DETHERM database directory

Systems with 2 component(s): 120001 - 130000

The given links are permalinks. The order of the systems and the system number instead can change anytime.

  1. nonanoic acid/2-propanone
  2. nonanoic acid/3-methylpentane
  3. nonanoic acid/5-(1-propenyl)-1,3-benzodioxole
  4. nonanoic acid/5-(2-propenyl)-1,3-benzodioxole
  5. nonanoic acid/5-methyl-2-(1-methylethyl)phenol
  6. nonanoic acid/acetic acid
  7. nonanoic acid/acetic acid butyl ester
  8. nonanoic acid/acetic acid ethyl ester
  9. nonanoic acid/acetonitrile
  10. nonanoic acid/air
  11. nonanoic acid/benzene
  12. nonanoic acid/butanedioic acid dipropyl ester
  13. nonanoic acid/carbon dioxide
  14. nonanoic acid/decanoic acid
  15. nonanoic acid/dodecanoic acid
  16. nonanoic acid/dodecanoic acid sodium salt
  17. nonanoic acid/ethanedioic acid bis(3-methylbutyl) ester
  18. nonanoic acid/hexadecane
  19. nonanoic acid/methanol
  20. nonanoic acid/n-heptadecane
  21. nonanoic acid/naphthalene
  22. nonanoic acid/nitrobenzene
  23. nonanoic acid/nitroethane
  24. nonanoic acid/nitromethane
  25. nonanoic acid/nonanoic acid cesium salt
  26. nonanoic acid/nonanoic acid potassium salt
  27. nonanoic acid/nonanoic acid rubidium salt
  28. nonanoic acid/nonanoic acid sodium salt
  29. nonanoic acid/oxygen
  30. nonanoic acid/tetrachloromethane
  31. nonanoic acid/tetradecane
  32. nonanoic acid/trichloromethane
  33. nonanoic acid/urea
  34. nonanoic acid/water
  35. nonyl-β-D-glucopyranoside/water
  36. nonylbenzene/1,1,2,2-tetrabromoethane
  37. nonylbenzene/carbon dioxide
  38. nonylbenzene/cyclohexane
  39. nonylbenzene/dodecane
  40. nonylbenzene/ethane
  41. nonylbenzene/heptane
  42. nonylbenzene/hexadecane
  43. nonylbenzene/nonylcyclohexane
  44. nonylcyclohexane/benzene
  45. nonylcyclohexane/hexadecane
  46. nonylpropanedioic acid/benzene
  47. nonylpropanedioic acid/water
  48. nordalbergin/2-propanone
  49. nordalbergin/methanol
  50. nordalbergin/trichloromethane
  51. nordalbergin/water
  52. norleucine/1-butanol
  53. norleucine/2-propanone
  54. norleucine/ethanol
  55. norleucine/formamide
  56. norleucine/methanol
  57. norleucine/water
  58. north Louisiane lubricating oil (close cut)/pennsylvania steam-refined cylinder stock
  59. nystatin/methanol
  60. O-α-D-glucopyranosyl-(1->3)-β-D-fructofuranosyl α-D-glucopyranoside/water
  61. O-α-D-glucopyranosyl-(1->4)-O-α-D-glucopyranosyl-(1->4)-O-α-D-glucopyranosyl-(1->4)-O-α-D-glucopyranosyl-(1->4)-D-glucose/water
  62. O-α-D-glucopyranosyl-(1->4)-O-α-D-glucopyranosyl-(1->4)-O-α-D-glucopyranosyl-(1->4)-O-α-D-glucopyranosyl-(1->4)-D-glucose/water
  63. O-3-amino-3-deoxy-α-D-glucopyranosyl-(1->6)-O-(2,6-diamino-2,3,6-trideoxy-α-D-ribohexopyranosyl-(1->4))-2-deoxy-D-streptamine/ethanol
  64. O-3-amino-3-deoxy-α-D-glucopyranosyl-(1->6)-O-(2,6-diamino-2,3,6-trideoxy-α-D-ribohexopyranosyl-(1->4))-2-deoxy-D-streptamine/methanol
  65. O-3-amino-3-deoxy-α-D-glucopyranosyl-(1->6)-O-(2,6-diamino-2,3,6-trideoxy-α-D-ribohexopyranosyl-(1->4))-2-deoxy-D-streptamine/N,N-dimethylformamide
  66. O-3-amino-3-deoxy-α-D-glucopyranosyl-(1->6)-O-(2,6-diamino-2,3,6-trideoxy-α-D-ribohexopyranosyl-(1->4))-2-deoxy-D-streptamine/sulfinylbismethane
  67. O-phenyl chloromethanethioate/benzene
  68. octachlorodibenzofuran/water
  69. octachlorodibenzo[b,e][1,4]dioxin/water
  70. octacosane/(1-methylethyl)benzene
  71. octacosane/1,1'-biphenyl
  72. octacosane/1,2,4-trimethylbenzene
  73. octacosane/1,2-dichlorobenzene
  74. octacosane/1,2-dimethylbenzene
  75. octacosane/1-butanol
  76. octacosane/1-pentanol
  77. octacosane/1-propanol
  78. octacosane/2,2-dimethylbutane
  79. octacosane/2,3-dimethylbutane
  80. octacosane/2-butanone
  81. octacosane/2-ethoxy-2-methylbutane
  82. octacosane/2-ethoxy-2-methylpropane
  83. octacosane/2-furancarboxaldehyde
  84. octacosane/2-Hydroxy-1,3-propanediyl dinonanoate
  85. octacosane/2-methyl-2-propanol
  86. octacosane/2-methylbutane
  87. octacosane/2-methylnonane
  88. octacosane/2-methylpropanal
  89. octacosane/2-propanol
  90. octacosane/2-propanone
  91. octacosane/3-methylpentane
  92. octacosane/3-pentanone
  93. octacosane/9H-fluorene
  94. octacosane/9H-xanthene
  95. octacosane/acetic acid
  96. octacosane/acetic acid methyl ester
  97. octacosane/argon
  98. octacosane/benzene
  99. octacosane/bromoethane
  100. octacosane/carbon monoxide
  101. octacosane/cyclododecanone
  102. octacosane/dichloromethane
  103. octacosane/ethane
  104. octacosane/ethanol
  105. octacosane/ethene
  106. octacosane/formic acid
  107. octacosane/helium
  108. octacosane/krypton
  109. octacosane/methane
  110. octacosane/methanol
  111. octacosane/N,N-dimethylformamide
  112. octacosane/n-tetracosane
  113. octacosane/naphthalene
  114. octacosane/nitrogen
  115. octacosane/nonacosane
  116. octacosane/oxygen
  117. octacosane/petroleum ether
  118. octacosane/phenanthrene
  119. octacosane/propane
  120. octacosane/sulfinylbismethane
  121. octacosane/triacontane
  122. octacosane/trichloromethane
  123. octacosane/tritriacontane
  124. octacosane/water
  125. octacosane/xenon
  126. octacosanoic acid/triacontanoic acid
  127. octadecafluorodecahydronaphthalene/1,1,1,2,2,3,3,4,5,5,5-undecafluoro-4-(trifluoromethyl)pentane
  128. octadecafluorodecahydronaphthalene/1-heptene
  129. octadecafluorodecahydronaphthalene/1-heptene
  130. octadecafluorodecahydronaphthalene/1-hexene
  131. octadecafluorodecahydronaphthalene/1-hexene
  132. octadecafluorodecahydronaphthalene/1-methyl-3-octyl-1H-imidazolium salt with 1,1,2,2,3,3,4,4,4-nonafluoro-1-butanesulfonic acid (1:1)
  133. octadecafluorodecahydronaphthalene/1-propanol
  134. octadecafluorodecahydronaphthalene/2-butanone
  135. octadecafluorodecahydronaphthalene/2-propanol
  136. octadecafluorodecahydronaphthalene/2-propanone
  137. octadecafluorodecahydronaphthalene/ammonia
  138. octadecafluorodecahydronaphthalene/benzene
  139. octadecafluorodecahydronaphthalene/dodecafluoropentane
  140. octadecafluorodecahydronaphthalene/dodecafluoropentane
  141. octadecafluorodecahydronaphthalene/ethanol
  142. octadecafluorodecahydronaphthalene/methanol
  143. octadecafluorodecahydronaphthalene/nitrogen
  144. octadecafluorodecahydronaphthalene/oxygen
  145. octadecafluorodecahydronaphthalene/oxygen
  146. octadecafluorodecahydronaphthalene/tetradecafluorohexane
  147. octadecafluorodecahydronaphthalene/tetradecafluorohexane
  148. octadecafluorodecahydronaphthalene/tetrafluoromethane
  149. octadecafluorodecahydronaphthalene/undecafluoro(trifluoromethyl)cyclohexane
  150. octadecafluorodecahydronaphthalene/undecafluoro(trifluoromethyl)cyclohexane
  151. octadecafluorodecahydronaphthalene/water
  152. octadecafluorooctane/1,1,1,2,2,3,3,4,5,5,5-undecafluoro-4-(trifluoromethyl)pentane
  153. octadecafluorooctane/1-ethoxybutane
  154. octadecafluorooctane/1-methoxybutane
  155. octadecafluorooctane/1-methyl-3-octyl-1H-imidazolium salt with 1,1,2,2,3,3,4,4,4-nonafluoro-1-butanesulfonic acid (1:1)
  156. octadecafluorooctane/2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-1-heptanol
  157. octadecafluorooctane/2,2,4-trimethylpentane
  158. octadecafluorooctane/2,3,4-trimethylpentane
  159. octadecafluorooctane/2,5-dimethylhexane
  160. octadecafluorooctane/carbon monoxide
  161. octadecafluorooctane/dichloromethane
  162. octadecafluorooctane/ethane
  163. octadecafluorooctane/ethene
  164. octadecafluorooctane/hexafluoroethane
  165. octadecafluorooctane/hydrofluoric acid
  166. octadecafluorooctane/methane
  167. octadecafluorooctane/nitrogen
  168. octadecafluorooctane/oxygen
  169. octadecafluorooctane/tetrachloromethane
  170. octadecafluorooctane/tetradecane
  171. octadecafluorooctane/tetrafluoromethane
  172. octadecafluorooctane/trichloromethane
  173. octadecafluorooctane/trichloromethane-d
  174. octadecafluorooctane/tridecane
  175. octadecafluorooctane/trifluoroacetic acid
  176. octadecafluorooctane/trifluoroacetonitrile
  177. octadecafluorooctane/trihexyltetradecylphosphonium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  178. octadecafluorooctane/water
  179. octadecafluorooctane/xenon
  180. Octadecanal/acetonitrile
  181. Octadecanal/nitromethane
  182. octadecanamide/1-butanol
  183. octadecanamide/2-butanone
  184. octadecanamide/2-propanol
  185. octadecanamide/2-propanone
  186. octadecanamide/acetic acid ethyl ester
  187. octadecanamide/acetonitrile
  188. octadecanamide/benzene
  189. octadecanamide/hexadecanoic acid
  190. octadecanamide/methanol
  191. octadecanamide/nitroethane
  192. octadecanamide/octadecanoic acid potassium salt
  193. octadecanamide/octadecanoic acid sodium salt
  194. octadecanamide/perchloric acid sodium salt
  195. octadecanamide/tetrachloromethane
  196. octadecanamide/thiocyanic acid potassium salt
  197. octadecanamide/thiocyanic acid sodium salt
  198. octadecanamide/trifluoroacetic acid sodium salt
  199. octadecane/±-2-pentanol
  200. octadecane/(1-methylethyl)benzene
  201. octadecane/(2E)-2-pentene
  202. octadecane/(4E)-1,4-hexadiene
  203. octadecane/1,1'-bicyclohexyl
  204. octadecane/1,1'-biphenyl
  205. octadecane/1,1'-oxybisoctane
  206. octadecane/1,1,1,3,3,3-d6-2-propanone
  207. octadecane/1,1,1-trichloroethane
  208. octadecane/1,2-benzenedicarboxylic acid dinonyl ester
  209. octadecane/1,2-dihydroacenaphthylene
  210. octadecane/1,2-dimethylbenzene
  211. octadecane/1-butanol
  212. octadecane/1-methylnaphthalene
  213. octadecane/1-pentanol
  214. octadecane/1-propanol
  215. octadecane/2,2-dimethylbutane
  216. octadecane/2,3-dimethylbutane
  217. octadecane/2-butanol
  218. octadecane/2-butanone
  219. octadecane/2-ethoxy-2-methylbutane
  220. octadecane/2-ethoxy-2-methylpropane
  221. octadecane/2-furancarboxaldehyde
  222. octadecane/2-methyl-1-propanol
  223. octadecane/2-methyl-2-butanol
  224. octadecane/2-methyl-2-propanol
  225. octadecane/2-methylbutane
  226. octadecane/2-propanol
  227. octadecane/2-propanone
  228. octadecane/3-methylpentane
  229. octadecane/3-pentanone
  230. octadecane/acetic acid methyl ester
  231. octadecane/acetonitrile
  232. octadecane/ammonia
  233. octadecane/benzenamine
  234. octadecane/benzene
  235. octadecane/carbon disulfide
  236. octadecane/carbon monoxide
  237. octadecane/carbonic acid dimethyl ester
  238. octadecane/dichloromethane
  239. octadecane/dihydro-2(3H)-furanone
  240. octadecane/docosane
  241. octadecane/ethane
  242. octadecane/ethanol
  243. octadecane/ethene
  244. octadecane/ethenetetracarboxylic acid tetraethyl ester
  245. octadecane/heneicosane
  246. octadecane/hexadecanoic acid ethyl ester
  247. octadecane/methane
  248. octadecane/methanol
  249. octadecane/N,N-dimethylformamide
  250. octadecane/n-heptadecane
  251. octadecane/naphthalene
  252. octadecane/nitroethane
  253. octadecane/nitromethane
  254. octadecane/oxygen
  255. octadecane/pentadecane
  256. octadecane/phenanthrene
  257. octadecane/poly(1-phenylethylene)
  258. octadecane/propane
  259. octadecane/sea water
  260. octadecane/sulfinylbismethane
  261. octadecane/tetradecane
  262. octadecane/trichloroethene
  263. octadecane/trichloromethane
  264. octadecane/tricosane
  265. octadecane/tridecane
  266. octadecane/tridecanoic acid
  267. octadecane/water
  268. octadecanedioic acid diethyl ester/benzene
  269. octadecanenitrile/1-butanol
  270. octadecanenitrile/2-butanone
  271. octadecanenitrile/2-propanol
  272. octadecanenitrile/2-propanone
  273. octadecanenitrile/acetic acid
  274. octadecanenitrile/acetonitrile
  275. octadecanenitrile/benzene
  276. octadecanenitrile/methanol
  277. octadecanenitrile/nitroethane
  278. octadecanenitrile/trichloromethane
  279. octadecanoic acid 1,2,3-propanetriyl ester/(9Z,12Z)-9,12-octadecadienoic acid
  280. octadecanoic acid 1,2,3-propanetriyl ester/1,1'-oxybisethane
  281. octadecanoic acid 1,2,3-propanetriyl ester/2-propanone
  282. octadecanoic acid 1,2,3-propanetriyl ester/2-propanone
  283. octadecanoic acid 1,2,3-propanetriyl ester/2-propanone
  284. octadecanoic acid 1,2,3-propanetriyl ester/3-chloro-1,2-propanediol
  285. octadecanoic acid 1,2,3-propanetriyl ester/4-(1,1-dimethylpropyl)phenol
  286. octadecanoic acid 1,2,3-propanetriyl ester/5-methyl-2-(1-methylethyl)phenol
  287. octadecanoic acid 1,2,3-propanetriyl ester/acetonitrile
  288. octadecanoic acid 1,2,3-propanetriyl ester/benzene
  289. octadecanoic acid 1,2,3-propanetriyl ester/benzene
  290. octadecanoic acid 1,2,3-propanetriyl ester/benzene
  291. octadecanoic acid 1,2,3-propanetriyl ester/benzene
  292. octadecanoic acid 1,2,3-propanetriyl ester/benzoic acid
  293. octadecanoic acid 1,2,3-propanetriyl ester/carbon disulfide
  294. octadecanoic acid 1,2,3-propanetriyl ester/cottonseed oil
  295. octadecanoic acid 1,2,3-propanetriyl ester/cottonseed oil
  296. octadecanoic acid 1,2,3-propanetriyl ester/cottonseed oil
  297. octadecanoic acid 1,2,3-propanetriyl ester/ethanol
  298. octadecanoic acid 1,2,3-propanetriyl ester/hentriacontane
  299. octadecanoic acid 1,2,3-propanetriyl ester/hexadecanoic acid
  300. octadecanoic acid 1,2,3-propanetriyl ester/hexadecanoic acid 1,2,3-propanetriyl ester
  301. octadecanoic acid 1,2,3-propanetriyl ester/nitromethane
  302. octadecanoic acid 1,2,3-propanetriyl ester/octadecanoic acid
  303. octadecanoic acid 1,2,3-propanetriyl ester/oxiranemethanol
  304. octadecanoic acid 1,2,3-propanetriyl ester/propane
  305. octadecanoic acid 1,2,3-propanetriyl ester/quinoline
  306. octadecanoic acid 1,2,3-propanetriyl ester/sulfur dioxide
  307. octadecanoic acid 1,2,3-propanetriyl ester/sunflower oil
  308. octadecanoic acid 1,2,3-propanetriyl ester/tetrachloromethane
  309. octadecanoic acid 1,2,3-propanetriyl ester/trichloromethane
  310. octadecanoic acid 1,2,3-propanetriyl ester/trichloromethane
  311. octadecanoic acid 1,2,3-propanetriyl ester/trichloromethane
  312. octadecanoic acid 1,2,3-propanetriyl ester/trichloromethane
  313. octadecanoic acid 1,2-ethanediyl ester/ethanol
  314. octadecanoic acid 1,2-propanetriyl ester/ethanol
  315. octadecanoic acid 1,3-propanediyl ester/ethanol
  316. octadecanoic acid 1-[[(1-oxodecyl)oxy]methyl]-1,2-ethanediyl ester/2-propanone
  317. octadecanoic acid 1-[[(1-oxodecyl)oxy]methyl]-1,2-ethanediyl ester/ethanol
  318. octadecanoic acid 1-[[(1-oxohexadecyl)oxy]methyl]-1,2-ethanediyl ester/2-propanone
  319. octadecanoic acid 1-[[(1-oxohexadecyl)oxy]methyl]-1,2-ethanediyl ester/ethanol
  320. octadecanoic acid 1-[[(oxotetradecyl)oxy]methyl]-1,2-ethanediyl ester/ethanol
  321. octadecanoic acid 2,3-dihydroxypropyl ester/(1'S-trans)-7-chloro-2',4,6-trimethoxy-6'-methylspiro[benzofuran-2(3H),1'-(2)cyclohexene]-3,4'-dione
  322. octadecanoic acid 2,3-dihydroxypropyl ester/2-propanol
  323. octadecanoic acid 2,3-dihydroxypropyl ester/2-propanone
  324. octadecanoic acid 2,3-dihydroxypropyl ester/carbon dioxide
  325. octadecanoic acid 2,3-dihydroxypropyl ester/ethanol
  326. octadecanoic acid 2,3-dihydroxypropyl ester/methanol
  327. octadecanoic acid 2,3-dihydroxypropyl ester/nitromethane
  328. octadecanoic acid 2,3-dihydroxypropyl ester/water
  329. octadecanoic acid 2-((1-oxohexadecyl)oxy)-1-(((1-oxohexadecyl)oxy)methyl)ethyl ester/octadecanoic acid 1,2,3-propanetriyl ester
  330. octadecanoic acid 2-((1-oxohexadecyl)oxy)-3-((1-oxotetradecyl)oxy)propyl ester/2-propanone
  331. octadecanoic acid 2-((1-oxohexadecyl)oxy)-3-((1-oxotetradecyl)oxy)propyl ester/ethanol
  332. octadecanoic acid 2-((1-oxohexadecyl)oxy)-3-((1-oxotetradecyl)oxy)propyl ester/petroleum ether
  333. octadecanoic acid 2-(4-bromophenyl)-2-oxoethyl ester/ethanol
  334. octadecanoic acid 2-(4-chlorophenyl)-2-oxoethyl ester/ethanol
  335. octadecanoic acid 2-hydroxy-1,3-propanediyl ester/acetonitrile
  336. octadecanoic acid 2-hydroxy-1,3-propanediyl ester/nitromethane
  337. octadecanoic acid 2-hydroxyethyl ester/1,1,1-trichloroethane
  338. octadecanoic acid 2-hydroxyethyl ester/1,1,2-trichloro-1,2,2-trifluoroethane
  339. octadecanoic acid 2-hydroxyethyl ester/acetic acid butyl ester
  340. octadecanoic acid 2-hydroxyethyl ester/acetic acid ethyl ester
  341. octadecanoic acid 2-hydroxyethyl ester/acetic acid hexyl ester
  342. octadecanoic acid 2-hydroxyethyl ester/acetic acid pentyl ester
  343. octadecanoic acid 2-hydroxyethyl ester/ethanol
  344. octadecanoic acid 2-[(1-oxodecyl)oxy]-1,3-propanediyl ester/2-propanone
  345. octadecanoic acid 2-[(1-oxodecyl)oxy]-1,3-propanediyl ester/ethanol
  346. octadecanoic acid 2-[(1-oxododecyl)oxy]-1,3-propanediyl ester/petroleum ether
  347. octadecanoic acid 2-[(1-oxohexadecyl)oxy]-1,3-propanediyl ester/2-propanone
  348. octadecanoic acid 2-[(1-oxohexadecyl)oxy]-1,3-propanediyl ester/ethanol
  349. octadecanoic acid 2-[(1-oxotetradecyl)oxy]-1,3-propanediyl ester/ethanol
  350. octadecanoic acid 3-((1-oxohexadecyl)oxy)-2-((1-oxotetradecyl)oxy)propyl ester/1,1'-oxybisethane
  351. octadecanoic acid 3-((1-oxohexadecyl)oxy)-2-((1-oxotetradecyl)oxy)propyl ester/2-propanone
  352. octadecanoic acid 3-((1-oxohexadecyl)oxy)-2-((1-oxotetradecyl)oxy)propyl ester/ethanol
  353. octadecanoic acid 3-((1-oxohexadecyl)oxy)-2-((1-oxotetradecyl)oxy)propyl ester/petroleum ether
  354. octadecanoic acid aluminum salt/2-propanone
  355. octadecanoic acid aluminum salt/benzene
  356. octadecanoic acid aluminum salt/methanol
  357. octadecanoic acid ammonium salt/1,1'-oxybisethane
  358. octadecanoic acid ammonium salt/2-propanol
  359. octadecanoic acid ammonium salt/2-propanone
  360. octadecanoic acid ammonium salt/ethanol
  361. octadecanoic acid ammonium salt/trichloroethene
  362. octadecanoic acid anhydride/ethanol
  363. octadecanoic acid barium salt/1-pentanol
  364. octadecanoic acid barium salt/water
  365. octadecanoic acid beryllium salt/methanol
  366. octadecanoic acid butyl ester/2-propanone
  367. octadecanoic acid butyl ester/acetic acid ethyl ester
  368. octadecanoic acid butyl ester/acetonitrile
  369. octadecanoic acid butyl ester/air
  370. octadecanoic acid butyl ester/benzene
  371. octadecanoic acid butyl ester/carbon dioxide
  372. octadecanoic acid butyl ester/nitromethane
  373. octadecanoic acid butyl ester/poly(1-phenylethylene)
  374. octadecanoic acid calcium salt/water
  375. octadecanoic acid cerium(3+) salt/1,1'-oxybisethane
  376. octadecanoic acid compd. with pentadecanoic acid (1:1)/octadecanoic acid
  377. octadecanoic acid copper(2+) salt/water
  378. octadecanoic acid ethenyl ester/carbon dioxide
  379. octadecanoic acid ethyl ester/(9Z)-9-octadecenoic acid ethyl ester
  380. octadecanoic acid ethyl ester/(9Z,12Z)-9,12-octadecadienoic acid ethyl ester
  381. octadecanoic acid ethyl ester/1,1'-biphenyl
  382. octadecanoic acid ethyl ester/1,1'-methylenebis((1-methylethyl)benzene)
  383. octadecanoic acid ethyl ester/1,1,2,2-tetrabromoethane
  384. octadecanoic acid ethyl ester/1,4-dioxane
  385. octadecanoic acid ethyl ester/1-(phenylmethyl)naphthalene
  386. octadecanoic acid ethyl ester/1-octadecanol
  387. octadecanoic acid ethyl ester/2,2,4-trimethylpentane
  388. octadecanoic acid ethyl ester/2-propanone
  389. octadecanoic acid ethyl ester/3-Methylbutyl dodecanoate
  390. octadecanoic acid ethyl ester/3-Methylbutyl nonanoate
  391. octadecanoic acid ethyl ester/acetic acid ethyl ester
  392. octadecanoic acid ethyl ester/acetonitrile
  393. octadecanoic acid ethyl ester/benzene
  394. octadecanoic acid ethyl ester/carbon dioxide
  395. octadecanoic acid ethyl ester/diphenylmethanone
  396. octadecanoic acid ethyl ester/dodecane
  397. octadecanoic acid ethyl ester/dodecanoic acid
  398. octadecanoic acid ethyl ester/dotriacontane
  399. octadecanoic acid ethyl ester/ethanol
  400. octadecanoic acid ethyl ester/heptadecanoic acid ethyl ester
  401. octadecanoic acid ethyl ester/heptane
  402. octadecanoic acid ethyl ester/hexadecane
  403. octadecanoic acid ethyl ester/hexadecanoic acid ethyl ester
  404. octadecanoic acid ethyl ester/hexadecanoic acid methyl ester
  405. octadecanoic acid ethyl ester/hexanedioic acid
  406. octadecanoic acid ethyl ester/n-tetracosane
  407. octadecanoic acid ethyl ester/nitromethane
  408. octadecanoic acid ethyl ester/nonanedioic acid
  409. octadecanoic acid ethyl ester/octacosane
  410. octadecanoic acid ethyl ester/octadecanoic acid
  411. octadecanoic acid ethyl ester/octane
  412. octadecanoic acid ethyl ester/octanedioic acid
  413. octadecanoic acid ethyl ester/tetrachloromethane
  414. octadecanoic acid ethyl ester/tetradecanoic acid
  415. octadecanoic acid ethyl ester/tetradecanoic acid ethyl ester
  416. octadecanoic acid ethyl ester/water
  417. octadecanoic acid hexadecyl ester/1,1'-oxybisethane
  418. octadecanoic acid hexadecyl ester/acetic acid
  419. octadecanoic acid hexadecyl ester/acetonitrile
  420. octadecanoic acid hexadecyl ester/ethanol
  421. octadecanoic acid hexadecyl ester/nitromethane
  422. octadecanoic acid hexadecyl ester/propane
  423. octadecanoic acid lead(2+) salt/1,1'-oxybisethane
  424. octadecanoic acid lead(2+) salt/acetic acid ethyl ester
  425. octadecanoic acid lead(2+) salt/benzene
  426. octadecanoic acid lead(2+) salt/ethanol
  427. octadecanoic acid lead(2+) salt/methanol
  428. octadecanoic acid lead(2+) salt/water
  429. octadecanoic acid lithium salt/1,1'-oxybisethane
  430. octadecanoic acid lithium salt/1-pentanol
  431. octadecanoic acid lithium salt/2-propanone
  432. octadecanoic acid lithium salt/acetic acid methyl ester
  433. octadecanoic acid lithium salt/acetic acid pentyl ester
  434. octadecanoic acid lithium salt/ethanol
  435. octadecanoic acid lithium salt/methanol
  436. octadecanoic acid lithium salt/trichloromethane
  437. octadecanoic acid lithium salt/water
  438. octadecanoic acid magnesium salt/1,1'-oxybisethane
  439. octadecanoic acid magnesium salt/1-pentanol
  440. octadecanoic acid magnesium salt/acetic acid pentyl ester
  441. octadecanoic acid magnesium salt/ethanol
  442. octadecanoic acid magnesium salt/methanol
  443. octadecanoic acid magnesium salt/water
  444. octadecanoic acid mercury(2+) salt/formamide
  445. octadecanoic acid mercury(2+) salt/N,N-dimethylformamide
  446. octadecanoic acid mercury(2+) salt/trichloromethane
  447. octadecanoic acid mercury(2+) salt/water
  448. octadecanoic acid methyl ester/(9Z)-9-octadecenoic acid methyl ester
  449. octadecanoic acid methyl ester/(9Z,12Z)-9,12-octadecadienoic acid methyl ester
  450. octadecanoic acid methyl ester/1,1'-biphenyl
  451. octadecanoic acid methyl ester/1,2,3-propanetriol
  452. octadecanoic acid methyl ester/1-butanol
  453. octadecanoic acid methyl ester/1-octadecanol
  454. octadecanoic acid methyl ester/2-butanone
  455. octadecanoic acid methyl ester/2-propanone
  456. octadecanoic acid methyl ester/acetic acid
  457. octadecanoic acid methyl ester/acetic acid butyl ester
  458. octadecanoic acid methyl ester/acetic acid ethyl ester
  459. octadecanoic acid methyl ester/acetonitrile
  460. octadecanoic acid methyl ester/benzene
  461. octadecanoic acid methyl ester/carbon dioxide
  462. octadecanoic acid methyl ester/docosanoic acid methyl ester
  463. octadecanoic acid methyl ester/dodecanoic acid
  464. octadecanoic acid methyl ester/dotriacontane
  465. octadecanoic acid methyl ester/eicosane
  466. octadecanoic acid methyl ester/ethane
  467. octadecanoic acid methyl ester/heptadecanoic acid methyl ester
  468. octadecanoic acid methyl ester/hexadecane
  469. octadecanoic acid methyl ester/hexanedioic acid
  470. octadecanoic acid methyl ester/methanol
  471. octadecanoic acid methyl ester/n-tetracosane
  472. octadecanoic acid methyl ester/naphthalene
  473. octadecanoic acid methyl ester/nitromethane
  474. octadecanoic acid methyl ester/octacosane
  475. octadecanoic acid methyl ester/octadecane
  476. octadecanoic acid methyl ester/octadecanoic acid
  477. octadecanoic acid methyl ester/octanoic acid 2,3-dihydroxypropyl ester
  478. octadecanoic acid methyl ester/propane
  479. octadecanoic acid methyl ester/sulfur dioxide
  480. octadecanoic acid methyl ester/tetrachloromethane
  481. octadecanoic acid methyl ester/tetradecanoic acid methyl ester
  482. octadecanoic acid methyl ester/trichloromethane
  483. octadecanoic acid methyl ester/water
  484. octadecanoic acid monoester with 1,2-propanediol/ethanol
  485. octadecanoic acid monoester with 1,3-propanediol/ethanol
  486. octadecanoic acid phenylmethyl ester/ethanol
  487. octadecanoic acid potassium salt/ethanol
  488. octadecanoic acid propyl ester/2-propanone
  489. octadecanoic acid propyl ester/acetonitrile
  490. octadecanoic acid propyl ester/benzene
  491. octadecanoic acid silver(1+) salt/1,1'-oxybisethane
  492. octadecanoic acid silver(1+) salt/1-butanol
  493. octadecanoic acid silver(1+) salt/2-butanone
  494. octadecanoic acid silver(1+) salt/2-hexanone
  495. octadecanoic acid silver(1+) salt/2-propanone
  496. octadecanoic acid silver(1+) salt/3-methyl-2-butanol
  497. octadecanoic acid silver(1+) salt/ethanol
  498. octadecanoic acid silver(1+) salt/methanol
  499. octadecanoic acid silver(1+) salt/water
  500. octadecanoic acid sodium salt/2-methylpropanoic acid sodium salt
  501. octadecanoic acid thallium(1+) salt/1,1'-oxybisethane
  502. octadecanoic acid thallium(1+) salt/2-propanone
  503. octadecanoic acid thallium(1+) salt/ethanol
  504. octadecanoic acid thallium(1+) salt/water
  505. octadecanoic acid/α-phenylbenzenemethanol
  506. octadecanoic acid/(1,1'-biphenyl)-4,4'-diamine
  507. octadecanoic acid/(9Z,12Z)-9,12-octadecadienoic acid
  508. octadecanoic acid/1,1'-biphenyl
  509. octadecanoic acid/1,1'-oxybisethane
  510. octadecanoic acid/1,1':2',1''-terphenyl
  511. octadecanoic acid/1,1':3',1''-terphenyl
  512. octadecanoic acid/1,1,1-trichloroethane
  513. octadecanoic acid/1,1,2,2-tetrachloro-1,2-difluoroethane
  514. octadecanoic acid/1,1,2-trichloro-1,2,2-trifluoroethane
  515. octadecanoic acid/1,2-dimethylbenzene
  516. octadecanoic acid/1-butanol
  517. octadecanoic acid/1-hexene
  518. octadecanoic acid/1-propanol
  519. octadecanoic acid/2,2-dimethylbutane
  520. octadecanoic acid/2,3-dimethylbutane
  521. octadecanoic acid/2-butanol
  522. octadecanoic acid/2-butanone
  523. octadecanoic acid/2-ethyl-4-prop-2-enylphenol
  524. octadecanoic acid/2-furancarboxaldehyde
  525. octadecanoic acid/2-hydroxy-N,N,N-trimethylethanaminium chloride
  526. octadecanoic acid/2-hydroxybenzoic acid
  527. octadecanoic acid/2-methylbutane
  528. octadecanoic acid/2-naphthalenamine
  529. octadecanoic acid/2-nonadecanone
  530. octadecanoic acid/2-propanol
  531. octadecanoic acid/2-propanone
  532. octadecanoic acid/3-chloro-1,2-propanediol
  533. octadecanoic acid/3-methyl-2-butanol
  534. octadecanoic acid/5-methyl-2-(1-methylethyl)phenol
  535. octadecanoic acid/acetamide
  536. octadecanoic acid/acetic acid
  537. octadecanoic acid/acetic acid pentyl ester
  538. octadecanoic acid/acetonitrile
  539. octadecanoic acid/benzene
  540. octadecanoic acid/benzoic acid
  541. octadecanoic acid/carbon disulfide
  542. octadecanoic acid/dichloromethane
  543. octadecanoic acid/ethane
  544. octadecanoic acid/ethanol
  545. octadecanoic acid/ethene
  546. octadecanoic acid/hexadecanoic acid ethyl ester
  547. octadecanoic acid/hydrogen sulfide (H2S)
  548. octadecanoic acid/iodine
  549. octadecanoic acid/methanol
  550. octadecanoic acid/N,N,N-trimethylmethanaminium chloride
  551. octadecanoic acid/N,N,N-tripropyl-1-propanaminium chloride
  552. octadecanoic acid/N,N-dimethylformamide
  553. octadecanoic acid/n-tetracosane
  554. octadecanoic acid/nitrobenzene
  555. octadecanoic acid/nitroethane
  556. octadecanoic acid/nitromethane
  557. octadecanoic acid/nonadecanoic acid
  558. octadecanoic acid/octadecanoic acid compd. with hexadecanoic acid (1:1)
  559. octadecanoic acid/octadecanoic acid compd. with tetradecanoic acid (1:2)
  560. octadecanoic acid/octadecanoic acid sodium salt
  561. octadecanoic acid/phosphoric acid triethyl ester
  562. octadecanoic acid/propane
  563. octadecanoic acid/sulfinylbismethane
  564. octadecanoic acid/sulfur dioxide
  565. octadecanoic acid/trichloroethene
  566. octadecanoic acid/trichloromethane
  567. octadecanoic acid/water
  568. octadecanol/octadecanoic acid zinc salt
  569. octadecenoic acid/ethanol
  570. octadecylbenzene/2-furancarboxaldehyde
  571. octadecylbenzene/propane
  572. octadecylcyclohexane/propane
  573. octafluorocyclobutane/1,1,2,2,3,3,4,4,4-nonafluoro-N,N-bis(nonafluorobutyl)-1-butanamine
  574. octafluorocyclobutane/1,1,2,2-tetrafluoroethane
  575. octafluorocyclobutane/1,1,2,3,3,3-hexafluoro-1-propene
  576. octafluorocyclobutane/1-chloro-1,1,2,2-tetrafluoroethane
  577. octafluorocyclobutane/1-chloro-1,1-difluoroethane
  578. octafluorocyclobutane/1-methyl-2-pyrrolidinone
  579. octafluorocyclobutane/2-chloro-1,1,1,2-tetrafluoroethane
  580. octafluorocyclobutane/2-propanone
  581. octafluorocyclobutane/ammonia
  582. octafluorocyclobutane/benzene
  583. octafluorocyclobutane/carbon disulfide
  584. octafluorocyclobutane/chlorodifluoromethane
  585. octafluorocyclobutane/dichlorodifluoromethane
  586. octafluorocyclobutane/dichlorofluoromethane
  587. octafluorocyclobutane/hydrofluoric acid
  588. octafluorocyclobutane/octafluoropropane
  589. octafluorocyclobutane/propane
  590. octafluorocyclobutane/tetrafluoroethene
  591. octafluorocyclobutane/trifluoro(trifluoromethyl)oxirane
  592. octafluorocyclobutane/water
  593. octafluoronaphthalene/benzene
  594. octafluoronaphthalene/hexafluorobenzene
  595. octafluoronaphthalene/naphthalene
  596. octafluoropropane/1,1,1,2-tetrafluoroethane
  597. octafluoropropane/ammonia
  598. octafluoropropane/hydrofluoric acid
  599. octafluoropropane/nitrogen
  600. octafluoropropane/water
  601. octahydro-1,3,5,7-tetranitro-1,3,5,7-tetrazocine/1-methyl-2-pyrrolidinone
  602. octahydro-1,3,5,7-tetranitro-1,3,5,7-tetrazocine/2-propanone
  603. octahydro-1,3,5,7-tetranitro-1,3,5,7-tetrazocine/acetonitrile
  604. octahydro-1,3,5,7-tetranitro-1,3,5,7-tetrazocine/dihydro-2(3H)-furanone
  605. octahydro-1,3,5,7-tetranitro-1,3,5,7-tetrazocine/N,N-dimethylformamide
  606. octahydro-1,3,5,7-tetranitro-1,3,5,7-tetrazocine/phosphoric acid triethyl ester
  607. octahydro-1,3,5,7-tetranitro-1,3,5,7-tetrazocine/sulfinylbismethane
  608. octahydro-1,3,5,7-tetranitro-1,3,5,7-tetrazocine/water
  609. octahydro-1H-indene/(17β)-17-(1-oxopropyl)androst-4-en-3-one
  610. octahydro-3,5,1,7-[1,2,3,4]butanetetraylnaphthalen-1(2H)-ol/methanol
  611. octahydroazocine/heptane
  612. octahydroazocine/water
  613. octahydrophenazine/trichloroethene
  614. octan-1-amine hydrochloride/water
  615. octanal/1-butanol
  616. octanal/1-butyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  617. octanal/1-ethyl-3-methyl-1H-imidazolium salt with sulfuric acid monoethyl ester (1:1)
  618. octanal/1-hexyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  619. octanal/1-methyl-3-octyl-1H-imidazolium tetrafluoroborate(1-)
  620. octanal/ethanol
  621. octanal/formamide
  622. octanal/heptane
  623. octanal/hexadecane
  624. octanal/N,N,N-trimethyl-1-butanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  625. octanal/oxygen
  626. octanal/sea water
  627. octanal/water
  628. octanamide/1-butanol
  629. octanamide/2-butanone
  630. octanamide/2-propanol
  631. octanamide/2-propanone
  632. octanamide/acetonitrile
  633. octanamide/benzene
  634. octanamide/methanol
  635. octanamide/nitroethane
  636. octanamide/water
  637. octane/α,α-dimethylbenzenemethanol
  638. octane/α-hydro-ω-hydroxypoly(oxy(methyl-1,2-ethanediyl))
  639. octane/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)
  640. octane/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)
  641. octane/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)
  642. octane/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)
  643. octane/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)
  644. octane/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)
  645. octane/α-methyl-ω-methoxypoly(oxy-1,2-ethanediyl)
  646. octane/α-methyl-ω-methoxypoly(oxy-1,2-ethanediyl)
  647. octane/β-cyclodextrin
  648. octane/β-hydroxy-2,4,6-trimethylbenzenepropanol 2-methyl-2-propenoate homopolymer
  649. octane/±-2-pentanol
  650. octane/(1,3-dioxobutyl)ferrocene
  651. octane/(1-hydroxy-1-methylethyl)ferrocene
  652. octane/(16α,17β)-estra-1,3,5(10)-triene-3,16,17-triol
  653. octane/(17β)-17-(1-oxopropyl)androst-4-en-3-one
  654. octane/(17β)-17-hydroxy-17-methylandrost-4-en-3-one
  655. octane/(17β)-17-hydroxyandrost-4-en-3-one
  656. octane/(17β)-hydroxy-17-methylandrosta-1,4-dien-3-one
  657. octane/(17β)-hydroxyestr-4-en-3-one
  658. octane/(2,4-dihydroxyphenyl)phenylmethanone
  659. octane/(2E)-2-butene
  660. octane/(2E)-2-butenedioic acid diethyl ester
  661. octane/(2E)-2-octene
  662. octane/(2Z)-2-butene
  663. octane/(2Z)-2-butenedioic acid bis(2,2,6,6-tetramethyl-4-piperidinyl) ester
  664. octane/(2Z)-2-butenedioic acid diethyl ester
  665. octane/(2Z)-2-butenedioic acid dimethyl ester
  666. octane/(2Z)-2-octene
  667. octane/(3β)-cholest-5-en-3-ol tetradecanoate
  668. octane/(3β,25R)-spirost-5-en-3-ol
  669. octane/(3aR,4S,7R,7aS)-rel-octahydro-4,7-methano-1H-indene
  670. octane/(3E)-3-octene
  671. octane/(3S,4R)-1,1,2,2,3,4-hexafluorocyclobutane
  672. octane/(3Z)-3-octene
  673. octane/(4E)-4-octene
  674. octane/(4R)-1-methyl-4-(1-methylethenyl)cyclohexene
  675. octane/(4Z)-4-octene
  676. octane/(5α,17β)-17-hydroxy-17-methylandrostan-3-one
  677. octane/(5,6)fullerene-C60-Ih
  678. octane/(9Z)-9-octadecenoic acid
  679. octane/(9Z)-9-octadecenoic acid 1,2,3-propanetriyl ester
  680. octane/(dimethyl-trimethylsilyloxysilyl)oxy-dimethyl-trimethylsilyloxysilane
  681. octane/(E)-1,2-dichloroethene
  682. octane/(E)-diphenyldiazene
  683. octane/(Nitromethyl)oxirane
  684. octane/(OC-6-11)-sulfur fluoride (SF6)
  685. octane/(R/S)-2-hexanol
  686. octane/(S)-2-methyl-1-butanol
  687. octane/(Z)-poly(1-butene-1,4-diyl)
  688. octane/(Z)-poly(1-methyl-1-butene-1,4-diyl)
  689. octane/1(or 2)-methoxypropanol
  690. octane/1,1'-(methylenebis(oxy))bisethane
  691. octane/1,1'-(oxybis(2,1-ethanediyloxy))bisethene
  692. octane/1,1'-bicyclohexyl
  693. octane/1,1'-biphenyl
  694. octane/1,1'-oxybis(2,3,4,5,6-pentafluorobenzene)
  695. octane/1,1'-oxybis(2,3,5,6-tetrafluoro-4-(trifluoromethyl)benzene)
  696. octane/1,1'-oxybis(2-ethoxyethane)
  697. octane/1,1'-oxybis(2-methoxyethane)
  698. octane/1,1'-oxybisbutane
  699. octane/1,1'-oxybisethane
  700. octane/1,1'-oxybisoctane
  701. octane/1,1'-oxybispentane
  702. octane/1,1'-sulfinylbisethane
  703. octane/1,1'-sulfonylbisbenzene
  704. octane/1,1'-thiobisbutane
  705. octane/1,1'-thiobisethane
  706. octane/1,1'-thiobisheptane
  707. octane/1,1'-thiobisoctane
  708. octane/1,1'-[1,7-(2,6-dioxaheptane)]bis(4-dimethylaminopyridinium) bis(trifluoromethylsulfonyl)imide
  709. octane/1,1'-[oxybis(2,1-ethanediyloxy)]bisbutane
  710. octane/1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-heneicosafluorooctadecane
  711. octane/1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluorohexacosane
  712. octane/1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluorooctane
  713. octane/1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluoroheptane
  714. octane/1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-6-iodohexane
  715. octane/1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorododecane
  716. octane/1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorotetradecane
  717. octane/1,1,1,2,2,3,3,4,4-nonafluoro-4-methoxybutane
  718. octane/1,1,1,2,2,3,3,4,4-nonafluorohexane
  719. octane/1,1,1,2,2-pentafluoro-3-methoxypropane
  720. octane/1,1,1,3,3,3-d6-2-propanone
  721. octane/1,1,1,3,3,3-hexafluoro-2-propanol
  722. octane/1,1,1-trichloroethane
  723. octane/1,1,2,2,3,3,3-heptafluoro-N,N-bis(1,1,2,2,3,3,3-heptafluoropropyl)-1-propanamine
  724. octane/1,1,2,2,3,3,4,4,4-nonafluoro-N,N-bis(nonafluorobutyl)-1-butanamine
  725. octane/1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-hexadecafluorooctane
  726. octane/1,1,2,2-tetrachloroethane
  727. octane/1,1-dichloro-2-propanone
  728. octane/1,1-dichloroethane
  729. octane/1,1-difluoroethene homopolymer
  730. octane/1,1-dioxo-2-methylthietane
  731. octane/1,10-decanediamine
  732. octane/1,12-bis(N-methylpyrrolidinium)dodecane salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  733. octane/1,12-di(N-ethylmorpholinium)dodecane bis(tri-fluoromethylsulfonyl)imide
  734. octane/1,12-di(N-methylmorpholinium)dodecane bis(tri-fluoromethylsulfonyl)imide
  735. octane/1,12-dodecanediamine
  736. octane/1,2,3,4,5-pentafluoro-6-methoxybenzene
  737. octane/1,2,3,4-tetrahydronaphthalene
  738. octane/1,2,3-propanetriol
  739. octane/1,2,3-trichlorobenzene
  740. octane/1,2,3-tris(diethylamino)cyclopropenylium bis(trifluoromethanesulfonyl)imide
  741. octane/1,2,3-tris(diethylamino)cyclopropenylium dicyanamide
  742. octane/1,2,4,5-tetramethylbenzene
  743. octane/1,2,4-trichlorobenzene
  744. octane/1,2,4-trifluoro-3-nitrobenzene
  745. octane/1,2-benzenedicarboxylic acid bis(1,7,7-trimethylbicyclo[2.2.1]hept-2-yl) ester
  746. octane/1,2-benzenedicarboxylic acid bis(1-methylethyl) ester
  747. octane/1,2-benzenedicarboxylic acid bis(1-methylpropyl) ester
  748. octane/1,2-benzenedicarboxylic acid bis(2-butoxy-2-oxoethyl) ester
  749. octane/1,2-benzenedicarboxylic acid bis(2-ethylhexyl) ester
  750. octane/1,2-benzenedicarboxylic acid bis(2-methylpropyl) ester
  751. octane/1,2-benzenedicarboxylic acid bis(2-phenylethyl) ester
  752. octane/1,2-benzenedicarboxylic acid bis(3-phenylpropyl) ester
  753. octane/1,2-benzenedicarboxylic acid bis(phenylmethyl) ester
  754. octane/1,2-benzenedicarboxylic acid butyl 2-ethylhexyl ester
  755. octane/1,2-benzenedicarboxylic acid butyl phenylmethyl ester
  756. octane/1,2-benzenedicarboxylic acid di-2-propenyl ester
  757. octane/1,2-benzenedicarboxylic acid dibutyl ester
  758. octane/1,2-benzenedicarboxylic acid dicyclohexyl ester
  759. octane/1,2-benzenedicarboxylic acid didecyl ester
  760. octane/1,2-benzenedicarboxylic acid diethyl ester
  761. octane/1,2-benzenedicarboxylic acid dihexyl ester
  762. octane/1,2-benzenedicarboxylic acid diisodecyl ester
  763. octane/1,2-benzenedicarboxylic acid dinonyl ester
  764. octane/1,2-benzenedicarboxylic acid dioctyl ester
  765. octane/1,2-benzenedicarboxylic acid diphenyl ester
  766. octane/1,2-benzenedicarboxylic acid dipropyl ester
  767. octane/1,2-benzenediol dibenzoate
  768. octane/1,2-butadiene homopolymer
  769. octane/1,2-dichlorobenzene
  770. octane/1,2-dichloropropane
  771. octane/1,2-dihydroacenaphthylene
  772. octane/1,2-dimethyl-3-propyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  773. octane/1,2-dimethylbenzene
  774. octane/1,2-ethanediol diformate
  775. octane/1,2-Oxathiane, 2,2-dioxide
  776. octane/1,2-oxathiolane 2,2-dioxide
  777. octane/1,2-propadiene
  778. octane/1,2-propanediol
  779. octane/1,2-propanediol diformate
  780. octane/1,2-propanediol monoformate
  781. octane/1,3,2-dioxathiolane 2-oxide
  782. octane/1,3,3-trimethyl-2-oxabicyclo[2.2.2]octane
  783. octane/1,3,4,6,7,8-hexahydro-1-methyl-2H-pyrimidol[1,2-α]pyrimidine salt with 1,1,2,2,2-pentafluoro-N-((pentafluoroethyl)sulfonyl)ethanesulfonamide (1:1)
  784. octane/1,3,5-tribromobenzene
  785. octane/1,3,5-tributyldihydro-1,3,5-triazine-2,4(1H,3H)-dione
  786. octane/1,3,5-triethyldihydro-1,3,5-triazine-2,4(1H,3H)-dione
  787. octane/1,3,5-trimethyl-2-nitrobenzene
  788. octane/1,3-benzenedicarboxylic acid dihexyl ester
  789. octane/1,3-benzodioxole-5-carboxaldehyde
  790. octane/1,3-bis[(hexyloxy)methyl]-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  791. octane/1,3-butadiene homopolymer
  792. octane/1,3-butadiyne
  793. octane/1,3-dichloro-2-propanol
  794. octane/1,3-dichlorobenzene
  795. octane/1,3-dichloropropane
  796. octane/1,3-didecyl-2-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  797. octane/1,3-Didecyl-2-methylimidazolium dicyanamide
  798. octane/1,3-diethoxypropane
  799. octane/1,3-dihydroxyimidazolium bis(trifluoromethylsulfonyl)imide
  800. octane/1,3-dimethoxy-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  801. octane/1,3-dimethyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  802. octane/1,3-dimethyl-1H-imidazolium salt with phosphoric acid dimethyl ester (1:1)
  803. octane/1,3-dimethyl-1H-imidazolium salt with sulfuric acid monomethyl ester (1:1)
  804. octane/1,3-dinitro-5-(trifluoromethyl)benzene
  805. octane/1,3-dioxane
  806. octane/1,3-dioxolane
  807. octane/1,3-propanediol
  808. octane/1,3-propanediol diacetate
  809. octane/1,3-propanediol ester with 2,3,5,6-tetrachloro-1,4-benzenedicarboxylic acid monobutyl ester (1:2)
  810. octane/1,3-propanediol ester with 2,3,5,6-tetrachloro-1,4-benzenedicarboxylic acid monopropyl ester (1:2)
  811. octane/1,4,7,10,13,16-hexaoxacyclooctadecane
  812. octane/1,4,7,10-tetraoxacyclododecane
  813. octane/1,4-benzenedicarboxylic acid dihexyl ester
  814. octane/1,4-dichloro-2-nitrobenzene
  815. octane/1,4-difluorobenzene
  816. octane/1,4-dimethylnaphthalene
  817. octane/1,4-dioxane
  818. octane/1,4-oxathian-2-one
  819. octane/1,5-dimethoxypentane
  820. octane/1,5-dimethyl-2-pyrrolidinone
  821. octane/1,6-dichlorohexane
  822. octane/1,6-hexanediol
  823. octane/1,7-octadiene
  824. octane/1,8-octanediamine
  825. octane/1,9-di(N-ethylmorpholiinium)nonane bis(tri-fluoromethylsulfonyl)imide
  826. octane/1,9-di(N-methylmorpholiinium)nonane bis(tri-fluoromethylsulfonyl)imide
  827. octane/1-((difluoromethyl)thio)-2-nitrobenzene
  828. octane/1-((difluoromethyl)thio)-4-nitrobenzene
  829. octane/1-((hexyloxy)methyl)-3-methyl-1H-imidazolium tetrafluoroborate(1-)
  830. octane/1-(1-naphthalenyl)ethanone
  831. octane/1-(2-chloroethyl)-3-methylimidazoliumdicyanamide
  832. octane/1-(2-ethoxyethoxy)propane
  833. octane/1-(2-furanyl)ethanone
  834. octane/1-(2-Hydroxyethoxy)-3-nitropropan-2-ol
  835. octane/1-(2-hydroxyethyl)-3-methyl-1H-imidazolium hexafluorophosphate(1-)
  836. octane/1-(2-hydroxyethyl)-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  837. octane/1-(2-hydroxyethyl)-3-methyl-1H-imidazolium tetrafluoroborate(1-)
  838. octane/1-(2-hydroxyethyl)-3-methyl-1H-imidazolium trifluorotris(1,1,2,2,2-pentafluoroethyl)phosphate(1-)
  839. octane/1-(2-Hydroxyethyl)-3-Methylimidazolium Dicyanamid
  840. octane/1-(2-Hydroxyethyl)-3-methylimidazolium nonafluorobutyl sulfonate
  841. octane/1-(2-methoxyethoxy)butane
  842. octane/1-(2-methoxyethyl)-1-methyl-pyrrolidinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  843. octane/1-(2-methoxyethyl)-1-methylpiperidinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  844. octane/1-(2-methoxyethyl)-1-methylpiperidinium tris(pentafluoroethyl)trifluorophosphate
  845. octane/1-(2-methoxyethyl)-1-methylpyrrolidinium trifluorotris(1,1,2,2,2-pentafluoroethyl)phosphate(1-) (1:1)
  846. octane/1-(2-methoxyethyl)-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  847. octane/1-(2-pyridinyl)ethanone
  848. octane/1-(2-thienyl)ethanone
  849. octane/1-(3-boronopropyl)-3-decyl-1H-imidazolium bromide
  850. octane/1-(3-boronopropyl)-3-dodecyl-1H-imidazolium bromide
  851. octane/1-(3-boronopropyl)-3-methyl-1H-imidazolium bromide
  852. octane/1-(3-boronopropyl)-3-octyl-1H-imidazolium bromide
  853. octane/1-(3-Cyanopropyl)-1-methylpyrrolidinium thiocyanate
  854. octane/1-(3-cyanopropyl)-2,3-dimethyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  855. octane/1-(3-cyanopropyl)-2,3-dimethyl-1H-imidazolium salt with cyanocyanamide (1:1)
  856. octane/1-(3-cyanopropyl)-3-methyl-1H-imidazolium salt with cyanocyanamide (1:1)
  857. octane/1-(3-cyclohexen-1-yl)ethanone
  858. octane/1-(3-Hydroxypropyl)-1-methylmorpholinium dicyanamide
  859. octane/1-(3-Hydroxypropyl)-3-methylimidazolium dicyanamide
  860. octane/1-(3-Hydroxypropyl)-3-methylimidazolium thiocyanate
  861. octane/1-(3-Hydroxypropyl)pyridinium dicyanamide
  862. octane/1-(3-hydroxypropyl)pyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  863. octane/1-(3-hydroxypropyl)pyridinium tris(pentafluoroethyl)trifluorophosphate(1-)
  864. octane/1-(3-oxazolidinyl)-1-propanone
  865. octane/1-(4-fluorophenyl)ethanone
  866. octane/1-(4-Methoxy-4-oxobutyl)-3-methylimidazolium dicyanamide
  867. octane/1-(4-methyl-1-piperazinyl)ethanon
  868. octane/1-(6-methoxy-2-naphthalenyl)ethanone
  869. octane/1-(6-methyl-2-naphthalenyl)ethanone
  870. octane/1-(7-methyl-2-naphthalenyl)ethanone
  871. octane/1-(acetyloxy)-2-propanone
  872. octane/1-(cyclohexylmethyl)-3-methylimidazolium bis(trifluoromethylsulfonyl)imide
  873. octane/1-(difluoromethoxy)-3-nitrobenzene
  874. octane/1-(difluoromethoxy)-4-nitrobenzene
  875. octane/1-(difluoromethyl)-4-nitrobenzene
  876. octane/1-(pentafluorophenyl)ethanone
  877. octane/1-(phenylmethyl)pyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  878. octane/1-acetyl-1H-pyrrole
  879. octane/1-acetyl-2-pyrrolidone
  880. octane/1-acetylaziridine
  881. octane/1-acetylpiperidine
  882. octane/1-acetylpyrrolidine
  883. octane/1-allyl-3-methylimidazolium dicyanamide
  884. octane/1-allyl-3-methylimidazolium tetrafluoroborate
  885. octane/1-Allyl-3-vinylimidazolium bis(trifluoromethylsulfonyl)imide
  886. octane/1-Azetidinepropanenitrile
  887. octane/1-aziridinecarboxylic acid methyl ester
  888. octane/1-benzyl-3-methylimidazolium dicyanamide
  889. octane/1-benzyl-3-propoxymethylimidazolium bis(trifluoromethyl-sulfonyl)imide
  890. octane/1-benzyl-3-propoxymethylimidazolium dicyanam
  891. octane/1-bromo-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane
  892. octane/1-bromo-2-propanone
  893. octane/1-bromonaphthalene
  894. octane/1-bromooctane
  895. octane/1-butanol
  896. octane/1-butene homopolymer
  897. octane/1-butene homopolymer isotactic
  898. octane/1-butoxyethanol
  899. octane/1-butyl-1-methyl-1H-pyrrolidinium tris(pentafluoroethyl) trifluorophosphate
  900. octane/1-butyl-1-methylmorpholinium tricyanomethanide
  901. octane/1-butyl-1-methylpiperidinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  902. octane/1-butyl-1-methylpiperidinium thiocyanate
  903. octane/1-butyl-1-methylpyrrolidinium bis[oxalato(2-)-O,O']borate
  904. octane/1-butyl-1-methylpyrrolidinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  905. octane/1-butyl-1-methylpyrrolidinium salt with cyanocyanamide (1:1)
  906. octane/1-butyl-1-methylpyrrolidinium salt with trifluoromethanesulfonic acid (1:1)
  907. octane/1-butyl-1-methylpyrrolidinium tetrakis(cyano-κC)borate(1-)
  908. octane/1-butyl-1-methylpyrrolidinium thiocyanate
  909. octane/1-butyl-1-methylpyrrolidinium tricyanomethanide
  910. octane/1-butyl-2-methylpyridinium tetrafluoroborate(1-)
  911. octane/1-butyl-3-methyl-1H-imidazolium (T-4)-tetrachloroferrate(1-)
  912. octane/1-butyl-3-methyl-1H-imidazolium bis[ethanedioato(2-)-κO1,kapppaO2]borate(1-)
  913. octane/1-butyl-3-methyl-1H-imidazolium chloride
  914. octane/1-butyl-3-methyl-1H-imidazolium compd. with tricyanomethane
  915. octane/1-butyl-3-methyl-1H-imidazolium hexafluoroantimonate(1-)
  916. octane/1-butyl-3-methyl-1H-imidazolium hexafluorophosphate(1-)
  917. octane/1-butyl-3-methyl-1H-imidazolium nitrate
  918. octane/1-butyl-3-methyl-1H-imidazolium salt with 1,1,1,2,2-pentafluoro-N-((pentafluoroethyl)sulfonyl)ethanesulfonamide (1:1)
  919. octane/1-butyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  920. octane/1-butyl-3-methyl-1H-imidazolium salt with 4-methylbenzenesulfonic acid (1:1)
  921. octane/1-butyl-3-methyl-1H-imidazolium salt with cyanocyanamide (1:1)
  922. octane/1-butyl-3-methyl-1H-imidazolium salt with hexadecanoic acid (1:1)
  923. octane/1-butyl-3-methyl-1H-imidazolium salt with methanesulfonic acid
  924. octane/1-butyl-3-methyl-1H-imidazolium salt with octadecanoic acid (1:1)
  925. octane/1-butyl-3-methyl-1H-imidazolium salt with perchloric acid (1:1)
  926. octane/1-butyl-3-methyl-1H-imidazolium salt with phosphoric acid dibutyl ester (1:1)
  927. octane/1-butyl-3-methyl-1H-imidazolium salt with sulfuric acid methyl ester (1:1)
  928. octane/1-butyl-3-methyl-1H-imidazolium salt with sulfuric acid mono(2-(2-methoxyethoxy)ethyl) ester (1:1)
  929. octane/1-butyl-3-methyl-1H-imidazolium salt with sulfuric acid monooctyl ester (1:1)
  930. octane/1-butyl-3-methyl-1H-imidazolium salt with thiocyanic acid (1:1)
  931. octane/1-butyl-3-methyl-1H-imidazolium salt with trifluoroacetic acid (1:1)
  932. octane/1-butyl-3-methyl-1H-imidazolium salt with trifluoromethanesulfonic acid (1:1)
  933. octane/1-butyl-3-methyl-1H-imidazolium tetrabromidocobaltate(2-)
  934. octane/1-butyl-3-methyl-1H-imidazolium tetrabromocobaltate(2-) (2:1)
  935. octane/1-butyl-3-methyl-1H-imidazolium tetrafluoroborate(1-)
  936. octane/1-butyl-3-methyl-1H-pyridinium salt with trifluoromethanesulfonic acid (1:1)
  937. octane/1-butyl-3-methylimidazolium dimethylphosphate
  938. octane/1-butyl-3-methylimidazolium salt with acetic acid (1:1)
  939. octane/1-butyl-3-methylimidazolium salt with sulfuric acid (1:1)
  940. octane/1-butyl-3-methylpyridinium 4-methylbenzenesulfonate
  941. octane/1-butyl-3-methylpyridinium compd. with tricyanomethane
  942. octane/1-butyl-3-methylpyridinium tetrafluoroborate(1-)
  943. octane/1-butyl-4-cyanopyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  944. octane/1-butyl-4-methylpyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  945. octane/1-butyl-4-methylpyridinium salt with 4-methylbenzenesulfonic acid
  946. octane/1-butyl-4-methylpyridinium salt with cyanocyanamide (1:1)
  947. octane/1-butyl-4-methylpyridinium tetrafluoroborate(1-)
  948. octane/1-butyl-4-methylpyridinium tricyanomethanide
  949. octane/1-butylpyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  950. octane/1-butylpyridinium tetrafluoroborate(1-)
  951. octane/1-chloro-2,4-dinitrobenzene
  952. octane/1-chloro-2-nitro-4-(trifluoromethyl)benzene
  953. octane/1-chloro-2-nitrobenzene
  954. octane/1-chloro-2-propanone
  955. octane/1-chloro-9,10-anthracenedione
  956. octane/1-chlorododecane
  957. octane/1-chloroheptane
  958. octane/1-chlorohexadecane
  959. octane/1-chlorohexane
  960. octane/1-chloronaphthalene
  961. octane/1-chlorooctadecane
  962. octane/1-chlorooctane
  963. octane/1-chloropentane
  964. octane/1-chloropropane
  965. octane/1-cyclohexene-1-carbonitrile
  966. octane/1-cyclohexene-1-carboxaldehyde
  967. octane/1-cyclohexylethanone
  968. octane/1-Cyclohexylmethyl-1-methylpyrrolidinium bis(trifluoromethylsulfonyl)imide
  969. octane/1-decanol
  970. octane/1-decene
  971. octane/1-decyl-1-methylpyrrolidinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  972. octane/1-decyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  973. octane/1-decyl-3-methyl-1H-imidazolium tetrafluoroborate(1-)
  974. octane/1-decyl-3-methyl-1H-imidazolium tetrakis(cyano-κC)borate(1-)
  975. octane/1-docosanol
  976. octane/1-dodecanol
  977. octane/1-dodecene
  978. octane/1-dodecyl-3-methyl-1H-imidazolium chloride
  979. octane/1-dodecyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  980. octane/1-dodecyl-3-methyl-1H-imidazolium tetrafluoroborate(1-)
  981. octane/1-eicosanol
  982. octane/1-ethenyl-2-pyrrolidinone
  983. octane/1-ethenyl-4-(1,1-dimethylethyl)benzene homopolymer
  984. octane/1-ethoxy-1,1,2,2,3,3,4,4,4-nonafluorobutane
  985. octane/1-ethoxy-4-methoxybutane
  986. octane/1-ethyl-1-methylpyrrolidinium lactate
