium indium digermanate
  6391. thulium iodide (TmI3)
  6392. thulium oxide (Tm2O3)
  6393. thulium propionate
  6394. thulium propionate monohydrate
  6395. thulium sulfate decahydrate
  6396. thulium sulfate hexaurea
  6397. thulium sulfide (Tm2S3)
  6398. Thulium titanate
  6399. thulium(+3) cation trisulfate
  6400. Thulium(III) β-resorcylate
  6401. thulium(III) chloride hexahydrate
  6402. thulium(III) ethylsulfate
  6403. Thulium(III) histidine trinitrate monohydrate
  6404. thulium(III) iodate tetrahydrate
  6405. Thulium(III) nitrate dihydrate
  6406. thulium(III) nitrate hexahydrate
  6407. Thulium(III) nitrate pentahydrate
  6408. Thulium(III) nitrate tetrahydrate
  6409. Thulium(III) triindium(I)
  6410. Thulium(III) triisothiocyanate tris(2,6-Dimethylpicoline-N-oxide)
  6411. Thulium(III) trilead
  6412. Thulium(III) tris(1,4-thioxane-S-oxide trifluoroacetate)
  6413. Thulium(III) tris(2,6-dichlorobenzoic acid)
  6414. Thulium(III) tris(3-Methoxybenzoate)
  6415. Thulium(III)-2,5-dihydroxybenzoate
  6416. Thulium(III)-2,6-dihydroxybenzoate
  6417. Thulium(III)trifluoromethanesulphonate hepta(4-picoline-N-oxide)
  6418. thullium rhodium oxide (TmRhO3)
  6419. thymidine
  6420. Tibolone
  6421. Ticagrelor
  6422. Ticlopidine hydrochloride
  6423. Tiglic anhydride
  6424. tin
  6425. tin arsenide (Sn4As3)
  6426. tin bromide (SnBr2)
  6427. tin bromide iodide (SnBrI)
  6428. tin chloride (SnCl2)
  6429. tin chloride (SnCl2) dihydrate
  6430. tin chloride iodide (SnClI)
  6431. tin compd. with titanium (1:3)
  6432. tin diiodide mono(hydrogen iodide)
  6433. tin dioxysulfate
  6434. tin dioxysulfate tetrahydrate
  6435. tin fluoride (SnF2)
  6436. tin hydroxide (Sn(OH)2)
  6437. tin hydroxide (Sn(OH)4)
  6438. tin iodide (SnI2)
  6439. tin oxide (SnO)
  6440. tin oxide (SnO2)
  6441. tin selenide (SnSe)
  6442. tin selenide (SnSe2)
  6443. tin sulfide (SnS)
  6444. tin sulfide (SnS2)
  6445. tin telluride (SnTe)
  6446. tin tetrachloride bis(acetic acid)
  6447. tin tetrachloride di(selenium oxychloride)
  6448. tin(II) chloride hydrogen chloride trihydrate
  6449. Tin(IV) bis(2-dimethylaminopyridine N-oxide) tetrabromide
  6450. Tin(IV) bis(2-dimethylaminopyridine N-oxide) tetrachloride
  6451. Tin(IV) bis(2-methylaminopyridine N-oxide) tetrabromide
  6452. Tin(IV) bis(2-methylaminopyridine N-oxide) tetrachloride
  6453. Tin(IV) bis(aniline) tetrachloride
  6454. Tin(IV) bis(cyclohexylammonium) hexachloride
  6455. Tin(IV) bis(dibutylaminium) hexachloride
  6456. Tin(IV) bis(diethyl ether) tetrachloride
  6457. Tin(IV) bis(diethylaminium) hexachloride
  6458. Tin(IV) bis(diisobutylaminium) hexachloride
  6459. Tin(IV) bis(diisopropylaminium) hexachloride
  6460. Tin(IV) bis(dimethylaminium) hexachloride
  6461. Tin(IV) bis(dipropylaminium) hexachloride
  6462. Tin(IV) bis(ethyl alcohol) tetrachloride
  6463. Tin(IV) bis(ethyl benzoate) tetrachloride
  6464. Tin(IV) bis(ethyl propanoate) tetrachloride
  6465. Tin(IV) bis(isopentylammonium) hexachloride
  6466. Tin(IV) bis(isopropylaminium) hexachloride
  6467. Tin(IV) bis(piperidinium) hexachloride
  6468. Tin(IV) bis(pyrrolidinium) hexachloride
  6469. Tin(IV) bis(sec-butylammonium) hexachloride
  6470. Tin(IV) bis(tert-butylammonium) hexachloride
  6471. Tin(IV) bis(tetrabutylaminium) hexachloride
  6472. Tin(IV) bis(tetraethylaminium) hexachloride
  6473. Tin(IV) bis(tetrapropylaminium) hexachloride
  6474. Tin(IV) bis(tributylaminium) hexachloride
  6475. Tin(IV) bis(triethylaminium) hexachloride
  6476. Tin(IV) bis(trimethylaminium) hexachloride
  6477. Tin(IV) bis(tripropylaminium) hexachloride
  6478. Tin(IV) diethyl adipate tetrachloride
  6479. Tin(IV) diethyl glutarate tetrachloride
  6480. Tin(IV) diethyl malonate tetrachloride
  6481. Tin(IV) diethyl oxalate tetrachloride
  6482. Tin(IV) diethyl sebacate tetrachloride
  6483. Tin(IV) diethyl succinate tetrachloride
  6484. Tin(IV) diselenite
  6485. Tin(IV) tellurite
  6486. Tioconazole
  6487. Tiopronin
  6488. titanium
  6489. titanium
  6490. titanium
  6491. titanium alloy base Ti 88-91,Al 5.5-6.75,V 3.5-4.5,Fe0-0.40,O 0-0.20,C0-0.10,N 0-0.05,H 0-0.015 (UNS R56400)
  6492. titanium alloy base Ti 92,V 4.4,Al 3.5
  6493. titanium boride (TiB)
  6494. titanium boride (TiB2)
  6495. titanium bromide (TiBr)
  6496. titanium bromide (TiBr2)
  6497. titanium bromide (TiBr3)
  6498. titanium carbide (TiC)
  6499. titanium chloride (TiCl)
  6500. titanium chloride (TiCl2)
  6501. titanium chloride (TiCl3)
  6502. titanium chloride (TiCl4)
  6503. titanium chloride oxide (TiOCl)
  6504. titanium difluoride oxide (TiF2O)
  6505. titanium fluoride (TiF)
  6506. titanium fluoride (TiF2)
  6507. titanium fluoride (TiF3)
  6508. titanium fluoride oxide (TiFO)
  6509. titanium hydride (TiH2)
  6510. titanium hydroxide (Ti(OH)4) tetra(1,1-dimethylethyl) ester
  6511. titanium iodide (TiI)
  6512. titanium iodide (TiI2)
  6513. titanium iodide (TiI3)
  6514. titanium ion (Ti(1+))
  6515. titanium nitride (TiN)
  6516. titanium oxide (Ti2O3)
  6517. titanium oxide (Ti3O5)
  6518. titanium oxide (Ti3O5)
  6519. titanium oxide (Ti3O5)
  6520. titanium oxide (Ti4O7)
  6521. titanium oxide (Ti6O11)
  6522. titanium oxide (TiO)
  6523. titanium oxide (TiO)
  6524. titanium oxide (TiO)
  6525. titanium oxide (TiO2)
  6526. titanium silicide (1:1)
  6527. titanium silicide (Ti5Si3)
  6528. titanium silicide (TiSi)
  6529. titanium silicide (TiSi2)
  6530. titanium sulfide (TiS2)
  6531. titanium tetrachloride di(selenium oxychloride)
  6532. titanium trichloride hexahydrate
  6533. titanium uranium oxide (Ti2UO6)
  6534. titanium yttrium oxide (Ti2Y2O7)
  6535. titanium zinc oxide (TiZn2O4)
  6536. titanium zirconium oxide (TiZrO4)
  6537. titanium(+4) cation disulfate
  6538. Titanium(III) trisulfate
  6539. Titanium(IV) oxyhydrate
  6540. Titanium(IV)(bis-(2-hydroxynaphthyl)-o-phenylenedialdimine dichloride)
  6541. titanyl sulfate dihydrate
  6542. titanyl sulfate monohydrate
  6543. titanyl sulfate sulfuric acid
  6544. titanyl sulfate sulfuric acid monohydrate
  6545. TKX-55
  6546. Tl-Natrolite (Tl-exchanged natrolite)
  6547. Toluene-2,4-dicarbamic acid di-isobutyl ester
  6548. Toluene-2,4-dicarbamic acid di-n-butyl ester
  6549. Toluene-4-sulfonic acid 4-allyl-5-oxo-2,5-dihydro-furan-3-yl ester
  6550. Toluene-p-sulphonic anhydride
  6551. topiramate
  6552. toxaphene
  6553. Tranid
  6554. trans,trans-1,2-Bis(prop-1-enyl)benzene
  6555. trans,trans-13,13-dichloro-trans-bicyclo(10.1.0)trideca-4,8-diene
  6556. trans-(±)-11,12-Dimethyl-9,10-Dihydro-9,10-ethanoanthracene
  6557. trans-(±)-9,10-Dihydro-9,10-ethanoanthracene-11,12-bismethanol ditosylate
  6558. trans-(+)-11,12-Dimethyl-9,10-Dihydro-9,10-ethanoanthracene
  6559. trans-(+)-3-carboxy-2,2-dimethylcyclobutaneacetic acid
  6560. trans-(-)-9,10-Dihydro-9,10-ethanoanthracene-11,12-bismethanol ditosylate
  6561. trans-(1,1'-bicyclopentyl)-2-ol
  6562. trans-(2-(trifluoromethyl)cyclopropan)carboxylic acid
  6563. trans-(2-trifluoromethyl)cyclopropanemethanol
  6564. trans-(3S,4S)-3,4-bis(phenylcarbonyl(oxy))tetrahydrofuran
  6565. trans-(3S,4S)-4-(phenylmethoxy)-3-tetrahydrofuranol benzoate
  6566. trans-(S)-(-)-4-Methylbenzenesulfinic acid 2-butenyl ester
  6567. trans-(S)-(-)-4-Methylbenzenesulfinic acid 2-hexenyl ester
  6568. trans-(S)-(-)-4-Methylbenzenesulfinic acid 2-octenyl ester
  6569. trans-(S)-(-)-4-Methylbenzenesulfinic acid 3-phenylprop-2-enyl ester
  6570. trans-1,1'-(1,2-cyclopropanediyl)bisbenzene
  6571. trans-1,1'-bi(cyclohexan)-1'-en-2-ol
  6572. trans-1,1'-vinylenebis[3,3'-(3-methoxypropyl)urea]
  6573. trans-1,1'-vinylenebis[3,3'-(morpholin-4-yl)urea]
  6574. trans-1,1'-vinylenebis[3,3'-(p-nitrophenyl)urea]
  6575. trans-1,1,1,3-Tetrafluoro-2-butene
  6576. trans-1,1,1-Trimethoxybut-2-ene
  6577. trans-1,1,1-Trimethoxypent-2-ene
  6578. trans-1,1,2,2,3,3,3a,4,4,5,5,6,6,7,7,7a-hexadecafluorooctahydro-1H-indene
  6579. trans-1,1,2,4,4,5-hexachlorocyclohexane
  6580. trans-1,1-dichloro-2,3-dimethylcyclopropane
  6581. trans-1,2-bis[(trimethylsilyl)oxy]cyclohexane
  6582. trans-1,2-cyclohexanediol
  6583. trans-1,2-cyclopentanediol
  6584. trans-1,2-dibromocyclohexane
  6585. trans-1,2-dibromocyclopentane
  6586. trans-1,2-dichlorocyclodecane
  6587. trans-1,2-dichlorohexafluorocyclobutane
  6588. trans-1,2-diethenylcyclobutane
  6589. trans-1,2-diethylcyclopentane
  6590. trans-1,2-diethylcyclopropane
  6591. trans-1,2-dihydro-1,2-dimethylacenaphthylene
  6592. trans-1,2-dihydroacenaphthylene-1,2-dicarboxylic acid dimethyl ester
  6593. trans-1,2-dimethyl-1,2-cyclohexanediol
  6594. trans-1,2-Dimethyl-1,2-diphenylcyclobutane
  6595. trans-1,2-dimethyl-1-oxylatopiperidine-1-ium
  6596. trans-1,2-dimethyl-4-cyclohexene-1,2-diol
  6597. trans-1,2-dimethylcyclobutane
  6598. trans-1,2-dimethylcyclohexane
  6599. trans-1,2-dimethylcyclohexanol acetate
  6600. trans-1,2-dimethylcyclopentane
  6601. trans-1,2-dimethylcyclopentanol
  6602. trans-1,2-dimethylcyclopentanol acetate
  6603. trans-1,2-dimethylcyclopropane
  6604. trans-1,2-Dinitrocycloheptane
  6605. trans-1,2-Dinitrocyclohexane
  6606. trans-1,2-heptanediol cyclic sulfite
  6607. trans-1,3,5,7-tetraoxadecahydronaphthalene
  6608. trans-1,3-diiodocyclobutane
  6609. trans-1,3-dimethylcyclobutane
  6610. trans-1,3-dimethylcyclohexane
  6611. trans-1,3-dimethylcyclopentane
  6612. trans-1,3-Dinitrocyclohexane
  6613. trans-1,4-(diethyl acetamidomalonyl)-butene-2
  6614. trans-1,4-cyclohexanediamine
  6615. trans-1,4-Cyclohexanedicarboxylic acid
  6616. trans-1,4-cyclohexanedicarboxylic acid bis(4-methoxyphenyl) ester
  6617. trans-1,4-cyclohexanedimethanol
  6618. trans-1,4-cyclohexyl-bis-4-hexyloxybenzoate
  6619. trans-1,4-cyclohexylene p-butoxybenzoate
  6620. trans-1,4-cyclohexylene p-methoxybenzoate
  6621. trans-1,4-Dibromobut-2-ene
  6622. trans-1,4-Didecylcyclohexane
  6623. trans-1,4-dimethylcyclohexane
  6624. trans-1,4-ditert-Butylcyclohexane
  6625. trans-1,4a-Dimethyldecahydronaphthalene
  6626. trans-1,5-Dichloro-9,10-dihydroanthracene-9,10-diol
  6627. trans-1,6,7,8,9,9a-hexahydro-1,6-dimethyl-4-oxo-4H-pyrido[1,2-a]pyrimidine-3-carboxamide
  6628. trans-1-benzyloxy-2,3-epoxybutane
  6629. trans-1-bromo-2-ethoxycyclopentane
  6630. trans-1-bromo-2-fluorocyclododecane
  6631. trans-1-bromo-2-methoxycyclopentane
  6632. trans-1-Chloro-9,10-dihydro-9,10-ethanoanthracene-11,12-dicarboxylic acid dimethyl ester
  6633. trans-1-ethyl-2-methylcyclohexane
  6634. trans-1-ethyl-2-methylcyclopentane
  6635. trans-1-ethyl-3-methylcyclopentane
  6636. trans-1-ethyl-4-methylcyclohexane
  6637. trans-1-Hexene-1-sulfonyl chloride
  6638. trans-1-Iodo-1-hexene
  6639. trans-1-methyl-1,2-cyclohexanediacetic acid
  6640. trans-1-methyl-2-(dimethylamino)-4-(1-methylethenyl)cyclohexanol
  6641. trans-1-Methyl-2-propylcyclopentan-1-ol
  6642. trans-1-methyl-2-propylcyclopentane
  6643. trans-1-methyl-2-propylcyclopropane
  6644. trans-1-methyl-3-propylcyclopentane
  6645. trans-1-methyl-4-(1-methylethyl)cyclohexane
  6646. trans-1-Octene-1-sulfonyl chloride
  6647. trans-1-Phenylbuta-1,3-diene
  6648. trans-1-[4-(3,4-dimethoxyphenyl)]-4,5-dihydro-5-(4-methoxybenzoyl)-1-(4-methoxyphenyl)ethanone
  6649. trans-1-[5-benzoyl-4,5-dihydro-1,4-bis(4-methoxyphenyl)-1H-pyrazol-3-yl]ethanone
  6650. trans-1-[5-benzoyl-4,5-dihydro-1-(4-methoxyphenyl)-4-phenyl-1H-pyrazol-3-yl]ethanone
  6651. trans-1-[5-benzoyl-4,5-dihydro-1-phenyl-4-phenyl-1H-pyrazol-3-yl]ethanone
  6652. trans-1-[B-benzoyl-4-(4-chlorophenyl)-4,5-dihydro-1-(4-methoxyphenyl)-1H-py razol-3-yl]ethanone
  6653. trans-10-Methoxydec-2-enoic acid methyl ester
  6654. trans-11,11-dibromobicyclo(8.1.0)undec-(Z)-4-ene
  6655. trans-11,11-dibromobicyclo(8.1.0)undecane
  6656. trans-11-bromobicyclo(8.1.0)undecane
  6657. trans-17-Chloroheptadec-7-en-9-yne
  6658. trans-2,2,3,3,5,6-hexafluoro-1,4-dioxane
  6659. trans-2,2,3,5,6,6-hexafluoro-1,4-dioxane
  6660. trans-2,2,4,6-tetramethyl-1,3-dioxane
  6661. trans-2,2-dibromo-1,3-dimethyl-α-methylcyclopropanemethanol
  6662. trans-2,2-dimethyl-3-(2-methyl-1-propenyl)cyclopropanecarboxylic acid methyl ester
  6663. trans-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-4a-carboxylic acid
  6664. trans-2,3-Dichlorotetrahydrofuran
  6665. trans-2,3-diethylsuccinic anhydride
  6666. trans-2,3-dihydro-1,2-dimethyl-1H-indene
  6667. trans-2,3-dihydro-1,3-dimethyl-1H-indene
  6668. trans-2,3-dimethyloxirane
  6669. trans-2,3-dimethylsuccinic anhydride
  6670. trans-2,3-Diphenylpropenoic acid
  6671. trans-2,4-dimethyl-1,3-dioxolane
  6672. trans-2,5-Bis-(tosyloxymethyl)tetrahydrofuran
  6673. trans-2,5-cyclohexadiene-1,4-dicarboxylic acid
  6674. trans-2,5-Dihydrofuran-2,5-dicarboxylic acid
  6675. trans-2,5-Dimethyloxolane
  6676. trans-2,6-dichlorocyclohexanone
  6677. trans-2,cis-6-nonadien-1-ol
  6678. trans-2-(α,γ-Dimethylallyl)-phenol
  6679. trans-2-(2-propenyl)decahydronaphthalene
  6680. trans-2-(2-Thienyl)cyclopentanol
  6681. trans-2-(4-methoxyphenyl)cyclopropanecarboxylic acid
  6682. trans-2-(4-methoxyphenyl)cyclopropanecarboxylic acid ethyl ester
  6683. trans-2-(4-nitrophenyl)-1,3-dioxan-5-ol benzoate
  6684. trans-2-(4-nitrophenyl)-1,3-dioxolan-5-ol 4-nitrobenzoate
  6685. trans-2-(4-nitrophenyl)-1,3-dioxolane-4-methanol 4-nitrobenzoate
  6686. trans-2-(Benzyloxy)cyclohexanol
  6687. trans-2-(bromomethyl)cyclohexanol
  6688. trans-2-(difluoromethyl)-2,3,4,5,5-pentafluorotetrahydrofuran
  6689. trans-2-(trichloromethyl)-1,3-dioxolane-4-methanol benzoate
  6690. trans-2-(trifluoromethyl)cyclopropaneacetonitrile
  6691. trans-2-Benzyl-1,2,3,4,5,6,7,8-octahydronaphthalene
  6692. trans-2-Benzyldecahydronaphthalen-1-ol
  6693. trans-2-bromo-6-fluorocyclohexanone
  6694. trans-2-bromocyclohexanol nitrate
  6695. trans-2-chloro-2-butenoic acid
  6696. trans-2-chloro-6-fluorocyclohexanone
  6697. trans-2-chlorocyclohexanol
  6698. trans-2-Ethylcyclohexanol
  6699. trans-2-ethylcyclopentan-1-ol
  6700. trans-2-ethyldecalin
  6701. trans-2-hydroxyhexahydrocyclopenta[d][1,3,2]dioxaphosphinine 2-oxide
