DETHERM database directory

Systems with 3 component(s): 30001 - 40000

The given links are permalinks. The order of the systems and the system number instead can change anytime.

  1. hydrochloric acid/water/mercury chloride (HgCl2) compd. with mercury oxide (HgO) (1:2)
  2. hydrochloric acid/water/N-methylacetamide
  3. hydrochloric acid/water/neodymium(3+) (OC-6-11)-hexakis(cyano-κC)cobaltate(3-) (1:1)
  4. hydrochloric acid/water/nitric acid potassium salt
  5. hydrochloric acid/water/oxobismuth hydrochloride
  6. hydrochloric acid/water/oxygen
  7. hydrochloric acid/water/phosphinic acid scandium(3+) salt (3:1)
  8. hydrochloric acid/water/poly(acrylic acid)
  9. hydrochloric acid/water/potassium bromide (KBr)
  10. hydrochloric acid/water/propanamide
  11. hydrochloric acid/water/rubidium chloride (RbCl)
  12. hydrochloric acid/water/silver chloride (AgCl)
  13. hydrochloric acid/water/sodium rubidium tetraborate (NaRb(B4O5(OH)4)) tetrahydrate
  14. hydrochloric acid/water/sulfuric acid calcium salt (1:1)
  15. hydrochloric acid/water/sulfuric acid disodium salt
  16. hydrochloric acid/water/sulfuric acid nickel(2+) salt (1:1)
  17. hydrochloric acid/water/tetrapotassium decachlorooxorhenate(4-)
  18. hydrochloric acid/water/thallium chloride (TlCl)
  19. hydrochloric acid/water/thiosulfuric acid (H2S2O3) disodium salt
  20. hydrochloric acid/water/tin chloride (SnCl2)
  21. hydrochloric acid/water/tributyl(tetradecyl)phosphonium chloride
  22. hydrochloric acid/water/triimidazolium nonaborate ((C3H5N2)3(B9O12(OH)6))
  23. hydrochloric acid/water/tris(DL-α-alanine)bis(glycine)neodymium trichloride dihydrate
  24. hydrochloric acid/water/tungstic acid (H2WO4)
  25. hydrochloric acid/water/ytterbium(3+) (OC-6-11)-hexakis(cyano-κC)cobaltate(3-) (1:1)
  26. hydrochloric acid/water/yttrium(3+) (OC-6-11)-hexakis(cyano-κC)cobaltate(3-) (1:1)
  27. hydrocyanic acid/potassium chloride (KCl)/water
  28. hydrofluoric acid-d/beryllium fluoride (BeF2)/lithium fluoride (LiF)
  29. hydrofluoric acid/(OC-6-11)-uranium fluoride (UF6)/chlorine fluoride (ClF3)
  30. hydrofluoric acid/beryllium fluoride (BeF2)/lithium fluoride (LiF)
  31. hydrofluoric acid/hydrogen peroxide (H2O2)/water
  32. hydrofluoric acid/nitric acid/water
  33. hydrofluoric acid/potassium fluoride (KF)/lithium fluoride (LiF)
  34. hydrofluoric acid/sodium fluoride (NaF)/(T-4)-zirconium fluoride (ZrF4)
  35. hydrofluoric acid/sodium fluoride (NaF)/thallium(1+) (OC-6-11)-hexafluoroantimonate(1-)
  36. hydrofluoric acid/sodium fluoride (NaF)/water
  37. hydrofluoric acid/sulfuric acid/water
  38. hydrofluoric acid/water/(T-4)-zirconium fluoride (ZrF4)
  39. hydrofluoric acid/water/1,2-ethanediamine (OC-6-11)-hexafluorostannate(2-)
  40. hydrofluoric acid/water/2-methyl-1-propanol
  41. hydrofluoric acid/water/aluminum fluoride (AlF3)
  42. hydrofluoric acid/water/barium fluoride (BaF2)
  43. hydrofluoric acid/water/benzenamine hydrofluoride
  44. hydrofluoric acid/water/cadmium fluoride (CdF2)
  45. hydrofluoric acid/water/calcium fluoride (CaF2)
  46. hydrofluoric acid/water/cesium antimony fluoride
  47. hydrofluoric acid/water/cesium diantimony fluoride
  48. hydrofluoric acid/water/copper fluoride (CuF2)
  49. hydrofluoric acid/water/diammonium (OC-6-21)-pentafluorooxoniobate(2-)
  50. hydrofluoric acid/water/dicesium antimony fluoride