  987. octane/1-ethyl-2,3-dimethyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  988. octane/1-ethyl-2-nitrobenzene
  989. octane/1-ethyl-2-pyrrolidinone
  990. octane/1-Ethyl-3-(2-methoxyethyl)-imidazolium bis(trifluoromethylsulfonyl)imide
  991. octane/1-ethyl-3-methyl-1H-imidazol-3-ium trifluorotris(1,1,2,2,2-pentafluoroethyl)phosphate(1-) (1:1)
  992. octane/1-ethyl-3-methyl-1H-imidazolium ethylphosphite
  993. octane/1-ethyl-3-methyl-1H-imidazolium methylphosphonate
  994. octane/1-ethyl-3-methyl-1H-imidazolium nitrate
  995. octane/1-ethyl-3-methyl-1H-imidazolium octyl sulfate
  996. octane/1-ethyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  997. octane/1-ethyl-3-methyl-1H-imidazolium salt with 4-methylbenzenesulfonic acid (1:1)
  998. octane/1-ethyl-3-methyl-1H-imidazolium salt with cyanocyanamide (1:1)
  999. octane/1-ethyl-3-methyl-1H-imidazolium salt with imidodisulfuryl fluoride (1:1)
  1000. octane/1-ethyl-3-methyl-1H-imidazolium salt with methanesulfonic acid
  1001. octane/1-ethyl-3-methyl-1H-imidazolium salt with phosphoric acid diethyl ester (1:1)
  1002. octane/1-ethyl-3-methyl-1H-imidazolium salt with phosphoric acid dimethyl ester (1:1)
  1003. octane/1-ethyl-3-methyl-1H-imidazolium salt with sulfuric acid (1:1)
  1004. octane/1-ethyl-3-methyl-1H-imidazolium salt with sulfuric acid 2-(2-methoxyethoxy)ethyl ester (1:1)
  1005. octane/1-ethyl-3-methyl-1H-imidazolium salt with sulfuric acid monoethyl ester (1:1)
  1006. octane/1-ethyl-3-methyl-1H-imidazolium salt with sulfuric acid monomethyl ester (1:1)
  1007. octane/1-ethyl-3-methyl-1H-imidazolium salt with trifluoromethanesulfonic acid (1:1)
  1008. octane/1-ethyl-3-methyl-1H-imidazolium tetrafluoroborate(1-)
  1009. octane/1-ethyl-3-methyl-1H-imidazolium tetrakis(cyano-κC)borate(1-)
  1010. octane/1-ethyl-3-methyl-1H-imidazolium thiocyanate
  1011. octane/1-ethyl-3-methyl-1H-imidazolium tricyanomethanide
  1012. octane/1-ethyl-3-methylimidazolium trifluoroacetate
  1013. octane/1-ethyl-3-methylpyridinium salt with sulfuric acid ethyl ester
  1014. octane/1-Ethyl-3-octylimidazolium bromide
  1015. octane/1-ethylpyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1016. octane/1-fluoro-2,4-dinitrobenzene
  1017. octane/1-fluoro-2-methoxybenzene
  1018. octane/1-fluoro-2-methyl-3-nitrobenzene
  1019. octane/1-fluoro-2-nitro-4-(trifluoromethyl)benzene
  1020. octane/1-fluoro-2-nitro-4-[(trifluoromethyl)sulfonyl]benzene
  1021. octane/1-fluoro-2-propanone
  1022. octane/1-fluoro-3-nitrobenzene
  1023. octane/1-fluoro-4-methoxybenzene
  1024. octane/1-fluoro-4-nitrobenzene
  1025. octane/1-heptanamine
  1026. octane/1-heptanol
  1027. octane/1-heptene
  1028. octane/1-heptyne
  1029. octane/1-hexadecanol
  1030. octane/1-hexadecyl-3-methyl-1H-imidazolium tetrafluoroborate(1-)
  1031. octane/1-hexene
  1032. octane/1-hexyl-1,4-diaza[2.2.2]-bicyclooctanium bis(trifluoromethylsulfonyl)imide
  1033. octane/1-hexyl-1-methylpiperidinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1034. octane/1-hexyl-1-methylpyrrolidinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1035. octane/1-hexyl-2,3-dimethyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1036. octane/1-Hexyl-2,3-dimethylimidazolium tetrafluoroborate
  1037. octane/1-hexyl-3-methyl-1H-imidazolium acetate
  1038. octane/1-hexyl-3-methyl-1H-imidazolium bis[ethanedioato(2-)-κO1,kapppaO2]borate(1-)
  1039. octane/1-hexyl-3-methyl-1H-imidazolium chloride
  1040. octane/1-hexyl-3-methyl-1H-imidazolium hexafluorophosphate(1-)
  1041. octane/1-hexyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1042. octane/1-hexyl-3-methyl-1H-imidazolium salt with nitric acid (1:1)
  1043. octane/1-hexyl-3-methyl-1H-imidazolium salt with sulfuric acid (1:1)
  1044. octane/1-hexyl-3-methyl-1H-imidazolium salt with trifluoromethanesulfonic acid (1:1)
  1045. octane/1-hexyl-3-methyl-1H-imidazolium tetrafluoroborate(1-)
  1046. octane/1-hexyl-3-methyl-1H-imidazolium tetrakis(cyano-κC)borate(1-)
  1047. octane/1-hexyl-3-methyl-1H-imidazolium thiocyanate
  1048. octane/1-hexyl-3-methyl-1H-imidazolium trifluorotris(1,1,2,2,2-pentafluoroethyl)phosphate(1-) (1:1)
  1049. octane/1-hexyl-3-methylimidazol-3-ium; 2,2,2-trifluoroacetate
  1050. octane/1-hexyl-3-methylpyridinium 4-methylbenzenesulfonate
  1051. octane/1-hexylisoquinolinium thiocyanate
  1052. octane/1-hexylpyridin-1-ium bromide
  1053. octane/1-hexylpyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1054. octane/1-hexylquinuclidinium bis(trifluoromethylsulfonyl)imide
  1055. octane/1-hexyne
  1056. octane/1-hydroxy-2-propanone
  1057. octane/1-methoxy-2-nitro-4-(trifluoromethyl)benzene
  1058. octane/1-methoxy-3-nitrobenzene
  1059. octane/1-methoxy-3-propoxypropane
  1060. octane/1-methoxybutane
  1061. octane/1-methyl-1-(phenylmethyl)pyrrolidinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1062. octane/1-methyl-1-octylpyrrolidinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1063. octane/1-methyl-1-pentylpiperidinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1064. octane/1-methyl-1-pentylpyrrolidinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1065. octane/1-methyl-1-propylpiperidinium bis(fluorosulfonyl)imide
  1066. octane/1-methyl-1-propylpiperidinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1067. octane/1-methyl-1-propylpyrrolidinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1068. octane/1-methyl-1-propylpyrrolidinium salt with imidodisulfuryl fluoride (1:1)
  1069. octane/1-methyl-1H-pyrrole-2-carboxylic acid methyl ester
  1070. octane/1-methyl-2(1H)-pyridinone
  1071. octane/1-methyl-2,4-dinitrobenzene
  1072. octane/1-methyl-2-azetidinone
  1073. octane/1-methyl-2-nitrobenzene
  1074. octane/1-Methyl-2-nitropyrrole
  1075. octane/1-methyl-2-piperidinone
  1076. octane/1-methyl-2-pyrrolidinone
  1077. octane/1-methyl-3-(2-propenyl)-1H-imidazolium bromide
  1078. octane/1-methyl-3-(2-propenyl)-1H-imidazolium chloride
  1079. octane/1-methyl-3-(phenylmethyl)-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1080. octane/1-methyl-3-H-imidazolium nitrate
  1081. octane/1-methyl-3-nitrobenzene
  1082. octane/1-methyl-3-octyl-1H-imidazolium chloride
  1083. octane/1-methyl-3-octyl-1H-imidazolium hexafluorophosphate(1-)
  1084. octane/1-methyl-3-octyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1085. octane/1-methyl-3-octyl-1H-imidazolium salt with nitric acid (1:1)
  1086. octane/1-methyl-3-octyl-1H-imidazolium salt with sulfuric acid 2-(2-methoxyethoxy)ethyl ester (1:1)
  1087. octane/1-methyl-3-octyl-1H-imidazolium salt with trifluoromethanesulfonic acid (1:1)
  1088. octane/1-methyl-3-octyl-1H-imidazolium tetrafluoroborate(1-)
  1089. octane/1-methyl-3-propoxymethylimidazolium bis(trifluoromethylsulfonyl)imide
  1090. octane/1-methyl-3-propoxymethylimidazolium dicyanamide
  1091. octane/1-methyl-3-propoxymethylimidazolium tetrafluoroborate
  1092. octane/1-methyl-3-propyl-1H-imidazolium bromide
  1093. octane/1-methyl-3-[(9Z)-9-octadecenyl]-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1094. octane/1-methyl-3-[3-[(1-oxo-2-propenyl)oxy]propyl]-1H-imidazol-3-ium bromide
  1095. octane/1-methyl-3-[3-[(2-methyl-1-oxo-2-propenyl)oxy]propyl]-1H-imidazol-3-ium bromide
  1096. octane/1-methyl-4-nitrobenzene
  1097. octane/1-methyl-4-nitrosopiperazine
  1098. octane/1-methylimidazolium bis(trifluoromethylsulfonyl)imide
  1099. octane/1-methylnaphthalene
  1100. octane/1-methylpiperidine
  1101. octane/1-Methylpyrrole-2-carbaldehyde
  1102. octane/1-naphthalenamine
  1103. octane/1-naphthalenecarboxaldehyde
  1104. octane/1-naphthalenol
  1105. octane/1-nitro-2-butanol
  1106. octane/1-nitro-2-hexanol
  1107. octane/1-nitro-2-pentanol
  1108. octane/1-nitro-2-propanol
  1109. octane/1-nitro-3-((trifluoromethyl)thio)benzene
  1110. octane/1-nitro-3-(trifluoromethyl)benzene
  1111. octane/1-nitro-4-((trifluoromethyl)thio)benzene
  1112. octane/1-nitronaphthalene
  1113. octane/1-nitroso-2-pyrrolidinone
  1114. octane/1-nitrosoazepane
  1115. octane/1-nitrosopiperazine
  1116. octane/1-nitrosopyrrolidine
  1117. octane/1-nonanol
  1118. octane/1-octadecanol
  1119. octane/1-octanamine
  1120. octane/1-octanol
  1121. octane/1-octene
  1122. octane/1-Octyl-2,3-dimethylimidazolium tetrafluoroborate
  1123. octane/1-octyl-3-methyl-1H-imidazolium acetate
  1124. octane/1-octyl-3-methylimidazolium hydrogensulfate
  1125. octane/1-octylisoquinolinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1126. octane/1-octylpyridin-1-ium bromide
  1127. octane/1-octylquinolinium bis(trifluoromethylsulfonyl)amide
  1128. octane/1-octylquinuclidinium bis(trifluoromethylsulfonyl)imide
  1129. octane/1-octyne
  1130. octane/1-pentanol
  1131. octane/1-pentylpyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1132. octane/1-phenyl-1-butanone
  1133. octane/1-phenylethanone
  1134. octane/1-Piperazine carboxaldehyde
  1135. octane/1-Piperazinepropionitrile
  1136. octane/1-piperidinecarbonitrile
  1137. octane/1-piperidinecarboxaldehyde
  1138. octane/1-propaneboronic acid 3-decylimidazolium bromide
  1139. octane/1-propaneboronic acid 3-dodecylimidazolium bromide
  1140. octane/1-propaneboronic acid 3-methylimidazolium bromide
  1141. octane/1-propaneboronic acid 3-octylimidazolium bromide
  1142. octane/1-propanol
  1143. octane/1-propene
  1144. octane/1-propyl-2,3-dimethyl-1H-imidazolium tetrafluoroborate(1-)
  1145. octane/1-propyne
  1146. octane/1-pyrrolidinecarboxaldehyde
  1147. octane/1-pyrrolidinecarboxylic acid methyl ester
  1148. octane/1-pyrrolidinepropanenitrile
  1149. octane/1-sec-Butyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide
  1150. octane/1-tert-Butyl-3-methylimidazolium bis(trifluoromethylsulfonyl)imide
  1151. octane/1-tetradecanol
  1152. octane/1-tetradecyl-3-methylimidazolium tetrafluoroborate
  1153. octane/1-tridecanamine
  1154. octane/1-undecanol
  1155. octane/1-[(hexyloxy)methyl]-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1156. octane/10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-one
  1157. octane/10-nonadecanone
  1158. octane/10H-phenothiazine
  1159. octane/19,24-dioctadecyldotetracontane
  1160. octane/1H-indole
  1161. octane/1H-pyrrole-1-propanenitrile
  1162. octane/2',3'-N-Epoxypropyl-N-methyl-2-oxopyrrolidinium salicylate
  1163. octane/2(3H)-furanone
  1164. octane/2,2'-(1,2-ethanediylbis(oxy))bisethanol
  1165. octane/2,2'-oxybisacetic acid dimethyl ester
  1166. octane/2,2'-thiobisacetic acid dimethyl ester
  1167. octane/2,2'-[oxybis(2,1-ethanediyloxy)]bisethanol
  1168. octane/2,2,2-trifluoro-1-(pentafluorophenyl)ethanone
  1169. octane/2,2,2-trifluoroethanol
  1170. octane/2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoro-1-heptanol
  1171. octane/2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-1-heptanol
  1172. octane/2,2,3,3,4,4,5,5-octafluoro-1-pentanol
  1173. octane/2,2,3,3-tetrafluoro-1-propanol
  1174. octane/2,2,3,3-tetrafluoro-1-propanol phosphate (3:1)
  1175. octane/2,2,4,4,6,6,8,8-octamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane
  1176. octane/2,2,4-trimethylpentane
  1177. octane/2,2-dichloroethanol
  1178. octane/2,2-diethyl-1,3-dioxolane
  1179. octane/2,2-dimethylbutane
  1180. octane/2,3,4,5,6-pentafluoro-α-methylbenzenemethanol
  1181. octane/2,3,4,5,6-pentafluorobenzenamine
  1182. octane/2,3,4,5,6-pentafluorobenzenemethanol
  1183. octane/2,3,4,6-tetrafluoro-1-nitrobenzene
  1184. octane/2,3,4,6-tetrafluorobenzenamine
  1185. octane/2,3,4-trimethylpentane
  1186. octane/2,3,5,6-tetrachloro-1,4-benzenedicarboxylic acid dibutyl ester
  1187. octane/2,3,5,6-tetrachloro-1,4-benzenedicarboxylic acid dipentyl ester
  1188. octane/2,3-dimethyl-1,3-butadiene homopolymer
  1189. octane/2,3-dimethyl-1-octyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1190. octane/2,3-dimethyl-2,3-butanediol
  1191. octane/2,3-dimethylbutane
  1192. octane/2,3-diphenyl-2-cyclopropen-1-one
  1193. octane/2,4,8,10-tetraoxaspiro[5.5]undecane
  1194. octane/2,4-bis(1-methylethyl)phenol
  1195. octane/2,4-difluoro-1-nitrobenzene
  1196. octane/2,4-difluorobenzenamine
  1197. octane/2,4-Difluorobenzonitrile
  1198. octane/2,4-dimethylphenol phosphate (3:1)
  1199. octane/2,4-dinitrobenzaldehyde
  1200. octane/2,4-hexanedione
  1201. octane/2,5,8,11,14-pentaoxapentadecane
  1202. octane/2,5,8,11-tetraoxadodecane
  1203. octane/2,5-bis(trifluoromethyl)benzenamine
  1204. octane/2,5-dimethyl-1,3,4-oxadiazole
  1205. octane/2,5-dimethylfuran
  1206. octane/2,5-dimethylhexane
  1207. octane/2,5-furandicarboxylic acid diethyl ester
  1208. octane/2,6,6-trimethylbicyclo[3.1.1]hept-2-ene
  1209. octane/2,6-dimethoxyphenol
  1210. octane/2,6-dimethylbenzenamine
  1211. octane/2,6-dimethylphenol homopolymer
  1212. octane/2,6-heptanedione
  1213. octane/2,7-octanedione
  1214. octane/2-(1,1-dimethylethyl)-9,10-anthracenedione
  1215. octane/2-(2,2,3,3-Tetrafluoropropoxy)ethanol
  1216. octane/2-(2-aminoethoxy)ethanol
  1217. octane/2-(2-ethoxyethoxy)ethanol
  1218. octane/2-(2-methoxyethoxy)-2-methylpropane
  1219. octane/2-(2-methylpropoxy)ethanol
  1220. octane/2-(acetyloxy)propanenitrile
  1221. octane/2-(Chloromethyl)-1,4-dioxane
  1222. octane/2-(chloromethyl)oxirane homopolymer
  1223. octane/2-(Pentafluorophenoxy)ethanol
  1224. octane/2-acetoxyacetonitrile
  1225. octane/2-acetyl-1-methylpyrrole
  1226. octane/2-aminoethanol
  1227. octane/2-butanol
  1228. octane/2-butanone
  1229. octane/2-butenal
  1230. octane/2-butoxyethanol
  1231. octane/2-butylphenol
  1232. octane/2-butynedioic acid dimethyl ester
  1233. octane/2-chlorbutane
  1234. octane/2-chloro-1,3-dinitro-5-(trifluoromethyl)benzene
  1235. octane/2-chloro-2-methylpropane
  1236. octane/2-chloro-4-methylquinoline
  1237. octane/2-chloro-5-(trifluoromethyl)benzenamine
  1238. octane/2-chloronaphthalene
  1239. octane/2-ethoxy-2-methylbutane
  1240. octane/2-ethoxy-2-methylpropane
  1241. octane/2-ethoxybenzenamine
  1242. octane/2-ethoxynaphthalene
  1243. octane/2-ethyl-1,3,5-trinitrobenzene
  1244. octane/2-ethyl-2-(hydroxymethyl)-1,3-propanediol
  1245. octane/2-ethyl-6-methylpyridine 1-oxide
  1246. octane/2-ethylthiophene
  1247. octane/2-fluoro-α-methyl-(1,1'-biphenyl)-4-acetic acid
  1248. octane/2-fluoro-1,3-dinitro-5-(trifluoromethyl)benzene
  1249. octane/2-fluoro-1-methoxy-4-nitrobenzene
  1250. octane/2-fluoro-1-nitrobenzene
  1251. octane/2-fluorobenzenamine
  1252. octane/2-fluorobenzonitrile
  1253. octane/2-fluoroethanol
  1254. octane/2-furancarbonitrile
  1255. octane/2-furancarboxaldehyde
  1256. octane/2-furancarboxylic acid methyl ester
  1257. octane/2-furanmethanol
  1258. octane/2-heptanol
  1259. octane/2-hexanone
  1260. octane/2-hexyne
  1261. octane/2-hydroxy-N,N,N-trimethyl-1-ethanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1262. octane/2-hydroxy-N,N,N-trimethylethanaminium chloride
  1263. octane/2-hydroxybenzaldehyde
  1264. octane/2-hydroxybenzoic acid ethyl ester
  1265. octane/2-hydroxybenzoic acid methyl ester
  1266. octane/2-Hydroxyethyl-2,2,2-trifluoroacetate
  1267. octane/2-hydroxypropanoic acid
  1268. octane/2-hydroxypropanoic acid ethyl ester
  1269. octane/2-hydroxypropanoic acid methyl ester
  1270. octane/2-methoxy-1,3-dinitro-5-(trifluoromethyl)benzene
  1271. octane/2-methoxy-2-methylbutane
  1272. octane/2-methoxy-2-methylpropane
  1273. octane/2-Methoxy-tetrahydro-furan-3-carboxylic acid methyl ester
  1274. octane/2-methoxybenzenamine
  1275. octane/2-methoxyfuran
  1276. octane/2-methoxynaphthalene
  1277. octane/2-methoxyphenol
  1278. octane/2-Methoxytetrahydro-1,4-thiazine
  1279. octane/2-methyl-1,3,5-trinitrobenzene
  1280. octane/2-methyl-1,3-butadiene
  1281. octane/2-methyl-1-butanol
  1282. octane/2-methyl-1-octyl-3-propoxymethylimidazolium bis(trifluoromethylsulfonyl)imide
  1283. octane/2-methyl-1-octyl-3-propoxymethylimidazolium dicyanamide
  1284. octane/2-methyl-1-propanol
  1285. octane/2-methyl-1-propene
  1286. octane/2-methyl-1-propene homopolymer
  1287. octane/2-methyl-1H-pyrrole
  1288. octane/2-methyl-2-butanol
  1289. octane/2-methyl-2-butene
  1290. octane/2-methyl-2-nitro-3-pentanol
  1291. octane/2-methyl-2-propanol
  1292. octane/2-methyl-2-propenoic acid
  1293. octane/2-methyl-2-propenoic acid 1,1-dimethylethyl ester homopolymer
  1294. octane/2-methyl-2-propenoic acid 2,2,2-trifluoro-1-(trifluoromethyl)ethyl ester homopolymer
  1295. octane/2-methyl-2-propenoic acid 2,2,2-trifluoroethyl ester homopolymer
  1296. octane/2-methyl-2-propenoic acid 2,2,3,3,3-pentafluoropropyl ester homopolymer
  1297. octane/2-methyl-2-propenoic acid 2-(4-morpholinyl)ethyl ester diblock polymer with 2-(dimethylamino)ethyl 2-methyl-2-propenoate
  1298. octane/2-methyl-2-propenoic acid 2-(4-morpholinyl)ethyl ester homopolymer
  1299. octane/2-methyl-2-propenoic acid 2-(diethylamino)ethyl ester homopolymer
  1300. octane/2-methyl-2-propenoic acid 2-(dimethylamino)ethyl ester homopolymer
  1301. octane/2-methyl-2-propenoic acid 2-hydroxy-2-(3-methyl-3-phenylcyclobutyl)ethyl ester homopolymer
  1302. octane/2-methyl-2-propenoic acid 2-hydroxy-2-[3-methyl-3-(5,6,7,8-tetrahydro-2-naphthalenyl)cyclobutyl]ethyl ester homopolymer
  1303. octane/2-methyl-2-propenoic acid butyl ester homopolymer
  1304. octane/2-methyl-2-propenoic acid cyclohexyl ester homopolymer
  1305. octane/2-methyl-2-propenoic acid ethyl ester homopolymer
  1306. octane/2-methyl-2-propenoic acid methyl ester
  1307. octane/2-methyl-2-propenoic acid methyl ester homopolymer
  1308. octane/2-methyl-2-propenoic acid rel-(1R,2R,4R)-1,7,7-trimethylbicyclo[2.2.1]hept-2-yl ester homopolymer
  1309. octane/2-methyl-3-nitrofuran
  1310. octane/2-methyl-3-oxobutanenitrile
  1311. octane/2-methyl-5-nitrofuran
  1312. octane/2-methylaziridine homopolymer dendrimer
  1313. octane/2-methylbenzenamine
  1314. octane/2-methylheptane
  1315. octane/2-methylphenol
  1316. octane/2-methylpropane
  1317. octane/2-methylpropanoic acid
  1318. octane/2-methylpropanoic acid ethyl ester
  1319. octane/2-methylpyridine 1-oxide
  1320. octane/2-methylquinoline
  1321. octane/2-naphthalenol
  1322. octane/2-nitro-1,4-bis(trifluoromethyl)benzene
  1323. octane/2-nitro-4-(trifluoromethyl)phenol
  1324. octane/2-nitroethanol
  1325. octane/2-Nitroethyl acetate
  1326. octane/2-nitrofuran
  1327. octane/2-nitrophenol
  1328. octane/2-nitropropane
  1329. octane/2-nitropyridine
  1330. octane/2-Nitropyrrole
  1331. octane/2-nitrothiophene
  1332. octane/2-octanol
  1333. octane/2-octyne
  1334. octane/2-oxepanone
  1335. octane/2-oxetanone
  1336. octane/2-phenoxyethanol
  1337. octane/2-piperidinone
  1338. octane/2-propanol
  1339. octane/2-propanone
  1340. octane/2-propenoic acid
  1341. octane/2-propenoic acid 2-hydroxyethyl ester homopolymer
  1342. octane/2-propenoic acid 2-hydroxypropyl ester homopolymer
  1343. octane/2-propenoic acid ethyl ester homopolymer
  1344. octane/2-propenoic acid methyl ester
  1345. octane/2-propenoic acid methyl ester homopolymer
  1346. octane/2-propoxyethanol
  1347. octane/2-pyridinamine
  1348. octane/2-pyridinemethanol
  1349. octane/2-pyrrolidinone
  1350. octane/2-thiophenecarboxaldehyde
  1351. octane/2-thiophenecarboxylic acid methyl ester
  1352. octane/2-[2-[(Z)-heptadec-8-enyl]-4,5-dihydroimidazol-1-yl]ethanol
  1353. octane/2-[4-ethenylphenyl)sulfonyl]naphthalene homopolymer
  1354. octane/3,3',3"-(Benzene-1,3,5-triyltris(methylene))tris(1-(naphthalen-2-yl)imidazolium) tris(bis((trifluoromethyl)sulfonyl)amide)
  1355. octane/3,3'-iminobispropanenitrile
  1356. octane/3,3'-oxybispropanenitrile
  1357. octane/3,3'-thiobispropanenitrile
  1358. octane/3,3'-[1,7-(2,6-dioxaheptane)]bis(1-methylimidazolium) bis(trifluoromethylsulfonyl)imide
  1359. octane/3,3'-[1,7-(2,6-dioxaheptane)]bis(2-methy-1-octylimidazolium) bis(trifluoromethylsulfonyl)imide
  1360. octane/3,3'-[1,7-(2,6-dioxaheptane)]bis(2-methy-1-octylimidazolium) dicyanamide
  1361. octane/3,3'-[1,7-(2,6-dioxaheptane)]bis(2-methy-1-octylimidazolium) tetrafluoroborate
  1362. octane/3,3'-[2,2-bis((2-cyanoethoxy)methyl)-1,3-propanediyl]bis(oxy)bispropanenitrile
  1363. octane/3,3,9,9-Tetramethyl-2,4,8,10-tetraoxaspiro[5.5]undecane
  1364. octane/3,4,5,6-tetrachloro-1,2-benzenedicarboxylic acid dibutyl ester
  1365. octane/3,4-dimethyl-1,2,5-oxadiazole
  1366. octane/3,4-dimethyl-1,2,5-oxadiazole 2-oxide
  1367. octane/3,4-furandicarboxylic acid diethyl ester
  1368. octane/3,4-Furandicarboxylic acid dimethyl ester
  1369. octane/3,5,5-Trimethyloxazolidine-2,4-dione
  1370. octane/3,5-Dimethyl-4-isoxazolamine
  1371. octane/3,5-dimethyl-4-isoxazolecarboxylic acid methyl ester
  1372. octane/3,5-Dimethyl-4-nitroisoxazole
  1373. octane/3,5-dimethylisoxazole
  1374. octane/3,5-dimethylpyridine
  1375. octane/3,9-Dimethyl-2,4,8,10-tetraoxaspiro(5.5)undecane
  1376. octane/3-((1,4-Dioxan-2-yl)methoxy)propannitrile
  1377. octane/3-((2,2,3,3,4,4,5,5-octafluoropentyl)oxy)propanenitrile
  1378. octane/3-((2,2-dimethyl-1,3-dioxan-5-yl)oxy)propanenitrile
  1379. octane/3-((2-methyl-1,3-dioxan-5-yl)oxy)propanenitrile
  1380. octane/3-((tetrahydro-2-furanyl)methoxy)propanenitrile
  1381. octane/3-(1,3-dioxan-5-yloxy)propanenitrile
  1382. octane/3-(2,2,3,3-tetrafluoropropoxy)propanenitrile
  1383. octane/3-(2-Furanylmethoxy)propannitrile
  1384. octane/3-(2-hydroxyethyl)-2-oxazolidinone
  1385. octane/3-(2-morpholino-ethoxy)propionitrile
  1386. octane/3-(2-propenyloxy)-1,2-propanediol
  1387. octane/3-(acetyloxy)propanenitrile
  1388. octane/3-(difluoromethoxy)phenol
  1389. octane/3-(difluoromethyl)benzenamine
  1390. octane/3-(Hexahydro-1H-azepin-1-yl)propionitrile
  1391. octane/3-(pentyloxy)propanenitrile
  1392. octane/3-(Thiomorpholin-4-yl)propanenitrile
  1393. octane/3-(trifluoromethyl)benzenamine
  1394. octane/3-(trifluoromethyl)benzonitrile
  1395. octane/3-(trifluoromethyl)phenol
  1396. octane/3-acetyl-1,3-thiazolidine
  1397. octane/3-Acetyl-[1,5,3]dioxazepane
  1398. octane/3-acetyldihydro-2(3H)-furanone
  1399. octane/3-acetyloxazolidine
  1400. octane/3-bromodihydro-2(3H)-furanone
  1401. octane/3-Butyryl-oxazolidine
  1402. octane/3-chloro-1,2-propanediol
  1403. octane/3-cyano-2-methylpropanoic acid methyl ester
  1404. octane/3-cyanopropanoic acid methyl ester
  1405. octane/3-decyl-1-(2-propenyl)-1H-imidazolium bromide
  1406. octane/3-dodecyl-1-(2-propenyl)-1H-imidazolium bromide
  1407. octane/3-ethoxypropanenitrile
  1408. octane/3-ethyl-2-oxazolidinone
  1409. octane/3-fluorobenzenamine
  1410. octane/3-fluorobenzonitrile
  1411. octane/3-furancarbonitrile
  1412. octane/3-furancarboxaldehyde
  1413. octane/3-furancarboxylic acid methyl ester
  1414. octane/3-hexyne
  1415. octane/3-hydroxyestra-1,3,5(10)-trien-17-one
  1416. octane/3-hydroxypropanal
  1417. octane/3-methyl-1-(2-methyl-1-propenyl)-1H-imidazolium tetrafluoroborate(1-)
  1418. octane/3-methyl-1-(2-propenyl)-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1419. octane/3-methyl-1-(3-cyanopropyl)-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1420. octane/3-methyl-1-butanol
  1421. octane/3-methyl-2-butanone
  1422. octane/3-methyl-2-oxazolidinone
  1423. octane/3-methyl-3-(2,4,6-trimethylphenyl)-β-hydroxycyclobutaneethanol 2-methyl-2-propenoate homopolymer
  1424. octane/3-methyl-3-(2,4,6-trimethylphenyl)-β-oxocyclobutaneethanol 2-methyl-2-propenoate homopolymer
  1425. octane/3-methyl-3-nitro-2-butanol
  1426. octane/3-methyl-3-pentanol
  1427. octane/3-methylbutanoic acid
  1428. octane/3-methylbutanoic acid methyl ester
  1429. octane/3-methylheptane
  1430. octane/3-methylpentane
  1431. octane/3-methylthiophene
  1432. octane/3-nitro-2-butanol
  1433. octane/3-nitrobenzaldehyde
  1434. octane/3-octyl-1-(2-propenyl)-1H-imidazolium bromide
  1435. octane/3-octyne
  1436. octane/3-oxazolidinecarboxaldehyde
  1437. octane/3-oxazolidinecarboxylic acid methyl ester
  1438. octane/3-Oxazolidinepropanenitrile
  1439. octane/3-oxobutanenitrile
  1440. octane/3-oxobutanoic acid ethyl ester
  1441. octane/3-oxopentanedioic acid dimethyl ester
  1442. octane/3-pentanone
  1443. octane/3-propoxypropanenitrile
  1444. octane/3-pyridinamine
  1445. octane/3-pyridinecarboxylic acid methyl ester
  1446. octane/4'-octyl-(1,1'-biphenyl)-4-carbonitrile
  1447. octane/4,4'-Methylenedimorpholine
  1448. octane/4,4-dimethyl-1,3-dioxane
  1449. octane/4,5-Dihydro-3-furancarboxylic acid methyl ester
  1450. octane/4,7,13,16,21,24-hexaoxa-1,10-diazabicyclo[8.8.8]hexacosane
  1451. octane/4-(1-Oxopentyl)morpholine
  1452. octane/4-(2-Hydroxyethyl)morpholin-2-one
  1453. octane/4-(2-methoxyethyl)-4-methyl-5-morpholinium tris(pentafluoroethyl)trifluorophosphate
  1454. octane/4-(2-methoxyethyl)-4-methylmorpholinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1455. octane/4-(3-Cyanopropyl)-4-methylmorpholinium tricyanomethanide
  1456. octane/4-(3-hydroxypropyl)-4-methylmorpholinium bis(trifluoromethylsulfonyl)imide
  1457. octane/4-(3-Hydroxypropyl)-4-methylmorpholinium tricyanomethanide
  1458. octane/4-(phenylmethyl)pyridine
  1459. octane/4-acetylmorpholine
  1460. octane/4-acetylthiomorpholine
  1461. octane/4-bromo-N,N-dimethylbenzenamine
  1462. octane/4-butylbenzoic acid 4-cyanophenyl ester
  1463. octane/4-Butyrylmorpholine
  1464. octane/4-Chloromorpholine
  1465. octane/4-dimethylamino-1-propoxymethyl pyridinium bis(trifluoromethylsulfonyl)imide
  1466. octane/4-ethoxybenzenamine
  1467. octane/4-ethylbenzoic acid 4-cyanophenyl ester
  1468. octane/4-fluoro-1-methoxy-2-nitrobenzene
  1469. octane/4-fluorobenzenamine
  1470. octane/4-fluorobenzonitrile
  1471. octane/4-fluorophenol
  1472. octane/4-heptanone
  1473. octane/4-heptylbenzoic acid 4-cyanophenyl ester
  1474. octane/4-hexylbenzoic acid 4-cyanophenyl ester
  1475. octane/4-hydroxy-4-methyl-2-pentanone
  1476. octane/4-methyl-1-piperazinecarboxaldehyde
  1477. octane/4-methyl-1-piperazinepropanenitrile
  1478. octane/4-methyl-2-morpholinone
  1479. octane/4-Methyl-2-thiomorpholinone
  1480. octane/4-methyl-3-morpholinone
  1481. octane/4-methyl-3-penten-2-one
  1482. octane/4-methyl-N,N-bis(4-methylphenyl)benzenamine
  1483. octane/4-methylbenzeneacetic acid
  1484. octane/4-methylheptane
  1485. octane/4-morpholinecarbonitrile
  1486. octane/4-morpholinecarbonyl chloride
  1487. octane/4-morpholinecarboxaldehyde
  1488. octane/4-Morpholinecarboxylic acid ethyl ester
  1489. octane/4-morpholinecarboxylic acid methyl ester
  1490. octane/4-morpholineethanol
  1491. octane/4-morpholinepropanenitrile
  1492. octane/4-nitro-1,2-benzenedicarboxylic acid dihexyl ester
  1493. octane/4-nitro-1-cyclohexene
  1494. octane/4-nitropyridine
  1495. octane/4-nitrosomorpholine
  1496. octane/4-octyne
  1497. octane/4-Oxopentanal
  1498. octane/4-oxopentanenitrile
  1499. octane/4-oxopentanoic acid methyl ester
  1500. octane/4-pentylbenzoic acid 4-cyanophenyl ester
  1501. octane/4-Propionylmorpholine
  1502. octane/4-propylbenzoic acid 4-cyanophenyl ester
  1503. octane/4-pyridinecarboxylic acid methyl ester
  1504. octane/4-Thiomorpholinecarboxaldehyde
  1505. octane/4-[(difluoromethyl)thio]benzenamine
  1506. octane/5,5-dimethoxy-2-pentanone
  1507. octane/5,8,11,14-tetraoxaoctadecane
  1508. octane/5-((S)-3,7-Dimethyloctyloxy)-2-[[[4-(octyloxy)phenyl]imino]methyl]phenol
  1509. octane/5-Methoxy-3,4-dihydro-2H-pyrrole
  1510. octane/5-Methoxy-5-methyloxolan-2-one
  1511. octane/5-Methyl-2-furancarboxylic acid methyl ester
  1512. octane/5-Methyl-3-isoxazolecarbonitrile
  1513. octane/5-methyl-4-nitroisoxazole
  1514. octane/5-methylisoxazole
  1515. octane/5-nitro-2-furancarboxaldehyde
  1516. octane/5-nitro-2-furanmethanol
  1517. octane/5-nitroquinoline
  1518. octane/6-methoxyquinoline
  1519. octane/6-methyl-2-pyridineethanol
  1520. octane/7-methyl-3-methylene-1,6-octadiene
  1521. octane/8-methoxyquinoline
  1522. octane/8-nitroquinoline
  1523. octane/9-heptadecanone
  1524. octane/9H-carbazole
  1525. octane/9H-fluoren-9-one
  1526. octane/9H-fluorene
  1527. octane/9H-thioxanthen-9-one
  1528. octane/9H-xanthene
  1529. octane/acetamide
  1530. octane/acetic acid
  1531. octane/acetic acid butyl ester
  1532. octane/acetic acid ethenyl ester homopolymer
  1533. octane/acetic acid ethyl ester
  1534. octane/acetic acid hexyl ester
  1535. octane/acetic acid methyl ester
  1536. octane/acetic acid octyl ester
  1537. octane/acetic acid pentyl ester
  1538. octane/acetic acid phenylmethyl ester
  1539. octane/acetonitrile
  1540. octane/acetylferrocene
  1541. octane/air
  1542. octane/ammoeng
  1543. octane/ammonia
  1544. octane/Amylphenol
  1545. octane/anthracene
  1546. octane/argon
  1547. octane/azulene
  1548. octane/benzenamine
  1549. octane/benzene
  1550. octane/benzeneacetonitrile
  1551. octane/benzeneethanol
  1552. octane/benzenepropanenitrile
  1553. octane/benzenepropanoic acid ethyl ester
  1554. octane/benzoic acid
  1555. octane/benzoic acid butyl ester
  1556. octane/benzoic acid ethyl ester
  1557. octane/benzoic acid methyl ester
  1558. octane/benzoic acid propyl ester
  1559. octane/benzo[b]thiophene
  1560. octane/benzo[h]quinoline
  1561. octane/biodiesel
  1562. octane/bis(1-methylethyl) disulfide
  1563. octane/Bis(2,2,3,3,4,4,5,5-Octafluoropentyl)carbonate
  1564. octane/Bis(2,2,3,3-tetrafluoropropyl) sulfite
  1565. octane/Bis(2,2,3,3-tetrafluoropropyl)formal
  1566. octane/bromochloromethane
  1567. octane/bromoethane
  1568. octane/butanal
  1569. octane/butanedioic acid bis(1-methylethyl) ester
  1570. octane/Butanedioic acid cyanomethyl methyl ester
  1571. octane/butanedioic acid diethyl ester
  1572. octane/butanedioic acid dinonyl ester
  1573. octane/butanedioic acid dipropyl ester
  1574. octane/butanoic acid 1,2-phenylene ester
  1575. octane/butanoic acid methyl ester
  1576. octane/butoxybenzene
  1577. octane/Butylammonium hydrogensulfate
  1578. octane/butylcyclohexane
  1579. octane/carbamic acid ethyl ester
  1580. octane/carbon dioxide
  1581. octane/carbon disulfide
  1582. octane/carbon monoxide
  1583. octane/Carbonic acid di(2,2,3,3-Tetrafluoropropyl) ester
  1584. octane/carbonic acid dimethyl ester
  1585. octane/carbonic acid polymer with 4,4'-(1-methylethylidene)bis(phenol)
  1586. octane/cellulose 2-propenoate
  1587. octane/chlorine
  1588. octane/chloroacetic acid methyl ester
  1589. octane/chloromethane
  1590. octane/chlorotrifluoromethane
  1591. octane/chlorotrioctylstannane
  1592. octane/cis-1,3-dimethylcyclohexane
  1593. octane/cis-decahydronaphthalene
  1594. octane/corn oil
  1595. octane/corn oil
  1596. octane/Cyanomethyl propanoate
  1597. octane/cyanomethyl-dimethyl-isopropylammonium bis(trifluoromethylsulfonyl)imide
  1598. octane/cyclodecane
  1599. octane/cycloheptane
  1600. octane/cycloheptanone
  1601. octane/cycloheptene
  1602. octane/cyclohexanecarbonitrile
  1603. octane/cyclohexanecarboxaldehyde
  1604. octane/cyclohexanecarboxylic acid methyl ester
  1605. octane/cyclohexylbenzene
  1606. octane/cyclooctane
  1607. octane/cyclopentane
  1608. octane/cyclopentanol
  1609. octane/cyclopentanone
  1610. octane/Deasphalted bitumen
  1611. octane/decahydro-3,5,1,7-(1,2,3,4)butanetetraylnaphthalene
  1612. octane/decahydronaphthalene
  1613. octane/decane
  1614. octane/decanedioic acid bis(2-ethylhexyl) ester
  1615. octane/decanedioic acid dihexyl ester
  1616. octane/decylcyclohexane
  1617. octane/deuterium
  1618. octane/diacetylferrocene
  1619. octane/dibenzofuran
  1620. octane/dibenzothiophene
  1621. octane/dibromomethane
  1622. octane/dichlorodifluoromethane
  1623. octane/dichlorodioctylstannane
  1624. octane/dichloromethane
  1625. octane/Didecyldimethylammonium perchlorate
  1626. octane/Didecyldimethylammonium tetrafluoroborate
  1627. octane/difluoroacetic acid 2-nitroethyl ester
  1628. octane/dihydro-1,3,5-trimethyl-1,3,5-triazine-2,4(1H,3H)-dione
  1629. octane/dihydro-2(3H)-furanone
  1630. octane/diiodomethane
  1631. octane/dimethyl disulfide
  1632. octane/dimethyl-(2-hydroxethyl)-isopropyl ammonium bis(trifluoromethylsulfonyl)imide
  1633. octane/dimethyl-propyl-isopropyl ammonium bis(trifluoromethylsulfonyl)imide
  1634. octane/dimethylbenzene
  1635. octane/dimethylcyanamide
  1636. octane/Dimethyldodecylphenoxyethylammonium bis(trifluoromethylsulfonyl)imide
  1637. octane/Dimethyldodecylphenoxyethylammonium dicyanamide
  1638. octane/dimethylphenol phosphate (3:1)
  1639. octane/Dimethylvinylethoxysilane
  1640. octane/diphenylethanedione
  1641. octane/diphenylmethanone
  1642. octane/docosane
  1643. octane/dodecafluoropentane
  1644. octane/dodecane
  1645. octane/dodecanoic acid methyl ester
  1646. octane/dodecylbenzene
  1647. octane/dotriacontane
  1648. octane/eicosafluorononane
  1649. octane/eicosane
  1650. octane/ethane
  1651. octane/ethanedioic acid didecyl ester
  1652. octane/ethanedioic acid diethyl ester
  1653. octane/ethanethiol
  1654. octane/ethanol
  1655. octane/ethene
  1656. octane/ethenylbenzene graft polymer with ethyl 2-methyl-2-propenoate
  1657. octane/ethoxypentafluorobenzene
  1658. octane/ethyl(2-methoxyethyl)dimethylammonium trifluoridotris(pentafluoroethyl)phosphate
  1659. octane/ethylcarbamic acid methyl ester
  1660. octane/ethylcyclohexane
  1661. octane/Ethylene glycol bis(trifluoroacetate)
  1662. octane/ethyne
  1663. octane/fluoranthene
  1664. octane/fluorobenzene
  1665. octane/formamide
  1666. octane/formic acid
  1667. octane/formic acid butyl ester
  1668. octane/formic acid pentyl ester
  1669. octane/formylbutanedioic acid dimethyl ester
  1670. octane/fuels diesel no. 1
  1671. octane/glycerol formal
  1672. octane/helium
  1673. octane/heneicosane
  1674. octane/heptafluorobutanoic acid 2,2-bis((2,2,3,3,4,4,4-heptafluoro-1-oxobutoxy)methyl)-1,3-propanediyl ester
  1675. octane/heptane
  1676. octane/heptanedioic acid dioctyl ester
  1677. octane/heptanoic acid anhydride
  1678. octane/hexachlorobenzene
  1679. octane/hexacosafluorododecane
  1680. octane/hexadecafluoro-n-heptane
  1681. octane/hexadecane
  1682. octane/hexadecanoic acid
  1683. octane/hexafluorobenzene
  1684. octane/hexafluoroethane
  1685. octane/hexahydro-1-methyl-2H-azepin-2-one
  1686. octane/hexamethylphosphoric triamide
  1687. octane/hexanal
  1688. octane/hexanedinitrile
  1689. octane/hexanedioic acid dimethyl ester
  1690. octane/hexanedioic acid dioctyl ester
  1691. octane/hexanedioic acid polymer with 1,2-propanediol
  1692. octane/hexanenitrile
  1693. octane/hexanoic acid
  1694. octane/hexanoic acid anhydride
  1695. octane/hexanoic acid copper(2+) salt
  1696. octane/hydrochloric acid
  1697. octane/hydrofluoric acid
  1698. octane/hydrogen
  1699. octane/hydrogen sulfide (H2S)
  1700. octane/iodine
  1701. octane/iodobenzene
  1702. octane/iodoethane
  1703. octane/iodomethane
  1704. octane/krypton
  1705. octane/l,9-di(N-naphthalen-2-ylmethylpyrrolidinium)nonane bis[(trifluoromethyl)sulfonylimide]
  1706. octane/mercury
  1707. octane/methane
  1708. octane/methanediol diacetate
  1709. octane/methanol
  1710. octane/methoxyacetic acid methyl ester
  1711. octane/Methyl (2Z)-2-methoxyimino-2-[2-[[(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]acetate
  1712. octane/Methyl 1,2-oxazinane-2-carboxylate
  1713. octane/Methyl 3-(dimethylcarbamoyl)-propanoate
  1714. octane/Methyl 5-(chloromethyl)-2-furoate
  1715. octane/methylphenylsilanediol homopolymer
  1716. octane/methyltris(2-methylpropyl)phosphonium salt with 4-methylbenzenesulfonic acid (1:1)
  1717. octane/N'-(3,4-dichlorophenyl)-N,N-dimethylurea
  1718. octane/N'-(4-chlorophenyl)-N,N-dimethylurea
  1719. octane/N,N'-Di(2-ethylhexyl)isobutyramide
  1720. octane/N,N,N',N'-tetramethyl-N,N'-diisopropyl-1,9-nonanediaminium bis(trifluoromethylsulfonyl)imide
  1721. octane/N,N,N',N'-Tetramethylglutaramide
  1722. octane/N,N,N-tributyl-1-butanaminium ethanesulfonate
  1723. octane/N,N,N-tributyl-1-butanaminium methanesulfonate
  1724. octane/N,N,N-tributyl-1-hexanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1725. octane/N,N,N-triethyl-1-octanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1726. octane/N,N,N-trimethyl-1-butanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1727. octane/N,N,N-trimethyl-1-decanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1728. octane/N,N,N-trimethyl-1-hexanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1729. octane/N,N,N-trimethyl-1-octanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1730. octane/N,N,N-trioctyl-1-octanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1731. octane/N,N-Di(2-hydroxyethyl)-2,3,4,5,6-pentafluoroaniline
  1732. octane/N,N-dibutyl-2,2-dimethylbutanamide
  1733. octane/N,N-dibutyl-2-ethylhexanamide
  1734. octane/N,N-dibutyl-N-methyl-1-butanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1735. octane/N,N-dibutylbenzenamine
  1736. octane/N,N-Diethyl-2,2,2-trifluoroacetamide
  1737. octane/N,N-diethyl-N-methyl-N-2-methoxyethyl ammonium bis(trifluoromethylsulfonyl)imide
  1738. octane/N,N-diethylacetamide
  1739. octane/N,N-diethylbenzenamine
  1740. octane/N,N-diethylethanamine
  1741. octane/N,N-dimethyl-1-naphthalenamine
  1742. octane/N,N-dimethyl-3-nitrobenzenamine
  1743. octane/N,N-dimethyl-4-(phenylazo)benzenamine
  1744. octane/N,N-dimethyl-4-nitrosobenzenamine
  1745. octane/N,N-Dimethyl-4-oxo-pentanamide
  1746. octane/N,N-dimethylacetamide
  1747. octane/N,N-Dimethylacetoacetamide
  1748. octane/N,N-dimethylbenzenamine
  1749. octane/N,N-dimethylformamide
  1750. octane/N,N-dimethylpropanamide
  1751. octane/N,N-Dimethyltrifluoroacetamide
  1752. octane/N,N-dioctyl-1-octanamine
  1753. octane/N,N-diphenylformamide
  1754. octane/N-(1-methylethyl)-N,N-dimethyl-1-hexanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1755. octane/N-(2-(N',N''-Dimethylamino)-ethoxyethyl)-N,N-(dimethyl)-1-propanaminium bis(trifluoromethylsulfonyl)imide
  1756. octane/N-(2-(N',N''-Dimethylamino)ethoxyethyl)-N,N-(dimethyl)-1-butanaminium bis(trifluoromethylsulfonyl)imide
  1757. octane/N-(2-(N',N''-Dimethylamino)ethyl)-N,N-(dimethyl)-1-butanaminium bis(trifluoromethylsulfonyl)imide
  1758. octane/N-(2-(N',N''-Dimethylamino)ethyl)-N,N-(dimethyl)-1-propanaminium bis(trifluoromethylsulfonyl)imide
  1759. octane/N-(2-methoxy-2-oxoethyl)-N-methylglycine methyl ester
  1760. octane/N-(2-methoxy-2-oxoethyl)glycine dimethyl ester
  1761. octane/N-(3-Cyanopropyl)-N-methylpyrrolidinium dicynamide
  1762. octane/N-(3-Cyanopropyl)pyridinium dicynamide
  1763. octane/N-Benzyl-N-dimethyl-N-tetradecylammonium cinnamate
  1764. octane/N-butyl-1-butanamine
  1765. octane/N-butyl-4-methylpyridinium thiocyanate
  1766. octane/N-butyl-N-methylpyrrolidinium salt with bis(fluorosulfonyl)imide
  1767. octane/N-Butyrylpiperidine
  1768. octane/N-Cyclohexylmethylpyridinium bis(trifluoromethylsulfonyl)imide
  1769. octane/N-ethyl-2-hydroxy-N,N-dimethyl-1-ethanaminium salt with phosphoric acid diethyl ester
  1770. octane/N-ethyl-2-hydroxy-N,N-dimethylethanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1771. octane/N-ethyl-N-methylmorpholinium bis(trifluoromethylsulfonyl)imide
  1772. octane/N-ethyl-N-methylmorpholinium dicyanamide
  1773. octane/N-ethyl-N-nitrosoethanamine
  1774. octane/N-ethylacetamide
  1775. octane/N-ethylformamide
  1776. octane/n-heptadecane
  1777. octane/n-hexatriacontane
  1778. octane/N-methoxyethylpyridinium bis(trifluoromethanesulfonyl)imide
  1779. octane/N-methyl-N,N-dioctyl-1-octanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1780. octane/N-Methyl-N-(2',3'-epoxypropyl)-2-oxopyrrolidinium chloride
  1781. octane/N-methyl-N-nitrosomethanamine
  1782. octane/N-methyl-N-octylmorpholinium bis(trifluoromethylsulfonyl)imide
  1783. octane/N-methyl-N-phenylformamide
  1784. octane/N-methylacetamide
  1785. octane/N-methylformamide
  1786. octane/N-methylpropanamide
  1787. octane/N-Octylpyridinium hexafluorophosphate
  1788. octane/N-phenylbenzenamine
  1789. octane/N-propyl-1-propanamine
  1790. octane/n-tetracosane
  1791. octane/N-Trichloroacetylpiperidine
  1792. octane/N-Triethyl-N-octylammonium bis(fluorosulfonyl)imide
  1793. octane/N-[2-(2-hydroxyethoxy)ethyl]-N-2-[2-(2-hydroxyethoxy)ethoxy]ethyl-N-methyl-1-tridecanaminium salt with sulfuric acid methyl ester (1:1)
  1794. octane/naphthalene
  1795. octane/natural rubber
  1796. octane/neon
  1797. octane/nitroacetic acid ethyl ester
  1798. octane/nitroacetic acid methyl ester
  1799. octane/nitrobenzene
  1800. octane/nitrocyclohexane
  1801. octane/nitroethane
  1802. octane/nitrogen
  1803. octane/nitromethane
  1804. octane/nitromethane-d3
  1805. octane/Nitrosoazetidine
  1806. octane/nonadecane
  1807. octane/nonadecylbenzene
  1808. octane/nonadecylcyclohexane
  1809. octane/nonane
  1810. octane/nonanedioic acid diheptyl ester
  1811. octane/nonanenitrile
  1812. octane/nonanoic acid methyl ester
  1813. octane/octacosane
  1814. octane/octadecafluorodecahydronaphthalene
  1815. octane/octadecafluorodecahydronaphthalene
  1816. octane/octadecafluorooctane
  1817. octane/octadecane
  1818. octane/octadecylcyclohexane
  1819. octane/octanedioic acid diheptyl ester
  1820. octane/octanedioic acid dihexyl ester
  1821. octane/octanoic acid copper(2+) salt
  1822. octane/olive oil
  1823. octane/olive oil
  1824. octane/Orange OT
  1825. octane/Oxiran-2-ylmethyl acetate
  1826. octane/oxiranemethanol
  1827. octane/oxygen
  1828. octane/paraffin
  1829. octane/pentadecane
  1830. octane/pentadecanenitrile
  1831. octane/pentadecanoic acid methyl ester
  1832. octane/pentadecylcyclohexane
  1833. octane/pentafluorobenzonitrile
  1834. octane/pentafluoronitrobenzene
  1835. octane/pentafluorophenol
  1836. octane/pentanedioic acid diethyl ester
  1837. octane/pentanedioic acid dimethyl ester
  1838. octane/pentanedioic acid dinonyl ester
  1839. octane/pentanoic acid anhydride
  1840. octane/pentanoic acid ethyl ester
  1841. octane/pentanoic acid methyl ester
  1842. octane/pentatriacontane
  1843. octane/Perfluorocyclohexane 1.2-dicarboxylic acid dimethyl ester
  1844. octane/phenanthrene
  1845. octane/phosphoric acid tributyl ester
  1846. octane/phosphoric acid triphenyl ester
  1847. octane/phosphoric acid tripropyl ester
  1848. octane/phosphoric acid tris(2-ethylhexyl) ester
  1849. octane/phosphoric acid tris(methylphenyl) ester
  1850. octane/phosphorous acid trimethyl ester
  1851. octane/Piperidine-1-carbothialdehyde
  1852. octane/poly(1,4-trans-isoprene)
  1853. octane/poly(1-phenylethylene)
  1854. octane/poly(2-chloro-1,3-butadiene)
  1855. octane/poly(carbonate) bisphenol-A
  1856. octane/poly(dimethylsiloxane)
  1857. octane/poly(eps-caprolactone)diol
  1858. octane/poly(iso-butyl methacrylate)
  1859. octane/poly(methyl cyanopropyl siloxane)
  1860. octane/poly(phenylmethyl 2-methylprop-2-enoate)
  1861. octane/poly(sec-butyl methacrylate)
  1862. octane/poly(tetramethylene oxide)
  1863. octane/poly(vinyl chloride)
  1864. octane/polyester
  1865. octane/polyesteramide
  1866. octane/polyetherurethane
  1867. octane/polyethylene
  1868. octane/polypropylene
  1869. octane/poly[oxy(1-oxo-1,6-hexanediyl)]
  1870. octane/poly[oxy-1,4-phenylenesulfonyl-1,4-phenyleneoxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene]
  1871. octane/propanal
  1872. octane/propane
  1873. octane/propanedioic acid didecyl ester
  1874. octane/propanoic acid
  1875. octane/propanoic acid butyl ester
  1876. octane/propanoic acid methyl ester
  1877. octane/pyrene
  1878. octane/pyridine 1-oxide
  1879. octane/pyridinium ethoxyethylsulfate
  1880. octane/pyrrole-2-carboxaldehyde
  1881. octane/quinoline
  1882. octane/refined sunflower oil
  1883. octane/selenium
  1884. octane/silicic acid (H4SiO4) tetramethyl ester
  1885. octane/siloxanes and silicones di-Me 1
  1886. octane/siloxanes and silicones di-Me 2
  1887. octane/Siloxanes and Silicones Me 3,3,3-trifluoropropyl
  1888. octane/silver(1+) compd. with N,N-dimethylbenzamide salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:2:1)
  1889. octane/silver(I)/propylamine bis(trifluoromethylsulfonyl)imide
  1890. octane/soybean oil
  1891. octane/soybean oil
  1892. octane/sucrose monopalmitate blend
  1893. octane/sucrose monostearate blend
  1894. octane/sulfinylbismethane
  1895. octane/sulfur
  1896. octane/sulfur dioxide
  1897. octane/sunflower oil
  1898. octane/sunflower oil
  1899. octane/Tetra-N-butylammonium hexanesulfonate
  1900. octane/Tetra-N-butylammonium pentanesulfonate
  1901. octane/Tetra-N-butylammonium propanesulfonate
  1902. octane/Tetrabutylphosphonium bis(trifluoromethylsulfonyl)imide
  1903. octane/tetrabutylstannane
  1904. octane/tetrachloroethene
  1905. octane/tetrachloromethane
  1906. octane/tetrachlorostannane
  1907. octane/tetradecafluorohexane
  1908. octane/tetradecane
  1909. octane/tetradecylbenzene
  1910. octane/tetradecylcyclohexane
  1911. octane/tetradodecylstannane
  1912. octane/tetraethylstannane
  1913. octane/tetrafluoromethane
  1914. octane/tetrahydro-2-furancarboxaldehyde
  1915. octane/tetrahydro-2-furancarboxylic acid methyl ester
  1916. octane/tetrahydro-2-furanmethanol
  1917. octane/tetrahydro-2-furonitrile
  1918. octane/tetrahydro-2-methylfuran
  1919. octane/tetrahydro-2H-pyran
  1920. octane/tetrahydro-2H-pyran-2-one
  1921. octane/tetrahydro-2H-thiopyran 1-oxide
  1922. octane/tetrahydro-3-furancarboxylic acid methyl ester
  1923. octane/tetrahydro-3-methylthiophene 1,1-dioxide
  1924. octane/tetrahydrothiophene 1,1-dioxide
  1925. octane/tetrahydrothiophene 1-oxide
  1926. octane/tetraiodostannane
  1927. octane/tetramethylstannane
  1928. octane/tetramethylurea
  1929. octane/Tetraoctylphosphonium bis{(trifluomethyl)sulfonyl}imide
  1930. octane/tetraoctylstannane
  1931. octane/tetrapentylstannane
  1932. octane/tetrapropylstannane
  1933. octane/tetratriacontane
  1934. octane/Thietan-3-yl acetate
  1935. octane/thietane 1-oxide
  1936. octane/thiobismethane
  1937. octane/thionyl chloride
  1938. octane/trans-poly(octenylene)
  1939. octane/triacontane
  1940. octane/tribromomethane
  1941. octane/tribromostibine
  1942. octane/Tributyl(2-methoxyethyl)phosphonium bis(trifluoromethanesulfonyl)imide
  1943. octane/tributylethylphosphonium diethyl hydrogen phosphate (1:1)
  1944. octane/tributylhexylphosphonium bis(trifluoromethylsulfonyl)imide
  1945. octane/tributylmethylphosphonium methylsulfate
  1946. octane/tributyltetradecylphosphonium salt with dodecylbenzenesulfonic acid (1:1)
  1947. octane/trichloroacetaldehyde
  1948. octane/trichloroacetic acid ethyl ester
  1949. octane/trichloromethane
  1950. octane/tricyclo[3.3.1.1(3,7)]decane
  1951. octane/tridecane
  1952. octane/tridecanoic acid methyl ester
  1953. octane/Triethyl (2-methoxyethyl) phosphonium bis(trifluoromethylsulfonyl)imide
  1954. octane/Triethyl(2-methoxyethyl)ammonium bis(trifluoromethanesulfonyl)imide
  1955. octane/triethylsulfonium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1956. octane/trifluoroacetic acid
  1957. octane/trifluoroacetic acid 2-nitroethyl ester
  1958. octane/trifluoroacetic acid anhydride
  1959. octane/trifluoromethane
  1960. octane/trifluoromethanesulfonic acid phenyl ester
  1961. octane/trihexyl tetradecyl phosphonium (1S)-(+)-10-camphorsulfonate
  1962. octane/trihexyl tetradecyl phosphonium L-lactate
  1963. octane/trihexyl tetradecyl phosphonium tricyanomethanide
  1964. octane/trihexyl(tetradecyl)phosphonium hexafluorophosphate(1-)
  1965. octane/trihexyl(tetradecyl)phosphonium trifluorotris(1,1,1,2,2,2-hexafluoroethyl)phosphate(1-)
  1966. octane/trihexyltetradecylphosphonium bis(2,4,4-trimethylpentyl)phosphinate
  1967. octane/trihexyltetradecylphosphonium bromide
  1968. octane/trihexyltetradecylphosphonium chloride
  1969. octane/trihexyltetradecylphosphonium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  1970. octane/trihexyltetradecylphosphonium tetrafluoroborate(1-)
  1971. octane/trioctylmethylphosphonium bis(trifluoromethylsulfonyl)imide
  1972. octane/tris(1-methoxy-2-methyl-3-octylimidazolium)propane tri(bis(trifluoromethylsulfonyl)imide)
  1973. octane/tris(1-methoxy-2-methyl-3-octylimidazolium)propane tri(tetrafluoroborate)
  1974. octane/tris(1-methoxy-3-benzylimidazolium)propane tri(bis(trifluoromethylsulfonyl)imide)
  1975. octane/tris(1-methoxy-3-methylimidazolium)propane tri(bis(trifluoromethylsulfonyl)imide)
  1976. octane/tris(1-methoxy-3-methylimidazolium)propane tri(dicyanamide)
  1977. octane/tris(1-methoxy-4-dimethylaminepyridinium)propane tri(bis(trifluoromethylsulfonyl)imide)
  1978. octane/tris(2,2,2-trifluoroethyl) phosphate
  1979. octane/Tris(2,4-ditert-butylphenyl) phosphite
  1980. octane/undecafluoro(trifluoromethyl)cyclohexane
  1981. octane/undecane
  1982. octane/undecanoic acid methyl ester
  1983. octane/water
  1984. octane/xenon
  1985. octane/xenon isotope of mass 133
  1986. octane/[(difluoromethyl)sulfonyl]benzene
  1987. octane/[(trifluoromethyl)sulfonyl]benzene
  1988. octanedinitrile/2-methyl-1,3-butadiene
  1989. octanedinitrile/benzene
  1990. octanedioic acid diethyl ester/water
  1991. octanedioic acid diheptyl ester/1-butanol
  1992. octanedioic acid dihexyl ester/2-butanone
  1993. octanedioic acid dimethyl ester/2-propanone
  1994. octanedioic acid disodium salt/water
  1995. octanedioic acid/1,1':2',1''-terphenyl
  1996. octanedioic acid/1,1':4',1''-terphenyl
  1997. octanedioic acid/1-butanol
  1998. octanedioic acid/1-pentanol
  1999. octanedioic acid/1-propanol
  2000. octanedioic acid/2,2-dimethylbutanedioic acid
  2001. octanedioic acid/2-propanol
  2002. octanedioic acid/2-propanone
  2003. octanedioic acid/3-methylpentanedioic acid
  2004. octanedioic acid/3-pyridinecarboxamide
  2005. octanedioic acid/acetic acid
  2006. octanedioic acid/benzene
  2007. octanedioic acid/ethanol
  2008. octanedioic acid/formic acid
  2009. octanedioic acid/hexadecanoic acid ethyl ester
  2010. octanedioic acid/methanol
  2011. octanedioic acid/octadecanoic acid
  2012. octanedioic acid/octadecanoic acid potassium salt
  2013. octanedioic acid/octadecanoic acid sodium salt
  2014. octanedioic acid/sulfuric acid
  2015. octanedioic acid/water
  2016. octanenitrile/(methylsulfinyl)(methylthio)methane
  2017. octanenitrile/2-methyl-1,3-butadiene
  2018. octanenitrile/2-methyl-2-butene
  2019. octanenitrile/acetic acid
  2020. octanenitrile/benzene
  2021. octanenitrile/methanol
  2022. octanenitrile/sulfinylbismethane
  2023. octanenitrile/water
  2024. octanoic acid 1,2,3-propanetriyl ester/(11bS)-2-(cyclohexanecarbonyl)-3,6,7,11b-tetrahydro-1H-pyrazino[6,1-a]isoquinolin-4-one
  2025. octanoic acid 1,2,3-propanetriyl ester/(3β)-cholest-5-en-3-ol
  2026. octanoic acid 1,2,3-propanetriyl ester/1,1,1,2-tetrafluoroethane
  2027. octanoic acid 1,2,3-propanetriyl ester/1,1,1-trichloroethane
  2028. octanoic acid 1,2,3-propanetriyl ester/1,1,2-trichloro-1,2,2-trifluoroethane
  2029. octanoic acid 1,2,3-propanetriyl ester/1,1-dichloroethane
  2030. octanoic acid 1,2,3-propanetriyl ester/1,1-difluoroethane
  2031. octanoic acid 1,2,3-propanetriyl ester/1,2,3-propanetriol
  2032. octanoic acid 1,2,3-propanetriyl ester/1,2-dichloro-1,1,2,2-tetrafluoroethane
  2033. octanoic acid 1,2,3-propanetriyl ester/1-butanol
  2034. octanoic acid 1,2,3-propanetriyl ester/1-chloro-1,1-difluoroethane
  2035. octanoic acid 1,2,3-propanetriyl ester/2-chloro-1,1,1-trifluoroethane
  2036. octanoic acid 1,2,3-propanetriyl ester/2-hydroxybenzoic acid
  2037. octanoic acid 1,2,3-propanetriyl ester/2-methylpropane