  6702. trans-2-iodocyclohexanol nitrate
  6703. trans-2-Isopropylcyclohexanol
  6704. trans-2-Methoxycyclohexanol
  6705. trans-2-Methoxycyclopentanol
  6706. trans-2-methylcyclopropanecarboxylic acid methyl ester
  6707. trans-2-phenoxyhexahydrocyclopenta[d][1,3,2]dioxaphosphinine 2-oxide
  6708. trans-2-Phenyl-3-chlorotetrahydrofuran
  6709. trans-2-phenylcyclohexanamine
  6710. trans-2-phenylcyclohexanamine hydrochloride
  6711. trans-2-phenylcyclopropanamine
  6712. trans-2-Propylcyclohexanol
  6713. trans-2-[(2-hydroxyethyl)sulfanyl]cyclohexan-1-ol
  6714. trans-2-[2-(carboxymethyl)cyclohexyl]acetic acid
  6715. trans-3,3-dimethyl-1,2-cyclopropanedicarboxylic acid diethyl ester
  6716. trans-3,4-dimethylcyclopentene
  6717. trans-3,5-Dibromocyclopentene
  6718. trans-3,5-dimethylcyclopentene
  6719. trans-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylic acid (3-phenoxyphenyl)methyl ester
  6720. trans-3-(4-(Methoxycarbonyl)-5-methylfur-2-yl)acryloyl chloride
  6721. trans-3-(4-Hydroxycyclohexyl)propanoic acid
  6722. trans-3-(4-Hydroxycyclohexyl)propanoic acid ethyl ester
  6723. trans-3-(4-Methoxyphenyl)cyclopentane-1,2-diol
  6724. trans-3-Bromo-2-deuteriotetrahydropyran
  6725. trans-3-Chloro-2-butyltetrahydropyran
  6726. trans-3-chloro-2-ethenyltetrahydrofuran
  6727. trans-3-chloro-2-ethyltetrahydropyran
  6728. trans-3-Chloro-2-p-tolyltetrahydrofuran
  6729. trans-3-Chloro-2-p-tolyltetrahydropyran
  6730. trans-3-Chloro-2-phenyltetrahydropyran
  6731. trans-3-Chloro-2-propyltetrahydropyran
  6732. trans-3-chlorotetrahydro-2-(1-methylethyl)furan
  6733. trans-3-chlorotetrahydro-2-(2-propenyl)furan
  6734. trans-3-chlorotetrahydro-2-furancarbonitrile
  6735. trans-3-chlorotetrahydro-2-methyl-2H-pyran
  6736. trans-3-chlorotetrahydro-2-methylfuran
  6737. trans-3-chlorotetrahydro-2-propylfuran
  6738. trans-3-Heptene-2-one
  6739. trans-3-Hydroxycyclohexanecarboxylic acid
  6740. trans-3-Hydroxycyclohexanecarboxylic acid methyl ester
  6741. trans-3-Hydroxymethylcyclohexanol
  6742. trans-3-isopropyl-5-methylcyclohexanol
  6743. trans-3-methyl-5-(propan-2-yl)cyclohexyl acetate
  6744. trans-3-Octenoic acid
  6745. trans-3-[2-(carboxy)cyclohexyl]propanoic acid
  6746. trans-4,4'-di-n-propyl-1,1'-bicyclohexyl-cis-4-carbonitrile
  6747. trans-4,5-difluoro-1,3-dioxolan-2-one
  6748. trans-4,5-dimethyl-1,3-dioxane
  6749. trans-4,6-dimethyl-1,3-dioxane
  6750. trans-4-(1,1-dimethylethyl)cyclohexanecarboxylic acid methyl ester
  6751. trans-4-(1,1-dimethylethyl)cyclohexanol
  6752. trans-4-(4-Bromophenyl)cyclohexyl (E)-but-2-enoate
  6753. trans-4-(4-Chlorophenyl)cyclohexyl (E)-but-2-enoate
  6754. trans-4-(4-Cyano-3-fluorophenyl)cyclohexyl (E)-but-2-enoate
  6755. trans-4-(4-Cyanophenyl)cyclohexyl (E)-but-2-enoate
  6756. trans-4-(4-Fluorophenyl)cyclohexyl (E)-but-2-enoate
  6757. trans-4-(4-heptylcyclohexyl)benzonitrile
  6758. trans-4-(4-pentylcyclohexyl)benzonitrile
  6759. trans-4-(4-propylcyclohexyl)benzonitrile
  6760. trans-4-(aminomethyl)cyclohexanecarboxylic acid
  6761. trans-4-(methoxymethyl)-2-(4-nitrophenyl)-1,3-dioxolane
  6762. trans-4-Butylcyclohexanol
  6763. trans-4-cyclohexylcyclohexanol
  6764. trans-4-Ethyl-4'-(4-pentylcyclohexyl)-1,1'-biphenyl
  6765. trans-4-Isopropylcyclohexanol
  6766. trans-4-methylcyclohexanol
  6767. trans-4-[(2-chloroethyl-nitrosocarbamoyl)amino]cyclohexane-1-carboxylic acid
  6768. trans-4-[2-(4-Fluorophenyl)ethyl]cyclohexyl (E)-but-2-enoate
  6769. trans-4-[2-(carboxy)cyclohexyl]butanoic acid
  6770. trans-4-[4-(Trifluoromethoxy)phenyl]cyclohexyl (E)-but-2-enoate
  6771. trans-5,5-Dimethoxy-3,4-dimethyloxolan-3-ol
  6772. trans-5-Butyl-4-methyloxolan-2-one
  6773. trans-5-Hepten-1-ol
  6774. trans-5-Hydroxymethyl-5,6-dihydro-7H-dibenzo[a,c]cyclohepten-6-ol
  6775. trans-5-methoxy-2-(4-nitrophenyl)-1,3-dioxane
  6776. trans-5-methyl-2-(1-methylethyl)cyclohexanone
  6777. trans-5-Octen-1-ol
  6778. trans-6-methylhept-3-ene
  6779. trans-6-Octenoic acid
  6780. trans-8-p-Menthene-1,2-diol
  6781. trans-8-p-Menthene-1,2-diol
  6782. trans-9,10-Bis-hydroxymethyl-9,10-dihydrophenanthrene
  6783. trans-9,10-cis-6,10-H-6-benzamido-2-methyldecahydroisoquinoline
  6784. trans-9,10-Dihydro-9,10-ethanoanthracene-11,12-dicarboxylic acid
  6785. trans-9,10-dihydro-9,10-ethanoanthracene-11,12-dicarboxylic acid di-3,5-dimethylpyrazole
  6786. trans-9,10-dihydro-9,10-ethanoanthracene-11,12-dicarboxylic acid dihydrazide
  6787. trans-9,10-dihydro-9,10-ethanoanthracene-11,12-dicarboxylic acid dimethyl ester
  6788. trans-9-Methyldecahydronaphthalene
  6789. trans-acetic acid 3,5-dimethylcyclohexyl ester
  6790. trans-acetic acid 3-methylcyclohexyl ester
  6791. trans-bicyclo[2.2.2]octane-2,3-diol
  6792. trans-bicyclo[6.1.0]nonane
  6793. trans-Bis(fluoroxy)tetrafluoroselenium
  6794. trans-bis(glycinato-N,O)copper(II) hydrate
  6795. trans-Chrysanthemic acid chloride
  6796. trans-Chrysanthemum-dicarboxylic acid dichloride
  6797. trans-Chrysanthemum-dicarboxylic dianilide
  6798. trans-Cinnamyl alcohol
  6799. trans-cyano((2,4,5-trichlorophenyl)hydrazono)acetic acid methyl ester
  6800. trans-cyano[(3,5-bis(trifluoromethyl)phenyl)hydrazono]acetic acid methyl ester
  6801. trans-Cyclohexane-1,4-diol
  6802. trans-cyclopentanol-2-acetic acid methyl ester
  6803. trans-d-3-Carboxy-1,1-dimethylcyclopropane-2-propionic acid
  6804. trans-d-3-Carboxy-1,1-dimethylcyclopropane-2-propionic acid di-nor-d-pseudoephedrine salt monohydrate
  6805. trans-d-3-Carboxy-1,1-dimethylcyclopropane-2-propionic acid di-nor-l-pseudoephedrine salt monohydrate
  6806. trans-d-Caronic acid
  6807. trans-decahydro-1-naphthol
  6808. trans-decahydro-2-methylenenaphthalene
  6809. trans-decahydronaphthalene
  6810. trans-Decahydronaphthalene-2,2-diacetic acid
  6811. trans-Decahydronaphthalene-2,2-diacetic acid diethyl ester
  6812. trans-Decahydronaphthalene-2,2-diacetic acid dimethyl ester
  6813. trans-decahydroquinoline
  6814. trans-decalin-9-carboxamide
  6815. trans-decalin-9-carboxylic acid methyl ester
  6816. trans-dichlorobis(methanamine-N)platinum
  6817. trans-diethyl 4-chloro-2-butenyl acetamidomalonate
  6818. trans-dl-Caronic acid
  6819. trans-ethyl 1-oxo-decahydronaphthalene-2-carboxylate
  6820. trans-l-3-Carboxy-1,1-dimethylcyclopropane-2-propionic acid
  6821. trans-l-Caronic acid
  6822. trans-N,N'-1,2-cyclohexanediylbis(N-(carboxymethyl)glycine)
  6823. trans-N-[3-(ethoxycarbonyl)-1-oxo-2-propenyl]morpholine
  6824. trans-Nickel(II) tetrakis(4-Chloro-3-hydroxypyridine) dichloride
  6825. trans-nitrobis(ethylenediamine)amminecobalt(III) bromide
  6826. trans-nitrobis(ethylenediamine)amminecobalt(III) chloride
  6827. trans-nitrobis(ethylenediamine)amminecobalt(III) iodide
  6828. trans-nitrobis(ethylenediamine)amminecobalt(III) nitrate
  6829. trans-nitrogen fluoride (N2F4)
  6830. trans-Non-4-en-1-ol
  6831. trans-octadecafluorodecahydronaphthalene
  6832. trans-octahydro-1(2H)-naphthalenone oxime
  6833. trans-octahydro-1H-2-benzothiopyran
  6834. trans-octahydro-2-methylene-1H-indene
  6835. trans-octahydro-2H-1-benzothiopyran
  6836. trans-octahydro-2H-inden-2-one
  6837. trans-octahydropentalene
  6838. Trans-p-Menth-6-ene-2,8-diol
  6839. trans-Palladium(II) bis(dibenzyl sulfide) dibromide
  6840. trans-Palladium(II) bis(dibenzyl sulfide) dichloride
  6841. trans-Palladium(II) bis(dibenzyl sulfide) diiodide
  6842. trans-Palladium(II) bis(diethyl-phenylphosphine) dichloride
  6843. trans-Palladium(II) bis(diethylselenide) dichloride
  6844. trans-Palladium(II) bis(diethylsulfide) dibromide
  6845. trans-Palladium(II) bis(diethylsulfide) dichloride
  6846. trans-Palladium(II) bis(diethylsulfide) diiodide
  6847. trans-Palladium(II) bis(diethyltelluride) dichloride
  6848. trans-Palladium(II) bis(dipropyl sulfide) dibromide
  6849. trans-Palladium(II) bis(dipropyl sulfide) dichloride
  6850. trans-Palladium(II) bis(dipropyl sulfide) diiodide
  6851. trans-Palladium(II) bis(methyl ethyl sulfide) dibromide
  6852. trans-Palladium(II) bis(methyl ethyl sulfide) dichloride
  6853. trans-Palladium(II) bis(methyl ethyl sulfide) diiodide
  6854. trans-Palladium(II) bis(methyl phenyl sulfide) dibromide
  6855. trans-Palladium(II) bis(methyl phenyl sulfide) dichloride
  6856. trans-Palladium(II) bis(thiacyclopentane) dibromide
  6857. trans-Palladium(II) bis(thiacyclopentane) dichloride
  6858. trans-Palladium(II) bis(thiacyclopentane) diiodide
  6859. trans-Platinum(II) bis(1-hexanamine bromide)
  6860. trans-Platinum(II) bis(1-hexanamine chloride)
  6861. trans-Platinum(II) bis(tributylphosphine) dichloride
  6862. trans-Rhenium(V)-2-methylbenzene dicarbon oxide dibromide
  6863. trans-tetrahydro-2,5-dimethylthiophene
  6864. trans-tetrahydro-2,5-dimethylthiophene 1,1-dioxide
  6865. trans-Tetrahydrofuran-2,5-dicarboxylic acid
  6866. trans-tricyclo(7.1.0.0(1,3))decane
  6867. trans-Undec-2-enoic acid methyl ester
  6868. trans-[(4-trimethylsilyl)cyclohexyloxy]-trimethylsilane
  6869. transcal N
  6870. transformer oil
  6871. travertine
  6872. travertine
  6873. tremolite (Ca2((Mg0.9-1Fe0-0.1)4.5-5Al0-0.5)(Si7.5-8Al0-0.5)(OH)2O22)
  6874. Tri(2-hydroxyethyl)methyl ammonium mefenamate
  6875. tri(ammonium dihydrogen phosphate) phosphoric acid (3:1)
  6876. tri(ammonium tetraborate) ammonium chloride octahydrate
  6877. tri(ammonium tetraborate) ammonium iodide octahydrate
  6878. tri(butan-2-yloxy)-phenylsilane
  6879. tri(calcium phosphate) calcium fluoride (Fluorapatite)
  6880. tri(copper(II) sulfate) copper(II) acetate tri(copper(II) hydroxide)
  6881. tri(ethylene glycol) monohexyl ether
  6882. Tri(glycine) europium(III) tribromide
  6883. Tri(glycine) gadolinium(III) tribromide
  6884. Tri(glycine) samarium(III) tribromide
  6885. tri(hafnyl sulfate) hafnium(IV) hydroxide heptahydrate
  6886. tri(L-α-methionine) zinc dinitrate monohydrate
  6887. tri(potassium sulfate) mono sulfuric acid
  6888. tri(silver fluoride) di(hydrogen fluoride)
  6889. tri(silver fluoride) pentahydrate
  6890. tri(sodium formate) formic acid
  6891. tri(sodium selenate) di(selenic acid) tetrahydrate
  6892. tri-2-propenylsilane
  6893. Tri-n-butyl(2-methoxyethyl)phosphonium 2-(2-methoxyethoxy)ethyl sulfate
  6894. Tri-n-butyl(2-methoxyethyl)phosphonium 2-methoxyethyl sulfate
  6895. Tri-n-butyl(2-methoxyethyl)phosphonium n-hexyl sulfate
  6896. Tri-n-butylmethylammonium hexanesulfonate
  6897. Tri-N-dectylammonium chloride
  6898. tri-n-dodecylammonium picrate
  6899. Tri-N-heptylammoniumchloride
  6900. tri-n-hexyl-n-heptylammonium nitrate
  6901. Tri-n-octylammonium n-butanoate
  6902. Tri-n-octylammonium n-hexanoate
  6903. Tri-n-octylammonium n-octanoate
  6904. Tri-n-octylmethylammonium dodecanoate
  6905. Tri-n-octylmethylammonium n-hexadecanoate
  6906. Tri-n-octylmethylammonium n-hexanoate
  6907. Tri-n-octylmethylammonium octadecanoate
  6908. Tri-o-phenylene diborate
  6909. triacontachlorotriacontahydro(5,6)fullerene-C60-Ih
  6910. triacontafluorotetradecane
  6911. triacontane
  6912. triacontanoic acid
  6913. Triacontanoic acid decyl ester
  6914. triacontanoic acid ethyl ester
  6915. triacontanoic acid methyl ester
  6916. Triacontanoic acid octadecyl ester
  6917. Triacontanoic acid pentyl ester
  6918. Triacontanoic acid triacontyl ester
  6919. Triacontanoic anhydride
  6920. triacontylbenzene
  6921. triacontylcyclohexane
  6922. trialkyl(n-C6,n-C10)methanaminium salt with cyanocyanamide (1:1)
  6923. Triallyl phosphate
  6924. trialuminium hexahydroxo phosphate undecahydrate
  6925. triamine zinc chloride monohydrate
  6926. triammonium (OC-6-11)-hexafluoroaluminate(3-)
  6927. triammonium (OC-6-11)-hexafluoroindate(3-)
  6928. triammonium (OC-6-11)-hexafluoroscandate(3-)
  6929. triammonium (PB-7-11-11111)-heptafluorozirconate(3-)
  6930. triammonium antimony chloride
  6931. Triammonium bismuth sulfate
  6932. triammonium copper chloride hexahydrate
  6933. triammonium copper(II) nitrate
  6934. Triammonium dicalcium nitrite pentahydrate
  6935. triammonium dicopper(I)chloride
  6936. triammonium dititanyl chloride tetrahydrate
  6937. triammonium dizinc acetate
  6938. Triammonium fluorooxovanadate(IV)
  6939. triammonium gallium(III) fluoride
  6940. triammonium heptafluorohafnate(3-)
  6941. triammonium hexafluoroferrate(III)
  6942. triammonium hexafluoroindate
  6943. triammonium hydrogen diselenate
  6944. triammonium hydrogen pyrophosphate monohydrate
  6945. triammonium hydrogen pyrophosphate pentahydrate
  6946. triammonium hydrogen sulfate
  6947. triammonium indium trisulfate
  6948. triammonium perchlorate chromate
  6949. triammonium scandium trisulfate
  6950. triammonium uranyl fluoride
  6951. triammonium uranyl fluoride tetrahydrate
  6952. triangulo-dodecacarbonyltriosmium
  6953. Triantipyrine silver perchlorate
  6954. Triantipyrine silver tetrafluoroborate
  6955. triaqua(copper)(mu-((2,2'-((1,2-di(oxo-κO)-1,2-ethanediyl)di(imino-κN))bis(benzoato-κO))(4-)))manganese dihydrate stereoisomer
  6956. triaquabenzoatocalcium monobenzoate
  6957. triarsenic acid pentasodium salt
  6958. triazanium nitrate sulfate
  6959. triazanium zinc pentachloride
  6960. tribarium diarsenite
  6961. Tribarium tungsten(VI) oxide
  6962. Tribasic lead(II) styphnate dihydrate
  6963. tribenzo-18-crown-6
  6964. tribenzo-19-crown-6
  6965. tribenzo-21-crown-7
  6966. Tribenzylphosphine oxide
  6967. Triberyllium(II) pentaiodate hydroxide decahydrate
  6968. Tribismuth pentaborate
  6969. Tribismuth tetraselenide
  6970. tribromo(η5-2,4-cyclopentadien-1-yl)titanium
  6971. tribromo-2,4-cyclopentadien-1-ylgermane
  6972. tribromo-2-pentene
  6973. tribromoacetaldehyde
  6974. tribromoacetic acid
  6975. tribromobis(2-methylpyridine 1-oxide-O)arsenic
  6976. tribromobis(pyridine 1-oxide-O)arsenic
  6977. tribromobismuthine
  6978. tribromoborane
  6979. tribromobutane
  6980. tribromochlorogermane
  6981. tribromochloromethane
  6982. tribromochlorosilane
  6983. tribromoethene
  6984. tribromofluorogermane
  6985. tribromofluoromethane
  6986. tribromofluorosilane
  6987. tribromogermane