  51. hydrofluoric acid/water/dipotassium (OC-6-11)-hexafluorogermanate(2-)
  52. hydrofluoric acid/water/hafnium oxide fluoride (HrOF2)
  53. hydrofluoric acid/water/indium fluoride (InF3)
  54. hydrofluoric acid/water/iron fluoride (FeF3)
  55. hydrofluoric acid/water/lead fluoride (PbF2)
  56. hydrofluoric acid/water/magnesium fluoride (MgF2)
  57. hydrofluoric acid/water/manganese fluoride (MnF2)
  58. hydrofluoric acid/water/nitric acid cesium salt
  59. hydrofluoric acid/water/oxonium tetrafluoroborate(1-)
  60. hydrofluoric acid/water/plutonyl fluoride
  61. hydrofluoric acid/water/potassium fluoride (KF)
  62. hydrofluoric acid/water/silver fluoride (AgF)
  63. hydrofluoric acid/water/strontium fluoride (SrF2)
  64. hydrofluoric acid/water/trifluorostibine
  65. hydrofluoric acid/water/zinc fluoride (ZnF2)
  66. hydrogen (1,2-cyclohexylenedinitrilo)tetraacetatoferrate(1-)/dimethyl disulfide/water
  67. hydrogen (1,2-cyclohexylenedinitrilo)tetraacetatoferrate(1-)/water/oxygen
  68. hydrogen (l-leucinato-κN,κO)(sulfato(2-)-κO)zincate(1-)hydrate (2:1)/hydrochloric acid/water
  69. hydrogen (sulfato(2-)-κO)(L-threoninato-κN,κO1)zincate(1-) monohydrate/hydrochloric acid/water
  70. hydrogen (sulfato(2-)-κO)(L-valinato-κN,κO)zincate(1-) monohydrate/hydrochloric acid/water
  71. hydrogen (T-4)-(L-histidinato-κN,κN3,κO)(sulfato(2-)-κO)zincate(1-) monohydrate/hydrochloric acid/water
  72. hydrogen (T-4)-(L-methioninato-κN,κO,κS)(sulfato(2-)-κO)zincate(1-) monohydrate/hydrochloric acid/water
  73. hydrogen (T-4)-dichloro(L-histidinato-κN,κO)zincate(1-) hydrate (2:1)/hydrochloric acid/water
  74. hydrogen (T-4)-rhenate(ReO4(1-))/nitric acid/water
  75. hydrogen (T-4)-rhenate(ReO4(1-))/sulfuric acid/water
  76. hydrogen (T-4)-trifluorohydroxyborate(1-)/water/oxonium tetrafluoroborate(1-)
  77. hydrogen ion/chromate (Cr2O7(2-))/water
  78. hydrogen ion/water/2-Keto-L-gulonate(1-) anion
  79. hydrogen peroxide (H2O2)/diazanium sulfonatooxy sulfate/water
  80. hydrogen peroxide (H2O2)/diphosphoric acid tetrasodium salt/water
  81. hydrogen peroxide (H2O2)/dipotassium sulfonatooxy sulfate/water
  82. hydrogen peroxide (H2O2)/water/1,2-benzenedicarboxylic acid diethyl ester
  83. hydrogen peroxide (H2O2)/water/2-butanone
  84. hydrogen peroxide (H2O2)/water/2-methyl-2-propenoic acid methyl ester
  85. hydrogen peroxide (H2O2)/water/acetic acid methyl ester
  86. hydrogen peroxide (H2O2)/water/bis(diphenylmethylphosphoryl)dioxomolybdenum(IV) dibromide
  87. hydrogen peroxide (H2O2)/water/bis(diphenylmethylphosphoryl)dioxomolybdenum(IV) dichloride
  88. hydrogen peroxide (H2O2)/water/bis(triphenylphosphoryl)dioxomolybdenum(IV) dibromide
  89. hydrogen peroxide (H2O2)/water/bis(triphenylphosphoryl)dioxomolybdenum(IV) dichloride
  90. hydrogen peroxide (H2O2)/water/boric acid (HBO2) sodium salt
  91. hydrogen peroxide (H2O2)/water/chlorine
  92. hydrogen peroxide (H2O2)/water/disodium sulfonatooxy sulfate
  93. hydrogen peroxide (H2O2)/water/magnesium chloride (MgCl2)
  94. hydrogen peroxide (H2O2)/water/nitric acid potassium salt
  95. hydrogen peroxide (H2O2)/water/oxygen
  96. hydrogen peroxide (H2O2)/water/perchloric acid lithium salt
  97. hydrogen peroxide (H2O2)/water/perchloric acid potassium salt
  98. hydrogen peroxide (H2O2)/water/phosphoric acid dipotassium salt