  2038. octanoic acid 1,2,3-propanetriyl ester/2-propanone
  2039. octanoic acid 1,2,3-propanetriyl ester/4-(2,3-dichlorophenyl)-1,4-dihydro-2,6-dimethyl-3,5-pyridinedicarboxylic acid ethyl methyl ester
  2040. octanoic acid 1,2,3-propanetriyl ester/benzene
  2041. octanoic acid 1,2,3-propanetriyl ester/butanoic acid 1,2,3-propanetriyl ester
  2042. octanoic acid 1,2,3-propanetriyl ester/chlorodifluoromethane
  2043. octanoic acid 1,2,3-propanetriyl ester/chloroethane
  2044. octanoic acid 1,2,3-propanetriyl ester/chloropentafluoroethane
  2045. octanoic acid 1,2,3-propanetriyl ester/chlorotrifluoromethane
  2046. octanoic acid 1,2,3-propanetriyl ester/decanoic acid 1,2,3-propanetriyl ester
  2047. octanoic acid 1,2,3-propanetriyl ester/dichlorodifluoromethane
  2048. octanoic acid 1,2,3-propanetriyl ester/dichloromethane
  2049. octanoic acid 1,2,3-propanetriyl ester/difluoromethane
  2050. octanoic acid 1,2,3-propanetriyl ester/ethane
  2051. octanoic acid 1,2,3-propanetriyl ester/ethene
  2052. octanoic acid 1,2,3-propanetriyl ester/hexadecanoic acid 1,2,3-propanetriyl ester
  2053. octanoic acid 1,2,3-propanetriyl ester/hexanoic acid 1,2,3-propanetriyl ester
  2054. octanoic acid 1,2,3-propanetriyl ester/methane
  2055. octanoic acid 1,2,3-propanetriyl ester/nitromethane
  2056. octanoic acid 1,2,3-propanetriyl ester/octadecanoic acid 1,2,3-propanetriyl ester
  2057. octanoic acid 1,2,3-propanetriyl ester/propane
  2058. octanoic acid 1,2,3-propanetriyl ester/tetrachloromethane
  2059. octanoic acid 1,2,3-propanetriyl ester/tetradecanoic acid
  2060. octanoic acid 1,2,3-propanetriyl ester/tetrafluoromethane
  2061. octanoic acid 1,2,3-propanetriyl ester/trichloroethene
  2062. octanoic acid 1,2,3-propanetriyl ester/trichlorofluoromethane
  2063. octanoic acid 1,2,3-propanetriyl ester/trichloromethane
  2064. octanoic acid 1,2,3-propanetriyl ester/trifluoromethane
  2065. octanoic acid 1,2,3-propanetriyl ester/water
  2066. octanoic acid 2,2-bis(((1-oxooctyl)oxy)methyl)-1,3-propanediyl ester/2,3,3,3-tetrafluoro-1-propene
  2067. octanoic acid 2,2-bis(((1-oxooctyl)oxy)methyl)-1,3-propanediyl ester/2-methylpropane
  2068. octanoic acid 2,2-bis(((1-oxooctyl)oxy)methyl)-1,3-propanediyl ester/3,3,3-trifluoro-1-propene
  2069. octanoic acid 2,3-dihydroxypropyl ester/hexadecanoic acid
  2070. octanoic acid butyl ester/nitroethane
  2071. octanoic acid cadmium(2+) salt/water
  2072. octanoic acid calcium salt/water
  2073. octanoic acid cobalt(2+) salt/octanoic acid cadmium(2+) salt
  2074. octanoic acid cobalt(2+) salt/octanoic acid lead(2+) salt
  2075. octanoic acid cobalt(2+) salt/octanoic acid zinc(2+) salt
  2076. octanoic acid cobalt(2+) salt/water
  2077. octanoic acid copper(2+) salt/water
  2078. octanoic acid dodecyl ester/acetonitrile
  2079. octanoic acid dodecyl ester/nitromethane
  2080. octanoic acid ethyl ester/(2E)-2-butenedioic acid dimethyl ester
  2081. octanoic acid ethyl ester/(3β)-cholest-5-en-3-ol
  2082. octanoic acid ethyl ester/(9Z)-9-octadecenoic acid ethyl ester
  2083. octanoic acid ethyl ester/(9Z,12Z)-9,12-octadecadienoic acid ethyl ester
  2084. octanoic acid ethyl ester/1,1'-thiobis(3-methylbutane)
  2085. octanoic acid ethyl ester/1,2,3-propanetriol
  2086. octanoic acid ethyl ester/1,2-dichloroethane
  2087. octanoic acid ethyl ester/1,2-ethanediol monoacetate
  2088. octanoic acid ethyl ester/1-butanol
  2089. octanoic acid ethyl ester/1-heptene
  2090. octanoic acid ethyl ester/1-hexene
  2091. octanoic acid ethyl ester/1-iodo-4-methylbenzene
  2092. octanoic acid ethyl ester/1-octanol
  2093. octanoic acid ethyl ester/1-pentanol
  2094. octanoic acid ethyl ester/1-propanol
  2095. octanoic acid ethyl ester/2-(2-ethoxyethoxy)ethanol acetate
  2096. octanoic acid ethyl ester/2-butanol
  2097. octanoic acid ethyl ester/2-butanone
  2098. octanoic acid ethyl ester/2-ethoxyphenol
  2099. octanoic acid ethyl ester/2-hydroxybenzoic acid
  2100. octanoic acid ethyl ester/2-hydroxybenzoic acid methyl ester
  2101. octanoic acid ethyl ester/2-hydroxypropanoic acid 3-methylbutyl ester
  2102. octanoic acid ethyl ester/2-methoxyphenol
  2103. octanoic acid ethyl ester/2-methyl-1-propanol
  2104. octanoic acid ethyl ester/2-methylphenol
  2105. octanoic acid ethyl ester/2-propanone
  2106. octanoic acid ethyl ester/3,4-dimethylphenol
  2107. octanoic acid ethyl ester/3-methyl-1-butanol
  2108. octanoic acid ethyl ester/3-pentanone
  2109. octanoic acid ethyl ester/4-(1-methoxy-1-methylethyl)-1-methylcyclohexene
  2110. octanoic acid ethyl ester/4-chlorophenol
  2111. octanoic acid ethyl ester/4-methyl-1,3-dioxolan-2-one
  2112. octanoic acid ethyl ester/4-methylphenol
  2113. octanoic acid ethyl ester/5-methyl-2-(1-methylethyl)cyclohexanol
  2114. octanoic acid ethyl ester/acetamide
  2115. octanoic acid ethyl ester/acetic acid
  2116. octanoic acid ethyl ester/acetic acid ethyl ester
  2117. octanoic acid ethyl ester/acetic acid phenyl ester
  2118. octanoic acid ethyl ester/acetic acid propyl ester
  2119. octanoic acid ethyl ester/benzene
  2120. octanoic acid ethyl ester/benzoic acid methyl ester
  2121. octanoic acid ethyl ester/butanal
  2122. octanoic acid ethyl ester/butanedioic acid dimethyl ester
  2123. octanoic acid ethyl ester/carbamic acid ethyl ester
  2124. octanoic acid ethyl ester/carbon dioxide
  2125. octanoic acid ethyl ester/cyclohexane
  2126. octanoic acid ethyl ester/decanoic acid ethyl ester
  2127. octanoic acid ethyl ester/dichlorodifluoromethane
  2128. octanoic acid ethyl ester/dichlorofluoromethane
  2129. octanoic acid ethyl ester/dodecane
  2130. octanoic acid ethyl ester/dodecanoic acid ethyl ester
  2131. octanoic acid ethyl ester/dodecanoic acid methyl ester
  2132. octanoic acid ethyl ester/ethanol
  2133. octanoic acid ethyl ester/ethylcyclohexane
  2134. octanoic acid ethyl ester/ethyloxirane
  2135. octanoic acid ethyl ester/heptane
  2136. octanoic acid ethyl ester/hexadecane
  2137. octanoic acid ethyl ester/hexadecanoic acid ethyl ester
  2138. octanoic acid ethyl ester/hexane
  2139. octanoic acid ethyl ester/methanol
  2140. octanoic acid ethyl ester/methylbenzene
  2141. octanoic acid ethyl ester/n-heptadecane
  2142. octanoic acid ethyl ester/naphthalene
  2143. octanoic acid ethyl ester/nonane
  2144. octanoic acid ethyl ester/octadecanoic acid ethyl ester
  2145. octanoic acid ethyl ester/pentadecane
  2146. octanoic acid ethyl ester/pentane
  2147. octanoic acid ethyl ester/propanamide
  2148. octanoic acid ethyl ester/propanoic acid
  2149. octanoic acid ethyl ester/tetradecanoic acid ethyl ester
  2150. octanoic acid ethyl ester/trichlorofluoromethane
  2151. octanoic acid ethyl ester/tridecane
  2152. octanoic acid ethyl ester/undecane
  2153. octanoic acid ethyl ester/water
  2154. octanoic acid hexadecyl ester/acetonitrile
  2155. octanoic acid hexadecyl ester/nitromethane
  2156. octanoic acid hexyl ester/nitromethane
  2157. octanoic acid lead(2+) salt/water
  2158. octanoic acid manganese(2+) salt/water
  2159. octanoic acid methyl ester/(2E)-2-butenedioic acid dimethyl ester
  2160. octanoic acid methyl ester/(9Z)-9-octadecenoic acid methyl ester
  2161. octanoic acid methyl ester/1,1,2,2-tetrachloroethane
  2162. octanoic acid methyl ester/1,2,3-propanetriol
  2163. octanoic acid methyl ester/1-butanol
  2164. octanoic acid methyl ester/1-heptanol
  2165. octanoic acid methyl ester/1-hexanol
  2166. octanoic acid methyl ester/1-methyl-4-(1-methylethenyl)cyclohexene
  2167. octanoic acid methyl ester/1-pentanol
  2168. octanoic acid methyl ester/1-propanol
  2169. octanoic acid methyl ester/2,6-dimethyl-2,5-heptadien-4-one
  2170. octanoic acid methyl ester/2-furancarboxaldehyde
  2171. octanoic acid methyl ester/2-methylphenol
  2172. octanoic acid methyl ester/2-propanone
  2173. octanoic acid methyl ester/3-methylbutanoic acid 3-methylbutyl ester
  2174. octanoic acid methyl ester/3-oxobutanoic acid ethyl ester
  2175. octanoic acid methyl ester/acetamide
  2176. octanoic acid methyl ester/acetic acid butyl ester
  2177. octanoic acid methyl ester/acetic acid ethyl ester
  2178. octanoic acid methyl ester/acetonitrile
  2179. octanoic acid methyl ester/benzene
  2180. octanoic acid methyl ester/benzoic acid methyl ester
  2181. octanoic acid methyl ester/carbamic acid ethyl ester
  2182. octanoic acid methyl ester/chloroacetic acid
  2183. octanoic acid methyl ester/decane
  2184. octanoic acid methyl ester/dodecanoic acid methyl ester
  2185. octanoic acid methyl ester/ethanedioic acid diethyl ester
  2186. octanoic acid methyl ester/heptane
  2187. octanoic acid methyl ester/hexadecanoic acid methyl ester
  2188. octanoic acid methyl ester/hexanoic acid
  2189. octanoic acid methyl ester/methanol
  2190. octanoic acid methyl ester/n-heptadecane
  2191. octanoic acid methyl ester/nonane
  2192. octanoic acid methyl ester/octadecanoic acid methyl ester
  2193. octanoic acid methyl ester/octane
  2194. octanoic acid methyl ester/pentadecane
  2195. octanoic acid methyl ester/tetrabutylammonium 2-(bis(2-hydroxyethyl)amino)ethanesulfonate
  2196. octanoic acid methyl ester/Tetrabutylammonium 2-(cyclohexylamino)ethanesulfonate
  2197. octanoic acid methyl ester/tetrabutylammonium 2-hydroxy-3-morpholinopropanesulfonate
  2198. octanoic acid methyl ester/tetradecanoic acid methyl ester
  2199. octanoic acid methyl ester/Tetraethylammonium 2-(cyclohexylamino)ethanesulfonate
  2200. octanoic acid methyl ester/Tetraethylammonium 2-hydroxy-4-morpholinopropanesulfonate
  2201. octanoic acid methyl ester/Tetrapropylammonium 2-(cyclohexylamino)ethanesulfonate
  2202. octanoic acid methyl ester/trichloromethane
  2203. octanoic acid methyl ester/tridecane
  2204. octanoic acid methyl ester/undecane
  2205. octanoic acid methyl ester/water
  2206. octanoic acid nickel(2+) salt/water
  2207. octanoic acid octyl ester/acetonitrile
  2208. octanoic acid octyl ester/nitromethane
  2209. octanoic acid potassium salt/nitrous acid potassium salt
  2210. octanoic acid sodium salt/1,2-propanediol
  2211. octanoic acid sodium salt/formamide
  2212. octanoic acid sodium salt/water
  2213. octanoic acid tetradecyl ester/acetonitrile
  2214. octanoic acid tetradecyl ester/nitromethane
  2215. octanoic acid zinc(2+) salt/water
  2216. octanoic acid/α-methyl-4-(2-methylpropyl)benzeneacetic acid
  2217. octanoic acid/(1'S-trans)-7-chloro-2',4,6-trimethoxy-6'-methylspiro[benzofuran-2(3H),1'-(2)cyclohexene]-3,4'-dione
  2218. octanoic acid/(1,1'-biphenyl)-4,4'-diamine
  2219. octanoic acid/(11bS)-2-(cyclohexanecarbonyl)-3,6,7,11b-tetrahydro-1H-pyrazino[6,1-a]isoquinolin-4-one
  2220. octanoic acid/(1R-(1α,2β,5α))-5-methyl-2-(1-methylethyl)cyclohexanol
  2221. octanoic acid/(2E)-2-butenedioic acid diethyl ester
  2222. octanoic acid/(2Z)-2-butenedioic acid diethyl ester
  2223. octanoic acid/(3β)-cholest-5-en-3-ol
  2224. octanoic acid/(S)-6-methoxy-α-methyl-2-naphthaleneacetic acid
  2225. octanoic acid/1,2,3-propanetriol
  2226. octanoic acid/1,2-dimethylbenzene
  2227. octanoic acid/1,3-dioxane
  2228. octanoic acid/1,3-dioxolane
  2229. octanoic acid/1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indole-3-acetic acid
  2230. octanoic acid/1-butanol
  2231. octanoic acid/1-chloronaphthalene
  2232. octanoic acid/1-chloropentane
  2233. octanoic acid/1-heptene
  2234. octanoic acid/1-hexene
  2235. octanoic acid/1-methyl-2-nitrobenzene
  2236. octanoic acid/1-methyl-3-nitrobenzene
  2237. octanoic acid/1-methyl-4-nitrobenzene
  2238. octanoic acid/1-methylnaphthalene
  2239. octanoic acid/1-propanol
  2240. octanoic acid/1-[di(phenyl)methyl]-4-(3-phenylprop-2-enyl)piperazine
  2241. octanoic acid/2-butanone
  2242. octanoic acid/2-furancarboxaldehyde
  2243. octanoic acid/2-methyl-5-(1-methylethyl)phenol
  2244. octanoic acid/2-methylnaphthalene
  2245. octanoic acid/2-propanol
  2246. octanoic acid/2-propanone
  2247. octanoic acid/2-[4-(4-chlorobenzoyl)phenoxy]-2-methylpropanoic acid 1-methylethyl ester
  2248. octanoic acid/3,4-dimethylphenol
  2249. octanoic acid/3-methyl-1-butanol carbonate (2:1)
  2250. octanoic acid/3-pentanone
  2251. octanoic acid/4-(1-methoxy-1-methylethyl)-1-methylcyclohexene
  2252. octanoic acid/4-(2,3-dichlorophenyl)-1,4-dihydro-2,6-dimethyl-3,5-pyridinedicarboxylic acid ethyl methyl ester
  2253. octanoic acid/5-(2-propenyl)-1,3-benzodioxole
  2254. octanoic acid/5-methyl-2-(1-methylethyl)cyclohexanol
  2255. octanoic acid/5-methyl-2-(1-methylethyl)phenol
  2256. octanoic acid/5H-dibenz[b,f]azepine-5-carboxamide
  2257. octanoic acid/acetamide
  2258. octanoic acid/acetic acid
  2259. octanoic acid/acetic acid 1,1-dimethylethyl ester
  2260. octanoic acid/acetic acid ethyl ester
  2261. octanoic acid/acetonitrile
  2262. octanoic acid/benzene
  2263. octanoic acid/carbon dioxide
  2264. octanoic acid/decanoic acid
  2265. octanoic acid/dodecanoic acid
  2266. octanoic acid/dodecanoic acid sodium salt
  2267. octanoic acid/endo-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol acetate
  2268. octanoic acid/ethanol
  2269. octanoic acid/heptane
  2270. octanoic acid/hexanoic acid
  2271. octanoic acid/methanol
  2272. octanoic acid/N,N,N-tributyl-1-butanaminium bromide
  2273. octanoic acid/naphthalene
  2274. octanoic acid/nitrobenzene
  2275. octanoic acid/nitroethane
  2276. octanoic acid/nitromethane
  2277. octanoic acid/oxygen
  2278. octanoic acid/perchloric acid lithium salt
  2279. octanoic acid/propane
  2280. octanoic acid/tetrachloromethane
  2281. octanoic acid/tetradecanoic acid
  2282. octanoic acid/tetrahydro-2H-pyran
  2283. octanoic acid/trichloromethane
  2284. octanoic acid/water
  2285. octatriacontane/propane
  2286. octenal/1-butanol
  2287. octenal/water
  2288. octyl-β-D-glucopyranoside/water
  2289. octyl-18-crown-6/water
  2290. octylazanium acetate/Cyclosporin A
  2291. octylbenzene/(methylsulfinyl)(methylthio)methane
  2292. octylbenzene/1,1,1,2-tetrafluoroethane
  2293. octylbenzene/1,1,2,2-tetrabromoethane
  2294. octylbenzene/hexadecane
  2295. octylbenzene/hexahydro-1-methyl-2H-azepin-2-one
  2296. octylbenzene/poly(1-phenylethylene)
  2297. octylbenzene/sulfinylbismethane
  2298. octylbenzene/trifluoromethane
  2299. octylcyclohexane/benzene
  2300. octylcyclohexane/hexadecane
  2301. octylcyclohexane/octylbenzene
  2302. octyloxirane/1-decene
  2303. octylpropanedioic acid/water
  2304. oleanolic acid/1-butanol
  2305. oleanolic acid/2-propanol
  2306. oleanolic acid/2-propanone
  2307. oleanolic acid/ethanol
  2308. oleanolic acid/methanol
  2309. oleanolic acid/octadecanoic acid
  2310. oleanolic acid/water
  2311. oligotose/water
  2312. olive oil biodiesel/Jet fuel JP-5
  2313. olive oil/5-methyl-2-(1-methylethyl)phenol
  2314. omeprazole/acetonitrile
  2315. omeprazole/water
  2316. orange peel oil/ethane
  2317. ortho-deuterium/para-deuterium
  2318. osmium/indium
  2319. osmium/palladium
  2320. osmium/rhenium
  2321. osmium/ruthenium
  2322. osmium/titanium
  2323. oxacyclohexadecan-2-one/carbon dioxide
  2324. oxaldehydic acid/water
  2325. oxazole/acetonitrile
  2326. oxazole/thiazole
  2327. oxazole/water
  2328. oxepane/argon
  2329. oxepane/deuterium
  2330. oxepane/ethane
  2331. oxepane/ethene
  2332. oxepane/helium
  2333. oxepane/krypton
  2334. oxepane/methane
  2335. oxepane/neon
  2336. oxepane/nitrogen
  2337. oxepane/sulfinylbismethane
  2338. oxepane/tetrafluoromethane
  2339. oxepane/water
  2340. oxepane/xenon
  2341. oxetane/benzene
  2342. oxetane/sulfinylbismethane
  2343. oxetane/water
  2344. oxirane/1,1-dichloroethane
  2345. oxirane/1,3-dioxolan-2-one
  2346. oxirane/2-methyl-1-propanol
  2347. oxirane/2-methylbutane
  2348. oxirane/2-methylpropane
  2349. oxirane/bromine
  2350. oxirane/chlorine
  2351. oxirane/methyloxirane
  2352. oxirane/nitrogen
  2353. oxirane/water
  2354. oxirane/water-d2
  2355. oxiranemethanol/(1,1-dimethylethyl)benzene
  2356. oxiranemethanol/(1-methylethyl)benzene
  2357. oxiranemethanol/1-hexene
  2358. oxiranemethanol/1-phenylethanone
  2359. oxiranemethanol/benzene
  2360. oxiranemethanol/hexadecanoic acid
  2361. oxiranemethanol/octadecanoic acid
  2362. oxiranemethanol/water
  2363. oxo(sulfato(2-)-O)vanadium/water
  2364. oxo(sulphato(2-)-κO,κO')titanium/sulfinylbismethane
  2365. oxo(sulphato(2-)-κO,κO')titanium/water
  2366. oxobismuth hydrochloride/benzoyl chloride
  2367. oxobutanedioic acid/2-oxopentanedioic acid
  2368. oxolan-3-ol/water
  2369. oxonium tetrafluoroborate(1-)/trifluorodihydrateborane
  2370. oxybis(chloromethane)/1-methyl-1H-pyrrole
  2371. oxybis(chloromethane)/2,2'-thiobispropane
  2372. oxybis(chloromethane)/benzene
  2373. oxybis(chloromethane)/carbon disulfide
  2374. oxybis(chloromethane)/hydrochloric acid
  2375. oxybis(chloromethane)/tetrachloromethane
  2376. oxybis(diethylborane)/triethylborane
  2377. oxybis(difluoromethane)/1,1,2-trifluoroethane
  2378. oxybis(methane-d3)/1-butene polymer with ethene
  2379. oxybis(methoxymethane)/1-butanol
  2380. oxybis(methoxymethane)/1-propanol
  2381. oxybis(methoxymethane)/methanol
  2382. oxybis(methoxymethane)/tetramethylene glycoldimethyl ether
  2383. oxybis(methoxymethane)/water
  2384. oxybis(methoxypropane)/1,3-bis(1-methylethyl)benzene
  2385. oxybis(methoxypropane)/1-butanol
  2386. oxybis(methoxypropane)/1-pentanol
  2387. oxybis(methoxypropane)/1-propanol
  2388. oxybis(methoxypropane)/2-butanol
  2389. oxybis(methoxypropane)/2-propanol
  2390. oxybis(methoxypropane)/3-oxobutanoic acid ethyl ester
  2391. oxybis(methoxypropane)/acetic acid butyl ester
  2392. oxybis(methoxypropane)/acetic acid ethyl ester
  2393. oxybis(methoxypropane)/acetic acid methyl ester
  2394. oxybis(methoxypropane)/carbon dioxide
  2395. oxybis(methoxypropane)/methanol
  2396. oxybis(methoxypropane)/water
  2397. oxybis(trifluoromethane)/N,N-diethylethanesulfonamide
  2398. oxybis(trifluoromethane)/N,N-diethylmethanesulfonamide
  2399. oxybis(trifluoromethane)/N,N-dimethylethanesulfonamide
  2400. oxybis(trifluoromethane)/tetraethylsulfamide
  2401. oxybismethane/±-2-pentanol
  2402. oxybismethane/±-3,6-dimethyl-1,4-dioxane-2,5-dione homopolymer
  2403. oxybismethane/(3S,6S)-3,6-dimethyl-1,4-dioxane-2,5-dione polymer with 2,2-bis(4-glycidyloxyphenyl)propane and 4,4'-methylethylidenebisphenol
  2404. oxybismethane/(3S,6S)-3,6-dimethyl-1,4-dioxane-2,5-dione polymer with 2,2-bis(4-glycidyloxyphenyl)propane and 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]bisphenol
  2405. oxybismethane/1,1'-(1,1,1,3,3,3-hexafluoro-2,2-propanediyl)bis{4-[(trifluoroethenyl)oxy]benzene} homopolymer
  2406. oxybismethane/1,1'-oxybisoctane
  2407. oxybismethane/1,1'-thiobisethane
  2408. oxybismethane/1,1,1,2,2,3,3-heptafluoropropane
  2409. oxybismethane/1,1,1,2,3,3,3-heptafluoropropane
  2410. oxybismethane/1,1,1,2,3,3-hexafluoropropane
  2411. oxybismethane/1,1,1,2-tetrafluoroethane
  2412. oxybismethane/1,1,1,3,3,3-hexafluoropropane
  2413. oxybismethane/1,1,1-trifluoroethane
  2414. oxybismethane/1,1,1-trifluoropropane
  2415. oxybismethane/1,1,2,2-tetrafluoroethane
  2416. oxybismethane/1,2-dihydro-1,5-dimethyl-2-phenyl-3H-pyrazol-3-one
  2417. oxybismethane/1,2-dimethylbenzene
  2418. oxybismethane/1,3-butadiene homopolymer
  2419. oxybismethane/1-butanol
  2420. oxybismethane/1-butene polymer with ethene
  2421. oxybismethane/1-butyl-3-methyl-1H-imidazolium hexafluorophosphate(1-)
  2422. oxybismethane/1-butyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  2423. oxybismethane/1-butyl-3-methyl-1H-imidazolium tetrafluoroborate(1-)
  2424. oxybismethane/1-chloro-1,1-difluoroethane
  2425. oxybismethane/1-chloro-4-ethenylbenzene homopolymer
  2426. oxybismethane/1-decene
  2427. oxybismethane/1-ethenyl-4-[(decyloxy)methyl]benzene homopolymer
  2428. oxybismethane/1-pentanol
  2429. oxybismethane/1-propanol
  2430. oxybismethane/2,2,2-trichloroethanol
  2431. oxybismethane/2,4-dimethyl-3-pentanone
  2432. oxybismethane/2-butanol
  2433. oxybismethane/2-chloro-1,1,1,2-tetrafluoroethane
  2434. oxybismethane/2-hydroxybenzoic acid
  2435. oxybismethane/2-hydroxybenzoic acid methyl ester
  2436. oxybismethane/2-methoxy-2-methylpropane
  2437. oxybismethane/2-methyl-1-butanol
  2438. oxybismethane/2-methyl-1-propanol
  2439. oxybismethane/2-methyl-1-propene homopolymer
  2440. oxybismethane/2-methyl-2-butanol
  2441. oxybismethane/2-methyl-2-propanethiol
  2442. oxybismethane/2-methyl-2-propanol
  2443. oxybismethane/2-methyl-2-propenoic acid 2,2-dimethylpropyl ester homopolymer
  2444. oxybismethane/2-methyl-2-propenoic acid 2-(dimethylamino)ethyl ester homopolymer
  2445. oxybismethane/2-methyl-2-propenoic acid 2-ethylhexyl ester homopolymer
  2446. oxybismethane/2-methyl-2-propenoic acid 2-hydroxypropyl ester homopolymer
  2447. oxybismethane/2-methyl-2-propenoic acid dodecyl ester homopolymer
  2448. oxybismethane/2-methyl-2-propenoic acid isodecyl ester homopolymer
  2449. oxybismethane/2-methyl-2-propenoic acid propyl ester homopolymer
  2450. oxybismethane/2-methyl-2-propenoic acid rel-(1R,2R,4R)-1,7,7-trimethylbicyclo[2.2.1]hept-2-yl ester homopolymer
  2451. oxybismethane/2-methyl-3-buten-2-ol
  2452. oxybismethane/2-methylbutane
  2453. oxybismethane/2-methylphenol
  2454. oxybismethane/2-methylpropane
  2455. oxybismethane/2-propanol
  2456. oxybismethane/2-propanone
  2457. oxybismethane/2-propenoic acid 1-methylethyl ester homopolymer
  2458. oxybismethane/2-propenoic acid 2-ethylhexyl ester homopolymer
  2459. oxybismethane/2-propenoic acid 2-hydroxypropyl ester homopolymer
  2460. oxybismethane/2-propenoic acid decyl ester homopolymer
  2461. oxybismethane/2-propenoic acid dodecyl ester homopolymer
  2462. oxybismethane/2-propenoic acid isodecyl ester homopolymer
  2463. oxybismethane/2-propenoic acid isooctyl ester homopolymer
  2464. oxybismethane/2-propenoic acid octyl ester homopolymer
  2465. oxybismethane/2-propenoic acid propyl ester homopolymer
  2466. oxybismethane/3-methyl-1-butanol
  2467. oxybismethane/3-methyl-3-buten-1-ol
  2468. oxybismethane/3-pentanol
  2469. oxybismethane/4,4'-bis[(1,2,2-trifluoroethenyl)oxy]-1,1'-biphenyl homopolymer
  2470. oxybismethane/4-[(decylsulfonyl)methyl]-1-ethenylbenzene homopolymer
  2471. oxybismethane/4-[(decylthio)methyl]-1-ethenylbenzene homopolymer
  2472. oxybismethane/acetic acid
  2473. oxybismethane/acetic acid methyl ester
  2474. oxybismethane/air
  2475. oxybismethane/ammonia
  2476. oxybismethane/argon
  2477. oxybismethane/arsenous tribromide
  2478. oxybismethane/athabasca bitumen
  2479. oxybismethane/benzenamine
  2480. oxybismethane/benzene
  2481. oxybismethane/butanoic acid 2,2-bis((1-oxobutoxy)methyl)-1,3-propanediyl ester
  2482. oxybismethane/carbon dioxide
  2483. oxybismethane/carbon disulfide
  2484. oxybismethane/carbon monoxide
  2485. oxybismethane/carbonic acid dimethyl ester
  2486. oxybismethane/cellulose ethyl ether
  2487. oxybismethane/chlorodifluoromethane
  2488. oxybismethane/chloromethane
  2489. oxybismethane/decafluoro-n-butane
  2490. oxybismethane/decane
  2491. oxybismethane/dichloroacetic acid
  2492. oxybismethane/dichlorodifluoromethane
  2493. oxybismethane/difluoromethane
  2494. oxybismethane/emkarate RL 32S
  2495. oxybismethane/ethane
  2496. oxybismethane/ethanol
  2497. oxybismethane/ethene
  2498. oxybismethane/ethyne
  2499. oxybismethane/heptanoic acid 2,2-bis(((1-oxoheptyl)oxy)methyl)-1,3-propanediyl ester
  2500. oxybismethane/hexadecanoic acid 1,2,3-propanetriyl ester
  2501. oxybismethane/hexafluorobenzene
  2502. oxybismethane/hexahydro-1-methyl-2H-azepin-2-one
  2503. oxybismethane/hexanoic acid
  2504. oxybismethane/hexanoic acid 2,2-bis(((1-oxohexyl)oxy)methyl)-1,3-propanediyl ester
  2505. oxybismethane/hydrochloric acid
  2506. oxybismethane/hydrogen
  2507. oxybismethane/hydrogen sulfide (H2S)
  2508. oxybismethane/iodobenzene
  2509. oxybismethane/iodomethane
  2510. oxybismethane/krypton
  2511. oxybismethane/liquid paraffin
  2512. oxybismethane/methanamine
  2513. oxybismethane/methane
  2514. oxybismethane/methanethiol
  2515. oxybismethane/methanol
  2516. oxybismethane/N,N-dimethylbenzenamine
  2517. oxybismethane/N,N-dimethylformamide
  2518. oxybismethane/nitrobenzene
  2519. oxybismethane/nitrogen
  2520. oxybismethane/nonanoic acid 2,2-bis(((1-oxononyl)oxy)methyl)-1,3-propanediyl ester
  2521. oxybismethane/octafluoropropane
  2522. oxybismethane/octanoic acid 2,2-bis(((1-oxooctyl)oxy)methyl)-1,3-propanediyl ester
  2523. oxybismethane/oxygen
  2524. oxybismethane/pentafluoroethane
  2525. oxybismethane/pentanoic acid 2,2-bis(((1-oxopentyl)oxy)methyl)-1,3-propanediyl ester
  2526. oxybismethane/poly(1-phenylethylene)
  2527. oxybismethane/poly(2-butoxyethyl acrylate)
  2528. oxybismethane/poly(2-methoxyethyl acrylate)
  2529. oxybismethane/poly(2-phenylethyl methacrylate)
  2530. oxybismethane/poly(dimethylsiloxane)
  2531. oxybismethane/poly(isobornyl acrylate)
  2532. oxybismethane/poly(phenyl methacrylate)
  2533. oxybismethane/poly(tert-butylaminoethyl methacrylate)
  2534. oxybismethane/poly(tetrahydrofurfuryl acrylate)
  2535. oxybismethane/poly(tridecyl methacrylate)
  2536. oxybismethane/poly(vinyl stearate)
  2537. oxybismethane/polyester
  2538. oxybismethane/poly[2-(2-ethoxyethoxy)ethyl acrylate]
  2539. oxybismethane/poly[oxy((1S)-1-methyl-2-oxo-1,2-ethanediyl)]
  2540. oxybismethane/poly[oxy(1-oxo-1,6-hexanediyl)]
  2541. oxybismethane/poly[p-perfluorooctyl(ethyleneoxy)methylstyrene]
  2542. oxybismethane/poly[p-perfluorooctyl(ethylenesulfonyl)methylstyrene]
  2543. oxybismethane/poly[p-perfluorooctyl(ethylenethio)methylstyrene]
  2544. oxybismethane/propane
  2545. oxybismethane/quinoline
  2546. oxybismethane/soybean oil
  2547. oxybismethane/sulfur dioxide
  2548. oxybismethane/sulfuric acid
  2549. oxybismethane/tetrachloromethane
  2550. oxybismethane/tetrahydro-2H-pyran
  2551. oxybismethane/thiobismethane
  2552. oxybismethane/trichloromethane
  2553. oxybismethane/trifluoroborane
  2554. oxybismethane/trifluoromethane
  2555. oxybismethane/trihexyltetradecylphosphonium chloride
  2556. oxybismethane/water
  2557. oxybismethane/xenon
  2558. oxybispropanediol/1-butanol
  2559. oxybispropanediol/1-nitrobutane
  2560. oxybispropanediol/1-pentanol
  2561. oxybispropanediol/1-propanol
  2562. oxybispropanediol/ethanol
  2563. oxybispropanediol/methanol
  2564. oxybispropanediol/nitroethane
  2565. oxybispropanediol/nitromethane
  2566. oxybispropanediol/tetrahydro-2-methylfuran
  2567. oxybispropanediol/water
  2568. oxybispropanol/(3β)-cholest-5-en-3-ol
  2569. oxybispropanol/(phenoxymethyl)benzene
  2570. oxybispropanol/1,1'-oxybis(3-methylbutane)
  2571. oxybispropanol/1,2-dimethoxy-4-(2-propenyl)benzene
  2572. oxybispropanol/1,2-dimethylbenzene
  2573. oxybispropanol/1,2-propanediol
  2574. oxybispropanol/1,3,3-trimethyl-2-oxabicyclo[2.2.2]octane
  2575. oxybispropanol/1-bromo-2-methoxybenzene
  2576. oxybispropanol/1-bromo-4-ethoxybenzene
  2577. oxybispropanol/1-methyl-2-nitrobenzene
  2578. oxybispropanol/1-methyl-4-nitrobenzene
  2579. oxybispropanol/1-propyne
  2580. oxybispropanol/2,3-dibromo-1-propanol
  2581. oxybispropanol/2-hydroxybenzoic acid 3-methylbutyl ester
  2582. oxybispropanol/2-methylpropane
  2583. oxybispropanol/2-methylquinoline
  2584. oxybispropanol/2-nitrophenol
  2585. oxybispropanol/5-(2-propenyl)-1,3-benzodioxole
  2586. oxybispropanol/benzene
  2587. oxybispropanol/carbonic acid dimethyl ester
  2588. oxybispropanol/carbonic acid dimethyl ester
  2589. oxybispropanol/ethane
  2590. oxybispropanol/ethanol
  2591. oxybispropanol/ethene
  2592. oxybispropanol/hydrogen sulfide (H2S)
  2593. oxybispropanol/methane
  2594. oxybispropanol/naphthalene
  2595. oxybispropanol/naphthalene
  2596. oxybispropanol/propane
  2597. oxybispropanol/quinoline
  2598. oxybispropanol/urea
  2599. oxybispropanol/water
  2600. oxybispropanol/water
  2601. oxygen(-2) anion; terbium(+3) cation/hafnium oxide (HfO2)
  2602. oxygen/(1-methylethyl)benzene
  2603. oxygen/1,1,1,2,2,3,3,4,4,5,5,6,6,9,9,10,10,11,11,12,12,13,13,14,14,14-hexacosafluorotetradecane
  2604. oxygen/1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorooctane
  2605. oxygen/1,1,1,2,2,3,3,4,4,7,7,8,8,9,9,10,10,10-octadecafluoro-5-decene
  2606. oxygen/1,1,1,2,2,3,3,4,4,7,7,8,8,9,9,10,10,11,11,12,12,12-docosafluoro-5-dodecene
  2607. oxygen/1,1,1,2,2,5,5,6,6,7,7,8,8,8-tetradecafluoro-3-octene
  2608. oxygen/1,1,1,2,2,5,5,6,6,7,7,8,8,9,9,10,10,10-octadecafluoro-3-decene
  2609. oxygen/1,1,1,2,5,5,6,6,7,7,8,8,8-tridecafluoro-2-(trifluoromethyl)-3-octene
  2610. oxygen/1,1,1,2,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluoro-2-(trifluoromethyl)-3-decene
  2611. oxygen/1,1,1,3,3,3-hexafluoro-2-propanol
  2612. oxygen/1,1,2,2-tetrachloroethane
  2613. oxygen/1,2,4-trimethylbenzene
  2614. oxygen/1,2-benzenedicarboxylic acid dibutyl ester
  2615. oxygen/1,2-dimethylbenzene
  2616. oxygen/1,3,4,6,7,8-Hexahydro-1-methyl-2H-pyrimidol[1,2-α]pyrimidine bis(trifluoromethylsulfonyl)imide
  2617. oxygen/1,3,4,6,7,8-Hexahydro-1-methyl-2H-pyrimido[1,2-a]pyrimidinium perfluoropropinoyl(trifluoromethylsulfonyl)imide
  2618. oxygen/1-(2-methoxyethyl)-1-methylpiperidinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  2619. oxygen/1-(2-phenylethyl)-3-methylidimazolium bis(trifluoromethylsulfonyl)imide
  2620. oxygen/1-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  2621. oxygen/1-(cyanomethyl)-3-methyl-1H-imidazol-3-ium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  2622. oxygen/1-butyl-1H-imidazolium acetate
  2623. oxygen/1-butyl-3-methyl-1H-imidazolium salt with heptafluorobutanoic acid (1:1)
  2624. oxygen/1-Butyl-3-methyl-imidazolium perfluoropropanoyl(trifluoromethylsulfonyl)imide
  2625. oxygen/1-butyltetrahydrothiophenium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  2626. oxygen/1-methyl-4-(1-methylethyl)benzene
  2627. oxygen/1-propyl-3-methyl-1H-imidazolium tris(heptafluoropropyl)trifluorophosphate
  2628. oxygen/2,2,3,3,4,4,5,5,6,6-decafluoro-1-(trifluoromethyl)piperidine
  2629. oxygen/2-butanol
  2630. oxygen/2-butanone
  2631. oxygen/2-methyl-1,3-butadiene
  2632. oxygen/2-methyl-1-propanol
  2633. oxygen/2-methyl-2-propenal
  2634. oxygen/2-methyl-2-propenoic acid methyl ester
  2635. oxygen/2-methylbenzenamine
  2636. oxygen/2-methylbutane
  2637. oxygen/2-methylpropanal
  2638. oxygen/3-pentanone
  2639. oxygen/acetic acid methyl ester
  2640. oxygen/benzine (mixture)
  2641. oxygen/Bis(trifluoromethyl)benzene
  2642. oxygen/blood (whole) serum
  2643. oxygen/blood serum
  2644. oxygen/chlorine
  2645. oxygen/corn oil biodiesel
  2646. oxygen/cottonseed oil
  2647. oxygen/decahydronaphthalene
  2648. oxygen/diethyl-methyl-butylammonium bis(trifluoromethylsulfonyl)imide
  2649. oxygen/dihydro-2(3H)-furanone
  2650. oxygen/hydrogen sulfide (H2S)
  2651. oxygen/hydrogenated cottonseed oil shortening
  2652. oxygen/kerosene
  2653. oxygen/L-1822 fluorocarbon
  2654. oxygen/methylcyclopentane
  2655. oxygen/N,N-diethyl-N-methyl-N-2-methoxyethyl ammonium bis(trifluoromethylsulfonyl)imide
  2656. oxygen/N,N-diethylbenzenamine
  2657. oxygen/naphthalene
  2658. oxygen/nitrobenzene
  2659. oxygen/olive oil
  2660. oxygen/paraffin
  2661. oxygen/paraffin oil
  2662. oxygen/paraffin wax
  2663. oxygen/Perfluorodimethyladamantane
  2664. oxygen/petroleum ether
  2665. oxygen/petroleum ether
  2666. oxygen/petroleum ether
  2667. oxygen/poly(1-phenylethylene)
  2668. oxygen/propanoic acid
  2669. oxygen/sea water
  2670. oxygen/soybean oil
  2671. oxygen/Tetramethylguanidinium bis(perfluoroethylsulfonyl)imide
  2672. oxygen/trichloroethene
  2673. oxygen/triethyloctylphosphonium bis(trifluoromethylsulfonyl)imide
  2674. oxygen/water-d2
  2675. oxytocin/2-propanone
  2676. oxytocin/acetonitrile
  2677. ozone/1,1,2,2-tetrachloroethane
  2678. ozone/1,1,2-trichloro-1,2,2-trifluoroethane
  2679. ozone/1,2-dichloro-1,1,2,2-tetrafluoroethane
  2680. ozone/1,2-dichloroethane
  2681. ozone/2,2,4-trimethylpentane
  2682. ozone/2-propanone
  2683. ozone/acetic acid
  2684. ozone/acetic acid anhydride
  2685. ozone/acetic acid methyl ester
  2686. ozone/chlorodifluoromethane
  2687. ozone/chlorotrifluoromethane
  2688. ozone/decane
  2689. ozone/dichloroacetic acid
  2690. ozone/dichlorodifluoromethane
  2691. ozone/fluorine
  2692. ozone/heptane
  2693. ozone/hexane
  2694. ozone/methanol
  2695. ozone/oxygen
  2696. ozone/propanoic acid
  2697. ozone/propanoic acid anhydride
  2698. ozone/tetrachloromethane
  2699. ozone/tetrafluoromethane
  2700. ozone/trichlorofluoromethane
  2701. ozone/trichloromethane
  2702. ozone/trifluoroacetic acid
  2703. ozone/water
  2704. P,P'-(1,4-piperazinediyl)bis(phosphonic acid) tetraphenyl ester/1-butanol
  2705. P,P'-(1,4-piperazinediyl)bis(phosphonic acid) tetraphenyl ester/2-propanol
  2706. P,P'-(1,4-piperazinediyl)bis(phosphonic acid) tetraphenyl ester/2-propanone
  2707. P,P'-(1,4-piperazinediyl)bis(phosphonic acid) tetraphenyl ester/acetic acid
  2708. P,P'-(1,4-piperazinediyl)bis(phosphonic acid) tetraphenyl ester/benzene
  2709. P,P'-(1,4-piperazinediyl)bis(phosphonic acid) tetraphenyl ester/dichloromethane
  2710. P,P'-(1,4-piperazinediyl)bis(phosphonic acid) tetraphenyl ester/ethanol
  2711. P,P'-(1,4-piperazinediyl)bis(phosphonic acid) tetraphenyl ester/methanol
  2712. P,P'-(1,4-piperazinediyl)bis(phosphonic acid) tetraphenyl ester/trichloromethane
  2713. palladium alloy base Pd 70, Pt 30/hydrogen
  2714. palladium alloy base Pd 77, Ag 23/hydrogen
  2715. palladium alloy base Pd70, Ag 30/hydrogen
  2716. palladium chloride (PdCl2)/copper chloride (CuCl)
  2717. palladium chloride (PdCl2)/manganese chloride (MnCl2)
  2718. palladium chloride (PdCl2)/silver chloride (AgCl)
  2719. palladium oxide (PdO)/lead oxide (PbO)
  2720. palladium/antimony
  2721. palladium/cerium
  2722. palladium/copper
  2723. palladium/erbium
  2724. palladium/europium
  2725. palladium/gadolinium
  2726. palladium/germanium
  2727. palladium/holmium
  2728. palladium/indium
  2729. palladium/praseodymium
  2730. palladium/samarium
  2731. palladium/silicon
  2732. palladium/terbium
  2733. palladium/thorium
  2734. palladium/thulium
  2735. palladium/tin
  2736. palladium/titanium
  2737. palm Oil Biodiesel/Jet fuel JP-5
  2738. Palm oil methyl ester/Naphthenic based mineral oil
  2739. para-hydrogen/ortho-hydrogen
  2740. paraffin oil/fire damp
  2741. paraffin/benzine (mixture)
  2742. paraformaldehyde/water
  2743. peanut oil biodiesel/Jet fuel JP-5
  2744. Peanut oil/5-methyl-2-(1-methylethyl)phenol
  2745. pefloxacin mesylate dihydrate/water
  2746. pentaammine(2-methylpropanoato-O)cobalt(2+) dibromide/water
  2747. pentaammine(2-methylpropanoato-O)cobalt(2+) dichloride/water
  2748. pentaammine(2-methylpropanoato-O)cobalt(2+) diiodide/water
  2749. pentaammine(2-methylpropanoato-O)cobalt(2+) dinitrate/water
  2750. pentaborane(9)/helium
  2751. pentaborane(9)/lithium chloride (LiCl)
  2752. pentaborane(9)/lithium hydride (LiH)
  2753. pentaborane(9)/N,N,N-tributyl-1-butanaminium iodide
  2754. pentaborane(9)/N,N,N-triethylethanaminium iodide
  2755. pentaborane(9)/N,N,N-tripropyl-1-propanaminium iodide
  2756. pentaborane(9)/nitrogen
  2757. pentaborane(9)/potassium tetraphenylborate(1-)
  2758. pentabromomethoxybenzene/water
  2759. pentabromophosphorane/nitrobenzene
  2760. pentachloro(trichloroethenyl)benzene/water
  2761. pentachlorobenzene/benzene
  2762. pentachlorobenzene/water
  2763. pentachloroethane/(1-methylethyl)benzene
  2764. pentachloroethane/1,1,2,2-tetrachloroethane
  2765. pentachloroethane/1,2,4-trimethylbenzene
  2766. pentachloroethane/1,2-benzenedicarboxylic acid dinonyl ester
  2767. pentachloroethane/1,2-dimethylbenzene
  2768. pentachloroethane/1,3-dichloro-2-propanol
  2769. pentachloroethane/1-chloro-2-methylbenzene
  2770. pentachloroethane/1-methyl-2-pyrrolidinone
  2771. pentachloroethane/1-methyl-4-(1-methylethyl)-1,3-cyclohexadiene
  2772. pentachloroethane/1-methyl-4-(1-methylethyl)benzene
  2773. pentachloroethane/1-phenylethanone
  2774. pentachloroethane/2,3-dimethyl-2,3-butanediol
  2775. pentachloroethane/2,6,6-trimethylbicyclo[3.1.1]hept-2-ene
  2776. pentachloroethane/2-butanone
  2777. pentachloroethane/2-chlorophenol
  2778. pentachloroethane/2-furancarboxaldehyde
  2779. pentachloroethane/2-hydroxypropanoic acid ethyl ester
  2780. pentachloroethane/2-methylphenol
  2781. pentachloroethane/acetic acid methyl ester
  2782. pentachloroethane/bromoacetic acid
  2783. pentachloroethane/chloroacetic acid
  2784. pentachloroethane/ethanedioic acid diethyl ester
  2785. pentachloroethane/hydrochloric acid
  2786. pentachloroethane/hydrogen sulfide (H2S)
  2787. pentachloroethane/nitrobenzene
  2788. pentachloroethane/propanamide
  2789. pentachloroethane/silicic acid (H4SiO4) tetraethyl ester
  2790. pentachloroethane/sulfur
  2791. pentachloroethane/sulfuric acid dimethyl ester
  2792. pentachloroethane/trichloroacetic acid
  2793. pentachloroethane/water
  2794. pentachloroethane/water-d2
  2795. pentachloroethylbenzene/benzene
  2796. pentachlorophenol/diethylmethylsulfonium bis(trifluoromethylsulfonyl)imide
  2797. pentachlorophenol/pentachloromethylbenzene
  2798. pentachlorophenoxybenzene/water
  2799. pentachlorophosphorane/acetonitrile
  2800. pentachlorophosphorane/aluminum chloride (AlCl3)
  2801. pentachlorophosphorane/benzoyl chloride
  2802. pentachlorophosphorane/beryllium chloride (BeCl2)
  2803. pentachlorophosphorane/gallium chloride (GaCl3)
  2804. pentachlorophosphorane/iodine
  2805. pentachlorophosphorane/iodine chloride (ICl)
  2806. pentachlorophosphorane/iron chloride (FeCl3)
  2807. pentachlorophosphorane/mercury chloride (HgCl2)
  2808. pentachlorophosphorane/molybdenum chloride (MoCl5)
  2809. pentachlorophosphorane/nitrobenzene
  2810. pentachlorophosphorane/phosphoric acid tributyl ester
  2811. pentachlorophosphorane/phosphoric acid triethyl ester
  2812. pentachlorophosphorane/phosphoric acid trimethyl ester
  2813. pentachlorophosphorane/tantalum chloride (TaCl5)
  2814. pentachlorophosphorane/tetrachlorogermane
  2815. pentachlorophosphorane/tetrachloromethane
  2816. pentachlorophosphorane/tetrachlorostannane
  2817. pentachlorophosphorane/titanium chloride (TiCl4)
  2818. pentachlorophosphorane/trichlorobismuthine
  2819. pentachlorophosphorane/trichloroborane
  2820. pentachlorophosphorane/zinc chloride (ZnCl2)
  2821. pentachloropyridine/2-propanol
  2822. pentachloropyridine/ethanol
  2823. pentachloropyridine/methanol
  2824. pentachloropyridine/tetrachloromethane
  2825. pentacontane/methane
  2826. pentacontane/propane
  2827. pentacosane/1,1'-biphenyl
  2828. pentacosane/2-ethoxy-2-methylpropane
  2829. pentacosane/2-methyl-2-propanol
  2830. pentacosane/ethane
  2831. pentacosane/hexacosane
  2832. pentacosane/N,N-dimethylformamide
  2833. pentacosane/n-tetracosane
  2834. pentacosane/naphthalene
  2835. pentacosane/triacontane
  2836. pentacosane/tricosane
  2837. pentacosane/water
  2838. pentacosanoic acid/heptacosanoic acid
  2839. pentacosanoic acid/hexacosanoic acid
  2840. pentacosanoic acid/tetracosanoic acid
  2841. pentadecafluorooctanoic acid ammonium salt/water
  2842. pentadecafluorooctanoic acid sodium salt/water
  2843. pentadecane/1,1'-bicyclohexyl
  2844. pentadecane/1,1,2,2-tetrachloroethane
  2845. pentadecane/1-chloronaphthalene
  2846. pentadecane/1-eicosanol
  2847. pentadecane/1-propanol
  2848. pentadecane/2,2-dimethylbutane
  2849. pentadecane/2,3-dimethylbutane
  2850. pentadecane/2-butanone
  2851. pentadecane/2-propanol
  2852. pentadecane/2-propanone
  2853. pentadecane/2-propenoic acid methyl ester
  2854. pentadecane/3-methylpentane
  2855. pentadecane/acetic acid
  2856. pentadecane/acetic acid methyl ester
  2857. pentadecane/acetonitrile
  2858. pentadecane/argon
  2859. pentadecane/Bentonite
  2860. pentadecane/benzene
  2861. pentadecane/benzoic acid ethyl ester
  2862. pentadecane/benzoic acid methyl ester
  2863. pentadecane/carbon monoxide
  2864. pentadecane/dichloromethane
  2865. pentadecane/dihydro-2(3H)-furanone
  2866. pentadecane/docosane
  2867. pentadecane/ethane
  2868. pentadecane/ethanol
  2869. pentadecane/ethene
  2870. pentadecane/helium
  2871. pentadecane/heneicosane
  2872. pentadecane/hydrogen sulfide (H2S)
  2873. pentadecane/krypton
  2874. pentadecane/mercury
  2875. pentadecane/methane
  2876. pentadecane/methanol
  2877. pentadecane/n-heptadecane
  2878. pentadecane/n-hexatriacontane
  2879. pentadecane/n-tetracosane
  2880. pentadecane/neon
  2881. pentadecane/nitrobenzene
  2882. pentadecane/nitroethane
  2883. pentadecane/nitrogen
  2884. pentadecane/nitromethane
  2885. pentadecane/nonadecane
  2886. pentadecane/oxygen
  2887. pentadecane/pentadecanoic acid methyl ester
  2888. pentadecane/poly(1-phenylethylene)
  2889. pentadecane/polyethylene
  2890. pentadecane/propane
  2891. pentadecane/sulfur dioxide
  2892. pentadecane/tetrafluoromethane
  2893. pentadecane/trichloromethane
  2894. pentadecane/tricosane
  2895. pentadecane/water
  2896. pentadecane/xenon
  2897. pentadecanenitrile/2,3,4-trimethylpentane
  2898. pentadecanenitrile/2,5-dimethylhexane
  2899. pentadecanenitrile/2-butanone
  2900. pentadecanenitrile/ethanol
  2901. pentadecanenitrile/nitromethane
  2902. pentadecanoic acid methyl ester/1,1,2,2-tetrachloroethane
  2903. pentadecanoic acid methyl ester/acetonitrile
  2904. pentadecanoic acid methyl ester/nitromethane
  2905. pentadecanoic acid sodium salt/water
  2906. pentadecanoic acid/1,2-ethanediol
  2907. pentadecanoic acid/1-butanol
  2908. pentadecanoic acid/2-butanone
  2909. pentadecanoic acid/2-propanol
  2910. pentadecanoic acid/2-propanone
  2911. pentadecanoic acid/acetic acid
  2912. pentadecanoic acid/acetic acid butyl ester
  2913. pentadecanoic acid/acetic acid ethyl ester
  2914. pentadecanoic acid/acetonitrile
  2915. pentadecanoic acid/benzene
  2916. pentadecanoic acid/butanedioic acid
  2917. pentadecanoic acid/carbon dioxide
  2918. pentadecanoic acid/cyclohexane
  2919. pentadecanoic acid/decanoic acid
  2920. pentadecanoic acid/eicosane
  2921. pentadecanoic acid/ethane
  2922. pentadecanoic acid/heptadecanoic acid
  2923. pentadecanoic acid/hexadecanoic acid
  2924. pentadecanoic acid/hexadecanoic acid compd. with pentadecanoic acid (2:3)
  2925. pentadecanoic acid/hexane
  2926. pentadecanoic acid/hexanedioic acid
  2927. pentadecanoic acid/methanol
  2928. pentadecanoic acid/nitroethane
  2929. pentadecanoic acid/nitromethane
  2930. pentadecanoic acid/octadecanoic acid
  2931. pentadecanoic acid/octadecanoic acid compd. with pentadecanoic acid (1:1)
  2932. pentadecanoic acid/pentanedioic acid
  2933. pentadecanoic acid/propane
  2934. pentadecanoic acid/sulfur dioxide
  2935. pentadecanoic acid/tetrachloromethane
  2936. pentadecanoic acid/tetradecanoic acid
  2937. pentadecanoic acid/trichloromethane
  2938. pentadecanoic acid/tridecanoic acid
  2939. pentadecanoic acid/undecanoic acid
  2940. pentadecanoic acid/urea
  2941. pentadecanoic acid/water
  2942. pentadecylbenzene/1,1,2,2-tetrabromoethane
  2943. pentadecylbenzene/2,2,3,3-tetramethylbutane
  2944. pentadecylbenzene/2,2,3-trimethylbutane
  2945. pentadecylbenzene/2,2-dimethylhexane
  2946. pentadecylbenzene/2,2-dimethylpentane
  2947. pentadecylbenzene/2,3-dimethylbutane
  2948. pentadecylbenzene/2,3-dimethylpentane
  2949. pentadecylbenzene/2-methylbutane
  2950. pentadecylbenzene/2-methylhexane
  2951. pentadecylbenzene/3,3-dimethylpentane
  2952. pentadecylbenzene/3-methylhexane
  2953. pentadecylbenzene/3-methylpentane
  2954. pentadecylbenzene/benzene
  2955. pentadecylbenzene/hexafluorobenzene
  2956. pentaethylbenzene/1H-indene
  2957. pentafluoro(trifluoromethoxy)ethane/1,1-difluoroethane
  2958. pentafluoro(trifluoromethyl)benzene/1-pentyne
  2959. pentafluoro(trifluoromethyl)benzene/2-methyl-1,3-butadiene
  2960. pentafluoro(trifluoromethyl)benzene/2-methyl-2-butene
  2961. pentafluoro(trifluoromethyl)benzene/2-methylbutane
  2962. pentafluoro(trifluoromethyl)benzene/2-pentyne
  2963. pentafluoro(trifluoromethyl)benzene/oxygen
  2964. pentafluoro(trifluoromethyl)benzene/water
  2965. pentafluorobenzene/(1,1-dimethylethyl)benzene
  2966. pentafluorobenzene/(1-methylethyl)benzene
  2967. pentafluorobenzene/1,2,4-trimethylbenzene
  2968. pentafluorobenzene/1,2-dimethylbenzene
  2969. pentafluorobenzene/1,3,5-trifluorobenzene
  2970. pentafluorobenzene/1,4-difluorobenzene
  2971. pentafluorobenzene/2-propanone
  2972. pentafluorobenzene/benzene
  2973. pentafluorobenzene/fluorobenzene
  2974. pentafluorobenzene/hexafluorobenzene
  2975. pentafluorobenzene/octadecane
  2976. pentafluorobenzene/pentamethylbenzene
  2977. pentafluorobenzene/pentylbenzene
  2978. pentafluorobenzoic acid/water
  2979. pentafluorobenzonitrile/2-methyl-1,3-butadiene
  2980. pentafluorobenzonitrile/2-methylbutane
  2981. pentafluoroethane/(difluoromethoxy)trifluoromethane
  2982. pentafluoroethane/(OC-6-21)-pentafluoro(trifluoromethyl)sulfur
  2983. pentafluoroethane/1,1,1,2,3,3,3-heptafluoropropane
  2984. pentafluoroethane/1,1,1,2,3,3-hexafluoropropane
  2985. pentafluoroethane/1,1,1,2-tetrafluoroethane
  2986. pentafluoroethane/1,1,1,3,3,3-hexafluoropropane
  2987. pentafluoroethane/1,1,1,3,3-pentafluoropropane
  2988. pentafluoroethane/1,1,1-trifluoroethane
  2989. pentafluoroethane/1,1,2-trifluoroethane
  2990. pentafluoroethane/1,1-difluoroethane
  2991. pentafluoroethane/1-butyl-3-methyl-1H-imidazolium chloride
  2992. pentafluoroethane/1-butyl-3-methyl-1H-imidazolium salt with cyanocyanamide (1:1)
  2993. pentafluoroethane/1-ethyl-3-methyl-1H-imidazolium chloride
  2994. pentafluoroethane/1-ethyl-3-methyl-1H-imidazolium salt with (nonafluorobutane)sulfonic acid (1:1)
  2995. pentafluoroethane/1-ethyl-3-methyl-1H-imidazolium salt with cyanocyanamide (1:1)
  2996. pentafluoroethane/1-ethyl-3-methylimidazolium perfluoropentanoate
  2997. pentafluoroethane/1-hexyl-3-methyl-1H-imidazolium bromide
  2998. pentafluoroethane/1-hexyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  2999. pentafluoroethane/1-hexyl-3-methyl-1H-imidazolium salt with trifluoromethanesulfonic acid (1:1)
  3000. pentafluoroethane/1-hexyl-3-methyl-1H-imidazolium trifluorotris(1,1,2,2,2-pentafluoroethyl)phosphate(1-) (1:1)
  3001. pentafluoroethane/1-methyl-2-pyrrolidinone
  3002. pentafluoroethane/1-methyl-3-propyl-1H-imidazolium chloride
  3003. pentafluoroethane/2,3,3,3-tetrafluoro-1-propene
  3004. pentafluoroethane/2-ethylhexanoic acid 2,2-bis(((2-ethyl-1-oxohexyl)oxy)methyl)-1,3-propanediyl ester
  3005. pentafluoroethane/2-methylpropane
  3006. pentafluoroethane/2-propanol
  3007. pentafluoroethane/3,3,3-trifluoro-1-propene
  3008. pentafluoroethane/5,8,11,14-tetraoxaoctadecane
  3009. pentafluoroethane/alkylbenzene lubricant oil
  3010. pentafluoroethane/ammonia
  3011. pentafluoroethane/argon
  3012. pentafluoroethane/bromotrifluoromethane
  3013. pentafluoroethane/chloropentafluoroethane
  3014. pentafluoroethane/cyclopropane
  3015. pentafluoroethane/difluoromethane
  3016. pentafluoroethane/ethanol
  3017. pentafluoroethane/Fluorolink D 10H
  3018. pentafluoroethane/Fomblin YLOX 100
  3019. pentafluoroethane/helium
  3020. pentafluoroethane/hexadecane
  3021. pentafluoroethane/hydrochloric acid
  3022. pentafluoroethane/hydrocyanic acid
  3023. pentafluoroethane/hydrofluoric acid
  3024. pentafluoroethane/methanol
  3025. pentafluoroethane/N,N-dimethylformamide
  3026. pentafluoroethane/nitrogen
  3027. pentafluoroethane/octanoic acid 1,2,3-propanetriyl ester
  3028. pentafluoroethane/pentaerythritol ester lubricants
  3029. pentafluoroethane/pluracol 355
  3030. pentafluoroethane/pluracol 975
  3031. pentafluoroethane/poly(1-phenylethylene)
  3032. pentafluoroethane/polyol ester
  3033. pentafluoroethane/propane
  3034. pentafluoroethane/terol 352
  3035. pentafluoroethane/trifluoromethane
  3036. pentafluoroethane/trifluoromethoxymethane
  3037. pentafluoroethane/trihexyltetradecylphosphonium bis(2,4,4-trimethylpentyl)phosphinate
  3038. pentafluoroethane/water
  3039. pentafluoroiodoethane/N,N-dimethylmethanamine
  3040. pentafluoromethoxyethane/1,1,1,2,3,3,3-heptafluoropropane
  3041. pentafluoromethoxyethane/1,1,1,2,3,3-hexafluoropropane
  3042. pentafluoromethoxyethane/1,1,1,2-tetrafluoro-2-(trifluoromethoxy)ethane
  3043. pentafluoromethoxyethane/1,1,1,2-tetrafluoroethane
  3044. pentafluoromethoxyethane/pentafluoroethane
  3045. pentafluoropropanoic acid 3-methylphenyl ester/α-methyl-ω-methoxypoly(oxy-1,2-ethanediyl)
  3046. pentafluoropropanoic acid 3-methylphenyl ester/1,2-benzenedicarboxylic acid dinonyl ester
  3047. pentafluoropropanoic acid 3-methylphenyl ester/2,4-dimethylphenol phosphate (3:1)
  3048. pentafluoropropanoic acid 3-methylphenyl ester/3,3'-[2,2-bis((2-cyanoethoxy)methyl)-1,3-propanediyl]bis(oxy)bispropanenitrile
  3049. pentafluoropropanoic acid 3-methylphenyl ester/3,4,5,6-tetrachloro-1,2-benzenedicarboxylic acid dibutyl ester
  3050. pentafluoropropanoic acid 3-methylphenyl ester/methylphenylsilanediol homopolymer
  3051. pentafluoropropanoic acid 3-methylphenyl ester/poly(dimethylsiloxane)
  3052. pentafluoropropanoic acid 3-methylphenyl ester/Siloxanes and Silicones Me 3,3,3-trifluoropropyl
  3053. pentafluoropropanoic acid 4-methylphenyl ester/α-methyl-ω-methoxypoly(oxy-1,2-ethanediyl)
  3054. pentafluoropropanoic acid 4-methylphenyl ester/1,2-benzenedicarboxylic acid dinonyl ester
  3055. pentafluoropropanoic acid 4-methylphenyl ester/2,4-dimethylphenol phosphate (3:1)
  3056. pentafluoropropanoic acid 4-methylphenyl ester/3,3'-[2,2-bis((2-cyanoethoxy)methyl)-1,3-propanediyl]bis(oxy)bispropanenitrile
  3057. pentafluoropropanoic acid 4-methylphenyl ester/3,4,5,6-tetrachloro-1,2-benzenedicarboxylic acid dibutyl ester
  3058. pentafluoropropanoic acid 4-methylphenyl ester/methylphenylsilanediol homopolymer
  3059. pentafluoropropanoic acid 4-methylphenyl ester/poly(dimethylsiloxane)
  3060. pentafluoropropanoic acid 4-methylphenyl ester/Siloxanes and Silicones Me 3,3,3-trifluoropropyl
  3061. pentafluoropropanoic acid butyl ester/1,2-benzenedicarboxylic acid dinonyl ester
  3062. pentafluoropropanoic acid cyclohexyl ester/α-methyl-ω-methoxypoly(oxy-1,2-ethanediyl)
  3063. pentafluoropropanoic acid cyclohexyl ester/1,2-benzenedicarboxylic acid dinonyl ester
  3064. pentafluoropropanoic acid cyclohexyl ester/2,4-dimethylphenol phosphate (3:1)
  3065. pentafluoropropanoic acid cyclohexyl ester/3,3'-[2,2-bis((2-cyanoethoxy)methyl)-1,3-propanediyl]bis(oxy)bispropanenitrile
  3066. pentafluoropropanoic acid cyclohexyl ester/3,4,5,6-tetrachloro-1,2-benzenedicarboxylic acid dibutyl ester
  3067. pentafluoropropanoic acid cyclohexyl ester/methylphenylsilanediol homopolymer
  3068. pentafluoropropanoic acid cyclohexyl ester/poly(dimethylsiloxane)
  3069. pentafluoropropanoic acid cyclohexyl ester/Siloxanes and Silicones Me 3,3,3-trifluoropropyl
  3070. pentafluoropropanoic acid sodium salt/water
  3071. pentafluoropropanoyl fluoride/acetonitrile
  3072. pentafluoropyridine/2-methyl-1,3-butadiene
  3073. pentafluoropyridine/2-methylbutane
  3074. pentahydrogen tetrakis(sulfato(2-)-O)arsenate(5-)/chlorosulfuric acid
  3075. pentahydrogen tetrakis(sulfato(2-)-O)arsenate(5-)/sulfuric acid
  3076. pentahydrogen tetrakis(sulfato(2-)-O)borate(5-)/chlorosulfuric acid
  3077. pentahydrogen tetrakis(sulfato(2-)-O)borate(5-)/sulfuric acid
  3078. pentamethylbenzene/water
  3079. pentamethylphenol/1H-indene
  3080. pentamethylphenol/naphthalene