  6988. tribromoheptylsilane
  6989. tribromohydrogenstannate(1-) compd. with methanamine (1:1)
  6990. tribromoiodogermane
  6991. tribromoiodomethane
  6992. tribromoiodosilane
  6993. tribromoisocyanatomethane
  6994. tribromomethane
  6995. tribromomethane-d
  6996. tribromomethylsilane
  6997. tribromonitromethane
  6998. tribromonitrosomethane
  6999. tribromophenanthrene
  7000. tribromosilane
  7001. tribromostibine
  7002. tributoxy-(3-methylbutyl)silane
  7003. tributoxy-methoxysilane
  7004. tributoxy-phenylsilane
  7005. tributoxyethenylsilane
  7006. tributoxymethylsilane
  7007. tributoxystibine
  7008. tributyl (2-methoxyethoxy)methyl phosphonium 1,2,3-triazolide
  7009. Tributyl 11-phosphonoundecanoate
  7010. tributyl dodecyl phosphonium 1,2,3-triazolide
  7011. Tributyl ethyl phosphonium 2-hexyldecanoate
  7012. tributyl methoxymethyl phosphonium 1,2,3-triazolide
  7013. tributyl octadecyl phosphonium 1,2,3-triazolide
  7014. Tributyl octadecyl phosphonium 2-cyanopyrrolide
  7015. tributyl sulfonium perchlorate
  7016. tributyl trithiophosphite
  7017. Tributyl(2-methoxyethyl)phosphonium bis(trifluoromethanesulfonyl)imide
  7018. tributyl(diethylcarbamoyl)tin
  7019. Tributyl(ethyl)stannane
  7020. tributyl(iodo)stannane
  7021. Tributyl(methyl)stannane
  7022. tributyl(nitrooxy)stannane
  7023. Tributyl(octyl)phosphonium tetrafluoroborate
  7024. Tributyl(octyl)phosphonium trifluoroacetate
  7025. tributyl(perchloryloxy)stannane
  7026. tributyl(tetradecyl)phosphonium chloride
  7027. tributyl(trichloro)dialuminum
  7028. tributyl-tributylsilyloxysilane
  7029. Tributylamine boron tribromide
  7030. Tributylammonium bis(trifluoromethanesulphonyl)imide
  7031. Tributylammonium butyrate
  7032. Tributylammonium hexafluorophosphate
  7033. Tributylammonium tetrafluoroborate
  7034. tributylarsine
  7035. tributylazanium acetate
  7036. tributylbismuthine
  7037. tributylborane
  7038. tributylboroxin
  7039. tributylchlorostannane
  7040. Tributylethanolammonium bromide
  7041. Tributylethylphosphonium 2-pyridinolate
  7042. Tributylethylphosphonium 3-pyridinolate
  7043. Tributylethylphosphonium 4-pyridinolate
  7044. Tributylethylphosphonium acetate
  7045. Tributylethylphosphonium benzenesulfonate
  7046. Tributylethylphosphonium benzoate
  7047. Tributylethylphosphonium benzoyltrifluoroacetonate
  7048. Tributylethylphosphonium butanoate
  7049. Tributylethylphosphonium caproate
  7050. tributylethylphosphonium diethyl hydrogen phosphate (1:1)
  7051. Tributylethylphosphonium formate
  7052. Tributylethylphosphonium hexafluoroacetylacetonate
  7053. Tributylethylphosphonium laurate
  7054. Tributylethylphosphonium phenolate
  7055. Tributylethylphosphonium pyridinecarboxylate
  7056. Tributylethylphosphonium pyridinesulfonate
  7057. Tributylethylphosphonium stearate
  7058. Tributylethylphosphonium thenoyltrifluoroacetonate
  7059. tributylgallium
  7060. tributylheptylammonium bis(trifluoromethanesulfonyl)imide
  7061. tributylheptylammonium trifluoromethanesulfonate
  7062. Tributylhexadecylphosphonium bis(trifluoromethanesulfonyl)amide
  7063. tributylhexylammonium hexafluorophosphate
  7064. tributylhexylphosphonium bis(trifluoromethylsulfonyl)imide
  7065. tributylhexylphosphonium hexafluorophosphate
  7066. Tributylhexylphosphonium tetrafluoroborate
  7067. tributylindium
  7068. tributylisocyanatostannane
  7069. tributylmethylammonium bis(pentafluoroethylsulfonyl)imide
  7070. Tributylmethylammonium dicyanamide
  7071. Tributylmethylammonium phenyltrifluoroborate
  7072. tributylmethylphosphonium bis(2,4,4-trimethylpentyl)phosphinate
  7073. tributylmethylphosphonium bis(trifluoromethylsulfonyl)imide
  7074. Tributylmethylphosphonium chloride
  7075. tributylmethylphosphonium dodecylsulfate
  7076. Tributylmethylphosphonium formate
  7077. tributylmethylphosphonium methylsulfate
  7078. tributylmethylphosphonium salt with trifluoromethanesulfonic acid (1:1)
  7079. tributyloctylammonium bis(trifluoromethanesulfonyl)imide
  7080. tributyloctylammonium trifluoromethanesulfonate
  7081. Tributyloctylphosphonium 1,3-diphenylpropane-1,3-dionate
  7082. Tributyloctylphosphonium 5,5-dimethyl-1,3-cyclohexanedionate
  7083. Tributyloctylphosphonium benzotriazolate
  7084. Tributyloctylphosphonium bromide
  7085. tributyloctylphosphonium chloride
  7086. Tributyloctylphosphonium indene-1,3-dionate
  7087. Tributyloctylphosphonium pentane-2,4-dionate
  7088. tributylphenylphosphonium bromide
  7089. tributylphosphine
  7090. tributylphosphine oxide
  7091. tributylphosphonium tetrafluoroborate
  7092. Tributylphosphonolaurate
  7093. tributylpropylsilane
  7094. tributylsilane
  7095. tributylstannane
  7096. tributylstannanylium hydroxide
  7097. tributylstannyl 2-(2,4,5-trichlorophenoxy)propanoate
  7098. tributylstibine
  7099. tributylsulfanium iodide
  7100. tributylsulfonium
  7101. tributylsulfonium bis(trifluoromethylsulfonyl)imide
  7102. tributylsulfonium bromide
  7103. tributylsulfonium chloride
  7104. tributylsulfonium salt with 2,4,6-trinitrophenol (1:1)
  7105. Tributyltetradecylphosphonium bis(trifluoromethanesulfonyl)amide
  7106. tributyltetradecylphosphonium salt with dodecylbenzenesulfonic acid (1:1)
  7107. tributyltin 2-iodobenzoate
  7108. tributyltin 4-chlorobutanoate
  7109. tributyltin 4-iodobenzoate
  7110. tributyl[(dimethylsilyl)methyl]stannane
  7111. tributyl[(ethoxydimethylsilyl)methyl]stannane
  7112. Tributyl[(methylthio)methyl]phosphonium bis(fluorosulfonyl)amide
  7113. Tributyl[(methylthio)methyl]phosphonium bis(trifluoromethylsulfonyl)amide
  7114. Tributyl[(methylthio)methyl]phosphonium tetrafluoroborate
  7115. Tributyl[2-(ethylthio)ethyl]phosphonium bis(fluorosulfonyl)amide
  7116. Tributyl[2-(ethylthio)ethyl]phosphonium bis(trifluoromethylsulfonyl)amide
  7117. Tributyl[2-(ethylthio)ethyl]phosphonium tetrafluoroborate
  7118. Tributyl[2-(methylthio)ethyl]phosphonium bis(fluorosulfonyl)amide
  7119. Tributyl[2-(methylthio)ethyl]phosphonium bis(trifluoromethylsulfonyl)amide
  7120. Tributyl[2-(methylthio)ethyl]phosphonium tetrafluoroborate
  7121. tribuyltetradecylphosphonium salt with 1,1,2,3,3,3-hexafluoropropanesulfonic acid
  7122. tricadmium acetate tetraacetic acid tetrahydrate
  7123. tricadmium diammonium sulfate pentahydrate
  7124. tricadmium dinickel chloride tetradecahydrate
  7125. tricadmium dipotassium sulfate dihydrate
  7126. tricadmium dipotassium sulfate pentahydrate
  7127. tricadmium dithallium sulfate pentahydrate
  7128. tricadmium heptacesium bromide
  7129. tricadmium lutetium chloride tetradecahydrate
  7130. tricadmium potassium bromide (KCd3Br7)
  7131. tricadmium potassium bromide tetrahydrate
  7132. tricadmium potassium chloride tetrahydrate
  7133. tricadmium tetraethylammonium chloride
  7134. tricadmium tetralithium chloride dodecahydrate
  7135. tricadmium tetrapotassium sulfate monohydrate
  7136. tricadmium thulium(III) chloride pentadecahydrate
  7137. tricadmnium chloride dialanine tetrahydrate
  7138. tricalcium aluminium oxide hexahydrate
  7139. tricalcium bromide tetracalcium hydroxide dodecahydrate
  7140. tricalcium nickel chloride hexadecamethanol
  7141. tricalcium propionate bis(propionic acid) monohydrate
  7142. Tricarballylic acid monoethyl dioctyl ester
  7143. tricarbonyl(η5-2,4-cyclopentadien-1-yl)manganese
  7144. tricarbonyl(η5-2,4-cyclopentadien-1-yl)rhenium
  7145. tricarbonyl((1,2,3,4,5,6-η)-(1-methylethenyl)benzene)chromium
  7146. tricarbonyl((1,2,3,4,5,6-η)-1-ethenyl-4-methylbenzene)chromium
  7147. tricarbonyl((1,2,3,4,5,6-η)-ethenylbenzene)chromium
  7148. tricarbonyl((1,2,3,4,5,6-η)methyl benzoate)chromium
  7149. tricarbonyl(1-((2,3-η)-2-propenyl)-1H-pyrazole-N2)iron
  7150. Tricarbonyl-tri-(N-methylcyano) molybdenum
  7151. tricesium (OC-6-11)-hexabromolanthanate(3-)
  7152. tricesium (OC-6-11)-hexachloroindate(3-)
  7153. tricesium (OC-6-11)-hexafluoroaluminate(3-)
  7154. tricesium (T-4)-chromate (CrO4(3-))
  7155. tricesium antimony (III)chloride
  7156. tricesium bismuth (III) bromide
  7157. tricesium bismuth chloride
  7158. tricesium cobalt bromide
  7159. tricesium copper(I) chloride monohydrate
  7160. tricesium diantimony(III) iodide
  7161. tricesium dibismuth (III) bromide
  7162. tricesium dibismuth chloride
  7163. tricesium dicadmium chloride
  7164. tricesium dicopper(I) chloride
  7165. tricesium dicopper(II) chloride dihydrate
  7166. tricesium dierbium (III) bromide hexadecahydrate
  7167. tricesium dierbium(III) chloride tetradecahydrate
  7168. tricesium dithulium bromide hexadecahydrate
  7169. tricesium dithulium(III) chloride tetradecahydrate
  7170. tricesium erbium(III) chloride hexahydrate
  7171. tricesium fluoride di(molybdenum trioxide)
  7172. tricesium gadolinium chloride dihydrate
  7173. tricesium gadolinium chloride pentahydrate
  7174. Tricesium gadolinium(III) hexachloride
  7175. tricesium gallium(III) fluoride
  7176. Tricesium heptaphosphide
  7177. tricesium hydrogen diselenate
  7178. tricesium indium(III) fluoride
  7179. tricesium iodide di(bismut triiodide)
  7180. Tricesium lanthanum hexachloride trihydrate
  7181. tricesium lanthanum(III) chloride pentahydrate
  7182. Tricesium lanthanum(III) hexachloride
  7183. tricesium mercury(II) chloride
  7184. Tricesium neodymium(III) hexachloride
  7185. tricesium neodymium(III)chloride monohydrate
  7186. tricesium neodymium(III)chloride pentahydrate
  7187. Tricesium nitratocobalt(III) monohydrate
  7188. tricesium pentachlorocobaltate(3-)
  7189. tricesium praseodymium(III) chloride heptahydrate
  7190. Tricesium praseodymium(III) hexachloride
  7191. Tricesium samarium(III) hexachloride
  7192. tricesium scandium(III) sulfate
  7193. Tricesium sodium orthomolybdate
  7194. tricesium sodium perchlorate
  7195. tricesium terbium(III) bromide
  7196. tricesium trioxo trifluoromolybdate
  7197. Tricesium uranium(III) hexabromide
  7198. Tricesium ytterbium(III) hexachloride
  7199. Tricesium(I) cobalt(II) pentabromide
  7200. Tricesium(I) manganese(II) pentaiodide
  7201. trichloro(η5-2,4-cyclopentadien-1-yl)titanium
  7202. trichloro(1,1,2-trimethylpropyl)silane
  7203. trichloro(1,1-dimethylethoxy)silane
  7204. trichloro(1,1-dimethylethyl)silane
  7205. trichloro(1,2-dibromoethyl)silane
  7206. trichloro(1,2-dichloroethyl)silane
  7207. trichloro(1-chloroethyl)silane
  7208. Trichloro(1-methylethyl)silane
  7209. trichloro(1-naphthylmethyl)silane
  7210. trichloro(1-phenylbutyl)silane
  7211. trichloro(2,4,4-trimethylpentyl)silane
  7212. trichloro(2-chloroethyl)silane
  7213. trichloro(2-chlorophenyl)silane
  7214. trichloro(2-chloropropyl)silane
  7215. trichloro(2-dodecylhexadecyl)silane
  7216. trichloro(2-hexyldecyl)silane
  7217. trichloro(2-methylallyloxy)silane
  7218. trichloro(2-methylpropyl)silane
  7219. trichloro(2-phenylethyl)silane
  7220. trichloro(2-propenyl)germane
  7221. trichloro(2-tricyclo[3.3.1.1(3,7)]dec-1-ylethyl)silane
  7222. trichloro(3,3,3-trifluoropropyl)silane
  7223. trichloro(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane
  7224. trichloro(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane
  7225. trichloro(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)silane
  7226. trichloro(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-hexadecafluoro-11-dodecenyl)silane
  7227. trichloro(3,3-dimethylbutyl)silane
  7228. trichloro(3-chlorophenyl)silane
  7229. trichloro(3-chloropropyl)silane
  7230. trichloro(3-phenoxypropyl)silane
  7231. trichloro(4-chlorophenyl)silane
  7232. trichloro(4-ethoxyphenyl)silane
  7233. trichloro(4-ethylphenyl)silane
  7234. trichloro(4-methoxyphenyl)silane
  7235. trichloro(4-methylphenyl)silane
  7236. trichloro(4-phenylbutyl)silane
  7237. trichloro(6-phenylhexyl)silane
  7238. trichloro(chloroethynyl)silane
  7239. trichloro(chloromethoxy)silane
  7240. trichloro(chloromethyl)germane
  7241. trichloro(chloromethyl)silane
  7242. Trichloro(cyanosulfanyl)silane
  7243. trichloro(cyclohexylmethyl)silane
  7244. trichloro(dichloromethyl)germane
  7245. trichloro(dichloromethyl)silane
  7246. trichloro(dichlorophenyl)silane
  7247. trichloro(methylsulfonyl)methane
  7248. trichloro(methylthio)methane
  7249. trichloro(phenylmethyl)silane
  7250. trichloro(trichloromethyl)silane
  7251. trichloro-(3-methylbutyl)silane
  7252. trichloro-1,1'-biphenyl
  7253. trichloro-2,4-cyclopentadien-1-ylgermane
  7254. trichloro-2,4-dimethyl-3-pentanone
  7255. trichloro-2-propenylsilane
  7256. trichloro-2-thienylsilane
  7257. trichloro-bis(trifluoromethyl)phosphorane
  7258. trichloro-methoxysilane
  7259. trichloro-pentafluoro-cyclopentene
  7260. trichloro-prop-2-enoxysilane
  7261. trichloro-propoxysilane
  7262. trichloro2-[4-(1,1-dimethylethyl)phenyl]ethylsilane
  7263. trichloroacetaldehyde
  7264. trichloroacetaldehyde hemi-hydrate
  7265. trichloroacetamide
  7266. trichloroacetic acid
  7267. trichloroacetic acid 1-methylethyl ester
  7268. trichloroacetic acid 2,2-dimethylpropyl ester
  7269. trichloroacetic acid 2-cyanoethyl ester
  7270. trichloroacetic acid 2-methylbutyl ester
  7271. trichloroacetic acid 2-methylpropyl ester
  7272. trichloroacetic acid 2-phenylcyclohexyl ester
  7273. trichloroacetic acid 3-methyl-2-butenyl ester
  7274. trichloroacetic acid 3-methylbutyl ester
  7275. trichloroacetic acid ammonium salt
  7276. trichloroacetic acid anhydride
  7277. trichloroacetic acid cyclohexyl ester
  7278. trichloroacetic acid erbium(3+) salt
  7279. trichloroacetic acid ethenyl ester
  7280. trichloroacetic acid ethyl ester
  7281. trichloroacetic acid holmium(3+) salt
  7282. trichloroacetic acid lanthanum(3+) salt
  7283. trichloroacetic acid lead salt monohydrate
  7284. trichloroacetic acid lead(2+) salt
  7285. trichloroacetic acid lithium salt
  7286. trichloroacetic acid methyl ester
  7287. trichloroacetic acid neodymium(3+) salt
  7288. trichloroacetic acid potassium salt
  7289. trichloroacetic acid praseodymium(3+) salt
  7290. trichloroacetic acid samarium(3+) salt (3:1)
  7291. trichloroacetic acid sodium salt