  99. hydrogen peroxide (H2O2)/water/phosphoric acid monopotassium salt
  100. hydrogen peroxide (H2O2)/water/selenic acid diammonium salt
  101. hydrogen peroxide (H2O2)/water/selenic acid dipotassium salt
  102. hydrogen peroxide (H2O2)/water/sulfuric acid diammonium salt
  103. hydrogen peroxide (H2O2)/water/sulfuric acid dipotassium salt
  104. hydrogen peroxide (H2O2)/water/sulfuric acid disodium salt
  105. hydrogen sulfide (H2S)/1-methyl-2-pyrrolidinone/2-(2-aminoethoxy)ethanol
  106. hydrogen tetraphenylborate(1-) compd. with 1-propanamine (1:1)/acetonitrile/water
  107. hydrogen tetraphenylborate(1-) compd. with methanamine (1:1)/acetonitrile/water
  108. hydrogen tetraphenylborate(1-) compd. with N,N-dimethylmethanamine (1:1)/1,2,3-propanetriol/water
  109. hydrogen tetraphenylborate(1-) compd. with N,N-dimethylmethanamine (1:1)/N,N-dimethylformamide/water
  110. hydrogen tetraphenylborate(1-) compd. with N,N-dimethylmethanamine (1:1)/sulfinylbismethane/water
  111. hydrogen/α-D-glucopyranose/water
  112. hydrogen/β-D-fructofuranosyl α-D-glucopyranoside/water
  113. hydrogen/(1-methylethyl)cyclohexane/hydrogen sulfide (H2S)
  114. hydrogen/(OC-6-11)-sulfur fluoride (SF6)/water
  115. hydrogen/1,1-dimethylcyclohexane/water
  116. hydrogen/1,2,3-propanetriol/water
  117. hydrogen/1,2-dimethylcyclohexane/water
  118. hydrogen/1,3-dioxolane/water
  119. hydrogen/1-butyl-3-methyl-1H-imidazolium tetrafluoroborate(1-)/(-)-1,2-bis((2R,5R)-2,5-dimethylphospholano)benzene (cyclooctadiene)rhodium(I) tetrafluoroborate(1-)
  120. hydrogen/1-butyl-3-methyl-1H-imidazolium tetrafluoroborate(1-)/1-methyl-3-octyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  121. hydrogen/1-ethyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)/water
  122. hydrogen/1-ethyl-3-methyl-1H-imidazolium tetrafluoroborate(1-)/1-methyl-3-octyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  123. hydrogen/1-hexadecanol/propane
  124. hydrogen/2,2,2-trichloro-1,1-ethanediol/water
  125. hydrogen/2,2,2-trifluoroethanol/water
  126. hydrogen/2,2,3-trimethylbutane/water
  127. hydrogen/2,2,4-trimethylpentane/methane
  128. hydrogen/2,2-dimethylbutane/water
  129. hydrogen/2,3-dimethyl-1-butene/water
  130. hydrogen/2,5-dihydrofuran/water
  131. hydrogen/2-aminoethanol/water
  132. hydrogen/2-methoxy-2-methylpropane/water
  133. hydrogen/2-methyl-2-propanamine/water
  134. hydrogen/2-methyl-2-propanol/water
  135. hydrogen/2-propanol/2-propanone
  136. hydrogen/2-propanol/water
  137. hydrogen/2-propanone/benzene
  138. hydrogen/2-propanone/water
  139. hydrogen/3,3-dimethyl-1-butene/water
  140. hydrogen/3,3-dimethylpentane/water
  141. hydrogen/acetamide/water
  142. hydrogen/acetic acid/water
  143. hydrogen/aluminum chloride (AlCl3)/water
  144. hydrogen/ammonia/nitrogen
  145. hydrogen/argon/nitrogen
  146. hydrogen/argon/Stainless Steel Alloy (Type 304L)
  147. hydrogen/benzene/1,1,2-trichloro-1,2,2-trifluoroethane
  148. hydrogen/benzene/methane
  149. hydrogen/benzene/nitrogen
  150. hydrogen/benzene/water
  151. hydrogen/boric acid (HBO2) potassium salt/water
  152. hydrogen/carbon monoxide/methane
  153. hydrogen/carbon monoxide/nitrogen
  154. hydrogen/carbon monoxide/propane
  155. hydrogen/carbon monoxide/water
  156. hydrogen/carbon oxide sulfide (COS)/methanol
  157. hydrogen/carbonic acid dipotassium salt/water