  3081. pentan-2-yl nitrate/water
  3082. pentanal/1-butanol
  3083. pentanal/1-butyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3084. pentanal/1-decene
  3085. pentanal/1-docosanol
  3086. pentanal/1-eicosene
  3087. pentanal/1-ethyl-3-methyl-1H-imidazolium salt with sulfuric acid monoethyl ester (1:1)
  3088. pentanal/1-hexene
  3089. pentanal/1-hexyl-1,4-diaza[2.2.2]-bicyclooctanium bis(trifluoromethylsulfonyl)imide
  3090. pentanal/1-hexyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3091. pentanal/1-methyl-2-pyrrolidinone
  3092. pentanal/1-methyl-3-octyl-1H-imidazolium tetrafluoroborate(1-)
  3093. pentanal/1-octene
  3094. pentanal/10-nonadecanone
  3095. pentanal/2-ethoxyethanol
  3096. pentanal/3-bromobenzenamine
  3097. pentanal/4-morpholinecarboxaldehyde
  3098. pentanal/acetic acid butyl ester
  3099. pentanal/acetic acid ethyl ester
  3100. pentanal/air
  3101. pentanal/benzene
  3102. pentanal/cyclohexane
  3103. pentanal/dodecane
  3104. pentanal/ethanol
  3105. pentanal/heptane
  3106. pentanal/hexadecane
  3107. pentanal/methanol
  3108. pentanal/N,N,N-trimethyl-1-butanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3109. pentanal/N-ethyl-N-methylmorpholinium bis(trifluoromethylsulfonyl)imide
  3110. pentanal/N-methyl-N-octylmorpholinium bis(trifluoromethylsulfonyl)imide
  3111. pentanal/octacosane
  3112. pentanal/octane
  3113. pentanal/oxygen
  3114. pentanal/sea water
  3115. pentanal/tetrachloromethane
  3116. pentanal/water
  3117. pentanal/water-d2
  3118. pentanal/xenon isotope of mass 133
  3119. pentanamide/water
  3120. pentane-d12/ethane
  3121. pentane/α-(trimethylsilyl)-ω-((trimethylsilyl)oxy)poly(oxy(dimethylsilylene))
  3122. pentane/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)
  3123. pentane/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)
  3124. pentane/α-methyl-ω-methoxypoly(oxy-1,2-ethanediyl)
  3125. pentane/±-2-pentanol
  3126. pentane/±-3,6-dimethyl-1,4-dioxane-2,5-dione homopolymer
  3127. pentane/(1α,2α,3α,4β,5α,6β)-1,2,3,4,5,6-hexachlorocyclohexane
  3128. pentane/(1α,2α,3β,4α,5α,6β)-1,2,3,4,5,6-hexachlorocyclohexane
  3129. pentane/(1α,2α,3β,4α,5β,6β)-1,2,3,4,5,6-hexachlorocyclohexane
  3130. pentane/(1α,2β,3α,4β,5α,6β)-1,2,3,4,5,6-hexachlorocyclohexane
  3131. pentane/(1-methylethyl)benzene
  3132. pentane/(1E)-1,3,3,3-tetrafluoro-1-propene
  3133. pentane/(1R-(1α,4aβ,4bα,10aα))-1,2,3,4,4a,4b,5,6,10,10a-decahydro-1,4a-dimethyl-7-(1-methylethyl)-1-phenanthrenecarboxylic acid copper(2+) salt
  3134. pentane/(2Z)-1,1,1,4,4,4-hexafluoro-2-butene
  3135. pentane/(2Z)-2-pentene
  3136. pentane/(4R)-1-methyl-4-(1-methylethenyl)cyclohexene
  3137. pentane/(5,6)fullerene-C60-Ih
  3138. pentane/(9Z)-9-octadecenoic acid 1,2,3-propanetriyl ester
  3139. pentane/(dimethyl-trimethylsilyloxysilyl)oxy-dimethyl-trimethylsilyloxysilane
  3140. pentane/(E)-1,1,1,4,4,4-hexafluorobut-2-ene
  3141. pentane/(OC-6-11)-sulfur fluoride (SF6)
  3142. pentane/(phenylmethyl)-1,1'-biphenyl
  3143. pentane/(R/S)-2-hexanol
  3144. pentane/(S)-6-methoxy-α-methyl-2-naphthaleneacetic acid
  3145. pentane/(trifluoromethyl)benzene
  3146. pentane/(Z)-poly(1-butene-1,4-diyl)
  3147. pentane/1,1'-(oxybis(methylene))bisbenzene homopolymer dendrimer
  3148. pentane/1,1'-bicyclohexyl
  3149. pentane/1,1'-oxybis(1,1,2,2,3,3,4,4,4-nonafluorobutane)
  3150. pentane/1,1'-oxybis(2-ethoxyethane)
  3151. pentane/1,1'-oxybis(2-methoxyethane)
  3152. pentane/1,1'-oxybisbutane
  3153. pentane/1,1'-oxybisethane
  3154. pentane/1,1'-oxybisoctane
  3155. pentane/1,1'-sulfinylbisethane
  3156. pentane/1,1'-[oxybis(2,1-ethanediyloxy)]bisbutane
  3157. pentane/1,1,1,2,2,3,3,4,4-nonafluoro-4-methoxybutane
  3158. pentane/1,1,1,2,2,3,3-heptafluoro-3-methoxypropane
  3159. pentane/1,1,1,2,2,3,4,5,5,5-decafluoropentane
  3160. pentane/1,1,1,2,2,4,5,5,5-nonafluoro-4-(trifluoromethyl)pentan-3-one
  3161. pentane/1,1,1,2-tetrabromoethane
  3162. pentane/1,1,1,3,3,3-d6-2-propanone
  3163. pentane/1,1,1,3,3,3-hexafluoro-2-propanol
  3164. pentane/1,1,1,3,3,3-hexafluoropropane
  3165. pentane/1,1,1,3,3-pentafluoropropane
  3166. pentane/1,1,1,4,4,4-hexafluorobutane
  3167. pentane/1,1,1-trichloroethane
  3168. pentane/1,1,2,2,3,3,4,4,4-nonafluoro-N,N-bis(nonafluorobutyl)-1-butanamine
  3169. pentane/1,1,2,2,3,3,4,4-octafluorobutane
  3170. pentane/1,1,2,2-tetrabromoethane
  3171. pentane/1,1,2,2-tetrachloroethane
  3172. pentane/1,1,2,2-tetrafluoro-1-(2,2,2-trifluoroethoxy)ethane
  3173. pentane/1,1,2,2-tetrafluoroethane
  3174. pentane/1,1,2-trichloro-1,2,2-trifluoroethane
  3175. pentane/1,1-dichloro-1-fluoroethane
  3176. pentane/1,1-dichloroethane
  3177. pentane/1,1-difluoroethane
  3178. pentane/1,1-difluoroethene homopolymer
  3179. pentane/1,1-dioxo-2-methylthietane
  3180. pentane/1,10-decanediamine
  3181. pentane/1,12-dodecanediamine
  3182. pentane/1,12-dodecanedinitrile
  3183. pentane/1,2,3,4-tetrahydronaphthalene
  3184. pentane/1,2,3-propanetriol
  3185. pentane/1,2,4-trichlorobenzene
  3186. pentane/1,2-benzenedicarboxylic acid bis(2-ethylhexyl) ester
  3187. pentane/1,2-benzenedicarboxylic acid bis(2-methylpropyl) ester
  3188. pentane/1,2-benzenedicarboxylic acid butyl 2-ethylhexyl ester
  3189. pentane/1,2-benzenedicarboxylic acid butyl phenylmethyl ester
  3190. pentane/1,2-benzenedicarboxylic acid dibutyl ester
  3191. pentane/1,2-benzenedicarboxylic acid dicyclohexyl ester
  3192. pentane/1,2-benzenedicarboxylic acid diethyl ester
  3193. pentane/1,2-benzenedicarboxylic acid diisodecyl ester
  3194. pentane/1,2-benzenedicarboxylic acid dinonyl ester
  3195. pentane/1,2-bis(2-methoxymethylethoxy)propane
  3196. pentane/1,2-butadiene homopolymer
  3197. pentane/1,2-dichloro-1,1,2,2-tetrafluoroethane
  3198. pentane/1,2-dimethoxyethane
  3199. pentane/1,2-dimethyl-3-propyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3200. pentane/1,2-dimethylbenzene
  3201. pentane/1,2-ethanediol diacetate
  3202. pentane/1,2-oxathiolane 2,2-dioxide
  3203. pentane/1,3,2-dioxathiolane 2-oxide
  3204. pentane/1,3,5-tributyldihydro-1,3,5-triazine-2,4(1H,3H)-dione
  3205. pentane/1,3,5-triethyldihydro-1,3,5-triazine-2,4(1H,3H)-dione
  3206. pentane/1,3-bis[(hexyloxy)methyl]-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3207. pentane/1,3-butadiene homopolymer
  3208. pentane/1,3-cyclopentadiene
  3209. pentane/1,3-dichloropropane
  3210. pentane/1,3-Didecyl-2-methylimidazolium dicyanamide
  3211. pentane/1,3-dimethoxybenzene
  3212. pentane/1,3-dimethyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3213. pentane/1,3-dimethyl-1H-imidazolium salt with phosphoric acid dimethyl ester (1:1)
  3214. pentane/1,3-dimethyl-1H-imidazolium salt with sulfuric acid monomethyl ester (1:1)
  3215. pentane/1,3-dimethyl-2-imidazolidinone
  3216. pentane/1,3-dioxane
  3217. pentane/1,3-dioxolan-2-one
  3218. pentane/1,3-dioxolane
  3219. pentane/1,3-propanediol diacetate
  3220. pentane/1,4-bis(trifluoromethyl)benzene
  3221. pentane/1,4-diazabicyclo[2.2.2]octane
  3222. pentane/1,4-dibromobutane
  3223. pentane/1,4-dichlorobutane
  3224. pentane/1,4-dioxane
  3225. pentane/1,4-pentadiene
  3226. pentane/1,5-dibromopentane
  3227. pentane/1,5-dichloropentane
  3228. pentane/1,5-diiodopentane
  3229. pentane/1,5-dimethyl-2-pyrrolidinone
  3230. pentane/1,6-dibromohexane
  3231. pentane/1,6-dichlorohexane
  3232. pentane/1,6-diiodohexane
  3233. pentane/1,6-hexanedioic acid polyester with 1,4-butanediol
  3234. pentane/1,6-hexanediol
  3235. pentane/1,6-hexanedithiol
  3236. pentane/1,8-octanediamine
  3237. pentane/1,9-nonanediol
  3238. pentane/1-((hexyloxy)methyl)-3-methyl-1H-imidazolium tetrafluoroborate(1-)
  3239. pentane/1-(1-oxoethyl)hexahydro-1H-azepine
  3240. pentane/1-(1-oxopropyl)piperidine
  3241. pentane/1-(2-hydroxyethyl)-3-methyl-1H-imidazolium hexafluorophosphate(1-)
  3242. pentane/1-(2-hydroxyethyl)-3-methyl-1H-imidazolium trifluorotris(1,1,2,2,2-pentafluoroethyl)phosphate(1-)
  3243. pentane/1-(2-Hydroxyethyl)-3-methylimidazolium nonafluorobutyl sulfonate
  3244. pentane/1-(2-methoxyethyl)-1-methyl-pyrrolidinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3245. pentane/1-(2-methoxyethyl)-1-methylpiperidinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3246. pentane/1-(2-methoxyethyl)-1-methylpiperidinium tris(pentafluoroethyl)trifluorophosphate
  3247. pentane/1-(2-methoxyethyl)-1-methylpyrrolidinium trifluorotris(1,1,2,2,2-pentafluoroethyl)phosphate(1-) (1:1)
  3248. pentane/1-(3-hydroxypropyl)pyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3249. pentane/1-(3-hydroxypropyl)pyridinium tris(pentafluoroethyl)trifluorophosphate(1-)
  3250. pentane/1-(3-oxazolidinyl)-1-propanone
  3251. pentane/1-(4-chlorobenzoyl)-5-methoxy-2-methyl-1H-indole-3-acetic acid
  3252. pentane/1-(difluoromethyl)-4-nitrobenzene
  3253. pentane/1-(trans-4-butylcyclohexyl)-4-isothiocyanatobenzene
  3254. pentane/1-acetyl-1H-pyrrole
  3255. pentane/1-acetylaziridine
  3256. pentane/1-acetylpiperidine
  3257. pentane/1-acetylpyrrolidine
  3258. pentane/1-allyl-3-methylimidazolium dicyanamide
  3259. pentane/1-benzyl-3-methylimidazolium dicyanamide
  3260. pentane/1-bromononane
  3261. pentane/1-bromopentane
  3262. pentane/1-butanamine
  3263. pentane/1-butanol
  3264. pentane/1-butene homopolymer
  3265. pentane/1-butyl-1-methyl-1H-pyrrolidinium tris(pentafluoroethyl) trifluorophosphate
  3266. pentane/1-butyl-1-methylmorpholinium tricyanomethanide
  3267. pentane/1-butyl-1-methylpiperidinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3268. pentane/1-butyl-1-methylpyrrolidinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3269. pentane/1-butyl-1-methylpyrrolidinium salt with trifluoromethanesulfonic acid (1:1)
  3270. pentane/1-butyl-1-methylpyrrolidinium tetrakis(cyano-κC)borate(1-)
  3271. pentane/1-butyl-1-methylpyrrolidinium tricyanomethanide
  3272. pentane/1-butyl-3-methyl-1H-imidazolium bis[ethanedioato(2-)-κO1,kapppaO2]borate(1-)
  3273. pentane/1-butyl-3-methyl-1H-imidazolium hexafluoroantimonate(1-)
  3274. pentane/1-butyl-3-methyl-1H-imidazolium hexafluorophosphate(1-)
  3275. pentane/1-butyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3276. pentane/1-butyl-3-methyl-1H-imidazolium salt with cyanocyanamide (1:1)
  3277. pentane/1-butyl-3-methyl-1H-imidazolium salt with phosphoric acid dibutyl ester (1:1)
  3278. pentane/1-butyl-3-methyl-1H-imidazolium salt with sulfuric acid methyl ester (1:1)
  3279. pentane/1-butyl-3-methyl-1H-imidazolium salt with sulfuric acid mono(2-(2-methoxyethoxy)ethyl) ester (1:1)
  3280. pentane/1-butyl-3-methyl-1H-imidazolium salt with sulfuric acid monooctyl ester (1:1)
  3281. pentane/1-butyl-3-methyl-1H-imidazolium salt with trifluoromethanesulfonic acid (1:1)
  3282. pentane/1-butyl-3-methyl-1H-imidazolium tetrafluoroborate(1-)
  3283. pentane/1-butyl-3-methyl-1H-pyridinium salt with trifluoromethanesulfonic acid (1:1)
  3284. pentane/1-butyl-4-cyanopyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3285. pentane/1-butyl-4-methylpyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3286. pentane/1-butyl-4-methylpyridinium salt with 4-methylbenzenesulfonic acid
  3287. pentane/1-butylpyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3288. pentane/1-chloro-4-ethenylbenzene homopolymer
  3289. pentane/1-chlorobutane
  3290. pentane/1-chlorohexadecane
  3291. pentane/1-chlorohexane
  3292. pentane/1-chloronaphthalene
  3293. pentane/1-chlorononane
  3294. pentane/1-chlorooctadecane
  3295. pentane/1-chlorooctane
  3296. pentane/1-chloropentane
  3297. pentane/1-chloropropane
  3298. pentane/1-decanol
  3299. pentane/1-decene
  3300. pentane/1-decyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3301. pentane/1-decyl-3-methyl-1H-imidazolium tetrafluoroborate(1-)
  3302. pentane/1-decyl-3-methyl-1H-imidazolium tetrakis(cyano-κC)borate(1-)
  3303. pentane/1-docosanol
  3304. pentane/1-dodecanamine
  3305. pentane/1-dodecanol
  3306. pentane/1-dodecyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3307. pentane/1-eicosanol
  3308. pentane/1-eicosene
  3309. pentane/1-ethyl-2-pyrrolidinone
  3310. pentane/1-ethyl-3-methyl-1H-imidazol-3-ium trifluorotris(1,1,2,2,2-pentafluoroethyl)phosphate(1-) (1:1)
  3311. pentane/1-ethyl-3-methyl-1H-imidazolium octyl sulfate
  3312. pentane/1-ethyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3313. pentane/1-ethyl-3-methyl-1H-imidazolium salt with phosphoric acid diethyl ester (1:1)
  3314. pentane/1-ethyl-3-methyl-1H-imidazolium salt with phosphoric acid dimethyl ester (1:1)
  3315. pentane/1-ethyl-3-methyl-1H-imidazolium salt with sulfuric acid (1:1)
  3316. pentane/1-ethyl-3-methyl-1H-imidazolium salt with sulfuric acid 2-(2-methoxyethoxy)ethyl ester (1:1)
  3317. pentane/1-ethyl-3-methyl-1H-imidazolium salt with sulfuric acid monoethyl ester (1:1)
  3318. pentane/1-ethyl-3-methyl-1H-imidazolium salt with sulfuric acid monomethyl ester (1:1)
  3319. pentane/1-ethyl-3-methyl-1H-imidazolium salt with trifluoromethanesulfonic acid (1:1)
  3320. pentane/1-ethyl-3-methyl-1H-imidazolium tetrafluoroborate(1-)
  3321. pentane/1-ethyl-3-methyl-1H-imidazolium tetrakis(cyano-κC)borate(1-)
  3322. pentane/1-ethyl-3-methyl-1H-imidazolium tricyanomethanide
  3323. pentane/1-ethyl-3-methylimidazolium trifluoroacetate
  3324. pentane/1-ethylpyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3325. pentane/1-heptanol
  3326. pentane/1-hexadecanol
  3327. pentane/1-hexadecene
  3328. pentane/1-hexanol
  3329. pentane/1-hexene
  3330. pentane/1-hexyl-1,4-diaza[2.2.2]-bicyclooctanium bis(trifluoromethylsulfonyl)imide
  3331. pentane/1-hexyl-1-methylpiperidinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3332. pentane/1-hexyl-1-methylpyrrolidinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3333. pentane/1-hexyl-2,3-dimethyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3334. pentane/1-Hexyl-2,3-dimethylimidazolium tetrafluoroborate
  3335. pentane/1-hexyl-3-methyl-1H-imidazolium bis[ethanedioato(2-)-κO1,kapppaO2]borate(1-)
  3336. pentane/1-hexyl-3-methyl-1H-imidazolium hexafluorophosphate(1-)
  3337. pentane/1-hexyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3338. pentane/1-hexyl-3-methyl-1H-imidazolium salt with nitric acid (1:1)
  3339. pentane/1-hexyl-3-methyl-1H-imidazolium salt with trifluoromethanesulfonic acid (1:1)
  3340. pentane/1-hexyl-3-methyl-1H-imidazolium tetrafluoroborate(1-)
  3341. pentane/1-hexyl-3-methyl-1H-imidazolium tetrakis(cyano-κC)borate(1-)
  3342. pentane/1-hexyl-3-methylpyridinium 4-methylbenzenesulfonate
  3343. pentane/1-hexylpyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3344. pentane/1-iodohexadecane
  3345. pentane/1-methoxypropane
  3346. pentane/1-methyl-1H-imidazole
  3347. pentane/1-methyl-2-azetidinone
  3348. pentane/1-methyl-2-nitrobenzene
  3349. pentane/1-methyl-2-piperidinone
  3350. pentane/1-methyl-2-pyrrolidinone
  3351. pentane/1-methyl-3-(3-sulfopropyl)-1H-imidazolium sulfate (1:1)
  3352. pentane/1-methyl-3-(phenylmethyl)-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3353. pentane/1-methyl-3-methylimidazolium methoxyethylsulfate
  3354. pentane/1-methyl-3-octyl-1H-imidazolium chloride
  3355. pentane/1-methyl-3-octyl-1H-imidazolium hexafluorophosphate(1-)
  3356. pentane/1-methyl-3-octyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3357. pentane/1-methyl-3-octyl-1H-imidazolium salt with nitric acid (1:1)
  3358. pentane/1-methyl-3-octyl-1H-imidazolium salt with sulfuric acid 2-(2-methoxyethoxy)ethyl ester (1:1)
  3359. pentane/1-methyl-3-octyl-1H-imidazolium tetrafluoroborate(1-)
  3360. pentane/1-methyl-4-piperidinone
  3361. pentane/1-methylnaphthalene
  3362. pentane/1-naphthalenamine
  3363. pentane/1-nitro-3-(trifluoromethyl)benzene
  3364. pentane/1-nitropiperidine
  3365. pentane/1-nonanol
  3366. pentane/1-octadecanol
  3367. pentane/1-octadecene
  3368. pentane/1-octanol
  3369. pentane/1-octene
  3370. pentane/1-Octyl-2,3-dimethylimidazolium tetrafluoroborate
  3371. pentane/1-octyl-2-pyrrolidinone
  3372. pentane/1-pentanol
  3373. pentane/1-penten-4-yne
  3374. pentane/1-pentene
  3375. pentane/1-pentylpyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3376. pentane/1-pentyne
  3377. pentane/1-phenylethanone
  3378. pentane/1-Piperazine carboxaldehyde
  3379. pentane/1-piperidinecarboxaldehyde
  3380. pentane/1-piperidinepropanenitrile
  3381. pentane/1-propanol
  3382. pentane/1-propene
  3383. pentane/1-propyl-2,3-dimethyl-1H-imidazolium tetrafluoroborate(1-)
  3384. pentane/1-pyrrolidinecarboxaldehyde
  3385. pentane/1-pyrrolidinepropanenitrile
  3386. pentane/1-tetradecanol
  3387. pentane/1-[(hexyloxy)methyl]-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3388. pentane/10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-one
  3389. pentane/10-nonadecanone
  3390. pentane/19,24-dioctadecyldotetracontane
  3391. pentane/1H-indene
  3392. pentane/1H-pyrrole-1-propanenitrile
  3393. pentane/2',3'-N-Epoxypropyl-N-methyl-2-oxopyrrolidinium salicylate
  3394. pentane/2,2'-(1,2-ethanediylbis(oxy))bisethanol
  3395. pentane/2,2'-oxybisethanol
  3396. pentane/2,2'-[oxybis(2,1-ethanediyloxy)]bisethanol
  3397. pentane/2,2,2-trifluoroethanol
  3398. pentane/2,2,3,3,4,4,5,5,5-nonafluoro-1-pentanol
  3399. pentane/2,2,3,3,4,4,5,5-octafluoro-1-pentanol
  3400. pentane/2,2,3,3-tetrafluoro-1-propanol
  3401. pentane/2,2,4,4,6,6,8,8-octamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane
  3402. pentane/2,2,4-trimethylpentane
  3403. pentane/2,2-dimethylpropane
  3404. pentane/2,3,4-trimethylpentane
  3405. pentane/2,3-Dihydroxypropyl-N-methyl-2-oxopyrrolidinium chloride
  3406. pentane/2,3-dimethyl-1,3-butadiene homopolymer
  3407. pentane/2,3-dimethyl-1-octyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3408. pentane/2,4-pentanedione
  3409. pentane/2,5,8,11,14-pentaoxapentadecane
  3410. pentane/2,5,8,11-tetraoxadodecane
  3411. pentane/2,5-dimethylhexane
  3412. pentane/2,5-hexanedione
  3413. pentane/2,6,10,14-tetramethylpentadecane
  3414. pentane/2,6,10,15,19,23-hexamethyltetracosane
  3415. pentane/2-(2-aminoethoxy)ethanol
  3416. pentane/2-(2-methoxyethoxy)ethanol
  3417. pentane/2-(acetyloxy)propanenitrile
  3418. pentane/2-(chloromethyl)oxirane homopolymer
  3419. pentane/2-acetoxyacetonitrile
  3420. pentane/2-aminoethanol
  3421. pentane/2-bromo-2-chloro-1,1,1-trifluoroethane
  3422. pentane/2-butanol
  3423. pentane/2-butanone
  3424. pentane/2-butyne
  3425. pentane/2-chloro-2-methylpropane
  3426. pentane/2-chloropropane
  3427. pentane/2-chloropropanenitrile
  3428. pentane/2-dodecanone
  3429. pentane/2-fluoro-α-methyl-(1,1'-biphenyl)-4-acetic acid
  3430. pentane/2-furancarboxaldehyde
  3431. pentane/2-furanmethanamine
  3432. pentane/2-furanmethanol
  3433. pentane/2-heptanone
  3434. pentane/2-methoxy-2-methylbutane
  3435. pentane/2-methoxyethanol
  3436. pentane/2-methyl-1,1'-biphenyl
  3437. pentane/2-methyl-1,3-butadiene
  3438. pentane/2-methyl-1-buten-3-yne
  3439. pentane/2-methyl-1-butene
  3440. pentane/2-methyl-1-propanamine
  3441. pentane/2-methyl-1-propanol
  3442. pentane/2-methyl-1-propene
  3443. pentane/2-methyl-1-propene homopolymer
  3444. pentane/2-methyl-2-butanol
  3445. pentane/2-methyl-2-butene
  3446. pentane/2-methyl-2-propanol
  3447. pentane/2-methyl-2-propenoic acid butyl ester homopolymer
  3448. pentane/2-methyl-2-propenoic acid cyclohexyl ester homopolymer
  3449. pentane/2-methyl-2-propenoic acid methyl ester
  3450. pentane/2-methylbutane
  3451. pentane/2-methylfuran
  3452. pentane/2-methylpropane
  3453. pentane/2-methylquinoline
  3454. pentane/2-naphthalenol
  3455. pentane/2-nitropropane
  3456. pentane/2-oxepanone
  3457. pentane/2-oxiranylfuran
  3458. pentane/2-propanethiol
  3459. pentane/2-propanol
  3460. pentane/2-propanone
  3461. pentane/2-propenoic acid 2-hydroxyethyl ester homopolymer
  3462. pentane/2-propenoic acid 2-hydroxypropyl ester homopolymer
  3463. pentane/2-propenoic acid ethyl ester
  3464. pentane/2-propenoic acid ethyl ester homopolymer
  3465. pentane/2-propenoic acid methyl ester
  3466. pentane/2-propenoic acid methyl ester homopolymer
  3467. pentane/2-pyrrolidinone
  3468. pentane/3,3'-iminobispropanenitrile
  3469. pentane/3,3'-oxybispropanenitrile
  3470. pentane/3,3'-thiobispropanenitrile
  3471. pentane/3,4,5,6-tetrachloro-1,2-benzenedicarboxylic acid dibutyl ester
  3472. pentane/3,4-dimethyl-1,2,5-oxadiazole 2-oxide
  3473. pentane/3-(dimethylamino)propanenitrile
  3474. pentane/3-(Hexahydro-1H-azepin-1-yl)propionitrile
  3475. pentane/3-(methylamino)propanenitrile
  3476. pentane/3-(Methyloxymethyleneoxy)propanenitrile
  3477. pentane/3-(pentyloxy)propanenitrile
  3478. pentane/3-acetyl-1,3-thiazolidine
  3479. pentane/3-acetyldihydro-2(3H)-furanone
  3480. pentane/3-acetyloxazolidine
  3481. pentane/3-bromopentane
  3482. pentane/3-butoxypropanenitrile
  3483. pentane/3-chloropropanenitrile
  3484. pentane/3-cyano-2-methylpropanoic acid methyl ester
  3485. pentane/3-cyanopropanoic acid methyl ester
  3486. pentane/3-ethoxypropanenitrile
  3487. pentane/3-ethyl-2-oxazolidinone
  3488. pentane/3-methoxypropanenitrile
  3489. pentane/3-methyl-1-butanol
  3490. pentane/3-methyl-1-butyne
  3491. pentane/3-methyl-2-oxazolidinone
  3492. pentane/3-methylbutanoic acid copper(2+) salt
  3493. pentane/3-oxazolidinecarboxaldehyde
  3494. pentane/3-oxazolidinecarboxylic acid methyl ester
  3495. pentane/3-oxobutanoic acid ethyl ester copper(2+) salt
  3496. pentane/3-pentanone
  3497. pentane/3-phenyl-2-propenoic acid copper(2+) salt
  3498. pentane/3-propoxypropanenitrile
  3499. pentane/3a,4,7,7a-tetrahydro-4,7-methano-1H-indene
  3500. pentane/4'-octyl-(1,1'-biphenyl)-4-carbonitrile
  3501. pentane/4-(2-methoxyethyl)-4-methyl-5-morpholinium tris(pentafluoroethyl)trifluorophosphate
  3502. pentane/4-(2-methoxyethyl)-4-methylmorpholinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3503. pentane/4-acetylmorpholine
  3504. pentane/4-hydroxybenzoic acid methyl ester
  3505. pentane/4-methoxybenzoic acid copper(2+) salt
  3506. pentane/4-methyl-1-piperazinecarboxaldehyde
  3507. pentane/4-methyl-3-morpholinone
  3508. pentane/4-methylquinoline
  3509. pentane/4-morpholinecarboxaldehyde
  3510. pentane/4-morpholinecarboxylic acid methyl ester
  3511. pentane/4-morpholinepropanenitrile
  3512. pentane/4-oxopentanenitrile
  3513. pentane/4-phenyl-2-butanone
  3514. pentane/5,8,11,14-tetraoxaoctadecane
  3515. pentane/8,13,13b,14-tetrahydro-14-methylindolo[2',3':3,4]pyrido[2,1-b]quinazolin-5(7H)-one
  3516. pentane/8,13-dihydroindolo[2',3':3,4]pyrido[2,1-b]quinazolin-5(7H)-one
  3517. pentane/9,10-dihydrophenanthrene
  3518. pentane/9-(heptadecafluorooctyl)octadecanoic acid methyl ester
  3519. pentane/9-heptadecanone
  3520. pentane/acetaldehyde
  3521. pentane/acetic acid
  3522. pentane/acetic acid butyl ester
  3523. pentane/acetic acid ethenyl ester homopolymer
  3524. pentane/acetic acid ethyl ester
  3525. pentane/acetic acid hexyl ester
  3526. pentane/acetic acid methyl ester
  3527. pentane/acetic acid pentyl ester
  3528. pentane/acetonitrile
  3529. pentane/air
  3530. pentane/ammoeng
  3531. pentane/ammonia
  3532. pentane/argon
  3533. pentane/azulene
  3534. pentane/benzenamine
  3535. pentane/benzene
  3536. pentane/benzeneacetonitrile
  3537. pentane/benzeneethanol
  3538. pentane/benzoic acid
  3539. pentane/benzoic acid butyl ester
  3540. pentane/benzoic acid ethyl ester
  3541. pentane/benzoic acid methyl ester
  3542. pentane/benzoic acid propyl ester
  3543. pentane/benzo[h]quinoline
  3544. pentane/bis[(dimethyl-trimethylsilyloxysilyl)oxy]-dimethylsilane
  3545. pentane/bitumen
  3546. pentane/boric acid (H3BO3) trimethyl ester
  3547. pentane/bromoethane
  3548. pentane/bromoethene
  3549. pentane/bromomethane
  3550. pentane/butanal
  3551. pentane/butanedioic acid polymer with 1,2-ethanediol
  3552. pentane/butanenitrile
  3553. pentane/butanoic acid methyl ester
  3554. pentane/carbon dioxide
  3555. pentane/carbon disulfide
  3556. pentane/carbon monoxide
  3557. pentane/castor oil
  3558. pentane/chlorodifluoromethane
  3559. pentane/chloroethane
  3560. pentane/chlorotrioctylstannane
  3561. pentane/cis-decahydronaphthalene
  3562. pentane/crude Oil
  3563. pentane/Cyanomethyl propanoate
  3564. pentane/cycloheptane
  3565. pentane/cycloheptanol
  3566. pentane/cyclohexane
  3567. pentane/cyclohexene
  3568. pentane/cyclohexylbenzene
  3569. pentane/cyclooctane
  3570. pentane/cyclopentane
  3571. pentane/cyclopentanol
  3572. pentane/cyclopentanone
  3573. pentane/cyclopentene
  3574. pentane/decahydro-3,5,1,7-(1,2,3,4)butanetetraylnaphthalene
  3575. pentane/decahydronaphthalene
  3576. pentane/decane
  3577. pentane/decanedioic acid
  3578. pentane/decanedioic acid bis(2-ethylhexyl) ester
  3579. pentane/decanedioic acid polymer with 1,6-hexanediol
  3580. pentane/decanoic acid ethyl ester
  3581. pentane/decanoic acid methyl ester
  3582. pentane/decylcyclohexane
  3583. pentane/dibenzothiophene
  3584. pentane/dibromomethane
  3585. pentane/dichloroacetic acid
  3586. pentane/dichlorodifluoromethane
  3587. pentane/dichloromethane
  3588. pentane/Didecyldimethylammonium perchlorate
  3589. pentane/Didecyldimethylammonium tetrafluoroborate
  3590. pentane/diethyl peroxide
  3591. pentane/dihydro-1,3,5-trimethyl-1,3,5-triazine-2,4(1H,3H)-dione
  3592. pentane/dihydro-2(3H)-furanone
  3593. pentane/diiodomethane
  3594. pentane/dimethoxyethane
  3595. pentane/dimethoxymethane
  3596. pentane/dimethylcyanamide
  3597. pentane/dimethylphenol phosphate (3:1)
  3598. pentane/docosane
  3599. pentane/dodecafluoropentane
  3600. pentane/dodecane
  3601. pentane/dodecanoic acid methyl ester
  3602. pentane/dodecylbenzene
  3603. pentane/dotriacontane
  3604. pentane/E-1,1,1,4,4,5,5,5-Octafluoro-2-pentene
  3605. pentane/eicosane
  3606. pentane/engine oil
  3607. pentane/ethane
  3608. pentane/ethanedioic acid diethyl ester
  3609. pentane/ethanethiol
  3610. pentane/ethanol
  3611. pentane/ethene
  3612. pentane/ethene homopolymer chlorinated
  3613. pentane/ethyl(2-methoxyethyl)dimethylammonium trifluoridotris(pentafluoroethyl)phosphate
  3614. pentane/ethylcyclohexane
  3615. pentane/fluorobenzene
  3616. pentane/formic acid butyl ester
  3617. pentane/formic acid ethyl ester
  3618. pentane/formic acid propyl ester
  3619. pentane/furan
  3620. pentane/Galden - Perfluoropolyether oil
  3621. pentane/helium
  3622. pentane/heneicosane
  3623. pentane/heptadecanoic acid copper(2+) salt
  3624. pentane/heptafluorobutanoic acid 2,2-bis((2,2,3,3,4,4,4-heptafluoro-1-oxobutoxy)methyl)-1,3-propanediyl ester
  3625. pentane/heptanal
  3626. pentane/heptane
  3627. pentane/heptanedioic acid
  3628. pentane/hexacontane
  3629. pentane/hexadecafluoro-n-heptane
  3630. pentane/hexadecamethylheptasiloxane
  3631. pentane/hexadecane
  3632. pentane/hexadecanoic acid
  3633. pentane/hexadecanoic acid copper(2+) salt
  3634. pentane/hexadecanoic acid ethyl ester
  3635. pentane/hexafluorobenzene
  3636. pentane/hexafluoroethane
  3637. pentane/hexahydro-1-methyl-2H-azepin-2-one
  3638. pentane/hexamethylphosphoric triamide
  3639. pentane/hexane
  3640. pentane/hexanedinitrile
  3641. pentane/hexanedioic acid polymer with 1,2-ethanediol
  3642. pentane/hexanoic acid copper(2+) salt
  3643. pentane/hexanoic acid ethyl ester
  3644. pentane/hydrochloric acid
  3645. pentane/hydrogen
  3646. pentane/hydrogen sulfide (H2S)
  3647. pentane/iodine
  3648. pentane/iodobenzene
  3649. pentane/iodomethane
  3650. pentane/isoquinoline
  3651. pentane/kerosene
  3652. pentane/krypton
  3653. pentane/Krytox AX - Perfluoropolyether oil
  3654. pentane/McKay River bitumen
  3655. pentane/mercury
  3656. pentane/methane
  3657. pentane/methanediol diacetate
  3658. pentane/methanol
  3659. pentane/methoxyacetonitrile
  3660. pentane/Methyl 1,2-oxazinane-2-carboxylate
  3661. pentane/Methyl diethylcarbamate
  3662. pentane/methylcyclopentane
  3663. pentane/methylenecyclobutane
  3664. pentane/methyloxirane
  3665. pentane/methylpentanedinitrile
  3666. pentane/methylphenylsilanediol homopolymer
  3667. pentane/methyltris(2-methylpropyl)phosphonium salt with 4-methylbenzenesulfonic acid (1:1)
  3668. pentane/morpholine
  3669. pentane/N,N'-di(1-naphthyl)-N,N'-diphenyl benzidine
  3670. pentane/N,N'-Di(2-ethylhexyl)isobutyramide
  3671. pentane/N,N,N',N'-tetramethylmethanediamine
  3672. pentane/N,N,N-triethyl-1-octanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3673. pentane/N,N,N-trimethyl-1-butanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3674. pentane/N,N-dibutylformamide
  3675. pentane/N,N-didodecyl-1-dodecanamine hydrochloride
  3676. pentane/N,N-diethylacetamide
  3677. pentane/N,N-diethyldodecanamide
  3678. pentane/N,N-diethylethanamine
  3679. pentane/N,N-diethylformamide
  3680. pentane/N,N-dimethylacetamide
  3681. pentane/N,N-Dimethylacetoacetamide
  3682. pentane/N,N-dimethylformamide
  3683. pentane/N,N-dimethylmethanethioamide
  3684. pentane/N,N-dimethylpropanamide
  3685. pentane/N,N-dimethyltetradecanamide
  3686. pentane/N,N-Dimethyltrifluoroacetamide
  3687. pentane/N,N-dioctyl-1-octanamine
  3688. pentane/N,N-dipentyl-1-pentanamine
  3689. pentane/N-acetyl-N-methylacetamide
  3690. pentane/N-butyl-1-butanamine
  3691. pentane/N-butylbenzamide
  3692. pentane/N-Butyrylpiperidine
  3693. pentane/N-ethyl-2-hydroxy-N,N-dimethyl-1-ethanaminium salt with phosphoric acid diethyl ester
  3694. pentane/N-ethyl-N-methylmorpholinium bis(trifluoromethylsulfonyl)imide
  3695. pentane/N-ethylacetamide
  3696. pentane/N-ethylethanamine
  3697. pentane/N-ethylformamide
  3698. pentane/n-heptadecane
  3699. pentane/n-hexatriacontane
  3700. pentane/N-methyl-N,N-dioctyl-1-octanaminium chloride
  3701. pentane/N-methyl-N,N-dioctyl-1-octanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3702. pentane/N-Methyl-N-(2',3'-epoxypropyl)-2-oxopyrrolidinium chloride
  3703. pentane/N-methyl-N-nitrosomethanamine
  3704. pentane/N-methyl-N-octylmorpholinium bis(trifluoromethylsulfonyl)imide
  3705. pentane/N-methylacetamide
  3706. pentane/N-methylformamide
  3707. pentane/N-methylmethanesulfonamide
  3708. pentane/N-methylpropanamide
  3709. pentane/N-pentylbenzamide
  3710. pentane/N-phenylbenzenamine
  3711. pentane/n-tetracosane
  3712. pentane/N-[(4-hydroxy-3-methoxyphenyl)methyl]-8-methylnonanamide
  3713. pentane/natural rubber
  3714. pentane/neon
  3715. pentane/nitric acid methyl ester
  3716. pentane/nitrobenzene
  3717. pentane/nitroethane
  3718. pentane/nitrogen
  3719. pentane/nitromethane
  3720. pentane/nitromethane-d3
  3721. pentane/nitrous acid 1-methylethyl ester
  3722. pentane/nitrous acid 2-methylpropyl ester
  3723. pentane/nitrous acid ethyl ester
  3724. pentane/nitrous acid propyl ester
  3725. pentane/nonadecane
  3726. pentane/nonadecylbenzene
  3727. pentane/nonadecylcyclohexane
  3728. pentane/nonane
  3729. pentane/nonanenitrile
  3730. pentane/nonanoic acid
  3731. pentane/nonanoic acid ethyl ester
  3732. pentane/nonanoic acid methyl ester
  3733. pentane/octacosane
  3734. pentane/octadecafluorodecahydronaphthalene
  3735. pentane/octadecafluorooctane
  3736. pentane/octadecamethyloctasiloxane
  3737. pentane/octadecane
  3738. pentane/octadecanoic acid
  3739. pentane/octadecylbenzene
  3740. pentane/octadecylcyclohexane
  3741. pentane/octane
  3742. pentane/octanoic acid methyl ester
  3743. pentane/oxybismethane
  3744. pentane/oxygen
  3745. pentane/paraffin
  3746. pentane/pentacontane
  3747. pentane/pentadecane
  3748. pentane/pentadecanenitrile
  3749. pentane/pentadecanoic acid methyl ester
  3750. pentane/pentadecylbenzene
  3751. pentane/pentadecylcyclohexane
  3752. pentane/pentafluoro(trifluoromethyl)benzene
  3753. pentane/pentafluorobenzonitrile
  3754. pentane/pentafluoropyridine
  3755. pentane/pentanoic acid ethyl ester
  3756. pentane/pentanoic acid methyl ester
  3757. pentane/pentanoic acid pentyl ester
  3758. pentane/pentatriacontane
  3759. pentane/phenanthrene
  3760. pentane/phenylethanol
  3761. pentane/phosphoric acid bis(2-ethylhexyl) ester
  3762. pentane/phosphoric acid tributyl ester
  3763. pentane/phosphoric acid trimethyl ester
  3764. pentane/phosphoric acid triphenyl ester
  3765. pentane/phosphoric acid tris(2-ethylhexyl) ester
  3766. pentane/phosphoric acid tris(methylphenyl) ester
  3767. pentane/piperidine
  3768. pentane/poly(1-phenylethylene)
  3769. pentane/poly(2-chloro-1,3-butadiene)
  3770. pentane/poly(carbonate) bisphenol-A
  3771. pentane/poly(dimethylsiloxane)
  3772. pentane/poly(eps-caprolactone)diol
  3773. pentane/poly(phenylmethyl 2-methylprop-2-enoate)
  3774. pentane/poly(tetramethylene oxide)
  3775. pentane/poly(vinyl chloride)
  3776. pentane/polyester
  3777. pentane/polyethylene
  3778. pentane/polypropylene
  3779. pentane/poly[oxy(1-oxo-1,6-hexanediyl)]
  3780. pentane/poly[oxy-1,4-phenylenesulfonyl-1,4-phenyleneoxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene]
  3781. pentane/propanal
  3782. pentane/propane
  3783. pentane/propanoic acid
  3784. pentane/propanoic acid butyl ester
  3785. pentane/propanoic acid methyl ester
  3786. pentane/propanoic acid pentyl ester
  3787. pentane/pyridine
  3788. pentane/quinoline
  3789. pentane/silver(1+) compd. with N,N-dimethylbenzamide salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:2:1)
  3790. pentane/silver(I)/propylamine bis(trifluoromethylsulfonyl)imide
  3791. pentane/sodium
  3792. pentane/sulfinylbismethane
  3793. pentane/sulfur dioxide
  3794. pentane/sunflower oil
  3795. pentane/sunflower oil
  3796. pentane/Tetrabutylphosphonium bis(trifluoromethylsulfonyl)imide
  3797. pentane/tetrabutylstannane
  3798. pentane/tetrachloromethane
  3799. pentane/tetradecafluorohexane
  3800. pentane/tetradecane
  3801. pentane/tetradecanoic acid ethyl ester
  3802. pentane/tetradecanoic acid methyl ester
  3803. pentane/tetradecylbenzene
  3804. pentane/tetradecylcyclohexane
  3805. pentane/tetradodecylstannane
  3806. pentane/tetraethylstannane
  3807. pentane/tetrahydro-2-furanmethanol
  3808. pentane/tetrahydro-2H-pyran-2-one homopolymer
  3809. pentane/tetrahydro-3-methylthiophene 1,1-dioxide
  3810. pentane/tetrahydrofuran
  3811. pentane/tetrahydrothiophene 1,1-dioxide
  3812. pentane/tetrahydrothiophene 1-oxide
  3813. pentane/tetramethylstannane
  3814. pentane/Tetraoctylphosphonium bis{(trifluomethyl)sulfonyl}imide
  3815. pentane/tetraoctylstannane
  3816. pentane/tetrapentylstannane
  3817. pentane/tetratriacontane
  3818. pentane/thiirane
  3819. pentane/thiobismethane
  3820. pentane/trans-decahydronaphthalene
  3821. pentane/triacontane
  3822. pentane/tribromostibine
  3823. pentane/tributylethylphosphonium diethyl hydrogen phosphate (1:1)
  3824. pentane/tributylmethylphosphonium methylsulfate
  3825. pentane/tributyltetradecylphosphonium salt with dodecylbenzenesulfonic acid (1:1)
  3826. pentane/trichloromethane
  3827. pentane/tricosane
  3828. pentane/tricyclo[3.3.1.1(3,7)]decane
  3829. pentane/tridecane
  3830. pentane/tridecanoic acid methyl ester
  3831. pentane/triethylsulfonium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3832. pentane/trifluoroborane
  3833. pentane/trifluoromethane
  3834. pentane/trihexyl tetradecyl phosphonium tricyanomethanide
  3835. pentane/trihexyl(tetradecyl)phosphonium hexafluorophosphate(1-)
  3836. pentane/trihexyl(tetradecyl)phosphonium trifluorotris(1,1,1,2,2,2-hexafluoroethyl)phosphate(1-)
  3837. pentane/trihexyltetradecylphosphonium bis(2,4,4-trimethylpentyl)phosphinate
  3838. pentane/trihexyltetradecylphosphonium chloride
  3839. pentane/trihexyltetradecylphosphonium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3840. pentane/trihexyltetradecylphosphonium salt with cyanocyanamide (1:1)
  3841. pentane/trihexyltetradecylphosphonium tetrafluoroborate(1-)
  3842. pentane/trimethyl-5,8,11,14-tetraoxaoctadecane
  3843. pentane/trioctylmethylphosphonium bis(trifluoromethylsulfonyl)imide
  3844. pentane/undecane
  3845. pentane/undecanoic acid methyl ester
  3846. pentane/water
  3847. pentane/water-d2
  3848. pentane/xenon
  3849. pentane/xenon isotope of mass 133
  3850. pentanedial/water
  3851. pentanedinitrile/1,1'-oxybisethane
  3852. pentanedinitrile/1,2-dimethylbenzene
  3853. pentanedinitrile/1,3,5,7-heptanetetracarbonitrile
  3854. pentanedinitrile/1-hexene
  3855. pentanedinitrile/1-propanol
  3856. pentanedinitrile/2-butanone
  3857. pentanedinitrile/2-ethoxy-2-methylpropane
  3858. pentanedinitrile/2-methoxy-2-methylbutane
  3859. pentanedinitrile/2-methyl-1,3-butadiene
  3860. pentanedinitrile/2-nitropropane
  3861. pentanedinitrile/2-propanol
  3862. pentanedinitrile/2-propanone
  3863. pentanedinitrile/3-pentanone
  3864. pentanedinitrile/acetaldehyde
  3865. pentanedinitrile/acetic acid
  3866. pentanedinitrile/acetic acid methyl ester
  3867. pentanedinitrile/acetonitrile
  3868. pentanedinitrile/benzene
  3869. pentanedinitrile/bromoethene
  3870. pentanedinitrile/dichloromethane
  3871. pentanedinitrile/dihydro-2(3H)-furanone
  3872. pentanedinitrile/ethanol
  3873. pentanedinitrile/formamide
  3874. pentanedinitrile/lithium bis(trifluoromethylsulfonyl)azanide
  3875. pentanedinitrile/methanol
  3876. pentanedinitrile/N,N-dimethylformamide
  3877. pentanedinitrile/N-ethylacetamide
  3878. pentanedinitrile/N-methylacetamide
  3879. pentanedinitrile/nitroethane
  3880. pentanedinitrile/nitromethane
  3881. pentanedinitrile/propanoic acid
  3882. pentanedinitrile/trichloromethane
  3883. pentanedinitrile/trimethyl-ammonium bis[(trifluoromethyl)sulfonyl]imide
  3884. pentanedinitrile/trimethylsulfonium salt with 1,1,1-trifluoro-N-((trifluoromethyl)sulfonyl)methanesulfonamide (1:1)
  3885. pentanedinitrile/water
  3886. pentanedioic acid dimethyl ester/benzene
  3887. pentanedioic acid dimethyl ester/carbon dioxide
  3888. pentanedioic acid dimethyl ester/ethylcyclohexane
  3889. pentanedioic acid dimethyl ester/ethyne
  3890. pentanedioic acid dimethyl ester/heptane
  3891. pentanedioic acid dimethyl ester/hexanedioic acid
  3892. pentanedioic acid dimethyl ester/hexanedioic acid dimethyl ester
  3893. pentanedioic acid dimethyl ester/hydrogen
  3894. pentanedioic acid dimethyl ester/hydrogen sulfide (H2S)
  3895. pentanedioic acid dimethyl ester/methanol
  3896. pentanedioic acid dimethyl ester/nitrogen
  3897. pentanedioic acid dimethyl ester/water
  3898. pentanedioic acid dinonyl ester/1-butanol
  3899. pentanedioic acid disodium salt/water
  3900. pentanedioic acid ethenyl methyl ester/ethyne
  3901. pentanedioic acid monoammonium salt/water
  3902. pentanedioic acid monomethyl ester/benzene
  3903. pentanedioic acid sodium salt (1:1)/water
  3904. pentanedioic acid/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)
  3905. pentanedioic acid/1,1'-biphenyl
  3906. pentanedioic acid/1,1':2',1''-terphenyl
  3907. pentanedioic acid/1,1':3',1''-terphenyl
  3908. pentanedioic acid/1,1':4',1''-terphenyl
  3909. pentanedioic acid/1-butanol
  3910. pentanedioic acid/1-butyl-3-methyl-1H-imidazolium tetrafluoroborate(1-)
  3911. pentanedioic acid/1-methyl-2-pyrrolidinone
  3912. pentanedioic acid/1-octadecanol
  3913. pentanedioic acid/1-octanol
  3914. pentanedioic acid/1-propanol
  3915. pentanedioic acid/2,2-dimethylbutanedioic acid
  3916. pentanedioic acid/2,3-dimethylbutanedioic acid
  3917. pentanedioic acid/2-butanol
  3918. pentanedioic acid/2-hydroxy-N,N,N-trimethylethanaminium chloride
  3919. pentanedioic acid/2-methyl-1-propanol
  3920. pentanedioic acid/2-methyl-2-propanol
  3921. pentanedioic acid/2-oxepanone
  3922. pentanedioic acid/2-propanol
  3923. pentanedioic acid/2-propanone
  3924. pentanedioic acid/3-methylpentanedioic acid
  3925. pentanedioic acid/acetic acid
  3926. pentanedioic acid/acetic acid ethyl ester
  3927. pentanedioic acid/benzene
  3928. pentanedioic acid/benzoic acid
  3929. pentanedioic acid/decanedioic acid
  3930. pentanedioic acid/ethanol
  3931. pentanedioic acid/formic acid
  3932. pentanedioic acid/heptadecanoic acid
  3933. pentanedioic acid/heptanedioic acid
  3934. pentanedioic acid/hexadecanoic acid
  3935. pentanedioic acid/hexadecanoic acid ethyl ester
  3936. pentanedioic acid/hexadecanoic acid methyl ester
  3937. pentanedioic acid/hexanedioic acid
  3938. pentanedioic acid/hexanedioic acid dimethyl ester
  3939. pentanedioic acid/methanol
  3940. pentanedioic acid/N,N,N-triethylethanaminium bromide
  3941. pentanedioic acid/N,N,N-triethylethanaminium chloride
  3942. pentanedioic acid/N,N,N-triethylethanaminium iodide
  3943. pentanedioic acid/N,N-dimethylacetamide
  3944. pentanedioic acid/N,N-dimethylformamide
  3945. pentanedioic acid/nonadecanoic acid methyl ester
  3946. pentanedioic acid/nonanedioic acid
  3947. pentanedioic acid/octadecanoic acid
  3948. pentanedioic acid/octadecanoic acid ethyl ester
  3949. pentanedioic acid/octadecanoic acid methyl ester
  3950. pentanedioic acid/octadecanoic acid potassium salt
  3951. pentanedioic acid/octadecanoic acid sodium salt
  3952. pentanedioic acid/pentanedioic acid dimethyl ester
  3953. pentanedioic acid/propanoic acid
  3954. pentanedioic acid/sulfinylbismethane
  3955. pentanedioic acid/sulfuric acid
  3956. pentanedioic acid/tetrahydrothiophene 1,1-dioxide
  3957. pentanedioic acid/trichloromethane
  3958. pentanedioic acid/water
  3959. pentanenitrile/±-2-pentanol
  3960. pentanenitrile/(methylsulfinyl)(methylthio)methane
  3961. pentanenitrile/1,1'-oxybis(2-methylpropane)
  3962. pentanenitrile/1,1'-oxybisbutane
  3963. pentanenitrile/1,1'-oxybispropane
  3964. pentanenitrile/1,1'-thiobispropane
  3965. pentanenitrile/1,2-dichlorobenzene
  3966. pentanenitrile/1-butanol
  3967. pentanenitrile/1-octanol
  3968. pentanenitrile/1-pentanol
  3969. pentanenitrile/2-butanone
  3970. pentanenitrile/2-ethoxyethanol
  3971. pentanenitrile/2-methyl-1,3-butadiene
  3972. pentanenitrile/2-methyl-2-butene
  3973. pentanenitrile/2-propanone
  3974. pentanenitrile/2-pyrrolidinone
  3975. pentanenitrile/3-methylpentane
  3976. pentanenitrile/3-pentanone
  3977. pentanenitrile/acetic acid butyl ester
  3978. pentanenitrile/acetonitrile
  3979. pentanenitrile/benzene
  3980. pentanenitrile/bis(fluorosulfonyl)imide lithium salt
  3981. pentanenitrile/carbon dioxide
  3982. pentanenitrile/cyclohexane
  3983. pentanenitrile/cyclohexanecarbonitrile
  3984. pentanenitrile/cyclopentanecarbonitrile
  3985. pentanenitrile/decane
  3986. pentanenitrile/dichlorodifluoromethane
  3987. pentanenitrile/dichlorofluoromethane
  3988. pentanenitrile/dichloromethane
  3989. pentanenitrile/dodecane
  3990. pentanenitrile/heptane
  3991. pentanenitrile/hexadecane
  3992. pentanenitrile/methanol
  3993. pentanenitrile/N,N,N-triethylethanaminium perchlorate
  3994. pentanenitrile/nonane
  3995. pentanenitrile/octane
  3996. pentanenitrile/propanoic acid 2-methylpropyl ester
  3997. pentanenitrile/Siloxanes and Silicones Me 3,3,3-trifluoropropyl
  3998. pentanenitrile/sulfinylbismethane
  3999. pentanenitrile/tetrachloromethane
  4000. pentanenitrile/tetradecane
  4001. pentanenitrile/tetrahydrothiophene 1,1-dioxide
  4002. pentanenitrile/trichloromethane
  4003. pentanenitrile/water
  4004. pentanenitrile/water-d2
  4005. pentanoic acid 2,2-bis(((1-oxopentyl)oxy)methyl)-1,3-propanediyl ester/1,1,1,2-tetrafluoroethane
  4006. pentanoic acid 2,2-bis(((1-oxopentyl)oxy)methyl)-1,3-propanediyl ester/1,1,1-trifluoroethane
  4007. pentanoic acid 2,2-bis(((1-oxopentyl)oxy)methyl)-1,3-propanediyl ester/1,1-difluoroethane
  4008. pentanoic acid 2,2-bis(((1-oxopentyl)oxy)methyl)-1,3-propanediyl ester/1,3,3,3-tetrafluoroprop-1-ene
  4009. pentanoic acid 2,2-bis(((1-oxopentyl)oxy)methyl)-1,3-propanediyl ester/2,3,3,3-tetrafluoro-1-propene
  4010. pentanoic acid 2,2-bis(((1-oxopentyl)oxy)methyl)-1,3-propanediyl ester/2-ethylhexanoic acid 2,2-bis(((2-ethyl-1-oxohexyl)oxy)methyl)-1,3-propanediyl ester
  4011. pentanoic acid 2,2-bis(((1-oxopentyl)oxy)methyl)-1,3-propanediyl ester/2-methylpropane
  4012. pentanoic acid 2,2-bis(((1-oxopentyl)oxy)methyl)-1,3-propanediyl ester/difluoromethane
  4013. pentanoic acid 2,2-bis(((1-oxopentyl)oxy)methyl)-1,3-propanediyl ester/pentafluoroethane
  4014. pentanoic acid 2-(1-oxopentyl)hydrazide/ethanol
  4015. pentanoic acid 2-(1-oxopentyl)hydrazide/water
  4016. pentanoic acid 2-methylpropyl ester/phenol
  4017. pentanoic acid anhydride/hexadecane
  4018. pentanoic acid anhydride/tetradecane
  4019. pentanoic acid barium salt/water
  4020. pentanoic acid butyl ester/benzene
  4021. pentanoic acid butyl ester/water
  4022. pentanoic acid calcium salt/water
  4023. pentanoic acid ethyl ester/(3β)-cholest-5-en-3-ol
  4024. pentanoic acid ethyl ester/1,2-dibromopropane
  4025. pentanoic acid ethyl ester/1,2-dimethylbenzene
  4026. pentanoic acid ethyl ester/1,3-dioxolane
  4027. pentanoic acid ethyl ester/1,5-dichloropentane
  4028. pentanoic acid ethyl ester/1,6-dibromohexane
  4029. pentanoic acid ethyl ester/1-butanol
  4030. pentanoic acid ethyl ester/1-iodo-3-methylbutane
  4031. pentanoic acid ethyl ester/1-pentanol
  4032. pentanoic acid ethyl ester/2-hydroxypropanoic acid methyl ester
  4033. pentanoic acid ethyl ester/2-methylheptane
  4034. pentanoic acid ethyl ester/2-methylhexane
  4035. pentanoic acid ethyl ester/3-methylheptane
  4036. pentanoic acid ethyl ester/3-methylhexane
  4037. pentanoic acid ethyl ester/3-methylpentane
  4038. pentanoic acid ethyl ester/4-methylheptane
  4039. pentanoic acid ethyl ester/acetamide
  4040. pentanoic acid ethyl ester/acetic acid
  4041. pentanoic acid ethyl ester/benzene
  4042. pentanoic acid ethyl ester/ethanol
  4043. pentanoic acid ethyl ester/hexadecane
  4044. pentanoic acid ethyl ester/n-heptadecane
  4045. pentanoic acid ethyl ester/pentachloroethane
  4046. pentanoic acid ethyl ester/pentadecane
  4047. pentanoic acid ethyl ester/propanoic acid
  4048. pentanoic acid ethyl ester/tribromomethane
  4049. pentanoic acid ethyl ester/tridecane
  4050. pentanoic acid ethyl ester/water
  4051. pentanoic acid magnesium salt/pentanoic acid sodium salt
  4052. pentanoic acid methyl ester/1,1,2,2-tetrachloroethane
  4053. pentanoic acid methyl ester/1,4-dibromopentane
  4054. pentanoic acid methyl ester/1,5-dichloropentane
  4055. pentanoic acid methyl ester/1,6-dibromohexane
  4056. pentanoic acid methyl ester/1-butanol
  4057. pentanoic acid methyl ester/1-pentanol
  4058. pentanoic acid methyl ester/1-propanol
  4059. pentanoic acid methyl ester/acetic acid methyl ester
  4060. pentanoic acid methyl ester/acetonitrile
  4061. pentanoic acid methyl ester/benzene
  4062. pentanoic acid methyl ester/ethanol
  4063. pentanoic acid methyl ester/methanol
  4064. pentanoic acid methyl ester/n-heptadecane
  4065. pentanoic acid methyl ester/pentadecane
  4066. pentanoic acid methyl ester/tetradecane
  4067. pentanoic acid methyl ester/trichloromethane
  4068. pentanoic acid methyl ester/tridecane
  4069. pentanoic acid methyl ester/water
  4070. pentanoic acid methyl ester/zinc chloride (ZnCl2)
  4071. pentanoic acid pentyl ester/benzene
  4072. pentanoic acid pentyl ester/n-heptadecane
  4073. pentanoic acid pentyl ester/pentadecane
  4074. pentanoic acid pentyl ester/sulfur dioxide
  4075. pentanoic acid pentyl ester/tridecane
  4076. pentanoic acid pentyl ester/water
  4077. pentanoic acid potassium salt/nitric acid potassium salt
  4078. pentanoic acid potassium salt/nitric acid sodium salt
  4079. pentanoic acid potassium salt/nitrous acid potassium salt
  4080. pentanoic acid potassium salt/pentanoic acid sodium salt
  4081. pentanoic acid potassium salt/water
  4082. pentanoic acid samarium(3+) salt/N,N-dimethylformamide
  4083. pentanoic acid silver(1+) salt/water
  4084. pentanoic acid sodium salt/nitric acid potassium salt
  4085. pentanoic acid sodium salt/nitric acid sodium salt
  4086. pentanoic acid sodium salt/nitrous acid sodium salt
  4087. pentanoic acid sodium salt/water
  4088. pentanoic acid zinc salt (2:1)/water
  4089. pentanoic acid/(1'S-trans)-7-chloro-2',4,6-trimethoxy-6'-methylspiro[benzofuran-2(3H),1'-(2)cyclohexene]-3,4'-dione
  4090. pentanoic acid/(ethoxymethyl)benzene
  4091. pentanoic acid/1,1'-oxybis(3-methylbutane)
  4092. pentanoic acid/1,1'-oxybisbutane
  4093. pentanoic acid/1,1'-oxybispentane
  4094. pentanoic acid/1,1'-thiobispropane
  4095. pentanoic acid/1,1,2,2-tetrachloroethane
  4096. pentanoic acid/1,2-dibromopropane
  4097. pentanoic acid/1,2-dichlorobenzene
  4098. pentanoic acid/1,2-dimethylbenzene
  4099. pentanoic acid/1,2-ethanediol diacetate
  4100. pentanoic acid/1,3,3-trimethyl-2-oxabicyclo[2.2.2]octane
  4101. pentanoic acid/1,3-dibromopropane
  4102. pentanoic acid/1-bromo-2-methylbenzene
  4103. pentanoic acid/1-bromo-3-methylbenzene
  4104. pentanoic acid/1-bromohexane
  4105. pentanoic acid/1-butanol
  4106. pentanoic acid/1-chloro-2-methylbenzene
  4107. pentanoic acid/1-decanol
  4108. pentanoic acid/1-ethyl-3-methyl-1H-imidazolium salt with sulfuric acid monoethyl ester (1:1)
  4109. pentanoic acid/1-heptanol
  4110. pentanoic acid/1-hexanol
  4111. pentanoic acid/1-iodo-3-methylbutane
  4112. pentanoic acid/1-methyl-2-pyrrolidinone
  4113. pentanoic acid/1-methyl-4-(1-methylethenyl)cyclohexene
  4114. pentanoic acid/1-methyl-4-(1-methylethyl)-1,3-cyclohexadiene
  4115. pentanoic acid/1-methyl-4-(1-methylethyl)-1,4-cyclohexadiene
  4116. pentanoic acid/1-methyl-4-(1-methylethyl)benzene
  4117. pentanoic acid/1-methyl-4-(1-methylethylidene)cyclohexene
  4118. pentanoic acid/1-nonanol
  4119. pentanoic acid/1-octanol
  4120. pentanoic acid/1-pentanol
  4121. pentanoic acid/1-penten-4-yne
  4122. pentanoic acid/1-phenylethanone
  4123. pentanoic acid/1H-indene
  4124. pentanoic acid/2,2-dimethyl-3-methylenebicyclo[2.2.1]heptane
  4125. pentanoic acid/2,6,6-trimethylbicyclo[3.1.1]hept-2-ene
  4126. pentanoic acid/2,6-dimethyl-2,5-heptadien-4-one
  4127. pentanoic acid/2-butyne
  4128. pentanoic acid/2-hydroxybenzaldehyde
  4129. pentanoic acid/2-methylbutanoic acid
  4130. pentanoic acid/2-methylphenol
  4131. pentanoic acid/2-methylpropanoic acid
  4132. pentanoic acid/2-octanone
  4133. pentanoic acid/2-propanol
  4134. pentanoic acid/3,3'-oxybispropanenitrile
  4135. pentanoic acid/3-methoxy-1-butanol acetate
  4136. pentanoic acid/3-methyl-1,3-butanediol
  4137. pentanoic acid/3-methylbutanoic acid
  4138. pentanoic acid/3-methylbutanoic acid 3-methylbutyl ester
  4139. pentanoic acid/3-oxobutanoic acid ethyl ester
  4140. pentanoic acid/4-chloro-2-phenylisoindole-1,3-dione
  4141. pentanoic acid/6,6-dimethyl-2-methylenebicyclo[3.1.1]heptane
  4142. pentanoic acid/acetamide
  4143. pentanoic acid/acetic acid
  4144. pentanoic acid/acetonitrile
  4145. pentanoic acid/benzene
  4146. pentanoic acid/butanenitrile
  4147. pentanoic acid/carbon dioxide
  4148. pentanoic acid/chloroacetic acid
  4149. pentanoic acid/cyclohexane
  4150. pentanoic acid/cyclopropane
  4151. pentanoic acid/decane
  4152. pentanoic acid/dichlorofluoromethane
  4153. pentanoic acid/dodecane
  4154. pentanoic acid/ethanedioic acid diethyl ester
  4155. pentanoic acid/ethanol
  4156. pentanoic acid/formic acid
  4157. pentanoic acid/heptane
  4158. pentanoic acid/heptanoic acid
  4159. pentanoic acid/hexachloroethane
  4160. pentanoic acid/hexane
  4161. pentanoic acid/hexanoic acid
  4162. pentanoic acid/hydrazine
  4163. pentanoic acid/hydrochloric acid
  4164. pentanoic acid/iodobenzene
  4165. pentanoic acid/methanol
  4166. pentanoic acid/methoxymethylbenzene