  7292. trichloroacetic acid yttrium(3+) salt
  7293. trichloroacetonitrile
  7294. trichloroacetyl bromide
  7295. trichloroacetyl chloride
  7296. trichloroacrylic aldehyde
  7297. trichlorobis(3-methylpyridine 1-oxide-O)arsenic
  7298. trichlorobismuthine
  7299. trichloroborane
  7300. trichloroboroxin
  7301. trichlorocyclohexylsilane
  7302. trichlorocyclooctylsilane
  7303. trichlorocyclopentylsilane
  7304. trichlorodecane
  7305. trichlorodecylsilane
  7306. trichlorodocosylsilane
  7307. trichlorododecylsilane
  7308. trichloroeicosylsilane
  7309. trichloroethane
  7310. trichloroethane
  7311. trichloroethanethioic acid anhydrosulfide
  7312. trichloroethanethioic acid anhydrosulfide with ethanethioic acid
  7313. trichloroethanethioic acid anhydrosulfide with thiohypochlorous acid
  7314. trichloroethene
  7315. trichloroethenylsilane
  7316. trichloroethoxysilane
  7317. trichloroethyl phosphate
  7318. trichloroethylgermane
  7319. trichloroethylsilane
  7320. trichloroethylstannane
  7321. trichlorofluoroethene
  7322. trichlorofluorogermane
  7323. trichlorofluoromethane
  7324. trichlorofluorosilane
  7325. trichlorogermane
  7326. trichloroheptylgermane
  7327. trichloroheptylsilane
  7328. trichlorohexadecylsilane
  7329. trichlorohexylgermane
  7330. trichlorohexylsilane
  7331. trichloroindigane tetrahydrate
  7332. trichloroiodogermane
  7333. trichloroiodomethane
  7334. trichloroiodosilane
  7335. trichloroisocyanatogermane
  7336. trichloroisocyanatomethane
  7337. trichloroisothiocyanatosilane
  7338. trichloromethane
  7339. trichloromethane compd. with pyridine (1:1)
  7340. trichloromethane-d
  7341. trichloromethanesulfenyl chloride
  7342. trichloromethanesulfonyl chloride
  7343. trichloromethoxyethene
  7344. trichloromethoxymethane
  7345. trichloromethyl
  7346. trichloromethyl (4-chlorophenyl)methyl disulfide
  7347. trichloromethyl hexyl disulfide
  7348. trichloromethyl norbornyl disulfide
  7349. trichloromethyl trifluoromethyl disulfide
  7350. trichloromethylgermane
  7351. trichloromethylnitrobenzene
  7352. trichloromethylsilane
  7353. trichloromethylstannane
  7354. trichloromethylsulfanylbenzene
  7355. trichloronitromethane
  7356. trichloronitrosomethane
  7357. trichlorononylsilane
  7358. trichlorooctadecylsilane
  7359. trichlorooctylsilane
  7360. trichloropentylgermane
  7361. trichloropentylsilane
  7362. trichlorophenol
  7363. trichlorophenylgermane
  7364. trichlorophenylsilane
  7365. trichlorophenylstannane
  7366. trichloropropane
  7367. trichloropropylgermane
  7368. trichloropropylsilane
  7369. trichlorosilane
  7370. trichlorosilanecarbonitrile
  7371. trichlorosilicon
  7372. Trichlorosilyl 2,2-dimethylpropanoate
  7373. Trichlorosilyl 2-methylpropanoate
  7374. Trichlorosilyl 3-methylbutanoate
  7375. Trichlorosilyl acetate
  7376. Trichlorosilyl butanoate
  7377. Trichlorosilyl hexanoate
  7378. Trichlorosilyl octanoate
  7379. Trichlorosilyl pentanoate
  7380. Trichlorosilyl propanoate
  7381. Trichlorosilyl(trichlorogermyl)mercury
  7382. trichlorostannane
  7383. trichlorostibine
  7384. trichlorotetradecylsilane
  7385. trichlorotrifluoro-2,2,4,4,6,6-hexahydro-1,3,5,2,4,6-triazatriphosphorine
  7386. trichlorotrifluorobenzene
  7387. trichlorotrifluoroethane
  7388. trichlorotrifluoroethane
  7389. trichlorotripropyldialuminium
  7390. trichloroundecylsilane
  7391. trichloroyttrium hexahydrate
  7392. trichloro[(1,1-dimethylpropyl)oxy]silane
  7393. trichloro[(chloromethyl)sulfonyl]methane
  7394. trichloro[(chloromethyl)thio]methane
  7395. trichloro[(dichloromethyl)thio]methane
  7396. trichloro[(trichlorogermyl)methyl]silane
  7397. trichloro[11-(2-methoxyethoxy)undecyl]silane
  7398. trichloro[2-(methyldioctylsilyl)ethyl]silane
  7399. trichloro[3-(4-methoxyphenyl)propyl]silane
  7400. trichloro[3-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethoxy]propyl]silane
  7401. trichloro[4-(heptadecafluorooctyl)phenyl]silane
  7402. Trichromium silicide
  7403. triciribine
  7404. Triclabendazole
  7405. tricobalt chloride di(hexamethylene tetramine) hexahydrate
  7406. tricobaltous benzene-1,3,5-tricarboxylate dodecahydrate
  7407. tricopper(I) arsenic trisulfide
  7408. tricopper(II) acetate di(hexamethylenetetramine) hexahydrate
  7409. tricopper(II)trisodium ortophosphate
  7410. Tricos-4-yne
  7411. tricosadecanedioic acid bis(2-methylpropyl) ester
  7412. tricosafluorododecanoic acid compd. with 1-butanamine (1:1)
  7413. Tricosan-7-ol
  7414. Tricosan-8-ol
  7415. Tricosan-9-ol
  7416. tricosane
  7417. tricosanedioic acid bis(1-methylethyl) ester
  7418. tricosanedioic acid dibutyl ester
  7419. tricosanedioic acid dipentyl ester
  7420. tricosanedioic acid dipropyl ester
  7421. tricosanenitrile
  7422. tricosanoic acid
  7423. tricosanoic acid 1,2,3-propanetriyl ester
  7424. tricosanoic acid 1-methylethyl ester
  7425. tricosanoic acid 2-methylpropyl ester
  7426. tricosanoic acid ethyl ester
  7427. tricosanoic acid methyl ester
  7428. tricosanoic acid pentyl ester
  7429. tricosanoic acid propyl ester
  7430. tricyclo(13.2.2.2(3,6))heneicosa-3,5,15,17,18,20-hexaene
  7431. tricyclo(16.2.2.2(8,11))tetracosa-8,10,18,20,21,23-hexaene
  7432. tricyclo(3.3.1.1(3,7))decan-1-ol nitrate
  7433. tricyclo(3.3.1.1(3,7))decane-1,3,5,7-tetrol tetranitrate
  7434. tricyclo(3.3.1.1(3,7))decane-1,3-diol dinitrate
  7435. tricyclo(3.3.1.1(3,7))decane-2,6-dione
  7436. tricyclo(4.2.2.0(2,5))deca-3,7,9-triene
  7437. tricyclo(7.1.0.0(2,4))decane
  7438. tricyclo(8.2.2.2(4,7))hexadecane
  7439. tricyclo(9.2.2.1(4,8))hexadeca-4,6,8(16),11,13,14-hexaene
  7440. tricyclo(9.3.1.1(4,8))hexadeca-1(15),4,6,8(16),11,13-hexaene
  7441. Tricyclohexylamine
  7442. tricyclohexylborane
  7443. Tricyclohexylmethanol
  7444. tricyclohexyloxy-phenylsilane
  7445. Tricyclopentylamine
  7446. tricyclotrimethylenebenzene
  7447. tricyclo[10.2.2.2(5,8)octadeca-5,7,12,14,15,17-hexaene
  7448. Tricyclo[2.2.1.0(2,6)]heptan-3-one
  7449. tricyclo[2.2.1.0(2,6)]heptane
  7450. Tricyclo[2.2.1.0(2,6)]heptane-3,5-diol
  7451. tricyclo[3.1.0.0(2,6)]hex-3-ene
  7452. tricyclo[3.1.0.0(2,6)]hexane
  7453. tricyclo[3.2.1.0(2,4)]oct-6-ene
  7454. tricyclo[3.2.1.0(2,4)]octane
  7455. tricyclo[3.3.0.0(2,6)]octane
  7456. tricyclo[3.3.1.1(3,7)]decan-1-ol
  7457. tricyclo[3.3.1.1(3,7)]decan-2-ol
  7458. tricyclo[3.3.1.1(3,7)]decane
  7459. tricyclo[3.3.1.1(3,7)]decane-1-carbonitrile
  7460. tricyclo[3.3.1.1(3,7)]decane-1-carboxamide
  7461. tricyclo[3.3.1.1(3,7)]decane-1-carboxylic acid
  7462. tricyclo[3.3.1.1(3,7)]decane-1-carboxylic acid methyl ester
  7463. tricyclo[3.3.1.1(3,7)]decane-2-carboxylic acid
  7464. tricyclo[3.3.1.1(3,7)]decanone
  7465. tricyclo[3.3.1.1.1(3,7)]decan-1-amine
  7466. tricyclo[3.3.2.0(2,8)]deca-3,6,9-triene
  7467. tricyclo[4.1.0.0(2,4)]heptane
  7468. Tricyclo[5.2.1.0(2,6)]deca-4,8-dien-3-one
  7469. tricyclo[5.2.1.0(2,6)]decan-2-ol
  7470. tricyclo[5.2.1.0(2,6)]decan-2-yl 4-nitrobenzoate
  7471. Tricyclo[5.4.0.0 (2,6)]undecane-8,11-dione
  7472. Tricyclo[6.5.0.0 (2,7)]tridecane-3,6-dione
  7473. tricyclo[8.2.2.2(4,7)]hexadeca-4,6,10,12,13,15-hexaene
  7474. tricyclo[9.4.0.0(3,8)]pentadeca-1(15),3,5,7,11,13-hexaen-2-ol
  7475. Tridec-4-enol
  7476. Tridec-7-yl N-naphthalen-1-ylcarbamate
  7477. tridecafluorocyclohexaneacetic acid
  7478. tridecafluoroheptanoic acid
  7479. tridecafluoroheptanoyl chloride
  7480. tridecafluoroheptanoyl fluoride
  7481. tridecamethylenimine
  7482. tridecan-1-amine hydrochloride
  7483. tridecan-2-amine
  7484. tridecan-4-ol
  7485. Tridecan-5-ol
  7486. Tridecan-6-ol
  7487. tridecan-7-ol
  7488. tridecanal
  7489. tridecane
  7490. tridecanedioic acid
  7491. tridecanedioic acid dimethyl ester
  7492. tridecanenitrile
  7493. tridecaneperoxoic acid
  7494. tridecanoic acid
  7495. tridecanoic acid 1,10-decanediyl ester
  7496. tridecanoic acid 1,2,3-propanetriyl ester
  7497. tridecanoic acid 1,3-propanediyl ester
  7498. tridecanoic acid 1,4-butanediyl ester
  7499. tridecanoic acid 1,5-pentanediyl ester
  7500. tridecanoic acid 1,6-hexanediyl ester
  7501. tridecanoic acid 1,7-heptanediyl ester
  7502. tridecanoic acid 1,8-octanediyl ester
  7503. tridecanoic acid 1,9-nonanediyl ester
  7504. tridecanoic acid butyl ester
  7505. tridecanoic acid decyl ester
  7506. tridecanoic acid docosyl ester
  7507. tridecanoic acid dodecyl ester
  7508. tridecanoic acid eicosyl ester
  7509. tridecanoic acid ethyl ester
  7510. tridecanoic acid heneicosyl ester
  7511. tridecanoic acid heptadecyl ester
  7512. tridecanoic acid heptanoyloxyhexyl ester
  7513. tridecanoic acid heptyl ester
  7514. tridecanoic acid hexadecyl ester
  7515. tridecanoic acid lithium salt
  7516. tridecanoic acid methyl ester
  7517. tridecanoic acid nonadecyl ester
  7518. tridecanoic acid nonyl ester
  7519. tridecanoic acid octadecyl ester
  7520. tridecanoic acid octyl ester
  7521. tridecanoic acid pentadecyl ester
  7522. tridecanoic acid pentanoyloxydecyl ester
  7523. tridecanoic acid pentanoyloxyhexyl ester
  7524. tridecanoic acid pentanoyloxyoctyl ester
  7525. tridecanoic acid propyl ester
  7526. tridecanoic acid sodium salt
  7527. tridecanoic acid tetradecyl ester
  7528. tridecanoic acid thallium(1+) salt
  7529. tridecanoic acid tridecyl ester
  7530. tridecanoic acid undecyl ester
  7531. Tridecanoyl chloride
  7532. tridecylazanium acetate
  7533. tridecylbenzene
  7534. tridecylcarbamic acid methyl ester
  7535. tridecylcyclohexane
  7536. tridecylcyclopentane
  7537. tridecylpropanedioic acid
  7538. Trideuterocarbonylborane
  7539. tridodecylammonium chloride monochloromethane
  7540. Tridodecylmethylammonium chloride
  7541. Tridodecylmethylammonium picrate
  7542. Triethanolamine butyrate
  7543. triethanolamine divinyl ether
  7544. Triethanolammonium 3-hydroxypyridazonate-6
  7545. Triethanolammonium bis(trifluoromethylsulfonyl)imide
  7546. Triethanolammonium oleate
  7547. Triethanolammonium stearate
  7548. triethenyl-2-propenylsilane
  7549. triethenylarsine
  7550. triethenylbismuthine
  7551. triethenylborane
  7552. triethenyliodostannane
  7553. triethenylmethylsilane
  7554. triethenylphosphine
  7555. triethenylsilane
  7556. triethenylstibine
  7557. triethoxy(2-methylpropyl)silane
  7558. triethoxy(2-propenyl)silane
  7559. triethoxy(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane
  7560. triethoxy(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)silane
  7561. triethoxy(3-phenoxypropyl)silane
  7562. triethoxy(phenylmethyl)silane
  7563. triethoxy-(3-methylbutyl)silane
  7564. triethoxy-prop-2-enoxysilane
  7565. triethoxy-triethoxysilyloxysilane
  7566. triethoxyethylsilane
  7567. triethoxyfluorosilane
  7568. triethoxyhexadecylsilane
  7569. triethoxyhexylsilane
  7570. triethoxyisocyanatosilane
  7571. triethoxymethylsilane
  7572. triethoxyoctadecylsilane
  7573. triethoxyoctylsilane
  7574. triethoxypentylsilane
  7575. triethoxyphenylsilane
  7576. triethoxypropylsilane
  7577. triethoxysilanamine
  7578. triethoxysilane
  7579. triethoxysilylmethanamine
  7580. triethoxy[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane
  7581. triethoxy[3-((2-oxiranyl)methoxy)propyl]silane
  7582. triethoxy[4-(2-oxiranyl)butyl]silane
  7583. triethyl (2-(2-methoxyethoxy)ethoxy)ethylammonium acetate
  7584. triethyl (2-methoxyethoxy)ethylammonium acetate
  7585. triethyl (2-methoxyethoxy)methyl phosphonium 1,2,3-triazolide
  7586. triethyl (2-methoxyethoxy)methyl phosphonium 2-methyl-5-nitroimidazolide
  7587. triethyl (2-methoxyethoxy)methyl phosphonium 4-nitropyrazolide
  7588. triethyl (2-methoxyethoxy)methyl phosphonium bis(trifluoromethylsulfonyl)imide
  7589. Triethyl (2-methoxyethyl) phosphonium bis(trifluoromethylsulfonyl)imide
  7590. Triethyl Carboxymalonate
  7591. triethyl ethoxymethyl phosphonium 1,2,3-triazolide
  7592. triethyl furfuryl orthosilicate
  7593. triethyl methallyl orthosilicate
  7594. triethyl methoxymethyl phosphonium 1,2,3-triazolide
  7595. Triethyl phosphonoformate
  7596. Triethyl phosphonopropyonate
  7597. Triethyl phosphonostearate
  7598. triethyl((2-methylphenyl)thio)stannane
  7599. triethyl((2-methylpropyl)thio)stannane
  7600. triethyl((3-methylphenyl)thio)stannane
  7601. triethyl((4-methylphenyl)thio)stannane
  7602. triethyl((phenylmethyl)thio)stannane
  7603. triethyl(1,1-dimethylethylthio)stannane
  7604. triethyl(1-methylethylthio)tin
  7605. Triethyl(2-methoxyethyl)ammonium bis(trifluoromethanesulfonyl)imide
  7606. triethyl(2-methoxyethyl)sulfamide
  7607. Triethyl(2-methylpropoxy)silane
  7608. triethyl(2-methylpropyl)stannane
  7609. triethyl(3-methylbutyl)stannane
  7610. triethyl(3-methylbutylthio)stannane
  7611. triethyl(4-methylphenyloxy)stannane
  7612. triethyl(ethylthio)stannane
  7613. triethyl(heptylthio)stannane
  7614. triethyl(hexylthio)stannane
  7615. triethyl(isocyanato)stannane
  7616. Triethyl(methyl)plumbane
  7617. Triethyl(methyl)stannane
  7618. Triethyl(octyl)phosphonium 3-chloroindazolide
  7619. Triethyl(octyl)phosphonium 3-iodopyrazolide
  7620. Triethyl(octyl)phosphonium 3-thiol-1,2,4-triazolide
  7621. Triethyl(octyl)phosphonium 4-bromo-3-methylpyrazolide
  7622. Triethyl(octyl)phosphonium 4-bromoimidazolide
  7623. Triethyl(octyl)phosphonium 4-bromoindazolide
  7624. Triethyl(octyl)phosphonium 5-bromoindazolide
  7625. Triethyl(octyl)phosphonium 5-methylbenzimidazolide
  7626. Triethyl(octyl)phosphonium 6-bromoindazolide
  7627. Triethyl(octyl)phosphonium 6-cyanoindazolide
  7628. Triethyl(octyl)phosphonium benzotriazolide
  7629. Triethyl(pentyl)stannane
  7630. triethyl(phenylthio)stannane
  7631. Triethyl(propyl)plumbane
  7632. triethyl-(1,1,2,2,2-pentafluoroethyl)stannane
  7633. Triethyl-11-phosphonoundecanoate
  7634. Triethyl-methylammonium trichloride
  7635. Triethyl-n-pentylphosphonium bis(fluorosulfonyl)imide
  7636. Triethyl-n-pentylphosphonium bis(trifluorosulfonyl)imide
  7637. triethylaluminium comdp. with 1,1'-oxybisethane
  7638. triethylaluminum
  7639. Triethylammonium 6-propyl-4-(furan-2-yl)-3-cyano-5-ethoxycarbonyl-1,4-dihydropyridine-2-thiolate