  158. hydrogen/carbonic acid disodium salt/water
  159. hydrogen/cis-decahydronaphthalene/naphthalene
  160. hydrogen/cis-decahydronaphthalene/trans-decahydronaphthalene
  161. hydrogen/cycloheptane/water
  162. hydrogen/cycloheptene/water
  163. hydrogen/cyclopentane/2-propanone
  164. hydrogen/cyclopentane/water
  165. hydrogen/cyclopropane/water
  166. hydrogen/D-glucitol/water
  167. hydrogen/D-glucose/water
  168. hydrogen/D-xylose/water
  169. hydrogen/deuterium mol. with hydrogen (HD)/deuterium
  170. hydrogen/DL-alanine/water
  171. hydrogen/ethane/9-methylanthracene
  172. hydrogen/ethane/ethene
  173. hydrogen/ethane/water
  174. hydrogen/ethanol/water
  175. hydrogen/ethene/propane
  176. hydrogen/ethene/water
  177. hydrogen/glycine/water
  178. hydrogen/heptane/ethene
  179. hydrogen/heptane/methane
  180. hydrogen/hexadecane/benzene
  181. hydrogen/hexadecane/water
  182. hydrogen/hexadecanoic acid 1,2,3-propanetriyl ester/propane
  183. hydrogen/hydrochloric acid/chlorine
  184. hydrogen/hydrochloric acid/water
  185. hydrogen/krypton/argon
  186. hydrogen/lithium chloride (LiCl)/water
  187. hydrogen/methane/1,2,4-trimethylbenzene
  188. hydrogen/methane/1-methylnaphthalene
  189. hydrogen/methane/9-methylanthracene
  190. hydrogen/methane/ammonia
  191. hydrogen/methane/coal liquid cut wa-5
  192. hydrogen/methane/coal liquid cut wa-6
  193. hydrogen/methane/coal liquid i
  194. hydrogen/methane/coal liquid II
  195. hydrogen/methane/coal liquid III
  196. hydrogen/methane/ethane
  197. hydrogen/methane/ethene
  198. hydrogen/methane/nitrogen
  199. hydrogen/methane/propane
  200. hydrogen/methane/quinoline
  201. hydrogen/methane/water
  202. hydrogen/methanol/1-methoxy-2-nitrobenzene
  203. hydrogen/methanol/2-methoxybenzenamine
  204. hydrogen/methanol/hydrogen sulfide (H2S)
  205. hydrogen/methanol/nitrobenzene
  206. hydrogen/methanol/nitrogen
  207. hydrogen/N,N,N-tributyl-1-butanaminium bromide/water
  208. hydrogen/N,N,N-tributyl-1-butanaminium fluoride/water
  209. hydrogen/N,N,N-tributyl-1-butanaminium hydroxide/water
  210. hydrogen/N,N,N-tributyl-1-butanaminium nitrate/water
  211. hydrogen/N,N-dimethylmethanamine/water
  212. hydrogen/neon/nitrogen
  213. hydrogen/neon/oxygen
  214. hydrogen/niobium/nitrogen
  215. hydrogen/nitric acid ammonium salt/water
  216. hydrogen/nitric acid sodium salt/water
  217. hydrogen/nitric acid/water
  218. hydrogen/nitrogen/oxygen
  219. hydrogen/nitrogen/water
  220. hydrogen/octacosane/carbon monoxide
  221. hydrogen/potassium chloride (KCl)/water
  222. hydrogen/potassium iodide (KI)/water
  223. hydrogen/propane/2-methylpropanoic acid 3-hydroxy-2,2,4-trimethylpentyl ester
  224. hydrogen/propane/9-methylanthracene
  225. hydrogen/propane/ammonia
  226. hydrogen/propane/soybean oil
  227. hydrogen/propane/sunflower oil
  228. hydrogen/propane/water
  229. hydrogen/sodium chloride (NaCl)/water
  230. hydrogen/sulfinylbismethane/water
  231. hydrogen/sulfuric acid magnesium salt (1:1)/water
  232. hydrogen/sulfuric acid/water
  233. hydrogen/tetrabutylphosphonium bromide/water
  234. hydrogen/tetrahydro-2H-pyran/water
  235. hydrogen/trans-decahydronaphthalene/naphthalene
  236. hydrogen/urea/2-hydroxy-N,N,N-trimethylethanaminium chloride
  237. hydrogen/urea/water
  238. hydrogen/water/(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxane-3,4,5-triol