  4167. pentanoic acid/N,N-diethylbenzenamine
  4168. pentanoic acid/N,N-diethylethanamine
  4169. pentanoic acid/N,N-dimethylpentanamide
  4170. pentanoic acid/naphthalene
  4171. pentanoic acid/pentachloroethane
  4172. pentanoic acid/pentadecanoic acid compd. with tetradecanoic acid (2:3)
  4173. pentanoic acid/propanoic acid
  4174. pentanoic acid/propoxybenzene
  4175. pentanoic acid/pyridine
  4176. pentanoic acid/tetrachloromethane
  4177. pentanoic acid/tetrachlorostannane
  4178. pentanoic acid/tetrahydro-4-methyl-2H-pyran-4-ol
  4179. pentanoic acid/tetrahydrothiophene 1,1-dioxide
  4180. pentanoic acid/trichloroacetic acid ethyl ester
  4181. pentanoic acid/tridecane
  4182. pentanoic acid/undecane
  4183. pentanoic acid/urea
  4184. pentanoic acid/water
  4185. pentanoic acid/xenon isotope of mass 133
  4186. pentanol/1-ethyl-3-methyl-1H-imidazolium salt with sulfuric acid monoethyl ester (1:1)
  4187. pentanoyl chloride/benzene
  4188. pentathionic acid dipotassium salt/water
  4189. pentatriacontane/2,2-dimethylbutane
  4190. pentatriacontane/2-methylbutane
  4191. pentatriacontane/benzene
  4192. pentatriacontane/methylcyclopentane
  4193. pentatriacontane/triacontane
  4194. pentatricontafluoro-5,8,11,14,17,20,23,26-octakis(trifluoromethyl)-3,6,9,12,15,18,21,24,27-nonaoxatriacontane/oxygen
  4195. pentose/water
  4196. Pentyl 3-phenylpropanoate/propanoic acid methyl ester
  4197. pentylbenzene/1,1,2,2-tetrabromoethane
  4198. pentylbenzene/1,5-diazabicyclo[4.3.0]non-5-enium acetate
  4199. pentylbenzene/1-butyl-3-methyl-1H-imidazolium tetrabromidocobaltate(2-)
  4200. pentylbenzene/1-butyl-3-methyl-1H-imidazolium tetrabromocobaltate(2-) (2:1)
  4201. pentylbenzene/19,24-dioctadecyldotetracontane
  4202. pentylbenzene/1H-indene
  4203. pentylbenzene/acetonitrile
  4204. pentylbenzene/benzene
  4205. pentylbenzene/ethane
  4206. pentylbenzene/nitrobenzene
  4207. pentylbenzene/poly(1-phenylethylene)
  4208. pentylbenzene/Siloxanes and Silicones Me 3,3,3-trifluoropropyl
  4209. pentylbenzene/sulfinylbismethane
  4210. pentylbenzene/tetrachloromethane
  4211. pentylbenzene/tribromostibine
  4212. pentylbenzene/water
  4213. pentylcyclohexane/benzene
  4214. pentylcyclohexane/hexadecane
  4215. pentylcyclohexane/pentylbenzene
  4216. pentylcyclopentane/water
  4217. pentyldiphenyl(2-propenyl)arsonium iodide/2-propanone
  4218. pentyloxirane/1,2-benzenedicarboxylic acid dinonyl ester
  4219. pentyloxirane/1-heptene
  4220. pentylpropanedioic acid/benzene
  4221. pentylpropanedioic acid/water
  4222. perboric acid (HBO(O2)) sodium salt tetrahydrate/water
  4223. perboric acid (HBO(O2)) sodium salt/water
  4224. perbromic acid ammonium salt/2-propanone
  4225. perbromic acid ammonium salt/acetonitrile
  4226. perbromic acid ammonium salt/ethanol
  4227. perbromic acid ammonium salt/methanol
  4228. perbromic acid ammonium salt/water
  4229. perchlorate/methanol
  4230. perchloric acid aluminum salt/1,1'-oxybisethane
  4231. perchloric acid aluminum salt/2-propanone
  4232. perchloric acid aluminum salt/acetic acid
  4233. perchloric acid aluminum salt/acetonitrile
  4234. perchloric acid aluminum salt/benzene
  4235. perchloric acid aluminum salt/ethanol
  4236. perchloric acid aluminum salt/formamide
  4237. perchloric acid aluminum salt/methanol
  4238. perchloric acid aluminum salt/N,N-dimethylformamide
  4239. perchloric acid aluminum salt/nitrobenzene
  4240. perchloric acid aluminum salt/sulfinylbismethane
  4241. perchloric acid aluminum salt/water
  4242. perchloric acid ammonium salt/2-methyl-1-propanol
  4243. perchloric acid ammonium salt/N-methylacetamide
  4244. perchloric acid ammonium salt/perchloric acid lithium salt
  4245. perchloric acid barium salt/1,1'-oxybisethane
  4246. perchloric acid barium salt/1-butanol
  4247. perchloric acid barium salt/1-propanol
  4248. perchloric acid barium salt/2-butanone
  4249. perchloric acid barium salt/2-methyl-1-propanol
  4250. perchloric acid barium salt/2-propanone
  4251. perchloric acid barium salt/acetic acid ethyl ester
  4252. perchloric acid barium salt/acetonitrile
  4253. perchloric acid barium salt/ethanol
  4254. perchloric acid barium salt/hydrazine
  4255. perchloric acid barium salt/methanol
  4256. perchloric acid barium salt/N,N-dimethylformamide
  4257. perchloric acid barium salt/perchloric acid calcium salt
  4258. perchloric acid barium salt/perchloric acid potassium salt
  4259. perchloric acid barium salt/perchloric acid sodium salt
  4260. perchloric acid barium salt/sulfinylbismethane
  4261. perchloric acid barium salt/water
  4262. perchloric acid beryllium salt/N,N-dimethylformamide
  4263. perchloric acid beryllium salt/sulfinylbismethane
  4264. perchloric acid beryllium salt/water
  4265. perchloric acid cadmium salt/2-furancarboxaldehyde
  4266. perchloric acid cadmium salt/acetonitrile
  4267. perchloric acid cadmium salt/sulfinylbismethane
  4268. perchloric acid cadmium salt/water
  4269. perchloric acid calcium salt/1,1'-oxybisethane
  4270. perchloric acid calcium salt/1-butanol
  4271. perchloric acid calcium salt/1-propanol
  4272. perchloric acid calcium salt/2-methyl-1-propanol
  4273. perchloric acid calcium salt/2-propanone
  4274. perchloric acid calcium salt/acetic acid ethyl ester
  4275. perchloric acid calcium salt/acetonitrile
  4276. perchloric acid calcium salt/ethanol
  4277. perchloric acid calcium salt/hydrazine
  4278. perchloric acid calcium salt/hydrogen peroxide (H2O2)
  4279. perchloric acid calcium salt/methanol
  4280. perchloric acid calcium salt/N,N-dimethylformamide
  4281. perchloric acid calcium salt/perchloric acid lithium salt
  4282. perchloric acid calcium salt/perchloric acid potassium salt
  4283. perchloric acid calcium salt/perchloric acid sodium salt
  4284. perchloric acid calcium salt/sulfinylbismethane
  4285. perchloric acid calcium salt/water
  4286. perchloric acid cerium(3+) salt/acetonitrile
  4287. perchloric acid cerium(3+) salt/water
  4288. perchloric acid cesium salt/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)
  4289. perchloric acid cesium salt/1,1'-oxybisethane
  4290. perchloric acid cesium salt/1,2-propanediol
  4291. perchloric acid cesium salt/1-butanol
  4292. perchloric acid cesium salt/1-propanol
  4293. perchloric acid cesium salt/2-butanone
  4294. perchloric acid cesium salt/2-methyl-1-propanol
  4295. perchloric acid cesium salt/2-propanone
  4296. perchloric acid cesium salt/3-methyl-2-butanol
  4297. perchloric acid cesium salt/acetic acid ethyl ester
  4298. perchloric acid cesium salt/acetonitrile
  4299. perchloric acid cesium salt/ethanol
  4300. perchloric acid cesium salt/formamide
  4301. perchloric acid cesium salt/hexamethylphosphoric triamide
  4302. perchloric acid cesium salt/hydrazine
  4303. perchloric acid cesium salt/hydrogen peroxide (H2O2)
  4304. perchloric acid cesium salt/methanol
  4305. perchloric acid cesium salt/N,N-dimethylformamide
  4306. perchloric acid cesium salt/N-methylacetamide
  4307. perchloric acid cesium salt/nitrobenzene
  4308. perchloric acid cesium salt/perchloric acid
  4309. perchloric acid cesium salt/sulfinylbismethane
  4310. perchloric acid cesium salt/tetramethylurea
  4311. perchloric acid cesium salt/water
  4312. perchloric acid chromium(3+) salt/water
  4313. perchloric acid cobalt(2+) salt hexahydrate/water
  4314. perchloric acid cobalt(2+) salt/2-furancarboxaldehyde
  4315. perchloric acid cobalt(2+) salt/acetonitrile
  4316. perchloric acid cobalt(2+) salt/hexamethylphosphoric triamide
  4317. perchloric acid cobalt(2+) salt/methanol
  4318. perchloric acid cobalt(2+) salt/N,N-diethylacetamide
  4319. perchloric acid cobalt(2+) salt/N,N-dimethylformamide
  4320. perchloric acid cobalt(2+) salt/phosphoric acid triethyl ester
  4321. perchloric acid cobalt(2+) salt/sulfinylbismethane
  4322. perchloric acid cobalt(2+) salt/water
  4323. perchloric acid copper(2+) salt hexahydrate/2-ethoxyethanol
  4324. perchloric acid copper(2+) salt hexahydrate/2-furancarboxaldehyde
  4325. perchloric acid copper(2+) salt hexahydrate/water
  4326. perchloric acid copper(2+) salt/acetonitrile
  4327. perchloric acid copper(2+) salt/hexamethylphosphoric triamide
  4328. perchloric acid copper(2+) salt/N,N-dimethylformamide
  4329. perchloric acid copper(2+) salt/phosphoric acid triethyl ester
  4330. perchloric acid copper(2+) salt/sulfinylbismethane
  4331. perchloric acid copper(2+) salt/water
  4332. perchloric acid dysprosium(3+) salt/water
  4333. perchloric acid erbium(3+) salt/water
  4334. perchloric acid europium(3+) salt/N,N-dimethylformamide
  4335. perchloric acid europium(3+) salt/water
  4336. perchloric acid gadolinium(3+) salt/water
  4337. perchloric acid gallium(3+) salt/water
  4338. perchloric acid holmium(3+) salt/water
  4339. perchloric acid indium(3+) salt/N,N-dimethylformamide
  4340. perchloric acid indium(3+) salt/water
  4341. perchloric acid iron(2+) salt/ethanol
  4342. perchloric acid iron(2+) salt/water
  4343. perchloric acid iron(3+) salt/acetonitrile
  4344. perchloric acid iron(3+) salt/N,N-dimethylformamide
  4345. perchloric acid iron(3+) salt/sulfinylbismethane
  4346. perchloric acid iron(3+) salt/water
  4347. perchloric acid lanthanum(3+) salt/water
  4348. perchloric acid lead(2+) salt/2-furancarboxaldehyde
  4349. perchloric acid lead(2+) salt/methanol
  4350. perchloric acid lead(2+) salt/N,N-dimethylformamide
  4351. perchloric acid lead(2+) salt/water
  4352. perchloric acid lithium salt monohydrate/1,1'-oxybisethane
  4353. perchloric acid lithium salt trihydrate/1,1'-oxybisethane
  4354. perchloric acid lithium salt trihydrate/1-butanol
  4355. perchloric acid lithium salt trihydrate/1-propanol
  4356. perchloric acid lithium salt trihydrate/2-methyl-1-propanol
  4357. perchloric acid lithium salt trihydrate/2-propanone
  4358. perchloric acid lithium salt trihydrate/acetic acid ethyl ester
  4359. perchloric acid lithium salt trihydrate/ethanol
  4360. perchloric acid lithium salt trihydrate/methanol
  4361. perchloric acid lithium salt/1,2-benzenedicarboxylic acid diethyl ester
  4362. perchloric acid lithium salt/1,3-dioxolan-2-one
  4363. perchloric acid lithium salt/2-butanol
  4364. perchloric acid lithium salt/2-butanone
  4365. perchloric acid lithium salt/2-furancarboxaldehyde
  4366. perchloric acid lithium salt/2-methyl-1-propanol
  4367. perchloric acid lithium salt/2-methylpropanenitrile
  4368. perchloric acid lithium salt/acetic acid methyl ester
  4369. perchloric acid lithium salt/benzoic acid ethyl ester
  4370. perchloric acid lithium salt/chloroacetic acid methyl ester
  4371. perchloric acid lithium salt/dihydro-2(3H)-furanone
  4372. perchloric acid lithium salt/N-methylacetamide
  4373. perchloric acid lithium salt/nitrobenzene
  4374. perchloric acid lithium salt/tetrahydro-2-methylfuran
  4375. perchloric acid lutetium(3+) salt/water
  4376. perchloric acid magnesium salt hexahydrate/water
  4377. perchloric acid magnesium salt/1,1'-oxybisethane
  4378. perchloric acid magnesium salt/1-butanol
  4379. perchloric acid magnesium salt/1-hexanol
  4380. perchloric acid magnesium salt/1-propanol
  4381. perchloric acid magnesium salt/2-methyl-1-propanol
  4382. perchloric acid magnesium salt/2-propanol
  4383. perchloric acid magnesium salt/2-propanone
  4384. perchloric acid magnesium salt/3-methyl-1-butanol
  4385. perchloric acid magnesium salt/4-methyl-1,3-dioxolan-2-one
  4386. perchloric acid magnesium salt/acetic acid ethyl ester
  4387. perchloric acid magnesium salt/acetonitrile
  4388. perchloric acid magnesium salt/ammonia
  4389. perchloric acid magnesium salt/dihydro-2(3H)-furanone
  4390. perchloric acid magnesium salt/ethanol
  4391. perchloric acid magnesium salt/formamide
  4392. perchloric acid magnesium salt/hydrazine
  4393. perchloric acid magnesium salt/hydrogen peroxide (H2O2)
  4394. perchloric acid magnesium salt/methanol
  4395. perchloric acid magnesium salt/N,N-dimethylacetamide
  4396. perchloric acid magnesium salt/N,N-dimethylformamide
  4397. perchloric acid magnesium salt/nitromethane
  4398. perchloric acid magnesium salt/sulfinylbismethane
  4399. perchloric acid magnesium salt/tetrahydrofuran
  4400. perchloric acid magnesium salt/tetrahydrothiophene 1,1-dioxide
  4401. perchloric acid magnesium salt/water
  4402. perchloric acid manganese(2+) salt/acetonitrile
  4403. perchloric acid manganese(2+) salt/hexamethylphosphoric triamide
  4404. perchloric acid manganese(2+) salt/methanol
  4405. perchloric acid manganese(2+) salt/N,N-dimethylformamide
  4406. perchloric acid manganese(2+) salt/phosphoric acid triethyl ester
  4407. perchloric acid manganese(2+) salt/sulfinylbismethane
  4408. perchloric acid manganese(2+) salt/water
  4409. perchloric acid mercury(1+) salt/water
  4410. perchloric acid mercury(2+) salt/water
  4411. perchloric acid neodymium(3+) salt/N,N-dimethylformamide
  4412. perchloric acid neodymium(3+) salt/water
  4413. perchloric acid nickel(2+) salt hexahydrate/water
  4414. perchloric acid nickel(2+) salt/acetonitrile
  4415. perchloric acid nickel(2+) salt/hexamethylphosphoric triamide
  4416. perchloric acid nickel(2+) salt/methanol
  4417. perchloric acid nickel(2+) salt/N,N-dimethylformamide
  4418. perchloric acid nickel(2+) salt/phosphoric acid triethyl ester
  4419. perchloric acid nickel(2+) salt/sulfinylbismethane
  4420. perchloric acid nickel(2+) salt/water
  4421. perchloric acid nickel(2+) saltdihydrate/2-furancarboxaldehyde
  4422. perchloric acid potassium salt/1,3-dioxolan-2-one
  4423. perchloric acid potassium salt/1-methyl-2-pyrrolidinone
  4424. perchloric acid potassium salt/2-butanone
  4425. perchloric acid potassium salt/2-methyl-1-propanol
  4426. perchloric acid potassium salt/dihydro-2(3H)-furanone
  4427. perchloric acid potassium salt/disulfuric acid
  4428. perchloric acid potassium salt/N-methylacetamide
  4429. perchloric acid potassium salt/nitrobenzene
  4430. perchloric acid potassium salt/perchloric acid lithium salt
  4431. perchloric acid potassium salt/propanamide
  4432. perchloric acid potassium salt/water-d2
  4433. perchloric acid praseodymium(3+) salt/water
  4434. perchloric acid radium(2+) salt/water
  4435. perchloric acid rubidium salt/1,1'-oxybisethane
  4436. perchloric acid rubidium salt/1,3-dimethyl-2-imidazolidinone
  4437. perchloric acid rubidium salt/1-butanol
  4438. perchloric acid rubidium salt/1-propanol
  4439. perchloric acid rubidium salt/2-butanone
  4440. perchloric acid rubidium salt/2-methyl-1-propanol
  4441. perchloric acid rubidium salt/2-propanone
  4442. perchloric acid rubidium salt/acetic acid ethyl ester
  4443. perchloric acid rubidium salt/acetonitrile
  4444. perchloric acid rubidium salt/ethanol
  4445. perchloric acid rubidium salt/formamide
  4446. perchloric acid rubidium salt/formic acid
  4447. perchloric acid rubidium salt/hexamethylphosphoric triamide
  4448. perchloric acid rubidium salt/hydrazine
  4449. perchloric acid rubidium salt/hydrogen peroxide (H2O2)
  4450. perchloric acid rubidium salt/methanol
  4451. perchloric acid rubidium salt/N,N-dimethylformamide
  4452. perchloric acid rubidium salt/N-methylacetamide
  4453. perchloric acid rubidium salt/nitrobenzene
  4454. perchloric acid rubidium salt/nitromethane
  4455. perchloric acid rubidium salt/perchloric acid
  4456. perchloric acid rubidium salt/sulfinylbismethane
  4457. perchloric acid rubidium salt/tetrahydro-1,3-dimethyl-2(1H)-pyrimidinone
  4458. perchloric acid rubidium salt/tetramethylurea
  4459. perchloric acid rubidium salt/water
  4460. perchloric acid samarium(3+) salt/water
  4461. perchloric acid scandium(3+) salt/water
  4462. perchloric acid silver(1+) salt/1-methyl-2-pyrrolidinone
  4463. perchloric acid silver(1+) salt/2-furancarboxaldehyde
  4464. perchloric acid silver(1+) salt/2-methyl-1-propanol
  4465. perchloric acid silver(1+) salt/N-methylacetamide
  4466. perchloric acid silver(1+) salt/nitric acid lithium salt
  4467. perchloric acid silver(1+) salt/nitrobenzene
  4468. perchloric acid sodium salt/1,2-propanediamine
  4469. perchloric acid sodium salt/1,3-dioxolan-2-one
  4470. perchloric acid sodium salt/1-methyl-2-pyrrolidinone
  4471. perchloric acid sodium salt/2-butanone
  4472. perchloric acid sodium salt/2-methyl-1-propanol
  4473. perchloric acid sodium salt/acetic acid methyl ester
  4474. perchloric acid sodium salt/ammonia
  4475. perchloric acid sodium salt/chloric acid sodium salt
  4476. perchloric acid sodium salt/dihydro-2(3H)-furanone
  4477. perchloric acid sodium salt/hydrogen peroxide (H2O2)
  4478. perchloric acid sodium salt/N-methylacetamide
  4479. perchloric acid sodium salt/nitric acid lithium salt
  4480. perchloric acid sodium salt/nitric acid sodium salt
  4481. perchloric acid sodium salt/nitrobenzene
  4482. perchloric acid sodium salt/perchloric acid
  4483. perchloric acid sodium salt/perchloric acid lithium salt
  4484. perchloric acid sodium salt/propanamide
  4485. perchloric acid sodium salt/water
  4486. perchloric acid sodium salt/water-d2
  4487. perchloric acid strontium salt/1,1'-oxybisethane
  4488. perchloric acid strontium salt/1-butanol
  4489. perchloric acid strontium salt/1-propanol
  4490. perchloric acid strontium salt/2-methyl-1-propanol
  4491. perchloric acid strontium salt/2-propanone
  4492. perchloric acid strontium salt/acetic acid ethyl ester
  4493. perchloric acid strontium salt/ethanol
  4494. perchloric acid strontium salt/hydrazine
  4495. perchloric acid strontium salt/hydrogen peroxide (H2O2)
  4496. perchloric acid strontium salt/methanol
  4497. perchloric acid strontium salt/N,N-dimethylformamide
  4498. perchloric acid strontium salt/N-methylacetamide
  4499. perchloric acid strontium salt/sulfinylbismethane
  4500. perchloric acid strontium salt/water
  4501. perchloric acid terbium(3+) salt/water
  4502. perchloric acid thallium(1+) salt/acetonitrile
  4503. perchloric acid thallium(1+) salt/methanol
  4504. perchloric acid thallium(1+) salt/N,N-dimethylformamide
  4505. perchloric acid thallium(1+) salt/nitromethane
  4506. perchloric acid thallium(1+) salt/sulfur dioxide
  4507. perchloric acid thallium(1+) salt/water
  4508. perchloric acid thulium(3+) salt/water
  4509. perchloric acid ytterbium(3+) salt/water
  4510. perchloric acid yttrium(3+) salt/water
  4511. perchloric acid zinc salt/acetonitrile
  4512. perchloric acid zinc salt/hexamethylphosphoric triamide
  4513. perchloric acid zinc salt/methanol
  4514. perchloric acid zinc salt/N,N-dimethylformamide
  4515. perchloric acid zinc salt/phosphoric acid triethyl ester
  4516. perchloric acid zinc salt/sulfinylbismethane
  4517. perchloric acid zinc salt/water
  4518. perchloric acid/chloroacetic acid
  4519. perchloric acid/dichloroacetic acid
  4520. perchloric acid/hydrogen peroxide (H2O2)
  4521. perchloric acid/nitric acid
  4522. perchloric acid/nitrobenzene
  4523. perchloric acid/nitroguanidine perchlorate
  4524. perchloric acid/perchloric acid lithium salt
  4525. perchloric acid/perchloric acid potassium salt
  4526. perchloric acid/sulfuric acid
  4527. perchloric acid/water
  4528. perchloryl fluoride ((ClO3)F)/fluorine
  4529. perfluorobutyl sulfonic acid/Cholinium perfluoropentanoate
  4530. periodic acid (H4I2O9) dipotassium salt/water
  4531. periodic acid (H5IO6) diammonium salt/water
  4532. periodic acid (H5IO6) disilver(1+) salt/water
  4533. periodic acid (H5IO6) pentalithium salt/water
  4534. periodic acid (H5IO6)/N,N-dimethylurea
  4535. periodic acid (H5IO6)/water
  4536. periodic acid (HIO4) ammonium salt/water
  4537. periodic acid (HIO4) cesium salt/water
  4538. periodic acid (HIO4) rubidium salt/water
  4539. periodic acid (HIO4)/water
  4540. permanganic acid (HMnO4) calcium salt/water
  4541. permanganic acid (HMnO4) cesium salt/water
  4542. permanganic acid (HMnO4) lithium salt/water
  4543. permanganic acid (HMnO4) potassium salt/water
  4544. permanganic acid (HMnO4) potassium salt/water-d2
  4545. permanganic acid (HMnO4) rubidium salt/water
  4546. permanganic acid (HMnO4) sodium salt/water
  4547. permanganic acid (HMnO4) zinc salt/water
  4548. peroxydisulfuric acid (((HO)S(O)2)2O2) barium salt (1:1)/water
  4549. peroxydisulfuric acid (((HO)S(O)2)2O2) dicesium salt/water
  4550. peroxydisulfuric acid (((HO)S(O)2)2O2) dirubidium salt/water
  4551. peroxydisulfuric acid (((OH)S(O)2)2O2)/water
  4552. peroxymonosulfuric acid monopotassium salt/water
  4553. perrhenic acid (HReO4) compd. with N-octyl-1-octanamine (1:1)/chloronaphthalene
  4554. perylene/1,3,5-trinitrobenzene
  4555. perylene/1H,3H-benzo(1,2-c:4,5-c')difuran-1,3,5,7-tetrone
  4556. perylene/2,4,5,7-tetranitro-9H-fluoren-9-one
  4557. perylene/2-propanone
  4558. perylene/acetonitrile
  4559. perylene/ethane
  4560. perylene/ethanol
  4561. perylene/tetrachloromethane
  4562. perylene/trichloromethane
  4563. perylene/water
  4564. petroleum ether/(1,1'-biphenyl)-2-ol
  4565. petroleum ether/2,4,6-trinitrophenol
  4566. petroleum ether/9-ethyl-9H-carbazole
  4567. petroleum ether/fire damp
  4568. petroleum ether/fire damp
  4569. petroleum ether/fire damp
  4570. petroleum ether/N,N-diethylethanamine hydrochloride compd. with aluminum chloride (AlCl3) (1:2)
  4571. phenanthrene compd. with 2,4,6-trinitrophenol (1:1)/ethanol
  4572. phenanthrene/(1,1-dimethylethyl)benzene
  4573. phenanthrene/(1-methylethyl)benzene
  4574. phenanthrene/1,1'-biphenyl
  4575. phenanthrene/1,1':3',1''-terphenyl
  4576. phenanthrene/1,2,4,5-tetramethylbenzene
  4577. phenanthrene/1,2,4-trimethylbenzene
  4578. phenanthrene/1,2-dichlorobenzene
  4579. phenanthrene/1,2-dimethylbenzene
  4580. phenanthrene/1,3,5-trinitrobenzene
  4581. phenanthrene/1,3-dinitrobenzene
  4582. phenanthrene/1-chloro-2-methylbenzene
  4583. phenanthrene/1-methyl-2-pyrrolidinone
  4584. phenanthrene/1-methylnaphthalene
  4585. phenanthrene/1H,3H-benzo(1,2-c:4,5-c')difuran-1,3,5,7-tetrone
  4586. phenanthrene/1H-indene
  4587. phenanthrene/2,4,6-trinitrophenol
  4588. phenanthrene/2-chloro-1,3,5-trinitrobenzene
  4589. phenanthrene/2-furancarboxaldehyde
  4590. phenanthrene/2-methylnaphthalene
  4591. phenanthrene/3-hydroxybenzoic acid
  4592. phenanthrene/4-Benzylideneaminophenol
  4593. phenanthrene/9H-carbazole
  4594. phenanthrene/9H-fluorene
  4595. phenanthrene/benzine (mixture)
  4596. phenanthrene/Benzylidene-p-bromoaniline
  4597. phenanthrene/cyclopentanol
  4598. phenanthrene/decahydronaphthalene
  4599. phenanthrene/heavy naphtha
  4600. phenanthrene/hydrocarbon blend
  4601. phenanthrene/hydrocarbon blend
  4602. phenanthrene/N-(4-Chlorobenzylidene)aniline
  4603. phenanthrene/N-(4-Methoxyphenyl)-1-phenylmethanimine
  4604. phenanthrene/N-(4-Nitrophenyl)-1-phenylmethanimine
  4605. phenanthrene/N-Benzylidene-4-chloroaniline
  4606. phenanthrene/naphthalene
  4607. phenanthrene/petroleum solvent
  4608. phenanthrene/thianthrene
  4609. phenanthridine/9H-fluoren-9-one
  4610. phenanthridine/9H-fluorene-2-carbaldehyde
  4611. phenanthridine/benzene
  4612. phenanthridine/phenoxathiin
  4613. phenanthridine/water
  4614. phenol compd. with benzenamine (1:1)/water
  4615. phenol potassium salt/1,2-ethanediamine
  4616. phenol sodium salt/water
  4617. phenol-d/water
  4618. phenol-d/water-d2
  4619. phenol-d6/water
  4620. phenol-d6/water-d2
  4621. phenol/α,α,4-trimethyl-3-cyclohexene-1-methanol
  4622. phenol/α,α-dimethylbenzenemethanol
  4623. phenol/α,α-diphenylbenzenemethanol
  4624. phenol/α-methylbenzeneacetaldehyde
  4625. phenol/α-methylbenzenemethanol
  4626. phenol/α-phenylbenzenemethanol
  4627. phenol/±-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one
  4628. phenol/(1,1'-bicyclohexyl)one
  4629. phenol/(1,1'-bicyclohexyl)one
  4630. phenol/(1,1'-biphenyl)-4,4'-diamine
  4631. phenol/(1,1-dimethylethyl)benzene
  4632. phenol/(1-methylethenyl)benzene
  4633. phenol/(1-methylethenyl)benzene dimer
  4634. phenol/(1-methylethyl)benzene
  4635. phenol/(1-methylpropyl)benzene
  4636. phenol/(1R,2S,4R)-rel-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol
  4637. phenol/(1R,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one
  4638. phenol/(1R-(1α,2β,5α))-5-methyl-2-(1-methylethyl)cyclohexanol
  4639. phenol/(2-methylpropyl)benzene
  4640. phenol/(2E)-2-butenedioic acid dimethyl ester
  4641. phenol/(2E)-3-phenyl-2-propenoic acid
  4642. phenol/(2R,3S)-rel-1,2,3,4-butanetetrol
  4643. phenol/(2Z)-2-butenedioic acid dimethyl ester
  4644. phenol/(E)-1,2-dichloroethene
  4645. phenol/(ethoxymethyl)benzene
  4646. phenol/(S)-3-(1-methyl-2-pyrrolidinyl)pyridine
  4647. phenol/1,1',1''-methylidynetrisbenzene
  4648. phenol/1,1'-oxybis(2-chloroethane)
  4649. phenol/1,1'-oxybis(3-methylbutane)
  4650. phenol/1,1'-oxybisbutane
  4651. phenol/1,1'-oxybiscyclohexane
  4652. phenol/1,1'-oxybisethane
  4653. phenol/1,1'-oxybispentane
  4654. phenol/1,1'-thiobis(2-methylpropane)
  4655. phenol/1,1'-thiobis(3-methylbutane)
  4656. phenol/1,1'-thiobisbutane
  4657. phenol/1,1':4',1''-terphenyl
  4658. phenol/1,1,2,2-tetrachloroethane
  4659. phenol/1,1-dichloroethane
  4660. phenol/1,2,3,4-tetraethylbenzene
  4661. phenol/1,2,3,4-tetrahydronaphthalene
  4662. phenol/1,2,3,4-tetramethylbenzene
  4663. phenol/1,2,3,5-tetramethylbenzene
  4664. phenol/1,2,3-tribromopropane
  4665. phenol/1,2,3-trichloropropane
  4666. phenol/1,2,3-trimethylbenzene
  4667. phenol/1,2,4,5-tetraethylbenzene
  4668. phenol/1,2,4,5-tetramethylbenzene
  4669. phenol/1,2,4-triethylbenzene
  4670. phenol/1,2,4-trimethylbenzene
  4671. phenol/1,2-benzenediamine
  4672. phenol/1,2-benzenediol
  4673. phenol/1,2-dibromopropane
  4674. phenol/1,2-dichlorobenzene
  4675. phenol/1,2-dichloropropane
  4676. phenol/1,2-diethenylbenzene
  4677. phenol/1,2-diethylbenzene
  4678. phenol/1,2-dihydro-1,5-dimethyl-2-phenyl-3H-pyrazol-3-one
  4679. phenol/1,2-dimethoxybenzene
  4680. phenol/1,2-dimethylbenzene
  4681. phenol/1,2-ethanediol diacetate
  4682. phenol/1,2-ethanediol monoacetate
  4683. phenol/1,2-propanediol
  4684. phenol/1,3,3-trimethyl-2-oxabicyclo[2.2.2]octane
  4685. phenol/1,3,3-trimethylbicyclo[2.2.1]heptan-2-one
  4686. phenol/1,3-bis(1-methylethyl)benzene
  4687. phenol/1,3-dibromopropane
  4688. phenol/1,3-dichloro-2-propanol
  4689. phenol/1,3-dichloropropane
  4690. phenol/1,3-diethylbenzene
  4691. phenol/1,3-isobenzofurandione
  4692. phenol/1,4-benzenediol
  4693. phenol/1,4-dioxane
  4694. phenol/1-bromo-2-propanone
  4695. phenol/1-bromo-3-methylbenzene
  4696. phenol/1-bromohexane
  4697. phenol/1-butanol
  4698. phenol/1-butyl-2-methylbenzene
  4699. phenol/1-butyl-3-methyl-1H-imidazolium hexafluorophosphate(1-)
  4700. phenol/1-butyl-3-methylbenzene
  4701. phenol/1-butyl-4-methylbenzene
  4702. phenol/1-chloro-2-methoxybenzene
  4703. phenol/1-chloro-2-methylbenzene
  4704. phenol/1-chlorobutane
  4705. phenol/1-chloropropane
  4706. phenol/1-ethoxy-2-methoxy-4-prop-2-enylbenzene
  4707. phenol/1-ethyl-3,5-dimethylbenzene
  4708. phenol/1-ethyl-4-propylbenzene
  4709. phenol/1-ethylnaphthalene
  4710. phenol/1-heptanol
  4711. phenol/1-heptene
  4712. phenol/1-hexanol
  4713. phenol/1-hexene
  4714. phenol/1-hexylnaphthalene
  4715. phenol/1-iodo-3-methylbutane
  4716. phenol/1-iodo-4-methylbenzene
  4717. phenol/1-iodobutane
  4718. phenol/1-methyl-2-(1-methylethyl)benzene
  4719. phenol/1-methyl-2-pyrrolidinone
  4720. phenol/1-methyl-3-(1-methylethenyl)cyclohexane
  4721. phenol/1-methyl-3-(1-methylethyl)benzene
  4722. phenol/1-methyl-4-(1-methylethenyl)cyclohexanol
  4723. phenol/1-methyl-4-(1-methylethyl)-1,3-cyclohexadiene
  4724. phenol/1-methyl-4-(1-methylethyl)-1,4-cyclohexadiene
  4725. phenol/1-methyl-4-(1-methylethyl)-7-oxabicyclo[2.2.1]heptane
  4726. phenol/1-methyl-4-(1-methylethyl)benzene
  4727. phenol/1-methyl-4-(1-methylethylidene)cyclohexene
  4728. phenol/1-methylnaphthalene
  4729. phenol/1-naphthalenamine
  4730. phenol/1-naphthalenol
  4731. phenol/1-nonene
  4732. phenol/1-octadecylnaphthalene
  4733. phenol/1-octanol
  4734. phenol/1-octene
  4735. phenol/1-pentanol
  4736. phenol/1-phenyl-1-propanone
  4737. phenol/1-phenylethanone
  4738. phenol/1-propanol
  4739. phenol/1-propene
  4740. phenol/1-propyne
  4741. phenol/1-undecene
  4742. phenol/1H-indene
  4743. phenol/1H-pyrazole
  4744. phenol/2,2'-(1,2-ethanediylbis(oxy))bisethanol
  4745. phenol/2,2'-(1,4-butanediyl)bisoxirane
  4746. phenol/2,2'-oxybisethanol
  4747. phenol/2,2,4-trimethylpentane
  4748. phenol/2,2,5-trimethylhexane
  4749. phenol/2,2-dimethyl-3-methylenebicyclo[2.2.1]heptane
  4750. phenol/2,3-bis(acetyloxy)butanedioic acid diethyl ester
  4751. phenol/2,3-dichloro-1-propanol
  4752. phenol/2,3-dimethyl-2,3-butanediol
  4753. phenol/2,4,6-trimethylphenol
  4754. phenol/2,4,6-trinitrophenol
  4755. phenol/2,4-dimethylbenzenamine
  4756. phenol/2,5-pyrrolidinedione
  4757. phenol/2,6,10,15,19,23-hexamethyltetracosane
  4758. phenol/2,6-dimethyl-2,5-heptadien-4-one
  4759. phenol/2,6-dimethylphenol
  4760. phenol/2-(1,1-dimethylethyl)phenol
  4761. phenol/2-(2-ethoxyethoxy)ethanol
  4762. phenol/2-(2-methoxyethoxy)ethanol
  4763. phenol/2-aminoethanol
  4764. phenol/2-butanone
  4765. phenol/2-butoxyethanol
  4766. phenol/2-chloro-1-propanol
  4767. phenol/2-chlorophenol
  4768. phenol/2-ethoxyethanol
  4769. phenol/2-ethoxyethanol acetate
  4770. phenol/2-ethyl-1,4-dimethylbenzene
  4771. phenol/2-ethyl-4-prop-2-enylphenol
  4772. phenol/2-furancarboxaldehyde
  4773. phenol/2-furanmethanol
  4774. phenol/2-heptanone
  4775. phenol/2-hydroxy-2-methylpropanoic acid ethyl ester
  4776. phenol/2-hydroxy-N,N,N-trimethyl-1-ethanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  4777. phenol/2-hydroxy-N,N,N-trimethylethanaminium chloride
  4778. phenol/2-hydroxybenzaldehyde
  4779. phenol/2-hydroxybenzoic acid
  4780. phenol/2-hydroxypropanoic acid 1-methylethyl ester
  4781. phenol/2-hydroxypropanoic acid 3-methylbutyl ester
  4782. phenol/2-hydroxypropanoic acid ethyl ester
  4783. phenol/2-hydroxypropanoic acid methyl ester
  4784. phenol/2-hydroxypropanoic acid propyl ester
  4785. phenol/2-iodoethanol
  4786. phenol/2-methoxy-2-methylbutane
  4787. phenol/2-methoxy-4-(2-propenyl)phenol
  4788. phenol/2-methoxy-5-(2-propenyl)phenol
  4789. phenol/2-methoxyethanol
  4790. phenol/2-methoxyethanol acetate
  4791. phenol/2-methoxyphenol
  4792. phenol/2-methyl-1,3-butadiene
  4793. phenol/2-methyl-1-butanol
  4794. phenol/2-methyl-1-propanol
  4795. phenol/2-methyl-2-butene
  4796. phenol/2-methyl-2-propanol
  4797. phenol/2-methylbenzenamine
  4798. phenol/2-methylbenzofuran
  4799. phenol/2-methylbutane
  4800. phenol/2-methylnaphthalene
  4801. phenol/2-methylphenol
  4802. phenol/2-methylpropane
  4803. phenol/2-methylpropanoic acid
  4804. phenol/2-methylpropanoic acid 3-methylbutyl ester
  4805. phenol/2-methylpyridine
  4806. phenol/2-naphthalenamine
  4807. phenol/2-naphthalenol
  4808. phenol/2-nitrobenzenamine
  4809. phenol/2-octanol
  4810. phenol/2-octanone
  4811. phenol/2-propanol
  4812. phenol/2-propanone
  4813. phenol/2-propanone oxime
  4814. phenol/2-propenylbenzene
  4815. phenol/2-propoxyethanol
  4816. phenol/2H-1-benzopyran-2-one
  4817. phenol/3,7-dimethyl-1,6-octadien-3-ol
  4818. phenol/3-aminophenol
  4819. phenol/3-methoxy-1-butanol acetate
  4820. phenol/3-methyl-1-butanol
  4821. phenol/3-methylbutanoic acid
  4822. phenol/3-methylbutanoic acid 2-methylpropyl ester
  4823. phenol/3-methylbutanoic acid 3-methylbutyl ester
  4824. phenol/3-methylbutanoic acid butyl ester
  4825. phenol/3-methylpyridine
  4826. phenol/3-nitrobenzenamine
  4827. phenol/3-phenyl-2-propenoic acid
  4828. phenol/4,4'-(1-methylethylidene)bisphenol
  4829. phenol/4-(1,1-dimethylethyl)phenol
  4830. phenol/4-(1-methyl-1-phenylethyl)phenol
  4831. phenol/4-(2-propenyl)phenol
  4832. phenol/4-aminophenol
  4833. phenol/4-methyl-3-penten-2-one
  4834. phenol/4-methylpentanoic acid
  4835. phenol/5-(2-propenyl)-1,3-benzodioxole
  4836. phenol/5-hexenyloxirane
  4837. phenol/5-methyl-2-(1-methylethyl)cyclohexanol
  4838. phenol/5-methyl-2-(1-methylethyl)phenol
  4839. phenol/5-nonanone
  4840. phenol/6,6-dimethyl-2-methylenebicyclo[3.1.1]heptane
  4841. phenol/6-methyl-5-hepten-2-one
  4842. phenol/acetamide
  4843. phenol/acetic acid
  4844. phenol/acetic acid butyl ester
  4845. phenol/acetic acid ethyl ester
  4846. phenol/acetic acid heptyl ester
  4847. phenol/acetic acid hexyl ester
  4848. phenol/acetic acid methyl ester
  4849. phenol/acetic acid phenyl ester
  4850. phenol/acetonitrile
  4851. phenol/acridine
  4852. phenol/ammonia
  4853. phenol/anthracene
  4854. phenol/antimony chloride (SbCl5)
  4855. phenol/arsenous tribromide
  4856. phenol/benzamide
  4857. phenol/benzenamine
  4858. phenol/benzene
  4859. phenol/benzenepropanoic acid
  4860. phenol/benzoic acid
  4861. phenol/benzoic acid methyl ester
  4862. phenol/benzoic acid phenylmethyl ester
  4863. phenol/bromoethane
  4864. phenol/butanedioic acid
  4865. phenol/butanoic acid butyl ester
  4866. phenol/butylcyclohexane
  4867. phenol/carbamic acid ethyl ester
  4868. phenol/carbon dioxide
  4869. phenol/carbon disulfide
  4870. phenol/carbon monoxide
  4871. phenol/carbonic acid bis(2-methylpropyl) ester
  4872. phenol/carbonic acid dimethyl ester
  4873. phenol/carbonic acid methyl phenyl ester
  4874. phenol/chloroacetic acid
  4875. phenol/chrysene
  4876. phenol/cycloheptane
  4877. phenol/cyclohexane
  4878. phenol/cyclohexene
  4879. phenol/cyclohexylbenzene
  4880. phenol/cyclopentanol
  4881. phenol/decahydronaphthalene
  4882. phenol/decane
  4883. phenol/dichlorofluoromethane
  4884. phenol/dichloromethane
  4885. phenol/diethylbenzene
  4886. phenol/diphenylmethanone
  4887. phenol/dodecane
  4888. phenol/dodecylbenzene
  4889. phenol/eicosane
  4890. phenol/ethane
  4891. phenol/ethanedioic acid diethyl ester
  4892. phenol/ethanedioic acid dimethyl ester
  4893. phenol/ethanol
  4894. phenol/ethene
  4895. phenol/ethenylethylbenzene
  4896. phenol/ethylcyclohexane
  4897. phenol/exo-2-methoxy-1,7,7-trimethylbicyclo[2.2.1]heptane
  4898. phenol/formamide
  4899. phenol/formic acid ethyl ester
  4900. phenol/heptane
  4901. phenol/hexachloroethane
  4902. phenol/hexadecane
  4903. phenol/hexadecylcyclohexane
  4904. phenol/hexaethylbenzene
  4905. phenol/hexamethylbenzene
  4906. phenol/hexamethylphosphoric triamide
  4907. phenol/hexanal
  4908. phenol/hexane
  4909. phenol/hexanedioic acid
  4910. phenol/hexanoic acid ethyl ester
  4911. phenol/hydrazine
  4912. phenol/hydrochloric acid
  4913. phenol/hydrogen
  4914. phenol/hydrogen sulfide (H2S)
  4915. phenol/iodoethane
  4916. phenol/iodomethane
  4917. phenol/lithium chloride (LiCl)
  4918. phenol/mercury iodide (HgI2)
  4919. phenol/methane
  4920. phenol/methanol
  4921. phenol/methoxymethylbenzene
  4922. phenol/methylcyclopentane
  4923. phenol/methylphenol
  4924. phenol/methylurea
  4925. phenol/N,N'-dimethylurea
  4926. phenol/N,N,2-trimethylbenzenamine
  4927. phenol/N,N,N-triethylethanaminium chloride
  4928. phenol/N,N,N-trimethylmethanaminium chloride
  4929. phenol/N,N,N-tripropylbenzenemethanaminium chloride
  4930. phenol/N,N,N2,N2-tetramethyl-1,3-propanediamine dihydrochloride
  4931. phenol/N,N-diethylbenzenamine
  4932. phenol/N,N-diethylethanamine
  4933. phenol/N,N-dimethyl-4-nitrosobenzenamine
  4934. phenol/N,N-dimethylacetamide
  4935. phenol/N,N-dimethylbenzenamine
  4936. phenol/N,N-dimethylformamide
  4937. phenol/N,N-dimethylurea
  4938. phenol/N-ethylethanamine
  4939. phenol/n-hexatriacontane
  4940. phenol/N-methyl-N-phenylbenzenamine
  4941. phenol/N-methylacetamide
  4942. phenol/N-phenyl-N'-(2-propenyl)thiourea
  4943. phenol/N-phenylbenzenamine
  4944. phenol/naphthalene
  4945. phenol/nitric acid silver(1+) salt
  4946. phenol/nitrobenzene
  4947. phenol/nitrogen
  4948. phenol/nonane
  4949. phenol/octane
  4950. phenol/oxybismethane
  4951. phenol/oxygen
  4952. phenol/paraffin
  4953. phenol/pentaethylbenzene
  4954. phenol/pentane
  4955. phenol/pentanoic acid
  4956. phenol/pentylbenzene
  4957. phenol/phenanthrene
  4958. phenol/phenol sodium salt
  4959. phenol/phenol tin(4+) salt
  4960. phenol/phenol titanium(4+) salt (4:1)
  4961. phenol/phosphoric acid
  4962. phenol/phosphoric acid trimethyl ester
  4963. phenol/phosphoric acid tris(methylphenyl) ester
  4964. phenol/piperidine
  4965. phenol/poly(vinyl chloride)
  4966. phenol/polycarbonates
  4967. phenol/polyethylene
  4968. phenol/propanamide
  4969. phenol/propane
  4970. phenol/propanoic acid
  4971. phenol/propoxybenzene
  4972. phenol/pyridazine
  4973. phenol/pyridine
  4974. phenol/quinoline
  4975. phenol/silicic acid (H4SiO4) tetraethyl ester
  4976. phenol/sulfinylbismethane
  4977. phenol/sulfonylbismethane
  4978. phenol/sulfur
  4979. phenol/sulfur dioxide
  4980. phenol/sulfuric acid
  4981. phenol/sulfuric acid disodium salt
  4982. phenol/tetrabromostannane
  4983. phenol/tetrabutylphosphonium bromide
  4984. phenol/tetrachloromethane
  4985. phenol/tetrachlorostannane
  4986. phenol/tetrahydrofuran
  4987. phenol/tetrahydrothiophene 1,1-dioxide
  4988. phenol/thiophene
  4989. phenol/trans-decahydronaphthalene
  4990. phenol/triacontane
  4991. phenol/tribromomethane
  4992. phenol/tribromostibine
  4993. phenol/trichloroacetaldehyde
  4994. phenol/trichloroacetic acid
  4995. phenol/trichloroethene
  4996. phenol/trichloromethane
  4997. phenol/tridecane
  4998. phenol/trioctylphosphine oxide
  4999. phenol/Triphenyl(prop-2-enyl)phosphanium bromide
  5000. phenol/undecane
  5001. phenol/urea
  5002. phenol/water
  5003. phenol/water-d2
  5004. phenoxathiin/benzene
  5005. phenoxathiin/water
  5006. phenoxyacetic acid sodium salt/water
  5007. phenoxyacetic acid/carbon dioxide
  5008. phenoxyacetic acid/water
  5009. phenyl(2,3,4-trihydroxyphenyl)methanone/water
  5010. phenyl(2-pyridinyl)methanone 2-quinolynylhydrazone/water
  5011. phenylazanium; 2,4,6-trinitrophenolate/nitrobenzene
  5012. phenylazanium; 2,4,6-trinitrophenolate/phosphoric acid triethyl ester
  5013. phenylazanium; 2,4,6-trinitrophenolate/phosphoric acid tris(2-ethylhexyl) ester
  5014. phenylazanium; 2,4,6-trinitrophenolate/phosphoric acid tris(2-methylphenyl) ester
  5015. phenylcarbamic acid ethyl ester/1,2,3-propanetriol trinitrate
  5016. phenylcarbamic acid ethyl ester/1,4-dimethyl-2,5-piperazinedione
  5017. phenylcarbamic acid ethyl ester/2,2-bis((nitrooxy)methyl)-1,3-propanediol dinitrate
  5018. phenylcarbamic acid ethyl ester/4-(dimethylamino)-1,2-dihydro-1,5-dimethyl-2-phenyl-3H-pyrazol-3-one
  5019. phenylcarbamic acid ethyl ester/5,5-diethyl-2,4,6(1H,3H,5H)-pyrimidinetrione
  5020. phenylcarbamic acid ethyl ester/N,N'-dimethylurea
  5021. phenylcarbamic acid ethyl ester/N,N-dimethylurea
  5022. phenylcarbamic acid methyl ester/benzenamine
  5023. phenylcarbamic acid methyl ester/carbamic acid methyl ester
  5024. phenylenediamine/benzene
  5025. phenylethanol/benzene
  5026. phenylethanol/heptane
  5027. phenylethanolamine/sulfinylbismethane
  5028. phenylethynethiol potassium salt/acetonitrile
  5029. phenylhydrazine monohydrochloride/water
  5030. phenylhydrazine/2-chlorophenol
  5031. phenylhydrazine/2-methoxyphenol
  5032. phenylhydrazine/2-nitrophenol
  5033. phenylhydrazine/3-nitrophenol
  5034. phenylhydrazine/4-chlorophenol
  5035. phenylhydrazine/acetic acid
  5036. phenylhydrazine/benzenamine
  5037. phenylhydrazine/chlorosulfuric acid
  5038. phenylhydrazine/formic acid
  5039. phenylhydrazine/magnesium bromide (MgBr2)
  5040. phenylhydrazine/phenol
  5041. phenylhydrazine/water
  5042. phenylmercury(1+) acetate/trichloromethane
  5043. phenylmercury(1+) acetate/water
  5044. phenylphosphine dipotassium salt/sulfinylbismethane
  5045. phenylphosphinic acid/2-propanone
  5046. phenylphosphinic acid/benzene
  5047. phenylphosphinic acid/dichloromethane
  5048. phenylphosphinic acid/ethanol
  5049. phenylphosphinic acid/methanol
  5050. phenylphosphinic acid/trichloromethane
  5051. phenylphosphinic acid/water
  5052. phenylphosphonic acid/1-butanol
  5053. phenylphosphonic acid/1-pentanol
  5054. phenylphosphonic acid/1-propanol
  5055. phenylphosphonic acid/2-propanol
  5056. phenylphosphonic acid/2-propanone
  5057. phenylphosphonic acid/2-propoxyethanol
  5058. phenylphosphonic acid/acetonitrile
  5059. phenylphosphonic acid/ethanol
  5060. phenylphosphonic acid/methanol
  5061. phenylphosphonic acid/trichloromethane
  5062. phenylphosphonic acid/water
  5063. phenylphosphonodithious acid diethyl ester/tetrachloromethane
  5064. phenylphosphonodithious acid diethyl ester/trichloromethane
  5065. phenylphosphonothioic acid O-(4-bromo-2,5-dichlorophenyl) O-methyl ester/water
  5066. phenylphosphonothioic dichloride/water
  5067. phenylphosphonous acid diethyl ester/tetrachloromethane
  5068. phenylphosphonous acid diethyl ester/trichloromethane
  5069. phenylphosphonous dichloride/phosphorous trichloride
  5070. phenylpropanal/benzene
  5071. phenylpropanal/heptane
  5072. phenylsulfonylacetic acid methyl ester/water
  5073. phenylthiourea/ethanol
  5074. phenylthiourea/water
  5075. phenylurea/1-butanol
  5076. phenylurea/1-methyl-2-pyrrolidinone
  5077. phenylurea/1-propanol
  5078. phenylurea/2-methyl-1-propanol
  5079. phenylurea/2-propanol
  5080. phenylurea/acetonitrile
  5081. phenylurea/ethanol
  5082. phenylurea/methanol
  5083. phenylurea/N,N-dimethylformamide
  5084. phenylurea/sulfinylbismethane
  5085. phenylurea/water
  5086. phloroglucinol Tris(cyclic 2,2-dimethyl-1,3-propanediol phosphate)/1,4-dioxane
  5087. phloroglucinol Tris(cyclic 2,2-dimethyl-1,3-propanediol phosphate)/2-propanone
  5088. phloroglucinol Tris(cyclic 2,2-dimethyl-1,3-propanediol phosphate)/acetonitrile
  5089. phloroglucinol Tris(cyclic 2,2-dimethyl-1,3-propanediol phosphate)/dichloromethane
  5090. phloroglucinol Tris(cyclic 2,2-dimethyl-1,3-propanediol phosphate)/ethanol
  5091. phloroglucinol Tris(cyclic 2,2-dimethyl-1,3-propanediol phosphate)/methanol
  5092. phloroglucinol Tris(cyclic 2,2-dimethyl-1,3-propanediol phosphate)/trichloromethane
  5093. phosphane (red)/1,1'-oxybisethane
  5094. phosphane (red)/1,2,3-propanetriol
  5095. phosphane (red)/acetic acid
  5096. phosphane (red)/benzene
  5097. phosphane (red)/carbon disulfide
  5098. phosphane (red)/ethanol
  5099. phosphane (red)/indium
  5100. phosphane (red)/lead
  5101. phosphane (red)/mandelic acid
  5102. phosphane (red)/paraffin
  5103. phosphane (red)/water
  5104. phosphine/1,2-benzenedicarboxylic acid didecyl ester
  5105. phosphine/2-furancarboxaldehyde
  5106. phosphine/liquid paraffin
  5107. phosphine/nitrobenzene
  5108. phosphine/silane
  5109. phosphine/triethoxysilane
  5110. phosphinic acid barium salt (2:1)/water
  5111. phosphinic acid manganese(2+) salt (2:1)/water
  5112. phosphinic acid sodium salt/water
  5113. phosphinic acid/water
  5114. phosphonic acid bis(2-chloroethyl) ester/2-propanone
  5115. phosphonic acid bis(2-methylpropyl) ester/2-hydroxy-2-methylpropanenitrile
  5116. phosphonic acid calcium salt (2:1)/water
  5117. phosphonic acid dibutyl ester/2-hydroxy-2-methylpropanenitrile
  5118. phosphonic acid diethyl ester/1-hydroxycyclohexanecarbonitrile
  5119. phosphonic acid dilithium salt/water
  5120. phosphonic acid diphenyl ester/2-propanone
  5121. phosphonic acid disodium salt/water
  5122. phosphonic acid monomethyl ester/phosphonic acid dimethyl ester
  5123. Phosphonic acid/sodium dihydrogen phosphate mono(phosphoric acid)
  5124. phosphonitrile chloride/acetonitrile
  5125. phosphoramidic acid, N,N'-1,2-ethanediylbis-P,P,P',P'-tetraphenyl ester/2-propanone
  5126. phosphoramidic acid, N,N'-1,2-ethanediylbis-P,P,P',P'-tetraphenyl ester/acetic acid methyl ester
  5127. phosphoramidic acid, N,N'-1,2-ethanediylbis-P,P,P',P'-tetraphenyl ester/acetonitrile
  5128. phosphoramidic acid, N,N'-1,2-ethanediylbis-P,P,P',P'-tetraphenyl ester/benzene
  5129. phosphoramidic acid, N,N'-1,2-ethanediylbis-P,P,P',P'-tetraphenyl ester/ethanol
  5130. phosphoramidic acid, N,N'-1,2-ethanediylbis-P,P,P',P'-tetraphenyl ester/methanol
  5131. phosphoramidic acid, N,N'-1,2-ethanediylbis-P,P,P',P'-tetraphenyl ester/trichloromethane
  5132. phosphoramidic acid, N-(phenylmethyl)-, diphenyl ester/2-propanone
  5133. phosphoramidic acid, N-(phenylmethyl)-, diphenyl ester/acetic acid methyl ester
  5134. phosphoramidic acid, N-(phenylmethyl)-, diphenyl ester/acetonitrile
  5135. phosphoramidic acid, N-(phenylmethyl)-, diphenyl ester/dichloromethane
  5136. phosphoramidic acid, N-(phenylmethyl)-, diphenyl ester/methanol
  5137. phosphoramidic acid, N-(phenylmethyl)-, diphenyl ester/trichloromethane
  5138. phosphoric acid 1,4-phenylene tetrabutyl ester/water
  5139. phosphoric acid 2,2-dichloroethenyl dimethyl ester/water
  5140. phosphoric acid ammonium sodium salt (1:1:1)/water
  5141. phosphoric acid bis(2-ethylhexyl) ester/1,1'-oxybisethane
  5142. phosphoric acid bis(2-ethylhexyl) ester/1,2-dimethylbenzene
  5143. phosphoric acid bis(2-ethylhexyl) ester/1-butanol
  5144. phosphoric acid bis(2-ethylhexyl) ester/1-propanol
  5145. phosphoric acid bis(2-ethylhexyl) ester/2-propanone
  5146. phosphoric acid bis(2-ethylhexyl) ester/acetic acid
  5147. phosphoric acid bis(2-ethylhexyl) ester/alamine 336
  5148. phosphoric acid bis(2-ethylhexyl) ester/benzene
  5149. phosphoric acid bis(2-ethylhexyl) ester/Dysprosium di(2-ethylhexyl)phosphate
  5150. phosphoric acid bis(2-ethylhexyl) ester/ethanol
  5151. phosphoric acid bis(2-ethylhexyl) ester/Europium di(2-ethylhexyl)phosphate
  5152. phosphoric acid bis(2-ethylhexyl) ester/Gadolinium di(2-ethylhexyl)phosphate
  5153. phosphoric acid bis(2-ethylhexyl) ester/kerosene
  5154. phosphoric acid bis(2-ethylhexyl) ester/kerosene
  5155. phosphoric acid bis(2-ethylhexyl) ester/methanol
  5156. phosphoric acid bis(2-ethylhexyl) ester/Neodymium di(2-ethylhexyl)phosphate
  5157. phosphoric acid bis(2-ethylhexyl) ester/nitrobenzene
  5158. phosphoric acid bis(2-ethylhexyl) ester/propanoic acid
  5159. phosphoric acid bis(2-ethylhexyl) ester/Samarium di(2-ethylhexyl)phosphate
  5160. phosphoric acid bis(2-ethylhexyl) ester/Terbium di(2-ethylhexyl)phosphate
  5161. phosphoric acid bis(2-ethylhexyl) ester/tetrachloromethane
  5162. phosphoric acid bis(2-ethylhexyl) ester/trichloromethane
  5163. phosphoric acid bis(2-ethylhexyl) ester/tridecane
  5164. phosphoric acid bis(2-ethylhexyl) ester/water
  5165. phosphoric acid butyl bis(methylphenyl) ester/water
  5166. phosphoric acid cadmium salt (2:3)/phosphoric acid zinc salt (2:3)
  5167. phosphoric acid cadmium salt (2:3)/water
  5168. phosphoric acid calcium salt (2:1) monohydate/water
  5169. phosphoric acid calcium salt (2:3)/calcium fluoride (CaF2)
  5170. phosphoric acid calcium sodium salt (1:1:1)/phosphoric acid calcium salt (2:3)
  5171. phosphoric acid calcium sodium salt (1:1:1)/sodium magnesium phosphate
  5172. phosphoric acid calcium zinc salt/phosphoric acid zinc salt (2:3)
  5173. phosphoric acid cerium salt(4+) salt (2:1) dihydrate/water
  5174. phosphoric acid cerium(3+) salt (1:1)/diphosphoric acid tetrasodium salt
  5175. phosphoric acid cobalt(2+) salt (2:3)/water
  5176. phosphoric acid copper(2+) salt (1:1)/water
  5177. phosphoric acid dibutyl ester cerium(3+) salt/water
  5178. phosphoric acid dibutyl ester gadolinium(3+) salt (3:1)/water
  5179. phosphoric acid dibutyl ester lanthanum(3+) salt (3:1)/water
  5180. phosphoric acid dibutyl ester sodium salt/water
  5181. phosphoric acid dibutyl ester ytterbium(3+) salt (3:1)/water
  5182. phosphoric acid dibutyl ester/1,3-diethylbenzene
  5183. phosphoric acid dibutyl ester/2-propanone
  5184. phosphoric acid dibutyl ester/benzene
  5185. phosphoric acid dibutyl ester/carbon disulfide
  5186. phosphoric acid dibutyl ester/cyclohexane
  5187. phosphoric acid dibutyl ester/dodecane
  5188. phosphoric acid dibutyl ester/ethanol
  5189. phosphoric acid dibutyl ester/hexane
  5190. phosphoric acid dibutyl ester/methanol
  5191. phosphoric acid dibutyl ester/methylbenzene
  5192. phosphoric acid dibutyl ester/tetrachloromethane
  5193. phosphoric acid dibutyl ester/trichloromethane
  5194. phosphoric acid dibutyl ester/water
  5195. phosphoric acid dibutyl ethyl ester/water
  5196. phosphoric acid dibutyl methylphenyl ester/water
  5197. phosphoric acid diethyl 2-methylpropyl ester/water
  5198. phosphoric acid diethyl ester sodium salt/water
  5199. phosphoric acid dimethyl ester gadolinium(3+) salt/water
  5200. phosphoric acid dimethyl ester ytterbium(3+) salt/water
  5201. phosphoric acid dioctadecyl ester sodium salt/water
  5202. phosphoric acid disodium salt dodecahydrate/carbonic acid disodium salt decahydrate
  5203. phosphoric acid disodium salt/water
  5204. phosphoric acid dysprosium(3+) salt (1:1)/water
  5205. phosphoric acid erbium(3+) salt (1:1)/metaphosphoric acid (HPO3) potassium salt
  5206. phosphoric acid erbium(3+) salt (1:1)/water
  5207. phosphoric acid europium(3+) salt (1:1)/water
  5208. phosphoric acid gadolinium(3+) salt (1:1)/water
  5209. phosphoric acid gallium salt (1:1)/phosphoric acid trisodium salt
  5210. phosphoric acid holmium(3+) salt (1:1)/water
  5211. phosphoric acid hydrate (2:1)/water
  5212. phosphoric acid lanthanum(3+) salt (1:1)/water
  5213. phosphoric acid lead(2+) salt (2:3)/lead fluoride (PbF2)
  5214. phosphoric acid lead(2+) salt (2:3)/lead(2+) (T-4)-tungstate (WO4(2-)) (1:1)
  5215. phosphoric acid lutetium(3+) salt/water
  5216. phosphoric acid magnesium salt (2:1)/water
  5217. phosphoric acid magnesium salt (2:3)/magnesium fluoride (MgF2)
  5218. phosphoric acid magnesium sodium salt (2:1:4)/diphosphoric acid tetrasodium salt
  5219. phosphoric acid methyl diphenyl ester/1,4-dioxane
  5220. phosphoric acid methyl diphenyl ester/2-propanone
  5221. phosphoric acid methyl diphenyl ester/benzene
  5222. phosphoric acid methyl diphenyl ester/ethanol
  5223. phosphoric acid methyl diphenyl ester/methanol
  5224. phosphoric acid methyl diphenyl ester/tetrachloromethane
  5225. phosphoric acid methyl diphenyl ester/trichloromethane
  5226. phosphoric acid methyl diphenyl ester/water
  5227. phosphoric acid monethyl ester calcium salt/water
  5228. phosphoric acid monoammonium monosodium salt tetrahydrate/water
  5229. phosphoric acid monoammonium salt/nitric acid potassium salt
  5230. phosphoric acid monoammonium salt/phosphoric acid monopotassium salt
  5231. phosphoric acid monoammonium salt/water
  5232. phosphoric acid monobutyl ester/2-propanone
  5233. phosphoric acid monobutyl ester/benzene
  5234. phosphoric acid monobutyl ester/ethanol
  5235. phosphoric acid monobutyl ester/methanol
  5236. phosphoric acid monobutyl ester/tetrachloromethane
  5237. phosphoric acid monobutyl ester/trichloromethane
  5238. phosphoric acid monobutyl ester/water
  5239. phosphoric acid monodecyl ester aluminum salt (3:2)/water
  5240. phosphoric acid monodecyl ester barium salt (1:1)/water
  5241. phosphoric acid monodecyl ester cerium(3+) salt (3:2)/water
  5242. phosphoric acid monodecyl ester disilver(1+) salt/water
  5243. phosphoric acid monodecyl ester lanthanum(3+) salt (3:2)/water
  5244. phosphoric acid monodecyl ester magnesium salt (1:1)/water
  5245. phosphoric acid monodecyl ester nickel(2+) salt (1:1)/water
  5246. phosphoric acid monodecyl ester zinc salt (1:1)/water
  5247. phosphoric acid monododecyl ester aluminum salt (3:2)/water