  7640. Triethylammonium butanoate
  7641. Triethylammonium formate
  7642. Triethylammonium glycolate
  7643. Triethylammonium heptafluorobutyrate
  7644. Triethylammonium methoxyacetate
  7645. Triethylammonium propionate
  7646. Triethylammonium pyruvate
  7647. Triethylammonium tetrafluoroborate
  7648. Triethylammonium trifluoroacetate
  7649. triethylarsine
  7650. triethylarsine bis(3,6-di-tert.-butyl-o-benzosemiquinonato) nickel(II)
  7651. triethylbenzenesulfonyl chloride
  7652. triethylbismuthine
  7653. triethylborane
  7654. triethylboroxin
  7655. triethylbutanedioic acid
  7656. triethylene glycol compd. with dicyclohexylamine (1:2)
  7657. triethylene glycol diacrylate
  7658. Triethylene glycol monoenanthate
  7659. Triethylene glycol monopentyl ether
  7660. triethyleneglycol vinyl ethylether
  7661. Triethylenetetramine 2-methoxyphenolate
  7662. Triethylenetetramine phenolate
  7663. triethylfluorogermane
  7664. triethylfluorosilane
  7665. triethylgallium
  7666. triethylgermanylmethanesulfonic acid trimethylsilyl ester
  7667. triethylheptylsilane
  7668. triethylhexylsilane
  7669. triethylhydrazine
  7670. triethylindium
  7671. triethyliodostannane
  7672. triethylisothiocyanatostannane
  7673. triethylmethoxystannane
  7674. triethylmethylammonium 2,2,2-trifluoro-N-(trifluoromethylsulfonyl)acetamide
  7675. triethylmethylammonium bis-(trifluoromethanesulfonyl)imide
  7676. Triethylmethylammonium dibromoiodide
  7677. Triethylmethylammonium dichlorobromide
  7678. Triethylmethylammonium dichloroiodide
  7679. triethylmethylammonium methyl sulfate (1:1)
  7680. Triethylmethylammonium tribromide
  7681. Triethylmethylammonium triiodide
  7682. triethylmethylpyrazine
  7683. triethylmethylsilane
  7684. triethylmethylsulfamide
  7685. Triethyloctylphosphonium 5-bromobenzimidazolide
  7686. Triethyloctylphosphonium benzimidazolide
  7687. triethyloctylphosphonium bis(trifluoromethylsulfonyl)imide
  7688. triethyloctylsilane
  7689. triethylpentylsilane
  7690. triethylphenoxystannane
  7691. triethylphosphine
  7692. triethylphosphine oxide
  7693. triethylpropylsilane
  7694. triethylpropylstannane
  7695. triethylsilane
  7696. triethylsilanol
  7697. triethylsilyl 2,2,2-trifluoroacetate
  7698. triethylsilyl acetate
  7699. triethylsilylmethanesulfonic acid trimethylsilyl ester
  7700. triethylsilylmethylsulfonyl 2,2,2-trifluoroacetate
  7701. triethylstannane
  7702. triethylstibine
  7703. triethylsulfonium
  7704. triethylsulfonium bromide
  7705. triethylsulfonium bromide compd. with aluminum chloride (9:16)
  7706. triethylsulfonium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  7707. triethylthallium
  7708. Triethyl[(methylthio)methyl]phosphonium bis(fluorosulfonyl)amide
  7709. Triethyl[(methylthio)methyl]phosphonium bis(trifluoromethylsulfonyl)amide
  7710. Triethyl[(methylthio)methyl]phosphonium tetrafluoroborate
  7711. Triethyl[2-(ethylthio)ethyl]phosphonium bis(fluorosulfonyl)amide
  7712. Triethyl[2-(ethylthio)ethyl]phosphonium bis(trifluoromethylsulfonyl)amide
  7713. Triethyl[2-(ethylthio)ethyl]phosphonium tetrafluoroborate
  7714. Triethyl[2-(methylthio)ethyl]phosphonium bis(fluorosulfonyl)amide
  7715. Triethyl[2-(methylthio)ethyl]phosphonium bis(trifluoromethylsulfonyl)amide
  7716. Triethyl[2-(methylthio)ethyl]phosphonium tetrafluoroborate
  7717. trifluormethoxyacetic acid
  7718. trifluoro(1,1,1,2,3,3,3-heptafluoro-2-propanaminato(2-))(trifluoromethanolato)sulfur
  7719. trifluoro(1,1,1-trifluoromethanaminato(2-))(trifluoromethyl)sulfur
  7720. trifluoro(fluorosulfato-o)(1,1,1,2,3,3,3-heptafluoro-2-propanaminato(2-))sulfur
  7721. trifluoro(methylselen)methane
  7722. trifluoro(methylsulfonyl)
  7723. trifluoro(methylthio)methane
  7724. Trifluoro(propan-2-yl)silane
  7725. Trifluoro(propyl)silane
  7726. trifluoro(trifluoromethoxy)ethene
  7727. trifluoro(trifluoromethyl)oxirane
  7728. Trifluoro(trifluoromethyl)sulfur
  7729. trifluoro({[(fluorosulfonyl)oxy]sulfonyl}oxy)methane
  7730. trifluoro-(trifluoromethyldiselanyl)methane
  7731. trifluoro-(trifluoromethylselanyl)methane
  7732. trifluoro-1-propene
  7733. trifluoro-fluorosulfonyloxymethane
  7734. trifluoro-isocyanatomethane
  7735. trifluoro-nitromethane
  7736. trifluoro-nitrosomethane
  7737. trifluoroacetaldehyde
  7738. trifluoroacetic acid
  7739. trifluoroacetic acid (methylnitroamino)methyl ester
  7740. trifluoroacetic acid 1-(chlorodifluoromethyl)-2,2,2-trifluoroethyl ester
  7741. trifluoroacetic acid 1-methylethyl ester
  7742. trifluoroacetic acid 2,2,2-trifluoro-1,1-bis(trifluoromethyl)ethyl ester
  7743. trifluoroacetic acid 2,2,2-trifluoro-1-(trifluoromethyl)ethyl ester
  7744. trifluoroacetic acid 2,2,2-trifluoro-1-methyl-1-(trifluoromethyl)ethyl ester
  7745. trifluoroacetic acid 2,2,2-trifluoroethyl ester
  7746. trifluoroacetic acid 2-bromo-4,4,4-trichlorobutyl ester
  7747. trifluoroacetic acid 2-propenyl ester
  7748. trifluoroacetic acid 3-methyl-3-butenyl ester
  7749. trifluoroacetic acid 3-methylphenyl ester
  7750. trifluoroacetic acid 4,4,4-trichloro-2-butenyl ester
  7751. trifluoroacetic acid 4-methylphenyl ester
  7752. trifluoroacetic acid 4-nitrophenyl ester
  7753. trifluoroacetic acid aluminum salt
  7754. trifluoroacetic acid anhydride
  7755. trifluoroacetic acid anhydride with fluorosulfuric acid
  7756. trifluoroacetic acid barium salt
  7757. trifluoroacetic acid butyl ester
  7758. trifluoroacetic acid cadmium salt
  7759. trifluoroacetic acid calcium salt
  7760. trifluoroacetic acid cerium(3+) salt
  7761. trifluoroacetic acid cobalt(2+) salt
  7762. trifluoroacetic acid copper(1+) salt
  7763. trifluoroacetic acid copper(2+) salt
  7764. trifluoroacetic acid cyclohexyl ester
  7765. trifluoroacetic acid dianhydride with (trifluoromethyl)phosphonous acid
  7766. trifluoroacetic acid ethenyl ester
  7767. trifluoroacetic acid ethyl ester
  7768. trifluoroacetic acid europium(3+) salt
  7769. trifluoroacetic acid gadolinium(3+) salt
  7770. trifluoroacetic acid heptyl ester
  7771. trifluoroacetic acid hexyl ester
  7772. trifluoroacetic acid ion(1-)
  7773. trifluoroacetic acid lanthanum(3+) salt
  7774. trifluoroacetic acid magnesium salt
  7775. trifluoroacetic acid mercury(2+) salt
  7776. trifluoroacetic acid methyl ester
  7777. trifluoroacetic acid neodymium(3+) salt
  7778. trifluoroacetic acid nickel(2+) salt
  7779. trifluoroacetic acid octyl ester
  7780. trifluoroacetic acid pentyl ester
  7781. trifluoroacetic acid phenyl ester
  7782. trifluoroacetic acid potassium salt
  7783. trifluoroacetic acid praseodymium(3+) salt
  7784. trifluoroacetic acid propyl ester
  7785. trifluoroacetic acid silver(1+) salt
  7786. trifluoroacetic acid silyl ester
  7787. trifluoroacetic acid sodium salt
  7788. trifluoroacetic acid strontium salt
  7789. trifluoroacetic acid thorium(4+) salt
  7790. trifluoroacetic acid zinc salt
  7791. trifluoroacetic acid-d
  7792. trifluoroacetonitrile
  7793. trifluoroacetyl bromide
  7794. trifluoroacetyl chloride
  7795. trifluoroacetyl fluoride
  7796. trifluorobismuthine
  7797. trifluoroborane
  7798. trifluoroboroxin
  7799. trifluorodihydrateborane
  7800. trifluoroethaneperoxoic acid trifluoromethyl ester
  7801. trifluoroethanethioic acid S-(1,2,2-trifluoroethyl) ester
  7802. trifluoroethanethioic acid S-(2,2-difluoroethyl) ester
  7803. trifluoroethanethioic acid S-(2-fluoroethyl) ester
  7804. trifluoroethanethioic acid S-(trifluoromethyl) ester
  7805. trifluoroethanethioic acid S-ethyl ester
  7806. trifluoroethene
  7807. trifluoroethene-d
  7808. trifluorogermane
  7809. trifluoroheptylsilane
  7810. trifluoroiodoethene
  7811. trifluoroiodogermane
  7812. trifluoroiodomethane
  7813. trifluoroiodosilane
  7814. trifluoroisocyanatosilane
  7815. trifluoromethane
  7816. trifluoromethane-d
  7817. trifluoromethaneselenol
  7818. trifluoromethanesulfenic acid anhydride with isocyanic acid
  7819. trifluoromethanesulfenyl chloride
  7820. Trifluoromethanesulfenyl thiocyanate
  7821. trifluoromethanesulfinic acid 1,2-ethanediyl ester
  7822. trifluoromethanesulfinic acid 1-(chlorodifluoromethyl)-2,2,2-trifluoroethyl ester
  7823. trifluoromethanesulfinic acid 2,2,2-trifluoro-1,1-bis(trifluoromethyl)ethyl ester
  7824. trifluoromethanesulfinic acid 2,2,2-trifluoro-1,1-dimethylethyl ester
  7825. trifluoromethanesulfinic acid 2,2,2-trifluoro-1-(trifluoromethyl)ethyl ester
  7826. trifluoromethanesulfinic acid 2,2,2-trifluoro-1-methyl-1-(trifluoromethyl)ethyl ester
  7827. trifluoromethanesulfinic acid 2,2,2-trifluoro-1-methylethyl ester
  7828. trifluoromethanesulfinic acid 2,2,2-trifluoroethyl ester
  7829. trifluoromethanesulfinic acid 2-chloroethyl ester
  7830. trifluoromethanesulfinic acid 2-hydroxy-1,3-propanediyl ester
  7831. trifluoromethanesulfinic acid ethyl ester
  7832. trifluoromethanesulfinic acid methyl ester
  7833. trifluoromethanesulfinothioic acid S-(trifluoromethyl) ester
  7834. trifluoromethanesulfinyl cyanide
  7835. trifluoromethanesulfinyl fluoride
  7836. trifluoromethanesulfonamide
  7837. trifluoromethanesulfonic acid
  7838. trifluoromethanesulfonic acid monohydrate
  7839. trifluoromethanesulfonic acid phenyl ester
  7840. trifluoromethanesulfonic acid sodium salt
  7841. trifluoromethanesulfonic acid trifluoromethyl ester
  7842. Trifluoromethanesulfonyl fluoride
  7843. trifluoromethanesulfonyl fluorosulfate
  7844. trifluoromethanesulfonyl isocyanate
  7845. trifluoromethanesulfonyl isothiocyanate
  7846. trifluoromethanesulphenanilide
  7847. trifluoromethanethiol
  7848. trifluoromethanol
  7849. trifluoromethoxymethane
  7850. trifluoromethoxysilane
  7851. trifluoromethoxysulfonyl trifluoromethyl sulfate
  7852. trifluoromethyl
  7853. trifluoromethyl chloroformate
  7854. trifluoromethyl fluoranesulfonoperoxoate
  7855. trifluoromethyl hydroperoxide
  7856. Trifluoromethyl selenium thiocyanate
  7857. trifluoromethyl selenohypobromite
  7858. trifluoromethyl selenohypochlorite
  7859. trifluoromethylarsenic
  7860. trifluoromethylarsenic diiodide
  7861. trifluoromethylcyclopropane
  7862. Trifluoromethyldiacetoxyphosphine
  7863. trifluoromethylium
  7864. trifluoromethylphosphane
  7865. trifluoromethylphosphonic acid
  7866. trifluoromethylseleninic acid
  7867. trifluoromethylselenium trichloride
  7868. trifluoromethylselenylmercury chloride
  7869. trifluoromethylsilane
  7870. trifluoromethylsulfanylbenzene
  7871. Trifluoromethylthiomercuric chloride
  7872. trifluoronitrosoethene
  7873. trifluorophenylsilane
  7874. trifluorosilane
  7875. trifluorosilane-d1
  7876. trifluorosilyl
  7877. trifluorostibine
  7878. trifluoro[(chloromethyl)sulfonyl]methane
  7879. Trigallium(III) dinitrosyl fluoride
  7880. trigermane
  7881. trigermane-d8
  7882. Trigermanium(II) dibismuth(III) hexatellurium(II)
  7883. triglycerol
  7884. triheptacontane
  7885. triheptoxy-methylsilane
  7886. triheptylsilane
  7887. trihexacontane
  7888. trihexoxy-methylsilane
  7889. Trihexyl 11-phosphonoundecanoate
  7890. Trihexyl phosphonocaproate
  7891. trihexyl tetradecyl phosphonium (1S)-(+)-10-camphorsulfonate
  7892. Trihexyl tetradecyl phosphonium 2-(methylthio)benzimidazolide
  7893. Trihexyl tetradecyl phosphonium 2-bromobenzoate
  7894. Trihexyl tetradecyl phosphonium 2-hexyldecanoate
  7895. trihexyl tetradecyl phosphonium 2-methyl-5-nitroimidazolide
  7896. Trihexyl tetradecyl phosphonium 2-pyridinolate
  7897. Trihexyl tetradecyl phosphonium 3-(trifluoromethyl)pyrazolide
  7898. Trihexyl tetradecyl phosphonium 3-methyl-5-trifluoromethyl-pyrazolide
  7899. Trihexyl tetradecyl phosphonium 3-pyridinolate
  7900. trihexyl tetradecyl phosphonium 4,5-dichloroimidazolide
  7901. trihexyl tetradecyl phosphonium 4,5-dicyanoimidazolide
  7902. Trihexyl tetradecyl phosphonium 4-bromobenzoate
  7903. trihexyl tetradecyl phosphonium 4-nitroimidazolide
  7904. trihexyl tetradecyl phosphonium 4-nitropyrazolide
  7905. Trihexyl tetradecyl phosphonium 4-pyridinolate
  7906. Trihexyl tetradecyl phosphonium 6-bromobenzimidazolide
  7907. Trihexyl tetradecyl phosphonium acetanilide
  7908. Trihexyl tetradecyl phosphonium benzenesulfonate
  7909. Trihexyl tetradecyl phosphonium benzoate
  7910. Trihexyl tetradecyl phosphonium chloroacetate
  7911. Trihexyl tetradecyl phosphonium diacetamide
  7912. Trihexyl tetradecyl phosphonium glutarimide
  7913. Trihexyl tetradecyl phosphonium indazolide
  7914. Trihexyl tetradecyl phosphonium indolide
  7915. trihexyl tetradecyl phosphonium L-lactate
  7916. Trihexyl tetradecyl phosphonium maleimide
  7917. Trihexyl tetradecyl phosphonium o-phthalimide
  7918. Trihexyl tetradecyl phosphonium pyrrolide
  7919. Trihexyl tetradecyl phosphonium succinimide
  7920. trihexyl tetradecyl phosphonium tetrazolide
  7921. Trihexyl tetradecyl phosphonium trichloroacetate
  7922. trihexyl tetradecyl phosphonium tricyanomethanide
  7923. trihexyl(2-methylpropyl)phosphonium (T-4)-bis(ethanedioato(2-)-κO1,κO2)borate(1-)
  7924. trihexyl(2-methylpropyl)phosphonium (T-4)-bis(propanedioato(2-)-κO1,κO2)borate(1-)
  7925. trihexyl(2-methylpropyl)phosphonium (T-4)-bis[2-(hydroxy-κO)benzoato(2-)-κO]borate(1-)
  7926. trihexyl(2-methylpropyl)phosphonium bromide
  7927. Trihexyl(tetradecyl)phosphonium 2-(cyano)pyrrolide
  7928. trihexyl(tetradecyl)phosphonium hexafluorophosphate(1-)
  7929. trihexyl(tetradecyl)phosphonium salt with alanine
  7930. trihexyl(tetradecyl)phosphonium salt with glycine
  7931. trihexyl(tetradecyl)phosphonium salt with isoleucine
  7932. trihexyl(tetradecyl)phosphonium salt with leucine
  7933. trihexyl(tetradecyl)phosphonium salt with sarcosine
  7934. trihexyl(tetradecyl)phosphonium salt with valine
  7935. trihexyl(tetradecyl)phosphonium trifluorotris(1,1,1,2,2,2-hexafluoroethyl)phosphate(1-)
  7936. trihexyl(tetradecyl)phosphonium trifluorotris(1,1,2,2,2-pentafluoroethyl)phosphate(1-)
  7937. trihexyl(trichloro)dialuminum
  7938. Trihexylammonium butanoate
  7939. Trihexylammonium hexanoate
  7940. Trihexylammonium octanoate
  7941. trihexylarsine