  239. hydrogen/water/1,1,1,3,3,3-hexafluoro-2-propanol
  240. hydrogen/water/1-methyl-2-pyrrolidinone
  241. hydrogen/water/2,3-dimethylbutane
  242. hydrogen/water/3,3-dimethyl-1-butyne
  243. hydrogen/water/chloroacetic acid
  244. hydrogen/water/dextrin
  245. hydrogen/water/gelatin
  246. hydrogen/water/mannitol
  247. hydrogen/water/methylcyclopentane
  248. hydrogen/water/nitric acid potassium salt
  249. hydrogen/water/phosphoric acid dipotassium salt
  250. hydrogen/water/potassium bromide (KBr)
  251. hydrogen/water/propanoic acid
  252. hydrogen/water/quinoline
  253. hydrogen/water/sulfuric acid disodium salt
  254. hydrogen/water/sulfuric acid manganese(2+) salt (1:1)
  255. hydrogen/water/sulfuric acid zinc salt (1:1)
  256. hydrogen/water/tributylphosphine oxide
  257. hydrogen/water/xylitol
  258. hydrogensulfate anion/potassium ion (K(1+))/water
  259. hydroxy-(hydroxy-dioxochromio)oxy-dioxochromium; pyridine/N,N-dimethylformamide/water
  260. hydroxylamine hydrochloride/water/cerium chloride (CeCl3)
  261. hydroxylamine hydrofluoride/hydrofluoric acid/water
  262. hydroxylamine sulfate (2:1)/ethanol/water
  263. hydroxylamine sulfate (2:1)/glycine/water
  264. hydroxylamine sulfate (2:1)/L-alanine/water
  265. hydroxylamine sulfate (2:1)/L-arginine/water
  266. hydroxylamine sulfate (2:1)/water/sulfuric acid diammonium salt
  267. hydroxylapatite (Ca5(OH)(PO4)3)/1-butanol/acetonitrile
  268. hydroxylapatite (Ca5(OH)(PO4)3)/hydrochloric acid/water
  269. hydroxylapatite (Ca5(OH)(PO4)3)/perchloric acid/water
  270. hydroxymethanesulfinic acid monosodium salt/ethanol/water
  271. hydroxymethylurea/carbonic acid monosodium salt/water
  272. hydroxymethylurea/nitric acid calcium salt/water
  273. hydroxymethylurea/nitric acid magnesium salt/water
  274. hydroxyurea/glycine/water
  275. hydroxyurea/sodium iodide (NaI)/water
  276. hydroxyurea/urea/water
  277. hydroxyurea/water/nitric acid potassium salt
  278. hypochlorous acid 1,1-dimethylethyl ester/2-methyl-2-propanol/water
  279. hypochlorous acid lithium salt/lithium chloride (LiCl)/water
  280. hypochlorous acid sodium salt/water/hypochlorous acid calcium salt
  281. imidazol-1-ium chloride/1,2,3-propanetriol/ammonia
  282. imidazol-1-ium chloride/water/phosphoric acid tripotassium salt
  283. imidodicarbonic diamide/cerium(III) acetate/water
  284. imidodicarbonic diamide/cobalt chloride (CoCl2)/water
  285. imidodicarbonic diamide/formic acid iron(2+) salt/water
  286. imidodicarbonic diamide/formic acid manganese(2+) salt/water
  287. imidodicarbonic diamide/formic acid nickel(2+) salt/water
  288. imidodicarbonic diamide/formic acid zinc salt/water
  289. imidodicarbonic diamide/neodymium bromide (NdBr3)/water
  290. imidodicarbonic diamide/nitric acid ammonium salt/water
  291. imidodicarbonic diamide/nitric acid copper(2+) salt/water
  292. imidodicarbonic diamide/nitric acid sodium salt/water
  293. imidodicarbonic diamide/phosphoric acid monoammonium salt/water
  294. imidodicarbonic diamide/potassium chloride (KCl)/water
  295. imidodicarbonic diamide/sodium chloride (NaCl)/water
  296. imidodicarbonic diamide/thiocyanic acid ammonium salt/water
  297. imidodicarbonic diamide/urea/nitric acid potassium salt
  298. imidodicarbonic diamide/urea/nitric acid sodium salt