  5248. phosphoric acid monododecyl ester barium salt (1:1)/water
  5249. phosphoric acid monododecyl ester cerium(3+) salt (3:2)/water
  5250. phosphoric acid monododecyl ester disilver(1+) salt/water
  5251. phosphoric acid monododecyl ester lanthanum(3+) salt (3:2)/water
  5252. phosphoric acid monododecyl ester nickel(2+) salt (1:1)/water
  5253. phosphoric acid monododecyl ester zinc salt (1:1)/water
  5254. phosphoric acid monolithium salt/water
  5255. phosphoric acid monomethyl ester barium salt/water
  5256. phosphoric acid monomethyl ester monopotassium salt/water
  5257. phosphoric acid monooctyl ester aluminum salt (3:2)/water
  5258. phosphoric acid monooctyl ester barium salt (1:1)/water
  5259. phosphoric acid monooctyl ester cerium(3+) salt (3:2)/water
  5260. phosphoric acid monooctyl ester disilver(1+) salt/water
  5261. phosphoric acid monooctyl ester lanthanum(3+) salt (3:2)/water
  5262. phosphoric acid monooctyl ester nickel(2+) salt (1:1)/water
  5263. phosphoric acid monooctyl ester zinc salt (1:1)/water
  5264. phosphoric acid monopotassium salt labeled with deuterium/water-d2
  5265. phosphoric acid monopotassium salt/chlorosulfuric acid
  5266. phosphoric acid monopotassium salt/disulfuric acid
  5267. phosphoric acid monorubidium salt/water
  5268. phosphoric acid monosodium salt/water
  5269. phosphoric acid monothallium(1+) salt/water
  5270. phosphoric acid neodymium(3+) salt (1:1)/water
  5271. phosphoric acid nickel(2+) salt (2:3)/water
  5272. phosphoric acid samarium(3+) salt (1:1)/water
  5273. phosphoric acid sodium salt (x-Na)/water
  5274. phosphoric acid thulium(3+) salt (1:1)/water
  5275. phosphoric acid triammonium salt/ammonium chloride ((NH4)Cl)
  5276. phosphoric acid triammonium salt/diphosphoric acid tetraammonium salt
  5277. phosphoric acid triammonium salt/nitric acid potassium salt
  5278. phosphoric acid triammonium salt/water
  5279. phosphoric acid tributyl ester/(1-methylethyl)benzene
  5280. phosphoric acid tributyl ester/(1E)-1-propene-1,2,3-tricarboxylic acid
  5281. phosphoric acid tributyl ester/(T-4)-dihydrogen tetrachlorocadmate(2-)
  5282. phosphoric acid tributyl ester/1,1'-oxybisbutane
  5283. phosphoric acid tributyl ester/1,1,1-trichloroethane
  5284. phosphoric acid tributyl ester/1,1-dimethylethyl hydroperoxide
  5285. phosphoric acid tributyl ester/1,2-dihydro-1,5-dimethyl-2-phenyl-3H-pyrazol-3-one compd. with erbium iodide (ErI3) (6:1)
  5286. phosphoric acid tributyl ester/1,2-dihydroacenaphthylene
  5287. phosphoric acid tributyl ester/1,2-dimethylbenzene
  5288. phosphoric acid tributyl ester/1,3-diethylbenzene
  5289. phosphoric acid tributyl ester/1-(2-hydroxy-5-nonylphenyl)ethanone oxime
  5290. phosphoric acid tributyl ester/1-butanol
  5291. phosphoric acid tributyl ester/1-butyl-3-methyl-1H-imidazolium hexafluorophosphate(1-)
  5292. phosphoric acid tributyl ester/1-butyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  5293. phosphoric acid tributyl ester/1-butyl-3-methyl-1H-imidazolium tetrafluoroborate(1-)
  5294. phosphoric acid tributyl ester/1-decene
  5295. phosphoric acid tributyl ester/1-ethenyl-4-methylbenzene
  5296. phosphoric acid tributyl ester/1-ethyl-4-methylbenzene
  5297. phosphoric acid tributyl ester/1-heptene
  5298. phosphoric acid tributyl ester/1-hexene
  5299. phosphoric acid tributyl ester/1-pentanol
  5300. phosphoric acid tributyl ester/1-propanol
  5301. phosphoric acid tributyl ester/10H-phenothiazine
  5302. phosphoric acid tributyl ester/2,2,4,4,6,8,8-heptamethylnonane
  5303. phosphoric acid tributyl ester/2,2,4-trimethylpentane
  5304. phosphoric acid tributyl ester/2-butanone
  5305. phosphoric acid tributyl ester/2-chloro-5-nitrobenzoic acid
  5306. phosphoric acid tributyl ester/2-methyl-2-propanol
  5307. phosphoric acid tributyl ester/2-methylphenol
  5308. phosphoric acid tributyl ester/2-propanol
  5309. phosphoric acid tributyl ester/2-propanone
  5310. phosphoric acid tributyl ester/3,4-dichlorobenzoic acid
  5311. phosphoric acid tributyl ester/3,5-dinitrobenzoic acid
  5312. phosphoric acid tributyl ester/3-methylbenzoic acid
  5313. phosphoric acid tributyl ester/4-chloro-3-nitrobenzoic acid
  5314. phosphoric acid tributyl ester/4-chlorobenzoic acid
  5315. phosphoric acid tributyl ester/4-nitrobenzoic acid
  5316. phosphoric acid tributyl ester/5-dodecyl-2-hydroxybenzaldehyde oxime
  5317. phosphoric acid tributyl ester/5-dodecyl-2-hydroxybenzaldehyde oxime mixt. with 1-tridecanol
  5318. phosphoric acid tributyl ester/8-methyl-1-nonanol
  5319. phosphoric acid tributyl ester/9H-fluoren-9-one
  5320. phosphoric acid tributyl ester/acetic acid ethyl ester
  5321. phosphoric acid tributyl ester/acetyl chloride
  5322. phosphoric acid tributyl ester/aluminum chloride (AlCl3)
  5323. phosphoric acid tributyl ester/ammonia
  5324. phosphoric acid tributyl ester/argon
  5325. phosphoric acid tributyl ester/arsenous trichloride
  5326. phosphoric acid tributyl ester/benzene
  5327. phosphoric acid tributyl ester/benzoic acid
  5328. phosphoric acid tributyl ester/bromine
  5329. phosphoric acid tributyl ester/carbon disulfide
  5330. phosphoric acid tributyl ester/carbon oxide sulfide (COS)
  5331. phosphoric acid tributyl ester/cerium(4+) hydroxo trinitrate
  5332. phosphoric acid tributyl ester/chlorodifluoromethane
  5333. phosphoric acid tributyl ester/cis-1,2-dimethylcyclohexane
  5334. phosphoric acid tributyl ester/cis-1,3-dimethylcyclohexane
  5335. phosphoric acid tributyl ester/cis-1,4-dimethylcyclohexane
  5336. phosphoric acid tributyl ester/dichlorofluoromethane
  5337. phosphoric acid tributyl ester/dichloromethane
  5338. phosphoric acid tributyl ester/dihydrogen (T-4)-tetrachlorozincate(2-)
  5339. phosphoric acid tributyl ester/dimethylbenzene
  5340. phosphoric acid tributyl ester/diphenylethanedione
  5341. phosphoric acid tributyl ester/ethane
  5342. phosphoric acid tributyl ester/ethanedioic acid
  5343. phosphoric acid tributyl ester/ethanethiol
  5344. phosphoric acid tributyl ester/ethanol
  5345. phosphoric acid tributyl ester/ethene
  5346. phosphoric acid tributyl ester/ethylcyclohexane
  5347. phosphoric acid tributyl ester/ethyne
  5348. phosphoric acid tributyl ester/fluoranthene
  5349. phosphoric acid tributyl ester/fluoroethane
  5350. phosphoric acid tributyl ester/heptane
  5351. phosphoric acid tributyl ester/hexadecane
  5352. phosphoric acid tributyl ester/hydrochloric acid
  5353. phosphoric acid tributyl ester/hydrogen
  5354. phosphoric acid tributyl ester/hydrogen sulfide (H2S)
  5355. phosphoric acid tributyl ester/iodine
  5356. phosphoric acid tributyl ester/kerosene
  5357. phosphoric acid tributyl ester/lithium chloride (LiCl)
  5358. phosphoric acid tributyl ester/methane
  5359. phosphoric acid tributyl ester/methanol
  5360. phosphoric acid tributyl ester/nitric acid
  5361. phosphoric acid tributyl ester/nitric acid aluminum salt
  5362. phosphoric acid tributyl ester/nitric acid cerium(4+) salt
  5363. phosphoric acid tributyl ester/nitric acid copper(2+) salt
  5364. phosphoric acid tributyl ester/nitric acid lithium salt
  5365. phosphoric acid tributyl ester/nitric acid nickel(2+) salt
  5366. phosphoric acid tributyl ester/nitric acid silver(1+) salt
  5367. phosphoric acid tributyl ester/nitric acid thorium(4+) salt
  5368. phosphoric acid tributyl ester/nitric acid zinc salt
  5369. phosphoric acid tributyl ester/perchloric acid lithium salt
  5370. phosphoric acid tributyl ester/phosphoric acid
  5371. phosphoric acid tributyl ester/phosphorous trichloride
  5372. phosphoric acid tributyl ester/potassium fluoride (KF)
  5373. phosphoric acid tributyl ester/potassium iodide (KI)
  5374. phosphoric acid tributyl ester/propane
  5375. phosphoric acid tributyl ester/propylcyclohexane
  5376. phosphoric acid tributyl ester/pyrene
  5377. phosphoric acid tributyl ester/rubidium iodide (RbI)
  5378. phosphoric acid tributyl ester/sodium iodide (NaI)
  5379. phosphoric acid tributyl ester/sulfinylbismethane
  5380. phosphoric acid tributyl ester/sulfur dioxide
  5381. phosphoric acid tributyl ester/sulfuryl fluoride
  5382. phosphoric acid tributyl ester/tetrachloromethane
  5383. phosphoric acid tributyl ester/tetrachlorostannane
  5384. phosphoric acid tributyl ester/tetradecane
  5385. phosphoric acid tributyl ester/thiocyanic acid ammonium salt
  5386. phosphoric acid tributyl ester/thiocyanic acid cesium salt
  5387. phosphoric acid tributyl ester/thiocyanic acid lithium salt
  5388. phosphoric acid tributyl ester/thiocyanic acid potassium salt
  5389. phosphoric acid tributyl ester/thiocyanic acid rubidium salt
  5390. phosphoric acid tributyl ester/thiocyanic acid sodium salt
  5391. phosphoric acid tributyl ester/thulium chloride (TmCl3)
  5392. phosphoric acid tributyl ester/titanium chloride (TiCl4)
  5393. phosphoric acid tributyl ester/TKX-55
  5394. phosphoric acid tributyl ester/trans-1,2-dimethylcyclohexane
  5395. phosphoric acid tributyl ester/trans-1,3-dimethylcyclohexane
  5396. phosphoric acid tributyl ester/trans-1,4-dimethylcyclohexane
  5397. phosphoric acid tributyl ester/trichloroacetic acid samarium(3+) salt (3:1)
  5398. phosphoric acid tributyl ester/trichloroethene
  5399. phosphoric acid tributyl ester/trichloromethane
  5400. phosphoric acid tributyl ester/trifluoroacetic acid anhydride
  5401. phosphoric acid tributyl ester/water
  5402. phosphoric acid tricesium salt/cesium chloride (CsCl)
  5403. phosphoric acid triethyl ester/(trichloromethyl)benzene
  5404. phosphoric acid triethyl ester/(trifluoromethyl)benzene
  5405. phosphoric acid triethyl ester/1-nitronaphthalene
  5406. phosphoric acid triethyl ester/2-butanone
  5407. phosphoric acid triethyl ester/2-methyl-1-propanol
  5408. phosphoric acid triethyl ester/acetic acid methyl ester
  5409. phosphoric acid triethyl ester/iodine chloride (ICl3)
  5410. phosphoric acid triethyl ester/N,N,N-tributyl-1-butanaminium salt with 2,4,6-trinitrophenol (1:1)
  5411. phosphoric acid triethyl ester/nitrobenzene
  5412. phosphoric acid trilithium salt/boric acid (HBO2) cesium salt
  5413. phosphoric acid trilithium salt/boric acid (HBO2) lithium salt
  5414. phosphoric acid trilithium salt/boric acid (HBO2) potassium salt
  5415. phosphoric acid trilithium salt/boric acid (HBO2) sodium salt
  5416. phosphoric acid trilithium salt/lithium chloride (LiCl)
  5417. phosphoric acid trilithium salt/lithium fluoride (LiF)
  5418. phosphoric acid trilithium salt/metaphosphoric acid (HPO3) lithium salt
  5419. phosphoric acid trilithium salt/phosphoric acid lead(2+) salt (2:3)
  5420. phosphoric acid trilithium salt/phosphoric acid tripotassium salt
  5421. phosphoric acid trilithium salt/water
  5422. phosphoric acid trimethyl ester/(2E)-2-pentene
  5423. phosphoric acid trimethyl ester/1,3-cyclopentadiene
  5424. phosphoric acid trimethyl ester/1-butanol
  5425. phosphoric acid trimethyl ester/1-heptene
  5426. phosphoric acid trimethyl ester/1-hexene
  5427. phosphoric acid trimethyl ester/1-hexyne
  5428. phosphoric acid trimethyl ester/1-methyl-1H-imidazole
  5429. phosphoric acid trimethyl ester/1-methylnaphthalene
  5430. phosphoric acid trimethyl ester/1-pentyne
  5431. phosphoric acid trimethyl ester/1-propanol
  5432. phosphoric acid trimethyl ester/2,3-dimethyl-1,3-butadiene
  5433. phosphoric acid trimethyl ester/2-butanone
  5434. phosphoric acid trimethyl ester/2-methyl-1,3-butadiene
  5435. phosphoric acid trimethyl ester/2-methyl-1-butene
  5436. phosphoric acid trimethyl ester/2-methyl-2-butene
  5437. phosphoric acid trimethyl ester/2-methyl-2-pentene
  5438. phosphoric acid trimethyl ester/2-methylpropane
  5439. phosphoric acid trimethyl ester/2-propanone
  5440. phosphoric acid trimethyl ester/3-hexyne
  5441. phosphoric acid trimethyl ester/acetic acid
  5442. phosphoric acid trimethyl ester/acetic acid methyl ester
  5443. phosphoric acid trimethyl ester/acetonitrile
  5444. phosphoric acid trimethyl ester/arsenous trichloride
  5445. phosphoric acid trimethyl ester/benzene
  5446. phosphoric acid trimethyl ester/dichloromethane
  5447. phosphoric acid trimethyl ester/ethane
  5448. phosphoric acid trimethyl ester/ethanol
  5449. phosphoric acid trimethyl ester/ethene
  5450. phosphoric acid trimethyl ester/hydrochloric acid
  5451. phosphoric acid trimethyl ester/hydrogen sulfide (H2S)
  5452. phosphoric acid trimethyl ester/methanol
  5453. phosphoric acid trimethyl ester/methylcyclopentane
  5454. phosphoric acid trimethyl ester/N,N,N-tributyl-1-butanaminium azide
  5455. phosphoric acid trimethyl ester/N,N,N-triethylethanaminium azide
  5456. phosphoric acid trimethyl ester/N,N,N-trimethylmethanaminium azide
  5457. phosphoric acid trimethyl ester/N,N,N-tripropyl-1-propanaminium azide
  5458. phosphoric acid trimethyl ester/nitrogen
  5459. phosphoric acid trimethyl ester/octadecane
  5460. phosphoric acid trimethyl ester/phosphorous trichloride
  5461. phosphoric acid trimethyl ester/propane
  5462. phosphoric acid trimethyl ester/sulfur dioxide
  5463. phosphoric acid trimethyl ester/triacontane
  5464. phosphoric acid trimethyl ester/trifluoromethane
  5465. phosphoric acid trimethyl ester/water
  5466. phosphoric acid trioctyl ester/2-(1,1-dimethylethyl)-9,10-anthracenedione
  5467. phosphoric acid trioctyl ester/2-ethyl-9,10-anthracenedione
  5468. phosphoric acid tripentyl ester/water
  5469. phosphoric acid triphenyl ester/1,2-benzenedicarboxylic acid dimethyl ester
  5470. phosphoric acid triphenyl ester/1-butanol
  5471. phosphoric acid triphenyl ester/1-heptene
  5472. phosphoric acid triphenyl ester/1-hexene
  5473. phosphoric acid triphenyl ester/1-propanol
  5474. phosphoric acid triphenyl ester/acetic acid butyl ester
  5475. phosphoric acid triphenyl ester/acetic acid ethyl ester
  5476. phosphoric acid triphenyl ester/acetic acid methyl ester
  5477. phosphoric acid triphenyl ester/benzene
  5478. phosphoric acid triphenyl ester/carbon dioxide
  5479. phosphoric acid triphenyl ester/carbonic acid dimethyl ester
  5480. phosphoric acid triphenyl ester/ethanol
  5481. phosphoric acid triphenyl ester/ethylcyclohexane
  5482. phosphoric acid triphenyl ester/heptane
  5483. phosphoric acid triphenyl ester/methanol
  5484. phosphoric acid triphenyl ester/phosphorothioic acid O,O,O-triphenyl ester
  5485. phosphoric acid triphenyl ester/triphenoxyselenoxophosphorane
  5486. phosphoric acid tripotassium salt/dipotassium (T-4)-tetrafluoroberyllate(2-)
  5487. phosphoric acid tripotassium salt/metaphosphoric acid (HPO3) potassium salt
  5488. phosphoric acid tripotassium salt/potassium fluoride (KF)
  5489. phosphoric acid tripotassium salt/sulfuric acid dipotassium salt
  5490. phosphoric acid tripropyl ester/1-heptene
  5491. phosphoric acid tripropyl ester/1-hexene
  5492. phosphoric acid tripropyl ester/1-propyne
  5493. phosphoric acid tripropyl ester/2-methylpropane
  5494. phosphoric acid tripropyl ester/benzene
  5495. phosphoric acid tripropyl ester/ethane
  5496. phosphoric acid tripropyl ester/ethene
  5497. phosphoric acid tripropyl ester/hydrogen sulfide (H2S)
  5498. phosphoric acid tripropyl ester/methane
  5499. phosphoric acid tripropyl ester/propane
  5500. phosphoric acid tripropyl ester/sulfur dioxide
  5501. phosphoric acid tripropyl ester/water
  5502. phosphoric acid trirubidium salt/phosphoric acid yttrium(3+) salt (1:1)
  5503. phosphoric acid tris(2-chlorophenyl) ester/benzene
  5504. phosphoric acid tris(2-ethylhexyl) ester/acetic acid methyl ester
  5505. phosphoric acid tris(2-ethylhexyl) ester/N,N,N-tributyl-1-butanaminium salt with 2,4,6-trinitrophenol (1:1)
  5506. phosphoric acid tris(2-methylphenyl) ester/N,N,N-tributyl-1-butanaminium salt with 2,4,6-trinitrophenol (1:1)
  5507. phosphoric acid tris(2-methylpropyl) ester/2-methylpropane
  5508. phosphoric acid tris(2-methylpropyl) ester/ethane
  5509. phosphoric acid tris(2-methylpropyl) ester/ethene
  5510. phosphoric acid tris(2-methylpropyl) ester/hydrogen sulfide (H2S)
  5511. phosphoric acid tris(2-methylpropyl) ester/methane
  5512. phosphoric acid tris(2-methylpropyl) ester/nitric acid
  5513. phosphoric acid tris(2-methylpropyl) ester/propane
  5514. phosphoric acid tris(2-methylpropyl) ester/sulfur dioxide
  5515. phosphoric acid tris(3-chlorophenyl) ester/benzene
  5516. phosphoric acid tris(3-methylphenyl) ester/benzene
  5517. phosphoric acid tris(4-chlorophenyl) ester/benzene
  5518. phosphoric acid tris(methylphenyl) ester/(1,1'-biphenyl)-4-amine compd. with 2,4,6-trinitrophenol (1:1)
  5519. phosphoric acid tris(methylphenyl) ester/(1R,4aR,4bR,10aR)-7-(1-methylethyl)-1,2,3,4,4a,4b,5,6,10,10a-decahydro-1,4a-dimethyl-1-phenanthrenecarboxylic acid lead(2+) salt
  5520. phosphoric acid tris(methylphenyl) ester/(methylthio)ethane
  5521. phosphoric acid tris(methylphenyl) ester/1,1'-oxybisethane
  5522. phosphoric acid tris(methylphenyl) ester/1,1'-thiobisethane
  5523. phosphoric acid tris(methylphenyl) ester/1,1,1-trichloroethane
  5524. phosphoric acid tris(methylphenyl) ester/1,1,2,2-tetrachloroethane
  5525. phosphoric acid tris(methylphenyl) ester/1,1,2-trichloroethane
  5526. phosphoric acid tris(methylphenyl) ester/1,1-dichloroethane
  5527. phosphoric acid tris(methylphenyl) ester/1,2-dimethylbenzene
  5528. phosphoric acid tris(methylphenyl) ester/1-butanol
  5529. phosphoric acid tris(methylphenyl) ester/1-heptene
  5530. phosphoric acid tris(methylphenyl) ester/1-hexene
  5531. phosphoric acid tris(methylphenyl) ester/1-pentanol
  5532. phosphoric acid tris(methylphenyl) ester/1-propanol
  5533. phosphoric acid tris(methylphenyl) ester/2,2'-thiobispropane
  5534. phosphoric acid tris(methylphenyl) ester/2-butanone
  5535. phosphoric acid tris(methylphenyl) ester/2-butanone
  5536. phosphoric acid tris(methylphenyl) ester/2-methoxyphenol
  5537. phosphoric acid tris(methylphenyl) ester/2-methylphenol
  5538. phosphoric acid tris(methylphenyl) ester/2-methylthiophene
  5539. phosphoric acid tris(methylphenyl) ester/2-propanone
  5540. phosphoric acid tris(methylphenyl) ester/2-propanone
  5541. phosphoric acid tris(methylphenyl) ester/acetic acid ethyl ester
  5542. phosphoric acid tris(methylphenyl) ester/acetic acid ethyl ester
  5543. phosphoric acid tris(methylphenyl) ester/acetic acid methyl ester
  5544. phosphoric acid tris(methylphenyl) ester/acetic acid methyl ester
  5545. phosphoric acid tris(methylphenyl) ester/benzene
  5546. phosphoric acid tris(methylphenyl) ester/benzene
  5547. phosphoric acid tris(methylphenyl) ester/chloromethane
  5548. phosphoric acid tris(methylphenyl) ester/dichloromethane
  5549. phosphoric acid tris(methylphenyl) ester/ethanol
  5550. phosphoric acid tris(methylphenyl) ester/ethylcyclohexane
  5551. phosphoric acid tris(methylphenyl) ester/heptane
  5552. phosphoric acid tris(methylphenyl) ester/krypton
  5553. phosphoric acid tris(methylphenyl) ester/krypton
  5554. phosphoric acid tris(methylphenyl) ester/methanol
  5555. phosphoric acid tris(methylphenyl) ester/N,N,N-tributyl-1-butanaminium salt with 2,4,6-trinitrophenol (1:1)
  5556. phosphoric acid tris(methylphenyl) ester/N,N-dibutyl-1-butanamine compd. with 2,4,6-trinitrophenol (1:1)
  5557. phosphoric acid tris(methylphenyl) ester/N,N-dimethylbenzenamine compd. with 2,4,6-trinitrophenol (1:1)
  5558. phosphoric acid tris(methylphenyl) ester/nitromethane
  5559. phosphoric acid tris(methylphenyl) ester/phenylazanium; 2,4,6-trinitrophenolate
  5560. phosphoric acid tris(methylphenyl) ester/sulfur dioxide
  5561. phosphoric acid tris(methylphenyl) ester/sulfur dioxide
  5562. phosphoric acid tris(methylphenyl) ester/tetrachloromethane
  5563. phosphoric acid tris(methylphenyl) ester/tetrachloromethane
  5564. phosphoric acid tris(methylphenyl) ester/tribenzylammonium picrate
  5565. phosphoric acid tris(methylphenyl) ester/trichloroethene
  5566. phosphoric acid tris(methylphenyl) ester/trichloromethane
  5567. phosphoric acid trisodium salt/boric acid (HBO2) sodium salt
  5568. phosphoric acid trisodium salt/diphosphoric acid tetrasodium salt
  5569. phosphoric acid trisodium salt/metaphosphoric acid (HPO3) potassium salt
  5570. phosphoric acid trisodium salt/phosphoric acid magnesium salt (2:3)
  5571. phosphoric acid trisodium salt/phosphoric acid tripotassium salt
  5572. phosphoric acid trisodium salt/sodium chloride (NaCl)
  5573. phosphoric acid trisodium salt/sodium fluoride (NaF)
  5574. phosphoric acid trisodium salt/water
  5575. phosphoric acid yttrium(3+) salt (1:1)/diphosphoric acid tetrasodium salt
  5576. phosphoric acid yttrium(3+) salt (1:1)/magnesium metaphosphate
  5577. phosphoric acid yttrium(3+) salt (1:1)/phosphoric acid trisodium salt
  5578. phosphoric acid yttrium(3+) salt (1:1)/water
  5579. phosphoric acid/1-naphthalenol
  5580. phosphoric acid/1-phenylethanone
  5581. phosphoric acid/2-chlorophenol
  5582. phosphoric acid/2-hydroxybenzaldehyde
  5583. phosphoric acid/2-methoxyphenol
  5584. phosphoric acid/2-methylphenol
  5585. phosphoric acid/2-nitrophenol
  5586. phosphoric acid/2H-1-benzopyran-2-one
  5587. phosphoric acid/5-methyl-2-(1-methylethyl)phenol
  5588. phosphoric acid/ammonia
  5589. phosphoric acid/bromoacetic acid
  5590. phosphoric acid/chloroacetic acid
  5591. phosphoric acid/N-methylacetamide
  5592. phosphoric acid/nitric acid
  5593. phosphoric acid/phosphoric acid diammonium salt
  5594. phosphoric acid/phosphoric acid monopotassium salt
  5595. phosphoric acid/propanoic acid
  5596. phosphoric acid/selenic acid
  5597. phosphoric acid/sulfuric acid
  5598. phosphoric acid/water
  5599. phosphorochloridic acid diphenyl ester/hydrochloric acid
  5600. phosphorochloridous acid diethyl ester/trichloromethane
  5601. phosphorodichloridous acid butyl ester/hexane
  5602. phosphorodifluoridic acid potassium salt/water
  5603. phosphorodifluoridic acid/chlorosulfuric acid
  5604. phosphorodifluoridic acid/disulfuric acid
  5605. phosphorodifluoridic acid/sulfuric acid
  5606. phosphorodithioic acid O,O-bis(1-methylethyl) ester/1,4-dioxane
  5607. phosphorodithioic acid O,O-bis(1-methylpropyl) ester/1,4-dioxane
  5608. phosphorodithioic acid S-((6-chloro-2-oxo-3(2H)-benzoxazolyl)methyl) O,O-diethyl ester/water
  5609. phosphorodithioic acid S-methyl O,O-bis(1-methylethyl) ester/nitrobenzene
  5610. phosphorothioic acid O,O,O-triphenyl ester/1H-isoindole-1,3(2H)-dione
  5611. phosphorothioic acid O,O,O-triphenyl ester/benzene
  5612. phosphorothioic acid O,O,O-triphenyl ester/triphenoxyselenoxophosphorane
  5613. phosphorothioic acid O,O,O-tris(4-methylphenyl) ester/phosphoric acid tris(4-methylphenyl) ester
  5614. phosphorothioic acid O,O-bis(1-methylethyl) S-(phenylmethyl) ester/water
  5615. phosphorothioic acid O,O-diethyl O-(3,5,6-trichloro-2-pyridyl) ester/1,1'-oxybisethane
  5616. phosphorothioic acid O,O-diethyl O-(3,5,6-trichloro-2-pyridyl) ester/2,2,4-trimethylpentane
  5617. phosphorothioic acid O,O-diethyl O-(3,5,6-trichloro-2-pyridyl) ester/2-propanone
  5618. phosphorothioic acid O,O-diethyl O-(3,5,6-trichloro-2-pyridyl) ester/benzene
  5619. phosphorothioic acid O,O-diethyl O-(3,5,6-trichloro-2-pyridyl) ester/carbon disulfide
  5620. phosphorothioic acid O,O-diethyl O-(3,5,6-trichloro-2-pyridyl) ester/ethanol
  5621. phosphorothioic acid O,O-diethyl O-(3,5,6-trichloro-2-pyridyl) ester/methanol
  5622. phosphorothioic acid O,O-diethyl O-(3,5,6-trichloro-2-pyridyl) ester/sea water
  5623. phosphorothioic acid O,O-diethyl O-(3,5,6-trichloro-2-pyridyl) ester/tetrachloromethane
  5624. phosphorothioic acid O,O-diethyl O-(3,5,6-trichloro-2-pyridyl) ester/trichloromethane
  5625. phosphorothioic acid O,O-diethyl O-(3,5,6-trichloro-2-pyridyl) ester/water
  5626. phosphorothioic acid O,O-diethyl O-(4-nitrophenyl) ester/water
  5627. phosphorothioic acid O,O-diethyl O-(6-methyl-2-(1-methylethyl)-4-pyrimidinyl) ester/water
  5628. phosphorothioic acid O,O-dimethyl O-(2,4,5-trichlorophenyl) ester/water
  5629. phosphorothioic acid O,O-dimethyl O-(3,5,6-trichloro-2-pyridinyl) ester/water
  5630. phosphorothioic acid O,O-dimethyl O-(3-methyl-4-nitrophenyl) ester/water
  5631. phosphorothioic acid O,O-dimethyl O-(4-nitrophenyl) ester/water
  5632. phosphorothioic acid O-(2-chloro-4-nitrophenyl) O,O-dimethyl ester/water
  5633. phosphorothioic acid O-(3-chloro-4-methyl-2-oxo-2H-1-benzopyran-7-yl) O,O-diethyl ester/2-butanone
  5634. phosphorothioic acid O-(3-chloro-4-methyl-2-oxo-2H-1-benzopyran-7-yl) O,O-diethyl ester/2-propanone
  5635. phosphorothioic acid O-(3-chloro-4-methyl-2-oxo-2H-1-benzopyran-7-yl) O,O-diethyl ester/ethanol
  5636. phosphorotrithioic acid S,S,S-trimethyl ester/ethyne
  5637. phosphorous acid tributyl ester/2,2,4,4,6,8,8-heptamethylnonane
  5638. phosphorous acid tributyl ester/2,2,4,6,6-pentamethylheptane
  5639. phosphorous acid tributyl ester/2,2,4-trimethylpentane
  5640. phosphorous acid tributyl ester/benzene
  5641. phosphorous acid tributyl ester/decane
  5642. phosphorous acid tributyl ester/dodecane
  5643. phosphorous acid tributyl ester/heptane
  5644. phosphorous acid tributyl ester/hexadecane
  5645. phosphorous acid tributyl ester/hexane
  5646. phosphorous acid tributyl ester/octane
  5647. phosphorous acid tributyl ester/sulfur dioxide
  5648. phosphorous acid tributyl ester/tetrachloromethane
  5649. phosphorous acid tributyl ester/trichloromethane
  5650. phosphorous acid triethyl ester/acetonitrile
  5651. phosphorous acid triethyl ester/benzene
  5652. phosphorous acid triethyl ester/N,N,N-tributyl-1-butanaminium salt with 4-methylbenzenesulfonic acid (1:1)
  5653. phosphorous acid triethyl ester/tetrachloromethane
  5654. phosphorous acid triethyl ester/tetrapentylammonium picrate
  5655. phosphorous acid triethyl ester/trichloroethene
  5656. phosphorous acid triethyl ester/trichloromethane
  5657. phosphorous acid trimethyl ester/2,2,4,4,6,8,8-heptamethylnonane
  5658. phosphorous acid trimethyl ester/2,2,4-trimethylpentane
  5659. phosphorous acid trimethyl ester/benzene
  5660. phosphorous acid trimethyl ester/decane
  5661. phosphorous acid trimethyl ester/ethyne
  5662. phosphorous acid trimethyl ester/heptane
  5663. phosphorous acid trimethyl ester/hexadecane
  5664. phosphorous acid trimethyl ester/methanol
  5665. phosphorous acid trimethyl ester/octadecane
  5666. phosphorous acid trimethyl ester/tetrachloromethane
  5667. phosphorous acid trimethyl ester/triacontane
  5668. phosphorous acid trimethyl ester/trichloromethane
  5669. phosphorous acid triphenyl ester/4'-pentyl-(1,1'-biphenyl)-4-carbonitrile
  5670. phosphorous acid triphenyl ester/4-methylbenzenesulfonate; tetraethylazanium
  5671. phosphorous acid triphenyl ester/4-methylbenzenesulfonate; tetramethylazanium
  5672. phosphorous acid triphenyl ester/4-methylbenzenesulfonate; tetrapropylazanium
  5673. phosphorous acid triphenyl ester/benzene
  5674. phosphorous acid triphenyl ester/carbon dioxide
  5675. phosphorous acid triphenyl ester/hydrochloric acid
  5676. phosphorous acid triphenyl ester/N,N,N-tributyl-1-butanaminium salt with 4-methylbenzenesulfonic acid (1:1)
  5677. phosphorous acid tris(2-chlorophenyl) ester/benzene
  5678. phosphorous acid tris(2-methylphenyl) ester/benzene
  5679. phosphorous acid tris(3-chlorophenyl) ester/benzene
  5680. phosphorous acid tris(3-methylphenyl) ester/4-methylbenzenesulfonate; tetraethylazanium
  5681. phosphorous acid tris(3-methylphenyl) ester/4-methylbenzenesulfonate; tetrapropylazanium
  5682. phosphorous acid tris(3-methylphenyl) ester/benzene
  5683. phosphorous acid tris(3-methylphenyl) ester/N,N,N-tributyl-1-butanaminium salt with 4-methylbenzenesulfonic acid (1:1)
  5684. phosphorous acid tris(4-chlorophenyl) ester/benzene
  5685. phosphorous acid tris(4-methylphenyl) ester/4-methylbenzenesulfonate; tetraethylazanium
  5686. phosphorous acid tris(4-methylphenyl) ester/4-methylbenzenesulfonate; tetrapropylazanium
  5687. phosphorous acid tris(4-methylphenyl) ester/benzene
  5688. phosphorous acid tris(4-methylphenyl) ester/N,N,N-tributyl-1-butanaminium salt with 4-methylbenzenesulfonic acid (1:1)
  5689. phosphorous acid/1,3-benzodioxole-5-carboxaldehyde
  5690. phosphorous acid/1,4-dioxane
  5691. phosphorous acid/1-phenylethanone
  5692. phosphorous acid/2-oxopropanoic acid
  5693. phosphorous acid/2H-1-benzopyran-2-one
  5694. phosphorous acid/acetic acid
  5695. phosphorous acid/N,N-dimethylformamide
  5696. phosphorous acid/N,N-dimethylurea
  5697. phosphorous acid/phenol
  5698. phosphorous acid/sulfuric acid
  5699. phosphorous acid/trichloroacetic acid
  5700. phosphorous acid/water
  5701. phosphorous tribromide/tetrabromostannane
  5702. phosphorous trichloride/1-chloro-2-methylbenzene
  5703. phosphorous trichloride/arsenous trichloride
  5704. phosphorous trichloride/bromine
  5705. phosphorous trichloride/N,N-diethylethanamine hydrochloride compd. with aluminum chloride (AlCl3) (1:2)
  5706. phosphorous trichloride/nitrobenzene
  5707. phosphorous trichloride/phosphoric acid triethyl ester
  5708. phosphorous trichloride/sulfuryl chloride
  5709. phosphorous triiodide/benzene
  5710. phosphorus mol. (P4)/1,1'-oxybisethane
  5711. phosphorus mol. (P4)/1,2,3-propanetriol
  5712. phosphorus mol. (P4)/2-methyl-1-propanol
  5713. phosphorus mol. (P4)/2-propanone
  5714. phosphorus mol. (P4)/acetic acid
  5715. phosphorus mol. (P4)/benzene
  5716. phosphorus mol. (P4)/carbon disulfide
  5717. phosphorus mol. (P4)/carbon disulfide
  5718. phosphorus mol. (P4)/dibromobenzene
  5719. phosphorus mol. (P4)/dibromoethane
  5720. phosphorus mol. (P4)/ethanol
  5721. phosphorus mol. (P4)/gallium
  5722. phosphorus mol. (P4)/heptane
  5723. phosphorus mol. (P4)/heptane
  5724. phosphorus mol. (P4)/iron
  5725. phosphorus mol. (P4)/naphthalene
  5726. phosphorus mol. (P4)/naphthalene
  5727. phosphorus mol. (P4)/phenanthrene
  5728. phosphorus mol. (P4)/phenanthrene
  5729. phosphorus mol. (P4)/tetrachloromethane
  5730. phosphorus mol. (P4)/water
  5731. phosphorus oxide (P2O3)/phosphane (red)
  5732. phosphorus oxide (P2O5)/chlorosulfuric acid
  5733. phosphorus oxide (P2O5)/copper oxide (Cu2O)
  5734. phosphorus oxide (P2O5)/phosphoric acid
  5735. phosphorus oxide (P2O5)/phosphoric acid tripotassium salt
  5736. phosphorus oxide (P2O5)/silver oxide (Ag2O)
  5737. phosphorus oxide (P2O5)/water
  5738. phosphorus pentasulfide/carbon disulfide
  5739. phosphorus sulfide (P2S4)/zinc sulfide (ZnS)
  5740. phosphorus sulfide (P4S7)/carbon disulfide
  5741. phosphoryl chloride/(OC-6-11)-tungsten chloride (WCl6)
  5742. phosphoryl chloride/(SP-4-1)-platinum chloride (PtCl4)
  5743. phosphoryl chloride/(T-4)-dichlorodioxochromium
  5744. phosphoryl chloride/(T-4)-hafnium chloride (HfCl4)
  5745. phosphoryl chloride/(T-4)-tellurium chloride (TeCl4)
  5746. phosphoryl chloride/(T-4)-titanium bromide (TiBr4)
  5747. phosphoryl chloride/(T-4)-trichlorooxovanadium
  5748. phosphoryl chloride/(T-4)-zirconium chloride (ZrCl4)
  5749. phosphoryl chloride/1,1'-oxybis(3-methylbutane)
  5750. phosphoryl chloride/1,1'-oxybisbutane
  5751. phosphoryl chloride/1,1,2,3,4,4-hexachloro-1,3-butadiene
  5752. phosphoryl chloride/2-nitrobenzoic acid
  5753. phosphoryl chloride/acetic acid
  5754. phosphoryl chloride/aluminum bromide (AlBr3)
  5755. phosphoryl chloride/aluminum chloride (AlCl3)
  5756. phosphoryl chloride/aluminum fluoride (AlF3)
  5757. phosphoryl chloride/aluminum iodide (AlI3)
  5758. phosphoryl chloride/ammonium chloride ((NH4)Cl)
  5759. phosphoryl chloride/antimony chloride (SbCl5)
  5760. phosphoryl chloride/arsenous trichloride
  5761. phosphoryl chloride/benzenamine hydrochloride
  5762. phosphoryl chloride/benzene
  5763. phosphoryl chloride/benzoic acid
  5764. phosphoryl chloride/beryllium chloride (BeCl2)
  5765. phosphoryl chloride/bromine
  5766. phosphoryl chloride/butanoic acid
  5767. phosphoryl chloride/cesium chloride (CsCl)
  5768. phosphoryl chloride/chlorine
  5769. phosphoryl chloride/chloroacetic acid
  5770. phosphoryl chloride/chloroacetyl chloride
  5771. phosphoryl chloride/chlorosulfuric acid lithium salt
  5772. phosphoryl chloride/cobalt iodide (CoI2)
  5773. phosphoryl chloride/dichloroacetic acid
  5774. phosphoryl chloride/dilithium (OC-6-11)-hexachlorostannate(2-)
  5775. phosphoryl chloride/dilithium (OC-6-11)-hexachlorotitanate(2-)
  5776. phosphoryl chloride/erbium chloride (ErCl3)
  5777. phosphoryl chloride/gallium chloride (GaCl3)
  5778. phosphoryl chloride/gold(III) chloride
  5779. phosphoryl chloride/hexachlorobenzene
  5780. phosphoryl chloride/hexane
  5781. phosphoryl chloride/holmium chloride (HoCl3)
  5782. phosphoryl chloride/iodine chloride (ICl)
  5783. phosphoryl chloride/iodine chloride (ICl3)
  5784. phosphoryl chloride/iron chloride (FeCl3)
  5785. phosphoryl chloride/lithium (OC-6-11)-hexachloroantimonate(1-)
  5786. phosphoryl chloride/lithium (T-4)-tetrabromoaluminate(1-)
  5787. phosphoryl chloride/lithium (T-4)-tetrachloroaluminate(1-)
  5788. phosphoryl chloride/lithium chloride (LiCl)
  5789. phosphoryl chloride/lithium hexafluoroarsenate(1-)
  5790. phosphoryl chloride/lithium hexafluorophosphate(1-)
  5791. phosphoryl chloride/lithium tetrachloroborate(1-)
  5792. phosphoryl chloride/lithium tetrafluoroborate(1-)
  5793. phosphoryl chloride/methylbenzene
  5794. phosphoryl chloride/molybdenum chloride (MoCl3)
  5795. phosphoryl chloride/N,N,N-tributyl-1-butanaminium chloride
  5796. phosphoryl chloride/N,N,N-triethylethanaminium bromide
  5797. phosphoryl chloride/N,N,N-triethylethanaminium chloride
  5798. phosphoryl chloride/N,N,N-triethylethanaminium iodide
  5799. phosphoryl chloride/N,N,N-triethylethanaminium perchlorate
  5800. phosphoryl chloride/N,N,N-trimethylmethanaminium chloride
  5801. phosphoryl chloride/N,N,N-tripropyl-1-propanaminium chloride
  5802. phosphoryl chloride/N,N-diethylethanamine hydrochloride
  5803. phosphoryl chloride/niobium chloride (NbCl5)
  5804. phosphoryl chloride/nitric acid
  5805. phosphoryl chloride/pentachlorophosphorane
  5806. phosphoryl chloride/phenylphosphonic dichloride
  5807. phosphoryl chloride/phosphoric acid
  5808. phosphoryl chloride/phosphorous trichloride
  5809. phosphoryl chloride/potassium bromide (KBr)
  5810. phosphoryl chloride/potassium chloride (KCl)
  5811. phosphoryl chloride/potassium cyanide (K(CN))
  5812. phosphoryl chloride/potassium fluoride (KF)
  5813. phosphoryl chloride/potassium iodide (KI)
  5814. phosphoryl chloride/Potassium isocyanate
  5815. phosphoryl chloride/praseodymium chloride (PrCl3)
  5816. phosphoryl chloride/propanoic acid
  5817. phosphoryl chloride/pyridine hydrochloride
  5818. phosphoryl chloride/rhenium chloride (ReCl5)
  5819. phosphoryl chloride/rhenium chloride oxide (ReCl4O)
  5820. phosphoryl chloride/rubidium chloride (RbCl)
  5821. phosphoryl chloride/sodium chloride (NaCl)
  5822. phosphoryl chloride/sulfur chloride (SCl2)
  5823. phosphoryl chloride/sulfuric acid
  5824. phosphoryl chloride/sulfuryl chloride
  5825. phosphoryl chloride/tantalum chloride (TaCl5)
  5826. phosphoryl chloride/terbium chloride (TbCl3)
  5827. phosphoryl chloride/tetrabromogermane
  5828. phosphoryl chloride/tetrachlorogermane
  5829. phosphoryl chloride/tetrachloromethane
  5830. phosphoryl chloride/tetrachlorosilane
  5831. phosphoryl chloride/tetrachlorostannane
  5832. phosphoryl chloride/thiocyanic acid potassium salt
  5833. phosphoryl chloride/thionyl chloride
  5834. phosphoryl chloride/titanium chloride (TiCl4)
  5835. phosphoryl chloride/tribromoacetic acid
  5836. phosphoryl chloride/trichloroacetic acid
  5837. phosphoryl chloride/trichloroacetyl chloride
  5838. phosphoryl chloride/trichloroborane
  5839. phosphoryl chloride/trichloromethane
  5840. phosphoryl chloride/trichloromethylsilane
  5841. phosphoryl chloride/trimethylsulfonium iodide
  5842. phosphoryl chloride/ytterbium chloride (YbCl3)
  5843. phosphoryl fluoride/sulfuric acid
  5844. phosphoryl fluoride/trifluoroborane
  5845. phosporic acid manganese(2+) salt (2:3)/water
  5846. phosporic acid monocesium salt/water
  5847. phycocyanin/water
  5848. phycoerythrin r/water
  5849. picene/water
  5850. picrotoxin/water
  5851. piperazine dihydrochloride/water
  5852. piperazine sulfate(1:1)/water
  5853. piperazine/1,1'-oxybisbutane
  5854. piperazine/2-amino-2-methyl-1-propanol
  5855. piperazine/2-aminoethanol
  5856. piperazine/2-propanone
  5857. piperazine/4-methoxyphenol
  5858. piperazine/methanol
  5859. piperazine/water
  5860. piperidine compd. with 2,4,6-trinitrophenol (1:1)/1-methyl-2-pyrrolidinone
  5861. piperidine compd. with 2,4,6-trinitrophenol (1:1)/benzenamine
  5862. piperidine compd. with 2,4,6-trinitrophenol (1:1)/ethanol
  5863. piperidine compd. with 2,4,6-trinitrophenol (1:1)/methanol
  5864. piperidine compd. with 2,4,6-trinitrophenol (1:1)/nitrobenzene
  5865. piperidine compd. with 2,4,6-trinitrophenol (1:1)/water
  5866. piperidine conjugate acid/methanol
  5867. piperidine hydrochloride/benzene
  5868. piperidine hydrochloride/ethanol
  5869. piperidine hydrochloride/methanol
  5870. piperidine hydrochloride/nitrobenzene
  5871. piperidine hydrochloride/water
  5872. piperidine nitrate/water
  5873. piperidine perchlorate/nitrobenzene
  5874. piperidine/α-(hydroxymethyl)benzeneacetic acid (3-endo)-±-8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester
  5875. piperidine/(1R,2R,3S,5S)-3-(benzoyloxy)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylic acid methyl ester
  5876. piperidine/(3β(Z),4α,16β)-4,9-epoxycevane-3,4,12,14,16,17,20-heptol 3-(2-methyl-2-butanoate)
  5877. piperidine/(3S,5R)-6,7-dimethoxy-3-(5,6,7,8-tetrahydro-4-methoxy-6-methyl-1,3-dioxolo(4,5-g)isoquinolin-5-yl)-1(3H)-isobenzofuranone
  5878. piperidine/(3S-(3α(2E,7S*,11S*),4β,21β))-9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-3-phorbinepropanoic acid 3,7,11,15-tetramethyl-2-hexadecenyl ester
  5879. piperidine/(5α)-6,7,8,14-tetrahydro-4,5-epoxy-3,6-dimethoxy-17-methylmorphinan
  5880. piperidine/(5α,6α)-7,8-didehydro-4,5-epoxy-17-methylmorphinan-3,6-diol
  5881. piperidine/(5,10,15,20-tetrakis(3,5-di-tert-butyl-4-hydroxyphenyl)porphine)zinc
  5882. piperidine/(5,10,15,20-tetrakis(3,5-dimethylphenyl)porphine)zinc
  5883. piperidine/(5-(3-hydroxyphenyl)-10,15,20-triphenyl-21H,23H-porphine)zinc
  5884. piperidine/(5-(4-hydroxyphenyl)-10,15,20-triphenyl-21H,23H-porphine)zinc
  5885. piperidine/(8α,9R)-6'-methoxycinchonan-9-ol
  5886. piperidine/(9S)-cinchonan-9-ol
  5887. piperidine/(SP-4-1)-((4,4',4'',4'''-(21H,23H-porphine-5,10,15,20-tetrayl)tetrakis(phenolato))(2-)-N(21),N(22),N(23),N(24))zinc
  5888. piperidine/(SP-4-1)-(5,10,15,20-tetrakis(4-(decyloxy)phenyl)-21H,23H-porphinato(2-)-κN(21),κN(22),κN(23),κN(24))zinc
  5889. piperidine/(SP-4-1)-(5,10,15,20-tetrakis(4-(hexadecyloxy)phenyl)-21H,23H-porphinato(2-)-κN(21),κN(22),κN(23),κN(24))zinc
  5890. piperidine/(SP-4-1)-(5,10,15,20-tetrakis(4-butoxyphenyl)-21H,23H-porphinato(2-)-κN(21),κN(22),κN(23),κN(24))zinc
  5891. piperidine/(SP-4-1)-(5,10,15,20-tetraphenyl-21H,23H-porphinato(2-)-κN21,κN22,κN23,κN24)zinc
  5892. piperidine/(SP-5-13)-(acetato-κO)((2E,7R,11R)-3,7,11,15-tetramethyl-2-hexadecenyl (3S,4S,21R)-9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-3-phorbinepropanoato(2-)-κN23,κN24,κ(25),κN(26))iron
  5893. piperidine/(SP-5-13)-(acetato-κO)((2E,7R,11R)-3,7,12,15-tetramethyl-2-hexadecenyl (3S,4S,21R)-9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-3-phorbinepropanoato(2-)-κN23,κN24,κN(25),κN(26))manganese
  5894. piperidine/(SP-5-13)-(acetato-κO)(methyl (3S,4S,21R)-9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-3-phorbinepropanoato(2-)-κN23,κN24,κN25,κN26)iron
  5895. piperidine/(SP-5-13)-(acetato-κO)(methyl (3S,4S,21R)-9-ethenyl-14-ethyl-21-(methoxycarbonyl)-4,8,13,18-tetramethyl-20-oxo-3-phorbinepropanoato(2-)-κN23,κN24,κN25,κN26)manganese
  5896. piperidine/1,1'-oxybispropane
  5897. piperidine/1,2,3,4-tetrahydronaphthalene
  5898. piperidine/1,3-dioxolane
  5899. piperidine/1,4-dioxane
  5900. piperidine/1-((3,4-dimethoxyphenyl)methyl)-6,7-dimethoxyisoquinoline
  5901. piperidine/1-hexyne
  5902. piperidine/1-methylpiperidine
  5903. piperidine/1-octanol
  5904. piperidine/2,2,4-trimethylpentane
  5905. piperidine/2,3-dimethoxystrychnidin-10-one
  5906. piperidine/2-aminoethanol
  5907. piperidine/2-bromo-2-chloro-1,1,1-trifluoroethane
  5908. piperidine/2-butanone
  5909. piperidine/2-methoxy-2-methylpropane
  5910. piperidine/2-methoxyphenol
  5911. piperidine/2-pyrrolidinone
  5912. piperidine/3-(10,15,20-triphenyl-21H,23H-porphin-5-yl)phenol
  5913. piperidine/3-isothiocyanato-1-propene
  5914. piperidine/3-pentanone
  5915. piperidine/4,4',4'',4'''-(21H,23H-porphine-5,10,15,20-tetrayl)tetrakis(2,6-bis(1,1-dimethylethyl)phenol)
  5916. piperidine/4,4',4'',4'''-(21H,23H-porphine-5,10,15,20-tetrayl)tetrakis(phenol)
  5917. piperidine/4-(10,15,20-triphenyl-21H,23H-porphin-5-yl)phenol
  5918. piperidine/5,10,15,20-tetrakis(2-bromophenyl)-21H,23H-porphine
  5919. piperidine/5,10,15,20-tetrakis(2-chlorophenyl)-21H,23H-porphine
  5920. piperidine/5,10,15,20-tetrakis(3,5-dimethylphenyl)-21H,23H-porphine
  5921. piperidine/5,10,15,20-tetrakis(3-chlorophenyl)-21H,23H-porphine
  5922. piperidine/5,10,15,20-tetrakis(4-(decyloxy)phenyl)-21H,23H-porphine
  5923. piperidine/5,10,15,20-tetrakis(4-butoxyphenyl)-21H,23H-porphine
  5924. piperidine/5,10,15,20-tetrakis(p-chlorophenyl)porphyrin
  5925. piperidine/5,10,15,20-tetraphenyl-21H,23H-porphine
  5926. piperidine/7,12-bis(1-methoxyethyl)-3,8,13,17-tetramethyl-21H,23H-porphine-2,18-dipropanoic acid dimethyl ester
  5927. piperidine/acetic acid
  5928. piperidine/acetic acid ethyl ester
  5929. piperidine/benzenamine
  5930. piperidine/benzene
  5931. piperidine/chlorosulfuric acid
  5932. piperidine/cycloheptane
  5933. piperidine/cycloheptanone
  5934. piperidine/cyclooctane
  5935. piperidine/cyclopentane
  5936. piperidine/cyclopentanone
  5937. piperidine/decane
  5938. piperidine/dimethylmercury
  5939. piperidine/dodecane
  5940. piperidine/formic acid
  5941. piperidine/heptane
  5942. piperidine/hydrogen
  5943. piperidine/hydrogen peroxide (H2O2)
  5944. piperidine/hydrogen sulfide (H2S)
  5945. piperidine/isothiocyanatoethane
  5946. piperidine/methane
  5947. piperidine/methanesulfonic acid
  5948. piperidine/methanol
  5949. piperidine/morpholine
  5950. piperidine/N,N-diethylethanamine
  5951. piperidine/N,N-dimethyl-1-butanamine
  5952. piperidine/N,N-dimethylbenzenamine
  5953. piperidine/N,N-dimethylformamide
  5954. piperidine/N-phenylbenzenamine
  5955. piperidine/N-propyl-1-propanamine
  5956. piperidine/nitric acid silver(1+) salt
  5957. piperidine/nitric acid thorium(4+) salt
  5958. piperidine/nitrogen
  5959. piperidine/nitromethane
  5960. piperidine/octane
  5961. piperidine/oxygen
  5962. piperidine/pyrrolidine
  5963. piperidine/quinoline
  5964. piperidine/strychnidin-10-one
  5965. piperidine/sulfuric acid disodium salt
  5966. piperidine/tetrachloromethane
  5967. piperidine/tetradecane
  5968. piperidine/tetrahydro-2H-pyran
  5969. piperidine/trichloromethane
  5970. piperidine/water
  5971. platinum chloride (PtCl2)/hydrazine
  5972. platinum/antimony
  5973. platinum/barium
  5974. platinum/cobalt
  5975. platinum/copper
  5976. platinum/germanium
  5977. platinum/gold
  5978. platinum/indium
  5979. platinum/ruthenium
  5980. platinum/silicon
  5981. platinum/silver
  5982. platinum/tin
  5983. plutonium chloride (PuCl3)/lithium chloride (LiCl)
  5984. plutonium chloride (PuCl3)/magnesium chloride (MgCl2)
  5985. plutonium chloride (PuCl3)/plutonium chloride oxide (PuClO)
  5986. plutonium chloride (PuCl3)/sodium chloride (NaCl)
  5987. plutonium chloride (PuCl4)/cesium chloride (CsCl)
  5988. plutonium chloride (PuCl4)/potassium chloride (KCl)
  5989. plutonium chloride (PuCl4)/rubidium chloride (RbCl)
  5990. plutonium fluoride (PuF3)/lithium fluoride (LiF)
  5991. plutonium fluoride (PuF3)/sodium fluoride (NaF)
  5992. plutonium fluoride (PuF4)/water
  5993. plutonium oxide (PuO2)/beryllium oxide (BeO)
  5994. plutonium oxide (PuO2)/magnesium oxide (MgO)
  5995. plutonium/zinc
  5996. poly(1-phenylethylene)/1,2,4-trimethylbenzene
  5997. poly(1-phenylethylene)/1,2-dichlorobenzene
  5998. poly(1-phenylethylene)/1,2-dimethylbenzene
  5999. poly(1-phenylethylene)/1-phenylethanone
  6000. poly(1-phenylethylene)/3-methylpentane
  6001. poly(1-phenylethylene)/3-pentanone
  6002. poly(1-phenylethylene)/decahydronaphthalene
  6003. poly(1-phenylethylene)/ethanedioic acid diethyl ester
  6004. poly(1-phenylethylene)/methylcyclopentane
  6005. poly(1-phenylethylene)/nitrobenzene
  6006. poly(carbonate) bisphenol-A/(1,1-dimethylethyl)benzene
  6007. poly(carbonate) bisphenol-A/1,1,2,2-tetrachloroethane
  6008. poly(carbonate) bisphenol-A/1,2-dichlorobenzene
  6009. poly(carbonate) bisphenol-A/1,2-dimethylbenzene
  6010. poly(carbonate) bisphenol-A/1-butanol
  6011. poly(carbonate) bisphenol-A/1-pentanol
  6012. poly(carbonate) bisphenol-A/1-propanol
  6013. poly(carbonate) bisphenol-A/acetic acid 1,1-dimethylethyl ester
  6014. poly(carbonate) bisphenol-A/benzene
  6015. poly(carbonate) bisphenol-A/dichloromethane
  6016. poly(carbonate) bisphenol-A/ethanol
  6017. poly(carbonate) bisphenol-A/tetradecane
  6018. poly(carbonate) bisphenol-A/trichloromethane
  6019. poly(carbonate) bisphenol-A/water
  6020. poly(dimethylsiloxane)/(1-methylethyl)benzene
  6021. poly(dimethylsiloxane)/(2E)-2-pentene
  6022. poly(dimethylsiloxane)/(2E)-4,4-dimethyl-2-pentene
  6023. poly(dimethylsiloxane)/(2E)-4-methyl-2-pentene
  6024. poly(dimethylsiloxane)/(2Z)-2-hexene
  6025. poly(dimethylsiloxane)/(2Z)-3-methyl-2-pentene
  6026. poly(dimethylsiloxane)/(2Z)-4,4-dimethyl-2-pentene
  6027. poly(dimethylsiloxane)/(2Z)-4-methyl-2-pentene
  6028. poly(dimethylsiloxane)/(3E)-2,5-dimethyl-3-hexene
  6029. poly(dimethylsiloxane)/(3E)-2-methyl-3-heptene
  6030. poly(dimethylsiloxane)/(3Z)-2,2-dimethyl-3-hexene
  6031. poly(dimethylsiloxane)/(3Z)-3-heptene
  6032. poly(dimethylsiloxane)/(3Z)-3-hexene
  6033. poly(dimethylsiloxane)/1,1,1-trichloroethane
  6034. poly(dimethylsiloxane)/1,1-dichloroethane
  6035. poly(dimethylsiloxane)/1,2-dichlorobenzene
  6036. poly(dimethylsiloxane)/1,2-dimethylbenzene
  6037. poly(dimethylsiloxane)/1-butanol
  6038. poly(dimethylsiloxane)/1-pentanol
  6039. poly(dimethylsiloxane)/1-propanol
  6040. poly(dimethylsiloxane)/2,2-dimethylbutane
  6041. poly(dimethylsiloxane)/2,3-dimethyl-2-hexene
  6042. poly(dimethylsiloxane)/2,3-dimethylbutane
  6043. poly(dimethylsiloxane)/2-butanone
  6044. poly(dimethylsiloxane)/2-methyl-1-pentene
  6045. poly(dimethylsiloxane)/2-methylbutane
  6046. poly(dimethylsiloxane)/2-propanone
  6047. poly(dimethylsiloxane)/3,4-dimethyl-1-pentene
  6048. poly(dimethylsiloxane)/3-methyl-1-pentene
  6049. poly(dimethylsiloxane)/3-methylpentane
  6050. poly(dimethylsiloxane)/4,4-dimethyl-1-pentene
  6051. poly(dimethylsiloxane)/4-methyl-1-pentene
  6052. poly(dimethylsiloxane)/acetic acid
  6053. poly(dimethylsiloxane)/acetic acid methyl ester
  6054. poly(dimethylsiloxane)/benzene
  6055. poly(dimethylsiloxane)/chlorodifluoromethane
  6056. poly(dimethylsiloxane)/cis-1,3-dimethylcyclohexane
  6057. poly(dimethylsiloxane)/dichloromethane
  6058. poly(dimethylsiloxane)/ethane
  6059. poly(dimethylsiloxane)/ethanol
  6060. poly(dimethylsiloxane)/methanol
  6061. poly(dimethylsiloxane)/methylcyclopentane
  6062. poly(dimethylsiloxane)/pentafluoropropanoic acid butyl ester
  6063. poly(dimethylsiloxane)/propane
  6064. poly(dimethylsiloxane)/tetramethylsilane
  6065. poly(dimethylsiloxane)/trans-1,2-dimethylcyclopentane
  6066. poly(dimethylsiloxane)/trichloroethene
  6067. poly(dimethylsiloxane)/trichloromethane
  6068. poly(dimethylsiloxane)/water
  6069. poly(ethylene glycol) diacrylate/1-butanol
  6070. poly(ethylene glycol) diacrylate/1-pentanol
  6071. poly(ethylene glycol) diacrylate/1-propanol
  6072. poly(ethylene glycol) diacrylate/ethanol
  6073. poly(ethylene glycol) diacrylate/water
  6074. poly(hexahydro-2H-azepin-2-one)/1,8-diazacyclotetradecane-2,9-dione
  6075. poly(hexahydro-2H-azepin-2-one)/formic acid
  6076. poly(iso-butyl methacrylate)/(1,1-dimethylethyl)benzene
  6077. poly(iso-butyl methacrylate)/1,2-dimethylbenzene
  6078. poly(oxy(1-methyl-2-oxo-1,2-ethanediyl))/nitrogen
  6079. poly(oxy-1,4-phenylenesulfonyl-1,4-phenylene)/N,N-dimethylformamide
  6080. poly(oxycarbonyloxy-1,4-phenylene(1-phenylethylidene)-1,4-phenylene)/(1,1-dimethylethyl)benzene
  6081. poly(oxycarbonyloxy-1,4-phenylene(1-phenylethylidene)-1,4-phenylene)/1,1,2,2-tetrachloroethane
  6082. poly(oxycarbonyloxy-1,4-phenylene(1-phenylethylidene)-1,4-phenylene)/1-propanol
  6083. poly(oxycarbonyloxy-1,4-phenylene(1-phenylethylidene)-1,4-phenylene)/benzene
  6084. poly(oxycarbonyloxy-1,4-phenylene(1-phenylethylidene)-1,4-phenylene)/dichloromethane
  6085. poly(oxycarbonyloxy-1,4-phenylene(1-phenylethylidene)-1,4-phenylene)/tetradecane
  6086. poly(oxycarbonyloxy-1,4-phenylene(1-phenylethylidene)-1,4-phenylene)/trichloromethane
  6087. poly(oxycarbonyloxy-1,4-phenylenecyclohexylidene-1,4-phenylene)/(1,1-dimethylethyl)benzene
  6088. poly(oxycarbonyloxy-1,4-phenylenecyclohexylidene-1,4-phenylene)/1,1,2,2-tetrachloroethane
  6089. poly(oxycarbonyloxy-1,4-phenylenecyclohexylidene-1,4-phenylene)/1-propanol
  6090. poly(oxycarbonyloxy-1,4-phenylenecyclohexylidene-1,4-phenylene)/benzene
  6091. poly(oxycarbonyloxy-1,4-phenylenecyclohexylidene-1,4-phenylene)/dichloromethane
  6092. poly(oxycarbonyloxy-1,4-phenylenecyclohexylidene-1,4-phenylene)/tetradecane
  6093. poly(oxycarbonyloxy-1,4-phenylenecyclohexylidene-1,4-phenylene)/trichloromethane
  6094. poly(oxycarbonyloxy-1,4-phenylenemethylene-1,4-phenylene)/(1,1-dimethylethyl)benzene
  6095. poly(oxycarbonyloxy-1,4-phenylenemethylene-1,4-phenylene)/1,1,2,2-tetrachloroethane
  6096. poly(oxycarbonyloxy-1,4-phenylenemethylene-1,4-phenylene)/1-propanol
  6097. poly(oxycarbonyloxy-1,4-phenylenemethylene-1,4-phenylene)/benzene
  6098. poly(oxycarbonyloxy-1,4-phenylenemethylene-1,4-phenylene)/dichloromethane
  6099. poly(oxycarbonyloxy-1,4-phenylenemethylene-1,4-phenylene)/tetradecane
  6100. poly(oxycarbonyloxy-1,4-phenylenemethylene-1,4-phenylene)/trichloromethane
  6101. poly(phenylmethyl 2-methylprop-2-enoate)/1,2-dimethylbenzene
  6102. poly(phenylmethyl 2-methylprop-2-enoate)/1-butanol
  6103. poly(phenylmethyl 2-methylprop-2-enoate)/2-butanone
  6104. poly(phenylmethyl 2-methylprop-2-enoate)/2-propanol
  6105. poly(phenylmethyl 2-methylprop-2-enoate)/2-propanone
  6106. poly(phenylmethyl 2-methylprop-2-enoate)/benzene
  6107. poly(phenylmethyl 2-methylprop-2-enoate)/ethanol
  6108. poly(phenylmethyl 2-methylprop-2-enoate)/methanol
  6109. poly(thio-1,4-phenylene)/(1,1-dimethylethyl)benzene
  6110. poly(thio-1,4-phenylene)/(1-methylethenyl)benzene
  6111. poly(thio-1,4-phenylene)/1,2,3,5-tetramethylbenzene
  6112. poly(thio-1,4-phenylene)/1-methylnaphthalene
  6113. poly(thio-1,4-phenylene)/3a,4,7,7a-tetrahydro-1H-indene
  6114. poly(thio-1,4-phenylene)/hexadecane
  6115. poly(thio-1,4-phenylene)/octadecane
  6116. poly(vinyl chloride)/1,2-dimethylbenzene
  6117. poly(vinyl chloride)/4-chloro-1-butanol
  6118. poly(vinyl chloride)/polyethylene
  6119. poly(vinyl chloride)/[(methylphenyl)methyl]naphthalene
  6120. polyamides/1-butanol
  6121. polyamides/2-butanone
  6122. polyamides/2-propanol
  6123. polyamides/acetonitrile
  6124. polyamides/benzene
  6125. polyamides/methane