  7942. trihexylborane
  7943. trihexylboroxin
  7944. Trihexylethoxysilane
  7945. Trihexylheptyl phosphonium bis(trifluoromethylsulfonyl)imide
  7946. Trihexylheptyl phosphonium hexafluorophosphate
  7947. Trihexyloctyl phosphonium hexafluorophosphate
  7948. Trihexylpentyl phosphonium hexafluorophosphate
  7949. trihexylphosphine
  7950. trihexylsilane
  7951. trihexylstibine
  7952. trihexyltetradecylphosphonium (T-4)-tetrachloroferrate(1-)
  7953. trihexyltetradecylphosphonium 1,2,3-triazolide
  7954. trihexyltetradecylphosphonium 1,2,4-triazolide
  7955. trihexyltetradecylphosphonium acetate
  7956. trihexyltetradecylphosphonium asparaginate
  7957. trihexyltetradecylphosphonium benzimidazolide
  7958. trihexyltetradecylphosphonium benzotriazolide
  7959. trihexyltetradecylphosphonium bis(2,4,4-trimethylpentyl)phosphinate
  7960. trihexyltetradecylphosphonium bromide
  7961. trihexyltetradecylphosphonium chloride
  7962. trihexyltetradecylphosphonium decanoate
  7963. Trihexyltetradecylphosphonium dioctylsulfosuccinate
  7964. trihexyltetradecylphosphonium glutaminate
  7965. trihexyltetradecylphosphonium lysinate
  7966. trihexyltetradecylphosphonium methioninate
  7967. trihexyltetradecylphosphonium phenoxide
  7968. trihexyltetradecylphosphonium prolinate
  7969. trihexyltetradecylphosphonium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  7970. trihexyltetradecylphosphonium salt with 1,1,2-trifluoro-2-(pentafluoroethoxy)ethanesulfonic acid
  7971. trihexyltetradecylphosphonium salt with cyanocyanamide (1:1)
  7972. trihexyltetradecylphosphonium salt with dodecylbenzenesulfonic acid (1:1)
  7973. trihexyltetradecylphosphonium salt with methanesulfonic acid (1:1)
  7974. trihexyltetradecylphosphonium salt with trifluoromethanesulfonic acid (1:1)
  7975. trihexyltetradecylphosphonium taurinate
  7976. trihexyltetradecylphosphonium tetrafluoroborate(1-)
  7977. trihexyltetradecylphosphonium tetrakis(cyano-κC)borate(1-)
  7978. trihexyltetradecylphosphonium threoninate
  7979. trihydrogen tetracosa-mu-oxododecaoxo(my12-(phosphato(3-)-κO:κO:κO:κO':κO':κO':κO'':κO'':κO'':κO''':κO''':κO'''))dodecatungstate(3-)
  7980. trihydrogen tetracosa-mu-oxododecaoxo(my12-(phosphato(3-)-O:O:O:O':O':O':O'':O'':O'':O''':O''':O'''))dodecamolybdate(3-)
  7981. triimidazolium nonaborate ((C3H5N2)3(B9O12(OH)6))
  7982. triindium hydrogen tripolyphosphate dodecahydrate
  7983. triiodic acid
  7984. triiodobis(4-methylpyridine 1-oxide-O)arsenic
  7985. triiodobis(pyridine 1-oxide-O)arsenic
  7986. triiodobismuthine
  7987. triiodoborane
  7988. triiodogermane
  7989. triiodomethane
  7990. triiodomethylsilane
  7991. triiodosilane
  7992. triiodostibine
  7993. triiodostibine compd. with 2-methylpyridine
  7994. triiodostibine compd. with 3-methylpyridine
  7995. triiodostibine compd. with 4-methylpyridine
  7996. triiodostibine compd. with pyridine
  7997. triiron(II)chloride bis(N,N'-Dithiodimorpholine)
  7998. triiron(III) dihydroxo hydrogen pentasulfate dodecahydrate(β-Copiapit)
  7999. triiron(III) pentahydroxo disulfate tetrahydrate
  8000. triisoamylbutylammonium iodide dihydrate
  8001. triisoamylbutylammonium iodide dotriacontahydrate
  8002. triisoamylbutylammonium iodide hexatriacontahydrate
  8003. triisobutyl methallyl orthosilicate
  8004. triisobutyl(trichloro)dialuminum
  8005. triisocyanato(methoxy)silane
  8006. triisocyanatomethylsilane
  8007. triisocyanatophenylsilane
  8008. triisocyanatophosphine sulfide
  8009. triisocyanatothiocyanatosilane
  8010. triisohexyl(trichloro)dialuminum
  8011. Triisotridecyl trimellitate
  8012. trilanthanum dizinc chloride pentacosahydrate
  8013. trilanthanum phosphate phosphoric acid hexahydrate
  8014. trilead dioxy diacetate tetrahydrate
  8015. trilead germanium pentaoxide
  8016. Trilead(II) dichromium(III) dodecathiocyanate
  8017. trilead(II) dihydroxy tetra(pentaborate) octahydrate
  8018. Trilead(II) selen(IV) oxide
  8019. Trilead(II) tellurium(IV) oxide
  8020. Trilead(II) tellurium(VI) oxide
  8021. trilithium (OC-6-11)-hexafluoroaluminate(3-)
  8022. trilithium (OC-6-11)-hexahydroaluminate(3-)
  8023. trilithium (T-4)-vanadate (VO4(3-))
  8024. trilithium 2-hydroxypropane-1,2,3-tricarboxylate
  8025. trilithium bismut chloride octahydrate
  8026. Trilithium bismut sulfate dihydrate
  8027. Trilithium borate
  8028. trilithium chlorate monohydrate
  8029. trilithium chloride bis(dimethylacetamide)
  8030. trilithium chloride bis(dimethylformamide)
  8031. trilithium chloride dihydroxide trihydrate
  8032. trilithium dicobalt chloride hexahydrate
  8033. Trilithium heptaborate
  8034. trilithium heptafluorothorate(3-)
  8035. Trilithium heptaphosphide
  8036. Trilithium iron(III) trimalonlate
  8037. Trilithium iron(III) trioxalate
  8038. Trilithium iron(III) trisuccinate
  8039. Trilithium neodymium(III) hexachloride
  8040. trilithium neodymium(III)tristrontium tetramanganite
  8041. trilithium potassium nitrite
  8042. Trilithium praseodymium(III) hexachloride
  8043. trilithium rubidium hydroxide
  8044. trilithium sulfate monourea
  8045. trimagnesium acetate tetra(acetic acid) pentahydrate
  8046. trimagnesium chloride mono(diethylether)
  8047. trimagnesium dicerium nitrate tetracosahydrate
  8048. trimagnesium dineodymium nitrate 24 hydrate
  8049. trimagnesium diphosphate octahydrate
  8050. Trimagnesium disamarium nitrate tetracosahydrate
  8051. Trimagnesium lithium tetrahydroaluminate hexa(diethyl ether)
  8052. trimagnesium oxide dimagnesium chloride pentadecahydrate
  8053. trimagnesium oxide magnesium chloride undecahydrate
  8054. trimanganese bromide di(hexamethylene tetramine) hexahydrate
  8055. trimanganese dipotassium sulfate pentahydrate
  8056. Trimebutine maleate
  8057. Trimercury dihydrogen selenite
  8058. trimercury(II) diammonium chloride hydrate
  8059. Trimercury(II) dichromium(III) dodecathiocyanate
  8060. trimethallyl chlorosilicate
  8061. trimethoxy(1-naphthyl)silane
  8062. trimethoxy(2,4,4-trimethylpentyl)silane
  8063. trimethoxy(2-methylpropyl)silane
  8064. trimethoxy(2-phenylethyl)silane
  8065. trimethoxy(2-propenyl)silane
  8066. trimethoxy(3,3,3-trifluoropropyl)silane
  8067. trimethoxy(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane
  8068. trimethoxy(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane
  8069. trimethoxy(3-methoxypropyl)silane
  8070. trimethoxy(4-methylphenyl)silane
  8071. trimethoxy(phenylmethyl)silane
  8072. trimethoxy(propyl)silane
  8073. trimethoxy-(2-methylprop-2-enoxy)silane
  8074. trimethoxy-(3-methylbutyl)silane
  8075. trimethoxy-prop-2-enoxysilane
  8076. trimethoxy-trimethoxysilyloxysilane
  8077. trimethoxybenzoic acid
  8078. trimethoxymethane
  8079. trimethoxymethylsilane
  8080. trimethoxyoct-1-ene
  8081. trimethoxyoctadecylsilane
  8082. trimethoxyoctylsilane
  8083. trimethoxyphenylsilane
  8084. trimethoxysilane
  8085. trimethoxy[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane
  8086. trimethoxy[3-((2-oxiranyl)methoxy)propyl]silane
  8087. Trimethyl 1,3,7-naphthalenetricarboxylate
  8088. Trimethyl 1,3,8-naphthalenetricarboxylate
  8089. Trimethyl 1,4,5-naphthalenetricarboxylate
  8090. Trimethyl 1,4,6-naphthalenetricarboxylate
  8091. trimethyl(1,1,2,2,2-pentafluoroethyl)plumbane
  8092. trimethyl(1-methylethoxy)silane
  8093. trimethyl(1-methylethyl)stannane
  8094. trimethyl(1-naphthalenyloxy)silane
  8095. Trimethyl(1-naphthylmethyl)ammonium iodide
  8096. trimethyl(2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl)silane
  8097. Trimethyl(2,6-dimethylphenoxy)silane
  8098. trimethyl(2-methylbutoxy)silane
  8099. trimethyl(2-methylphenoxy)silane
  8100. trimethyl(2-methylpropoxy)silane
  8101. Trimethyl(2-Naphthylmethyl)ammonium iodide
  8102. trimethyl(2-propenyl)germane
  8103. trimethyl(3-methylphenoxy)silane
  8104. trimethyl(3-phenoxypropyl)azanium iodide
  8105. trimethyl(3-trimethylsilyloxypropyl)silane
  8106. trimethyl(4-methylphenoxy)silane
  8107. trimethyl(4-methylphenyl)silane
  8108. trimethyl(4-trimethylsilyloxybutyl)silane
  8109. trimethyl(5-phenoxypentyl)azanium iodide
  8110. trimethyl(5-trimethylsilyloxypentyl)silane
  8111. trimethyl(allyl)ammonium bis(trifluoromethylsulfonyl)imide
  8112. Trimethyl(cyclohexylmethoxy)silane
  8113. trimethyl(hexyl)ammonium 2,2,2-trifluoro-N-(trifluoromethylsulfonyl)acetamide
  8114. trimethyl(isopropyl)ammonium 2,2,2-trifluoro-N-(trifluoromethylsulfonyl)acetamide
  8115. trimethyl(isopropyl)ammonium bis(trifluoromethylsulfonyl)imide
  8116. trimethyl(naphthalen-2-yl)azanium chloride
  8117. Trimethyl(nonan-2-yloxy)silane
  8118. trimethyl(octyl)ammonium 2,2,2-trifluoro-N-(trifluoromethylsulfonyl)acetamide
  8119. trimethyl(pentafluorophenyl)silane
  8120. trimethyl(pentyloxy)silane
  8121. trimethyl(phenylmethyl)silane
  8122. trimethyl(propargyl)ammonium 2,2,2-trifluoro-N-(trifluoromethylsulfonyl)acetamide
  8123. trimethyl(propargyl)ammonium bis(trifluoromethylsulfonyl)imide
  8124. trimethyl(propyl)ammonium 2,2,2-trifluoro-N-(trifluoromethylsulfonyl)acetamide
  8125. Trimethyl(propyl)plumbane
  8126. trimethyl(trichloromethyl)silane
  8127. trimethyl(triethylgermyloxy)silane
  8128. trimethyl(undecyloxy)silane
  8129. trimethyl-(1,1,2,2,2-pentafluoroethyl)stannane
  8130. trimethyl-(10-trimethylazaniumyldecyl)azanium dibromide
  8131. trimethyl-(2-phenylphenoxy)silane
  8132. trimethyl-(2-trimethylsilyloxyphenyl)silane
  8133. trimethyl-(3-methylphenyl)azanium iodide
  8134. trimethyl-(3-nitrophenyl)azanium iodide
  8135. trimethyl-(4-phenoxybutyl)azanium iodide
  8136. trimethyl-(4-trimethylsilyloxyphenyl)silane
  8137. trimethyl-(5-trimethylazaniumylpentyl)azanium diiodide
  8138. trimethyl-(trifluoromethyl)stannane
  8139. Trimethyl-11-phosphonoundecanoate
  8140. trimethyl-2-propenylsilane
  8141. Trimethyl-4-morpholinosilane
  8142. trimethyl-5,8,11,14-tetraoxaoctadecane
  8143. trimethyl-ammonium bis[(trifluoromethyl)sulfonyl]imide
  8144. trimethyl-tetradecylphosphanium bromide
  8145. trimethyl-trifluoromethylethylammonium bis(trifluoromethylsulfonyl)imide
  8146. trimethyl-trimethylsilyloxysilane
  8147. trimethylallylammonium (2,2,2-trifluoro-N-(trifluoromethylsulfonyl)acetamidei)
  8148. trimethylaluminum
  8149. trimethylammonium benzamidate
  8150. Trimethylammonium dibromoiodide
  8151. Trimethylammonium lead iodide
  8152. trimethylammonium p-bromobenzamidate
  8153. trimethylammonium p-methoxybenzamidat
  8154. trimethylammonium p-nitrobenzamidate
  8155. Trimethylammonium tetrafluoroborate
  8156. trimethylammonium trichlorocadmate
  8157. trimethylarsine
  8158. trimethylbismuthine
  8159. trimethylborane
  8160. trimethylboroxine
  8161. trimethylcyclohexene
  8162. trimethyldiborane(6)
  8163. trimethyldisiloxane
  8164. trimethylene glycol dimethyl ether
  8165. Trimethylene trisulfide monooxide
  8166. trimethylethylammonium (2,2,2-trifluoro-N-(trifluoromethylsulfonyl)acetamide)
  8167. trimethylethylammonium bis(trifluoromethanesulfonyl)imide
  8168. Trimethylethylammonium dibromoiodide
  8169. trimethylgallium
  8170. trimethylheptylammonium bis(trifluoromethanesulfonyl)imide
  8171. Trimethylhexanedioic acid dibutyl ester
  8172. Trimethylhexanedioic acid dihexyl ester
  8173. trimethylhydrazine
  8174. trimethylindium
  8175. Trimethylmethoxygermane * Boron Trifluoride adduct
  8176. trimethylnonylammonium bromide
  8177. trimethyloctylphosphonium bis(2,4,4-trimethylpentyl)phosphinate
  8178. trimethyloctylsilane
  8179. Trimethyloethane trihexanoate
  8180. Trimethylolpropane tri(2,2-dimethylpropanoate)
  8181. Trimethylolpropane tri(2-methylpropanoate)
  8182. Trimethylolpropane tri(3-methylbutanoate)
  8183. Trimethylolpropane triacetate
  8184. trimethylolpropane triacrylate
  8185. Trimethylolpropane tributanoate
  8186. Trimethylolpropane trihexanoate
  8187. Trimethylolpropane trioleate
  8188. Trimethylolpropane tripentanoate
  8189. Trimethyloxepan-2-one
  8190. trimethyloxirane
  8191. trimethylpentylsilane
  8192. trimethylphenoxysilane
  8193. trimethylphenylgermane
  8194. trimethylphenylsilane
  8195. trimethylphenylstannane
  8196. Trimethylphosphane-borane
  8197. trimethylphosphine
  8198. trimethylpropoxysilane
  8199. Trimethylpropylammonium phenyltrifluoroborate
  8200. trimethylpropylsilane
  8201. trimethylpropylstannane
  8202. trimethylpyrazine 1,4-dioxide
  8203. trimethylsilane
  8204. trimethylsilanecarbonitrile
  8205. trimethylsilanecarbonitrile compd. with borane (1:1)
  8206. trimethylsilanol
  8207. trimethylsilanol acetate
  8208. trimethylsilanol diethylcarbamate
  8209. trimethylsilanol dimethylcarbamate
  8210. trimethylsilanol methylcarbamate
  8211. trimethylsilanol phosphite (3:1)
  8212. Trimethylsiloxyboron dichloride
  8213. trimethylsilyl 2,2,2-trifluoro-N-(trimethylsilyl)acetimidate
  8214. trimethylsilyl 2,2,2-trifluoroacetate
  8215. Trimethylsilyl-1-hexyn-3-ol
  8216. Trimethylsilylketene
  8217. trimethylsilylmethanamine
  8218. trimethylsilylmethanamine hydrochloride
  8219. trimethylsilylmethanesulfonic acid
  8220. trimethylstibine
  8221. trimethylsulfonium
  8222. trimethylsulfonium 2,2,2-trifluoro-N-(trifluoromethylsulfonyl)acetamide
  8223. trimethylsulfonium bromide
  8224. trimethylsulfonium bromide compd. with aluminum chloride (9:16)
  8225. trimethylsulfonium chloride
  8226. trimethylsulfonium dodecahydrododecaborate(2-) (2:1)
  8227. trimethylsulfonium iodide
  8228. trimethylsulfonium salt with 1,1,1-trifluoro-N-((trifluoromethyl)sulfonyl)methanesulfonamide (1:1)
  8229. trimethylsulfonium salt with cyanocyanamide (1:1)
  8230. trimethyltetradecylsilane
  8231. trimethylthallium
  8232. trimethylurea
  8233. trimethyl[(1-methylpentyl)oxy]silane
  8234. trimethyl[(2-methylpentyl)oxy]silane
  8235. trimethyl[(3-methylpentyl)oxy]silane
  8236. trimethyl[(trichlorogermyl)methyl]silane
  8237. trimethyl[1-[4-(trimethylsilyl)phenoxy]propan-2-yl]oxysilane
  8238. trinickel aluminum
  8239. trinickel bis (hydrogen diphosphate) decahydrate
  8240. trinickel niobium
  8241. trinickel titanium