  299. imidodicarbonic diamide/water/acetic acid lanthanum(3+) salt
  300. imidodicarbonic diamide/water/cerium chloride (CeCl3)
  301. imidodicarbonic diamide/water/manganese chloride (MnCl2)
  302. imidodicarbonic diamide/water/nitric acid lithium salt
  303. imidodicarbonic diamide/water/nitric acid potassium salt
  304. imidodicarbonic diamide/water/sulfuric acid diammonium salt
  305. inderite (MgH7(BO3)3.4H2O)/hydrochloric acid/water
  306. indium bromide (InBr)/water/nitric acid potassium salt
  307. indium bromide (InBr3)/sodium bromide (NaBr)/water
  308. indium chloride (InCl)/potassium chloride (KCl)/zinc chloride (ZnCl2)
  309. indium chloride (InCl)/water/nitric acid potassium salt
  310. indium chloride (InCl)/zinc chloride (ZnCl2)/sodium chloride (NaCl)
  311. indium chloride (InCl3)/1,4-dioxane/water
  312. indium chloride (InCl3)/acetonitrile/water
  313. indium chloride (InCl3)/aluminum chloride (AlCl3)/thallium chloride (TlCl)
  314. indium chloride (InCl3)/ammonium chloride ((NH4)Cl)/water
  315. indium chloride (InCl3)/barium chloride (BaCl2)/water
  316. indium chloride (InCl3)/cadmium chloride (CdCl2)/water
  317. indium chloride (InCl3)/calcium chloride (CaCl2)/water
  318. indium chloride (InCl3)/cesium chloride (CsCl)/water
  319. indium chloride (InCl3)/diphosphoric acid tetracesium salt/water
  320. indium chloride (InCl3)/diphosphoric acid/water
  321. indium chloride (InCl3)/hydrochloric acid/water
  322. indium chloride (InCl3)/lithium chloride (LiCl)/water
  323. indium chloride (InCl3)/mercury chloride (HgCl2)/water
  324. indium chloride (InCl3)/potassium chloride (KCl)/cesium chloride (CsCl)
  325. indium chloride (InCl3)/potassium chloride (KCl)/magnesium chloride (MgCl2)
  326. indium chloride (InCl3)/potassium chloride (KCl)/sodium chloride (NaCl)
  327. indium chloride (InCl3)/potassium chloride (KCl)/water
  328. indium chloride (InCl3)/pyridine/water
  329. indium chloride (InCl3)/sodium chloride (NaCl)/iron chloride (FeCl2)
  330. indium chloride (InCl3)/sodium chloride (NaCl)/water
  331. indium chloride (InCl3)/strontium chloride (SrCl2)/water
  332. indium chloride (InCl3)/sulfuric acid indium(3+) salt (3:2)/water
  333. indium chloride (InCl3)/water/beryllium chloride (BeCl2)
  334. indium chloride (InCl3)/water/magnesium chloride (MgCl2)
  335. indium chloride (InCl3)/water/phosphonato phosphate; rubidium(+1) cation
  336. indium chloride (InCl3)/water/rubidium chloride (RbCl)
  337. indium chloride (InCl3)/zinc chloride (ZnCl2)/water
  338. indium hydroxide (In(OH)3)/hydrochloric acid/water
  339. indium hydroxide (In(OH)3)/perchloric acid/water
  340. indium oxide (In2O3)/chromium oxide (CrO3)/water
  341. indium oxide (In2O3)/phosphorus oxide (P2O5)/water
  342. indium oxide (In2O3)/selenium oxide (SeO2)/water
  343. indium oxide (In2O3)/water/2-methylpropanoic acid
  344. indium sodium sulfide (NaInS2)/sodium sulfide (Na2S)/water
  345. inosine/2-propanol/N,N-dimethylformamide
  346. inosine/ethanol/N,N-dimethylformamide
  347. inosine/ethanol/water
  348. inosine/N,N-dimethylformamide/1-propanol
  349. iodic acid (HIO3) aluminum salt/iodic acid (HIO3) sodium salt/water
  350. iodic acid (HIO3) aluminum salt/water/iodic acid (HIO3)
  351. iodic acid (HIO3) aluminum salt/water/iodic acid (HIO3) calcium salt
  352. iodic acid (HIO3) ammonium salt/iodic acid (HIO3) lithium salt/water