  6126. polyamides/trichloromethane
  6127. polycarbonates/water
  6128. polyethylene/(1-methylethyl)benzene
  6129. polyethylene/1,2-dimethylbenzene
  6130. polyethylene/3-pentanone
  6131. polyethylene/4-chloro-1-butanol
  6132. Polyoxymethylene dimethyl ether/Fluid catalytic cracking (FCC) diesel oil
  6133. polypropylene/3-pentanone
  6134. poly[imino(1,6-dioxo-1,6-hexanediyl)imino-1,6-hexanediyl]/water
  6135. poly[imino(1-oxo-1,11-undecanediyl)]/2-methylphenol
  6136. poly[oxy((1S)-1-methyl-2-oxo-1,2-ethanediyl)]/1,1-difluoroethane
  6137. poly[oxy((1S)-1-methyl-2-oxo-1,2-ethanediyl)]/chlorodifluoromethane
  6138. poly[oxy((1S)-1-methyl-2-oxo-1,2-ethanediyl)]/dichloromethane
  6139. poly[oxy((1S)-1-methyl-2-oxo-1,2-ethanediyl)]/difluoromethane
  6140. poly[oxy((1S)-1-methyl-2-oxo-1,2-ethanediyl)]/ethene
  6141. poly[oxy((1S)-1-methyl-2-oxo-1,2-ethanediyl)]/trifluoromethane
  6142. poly[oxy((1S)-1-methyl-2-oxo-1,2-ethanediyl)]/water
  6143. poly[oxy(1-oxo-1,6-hexanediyl)]/(1-methylethyl)benzene
  6144. poly[oxy(1-oxo-1,6-hexanediyl)]/1,1,1-trichloroethane
  6145. poly[oxy(1-oxo-1,6-hexanediyl)]/1,1-dichloroethane
  6146. poly[oxy(1-oxo-1,6-hexanediyl)]/1,4-cyclohexadiene
  6147. poly[oxy(1-oxo-1,6-hexanediyl)]/1-butanol
  6148. poly[oxy(1-oxo-1,6-hexanediyl)]/1-chlorohexane
  6149. poly[oxy(1-oxo-1,6-hexanediyl)]/1-chloropentane
  6150. poly[oxy(1-oxo-1,6-hexanediyl)]/1-pentanol
  6151. poly[oxy(1-oxo-1,6-hexanediyl)]/1-propanol
  6152. poly[oxy(1-oxo-1,6-hexanediyl)]/2-butanone
  6153. poly[oxy(1-oxo-1,6-hexanediyl)]/2-propanone
  6154. poly[oxy(1-oxo-1,6-hexanediyl)]/acetic acid 1,1-dimethylethyl ester
  6155. poly[oxy(1-oxo-1,6-hexanediyl)]/acetic acid methyl ester
  6156. poly[oxy(1-oxo-1,6-hexanediyl)]/benzene
  6157. poly[oxy(1-oxo-1,6-hexanediyl)]/chlorodifluoromethane
  6158. poly[oxy(1-oxo-1,6-hexanediyl)]/cycloheptane
  6159. poly[oxy(1-oxo-1,6-hexanediyl)]/cyclooctane
  6160. poly[oxy(1-oxo-1,6-hexanediyl)]/cyclopentane
  6161. poly[oxy(1-oxo-1,6-hexanediyl)]/dichloromethane
  6162. poly[oxy(1-oxo-1,6-hexanediyl)]/ethanol
  6163. poly[oxy(1-oxo-1,6-hexanediyl)]/methanol
  6164. poly[oxy(1-oxo-1,6-hexanediyl)]/propane
  6165. poly[oxy(1-oxo-1,6-hexanediyl)]/tetrachloromethane
  6166. poly[oxy(1-oxo-1,6-hexanediyl)]/trichloroethene
  6167. poly[oxy(1-oxo-1,6-hexanediyl)]/trichloromethane
  6168. poly[oxy-1,4-phenylenesulfonyl-1,4-phenyleneoxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene]/1,1'-oxybisethane
  6169. poly[oxy-1,4-phenylenesulfonyl-1,4-phenyleneoxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene]/1-butanol
  6170. poly[oxy-1,4-phenylenesulfonyl-1,4-phenyleneoxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene]/1-methyl-2-pyrrolidinone
  6171. poly[oxy-1,4-phenylenesulfonyl-1,4-phenyleneoxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene]/1-propanol
  6172. poly[oxy-1,4-phenylenesulfonyl-1,4-phenyleneoxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene]/2,2,2-trifluoroethanol
  6173. poly[oxy-1,4-phenylenesulfonyl-1,4-phenyleneoxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene]/2-butanone
  6174. poly[oxy-1,4-phenylenesulfonyl-1,4-phenyleneoxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene]/2-propanone
  6175. poly[oxy-1,4-phenylenesulfonyl-1,4-phenyleneoxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene]/3-pentanone
  6176. poly[oxy-1,4-phenylenesulfonyl-1,4-phenyleneoxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene]/acetaldehyde
  6177. poly[oxy-1,4-phenylenesulfonyl-1,4-phenyleneoxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene]/acetic acid
  6178. poly[oxy-1,4-phenylenesulfonyl-1,4-phenyleneoxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene]/acetic acid methyl ester
  6179. poly[oxy-1,4-phenylenesulfonyl-1,4-phenyleneoxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene]/acetonitrile
  6180. poly[oxy-1,4-phenylenesulfonyl-1,4-phenyleneoxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene]/benzene
  6181. poly[oxy-1,4-phenylenesulfonyl-1,4-phenyleneoxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene]/dichloromethane
  6182. poly[oxy-1,4-phenylenesulfonyl-1,4-phenyleneoxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene]/dihydro-2(3H)-furanone
  6183. poly[oxy-1,4-phenylenesulfonyl-1,4-phenyleneoxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene]/ethanol
  6184. poly[oxy-1,4-phenylenesulfonyl-1,4-phenyleneoxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene]/fluorobenzene
  6185. poly[oxy-1,4-phenylenesulfonyl-1,4-phenyleneoxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene]/methanol
  6186. poly[oxy-1,4-phenylenesulfonyl-1,4-phenyleneoxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene]/N,N-dimethylformamide
  6187. poly[oxy-1,4-phenylenesulfonyl-1,4-phenyleneoxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene]/propanoic acid
  6188. poly[oxy-1,4-phenylenesulfonyl-1,4-phenyleneoxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene]/sulfinylbismethane
  6189. poly[oxy-1,4-phenylenesulfonyl-1,4-phenyleneoxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene]/tetrachloromethane
  6190. poly[oxy-1,4-phenylenesulfonyl-1,4-phenyleneoxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene]/trichloromethane
  6191. poly[oxy-1,4-phenylenesulfonyl-1,4-phenyleneoxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene]/water
  6192. poly[oxycarbonyloxy-1,4-phenylene[4-(1,1-dimethylethyl)cyclohexylidene]-1,4-phenylene]/(1,1-dimethylethyl)benzene
  6193. poly[oxycarbonyloxy-1,4-phenylene[4-(1,1-dimethylethyl)cyclohexylidene]-1,4-phenylene]/1,1,2,2-tetrachloroethane
  6194. poly[oxycarbonyloxy-1,4-phenylene[4-(1,1-dimethylethyl)cyclohexylidene]-1,4-phenylene]/1-propanol
  6195. poly[oxycarbonyloxy-1,4-phenylene[4-(1,1-dimethylethyl)cyclohexylidene]-1,4-phenylene]/benzene
  6196. poly[oxycarbonyloxy-1,4-phenylene[4-(1,1-dimethylethyl)cyclohexylidene]-1,4-phenylene]/butylcyclohexane
  6197. poly[oxycarbonyloxy-1,4-phenylene[4-(1,1-dimethylethyl)cyclohexylidene]-1,4-phenylene]/dichloromethane
  6198. poly[oxycarbonyloxy-1,4-phenylene[4-(1,1-dimethylethyl)cyclohexylidene]-1,4-phenylene]/tetradecane
  6199. poly[oxycarbonyloxy-1,4-phenylene[4-(1,1-dimethylethyl)cyclohexylidene]-1,4-phenylene]/trichloromethane
  6200. potassium β-oxobenzenepropanal ion(1-)/sulfinylbismethane
  6201. potassium (2S,5R,6R)-3,3-dimethyl-7-oxo-6-[(2-phenoxyacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate/ethanol
  6202. potassium (OC-6-11)-hexachloroniobate(1-)/sodium (OC-6-11)-hexachloroniobate(1-)
  6203. potassium (OC-6-11)-hexachlorotantalate(1-)/dipotassium pentachlorooxoniobate
  6204. potassium (OC-6-11)-hexafluoroantimonate(1-)/hydrofluoric acid
  6205. potassium (OC-6-21)-((N,N'-1,2-ethanediylbis(N-(carboxymethyl)glycinato))(4-)-N,N',O,O',ON,ON')cobaltate(1-)/water
  6206. potassium (SP-4-1)-tetrachloroaurate(1-)/water
  6207. potassium (T-4)-rhenate (ReO4(1-))/cesium (T-4)-rhenate (ReO4(1-))
  6208. potassium (T-4)-rhenate (ReO4(1-))/dipotassium (T-4)-molybdate (MoO4(2-))
  6209. potassium (T-4)-rhenate (ReO4(1-))/dipotassium (T-4)-tungstate (WO4(2-))
  6210. potassium (T-4)-rhenate (ReO4(1-))/N-methylformamide
  6211. potassium (T-4)-rhenate (ReO4(1-))/potassium bromide (KBr)
  6212. potassium (T-4)-rhenate (ReO4(1-))/potassium chloride (KCl)
  6213. potassium (T-4)-rhenate (ReO4(1-))/potassium iodide (KI)
  6214. potassium (T-4)-rhenate (ReO4(1-))/rubidium (T-4)-rhenate (ReO4(1-))
  6215. potassium (T-4)-rhenate (ReO4(1-))/sodium (T-4)-rhenate (ReO4(1-))
  6216. potassium (T-4)-rhenate (ReO4(1-))/water
  6217. potassium (T-4)-rhenate (ReO4(1-))/Yttrium perrhenate
  6218. potassium (T-4)-technetate (TcO4(1-))/water
  6219. potassium (T-4)-tetrachloroaluminate(1-)/aluminum chloride (AlCl3)
  6220. potassium (T-4)-tetrachloroaluminate(1-)/dipotassium (OC-6-11)-hexachlorozirconate(2-)
  6221. potassium (T-4)-tetrachloroaluminate(1-)/dipotassium pentachlorooxoniobate(2-)
  6222. potassium (T-4)-tetrachloroaluminate(1-)/potassium chloride (KCl)
  6223. potassium (T-4)-tetrachloroaluminate(1-)/sodium (T-4)-tetrachloroaluminate(1-)
  6224. potassium (T-4)-tetrachloroferrate(1-)/dipotassium (OC-6-11)-hexachlorozirconate(2-)
  6225. potassium (T-4)-tetrafluoroaluminate(1-)/cesium (T-4)-tetrafluoroaluminate(1-)
  6226. potassium (T-4)-tetrafluoroaluminate(1-)/Cesium(I) alumiunum(III) tetrafluoride
  6227. potassium (T-4)-trifluorohydroxyborate(1-)/potassium fluoride (KF)
  6228. potassium (T-4)-trifluorohydroxyborate(1-)/potassium tetrafluoroborate(1-)
  6229. potassium (T-4)-trifluoromethoxyborate(1-)/methanol
  6230. potassium 2,2-dichloroacetate/water
  6231. potassium 2,2-dimethylpropanoate/water
  6232. potassium 2-chlorobenzoate/methanol
  6233. potassium 2-chlorobenzoate/water
  6234. potassium 2-methoxyacetate/water
  6235. potassium 3-ethoxy-3-oxopropanoate/water
  6236. potassium 3-methoxy-3-oxopropanoate/water
  6237. potassium 3-oxobutanal ion(1-)/sulfinylbismethane
  6238. potassium 4,4-dimethyl-3-oxopentanal ion(1-)/sulfinylbismethane
  6239. potassium 4-methyl-3-oxopentanal ion(1-)/sulfinylbismethane
  6240. potassium 4-methylbenzenesulfonate/water
  6241. potassium 4-methylbenzenesulfonate/water-d2
  6242. potassium amide (K(NH2))/ammonia
  6243. potassium azide (K(N3))/acetonitrile
  6244. potassium azide (K(N3))/benzene
  6245. potassium azide (K(N3))/ethanol
  6246. potassium azide (K(N3))/water
  6247. potassium bis(cyano-C)argentate(1-)/water
  6248. potassium bromide (KBr)/1,1'-biphenyl
  6249. potassium bromide (KBr)/1,1':3',1''-terphenyl
  6250. potassium bromide (KBr)/1,3-dioxolan-2-one
  6251. potassium bromide (KBr)/1-(3-chloro-2-hydroxypropyl)-3-methyl-1H-imidazolium chloride
  6252. potassium bromide (KBr)/1-chloronaphthalene
  6253. potassium bromide (KBr)/1-methylnaphthalene
  6254. potassium bromide (KBr)/2-butanol
  6255. potassium bromide (KBr)/2-furancarboxaldehyde
  6256. potassium bromide (KBr)/2-methyl-1-propanol
  6257. potassium bromide (KBr)/4-(hydroxymethyl)-1,3-dioxolan-2-one
  6258. potassium bromide (KBr)/9H-fluorene
  6259. potassium bromide (KBr)/cadmium bromide (CdBr2)
  6260. potassium bromide (KBr)/cadmium iodide (CdI2)
  6261. potassium bromide (KBr)/calcium bromide (CaBr2)
  6262. potassium bromide (KBr)/cesium bromide (CsBr)
  6263. potassium bromide (KBr)/chromic acid (H2CrO4) dipotassium salt
  6264. potassium bromide (KBr)/cobalt bromide (CoBr2)
  6265. potassium bromide (KBr)/copper bromide (CuBr)
  6266. potassium bromide (KBr)/dihydro-2(3H)-furanone
  6267. potassium bromide (KBr)/dipotassium (T-4)-tungstate (WO4(2-))
  6268. potassium bromide (KBr)/hydroxylamine
  6269. potassium bromide (KBr)/lead chloride (PbCl2)
  6270. potassium bromide (KBr)/lithium fluoride (LiF)
  6271. potassium bromide (KBr)/magnesium bromide (MgBr2)
  6272. potassium bromide (KBr)/mercury bromide (HgBr2)
  6273. potassium bromide (KBr)/N-methylacetamide
  6274. potassium bromide (KBr)/naphthalene
  6275. potassium bromide (KBr)/nitric acid lithium salt
  6276. potassium bromide (KBr)/nitrobenzene
  6277. potassium bromide (KBr)/potassium fluoride (KF)
  6278. potassium bromide (KBr)/rubidium bromide (RbBr)
  6279. potassium bromide (KBr)/rubidium chloride (RbCl)
  6280. potassium bromide (KBr)/silver bromide (AgBr)
  6281. potassium bromide (KBr)/silver chloride (AgCl)
  6282. potassium bromide (KBr)/sulfuric acid dipotassium salt
  6283. potassium bromide (KBr)/thallium bromide (TlBr)
  6284. potassium bromide (KBr)/thallium chloride (TlCl)
  6285. potassium bromide (KBr)/water-d2
  6286. potassium chloride (KCl)/(T-4)-trichlorooxovanadium
  6287. potassium chloride (KCl)/1,1'-biphenyl
  6288. potassium chloride (KCl)/1,1':3',1''-terphenyl
  6289. potassium chloride (KCl)/1,3-dioxolan-2-one
  6290. potassium chloride (KCl)/1-(3-chloro-2-hydroxypropyl)-3-methyl-1H-imidazolium chloride
  6291. potassium chloride (KCl)/1-chloronaphthalene
  6292. potassium chloride (KCl)/1-methyl-2-pyrrolidinone
  6293. potassium chloride (KCl)/1-methylnaphthalene
  6294. potassium chloride (KCl)/2-butanol
  6295. potassium chloride (KCl)/2-furancarboxaldehyde
  6296. potassium chloride (KCl)/2-methyl-1-propanol
  6297. potassium chloride (KCl)/2-methyl-2-butanol
  6298. potassium chloride (KCl)/2-methyl-2-propanol
  6299. potassium chloride (KCl)/4-(hydroxymethyl)-1,3-dioxolan-2-one
  6300. potassium chloride (KCl)/9H-fluorene
  6301. potassium chloride (KCl)/acetonitrile
  6302. potassium chloride (KCl)/aluminum fluoride (AlF3)
  6303. potassium chloride (KCl)/ammonia
  6304. potassium chloride (KCl)/barium (T-4)-molybdate (MoO4(2-)) (1:1)
  6305. potassium chloride (KCl)/barium fluoride (BaF2)
  6306. potassium chloride (KCl)/beryllium chloride (BeCl2)
  6307. potassium chloride (KCl)/boric acid (HBO2) sodium salt
  6308. potassium chloride (KCl)/cadmium iodide (CdI2)
  6309. potassium chloride (KCl)/calcium (T-4)-molybdate (MoO4(2-)) (1:1)
  6310. potassium chloride (KCl)/calcium (T-4)-tungstate (WO4(2-)) (1:1)
  6311. potassium chloride (KCl)/calcium fluoride (CaF2)
  6312. potassium chloride (KCl)/cerium chloride (CeCl3)
  6313. potassium chloride (KCl)/cesium bromide (CsBr)
  6314. potassium chloride (KCl)/cesium chloride (CsCl)
  6315. potassium chloride (KCl)/cesium iodide (CsI)
  6316. potassium chloride (KCl)/chlorine
  6317. potassium chloride (KCl)/chlorosulfuric acid
  6318. potassium chloride (KCl)/chromic acid (H2Cr2O7) dipotassium salt
  6319. potassium chloride (KCl)/chromic acid (H2CrO4) dipotassium salt
  6320. potassium chloride (KCl)/chromic acid (H2CrO4) lead(2+) salt (1:1)
  6321. potassium chloride (KCl)/cobalt chloride (CoCl2)
  6322. potassium chloride (KCl)/copper chloride (CuCl)
  6323. potassium chloride (KCl)/dihydro-2(3H)-furanone
  6324. potassium chloride (KCl)/diphosphoric acid tetrasodium salt
  6325. potassium chloride (KCl)/dipotassium (T-4)-tungstate (WO4(2-))
  6326. potassium chloride (KCl)/disodium (T-4)-molybdate (MoO4(2-))
  6327. potassium chloride (KCl)/disulfuric acid
  6328. potassium chloride (KCl)/ethanamine
  6329. potassium chloride (KCl)/formamide
  6330. potassium chloride (KCl)/hydrochloric acid
  6331. potassium chloride (KCl)/hydrogen peroxide (H2O2)
  6332. potassium chloride (KCl)/hydroxylamine
  6333. potassium chloride (KCl)/iodine chloride (ICl)
  6334. potassium chloride (KCl)/iron chloride (FeCl2)
  6335. potassium chloride (KCl)/iron chloride (FeCl3)
  6336. potassium chloride (KCl)/lead chloride (PbCl2)
  6337. potassium chloride (KCl)/lead(2+) (T-4)-tungstate (WO4(2-)) (1:1)
  6338. potassium chloride (KCl)/lithium bromide (LiBr)
  6339. potassium chloride (KCl)/lithium chloride (LiCl)
  6340. potassium chloride (KCl)/lithium fluoride (LiF)
  6341. potassium chloride (KCl)/magnesium chloride (MgCl2)
  6342. potassium chloride (KCl)/magnesium fluoride (MgF2)
  6343. potassium chloride (KCl)/manganese chloride (MnCl2)
  6344. potassium chloride (KCl)/manganese fluoride (MnF2)
  6345. potassium chloride (KCl)/mercury chloride (HgCl2)
  6346. potassium chloride (KCl)/metaphosphoric acid (HPO3) potassium salt
  6347. potassium chloride (KCl)/N-methylacetamide
  6348. potassium chloride (KCl)/naphthalene
  6349. potassium chloride (KCl)/nickel chloride (NiCl2)
  6350. potassium chloride (KCl)/nitric acid lithium salt
  6351. potassium chloride (KCl)/nitric acid potassium salt
  6352. potassium chloride (KCl)/nitrobenzene
  6353. potassium chloride (KCl)/nitromethane
  6354. potassium chloride (KCl)/nitrous acid potassium salt
  6355. potassium chloride (KCl)/phosphoric acid monopotassium salt
  6356. potassium chloride (KCl)/phosphoric acid tripotassium salt
  6357. potassium chloride (KCl)/potassium bromide (KBr)
  6358. potassium chloride (KCl)/potassium fluoride (KF)
  6359. potassium chloride (KCl)/potassium iodide (KI)
  6360. potassium chloride (KCl)/rubidium chloride (RbCl)
  6361. potassium chloride (KCl)/seleninyl chloride
  6362. potassium chloride (KCl)/silver bromide (AgBr)
  6363. potassium chloride (KCl)/silver chloride (AgCl)
  6364. potassium chloride (KCl)/sodium bromide (NaBr)
  6365. potassium chloride (KCl)/sodium chloride (NaCl)
  6366. potassium chloride (KCl)/sodium fluoride (NaF)
  6367. potassium chloride (KCl)/sodium iodide (NaI)
  6368. potassium chloride (KCl)/sulfuric acid calcium salt (1:1)
  6369. potassium chloride (KCl)/sulfuric acid dipotassium salt
  6370. potassium chloride (KCl)/sulfuric acid dirubidium salt
  6371. potassium chloride (KCl)/sulfuric acid disodium salt
  6372. potassium chloride (KCl)/sulfuric acid zinc salt (1:1)
  6373. potassium chloride (KCl)/tantalum chloride (TaCl5)
  6374. potassium chloride (KCl)/thallium bromide (TlBr)
  6375. potassium chloride (KCl)/thallium chloride (TlCl)
  6376. potassium chloride (KCl)/thallium iodide (TlI)
  6377. potassium chloride (KCl)/tin chloride (SnCl2)
  6378. potassium chloride (KCl)/titanium chloride (TiCl3)
  6379. potassium chloride (KCl)/titanium chloride (TiCl4)
  6380. potassium chloride (KCl)/trichlorobismuthine
  6381. potassium chloride (KCl)/vanadium chloride (VCl3)
  6382. potassium chloride (KCl)/water
  6383. potassium chloride (KCl)/water-d2
  6384. potassium chloride (KCl)/zinc chloride (ZnCl2)
  6385. potassium cyanide (K(CN))/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)
  6386. potassium cyanide (K(CN))/1,2,3-propanetriol
  6387. potassium cyanide (K(CN))/2-methyl-2-propanol
  6388. potassium cyanide (K(CN))/2-propanone
  6389. potassium cyanide (K(CN))/acetamide
  6390. potassium cyanide (K(CN))/acetonitrile
  6391. potassium cyanide (K(CN))/ammonia
  6392. potassium cyanide (K(CN))/carbon disulfide
  6393. potassium cyanide (K(CN))/copper cyanide (Cu(CN))
  6394. potassium cyanide (K(CN))/ethanol
  6395. potassium cyanide (K(CN))/formamide
  6396. potassium cyanide (K(CN))/hydrocyanic acid
  6397. potassium cyanide (K(CN))/hydroxylamine
  6398. potassium cyanide (K(CN))/methanol
  6399. potassium cyanide (K(CN))/N,N-dimethylformamide
  6400. potassium cyanide (K(CN))/potassium chloride (KCl)
  6401. potassium cyanide (K(CN))/potassium iodide (KI)
  6402. potassium cyanide (K(CN))/silver cyanide (Ag(CN))
  6403. potassium cyanide (K(CN))/sulfinylbismethane
  6404. potassium cyanide (K(CN))/sulfur dioxide
  6405. potassium cyanide (K(CN))/tetramethylurea
  6406. potassium cyanide (K(CN))/water
  6407. potassium cyanide (K(CN))/zinc cyanide (Zn(CN)2)
  6408. potassium diamminetetrakis(nitrito-N)cobaltate(1-)/2-propanone
  6409. potassium diamminetetrakis(nitrito-N)cobaltate(1-)/methanol
  6410. potassium diamminetetrakis(nitrito-N)cobaltate(1-)/water
  6411. potassium dimethyl phosphate/water
  6412. potassium ethyl sulfate/methanol
  6413. potassium ethyl sulfate/water
  6414. potassium ethyl sulfate/water
  6415. potassium ethyl sulfate/water
  6416. potassium fluoride (KF)/1,3-dioxolan-2-one
  6417. potassium fluoride (KF)/cadmium fluoride (CdF2)
  6418. potassium fluoride (KF)/calcium fluoride (CaF2)
  6419. potassium fluoride (KF)/dipotassium (T-4)-tungstate (WO4(2-))
  6420. potassium fluoride (KF)/dipotassium germanate (GeO3(2-))
  6421. potassium fluoride (KF)/lithium fluoride (LiF)
  6422. potassium fluoride (KF)/metaphosphoric acid (HPO3) potassium salt
  6423. potassium fluoride (KF)/N-methylacetamide
  6424. potassium fluoride hexafluorosilicate(2-) (3:1:1)/sodium fluoride (NaF)
  6425. potassium hexafluorophosphate(1-)/1,3-dioxolan-2-one
  6426. potassium hexafluorophosphate(1-)/acetic acid
  6427. potassium hexafluorophosphate(1-)/acetonitrile
  6428. potassium hexafluorophosphate(1-)/hydrofluoric acid
  6429. potassium hexafluorophosphate(1-)/water
  6430. potassium hexaiodotellurate(IV)/rubidium hexaiodotellurate(IV)
  6431. potassium hydroxide (K(OD))/water-d2
  6432. potassium hydroxide (K(OH)) monohydrate/water
  6433. potassium hydroxide (K(OH))/1-butanol
  6434. potassium hydroxide (K(OH))/2-methyl-1-propanol
  6435. potassium hydroxide (K(OH))/2-methyl-2-propanol
  6436. potassium hydroxide (K(OH))/barium hydroxide (Ba(OH)2)
  6437. potassium hydroxide (K(OH))/carbonic acid dilithium salt
  6438. potassium hydroxide (K(OH))/carbonic acid dipotassium salt
  6439. potassium hydroxide (K(OH))/cesium hydroxide (Cs(OH))
  6440. potassium hydroxide (K(OH))/chromic acid (H2CrO4) dipotassium salt
  6441. potassium hydroxide (K(OH))/ethanol
  6442. potassium hydroxide (K(OH))/hexahydro-1-methyl-2H-azepin-2-one
  6443. potassium hydroxide (K(OH))/lithium hydroxide (Li(OH))
  6444. potassium hydroxide (K(OH))/methanol
  6445. potassium hydroxide (K(OH))/N,N-dimethylformamide
  6446. potassium hydroxide (K(OH))/nitric acid potassium salt
  6447. potassium hydroxide (K(OH))/nitric acid sodium salt
  6448. potassium hydroxide (K(OH))/nitrous acid potassium salt
  6449. potassium hydroxide (K(OH))/potassium
  6450. potassium hydroxide (K(OH))/potassium bromide (KBr)
  6451. potassium hydroxide (K(OH))/potassium hydride (KH)
  6452. potassium hydroxide (K(OH))/potassium iodide (KI)
  6453. potassium hydroxide (K(OH))/potassium tetrahydroborate(1-)
  6454. potassium hydroxide (K(OH))/rubidium hydroxide (Rb(OH))
  6455. potassium hydroxide (K(OH))/sodium hydroxide (Na(OH))
  6456. potassium hydroxide (K(OH))/sulfuric acid dipotassium salt
  6457. potassium hydroxide (K(OH))/water
  6458. potassium iodide (K(I3))/sulfinylbismethane
  6459. potassium iodide (KI)/(T-4)-tellurium iodide (TeI4)
  6460. potassium iodide (KI)/1,3-dioxolan-2-one
  6461. potassium iodide (KI)/1-methyl-2-pyrrolidinone
  6462. potassium iodide (KI)/1-phenylethanone
  6463. potassium iodide (KI)/2-butanol
  6464. potassium iodide (KI)/2-butanone
  6465. potassium iodide (KI)/2-furancarboxaldehyde
  6466. potassium iodide (KI)/2-hydroxybenzaldehyde
  6467. potassium iodide (KI)/2-methyl-1-propanol
  6468. potassium iodide (KI)/2-methylpropanenitrile
  6469. potassium iodide (KI)/4-(hydroxymethyl)-1,3-dioxolan-2-one
  6470. potassium iodide (KI)/aluminum iodide (AlI3)
  6471. potassium iodide (KI)/cadmium bromide (CdBr2)
  6472. potassium iodide (KI)/cadmium iodide (CdI2)
  6473. potassium iodide (KI)/cesium iodide (CsI)
  6474. potassium iodide (KI)/dichloroacetic acid
  6475. potassium iodide (KI)/dihydro-2(3H)-furanone
  6476. potassium iodide (KI)/dipotassium (T-4)-tungstate (WO4(2-))
  6477. potassium iodide (KI)/hydroxylamine
  6478. potassium iodide (KI)/iodic acid (HIO3) potassium salt
  6479. potassium iodide (KI)/lead chloride (PbCl2)
  6480. potassium iodide (KI)/lithium fluoride (LiF)
  6481. potassium iodide (KI)/mercury iodide (HgI2)
  6482. potassium iodide (KI)/N-methylacetamide
  6483. potassium iodide (KI)/nitrobenzene
  6484. potassium iodide (KI)/potassium bromide (KBr)
  6485. potassium iodide (KI)/potassium fluoride (KF)
  6486. potassium iodide (KI)/rubidium iodide (RbI)
  6487. potassium iodide (KI)/silver bromide (AgBr)
  6488. potassium iodide (KI)/silver iodide (AgI)
  6489. potassium iodide (KI)/sodium fluoride (NaF)
  6490. potassium iodide (KI)/sodium iodide (NaI)
  6491. potassium iodide (KI)/sulfuric acid zinc salt (1:1)
  6492. potassium iodide (KI)/tetrahydro-3-methylthiophene 1,1-dioxide
  6493. potassium iodide (KI)/thallium chloride (TlCl)
  6494. potassium iodide (KI)/thallium iodide (TlI)
  6495. potassium iodide (KI)/water
  6496. potassium iodide (KI)/water-d2
  6497. potassium ion (K(1+))/methanol
  6498. Potassium isocyanate/4-(hydroxymethyl)-1,3-dioxolan-2-one
  6499. Potassium isocyanate/ammonia
  6500. Potassium isocyanate/benzene
  6501. Potassium isocyanate/ethanol
  6502. Potassium isocyanate/formamide
  6503. Potassium isocyanate/hydrocyanic acid
  6504. Potassium isocyanate/N,N-dimethylformamide
  6505. Potassium isocyanate/tetramethylurea
  6506. Potassium isocyanate/water
  6507. Potassium methanesulfonate/water
  6508. potassium methyl sulfate/water
  6509. potassium mu-fluorotetrafluorodiberyllate(1-)/potassium (T-4)-tetrafluoroaluminate(1-)
  6510. potassium mu-fluorotetrafluorodiberyllate(1-)/tripotassium (OC-6-11)-hexafluoroaluminate(3-)
  6511. potassium niobate(NbO3(1-))/dipotassium (T-4)-molybdate (MoO4(2-))
  6512. potassium niobate(NbO3(1-))/dipotassium (T-4)-tungstate (WO4(2-))
  6513. potassium niobate(NbO3(1-))/magnesium potassium trifluoride
  6514. potassium niobate(NbO3(1-))/potassium trifluoromanganate(1-)
  6515. potassium niobate(NbO3(1-))/water
  6516. potassium oxide (K2O)/boron oxide (B2O3)
  6517. potassium oxide (K2O)/germanium oxide (GeO2)
  6518. potassium oxide (K2O)/niobium oxide (Nb2O5)
  6519. potassium oxide (K2O)/potassium
  6520. potassium oxide (K2O)/quartz (SiO2)
  6521. potassium oxide (K2O)/silica
  6522. potassium oxide (K2O)/sodium oxide (Na2O)
  6523. potassium oxide (K2O)/titanium oxide (TiO2)
  6524. potassium oxide (K2O)/tungsten oxide (WO3)
  6525. potassium oxide (K2O)/vanadium oxide (V2O5)
  6526. potassium oxide (K2O)/water
  6527. potassium oxide (K2O)/zinc metaphosphate
  6528. potassium pentafluorozirconate(1-)/water
  6529. potassium pyrrolidone/2-pyrrolidinone
  6530. potassium selenide (K2Se)/antimony selenide (Sb2Se3)
  6531. potassium sulfide (K(SH))/water
  6532. potassium sulfide (K2S)/antimony sulfide (Sb2S3)
  6533. potassium sulfide (K2S)/carbonic acid dilithium salt
  6534. potassium sulfide (K2S)/carbonic acid dipotassium salt
  6535. potassium sulfide (K2S)/potassium
  6536. potassium sulfide (K2S)/sulfuric acid dipotassium salt
  6537. potassium sulfide (K2S)/water
  6538. potassium sulfinylbismethane ion(1-)/sulfinylbismethane
  6539. potassium superoxide (K(O2))/carbonic acid dipotassium salt
  6540. potassium tantalate(TaO3(1-))/water
  6541. potassium tetrachlorooxoniobate(1-)/aluminum chloride (AlCl3)
  6542. potassium tetrachlorooxoniobate(1-)/potassium (OC-6-11)-hexachloroniobate(1-)
  6543. potassium tetrachlorooxoniobate(1-)/potassium (OC-6-11)-hexachlorotantalate(1-)
  6544. potassium tetrachlorooxoniobate(1-)/sodium tetrachlorooxoniobate(1-)
  6545. potassium tetrachlorooxotantalate(1-)/potassium chloride (KCl)
  6546. potassium tetrafluoroborate(1-)/1,3-dioxolan-2-one
  6547. potassium tetrafluoroborate(1-)/acetonitrile
  6548. potassium tetrafluoroborate(1-)/cesium tetrafluoroborate(1-)
  6549. potassium tetrafluoroborate(1-)/dipotassium (OC-6-11)-hexafluorotitanate(2-)
  6550. potassium tetrafluoroborate(1-)/dipotassium (OC-6-11)-hexafluorozirconate(2-)
  6551. potassium tetrafluoroborate(1-)/hydrofluoric acid
  6552. potassium tetrafluoroborate(1-)/nitromethane
  6553. potassium tetrafluoroborate(1-)/potassium fluoride (KF)
  6554. potassium tetrafluoroborate(1-)/sodium fluoride (NaF)
  6555. potassium tetrafluoroborate(1-)/trifluoroiodomethane
  6556. potassium tetrafluoroborate(1-)/water
  6557. potassium tetrahydroborate(1-)/1-butanol
  6558. potassium tetrahydroborate(1-)/N,N-dimethylformamide
  6559. potassium tetrahydroborate(1-)/nitromethane
  6560. potassium tetrahydroborate(1-)/potassium chloride (KCl)
  6561. potassium tetrahydroborate(1-)/potassium fluoride (KF)
  6562. potassium tetrahydroborate(1-)/sodium tetrahydroborate(1-)
  6563. potassium tetrahydroborate(1-)/water
  6564. potassium tetraphenylborate(1-)/1,1'-oxybisethane
  6565. potassium tetraphenylborate(1-)/1,3-dimethyl-2-imidazolidinone
  6566. potassium tetraphenylborate(1-)/1-butanol
  6567. potassium tetraphenylborate(1-)/1-methyl-2-pyrrolidinone
  6568. potassium tetraphenylborate(1-)/1-pentanol
  6569. potassium tetraphenylborate(1-)/1-propanol
  6570. potassium tetraphenylborate(1-)/2-butanone
  6571. potassium tetraphenylborate(1-)/2-methyl-2-propanol
  6572. potassium tetraphenylborate(1-)/2-methylpyridine 1-oxide
  6573. potassium tetraphenylborate(1-)/2-propanone
  6574. potassium tetraphenylborate(1-)/3-methylsydnone
  6575. potassium tetraphenylborate(1-)/acetonitrile
  6576. potassium tetraphenylborate(1-)/dichloromethane
  6577. potassium tetraphenylborate(1-)/ethanol
  6578. potassium tetraphenylborate(1-)/formamide
  6579. potassium tetraphenylborate(1-)/hexamethylphosphoric triamide
  6580. potassium tetraphenylborate(1-)/methanol
  6581. potassium tetraphenylborate(1-)/N,N-dimethylformamide
  6582. potassium tetraphenylborate(1-)/nitrobenzene
  6583. potassium tetraphenylborate(1-)/nitromethane
  6584. potassium tetraphenylborate(1-)/sulfinylbismethane
  6585. potassium tetraphenylborate(1-)/tetrahydro-1,3-dimethyl-2(1H)-pyrimidinone
  6586. potassium tetraphenylborate(1-)/tetrahydro-3-methylthiophene 1,1-dioxide
  6587. potassium tetraphenylborate(1-)/tetramethylurea
  6588. potassium tetraphenylborate(1-)/water
  6589. potassium titanium oxide (K2TiO3)/chromic acid (H2CrO4) dipotassium salt
  6590. potassium titanium oxide (K2TiO3)/dilithium titanate (TiO3(2-))
  6591. potassium titanium oxide (K2TiO3)/dipotassium (T-4)-molybdate (MoO4(2-))
  6592. potassium titanium oxide (K2TiO3)/dipotassium (T-4)-tungstate (WO4(2-))
  6593. potassium titanium oxide (K2TiO3)/disodium titanate (Na2TiO3)
  6594. potassium titanium oxide (K2TiO3)/lead titanium oxide (PbTiO3)
  6595. potassium titanium oxide (K2TiO3)/lithium fluoride (LiF)
  6596. potassium titanium oxide (K2TiO3)/potassium chloride (KCl)
  6597. potassium titanium oxide (K2TiO3)/potassium fluoride (KF)
  6598. potassium titanium oxide (K2TiO3)/sodium fluoride (NaF)
  6599. potassium titanium oxide (K2TiO3)/sulfuric acid dipotassium salt
  6600. potassium titanium oxide (K2TiO3)/titanium oxide (TiO2)
  6601. potassium trans-((1,2-cyclohexylenedinitrilo)tetraacetato)cobaltate(1-)/water
  6602. potassium tribromocadmate(1-)/cesium tribromocadmate(1-)
  6603. potassium tribromocadmate(1-)/rubidium tribromocadmate(1-)
  6604. potassium tribromocadmate(1-)/water
  6605. potassium trichlorocadmate(1-)/water
  6606. potassium trichlorocalciate(1-)/chromic acid (H2CrO4) calcium salt (1:1)
  6607. potassium trichlorocuprate(1-)/water
  6608. potassium trichloromagnesate(1-) dihydrate/water
  6609. potassium trichloromagnesate(1-) hexahydrate/water
  6610. potassium trichloromagnesate(1-)/lithium chloride (LiCl)
  6611. potassium trichloromagnesate(1-)/water
  6612. potassium trichlorostannate(1-)/water
  6613. potassium trifluoroberyllate(1-)/metaphosphoric acid (HPO3) potassium salt
  6614. potassium trifluorocadmate(1-)/lithium trifluoroborate(1-)
  6615. potassium trifluorocalciate(1-)/lithium trifluoroborate(1-)
  6616. potassium trifluorocalciate(1-)/magnesium potassium trifluoride
  6617. potassium trifluorocobaltate(1-)/lithium trifluoroborate(1-)
  6618. potassium trifluoromanganate(1-)/cesium trifluoromanganate(1-)
  6619. potassium trifluoromanganate(1-)/lithium fluoride (LiF)
  6620. potassium trifluoromanganate(1-)/lithium trifluoroborate(1-)
  6621. potassium trifluoromanganate(1-)/potassium chloride (KCl)
  6622. potassium trifluoromanganate(1-)/rubidium trifluoromanganate(1-)
  6623. potassium trifluoromanganate(1-)/sodium chloride (NaCl)
  6624. potassium trifluoromanganate(1-)/sodium trifluoromanganate(1-)
  6625. potassium trifluoromethanesulfonate/2-propanol
  6626. potassium trifluoromethanesulfonate/acetonitrile
  6627. potassium trifluoromethanesulfonate/dihydro-2(3H)-furanone
  6628. potassium trifluoromethanesulfonate/formamide
  6629. potassium trifluoromethanesulfonate/N,N-dimethylformamide
  6630. potassium trifluoromethanesulfonate/water
  6631. potassium trifluoronickelate(1-)/lithium trifluoroborate(1-)
  6632. potassium trifluorozincate(1-)/lithium trifluoroborate(1-)
  6633. potassium triiodomercurate(1-)/almond oils
  6634. potassium vanadate (VO3(1-))/calcium metavanadate
  6635. potassium vanadate (VO3(1-))/calcium vanadate (VO3(1-))
  6636. potassium vanadate (VO3(1-))/cesium vanadate (VO3(1-))
  6637. potassium vanadate (VO3(1-))/chromic acid (H2CrO4) dipotassium salt
  6638. potassium vanadate (VO3(1-))/diphosphoric acid tetrapotassium salt
  6639. potassium vanadate (VO3(1-))/dipotassium (T-4)-tungstate (WO4(2-))
  6640. potassium vanadate (VO3(1-))/metaphosphoric acid (HPO3) potassium salt
  6641. potassium vanadate (VO3(1-))/phosphoric acid tripotassium salt
  6642. potassium vanadate (VO3(1-))/potassium bromide (KBr)
  6643. potassium vanadate (VO3(1-))/potassium chloride (KCl)
  6644. potassium vanadate (VO3(1-))/potassium fluoride (KF)
  6645. potassium vanadate (VO3(1-))/silver bromide (AgBr)
  6646. potassium vanadate (VO3(1-))/silver chloride (AgCl)
  6647. potassium vanadate (VO3(1-))/sodium chloride (NaCl)
  6648. potassium vanadate (VO3(1-))/sodium fluoride (NaF)
  6649. potassium vanadate (VO3(1-))/sulfuric acid dipotassium salt
  6650. potassium vanadate (VO3(1-))/water
  6651. potassium/ammonia
  6652. potassium/argon
  6653. potassium/arsenic
  6654. potassium/cadmium
  6655. potassium/cesium
  6656. potassium/gallium
  6657. potassium/gold
  6658. potassium/helium
  6659. potassium/indium
  6660. potassium/potassium bromide (KBr)
  6661. potassium/potassium chloride (KCl)
  6662. potassium/potassium fluoride (KF)
  6663. potassium/potassium iodide (KI)
  6664. potassium/rubidium
  6665. potassium/selenium
  6666. potassium/sodium
  6667. potassium/sulfur
  6668. potassium/thallium
  6669. potassium/tungsten
  6670. potassium/vanadium
  6671. praseodymium bromide (PrBr3)/cesium bromide (CsBr)
  6672. praseodymium bromide (PrBr3)/lithium bromide (LiBr)
  6673. praseodymium bromide (PrBr3)/methanol
  6674. praseodymium bromide (PrBr3)/potassium bromide (KBr)
  6675. praseodymium bromide (PrBr3)/rubidium bromide (RbBr)
  6676. praseodymium bromide (PrBr3)/sodium bromide (NaBr)
  6677. praseodymium bromide (PrBr3)/water
  6678. praseodymium chloride (PrCl3) heptahydrate/water
  6679. praseodymium chloride (PrCl3) hexahydrate/water
  6680. praseodymium chloride (PrCl3) monohydrate/water
  6681. praseodymium chloride (PrCl3) trihydrate/water
  6682. praseodymium chloride (PrCl3)/1-butanol
  6683. praseodymium chloride (PrCl3)/1-pentanol
  6684. praseodymium chloride (PrCl3)/1-propanol
  6685. praseodymium chloride (PrCl3)/cerium chloride (CeCl3)
  6686. praseodymium chloride (PrCl3)/cesium chloride (CsCl)
  6687. praseodymium chloride (PrCl3)/ethanol
  6688. praseodymium chloride (PrCl3)/iron chloride (FeCl2)
  6689. praseodymium chloride (PrCl3)/lithium chloride (LiCl)
  6690. praseodymium chloride (PrCl3)/magnesium chloride (MgCl2)
  6691. praseodymium chloride (PrCl3)/manganese chloride (MnCl2)
  6692. praseodymium chloride (PrCl3)/methanol
  6693. praseodymium chloride (PrCl3)/phosphoric acid tributyl ester
  6694. praseodymium chloride (PrCl3)/potassium chloride (KCl)
  6695. praseodymium chloride (PrCl3)/pyridine
  6696. praseodymium chloride (PrCl3)/rubidium chloride (RbCl)
  6697. praseodymium chloride (PrCl3)/sodium chloride (NaCl)
  6698. praseodymium chloride (PrCl3)/strontium chloride (SrCl2)
  6699. praseodymium chloride (PrCl3)/water
  6700. praseodymium fluoride (PrF3)/(OC-6-11)-uranium fluoride (UF6)
  6701. praseodymium fluoride (PrF3)/1-methoxydecane
  6702. praseodymium fluoride (PrF3)/barium fluoride (BaF2)
  6703. praseodymium fluoride (PrF3)/calcium fluoride (CaF2)
  6704. praseodymium fluoride (PrF3)/hydrofluoric acid
  6705. praseodymium fluoride (PrF3)/lithium fluoride (LiF)
  6706. praseodymium fluoride (PrF3)/potassium fluoride (KF)
  6707. praseodymium fluoride (PrF3)/sodium fluoride (NaF)
  6708. praseodymium fluoride (PrF3)/strontium fluoride (SrF2)
  6709. praseodymium fluoride (PrF3)/water
  6710. praseodymium iodide (PrI3)/water
  6711. praseodymium oxide (Pr2O3)/hafnium oxide (HfO2)
  6712. praseodymium sulfide (Pr2S3)/mangansulfid (MnS)
  6713. praseodymium(+3) cation phosphate/water
  6714. praseodymium(III) ethylsulfate/water
  6715. praseodymium/indium
  6716. praseodymium/selenium
  6717. praseodymium/thorium
  6718. prazosin/water
  6719. pregabalin/2-propanol
  6720. pregabalin/methanol
  6721. pregabalin/water
  6722. pregn-4-ene-3,20-dione/1-butanol
  6723. pregn-4-ene-3,20-dione/1-propanol
  6724. pregn-4-ene-3,20-dione/2-propanol
  6725. pregn-4-ene-3,20-dione/2-propanone
  6726. pregn-4-ene-3,20-dione/acetonitrile
  6727. pregn-4-ene-3,20-dione/ethanol
  6728. pregn-4-ene-3,20-dione/ethanol
  6729. pregn-4-ene-3,20-dione/methanol
  6730. pregn-4-ene-3,20-dione/propane
  6731. pregn-4-ene-3,20-dione/water
  6732. promethium fluoride (PmF3)/barium fluoride (BaF2)
  6733. promethium fluoride (PmF3)/calcium fluoride (CaF2)
  6734. promethium fluoride (PmF3)/sodium fluoride (NaF)
  6735. promethium fluoride (PmF3)/strontium fluoride (SrF2)
  6736. propafenone Hydrochloride/bis[(2RS)-1-[4-(2-methoxyethyl)phenoxy]-3-[(1-methylethyl)amino]propane-2-ol](2R,3R)-2,3-dihydroxybutanedioate
  6737. propanal oxime/2-butanone oxime
  6738. propanal/α-methyl-ω-methoxypoly(oxy-1,2-ethanediyl)
  6739. propanal/±-2-pentanol
  6740. propanal/1,1-dichloroethane
  6741. propanal/1,2-dichloropropane
  6742. propanal/1,3-dimethoxy-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  6743. propanal/1,4-dioxane
  6744. propanal/1-(2-hydroxyethyl)-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  6745. propanal/1-(2-hydroxyethyl)-3-methyl-1H-imidazolium trifluorotris(1,1,2,2,2-pentafluoroethyl)phosphate(1-)
  6746. propanal/1-(3-cyanopropyl)-3-methyl-1H-imidazolium salt with cyanocyanamide (1:1)
  6747. propanal/1-butanol
  6748. propanal/1-butyl-1-methylpyrrolidinium salt with cyanocyanamide (1:1)
  6749. propanal/1-butyl-3-methyl-1H-imidazolium hexafluorophosphate(1-)
  6750. propanal/1-butyl-3-methyl-1H-imidazolium salt with 1,1,1,2,2-pentafluoro-N-((pentafluoroethyl)sulfonyl)ethanesulfonamide (1:1)
  6751. propanal/1-butyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  6752. propanal/1-butyl-3-methyl-1H-imidazolium tetrafluoroborate(1-)
  6753. propanal/1-ethyl-3-methyl-1H-imidazol-3-ium trifluorotris(1,1,2,2,2-pentafluoroethyl)phosphate(1-) (1:1)
  6754. propanal/1-ethyl-3-methyl-1H-imidazolium salt with cyanocyanamide (1:1)
  6755. propanal/1-ethyl-3-methyl-1H-imidazolium salt with methanesulfonic acid
  6756. propanal/1-ethyl-3-methyl-1H-imidazolium salt with sulfuric acid monoethyl ester (1:1)
  6757. propanal/1-hexyl-1,4-diaza[2.2.2]-bicyclooctanium bis(trifluoromethylsulfonyl)imide
  6758. propanal/1-hexyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  6759. propanal/1-hexyl-3-methyl-1H-imidazolium trifluorotris(1,1,2,2,2-pentafluoroethyl)phosphate(1-) (1:1)
  6760. propanal/1-methyl-3-octyl-1H-imidazolium tetrafluoroborate(1-)
  6761. propanal/1-propanol
  6762. propanal/2,3,4-trimethylpentane
  6763. propanal/2-butanol
  6764. propanal/2-butanone
  6765. propanal/2-methyl-1,3-butadiene
  6766. propanal/2-methyl-1-propanol
  6767. propanal/2-methyl-2-butanol
  6768. propanal/2-methyl-2-propanol
  6769. propanal/2-methylfuran
  6770. propanal/2-propanol
  6771. propanal/2-propanone
  6772. propanal/3-methyl-2-butanone
  6773. propanal/4-(Ethoxymethyl)-2-ethyl-1,3-dioxolane
  6774. propanal/acetic acid ethyl ester
  6775. propanal/acetic acid methyl ester
  6776. propanal/air
  6777. propanal/benzene
  6778. propanal/bromoethane
  6779. propanal/carbon dioxide
  6780. propanal/carbon disulfide
  6781. propanal/decane
  6782. propanal/dichloromethane
  6783. propanal/ethane
  6784. propanal/ethanol
  6785. propanal/ethene
  6786. propanal/ethyne
  6787. propanal/formamide
  6788. propanal/heptane
  6789. propanal/hexadecane
  6790. propanal/hydrogen
  6791. propanal/methane
  6792. propanal/methanethiol
  6793. propanal/methanol
  6794. propanal/methyloxirane
  6795. propanal/N,N,N-tributyl-1-hexanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  6796. propanal/N,N,N-trimethyl-1-butanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  6797. propanal/N,N,N-trimethyl-1-decanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  6798. propanal/N,N,N-trimethyl-1-hexanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  6799. propanal/N,N,N-trimethyl-1-octanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  6800. propanal/N,N,N-trioctyl-1-octanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  6801. propanal/N,N-dibutyl-N-methyl-1-butanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  6802. propanal/N-ethyl-N-methylmorpholinium bis(trifluoromethylsulfonyl)imide
  6803. propanal/N-methyl-N,N-dioctyl-1-octanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  6804. propanal/N-methyl-N-octylmorpholinium bis(trifluoromethylsulfonyl)imide
  6805. propanal/n-tetracosane
  6806. propanal/nitrogen
  6807. propanal/nitrous acid 1-methylethyl ester
  6808. propanal/nitrous acid propyl ester
  6809. propanal/octadecane
  6810. propanal/oxirane
  6811. propanal/oxygen
  6812. propanal/perchloric acid lithium salt
  6813. propanal/propanoic acid
  6814. propanal/sea water
  6815. propanal/tetrachloromethane
  6816. propanal/tributylhexylammonium hexafluorophosphate
  6817. propanal/tributylhexylphosphonium bis(trifluoromethylsulfonyl)imide
  6818. propanal/trichloromethane
  6819. propanal/trihexyltetradecylphosphonium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  6820. propanal/trioctylmethylphosphonium bis(trifluoromethylsulfonyl)imide
  6821. propanal/tris(1-methoxy-2-methyl-3-octylimidazolium)propane tri(bis(trifluoromethylsulfonyl)imide)
  6822. propanal/tris(1-methoxy-2-methyl-3-octylimidazolium)propane tri(tetrafluoroborate)
  6823. propanal/tris(1-methoxy-3-benzylimidazolium)propane tri(bis(trifluoromethylsulfonyl)imide)
  6824. propanal/tris(1-methoxy-3-methylimidazolium)propane tri(bis(trifluoromethylsulfonyl)imide)
  6825. propanal/tris(1-methoxy-3-methylimidazolium)propane tri(dicyanamide)
  6826. propanal/tris(1-methoxy-4-dimethylaminepyridinium)propane tri(bis(trifluoromethylsulfonyl)imide)
  6827. propanal/water
  6828. propanal/water-d2
  6829. propanal/xenon isotope of mass 133
  6830. propanamide/α,α,4-trimethyl-3-cyclohexene-1-methanol
  6831. propanamide/(1-methylethyl)benzene
  6832. propanamide/(R)-5-methyl-2-(1-methylethylidene)cyclohexanone
  6833. propanamide/1,1'-biphenyl
  6834. propanamide/1,1,2,2-tetrachloroethane
  6835. propanamide/1,2-benzenediamine
  6836. propanamide/1,2-dichlorobenzene
  6837. propanamide/1,2-dihydroacenaphthylene
  6838. propanamide/1,2-dimethoxy-4-(1-propenyl)benzene
  6839. propanamide/1,2-dimethoxy-4-(2-propenyl)benzene
  6840. propanamide/1,2-dimethylbenzene
  6841. propanamide/1-bromo-2-methylbenzene
  6842. propanamide/1-bromonaphthalene
  6843. propanamide/1-chloro-2-methylbenzene
  6844. propanamide/1-chloro-2-nitrobenzene
  6845. propanamide/1-chloronaphthalene
  6846. propanamide/1-methyl-2-nitrobenzene
  6847. propanamide/1-methyl-3-nitrobenzene
  6848. propanamide/1-methyl-4-(1-methylethyl)-1,3-cyclohexadiene
  6849. propanamide/1-methyl-4-(1-methylethyl)benzene
  6850. propanamide/1-methyl-4-nitrobenzene
  6851. propanamide/1-methylnaphthalene
  6852. propanamide/1-phenyl-1-propanone
  6853. propanamide/1-phenylethanone
  6854. propanamide/1H-indene
  6855. propanamide/2,2-dimethyl-3-methylenebicyclo[2.2.1]heptane
  6856. propanamide/2,3-dimethylbenzenamine
  6857. propanamide/2,4-dimethylbenzenamine
  6858. propanamide/2,6,6-trimethylbicyclo[3.1.1]hept-2-ene
  6859. propanamide/2-bromophenol
  6860. propanamide/2-ethoxybenzenamine
  6861. propanamide/2-furanmethanol
  6862. propanamide/2-hydroxybenzoic acid 3-methylbutyl ester
  6863. propanamide/2-methoxy-4-(2-propenyl)phenol
  6864. propanamide/2-methoxyphenol
  6865. propanamide/2-methyl-5-(1-methylethenyl)-2-cyclohexen-1-one
  6866. propanamide/2-methylbenzenamine
  6867. propanamide/2-methylnaphthalene
  6868. propanamide/2-methylphenol
  6869. propanamide/2-methylquinoline
  6870. propanamide/2-nitrophenol
  6871. propanamide/3,4-dimethylphenol
  6872. propanamide/3-methyl-1-butanol benzoate
  6873. propanamide/5-(2-propenyl)-1,3-benzodioxole
  6874. propanamide/5-methyl-2-(1-methylethyl)cyclohexanol
  6875. propanamide/5-methyl-2-(1-methylethyl)phenol
  6876. propanamide/9H-fluorene
  6877. propanamide/benzoic acid ethyl ester
  6878. propanamide/benzoic acid methyl ester
  6879. propanamide/ethanedioic acid diethyl ester
  6880. propanamide/N,N,4-trimethylbenzenamine
  6881. propanamide/N,N-diethylbenzenamine
  6882. propanamide/naphthalene
  6883. propanamide/nitrobenzene
  6884. propanamide/quinoline
  6885. propane/(1-methylethyl)benzene
  6886. propane/(Z)-poly(1-butene-1,4-diyl)
  6887. propane/1,1'-(1,1,1,3,3,3-hexafluoro-2,2-propanediyl)bis{4-[(trifluoroethenyl)oxy]benzene} homopolymer
  6888. propane/1,1'-bicyclohexyl
  6889. propane/1,1,1,2-tetrafluoroethane
  6890. propane/1,1,2-trichloro-1,2,2-trifluoroethane
  6891. propane/1,1-dichloroethane
  6892. propane/1,1-difluoroethane
  6893. propane/1,2,2,3-tetrafluoropropane
  6894. propane/1,2-dichloro-1,1,2,2-tetrafluoroethane
  6895. propane/1,2-dihydroacenaphthylene
  6896. propane/1,2-dimethylbenzene
  6897. propane/1,3-butadiene homopolymer
  6898. propane/1-butene homopolymer
  6899. propane/1-butyl-1H-imidazolium acetate
  6900. propane/1-chloronaphthalene
  6901. propane/1-methyl-2-pyrrolidinone
  6902. propane/1-methylnaphthalene
  6903. propane/1-phenylethanone
  6904. propane/1-propyne
  6905. propane/2,2-dimethylbutane
  6906. propane/2,3,3,3-tetrafluoro-1-propene
  6907. propane/2,3-dimethylbutane
  6908. propane/2-butanol
  6909. propane/2-butanone
  6910. propane/2-furancarboxaldehyde
  6911. propane/2-furanmethanol
  6912. propane/2-hexyne
  6913. propane/2-methyl-1-propanol
  6914. propane/2-methyl-1-propene homopolymer
  6915. propane/2-methyl-2-butanol
  6916. propane/2-methyl-2-propanethiol
  6917. propane/2-methyl-2-propanol
  6918. propane/2-methyl-2-propenoic acid butyl ester homopolymer
  6919. propane/2-methylbutane
  6920. propane/2-methylphenol
  6921. propane/2-methylpropanal
  6922. propane/2-methylpropane
  6923. propane/2-propanethiol
  6924. propane/2-propenoic acid 2-ethylhexyl ester homopolymer
  6925. propane/2-propenoic acid ethyl ester homopolymer
  6926. propane/2-propenoic acid isooctyl ester homopolymer
  6927. propane/2-propenoic acid methyl ester homopolymer
  6928. propane/3-methyl-3-buten-1-ol
  6929. propane/3-methylpentane
  6930. propane/9,10-dihydrophenanthrene
  6931. propane/9-methylanthracene
  6932. propane/9H-carbazole
  6933. propane/acetic acid ethenyl ester homopolymer
  6934. propane/acetonitrile
  6935. propane/ammonia
  6936. propane/argon
  6937. propane/athabasca bitumen
  6938. propane/bitumen
  6939. propane/Bitumen fraction of vaccum distillation (bitumen cut)
  6940. propane/carbon disulfide
  6941. propane/castor oil
  6942. propane/chlorodifluoromethane
  6943. propane/chloropentafluoroethane
  6944. propane/chlorotrifluoromethane
  6945. propane/cyclopentanol
  6946. propane/cyclopropane
  6947. propane/decahydronaphthalene
  6948. propane/dichlorodifluoromethane
  6949. propane/dichloromethane
  6950. propane/difluoromethane
  6951. propane/docosanoic acid methyl ester
  6952. propane/ethanethiol
  6953. propane/formamide
  6954. propane/formation brine
  6955. propane/Gasoline, heavy cut
  6956. propane/heavy crude oil
  6957. propane/helium
  6958. propane/hexacontane
  6959. propane/hexafluoroethane
  6960. propane/hydrocarbon blend
  6961. propane/hydrochloric acid
  6962. propane/hydrofluoric acid
  6963. propane/hydrogen sulfide (H2S)
  6964. propane/kerosene
  6965. propane/Kerosene A-3
  6966. propane/McKay River bitumen
  6967. propane/mercury
  6968. propane/naphthalene
  6969. propane/nitric acid
  6970. propane/nitrobenzene
  6971. propane/nitrogen
  6972. propane/octafluoropropane
  6973. propane/oxirane
  6974. propane/oxygen
  6975. propane/peace river bitumen
  6976. propane/phenanthrene
  6977. propane/phosphoric acid
  6978. propane/phosphoric acid triethyl ester
  6979. propane/poly(1-phenylethylene)
  6980. propane/poly(2-butoxyethyl acrylate)
  6981. propane/poly(2-chloro-1,3-butadiene)
  6982. propane/poly(isobornyl acrylate)
  6983. propane/poly(tetramethylene oxide)
  6984. propane/poly(vinyl stearate)
  6985. propane/polyester
  6986. propane/polyethylene
  6987. propane/Polyol ester POE ISO 22
  6988. propane/polypropylene
  6989. propane/poly[2-(2-ethoxyethoxy)ethyl acrylate]
  6990. propane/quinoline
  6991. propane/sea water
  6992. propane/soybean oil
  6993. propane/sulfur dioxide
  6994. propane/sulfuric acid
  6995. propane/sunflower oil
  6996. propane/tetrabutylphosphonium bis(2,4,4-trimethylpentyl)phosphinate
  6997. propane/tetrafluoromethane
  6998. propane/tetrahydro-2-furanmethanol
  6999. propane/thiobismethane
  7000. propane/Tributylethylphosphonium caproate
  7001. propane/Tributylethylphosphonium laurate
  7002. propane/Tributylethylphosphonium stearate
  7003. propane/triethylaluminum
  7004. propane/trifluoromethane
  7005. propane/trimethyloctylphosphonium bis(2,4,4-trimethylpentyl)phosphinate
  7006. propane/Unilin 550
  7007. propane/Unithox 550
  7008. propane/water
  7009. propane/water-d2
  7010. propane/white oil
  7011. propane/xenon
  7012. propanediamide/water
  7013. propanedinitrile/2-methyl-1,3-butadiene
  7014. propanedinitrile/2-methyl-2-butene
  7015. propanedinitrile/benzene
  7016. propanedinitrile/butanedinitrile
  7017. propanedinitrile/cyclohexane
  7018. propanedinitrile/hexane
  7019. propanedinitrile/pentanedinitrile
  7020. propanedinitrile/water
  7021. propanedioic acid barium salt/water
  7022. propanedioic acid calcium salt/water
  7023. propanedioic acid dibutyl ester/acetic acid ethenyl ester homopolymer
  7024. propanedioic acid dibutyl ester/acetic acid ethyl ester
  7025. propanedioic acid didecyl ester/1-butanol
  7026. propanedioic acid diethyl ester/±-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one
  7027. propanedioic acid diethyl ester/(1S,2R,4S)-2-chloro-1,7,7-trimethylbicyclo[2.2.1]heptane
  7028. propanedioic acid diethyl ester/(2E)-2-butenedioic acid dimethyl ester
  7029. propanedioic acid diethyl ester/(2Z)-2-butenedioic acid dimethyl ester
  7030. propanedioic acid diethyl ester/(4R)-1-methyl-4-(1-methylethenyl)cyclohexene
  7031. propanedioic acid diethyl ester/(dichloromethyl)benzene
  7032. propanedioic acid diethyl ester/(ethoxymethyl)benzene
  7033. propanedioic acid diethyl ester/1,1',1''-(methylidynetris(oxy))trisethane
  7034. propanedioic acid diethyl ester/1,1'-(methylenebis(oxy))bis(3-methylbutane)
  7035. propanedioic acid diethyl ester/1,2-dimethylbenzene
  7036. propanedioic acid diethyl ester/1,3,5-trichlorobenzene
  7037. propanedioic acid diethyl ester/1,3,5-trimethylbenzene
  7038. propanedioic acid diethyl ester/1,3-bis(1-methylethyl)benzene
  7039. propanedioic acid diethyl ester/1,3-butanediol diacetate
  7040. propanedioic acid diethyl ester/1,3-dimethoxybenzene
  7041. propanedioic acid diethyl ester/1,3-dimethylbenzene
  7042. propanedioic acid diethyl ester/1,4-dimethylbenzene
  7043. propanedioic acid diethyl ester/1,4-dioxane
  7044. propanedioic acid diethyl ester/1-butanol
  7045. propanedioic acid diethyl ester/1-butyl-3-methyl-1H-imidazolium salt with methanesulfonic acid
  7046. propanedioic acid diethyl ester/1-butyl-3-methylimidazolium salt with acetic acid (1:1)
  7047. propanedioic acid diethyl ester/1-iodo-4-methylbenzene
  7048. propanedioic acid diethyl ester/1-methyl-4-(1-methylethenyl)cyclohexene
  7049. propanedioic acid diethyl ester/1-methyl-4-(1-methylethyl)-1,3-cyclohexadiene
  7050. propanedioic acid diethyl ester/1-methyl-4-(1-methylethyl)benzene
  7051. propanedioic acid diethyl ester/1-octene
  7052. propanedioic acid diethyl ester/1-pentanol
  7053. propanedioic acid diethyl ester/1-phenylethanone