  8242. trinickelous benzene-1,3,5-tricarboxylate dodecahydrate
  8243. triniobium tetraboride
  8244. trinitroacetonitrile
  8245. trinitromethane
  8246. trinitronaphthalene
  8247. trinonacontane
  8248. trinonylsilane
  8249. trioctacontane
  8250. Trioctyl methyl ammonium bromide
  8251. trioctyl(trichloro)dialuminum
  8252. Trioctylammonium 2-hexyldecanoate
  8253. trioctylammonium 2-naphthoate
  8254. Trioctylammonium 3,4-dimethylbenzoate
  8255. Trioctylammonium 4-phenylbutanoate
  8256. Trioctylammonium 4-tert-butylbenzoate
  8257. Trioctylammonium salicylate
  8258. trioctylarsine
  8259. trioctyldecylphosphonium L-leucine ion(1-)
  8260. trioctyldodecylphosphonium L-leucine ion(1-)
  8261. trioctylhexylphosphonium L-leucine ion(1-)
  8262. trioctylmethyl ammonium dimethyl phosphate
  8263. Trioctylmethylammonium levulinate
  8264. trioctylmethylphosphonium bis(trifluoromethylsulfonyl)imide
  8265. Trioctylmethylphosphonium levulinate
  8266. trioctylnonylphosphonium L-leucine ion(1-)
  8267. trioctyloctadecylphosphonium L-leucine ion(1-)
  8268. trioctylphosphine oxide
  8269. trioctylsilane
  8270. Trioctyltetradecylphosphonium dioctylsulfosuccinate
  8271. trioctyltetradecylphosphonium L-leucine ion(1-)
  8272. Tripalladium antimony
  8273. tripentacontane
  8274. Tripentyl(propyl)stannane
  8275. tripentylbenzene
  8276. tripentylbismuthine
  8277. tripentylborane
  8278. tripentylboroxin
  8279. tripentylcyclohexane
  8280. tripentylphosphine
  8281. tripentylphosphine oxide
  8282. tripentylsilane
  8283. tripentylstibine
  8284. triphenoxyselenoxophosphorane
  8285. triphenoxysilane
  8286. triphenyl stibonium comdp. with 2-methyl-2-propenoic acid (1:2)
  8287. triphenyl(1-naphthyl)urea
  8288. triphenyl(2-naphthyl)urea
  8289. triphenyl(4-methylphenyl)phosphonium iodide
  8290. triphenyl(butyl)urea
  8291. triphenyl(hexadecyl)urea
  8292. triphenyl(octadecyl)urea
  8293. triphenyl(octyl)urea
  8294. triphenyl(phenylethynyl)germane
  8295. triphenyl(phenylmethyl)phosphonium chloride
  8296. triphenyl(trityl)phosphanium chloride
  8297. triphenyl-(2,2,2-trifluoroethyl)phosphanium iodide
  8298. triphenyl-(2-triphenylphosphaniumylethyl)phosphanium diiodide
  8299. triphenyl-(4-triphenylphosphaniumylbutyl)phosphanium dibromide
  8300. triphenyl-2-propenylsilane
  8301. Triphenyl-n-butylphosphonium tetracyanoborate
  8302. triphenyl-propylphosphanium bromide
  8303. triphenyl-tritylphosphanium bromide
  8304. triphenylaluminum
  8305. Triphenylamine-3-carboxylic acid
  8306. triphenylantimony bis(1-adamantanecarboxylate)
  8307. Triphenylantimony bis(phenylpropiolate)
  8308. triphenylantimony dibenzoate
  8309. Triphenylantimony dicrotonate
  8310. Triphenylantimony dipropionate
  8311. triphenylarsine
  8312. triphenylarsine hydrochloride
  8313. triphenylarsine oxide
  8314. Triphenylbenzylphosphonium bis(trifluoromethylsulfonyl)imide
  8315. Triphenylbenzylphosphonium trifluoromethanesulfonate
  8316. Triphenylbismuth dicrotonate
  8317. triphenylbismuth dimethacrylate
  8318. triphenylbismuthine
  8319. triphenylborane
  8320. Triphenylcarbamoyl-β-cyclodextrin
  8321. triphenylene
  8322. triphenylgallium
  8323. triphenylguanidine
  8324. triphenylindium
  8325. triphenylmethyl hydroperoxide
  8326. triphenylmethylium tetrafluoroborate(1-)
  8327. Triphenylmonodeuteromethane
  8328. triphenylphosphine
  8329. triphenylphosphine bis(3,6-di-tert.-butyl-o-benzosemiquinonato) cobalt(II)
  8330. triphenylphosphine oxide
  8331. triphenylphosphine selenide
  8332. triphenylphosphine sulfide
  8333. triphenylsilanol
  8334. triphenylstannanylium perchlorate
  8335. triphenylstibine
  8336. triphenylstibine 2-propenoate (1:2)
  8337. triphenylstibine sulfide
  8338. Triphenyltin-2,4,6-trimethylbenzoate
  8339. Triphenyltin-3,5-dinitrobenzoate
  8340. Triphenyltin-4-aminobenzoate
  8341. Triphenyltin-4-hydroxybenzoate
  8342. Triphenyltin-4-methoxybenzoate
  8343. Triphenyltin-4-methylbenzoate
  8344. Triphenyltin-4-nitrobenzoate
  8345. triphosphate
  8346. triphosphoric acid calcium salt (2:5)
  8347. triphosphoric acid dilithium salt
  8348. triphosphoric acid monoammonium salt
  8349. triphosphoric acid monopotassium salt
  8350. triphosphoric acid pentaammonium salt
  8351. triphosphoric acid pentaammonium salt monohydrate
  8352. triphosphoric acid pentapotassium salt
  8353. triphosphoric acid pentasodium salt
  8354. triphosphoric acid tripotassium salt
  8355. Tripiperidinylcyclopropenylium bis(trifluoromethanesulfonyl)amide
  8356. Tripiperidinylcyclopropenylium chloride
  8357. Tripiperidinylcyclopropenylium dicyanamide
  8358. Tripiperidinylcyclopropenylium nitrate
  8359. Tripiperidinylcyclopropenylium tetrafluoroborate
  8360. Tripiperidinylcyclopropenylium thiocyanate
  8361. tripoassium (OC-6-11)-hexachloroytterbate(3-)
  8362. tripotassium (OC-6-11)-hexachloroaluminate(3-)
  8363. tripotassium (OC-6-11)-hexachloroindate(3-)
  8364. tripotassium (OC-6-11)-hexachloroscandate(3-)
  8365. tripotassium (OC-6-11)-hexafluoroaluminate(3-)
  8366. tripotassium (OC-6-11)-hexafluoroferrate(3-)
  8367. tripotassium (OC-6-11)-hexakis(cyano-κC)cobaltate(3-)
  8368. tripotassium (OC-6-11)-hexakis(cyano-κC)ferrate(3-)
  8369. tripotassium (PB-7-11-11111)-heptafluorozirconate(3-)
  8370. tripotassium (T-4)-vanadate (VO4(3-))
  8371. tripotassium 2-hydroxypropane-1,2,3-tricarboxylate hydrate
  8372. tripotassium ammonium nitrate
  8373. tripotassium cadmium formate
  8374. tripotassium calcium thiocyanate trihydrate
  8375. Tripotassium cerium(III) hexachloride
  8376. tripotassium cerium(IV) heptafluoride
  8377. tripotassium chlorohexafluorotitanate(3-)
  8378. tripotassium chromium(III) fluoride
  8379. tripotassium copper(I) cyanide
  8380. tripotassium copper(I) cyanide monohydrate
  8381. tripotassium diantimony bromide
  8382. tripotassium diantimony(III) chloride
  8383. tripotassium dibarium thiocyanate pentahydrate
  8384. tripotassium dicobalt formate dihydrate
  8385. tripotassium dihydrogen triphosphate monohydrate
  8386. tripotassium dimagnesium chloride tetrahydrate
  8387. tripotassium dimercury(II) iodide
  8388. tripotassium dizinc acetate dihydrate
  8389. Tripotassium erbium(III) hexafluoride
  8390. tripotassium erbium(III)formate
  8391. Tripotassium europium(III) hexafluoride
  8392. Tripotassium fluoromolybdate
  8393. Tripotassium gadolinium(III) hexafluoride
  8394. tripotassium gallium(III) fluoride
  8395. tripotassium gallium(III) fluoride hexa(acetic acid)
  8396. tripotassium gallium(III) fluoride nonahydrate
  8397. tripotassium gallium(III) fluoride tri(acetic acid)
  8398. tripotassium hafnium fluoride
  8399. tripotassium heptafluorotitanate(3-)
  8400. Tripotassium heptaphosphide
  8401. tripotassium holmium hexabromide
  8402. tripotassium hydrogen pyrophosphate
  8403. tripotassium hydrogen sulfate
  8404. tripotassium hydrogen sulfate monohydrate
  8405. Tripotassium lanthanum(III) trioxalate
  8406. tripotassium metaborate tetrahydrate
  8407. Tripotassium neodymium(III) hexachloride
  8408. tripotassium pentafluoroberyllate(3-)
  8409. tripotassium pentahydrogen dipyrophosphate
  8410. tripotassium phosphate heptahydrate
  8411. tripotassium phosphate nonahydrate
  8412. tripotassium phosphate trihydrate
  8413. Tripotassium praseodymium(III) hexachloride
  8414. Tripotassium samarium(III) hexafluoride
  8415. tripotassium scandium(III) sulfate
  8416. tripotassium silver cyanide monohydrate
  8417. Tripotassium sodium uranyl tricarbonate
  8418. Tripotassium terbium(III) hexafluoride
  8419. Tripotassium titanium(IV) heptafluoride
  8420. Tripotassium titanium(IV) hexafluoride chloride
  8421. tripotassium tri-mu-chlorohexachlorodialuminate(3+)
  8422. Tripotassium ytterbium(III) hexachloride
  8423. Tripotassium yttrium phosphate
  8424. tripotassium zinc acetate monohydrate
  8425. Tripotassium zirconium hydroxy trisulfate dihydrate
  8426. tripotassiumimidobissulfate monohydrate
  8427. tripropoxysilane
  8428. tripropoxystibine
  8429. tripropyl(2-methylpropyl)stannane
  8430. tripropylaluminum
  8431. Tripropylammonium p-toluenesulfonate
  8432. Tripropylammonium tetrafluoroborate
  8433. tripropylarsine
  8434. tripropylbismuthine
  8435. tripropylborane
  8436. tripropylboroxin
  8437. tripropylgallium
  8438. tripropylhydrazine
  8439. tripropylindium
  8440. tripropylphosphine
  8441. tripropylphosphine oxide
  8442. tripropylquinoline
  8443. tripropylsilane
  8444. tripropylsilanol acetate
  8445. tripropylstannane
  8446. tripropylstannyl acetate
  8447. tripropylstibine
  8448. tripropylsulfanium iodide
  8449. tripropylsulfonium
  8450. tripropyltin 2-iodobenzoate
  8451. Tripyridine bismuth(III) hexabromide
  8452. trirhodium tetrasulfide
  8453. trirubidium (OC-6-11)-hexachloroscandate(3-)
  8454. trirubidium (OC-6-11)-hexafluoroaluminate(3-)
  8455. trirubidium antimony(III) chloride
  8456. trirubidium bismuth chloride
  8457. trirubidium bismuth(III) bromide
  8458. trirubidium diantimony (III) bromide
  8459. trirubidium diantimony (III) chloride
  8460. trirubidium diantimony (III) iodide
  8461. trirubidium dibismuth(III) bromide
  8462. Trirubidium dimagnesium heptachloride
  8463. trirubidium dimercury(II)chloride dihydrate
  8464. trirubidium dineodymium nitrate monohydrate
  8465. Trirubidium fluoride tetra(acetic acid)
  8466. trirubidium fluoride tungsten(VI)oxide
  8467. trirubidium gadolinium(III) chloride dihydrate
  8468. trirubidium gallium(III) fluoride
  8469. trirubidium hafnium fluoride
  8470. Trirubidium heptaphosphide
  8471. trirubidium hexafluoroferrate(III)
  8472. trirubidium indium(III) fluoride
  8473. trirubidium iodide bismut triiodide
  8474. trirubidium iodide di(bismut triiodide)
  8475. Trirubidium lanthanum(III) hexachloride
  8476. trirubidium lithium chloride dihydrate
  8477. Trirubidium magnesium pentachloride
  8478. Trirubidium neodymium(III) hexachloride
  8479. Trirubidium praseodymium(III) hexachloride
  8480. Trirubidium sulfate hydrogen sulfate
  8481. Trirubidium ytterbium(III) hexachloride
  8482. trirubidium zirconium fluoride
  8483. trirubiudium (OC-6-11)-hexabromolanthanate(3-)
  8484. tris (sodium silicate) potassium silicate heneicosahydrate
  8485. tris (sodium sulfate) sodium chlorate
  8486. Tris(α-dL-Alanine) cerium(III) trithiocyanate
  8487. Tris(α-dL-Alanine) lanthanum(III) trithiocyanate
  8488. Tris(α-dL-Alanine) neodymium(III) trithiocyanate
  8489. Tris(α-dL-Alanine) praseodymium(III) trithiocyanate
  8490. Tris(β-hydroxyethyl)methylammonium chloride
  8491. Tris(ε-caprolactam) zinc(II) dibromide
  8492. Tris(ε-caprolactam) zinc(II) dichloride
  8493. Tris(ε-caprolactam) zinc(II) diiodide
  8494. tris(η(5)-2,4-cyclopentadien-1-yl)di-my(3)-thioxotricobalt triangulo
  8495. tris(η5-2,4-cyclopentadien-1-yl)yttrium
  8496. tris((1,1-dimethylethyl)dioxy)ethenylsilane
  8497. tris((2-ethylhexyl)oxy)phenylsilane
  8498. tris(1,1,1,2,2,3,3-Heptafluoro-7,7-dimethyloctane-4,6-dione)dysprosium(III)
  8499. tris(1,1,1,2,2,3,3-Heptafluoro-7,7-dimethyloctane-4,6-dione)erbium(III)
  8500. tris(1,1,1,2,2,3,3-Heptafluoro-7,7-dimethyloctane-4,6-dione)gadolinium(III)
  8501. tris(1,1,1,2,2,3,3-Heptafluoro-7,7-dimethyloctane-4,6-dione)lanthanum(III)
  8502. tris(1,1,1,2,2,3,3-Heptafluoro-7,7-dimethyloctane-4,6-dione)neodymium(III)
  8503. tris(1,1,1,2,2,3,3-Heptafluoro-7,7-dimethyloctane-4,6-dione)samarium(III)
  8504. tris(1,1,1,2,2,3,3-Heptafluoro-7,7-dimethyloctane-4,6-dione)ytterbium(III)
  8505. Tris(1,1,1,5,5,5-hexafluoro 2,4-pentanedionate) aluminium (III)
  8506. tris(1,1,1,5,5,5-Hexafluoro-2,4-pentanedionato)chromium(III)
  8507. tris(1,1,1,5,5,5-Hexafluoro-2,4-pentanedionato)gallium(III)
  8508. Tris(1,1,1,5,5,5-hexafluoro-2,4-pentanedionato)scandium
  8509. tris(1,1,1-Trifluoro-2,4-pentanedionato)aluminum(III)
  8510. tris(1,1,1-Trifluoro-2,4-pentanedionato)chromium(III)
  8511. tris(1,1,1-Trifluoro-2,4-pentanedionato)iron(III)
  8512. Tris(1,1,1-trifluoro-2,4-pentanedionato)scandium
  8513. tris(1,1,1-trifluoro-2,4-pentanedionato-κO,κO')cobalt
  8514. tris(1,1,1-trifluoro-5,5-dimethyl-2,4-hexanedionato-κO,κO')ruthenium
  8515. tris(1,1-dimethylethoxy)methylsilane
  8516. tris(1,1-dimethylethoxy)stibine
  8517. Tris(1,10-phenanthroline) iron(II) iodide
  8518. Tris(1,10-phenanthroline) ruthenium(II) bromide
  8519. Tris(1,10-phenanthroline) ruthenium(II) dirhenium(VII) oxide
  8520. Tris(1,10-phenanthroline) ruthenium(II) dithiocyanate
  8521. Tris(1,10-phenanthroline) ruthenium(II) divanadium(V) oxide
  8522. Tris(1,10-phenanthroline) ruthenium(II) iodide
  8523. tris(1,2,2-trifluoroethenyl)borane
  8524. tris(1,2,4-triazole)iron(II) decahydrodecaborate monohydrate
  8525. Tris(1,2-propanediamine) nickel(II) bis(trifluoromethanesulfonate)
  8526. tris(1,2-propanediamine-N,N')cobalt(3+) triperchlorate
  8527. tris(1,2-triaminopropane)-platinum-(IV)-chloride
  8528. Tris(1,3-dichloropropan-2-yl) orthoformate
  8529. Tris(1,3-propanediammonium) decavanadate pentahydrate
  8530. Tris(1,6-hexanediammonium) decavanadate dihydrate
  8531. tris(1-butyl-3-methyl-1H-imidazolium) phosphate
  8532. tris(1-chloropropan-2-yl) phosphate
  8533. tris(1-methylethoxy)phenylsilane
  8534. tris(1-methylethoxy)stibine
  8535. tris(1-methylethyl)aluminum
  8536. tris(1-methylethyl)arsine
  8537. tris(1-methylethyl)benzene
  8538. tris(1-methylethyl)borane
  8539. tris(1-methylethyl)boroxin
  8540. tris(1-methylethyl)cyclohexane
  8541. tris(1-methylethyl)indium
  8542. tris(1-methylpropoxy)methylsilane
  8543. tris(1-methylpropyl)phosphine oxide
  8544. tris(1-phenyl-1,3-butanedionato-κO,κO')cobalt
  8545. tris(1-phenyl-1,3-butanedionato-O,O')chromium
  8546. Tris(1-phenyl-1,3-butanediono)europium(III) dihydrate
  8547. tris(2',2'-dinitro-2'-fluoroethyl)-s-triazine-2,4,6-tricarboxylate
  8548. tris(2,2,2-trifluoroethyl) phosphate
  8549. Tris(2,2,3,3,4,4,5,5-octafluoropentyl) phosphate
  8550. tris(2,2,6,6-Tetramethylheptane-3,5-dionato)gallium(III)
  8551. Tris(2,3,4,5,6-pentafluorophenyl)-(2-pyridin-4-ylethyl)germane