  353. iodic acid (HIO3) ammonium salt/water/iodic acid (HIO3)
  354. iodic acid (HIO3) ammonium salt/water/iodic acid (HIO3) magnesium salt
  355. iodic acid (HIO3) cerium(3+) salt/ethanol/water
  356. iodic acid (HIO3) cerium(3+) salt/methanol/water
  357. iodic acid (HIO3) cerium(3+) salt/sulfinylbismethane/water
  358. iodic acid (HIO3) cerium(3+) salt/sulfuric acid magnesium salt (1:1)/water
  359. iodic acid (HIO3) cerium(3+) salt/water/magnesium chloride (MgCl2)
  360. iodic acid (HIO3) cerium(3+) salt/water/nitric acid potassium salt
  361. iodic acid (HIO3) cerium(3+) salt/water/sulfuric acid dipotassium salt
  362. iodic acid (HIO3) cesium salt/2-methyl-2-propanol/water
  363. iodic acid (HIO3) cesium salt/2-propanol/water
  364. iodic acid (HIO3) cesium salt/acetonitrile/water
  365. iodic acid (HIO3) cesium salt/iodic acid (HIO3) lithium salt/water
  366. iodic acid (HIO3) cesium salt/methanol/water
  367. iodic acid (HIO3) cesium salt/water/iodic acid (HIO3)
  368. iodic acid (HIO3) cesium salt/water/iodic acid (HIO3) potassium salt
  369. iodic acid (HIO3) cesium salt/water/nitric acid cesium salt
  370. iodic acid (HIO3) copper(2+) salt/D-alanine/water
  371. iodic acid (HIO3) copper(2+) salt/glycine/water
  372. iodic acid (HIO3) copper(2+) salt/methanol/1-methyl-2-pyrrolidinone
  373. iodic acid (HIO3) copper(2+) salt/methanol/N,N-dimethylformamide
  374. iodic acid (HIO3) copper(2+) salt/methanol/sulfinylbismethane
  375. iodic acid (HIO3) copper(2+) salt/potassium chloride (KCl)/water
  376. iodic acid (HIO3) copper(2+) salt/sulfinylbismethane/water
  377. iodic acid (HIO3) copper(2+) salt/water/1-methyl-2-pyrrolidinone
  378. iodic acid (HIO3) copper(2+) salt/water/nitric acid lithium salt
  379. iodic acid (HIO3) copper(2+) salt/water/perchloric acid lithium salt
  380. iodic acid (HIO3) dysprosium(3+) salt/ethanol/water
  381. iodic acid (HIO3) dysprosium(3+) salt/methanol/water
  382. iodic acid (HIO3) dysprosium(3+) salt/sulfinylbismethane/water
  383. iodic acid (HIO3) erbium(3+) salt/ethanol/water
  384. iodic acid (HIO3) erbium(3+) salt/methanol/water
  385. iodic acid (HIO3) erbium(3+) salt/sulfinylbismethane/water
  386. iodic acid (HIO3) europium(3+) salt/ethanol/water
  387. iodic acid (HIO3) europium(3+) salt/methanol/water
  388. iodic acid (HIO3) europium(3+) salt/sulfinylbismethane/water
  389. iodic acid (HIO3) gadolinium(3+) salt/ethanol/water
  390. iodic acid (HIO3) gadolinium(3+) salt/methanol/water
  391. iodic acid (HIO3) gadolinium(3+) salt/sulfinylbismethane/water
  392. iodic acid (HIO3) holmium(3+) salt/ethanol/water
  393. iodic acid (HIO3) holmium(3+) salt/methanol/water
  394. iodic acid (HIO3) holmium(3+) salt/sulfinylbismethane/water
  395. iodic acid (HIO3) indium(3+) salt/iodic acid (HIO3) aluminum salt/water
  396. iodic acid (HIO3) indium(3+) salt/nitric acid/water
  397. iodic acid (HIO3) lanthanum(3+) salt/1,2,3-propanetriol/water
  398. iodic acid (HIO3) lanthanum(3+) salt/1-propanol/water
  399. iodic acid (HIO3) lanthanum(3+) salt/2-propanone/water
  400. iodic acid (HIO3) lanthanum(3+) salt/acetic acid ethyl ester/water
  401. iodic acid (HIO3) lanthanum(3+) salt/ethanol/water
  402. iodic acid (HIO3) lanthanum(3+) salt/iodic acid (HIO3) sodium salt/water
  403. iodic acid (HIO3) lanthanum(3+) salt/methanol/water