  7054. propanedioic acid diethyl ester/1-propanol
  7055. propanedioic acid diethyl ester/2,2-dimethyl-3-methylenebicyclo[2.2.1]heptane
  7056. propanedioic acid diethyl ester/2,5-furandione
  7057. propanedioic acid diethyl ester/2,6,6-trimethylbicyclo[3.1.1]hept-2-ene
  7058. propanedioic acid diethyl ester/2,6-dimethyl-2,5-heptadien-4-one
  7059. propanedioic acid diethyl ester/2-ethoxy-1,7,7-trimethylbicyclo[2.2.1]heptane
  7060. propanedioic acid diethyl ester/2-hydroxypropanoic acid 3-methylbutyl ester
  7061. propanedioic acid diethyl ester/2-methoxy-4-methyl-1-(1-methylethyl)benzene
  7062. propanedioic acid diethyl ester/2-methyl-1-propanol
  7063. propanedioic acid diethyl ester/2-propanol
  7064. propanedioic acid diethyl ester/2-propanone
  7065. propanedioic acid diethyl ester/3,7-dimethyl-1,6-octadien-3-ol
  7066. propanedioic acid diethyl ester/3-methylbutanoic acid 3-methylbutyl ester
  7067. propanedioic acid diethyl ester/3-pentanone
  7068. propanedioic acid diethyl ester/4-(1-methoxy-1-methylethyl)-1-methylcyclohexene
  7069. propanedioic acid diethyl ester/4-methylpentanoic acid
  7070. propanedioic acid diethyl ester/5-methyl-2-(1-methylethyl)cyclohexanol
  7071. propanedioic acid diethyl ester/6,6-dimethyl-2-methylenebicyclo[3.1.1]heptane
  7072. propanedioic acid diethyl ester/acetic acid
  7073. propanedioic acid diethyl ester/acetic acid ethyl ester
  7074. propanedioic acid diethyl ester/acetic acid phenyl ester
  7075. propanedioic acid diethyl ester/arsenic oxide (As2O3)
  7076. propanedioic acid diethyl ester/benzene
  7077. propanedioic acid diethyl ester/benzoic acid ethyl ester
  7078. propanedioic acid diethyl ester/benzoic acid methyl ester
  7079. propanedioic acid diethyl ester/butanedioic acid dimethyl ester
  7080. propanedioic acid diethyl ester/butanoic acid ethyl ester
  7081. propanedioic acid diethyl ester/carbamic acid ethyl ester
  7082. propanedioic acid diethyl ester/carbonic acid bis(2-methylpropyl) ester
  7083. propanedioic acid diethyl ester/chlorodifluoromethane
  7084. propanedioic acid diethyl ester/cyclohexane
  7085. propanedioic acid diethyl ester/cyclohexanone
  7086. propanedioic acid diethyl ester/cyclopentanone
  7087. propanedioic acid diethyl ester/dichlorofluoromethane
  7088. propanedioic acid diethyl ester/endo-2-ethoxy-1,7,7-trimethylbicyclo[2.2.1]heptane
  7089. propanedioic acid diethyl ester/ethanedioic acid dipropyl ester
  7090. propanedioic acid diethyl ester/ethanol
  7091. propanedioic acid diethyl ester/ethylcyclohexane
  7092. propanedioic acid diethyl ester/heptane
  7093. propanedioic acid diethyl ester/hexachloroethane
  7094. propanedioic acid diethyl ester/hexane
  7095. propanedioic acid diethyl ester/hexanoic acid
  7096. propanedioic acid diethyl ester/hydrogen
  7097. propanedioic acid diethyl ester/iodobenzene
  7098. propanedioic acid diethyl ester/methanol
  7099. propanedioic acid diethyl ester/methylcyclohexane
  7100. propanedioic acid diethyl ester/naphthalene
  7101. propanedioic acid diethyl ester/nitrobenzene
  7102. propanedioic acid diethyl ester/octane
  7103. propanedioic acid diethyl ester/octanoic acid methyl ester
  7104. propanedioic acid diethyl ester/poly(1-phenylethylene)
  7105. propanedioic acid diethyl ester/tetrachloromethane
  7106. propanedioic acid diethyl ester/tetrachlorostannane
  7107. propanedioic acid diethyl ester/trichloromethane
  7108. propanedioic acid diethyl ester/water
  7109. propanedioic acid dimethyl ester/(ethoxymethyl)benzene
  7110. propanedioic acid dimethyl ester/1,1'-oxybis(3-methylbutane)
  7111. propanedioic acid dimethyl ester/1,1'-oxybispentane
  7112. propanedioic acid dimethyl ester/1,1'-thiobisbutane
  7113. propanedioic acid dimethyl ester/1,2,4-trimethylbenzene
  7114. propanedioic acid dimethyl ester/1,2-dichlorobenzene
  7115. propanedioic acid dimethyl ester/1,2-dimethoxybenzene
  7116. propanedioic acid dimethyl ester/1,2-dimethylbenzene
  7117. propanedioic acid dimethyl ester/1,2-ethanediol diacetate
  7118. propanedioic acid dimethyl ester/1,3,3-trimethyl-2-oxabicyclo[2.2.2]octane
  7119. propanedioic acid dimethyl ester/1,3,5-trimethylbenzene
  7120. propanedioic acid dimethyl ester/1,3-dibromopropane
  7121. propanedioic acid dimethyl ester/1-bromo-2-methylbenzene
  7122. propanedioic acid dimethyl ester/1-bromo-3-methylbenzene
  7123. propanedioic acid dimethyl ester/1-bromohexane
  7124. propanedioic acid dimethyl ester/1-chloro-2-methylbenzene
  7125. propanedioic acid dimethyl ester/1-methyl-3-(1-methylethenyl)cyclohexane
  7126. propanedioic acid dimethyl ester/1-methyl-4-(1-methylethenyl)cyclohexene
  7127. propanedioic acid dimethyl ester/1-methyl-4-(1-methylethyl)-1,3-cyclohexadiene
  7128. propanedioic acid dimethyl ester/1-methyl-4-(1-methylethyl)-1,4-cyclohexadiene
  7129. propanedioic acid dimethyl ester/1-methyl-4-(1-methylethyl)benzene
  7130. propanedioic acid dimethyl ester/1-methyl-4-(1-methylethylidene)cyclohexane
  7131. propanedioic acid dimethyl ester/1-methyl-4-(1-methylethylidene)cyclohexene
  7132. propanedioic acid dimethyl ester/1-octene
  7133. propanedioic acid dimethyl ester/1H-indene
  7134. propanedioic acid dimethyl ester/2,2-dimethyl-3-methylenebicyclo[2.2.1]heptane
  7135. propanedioic acid dimethyl ester/2,6,6-trimethylbicyclo[3.1.1]hept-2-ene
  7136. propanedioic acid dimethyl ester/2-ethoxyethanol acetate
  7137. propanedioic acid dimethyl ester/2-octanone
  7138. propanedioic acid dimethyl ester/2-propanone
  7139. propanedioic acid dimethyl ester/3-methylbutanoic acid 2-methylpropyl ester
  7140. propanedioic acid dimethyl ester/3-methylbutanoic acid 3-methylbutyl ester
  7141. propanedioic acid dimethyl ester/3-methylbutanoic acid butyl ester
  7142. propanedioic acid dimethyl ester/4-methylpentanoic acid
  7143. propanedioic acid dimethyl ester/6,6-dimethyl-2-methylenebicyclo[3.1.1]heptane
  7144. propanedioic acid dimethyl ester/6-methyl-5-hepten-2-one
  7145. propanedioic acid dimethyl ester/acetic acid hexyl ester
  7146. propanedioic acid dimethyl ester/benzene
  7147. propanedioic acid dimethyl ester/bromobenzene
  7148. propanedioic acid dimethyl ester/carbamic acid ethyl ester
  7149. propanedioic acid dimethyl ester/cyclohexane
  7150. propanedioic acid dimethyl ester/cyclohexene
  7151. propanedioic acid dimethyl ester/ethanedioic acid diethyl ester
  7152. propanedioic acid dimethyl ester/ethanol
  7153. propanedioic acid dimethyl ester/ethylcyclohexane
  7154. propanedioic acid dimethyl ester/ethyne
  7155. propanedioic acid dimethyl ester/exo-2-methoxy-1,7,7-trimethylbicyclo[2.2.1]heptane
  7156. propanedioic acid dimethyl ester/heptane
  7157. propanedioic acid dimethyl ester/hexachloroethane
  7158. propanedioic acid dimethyl ester/hexane
  7159. propanedioic acid dimethyl ester/iodobenzene
  7160. propanedioic acid dimethyl ester/methoxymethylbenzene
  7161. propanedioic acid dimethyl ester/methylbenzene
  7162. propanedioic acid dimethyl ester/methylcyclohexane
  7163. propanedioic acid dimethyl ester/N,N,N-triethylethanaminium iodide
  7164. propanedioic acid dimethyl ester/N,N,N-tripropyl-1-propanaminium iodide
  7165. propanedioic acid dimethyl ester/naphthalene
  7166. propanedioic acid dimethyl ester/octane
  7167. propanedioic acid dimethyl ester/pentachloroethane
  7168. propanedioic acid dimethyl ester/pentanoic acid
  7169. propanedioic acid dimethyl ester/poly(1-phenylethylene)
  7170. propanedioic acid dimethyl ester/tetrachloromethane
  7171. propanedioic acid dimethyl ester/trichloroacetic acid
  7172. propanedioic acid dimethyl ester/trichloromethane
  7173. propanedioic acid dimethyl ester/water
  7174. propanedioic acid dipotassium salt/water
  7175. propanedioic acid monomethyl sodium salt/water
  7176. propanedioic acid monosodium salt/water
  7177. propanedioic acid strontium salt (1:1)/water
  7178. propanedioic acid/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)
  7179. propanedioic acid/β-D-fructofuranosyl α-D-glucopyranoside
  7180. propanedioic acid/1,1'-oxybisethane
  7181. propanedioic acid/1-butanol
  7182. propanedioic acid/1-propanol
  7183. propanedioic acid/2-hydroxy-N,N,N-trimethylethanaminium acetate
  7184. propanedioic acid/2-hydroxy-N,N,N-trimethylethanaminium chloride
  7185. propanedioic acid/2-methyl-1-propanol
  7186. propanedioic acid/2-propanol
  7187. propanedioic acid/2-propanone
  7188. propanedioic acid/acetic acid
  7189. propanedioic acid/acetonitrile
  7190. propanedioic acid/benzene
  7191. propanedioic acid/D-fructose
  7192. propanedioic acid/D-mannose
  7193. propanedioic acid/ethanol
  7194. propanedioic acid/formic acid
  7195. propanedioic acid/methanol
  7196. propanedioic acid/methyltriphenylphosphonium bromide
  7197. propanedioic acid/N,N,N-tributyl-1-butanaminium bromide
  7198. propanedioic acid/N-methylmethanamine hydrochloride
  7199. propanedioic acid/sulfuric acid
  7200. propanedioic acid/water
  7201. propanedioic-d2 acid-d2/Choline chloride-(trimethyl-d9)
  7202. propanenitrile compd. with boron chloride (BCl3) (1:1)/benzene
  7203. propanenitrile/(3E)-1,3-pentadiene
  7204. propanenitrile/(6E,10E,14E,18E)-2,6,10,15,19,23-hexamethyl-2,6,10,14,18,22-tetracosahexaene
  7205. propanenitrile/(methylsulfinyl)(methylthio)methane
  7206. propanenitrile/(phenylmethyl)-1,1'-biphenyl
  7207. propanenitrile/1,1'-oxybisethane
  7208. propanenitrile/1,1'-oxybispropane
  7209. propanenitrile/1,1'-sulfinylbisethane
  7210. propanenitrile/1,1'-sulfonylbisbenzene
  7211. propanenitrile/1,1,1,2,2,3,3,4,4,5,5,6,6,-tridecafluorodocosane
  7212. propanenitrile/1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluorohexadecane
  7213. propanenitrile/1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorooctadecane
  7214. propanenitrile/1,1,1,2,2,3,3,4,4-nonafluorodocosane
  7215. propanenitrile/1,1-dimethylethyl hydroperoxide
  7216. propanenitrile/1,12-dodecanediamine
  7217. propanenitrile/1,12-dodecanedinitrile
  7218. propanenitrile/1,2,4,5-tetramethylbenzene
  7219. propanenitrile/1,2-dihydroacenaphthylene
  7220. propanenitrile/1,2-dimethylbenzene
  7221. propanenitrile/1,2-dimethylnaphthalene
  7222. propanenitrile/1,2-ethanediamine
  7223. propanenitrile/1,3,5,7-heptanetetracarbonitrile
  7224. propanenitrile/1,3-butadiene homopolymer
  7225. propanenitrile/1,3-dimethylbenzene
  7226. propanenitrile/1,4-dichloro-2-nitrobenzene
  7227. propanenitrile/1,6-heptadiene
  7228. propanenitrile/1,6-hexanediol
  7229. propanenitrile/1,6-hexanedithiol
  7230. propanenitrile/1,9-nonanediol
  7231. propanenitrile/1-bromo-2-methylpropane
  7232. propanenitrile/1-butanamine
  7233. propanenitrile/1-butanol
  7234. propanenitrile/1-butyl-3-methyl-1H-imidazolium salt with sulfuric acid methyl ester (1:1)
  7235. propanenitrile/1-chloro-9,10-anthracenedione
  7236. propanenitrile/1-chlorobutane
  7237. propanenitrile/1-chlorohexane
  7238. propanenitrile/1-chlorooctane
  7239. propanenitrile/1-chloropentane
  7240. propanenitrile/1-chloropropane
  7241. propanenitrile/1-decanamine
  7242. propanenitrile/1-decanol
  7243. propanenitrile/1-dodecanol
  7244. propanenitrile/1-heptene
  7245. propanenitrile/1-hexanamine
  7246. propanenitrile/1-hexanol
  7247. propanenitrile/1-hexene
  7248. propanenitrile/1-hexylnaphthalene
  7249. propanenitrile/1-nitronaphthalene
  7250. propanenitrile/1-nonanol
  7251. propanenitrile/1-octanamine
  7252. propanenitrile/1-octanol
  7253. propanenitrile/1-octene
  7254. propanenitrile/1-pentanol
  7255. propanenitrile/1-pentene
  7256. propanenitrile/1-pentyne
  7257. propanenitrile/1-propanol
  7258. propanenitrile/1-tetradecanol
  7259. propanenitrile/1-undecanol
  7260. propanenitrile/10-nonadecanone
  7261. propanenitrile/10H-phenothiazine
  7262. propanenitrile/2,2'-oxybispropane
  7263. propanenitrile/2,2,4-trimethylpentane
  7264. propanenitrile/2,3,4-trimethylpentane
  7265. propanenitrile/2,4,6-trinitrophenol
  7266. propanenitrile/2,4-dimethylpentane
  7267. propanenitrile/2,5-dimethylhexane
  7268. propanenitrile/2,6,10,15,19,23-hexamethyltetracosane
  7269. propanenitrile/2-bromobutane
  7270. propanenitrile/2-butanamine
  7271. propanenitrile/2-butanone
  7272. propanenitrile/2-chloro-2-methylpropane
  7273. propanenitrile/2-dodecanone
  7274. propanenitrile/2-ethoxy-2-methylbutane
  7275. propanenitrile/2-ethoxy-2-methylpropane
  7276. propanenitrile/2-hydroxypropanoic acid
  7277. propanenitrile/2-iodopropane
  7278. propanenitrile/2-methoxybenzoic acid
  7279. propanenitrile/2-methyl-1,3-butadiene
  7280. propanenitrile/2-methyl-1-propanol
  7281. propanenitrile/2-methyl-1-propene
  7282. propanenitrile/2-methyl-2-butanol
  7283. propanenitrile/2-methyl-2-butene
  7284. propanenitrile/2-methyl-2-propanamine
  7285. propanenitrile/2-methyl-2-propanol
  7286. propanenitrile/2-methyl-2-propenoic acid methyl ester homopolymer
  7287. propanenitrile/2-methyl-3,5-dinitrobenzoic acid
  7288. propanenitrile/2-methylbenzoic acid
  7289. propanenitrile/2-methylbutane
  7290. propanenitrile/2-methylpentane
  7291. propanenitrile/2-methylpropane
  7292. propanenitrile/2-methylpropanoic acid ethyl ester
  7293. propanenitrile/2-methylpropanoic acid methyl ester
  7294. propanenitrile/2-propanamine
  7295. propanenitrile/2-propanol
  7296. propanenitrile/2-propanone
  7297. propanenitrile/2-propenenitrile
  7298. propanenitrile/2-pyrrolidinone
  7299. propanenitrile/3,4-dichlorobenzoic acid
  7300. propanenitrile/3,4-dimethoxybenzoic acid
  7301. propanenitrile/3-methylbenzoic acid
  7302. propanenitrile/3-methylbutanoic acid methyl ester
  7303. propanenitrile/3-methylpentane
  7304. propanenitrile/3-nitrobenzoic acid
  7305. propanenitrile/4-(1,1-dimethylethyl)benzoic acid
  7306. propanenitrile/4-chloro-3-nitrobenzoic acid
  7307. propanenitrile/4-chlorobenzoic acid
  7308. propanenitrile/4-cyano-1-ethylpyridinium iodide
  7309. propanenitrile/4-nitrobenzoic acid
  7310. propanenitrile/8-acetamide-2,4,4,8-tetramethyl-3-azabicyclo[3.3.1]non-2-ene perchlorate
  7311. propanenitrile/8-benzamide-2-phenyl-4,4,8-trimethyl-3-azabicyclo[3.3.1]non-2-ene perchlorate
  7312. propanenitrile/9-heptadecanone
  7313. propanenitrile/9H-fluoren-9-one
  7314. propanenitrile/9H-thioxanthen-9-one
  7315. propanenitrile/acetic acid butyl ester
  7316. propanenitrile/acetic acid ethyl ester
  7317. propanenitrile/acetic acid methyl ester
  7318. propanenitrile/acetic acid propyl ester
  7319. propanenitrile/acetonitrile
  7320. propanenitrile/anthracene
  7321. propanenitrile/benzene
  7322. propanenitrile/benzoic acid
  7323. propanenitrile/bis((1,2,3,4,5,6-η)-1,1'-biphenyl)chromium
  7324. propanenitrile/bis((1,2,3,4,5,6-η)-1,1'-biphenyl)chromium(1+) tetraphenylborate(1-)
  7325. propanenitrile/bromoethane
  7326. propanenitrile/butanenitrile
  7327. propanenitrile/butanoic acid methyl ester
  7328. propanenitrile/carbon dioxide
  7329. propanenitrile/carbon disulfide
  7330. propanenitrile/carbon monoxide
  7331. propanenitrile/chlorotrimethylsilane
  7332. propanenitrile/cyclohexanamine
  7333. propanenitrile/cyclohexane
  7334. propanenitrile/decane
  7335. propanenitrile/decanedioic acid
  7336. propanenitrile/dichloromethane
  7337. propanenitrile/diphenylethanedione
  7338. propanenitrile/dodecane
  7339. propanenitrile/ethanol
  7340. propanenitrile/ethenyl-d3-benzene-d5 homopolymer
  7341. propanenitrile/ethylcyclohexane
  7342. propanenitrile/formic acid propyl ester
  7343. propanenitrile/Galden - Perfluoropolyether oil
  7344. propanenitrile/heptane
  7345. propanenitrile/heptanedioic acid
  7346. propanenitrile/hexachlorobenzene
  7347. propanenitrile/hexadecafluorooxonane
  7348. propanenitrile/hexadecane
  7349. propanenitrile/hexadecanoic acid
  7350. propanenitrile/hexane
  7351. propanenitrile/hexylbenzene
  7352. propanenitrile/hydrochloric acid
  7353. propanenitrile/iodoethane
  7354. propanenitrile/iodomethane
  7355. propanenitrile/Krytox AX - Perfluoropolyether oil
  7356. propanenitrile/methanol
  7357. propanenitrile/methylbenzene
  7358. propanenitrile/methylcyclohexane
  7359. propanenitrile/N'-(3,4-dichlorophenyl)-N,N-dimethylurea
  7360. propanenitrile/N'-(4-chlorophenyl)-N,N-dimethylurea
  7361. propanenitrile/N,N,N-tributyl-1-butanaminium iodide
  7362. propanenitrile/N,N,N-tributyl-1-butanaminium perchlorate
  7363. propanenitrile/N,N,N-triethylethanaminium iodide
  7364. propanenitrile/N,N,N-tripropyl-1-propanaminium iodide
  7365. propanenitrile/N,N-diethylethanamine
  7366. propanenitrile/N,N-dimethylacetamide
  7367. propanenitrile/N,N-dimethylformamide
  7368. propanenitrile/N-methyl-N,N-dipropyl-1-propanaminium iodide
  7369. propanenitrile/nitric acid silver(1+) salt
  7370. propanenitrile/nitromethane
  7371. propanenitrile/nonane
  7372. propanenitrile/o-Acetoacetanisidide
  7373. propanenitrile/octadecane
  7374. propanenitrile/octane
  7375. propanenitrile/pentane
  7376. propanenitrile/pentanedinitrile
  7377. propanenitrile/pentanenitrile
  7378. propanenitrile/pentanoic acid methyl ester
  7379. propanenitrile/perchloric acid lithium salt
  7380. propanenitrile/phenanthrene
  7381. propanenitrile/poly(1-phenylethylene)
  7382. propanenitrile/poly[oxy-1,4-phenylenesulfonyl-1,4-phenyleneoxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene]
  7383. propanenitrile/potassium iodide (KI)
  7384. propanenitrile/propanoic acid methyl ester
  7385. propanenitrile/pyrene
  7386. propanenitrile/pyridine
  7387. propanenitrile/rubidium iodide (RbI)
  7388. propanenitrile/silver bromide (AgBr)
  7389. propanenitrile/silver chloride (AgCl)
  7390. propanenitrile/silver iodide (AgI)
  7391. propanenitrile/sodium iodide (NaI)
  7392. propanenitrile/sulfinylbismethane
  7393. propanenitrile/sulfur dioxide
  7394. propanenitrile/tetrachloromethane
  7395. propanenitrile/tetrachlorostannane
  7396. propanenitrile/tetradecane
  7397. propanenitrile/tetrahydrothiophene 1,1-dioxide
  7398. propanenitrile/tetraphenylarsonium tetraphenylborate(1-)
  7399. propanenitrile/thionyl chloride
  7400. propanenitrile/titanium chloride (TiCl4)
  7401. propanenitrile/trichloromethane
  7402. propanenitrile/trifluoroacetic acid anhydride
  7403. propanenitrile/water
  7404. propanenitrile/water-d2
  7405. propanenitrile/water-t
  7406. propaneperoxoic acid/1,1'-oxybisethane
  7407. propaneperoxoic acid/trichloromethane
  7408. propaneperoxoic acid/water
  7409. propanoic acid 1-methylethyl ester/2-propanol
  7410. propanoic acid 1-methylethyl ester/3,3-dimethyl-2-butanone
  7411. propanoic acid 1-methylethyl ester/propanoic acid
  7412. propanoic acid 1-methylethyl ester/water
  7413. propanoic acid 2-(1-oxopropyl)hydrazide/ethanol
  7414. propanoic acid 2-(1-oxopropyl)hydrazide/water
  7415. propanoic acid 2-methylpropyl ester/1,1,2,2-tetrachloroethane
  7416. propanoic acid 2-methylpropyl ester/1,2-dibromopropane
  7417. propanoic acid 2-methylpropyl ester/1,2-dichloro-1-ethoxyethane
  7418. propanoic acid 2-methylpropyl ester/1,2-dimethylbenzene
  7419. propanoic acid 2-methylpropyl ester/1-butanol
  7420. propanoic acid 2-methylpropyl ester/1-iodo-3-methylbutane
  7421. propanoic acid 2-methylpropyl ester/1-iodobutane
  7422. propanoic acid 2-methylpropyl ester/2-hydroxypropanoic acid methyl ester
  7423. propanoic acid 2-methylpropyl ester/2-methyl-1-propanol
  7424. propanoic acid 2-methylpropyl ester/acetamide
  7425. propanoic acid 2-methylpropyl ester/chloroacetic acid methyl ester
  7426. propanoic acid 2-methylpropyl ester/cyclopentanol
  7427. propanoic acid 2-methylpropyl ester/tribromomethane
  7428. propanoic acid 2-methylpropyl ester/water
  7429. propanoic acid anhydride/carbon dioxide
  7430. propanoic acid anhydride/chlorosulfuric acid
  7431. propanoic acid anhydride/propanoic acid
  7432. propanoic acid barium salt monohydrate/water
  7433. propanoic acid barium salt/methanol
  7434. propanoic acid barium salt/water
  7435. propanoic acid butyl ester/(1-methylethyl)benzene
  7436. propanoic acid butyl ester/1,1,2,2-tetrachloroethane
  7437. propanoic acid butyl ester/1,2-dibromopropane
  7438. propanoic acid butyl ester/1,2-dichloro-1-ethoxyethane
  7439. propanoic acid butyl ester/1,2-dimethylbenzene
  7440. propanoic acid butyl ester/1,5-dichloropentane
  7441. propanoic acid butyl ester/1,6-dibromohexane
  7442. propanoic acid butyl ester/1-butanol
  7443. propanoic acid butyl ester/1-phenylethanone
  7444. propanoic acid butyl ester/1-propanol
  7445. propanoic acid butyl ester/2,6,6-trimethylbicyclo[3.1.1]hept-2-ene
  7446. propanoic acid butyl ester/2-butanol
  7447. propanoic acid butyl ester/2-butanone
  7448. propanoic acid butyl ester/2-methyl-1-propanol
  7449. propanoic acid butyl ester/2-methyl-2-propanol
  7450. propanoic acid butyl ester/2-methylpropanoic acid ethyl ester
  7451. propanoic acid butyl ester/2-oxopropanoic acid ethyl ester
  7452. propanoic acid butyl ester/2-propanol
  7453. propanoic acid butyl ester/2-propanone
  7454. propanoic acid butyl ester/3-pentanone
  7455. propanoic acid butyl ester/acetamide
  7456. propanoic acid butyl ester/acetic acid
  7457. propanoic acid butyl ester/acetic acid pentyl ester
  7458. propanoic acid butyl ester/benzene
  7459. propanoic acid butyl ester/carbonic acid dimethyl ester
  7460. propanoic acid butyl ester/diiodomethane
  7461. propanoic acid butyl ester/ethanol
  7462. propanoic acid butyl ester/formic acid butyl ester
  7463. propanoic acid butyl ester/methane
  7464. propanoic acid butyl ester/methanol
  7465. propanoic acid butyl ester/n-heptadecane
  7466. propanoic acid butyl ester/nitrogen
  7467. propanoic acid butyl ester/oxygen
  7468. propanoic acid butyl ester/pentadecane
  7469. propanoic acid butyl ester/propanoic acid
  7470. propanoic acid butyl ester/propanoic acid pentyl ester
  7471. propanoic acid butyl ester/tetrachlorostannane
  7472. propanoic acid butyl ester/titanium chloride (TiCl4)
  7473. propanoic acid butyl ester/tridecane
  7474. propanoic acid butyl ester/water
  7475. propanoic acid cadmium salt/water
  7476. propanoic acid calcium salt/methanol
  7477. propanoic acid calcium salt/water
  7478. propanoic acid cerium(3+) salt/water
  7479. propanoic acid cesium salt/1-butanol
  7480. propanoic acid cesium salt/1-propanol
  7481. propanoic acid cesium salt/ethanol
  7482. propanoic acid cesium salt/water
  7483. propanoic acid compd. with guanidine (1:1)/water
  7484. propanoic acid cyclohexyl ester/water
  7485. propanoic acid erbium(3+) salt/water
  7486. propanoic acid ethenyl ester/2-propanone
  7487. propanoic acid ethenyl ester/acetic acid
  7488. propanoic acid ethenyl ester/acetic acid ethenyl ester
  7489. propanoic acid ethenyl ester/butanoic acid ethenyl ester
  7490. propanoic acid ethenyl ester/carbon dioxide
  7491. propanoic acid ethenyl ester/methanol
  7492. propanoic acid ethenyl ester/propanoic acid
  7493. propanoic acid ethenyl ester/water
  7494. propanoic acid ethyl ester/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)
  7495. propanoic acid ethyl ester/(3β)-cholest-5-en-3-ol
  7496. propanoic acid ethyl ester/1,1'-oxybis(2-chloroethane)
  7497. propanoic acid ethyl ester/1,1'-oxybispropane
  7498. propanoic acid ethyl ester/1,1,2,2-tetrachloroethane
  7499. propanoic acid ethyl ester/1,1-diethoxyethane
  7500. propanoic acid ethyl ester/1,2-benzenedicarboxylic acid dibutyl ester
  7501. propanoic acid ethyl ester/1,2-dibromoethane
  7502. propanoic acid ethyl ester/1,2-dichloroethane
  7503. propanoic acid ethyl ester/1,2-dichloropropane
  7504. propanoic acid ethyl ester/1,2-ethanediol
  7505. propanoic acid ethyl ester/1,3-dibromopropane
  7506. propanoic acid ethyl ester/1,3-dichloropropane
  7507. propanoic acid ethyl ester/1,3-dioxolane
  7508. propanoic acid ethyl ester/1,4-dibromobutane
  7509. propanoic acid ethyl ester/1,4-dichlorobutane
  7510. propanoic acid ethyl ester/1,4-dimethylbenzene
  7511. propanoic acid ethyl ester/1,5-dibromopentane
  7512. propanoic acid ethyl ester/1,5-dichloropentane
  7513. propanoic acid ethyl ester/1,6-dibromohexane
  7514. propanoic acid ethyl ester/1,6-dichlorohexane
  7515. propanoic acid ethyl ester/1-(ethoxymethoxy)propane
  7516. propanoic acid ethyl ester/1-bromo-2-chloroethane
  7517. propanoic acid ethyl ester/1-bromo-2-methylpropane
  7518. propanoic acid ethyl ester/1-bromohexane
  7519. propanoic acid ethyl ester/1-bromopropane
  7520. propanoic acid ethyl ester/1-butanol
  7521. propanoic acid ethyl ester/1-butyl-2-methylpyridinium tetrafluoroborate(1-)
  7522. propanoic acid ethyl ester/1-butyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  7523. propanoic acid ethyl ester/1-butyl-3-methylimidazolium salt with sulfuric acid (1:1)
  7524. propanoic acid ethyl ester/1-butyl-3-methylpyridinium tetrafluoroborate(1-)
  7525. propanoic acid ethyl ester/1-butyl-4-methylpyridinium tetrafluoroborate(1-)
  7526. propanoic acid ethyl ester/1-butylpyridinium tetrafluoroborate(1-)
  7527. propanoic acid ethyl ester/1-chloro-3-methylbutane
  7528. propanoic acid ethyl ester/1-chloroheptane
  7529. propanoic acid ethyl ester/1-chlorohexane
  7530. propanoic acid ethyl ester/1-chlorooctane
  7531. propanoic acid ethyl ester/1-chloropentane
  7532. propanoic acid ethyl ester/1-decanol
  7533. propanoic acid ethyl ester/1-docosanol
  7534. propanoic acid ethyl ester/1-eicosene
  7535. propanoic acid ethyl ester/1-heptanol
  7536. propanoic acid ethyl ester/1-hexanol
  7537. propanoic acid ethyl ester/1-hexene
  7538. propanoic acid ethyl ester/1-hexyl-3-methyl-1H-imidazolium salt with sulfuric acid (1:1)
  7539. propanoic acid ethyl ester/1-methoxybutane
  7540. propanoic acid ethyl ester/1-methyl-2-pyrrolidinone
  7541. propanoic acid ethyl ester/1-methyl-3-(2-propenyl)-1H-imidazolium chloride
  7542. propanoic acid ethyl ester/1-nonanol
  7543. propanoic acid ethyl ester/1-octadecanol
  7544. propanoic acid ethyl ester/1-octanol
  7545. propanoic acid ethyl ester/1-octyl-3-methylimidazolium hydrogensulfate
  7546. propanoic acid ethyl ester/1-pentanol
  7547. propanoic acid ethyl ester/1-propanol
  7548. propanoic acid ethyl ester/10-nonadecanone
  7549. propanoic acid ethyl ester/1H-isoindole-1,3(2H)-dione
  7550. propanoic acid ethyl ester/2,2,2-trichloro-1,1-ethanediol
  7551. propanoic acid ethyl ester/2,2,4,4,6,8,8-heptamethylnonane
  7552. propanoic acid ethyl ester/2,2,4-trimethylpentane
  7553. propanoic acid ethyl ester/2,4,6-trinitrophenol cesium salt
  7554. propanoic acid ethyl ester/2,4,6-trinitrophenol potassium salt
  7555. propanoic acid ethyl ester/2,4,6-trinitrophenol rubidium salt
  7556. propanoic acid ethyl ester/2,5,8,11,14-pentaoxapentadecane
  7557. propanoic acid ethyl ester/2,5-dimethylhexane
  7558. propanoic acid ethyl ester/2-butanol
  7559. propanoic acid ethyl ester/2-ethoxyethanol
  7560. propanoic acid ethyl ester/2-methoxy-2-methylpropane
  7561. propanoic acid ethyl ester/2-methyl-1-propanol
  7562. propanoic acid ethyl ester/2-methyl-2-butanol
  7563. propanoic acid ethyl ester/2-methyl-2-propanol
  7564. propanoic acid ethyl ester/2-methylheptane
  7565. propanoic acid ethyl ester/2-methylhexane
  7566. propanoic acid ethyl ester/2-methylpentane
  7567. propanoic acid ethyl ester/2-pentanone
  7568. propanoic acid ethyl ester/2-propanol
  7569. propanoic acid ethyl ester/2-propen-1-ol
  7570. propanoic acid ethyl ester/3,3-dimethyl-2-butanone
  7571. propanoic acid ethyl ester/3-iodo-1-propene
  7572. propanoic acid ethyl ester/3-methyl-2-butanone
  7573. propanoic acid ethyl ester/3-methylheptane
  7574. propanoic acid ethyl ester/3-methylhexane
  7575. propanoic acid ethyl ester/3-methylpentane
  7576. propanoic acid ethyl ester/3-pentanol
  7577. propanoic acid ethyl ester/3-pentanone
  7578. propanoic acid ethyl ester/4,4'-sulfonylbisbenzenamine
  7579. propanoic acid ethyl ester/4-methyl-1,3-dioxolan-2-one
  7580. propanoic acid ethyl ester/4-methyl-2-pentanone
  7581. propanoic acid ethyl ester/4-methylheptane
  7582. propanoic acid ethyl ester/4-morpholinecarboxaldehyde
  7583. propanoic acid ethyl ester/5,8,11,14-tetraoxaoctadecane
  7584. propanoic acid ethyl ester/6-(2,3-dichlorophenyl)-1,2,4-triazine-3,5-diamine
  7585. propanoic acid ethyl ester/acetic acid
  7586. propanoic acid ethyl ester/acetic acid 2-methylpropyl ester
  7587. propanoic acid ethyl ester/acetic acid ethenyl ester
  7588. propanoic acid ethyl ester/acetic acid ethyl ester
  7589. propanoic acid ethyl ester/acetic acid propyl ester
  7590. propanoic acid ethyl ester/acetonitrile
  7591. propanoic acid ethyl ester/air
  7592. propanoic acid ethyl ester/antimony chloride (SbCl5)
  7593. propanoic acid ethyl ester/benzene
  7594. propanoic acid ethyl ester/bromodichloromethane
  7595. propanoic acid ethyl ester/butanoic acid methyl ester
  7596. propanoic acid ethyl ester/carbon dioxide
  7597. propanoic acid ethyl ester/carbon disulfide
  7598. propanoic acid ethyl ester/carbon monoxide
  7599. propanoic acid ethyl ester/carbonic acid diethyl ester
  7600. propanoic acid ethyl ester/Cellulose nitrate
  7601. propanoic acid ethyl ester/chloroacetic acid methyl ester
  7602. propanoic acid ethyl ester/chlorobenzene
  7603. propanoic acid ethyl ester/cyclohexane
  7604. propanoic acid ethyl ester/decane
  7605. propanoic acid ethyl ester/dodecane
  7606. propanoic acid ethyl ester/ethanol
  7607. propanoic acid ethyl ester/ethyloxirane
  7608. propanoic acid ethyl ester/formic acid 2-methylpropyl ester
  7609. propanoic acid ethyl ester/formic acid ethyl ester
  7610. propanoic acid ethyl ester/heptane
  7611. propanoic acid ethyl ester/hexadecane
  7612. propanoic acid ethyl ester/hexadecanoic acid
  7613. propanoic acid ethyl ester/hexane
  7614. propanoic acid ethyl ester/hydrochloric acid
  7615. propanoic acid ethyl ester/hydrogen
  7616. propanoic acid ethyl ester/iodoethane
  7617. propanoic acid ethyl ester/methane
  7618. propanoic acid ethyl ester/methanol
  7619. propanoic acid ethyl ester/methylbenzene
  7620. propanoic acid ethyl ester/methylcyclohexane
  7621. propanoic acid ethyl ester/Mycophenolic acid
  7622. propanoic acid ethyl ester/N-butyl-1-butanamine
  7623. propanoic acid ethyl ester/n-heptadecane
  7624. propanoic acid ethyl ester/N-methyl-1-butanamine
  7625. propanoic acid ethyl ester/N-propyl-1-propanamine
  7626. propanoic acid ethyl ester/nitric acid thorium(4+) salt
  7627. propanoic acid ethyl ester/nitroethane
  7628. propanoic acid ethyl ester/nitrogen
  7629. propanoic acid ethyl ester/nitromethane
  7630. propanoic acid ethyl ester/nonane
  7631. propanoic acid ethyl ester/octacosane
  7632. propanoic acid ethyl ester/octane
  7633. propanoic acid ethyl ester/oxygen
  7634. propanoic acid ethyl ester/pentadecane
  7635. propanoic acid ethyl ester/pentane
  7636. propanoic acid ethyl ester/propanenitrile
  7637. propanoic acid ethyl ester/propanoic acid
  7638. propanoic acid ethyl ester/propanoic acid butyl ester
  7639. propanoic acid ethyl ester/propanoic acid heptyl ester
  7640. propanoic acid ethyl ester/propanoic acid methyl ester
  7641. propanoic acid ethyl ester/propanoic acid pentyl ester
  7642. propanoic acid ethyl ester/propanoic acid propyl ester
  7643. propanoic acid ethyl ester/tetrachloromethane
  7644. propanoic acid ethyl ester/tetrachlorostannane
  7645. propanoic acid ethyl ester/tetradecane
  7646. propanoic acid ethyl ester/titanium chloride (TiCl4)
  7647. propanoic acid ethyl ester/trichloroacetaldehyde
  7648. propanoic acid ethyl ester/trichloroethene
  7649. propanoic acid ethyl ester/trichloromethane
  7650. propanoic acid ethyl ester/trichloronitromethane
  7651. propanoic acid ethyl ester/tricosane
  7652. propanoic acid ethyl ester/tridecane
  7653. propanoic acid ethyl ester/undecane
  7654. propanoic acid ethyl ester/water
  7655. propanoic acid ethyl ester/water-d2
  7656. propanoic acid ethyl ester/water-t
  7657. propanoic acid gadolinium(3+) salt/water
  7658. propanoic acid heptyl ester/propanoic acid methyl ester
  7659. propanoic acid hexyl ester/water
  7660. propanoic acid lanthanum(3+) salt/water
  7661. propanoic acid lithium salt/N-methylacetamide
  7662. propanoic acid lithium salt/nitric acid lithium salt
  7663. propanoic acid lithium salt/nitric acid sodium salt
  7664. propanoic acid lithium salt/propanoic acid
  7665. propanoic acid magnesium salt/water
  7666. propanoic acid methyl ester/(1α,2α,3β,4α,5α,6β)-1,2,3,4,5,6-hexachlorocyclohexane
  7667. propanoic acid methyl ester/1,1,1-trichloroethane
  7668. propanoic acid methyl ester/1,1,2,2-tetrachloroethane
  7669. propanoic acid methyl ester/1,2-dichloropropane
  7670. propanoic acid methyl ester/1,3,5-trinitrobenzene
  7671. propanoic acid methyl ester/1,3-Didecyl-2-methylimidazolium dicyanamide
  7672. propanoic acid methyl ester/1,5-dichloropentane
  7673. propanoic acid methyl ester/1,6-dibromohexane
  7674. propanoic acid methyl ester/1-(2-hydroxyethyl)-3-methyl-1H-imidazolium trifluorotris(1,1,2,2,2-pentafluoroethyl)phosphate(1-)
  7675. propanoic acid methyl ester/1-(2-methoxyethyl)-1-methyl-pyrrolidinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  7676. propanoic acid methyl ester/1-(2-methoxyethyl)-1-methylpiperidinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  7677. propanoic acid methyl ester/1-(2-methoxyethyl)-1-methylpiperidinium tris(pentafluoroethyl)trifluorophosphate
  7678. propanoic acid methyl ester/1-(3-Hydroxypropyl)-1-methylmorpholinium dicyanamide
  7679. propanoic acid methyl ester/1-(3-Hydroxypropyl)-3-methylimidazolium dicyanamide
  7680. propanoic acid methyl ester/1-(3-Hydroxypropyl)pyridinium dicyanamide
  7681. propanoic acid methyl ester/1-(4-chlorophenyl)sulfonyl-3-propylurea
  7682. propanoic acid methyl ester/1-(4-Methoxy-4-oxobutyl)-3-methylimidazolium dicyanamide
  7683. propanoic acid methyl ester/1-allyl-3-methylimidazolium dicyanamide
  7684. propanoic acid methyl ester/1-benzyl-3-methylimidazolium dicyanamide
  7685. propanoic acid methyl ester/1-bromo-2-methylpropane
  7686. propanoic acid methyl ester/1-butanol
  7687. propanoic acid methyl ester/1-butyl-1-methyl-1H-pyrrolidinium tris(pentafluoroethyl) trifluorophosphate
  7688. propanoic acid methyl ester/1-butyl-1-methylmorpholinium tricyanomethanide
  7689. propanoic acid methyl ester/1-butyl-1-methylpyrrolidinium tricyanomethanide
  7690. propanoic acid methyl ester/1-butyl-3-methyl-1H-imidazolium chloride
  7691. propanoic acid methyl ester/1-butyl-3-methylimidazolium dimethylphosphate
  7692. propanoic acid methyl ester/1-butyl-4-cyanopyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  7693. propanoic acid methyl ester/1-chloro-2,4-dinitrobenzene
  7694. propanoic acid methyl ester/1-ethyl-1-methylpyrrolidinium lactate
  7695. propanoic acid methyl ester/1-Ethyl-3-(2-methoxyethyl)-imidazolium bis(trifluoromethylsulfonyl)imide
  7696. propanoic acid methyl ester/1-ethyl-3-methyl-1H-imidazolium tricyanomethanide
  7697. propanoic acid methyl ester/1-methyl-3-(2-propenyl)-1H-imidazolium chloride
  7698. propanoic acid methyl ester/1-pentanol
  7699. propanoic acid methyl ester/1-propanol
  7700. propanoic acid methyl ester/2,2-dichloropropane
  7701. propanoic acid methyl ester/2-bromobutane
  7702. propanoic acid methyl ester/2-butanol
  7703. propanoic acid methyl ester/2-butanone
  7704. propanoic acid methyl ester/2-chlorbutane
  7705. propanoic acid methyl ester/2-chloro-1,3,5-trinitrobenzene
  7706. propanoic acid methyl ester/2-iodopropane
  7707. propanoic acid methyl ester/2-methyl-1-propanol
  7708. propanoic acid methyl ester/2-methyl-2-propanol
  7709. propanoic acid methyl ester/2-methyl-2-propenoic acid methyl ester
  7710. propanoic acid methyl ester/2-propanol
  7711. propanoic acid methyl ester/3-methyl-1-(2-propenyl)-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  7712. propanoic acid methyl ester/3-methylbutanal
  7713. propanoic acid methyl ester/4-(2-methoxyethyl)-4-methyl-5-morpholinium tris(pentafluoroethyl)trifluorophosphate
  7714. propanoic acid methyl ester/4-(2-methoxyethyl)-4-methylmorpholinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  7715. propanoic acid methyl ester/4-(3-hydroxypropyl)-4-methylmorpholinium bis(trifluoromethylsulfonyl)imide
  7716. propanoic acid methyl ester/acetic acid
  7717. propanoic acid methyl ester/acetic acid methyl ester
  7718. propanoic acid methyl ester/acetonitrile
  7719. propanoic acid methyl ester/benzene
  7720. propanoic acid methyl ester/Bezafibrate
  7721. propanoic acid methyl ester/bromodichloromethane
  7722. propanoic acid methyl ester/butanedioic acid mono((3R,5aS,6R,8aS,9R,10R,12R,12aR&sup*;)-decahydro-3,6,9-trimethyl-3,12-epoxy-12H-pyrano(4,3-j)-1,2-benzodioxepin-10-yl) ester
  7723. propanoic acid methyl ester/carbon disulfide
  7724. propanoic acid methyl ester/carbon monoxide
  7725. propanoic acid methyl ester/chloroacetic acid methyl ester
  7726. propanoic acid methyl ester/dichloromethane
  7727. propanoic acid methyl ester/Dimethyldodecylphenoxyethylammonium bis(trifluoromethylsulfonyl)imide
  7728. propanoic acid methyl ester/Dimethyldodecylphenoxyethylammonium dicyanamide
  7729. propanoic acid methyl ester/Doxofylline
  7730. propanoic acid methyl ester/ethanol
  7731. propanoic acid methyl ester/ethene
  7732. propanoic acid methyl ester/hexadecanoic acid
  7733. propanoic acid methyl ester/iodoethane
  7734. propanoic acid methyl ester/Methanesulfonamide
  7735. propanoic acid methyl ester/methanol
  7736. propanoic acid methyl ester/methylcyclopentane
  7737. propanoic acid methyl ester/N-(3-Cyanopropyl)-N-methylpyrrolidinium dicynamide
  7738. propanoic acid methyl ester/N-(3-Cyanopropyl)pyridinium dicynamide
  7739. propanoic acid methyl ester/N-Benzyl-N-dimethyl-N-tetradecylammonium cinnamate
  7740. propanoic acid methyl ester/N-butyl-N-methylpyrrolidinium salt with bis(fluorosulfonyl)imide
  7741. propanoic acid methyl ester/N-ethyl-N-methylmorpholinium dicyanamide
  7742. propanoic acid methyl ester/n-heptadecane
  7743. propanoic acid methyl ester/N-methoxyethylpyridinium bis(trifluoromethanesulfonyl)imide
  7744. propanoic acid methyl ester/N-Triethyl-N-octylammonium bis(fluorosulfonyl)imide
  7745. propanoic acid methyl ester/nitroethane
  7746. propanoic acid methyl ester/nitromethane
  7747. propanoic acid methyl ester/pentadecane
  7748. propanoic acid methyl ester/propanoic acid
  7749. propanoic acid methyl ester/propanoic acid butyl ester
  7750. propanoic acid methyl ester/propanoic acid pentyl ester
  7751. propanoic acid methyl ester/Tetrabutylphosphonium bis(trifluoromethylsulfonyl)imide
  7752. propanoic acid methyl ester/tetrachloromethane
  7753. propanoic acid methyl ester/tetradecane
  7754. propanoic acid methyl ester/Tetraoctylphosphonium bis{(trifluomethyl)sulfonyl}imide
  7755. propanoic acid methyl ester/Tributyl(2-methoxyethyl)phosphonium bis(trifluoromethanesulfonyl)imide
  7756. propanoic acid methyl ester/tributyltetradecylphosphonium salt with dodecylbenzenesulfonic acid (1:1)
  7757. propanoic acid methyl ester/trichloroethene
  7758. propanoic acid methyl ester/trichloromethane
  7759. propanoic acid methyl ester/tridecane
  7760. propanoic acid methyl ester/Triethyl (2-methoxyethyl) phosphonium bis(trifluoromethylsulfonyl)imide
  7761. propanoic acid methyl ester/trihexyl tetradecyl phosphonium tricyanomethanide
  7762. propanoic acid methyl ester/water
  7763. propanoic acid methyl ester/zinc chloride (ZnCl2)
  7764. propanoic acid neodymium(3+) salt/water
  7765. propanoic acid pentyl ester/2-methyl-1-propanol
  7766. propanoic acid pentyl ester/2-propanol
  7767. propanoic acid pentyl ester/n-heptadecane
  7768. propanoic acid pentyl ester/pentadecane
  7769. propanoic acid pentyl ester/titanium chloride (TiCl4)
  7770. propanoic acid pentyl ester/tridecane
  7771. propanoic acid pentyl ester/water
  7772. propanoic acid phenylmethyl ester/ethanol
  7773. propanoic acid potassium salt/formic acid potassium salt
  7774. propanoic acid potassium salt/methanol
  7775. propanoic acid potassium salt/N-methylacetamide
  7776. propanoic acid potassium salt/nitric acid potassium salt
  7777. propanoic acid potassium salt/nitric acid sodium salt
  7778. propanoic acid potassium salt/nitrous acid potassium salt
  7779. propanoic acid potassium salt/propanoic acid
  7780. propanoic acid potassium salt/propanoic acid lithium salt
  7781. propanoic acid potassium salt/propanoic acid magnesium salt
  7782. propanoic acid potassium salt/thiocyanic acid potassium salt
  7783. propanoic acid potassium salt/thiocyanic acid sodium salt
  7784. propanoic acid potassium salt/water
  7785. propanoic acid praseodymium(3+) salt/water
  7786. propanoic acid propyl ester/(chloromethyl)oxirane
  7787. propanoic acid propyl ester/1,1,2,2-tetrachloroethane
  7788. propanoic acid propyl ester/1,2,4-trimethylcyclohexane
  7789. propanoic acid propyl ester/1,2-dibromoethane
  7790. propanoic acid propyl ester/1,2-dichloroethane
  7791. propanoic acid propyl ester/1,2-dimethylbenzene
  7792. propanoic acid propyl ester/1,3-dibromopropane
  7793. propanoic acid propyl ester/1,3-dichloropropane
  7794. propanoic acid propyl ester/1,3-dimethylbenzene
  7795. propanoic acid propyl ester/1,4-dibromobutane
  7796. propanoic acid propyl ester/1,4-dichlorobutane
  7797. propanoic acid propyl ester/1,4-dimethylbenzene
  7798. propanoic acid propyl ester/1,5-dibromopentane
  7799. propanoic acid propyl ester/1,5-dichloropentane
  7800. propanoic acid propyl ester/1,6-dibromohexane
  7801. propanoic acid propyl ester/1,6-dichlorohexane
  7802. propanoic acid propyl ester/1-bromo-3-methylbutane
  7803. propanoic acid propyl ester/1-butanol
  7804. propanoic acid propyl ester/1-chlorobutane
  7805. propanoic acid propyl ester/1-chlorohexadecane
  7806. propanoic acid propyl ester/1-chlorohexane
  7807. propanoic acid propyl ester/1-hexanol
  7808. propanoic acid propyl ester/1-iodobutane
  7809. propanoic acid propyl ester/1-propanol
  7810. propanoic acid propyl ester/2,2,4-trimethylpentane
  7811. propanoic acid propyl ester/2-butanol
  7812. propanoic acid propyl ester/2-butanone
  7813. propanoic acid propyl ester/2-chloroethanol
  7814. propanoic acid propyl ester/2-ethoxyethanol
  7815. propanoic acid propyl ester/2-hexanone
  7816. propanoic acid propyl ester/2-methoxyethanol
  7817. propanoic acid propyl ester/2-methyl-1-propanol
  7818. propanoic acid propyl ester/2-methyl-2-propanol
  7819. propanoic acid propyl ester/2-propanol
  7820. propanoic acid propyl ester/2-propanone
  7821. propanoic acid propyl ester/3-hexanone
  7822. propanoic acid propyl ester/3-methyl-1-butanol
  7823. propanoic acid propyl ester/3-methyl-1-butanol formate
  7824. propanoic acid propyl ester/4-methyl-1,3-dioxolan-2-one
  7825. propanoic acid propyl ester/4-methyl-3-penten-2-one
  7826. propanoic acid propyl ester/acetamide
  7827. propanoic acid propyl ester/acetic acid
  7828. propanoic acid propyl ester/acetic acid 1-methylethyl ester
  7829. propanoic acid propyl ester/acetic acid butyl ester
  7830. propanoic acid propyl ester/benzene
  7831. propanoic acid propyl ester/carbon dioxide
  7832. propanoic acid propyl ester/chloroacetic acid methyl ester
  7833. propanoic acid propyl ester/chlorobenzene
  7834. propanoic acid propyl ester/cyclohexane
  7835. propanoic acid propyl ester/decane
  7836. propanoic acid propyl ester/ethanol
  7837. propanoic acid propyl ester/ethene
  7838. propanoic acid propyl ester/heptane
  7839. propanoic acid propyl ester/hexane
  7840. propanoic acid propyl ester/methanol
  7841. propanoic acid propyl ester/methylbenzene
  7842. propanoic acid propyl ester/methylcyclohexane
  7843. propanoic acid propyl ester/n-heptadecane
  7844. propanoic acid propyl ester/nitric acid 2-methylpropyl ester
  7845. propanoic acid propyl ester/nonane
  7846. propanoic acid propyl ester/octane
  7847. propanoic acid propyl ester/pentadecane
  7848. propanoic acid propyl ester/pentane
  7849. propanoic acid propyl ester/propanal
  7850. propanoic acid propyl ester/propanoic acid
  7851. propanoic acid propyl ester/propanoic acid butyl ester
  7852. propanoic acid propyl ester/propanoic acid heptyl ester
  7853. propanoic acid propyl ester/pyridine
  7854. propanoic acid propyl ester/tetrachloroethene
  7855. propanoic acid propyl ester/tetrachloromethane
  7856. propanoic acid propyl ester/tetradecane
  7857. propanoic acid propyl ester/trichloromethane
  7858. propanoic acid propyl ester/tridecane
  7859. propanoic acid propyl ester/undecane
  7860. propanoic acid propyl ester/water
  7861. propanoic acid samarium(3+) salt/water
  7862. propanoic acid silver(1+) salt/ethanol
  7863. propanoic acid silver(1+) salt/water
  7864. propanoic acid sodium salt/1,2-propanediol
  7865. propanoic acid sodium salt/acetic acid
  7866. propanoic acid sodium salt/acetic acid magnesium salt
  7867. propanoic acid sodium salt/formic acid sodium salt
  7868. propanoic acid sodium salt/methanol
  7869. propanoic acid sodium salt/N-methylacetamide
  7870. propanoic acid sodium salt/nitric acid lithium salt
  7871. propanoic acid sodium salt/nitric acid potassium salt
  7872. propanoic acid sodium salt/nitric acid sodium salt
  7873. propanoic acid sodium salt/nitrous acid sodium salt
  7874. propanoic acid sodium salt/propanoic acid
  7875. propanoic acid sodium salt/propanoic acid lithium salt
  7876. propanoic acid sodium salt/propanoic acid magnesium salt
  7877. propanoic acid sodium salt/propanoic acid potassium salt
  7878. propanoic acid sodium salt/thiocyanic acid potassium salt
  7879. propanoic acid sodium salt/thiocyanic acid sodium salt
  7880. propanoic acid sodium salt/water
  7881. propanoic acid/(1,1'-biphenyl)-4,4'-diamine
  7882. propanoic acid/(1-methylethyl)benzene
  7883. propanoic acid/(2R-(2α,6aα,12aα))-1,2,12,12a-tetrahydro-8,9-dimethoxy-2-(1-methylethenyl)-(1)benzopyrano(3,4-b)furo(2,3-h)(1)-benzopyran-6(6aH)-one
  7884. propanoic acid/1,1,2,2-tetrachloroethane
  7885. propanoic acid/1,2,3-trichloropropane
  7886. propanoic acid/1,2,4-trimethylbenzene
  7887. propanoic acid/1,2-benzenedicarboxylic acid
  7888. propanoic acid/1,2-dichlorobenzene
  7889. propanoic acid/1,2-dimethylbenzene
  7890. propanoic acid/1,3-dinitrobenzene
  7891. propanoic acid/1-bromo-2-methylbenzene
  7892. propanoic acid/1-butyl-1-methylpyrrolidinium bromide
  7893. propanoic acid/1-chloro-2-methylbenzene
  7894. propanoic acid/1-methyl-4-(1-methylethyl)-1,3-cyclohexadiene
  7895. propanoic acid/1-methyl-4-(1-methylethyl)benzene
  7896. propanoic acid/1-phenylethanone
  7897. propanoic acid/1H-indene
  7898. propanoic acid/2',3'-N-epoxypropyl-N-methyl-2-oxopyrrolidinium acetate
  7899. propanoic acid/2',3'-N-Epoxypropyl-N-methyl-2-oxopyrrolidinium salicylate
  7900. propanoic acid/2,2-dimethyl-3-methylenebicyclo[2.2.1]heptane
  7901. propanoic acid/2,3-Dihydroxypropyl-N-methyl-2-oxopyrrolidinium chloride
  7902. propanoic acid/2,6,6-trimethylbicyclo[3.1.1]hept-2-ene
  7903. propanoic acid/2-chlorobenzenamine
  7904. propanoic acid/2-furancarboxaldehyde
  7905. propanoic acid/2-methoxybenzenamine
  7906. propanoic acid/2-methylbenzenamine
  7907. propanoic acid/2-methylphenol
  7908. propanoic acid/2-methylpropanoic acid
  7909. propanoic acid/2-methylpropanoic acid 2-methylpropyl ester
  7910. propanoic acid/2-naphthalenamine
  7911. propanoic acid/2-propenoic acid
  7912. propanoic acid/3-methylbenzoic acid
  7913. propanoic acid/3-pentanone
  7914. propanoic acid/4-hydroxybenzoic acid
  7915. propanoic acid/4-hydroxybenzoic acid methyl ester
  7916. propanoic acid/5,10,15,20-tetraphenyl-21H,23H-porphine
  7917. propanoic acid/acetic acid methyl ester
  7918. propanoic acid/benzoic acid ethyl ester
  7919. propanoic acid/chloroacetic acid methyl ester
  7920. propanoic acid/N,N-diethylbenzenamine
  7921. propanoic acid/N-cyclopropyl-1,3,5-triazine-2,4,6-triamine
  7922. propanoic acid/N-Methyl-N-(2',3'-epoxypropyl)-2-oxopyrrolidinium chloride
  7923. propanoic acid/N-methylacetamide
  7924. propanoic acid/N-phenylbenzamide
  7925. propanoic acid/naphthalene
  7926. propanoic acid/nitrobenzene
  7927. propanoic acid/nitroethane
  7928. propanoic acid/paraffin
  7929. propanoic acid/phenanthrene
  7930. propanoic acid/quinoline
  7931. propanoic acid/soybean oil
  7932. propanoic acid/Thiamethoxam
  7933. propanoic acid/TKX-55
  7934. propanoic acid/Zaltoprofen
  7935. propargyl acrylate/carbon dioxide
  7936. propoxybenzene/3,7-dimethyl-1,6-octadien-3-ol
  7937. propoxybenzene/4-methylpentanoic acid
  7938. propoxybenzene/water
  7939. propoxypropanol/1,3-bis(1-methylethyl)benzene
  7940. propoxypropanol/1-butanol
  7941. propoxypropanol/1-propanol
  7942. propoxypropanol/2-butanol
  7943. propoxypropanol/methanol
  7944. propoxypropanol/water
  7945. propoxypropanol/water
  7946. Propyl 6-benzoyl-2-(methoxycarbonylamino)benzimidazole-1-carboxylate/Propyl 5-benzoyl-2-(methoxycarbonylamino)benzimidazole-1-carboxylate
  7947. propyl furoate/naphthalene
  7948. propylbenzene/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)
  7949. propylbenzene/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)
  7950. propylbenzene/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)
  7951. propylbenzene/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)
  7952. propylbenzene/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)
  7953. propylbenzene/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)
  7954. propylbenzene/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)
  7955. propylbenzene/(2'-chloroethyl)benzene
  7956. propylbenzene/(3-chloropropyl)benzene
  7957. propylbenzene/(methylsulfinyl)(methylthio)methane
  7958. propylbenzene/(phenylmethyl)-1,1'-biphenyl
  7959. propylbenzene/1,1',1''-(methylidynetris(oxy))trisethane
  7960. propylbenzene/1,1'-oxybis(2-chloroethane)
  7961. propylbenzene/1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluoroheptane
  7962. propylbenzene/1,1,2,2-tetrabromoethane
  7963. propylbenzene/1,1,2,2-tetrachloroethane
  7964. propylbenzene/1,2,3,4-tetrahydronaphthalene
  7965. propylbenzene/1,2,3-propanetriol
  7966. propylbenzene/1,2-benzenedicarboxylic acid dinonyl ester
  7967. propylbenzene/1,2-dichloroethane
  7968. propylbenzene/1,2-ethanediol
  7969. propylbenzene/1,2-ethanediol diacetate
  7970. propylbenzene/1,3,5-trimethylbenzene
  7971. propylbenzene/1,3-dichloro-2-propanol
  7972. propylbenzene/1,3-Didecyl-2-methylimidazolium dicyanamide
  7973. propylbenzene/1,3-dimethyl-1H-imidazolium salt with sulfuric acid monomethyl ester (1:1)
  7974. propylbenzene/1,3-dioxolan-2-one
  7975. propylbenzene/1,3-propanediol ester with 2,3,5,6-tetrachloro-1,4-benzenedicarboxylic acid monobutyl ester (1:2)
  7976. propylbenzene/1,3-propanediol ester with 2,3,5,6-tetrachloro-1,4-benzenedicarboxylic acid monopropyl ester (1:2)
  7977. propylbenzene/1,4-dioxane
  7978. propylbenzene/1-(3-Hydroxypropyl)-1-methylmorpholinium dicyanamide
  7979. propylbenzene/1-(3-Hydroxypropyl)-3-methylimidazolium dicyanamide
  7980. propylbenzene/1-(3-Hydroxypropyl)pyridinium dicyanamide
  7981. propylbenzene/1-(4-Methoxy-4-oxobutyl)-3-methylimidazolium dicyanamide
  7982. propylbenzene/1-allyl-3-methylimidazolium dicyanamide
  7983. propylbenzene/1-Allyl-3-vinylimidazolium bis(trifluoromethylsulfonyl)imide
  7984. propylbenzene/1-benzyl-3-methylimidazolium dicyanamide
  7985. propylbenzene/1-bromohexadecane
  7986. propylbenzene/1-butanol
  7987. propylbenzene/1-butyl-1-methyl-1H-pyrrolidinium tris(pentafluoroethyl) trifluorophosphate</