  8552. tris(2,3-dichlorobenzoato)(1,10-phenanthroline)europium dimer
  8553. tris(2,3-dichlorobenzoato)(1,10-phenanthroline)holmium dimer
  8554. tris(2,3-dichlorobenzoato)(1,10-phenanthroline)terbium dimer
  8555. Tris(2,4-ditert-butylphenyl) phosphite
  8556. tris(2,4-Pentanedionato)lutetium(III)
  8557. Tris(2,6-dimethylpyridine) dibismuth(III) bromide
  8558. Tris(2-(2-methoxyethoxy)ethyl)ammonium acetate
  8559. Tris(2-(2-methoxyethoxy)ethyl)ammonium butanoate
  8560. Tris(2-(2-methoxyethoxy)ethyl)ammonium cyanoacetate
  8561. Tris(2-(2-methoxyethoxy)ethyl)ammonium methoxyacetate
  8562. Tris(2-Aminoethanol) nickel(II) dibromide
  8563. Tris(2-Aminoethanol) nickel(II) dichloride
  8564. Tris(2-Aminoethanol) nickel(II) diiodide
  8565. Tris(2-Aminoethanol) nickel(II) nitrate
  8566. Tris(2-Aminoethanol) nickel(II) selenate
  8567. Tris(2-Aminoethanol) nickel(II) sulfate
  8568. Tris(2-aminoethyl) borate
  8569. Tris(2-aminopyridine) dibismuth(III) bromide
  8570. tris(2-carbethoxyethyl)phosphine sulfide
  8571. tris(2-carboxyethyl)phosphine oxide
  8572. tris(2-chloroethenyl)arsine
  8573. tris(2-chloroethoxy) methylsilane
  8574. tris(2-chloroethoxy)phenylsilane
  8575. tris(2-chloroethoxy)silane
  8576. Tris(2-chloroethyl) orthobenzoate
  8577. tris(2-cyanoethyl)-methylphosphanium iodide
  8578. tris(2-cyanoethyl)-prop-2-enylphosphanium chloride
  8579. Tris(2-ethylhexyl) 11-phosphonoundecanoate
  8580. Tris(2-ethylhexyl) amine
  8581. Tris(2-hydroxy-6-fluorophenyl)phosphine
  8582. tris(2-hydroxybenzoato)cerium dihydrate
  8583. tris(2-hydroxybenzoato)europium monohydrate
  8584. tris(2-hydroxybenzoato)gadolinium monohydrate
  8585. tris(2-hydroxybenzoato)lanthanum dihydrate
  8586. tris(2-hydroxybenzoato)neodymium dihydrate
  8587. tris(2-hydroxybenzoato)praseodymium dihydrate
  8588. tris(2-hydroxybenzoato)samarium dihydrate
  8589. Tris(2-hydroxyethyl)(tetradecyl)ammonium bromide
  8590. Tris(2-hydroxyethyl)ammonium 2,2,2-trifluoroacetate
  8591. Tris(2-hydroxyethyl)ammonium 2,4,6-trinitrobenzenesulfonate
  8592. Tris(2-hydroxyethyl)ammonium 2-(1-benzyl-1H-indol-3-ylsulfanyl)acetate
  8593. Tris(2-hydroxyethyl)ammonium 2-(1-benzyl-1H-indole-3-sulfonyl)acetate
  8594. Tris(2-hydroxyethyl)ammonium 2-(1-methyl-1H-indol-3-ylsulfanyl)acetate
  8595. Tris(2-hydroxyethyl)ammonium 2-(1H-indol-3-ylsulfanyl)acetate
  8596. Tris(2-hydroxyethyl)ammonium 2-(4-chlorophenyl)sulfonyl acetate
  8597. Tris(2-hydroxyethyl)ammonium 2-hydroxybenzoate
  8598. tris(2-hydroxyethyl)ammonium 2-sulfobenzoate
  8599. Tris(2-hydroxyethyl)ammonium 3-aminobenzenesulfonate
  8600. Tris(2-hydroxyethyl)ammonium 3-nitrobenzenesulfonate
  8601. Tris(2-hydroxyethyl)ammonium 4-aminobenzenesulfonate
  8602. Tris(2-hydroxyethyl)ammonium 4-methylbenzenesulfonate
  8603. Tris(2-hydroxyethyl)ammonium 5-sulfosalicylate
  8604. Tris(2-hydroxyethyl)ammonium benzenesulfonate
  8605. Tris(2-hydroxyethyl)ammonium benzoate
  8606. Tris(2-hydroxyethyl)ammonium caprate
  8607. Tris(2-hydroxyethyl)ammonium caprylate
  8608. Tris(2-hydroxyethyl)ammonium dihydrogen phosphate
  8609. Tris(2-hydroxyethyl)ammonium dihydrogen phosphite
  8610. Tris(2-hydroxyethyl)ammonium hydrogensulfate
  8611. Tris(2-hydroxyethyl)ammonium laurate
  8612. Tris(2-hydroxyethyl)ammonium linoleate
  8613. Tris(2-hydroxyethyl)ammonium methanesulfonate
  8614. Tris(2-hydroxyethyl)ammonium myristate
  8615. Tris(2-hydroxyethyl)ammonium palmitate
  8616. Tris(2-hydroxyethyl)ammonium propanoate
  8617. Tris(2-hydroxyethyl)ammonium sulfamate
  8618. Tris(2-hydroxyethyl)ammonium trifluoromethanesulfonate
  8619. Tris(2-hydroxyethyl)methylammonium L-prolinate
  8620. tris(2-hydroxyethyl)methylammonium salt with sulfic acid monomethyl ester (1:1)
  8621. Tris(2-hydroxypropyl)(tetradecyl)ammonium bromide
  8622. tris(2-mercapto-3-pyridinecarboxylato)cerium dihydrate
  8623. tris(2-mercapto-3-pyridinecarboxylato)dysprosium dihydrate
  8624. tris(2-mercapto-3-pyridinecarboxylato)erbium monohydrate
  8625. tris(2-mercapto-3-pyridinecarboxylato)europium dihydrate
  8626. tris(2-mercapto-3-pyridinecarboxylato)gadolinium dihydrate
  8627. tris(2-mercapto-3-pyridinecarboxylato)holmium dihydrate
  8628. tris(2-mercapto-3-pyridinecarboxylato)lanthanum dihydrate
  8629. tris(2-mercapto-3-pyridinecarboxylato)lutetium monohydrate
  8630. tris(2-mercapto-3-pyridinecarboxylato)neodymium dihydrate
  8631. tris(2-mercapto-3-pyridinecarboxylato)praseodymium dihydrate
  8632. tris(2-mercapto-3-pyridinecarboxylato)samarium dihydrate
  8633. tris(2-mercapto-3-pyridinecarboxylato)terbium dihydrate
  8634. tris(2-mercapto-3-pyridinecarboxylato)thulium monohydrate
  8635. tris(2-mercapto-3-pyridinecarboxylato)ytterbium monohydrate
  8636. tris(2-methoxyethoxy)-[3-(oxiran-2-ylmethoxy)propyl]silane
  8637. tris(2-methoxyethoxy)methylsilane
  8638. tris(2-methyl-2-phenylpropyl)-tris(2-methyl-2-phenylpropyl)stannyloxystannane
  8639. tris(2-methylphenyl)phosphine
  8640. Tris(2-methylprop-2-en-1-yl) borate
  8641. Tris(2-methylpropan-1-olato)oxovanadium
  8642. tris(2-methylpropoxy)-phenylsilane
  8643. tris(2-methylpropoxy)-[tris(2-methylpropoxy)silyloxy]silane
  8644. tris(2-methylpropoxy)silane
  8645. tris(2-methylpropyl)aluminum
  8646. tris(2-methylpropyl)arsine
  8647. tris(2-methylpropyl)bismuthine
  8648. tris(2-methylpropyl)borane
  8649. tris(2-methylpropyl)boroxin
  8650. tris(2-methylpropyl)gallium
  8651. tris(2-methylpropyl)indium
  8652. tris(2-methylpropyl)phosphine
  8653. tris(2-methylpropyl)propylplumbane
  8654. tris(2-methylpropyl)silane
  8655. tris(2-methylpropyl)stibine
  8656. Tris(2-phenylethyl)arsane
  8657. tris(2-propan-2-ylphenyl) phosphate
  8658. tris(2-propenyl)arsine
  8659. tris(2-propenyl)borane
  8660. Tris(3,4-dihydroxy benzoate) cerium(III)
  8661. Tris(3,4-dihydroxy benzoate) dysprosium(III)
  8662. Tris(3,4-dihydroxy benzoate) erbium(III)
  8663. Tris(3,4-dihydroxy benzoate) europium(III)
  8664. Tris(3,4-dihydroxy benzoate) gadolinium(III)
  8665. Tris(3,4-dihydroxy benzoate) holmium(III)
  8666. Tris(3,4-dihydroxy benzoate) lanthanum(III)
  8667. Tris(3,4-dihydroxy benzoate) lutetium(III)
  8668. Tris(3,4-dihydroxy benzoate) neodymium(III)
  8669. Tris(3,4-dihydroxy benzoate) praseodymium(III)
  8670. Tris(3,4-dihydroxy benzoate) samarium(III)
  8671. Tris(3,4-dihydroxy benzoate) terbium(III)
  8672. Tris(3,4-dihydroxy benzoate) thulium(III)
  8673. Tris(3,4-dihydroxy benzoate) ytterbium(III)
  8674. Tris(3,4-dihydroxy benzoate) yttrium(III)
  8675. Tris(3,5-dihydroxy benzoate) cerium(III)
  8676. Tris(3,5-dihydroxy benzoate) dysprosium(III)
  8677. Tris(3,5-dihydroxy benzoate) erbium(III)
  8678. Tris(3,5-dihydroxy benzoate) europium(III)
  8679. Tris(3,5-dihydroxy benzoate) gadolinium(III)
  8680. Tris(3,5-dihydroxy benzoate) holmium(III)
  8681. Tris(3,5-dihydroxy benzoate) lanthanum(III)
  8682. Tris(3,5-dihydroxy benzoate) lutetium(III)
  8683. Tris(3,5-dihydroxy benzoate) neodymium(III)
  8684. Tris(3,5-dihydroxy benzoate) praseodymium(III)
  8685. Tris(3,5-dihydroxy benzoate) samarium(III)
  8686. Tris(3,5-dihydroxy benzoate) terbium(III)
  8687. Tris(3,5-dihydroxy benzoate) thulium(III)
  8688. Tris(3,5-dihydroxy benzoate) ytterbium(III)
  8689. Tris(3,5-dihydroxy benzoate) yttrium(III)
  8690. Tris(3-fluorophenyl)antimony dibromide
  8691. Tris(3-fluorophenyl)antimony dichloride
  8692. Tris(3-fluorophenyl)antimony difluoride
  8693. Tris(3-fluorophenyl)antimony diiodide
  8694. tris(3-methylbutoxy)-phenylsilane
  8695. tris(3-methylbutyl)borane
  8696. tris(3-methylbutyl)methylplumbane
  8697. tris(3-methylbutyl)propylplumbane
  8698. tris(3-methylbutyl)silane
  8699. tris(3-methylbutyl)stibine
  8700. Tris(3-methylpyridine) bismuth(III) hexabromide
  8701. tris(3-methylpyridine-N-oxido) bis(arsenic triiodide)
  8702. tris(3-nitrobenzoato)(1,10-phenanthroline)dysprosium dimer tetrahydrate
  8703. Tris(4,7-dimethyl-1,10-phenanthroline) iron(II) iodide
  8704. Tris(4,7-diphenyl-1,10-phenanthroline) iron(II) iodide
  8705. Tris(4-amino-1,2,4-triazole)iron(II) iodide
  8706. Tris(4-aminopyridine) dibismuth(III) bromide
  8707. Tris(4-chlorobenzoylpivaloylmethanato)aluminium(III)
  8708. tris(4-chlorophenoxy)(methyl)silane
  8709. Tris(4-fluorobenzoylpivaloylmethanato)aluminium(III)
  8710. Tris(4-methoxybenzoylpivaloylmethanato)aluminium(III)
  8711. tris(4-methoxyphenyl)phosphine
  8712. tris(4-methoxyphenyl)phosphine oxide
  8713. Tris(4-methylbenzoylpivaloylmethanato)aluminium(III)
  8714. tris(4-methylphenyl)stibine oxide
  8715. tris(4-methylpyridine-N-oxido) bis(arsenic tribromide)
  8716. Tris(4-nitrolbenzoylpivaloylmethanato)aluminium(III)
  8717. Tris(4-nitrophenyl) phosphate
  8718. tris(4-propyl-4H-1,2,4-triazole-κN1)iron(2+) dibromide tetrahydrate
  8719. tris(4-propyl-4H-1,2,4-triazole-κN1)iron(2+) salt with trifluoromethanesulfonic acid (1:2) pentahydrate
  8720. Tris(4-tert-butylphenyl) phosphate
  8721. tris(4H-1,2,4-triazol-4-amine-κN(1))iron(2+) diiodide
  8722. tris(4H-1,2,4-triazol-4-amine-κN1)copper(2+) dinitrate
  8723. tris(4H-1,2,4-triazol-4-amine-κN1)iron(2+) bis((T-4)-tetraoxorhenate(1-))
  8724. tris(4H-1,2,4-triazol-4-amine-κN1)iron(2+) dibromide
  8725. tris(4H-1,2,4-triazol-4-amine-κN1)iron(2+) dinitrate
  8726. tris(4H-1,2,4-triazol-4-amine-κN1)iron(2+) diperchlorate
  8727. tris(4H-1,2,4-triazol-4-amine-κN1)iron(2+) hexafluorosilicate(2-) (1:1) monohydrate
  8728. tris(4H-1,2,4-triazol-4-amine-κN1)nickel(2+) dinitrate monohydrate
  8729. tris(acetonitrile)tricarbonyltungsten
  8730. tris(ammonium nitrate) ammonium phosphate
  8731. tris(ammonium sulfate)sulfuric acid
  8732. tris(aziridin-1-yl)-sulfanylidenephosphorane
  8733. tris(benzoylacetonato)aluminium (III)
  8734. Tris(benzoylpivaloylmethanato)aluminium(III)
  8735. tris(boric acid) monoethylenediamine
  8736. Tris(butylmethylamino)cyclopropenylium bis(trifluoromethanesulfonyl)imide
  8737. Tris(butylmethylamino)cyclopropenylium chloride
  8738. Tris(butylmethylamino)cyclopropenylium dicyanamide
  8739. Tris(butylmethylamino)cyclopropenylium nitrate
  8740. Tris(butylmethylamino)cyclopropenylium tetrafluoroborate
  8741. Tris(butylmethylamino)cyclopropenylium thiocyanate
  8742. tris(butyloxy)-N-ethylsilanamine
  8743. tris(butyloxy)-N-propylsilanamine
  8744. tris(butyloxy)silanamine
  8745. tris(decyl)(octadecyl)silane
  8746. tris(decyl)silane
  8747. tris(Dibenzoylmethano)iron(III)
  8748. Tris(dibutylamino)cyclopropenylium bis(trifluoromethanesulfonyl)imide
  8749. Tris(dibutylamino)cyclopropenylium chloride
  8750. Tris(dibutylamino)cyclopropenylium dicyanamide
  8751. Tris(dibutylamino)cyclopropenylium nitrate
  8752. Tris(dibutylamino)cyclopropenylium tetrachlorocuprate(II)
  8753. Tris(dibutylamino)cyclopropenylium tetrachloroferrate(III)
  8754. Tris(dibutylamino)cyclopropenylium tetrachlorozincate(II)
  8755. Tris(dibutylamino)cyclopropenylium tetracyanoborate
  8756. Tris(dibutylamino)cyclopropenylium tetrafluoroborate
  8757. Tris(dibutylamino)cyclopropenylium trichlorostannate(II)
  8758. Tris(dibutylamino)cyclopropenylium trifluoromethanesulfonate
  8759. Tris(dibutylamino)cyclopropenylium trifluorotris(pentafluoroethyl)phosphate
  8760. Tris(didecylamino)cyclopropenylium bis(trifluoromethanesulfonyl)imide
  8761. Tris(didecylamino)cyclopropenylium chloride
  8762. Tris(didecylamino)cyclopropenylium dicyanamide
  8763. Tris(diethylamino)arsine
  8764. Tris(diethylamino)cyclopropenylium chloride
  8765. Tris(diethylamino)cyclopropenylium nitrate
  8766. Tris(diethylamino)cyclopropenylium p-toluenesulfonate
  8767. Tris(diethylamino)cyclopropenylium pentafluorophenoxide
  8768. Tris(diethylamino)cyclopropenylium perchlorate
  8769. Tris(diethylamino)cyclopropenylium tetrachlorocuprate(II)
  8770. Tris(diethylamino)cyclopropenylium tetrachloroferrate(III)
  8771. Tris(diethylamino)cyclopropenylium tetrachlorozincate(II)
  8772. Tris(diethylamino)cyclopropenylium tetrafluoroborate
  8773. Tris(diethylamino)cyclopropenylium thiocyanate
  8774. Tris(diethylamino)cyclopropenylium trichlorostannate(II)
  8775. Tris(diethylamino)cyclopropenylium trifluoromethanesulfonate
  8776. Tris(diethylcarbamodithioato)(1,10-phenanthroline) europium(III)
  8777. Tris(diethylcarbamodithioato)(1,10-phenanthroline) gadolinium(III)
  8778. Tris(diethylcarbamodithioato)(1,10-phenanthroline) samarium(III)
  8779. tris(diethylcarbamodithioato-κS,κS')(1,10-phenanthroline-κN(1),κN(10))dysprosium
  8780. tris(diethylcarbamodithioato-κS,κS')(1,10-phenanthroline-κN(1),κN(10))holmium
  8781. tris(diethylcarbamodithioato-κS,κS')(1,10-phenanthroline-κN(1),κN(10))lutetium
  8782. tris(diethylcarbamodithioato-κS,κS')(1,10-phenanthroline-κN(1),κN(10))thulium
  8783. tris(diethylcarbamodithioato-κS,κS')(1,10-phenanthroline-κN(1),κN(10))ytterbium
  8784. tris(diethylcarbamodithioato-κS,κS')(1,10-phenanthroline-κN1,κN10)erbium
  8785. tris(diethylcarbamodithioato-κS,κS')(1,10-phenanthroline-κN1,κN10)europium
  8786. tris(diethylcarbamodithioato-κS,κS')(1,10-phenanthroline-κN1,κN10)lanthanum
  8787. tris(diethylcarbamodithioato-κS,κS')(1,10-phenanthroline-κN1,κN10)praseodymium
  8788. tris(diethylcarbamodithioato-κS,κS')(1,10-phenanthroline-κN1,κN10)terbium
  8789. tris(diethylphosphinoborine)
  8790. Tris(dihexylamino)cyclopropenylium bis(trifluoromethanesulfonyl)imide
  8791. Tris(dihexylamino)cyclopropenylium dicyanamide
  8792. Tris(dimethylamino)cyclopropenylium bis(trifluoromethanesulfonyl)imide
  8793. Tris(dimethylamino)cyclopropenylium dicyanamide
  8794. tris(dimethylammonium) terbium(III) chloride
  8795. tris(dimethylcarbamodithioato-κS,κS')(1,10-phenanthroline-κN(1),κN(10))lanthanum
  8796. tris(dimethylcarbamodithioato-κS,κS')(1,10-phenanthroline-κN(1),κN(10))neodymium
  8797. tris(dimethylcarbamodithioato-κS,κS')(1,10-phenanthroline-κN(1),κN(10))praseodymium
  8798. tris(dimethylcarbamodithioato-κS,κS')(1,10-phenanthroline-κN(1),κN(10))samarium
  8799. Tris(dimethylphosphinodimethylborine)
  8800. Tris(dipentylamino)cyclopropenylium bis(trifluoromethanesulfonyl)imide
  8801. Tris(dipentylamino)cyclopropenylium chloride