  404. iodic acid (HIO3) lanthanum(3+) salt/nitric acid sodium salt/water
  405. iodic acid (HIO3) lanthanum(3+) salt/potassium chloride (KCl)/water
  406. iodic acid (HIO3) lanthanum(3+) salt/sulfuric acid magnesium salt (1:1)/water
  407. iodic acid (HIO3) lanthanum(3+) salt/water/iodic acid (HIO3) potassium salt
  408. iodic acid (HIO3) lanthanum(3+) salt/water/magnesium chloride (MgCl2)
  409. iodic acid (HIO3) lanthanum(3+) salt/water/sulfuric acid dipotassium salt
  410. iodic acid (HIO3) lead(2+) salt/acetic acid ammonium salt/water
  411. iodic acid (HIO3) lead(2+) salt/D-alanine/water
  412. iodic acid (HIO3) lead(2+) salt/glycine/water
  413. iodic acid (HIO3) lead(2+) salt/water/iodic acid (HIO3) potassium salt
  414. iodic acid (HIO3) lead(2+) salt/water/nitric acid potassium salt
  415. iodic acid (HIO3) lead(2+) salt/water/perchloric acid ammonium salt
  416. iodic acid (HIO3) lithium salt/formic acid lithium salt/water
  417. iodic acid (HIO3) lithium salt/iodic acid (HIO3) aluminum salt/water
  418. iodic acid (HIO3) lithium salt/iodic acid (HIO3) dysprosium(3+) salt/water
  419. iodic acid (HIO3) lithium salt/iodic acid (HIO3) lutetium(3+) salt/water
  420. iodic acid (HIO3) lithium salt/iodic acid (HIO3) samarium(3+) salt/water
  421. iodic acid (HIO3) lithium salt/iodic acid (HIO3) sodium salt/water
  422. iodic acid (HIO3) lithium salt/iodic acid (HIO3) thulium(3+) salt/water
  423. iodic acid (HIO3) lithium salt/iodic acid (HIO3) ytterbium(3+) salt/water
  424. iodic acid (HIO3) lithium salt/lithium (T-4)-rhenate (ReO4(1-))/water
  425. iodic acid (HIO3) lithium salt/lithium chloride (LiCl)/water
  426. iodic acid (HIO3) lithium salt/periodic acid (H5IO6) pentalithium salt/water
  427. iodic acid (HIO3) lithium salt/water/iodic acid (HIO3)
  428. iodic acid (HIO3) lithium salt/water/iodic acid (HIO3)
  429. iodic acid (HIO3) lithium salt/water/iodic acid (HIO3)
  430. iodic acid (HIO3) lithium salt/water/iodic acid (HIO3) calcium salt
  431. iodic acid (HIO3) lithium salt/water/iodic acid (HIO3) magnesium salt
  432. iodic acid (HIO3) lithium salt/water/iodic acid (HIO3) potassium salt
  433. iodic acid (HIO3) lithium salt/water/nitric acid lithium salt
  434. iodic acid (HIO3) lutetium(3+) salt/ethanol/water
  435. iodic acid (HIO3) lutetium(3+) salt/methanol/water
  436. iodic acid (HIO3) lutetium(3+) salt/sulfinylbismethane/water
  437. iodic acid (HIO3) manganese(2+) salt/sodium chloride (NaCl)/water
  438. iodic acid (HIO3) manganese(2+) salt/water/iodic acid (HIO3) potassium salt
  439. iodic acid (HIO3) neodymium(3+) salt/ethanol/water
  440. iodic acid (HIO3) neodymium(3+) salt/iodic acid (HIO3) aluminum salt/water
  441. iodic acid (HIO3) neodymium(3+) salt/methanol/water
  442. iodic acid (HIO3) neodymium(3+) salt/sulfinylbismethane/water
  443. iodic acid (HIO3) potassium zinc salt (4:2:1) dihydrate/nitric acid/water
  444. iodic acid (HIO3) praseodymium(3+) salt/ethanol/water
  445. iodic acid (HIO3) praseodymium(3+) salt/methanol/water
  446. iodic acid (HIO3) praseodymium(3+) salt/sulfinylbismethane/water
  447. iodic acid (HIO3) rubidium salt/iodic acid (HIO3) cesium salt/water
  448. iodic acid (HIO3) rubidium salt/iodic acid (HIO3) lithium salt/water
  449. iodic acid (HIO3) rubidium salt/nitric acid/water
  450. iodic acid (HIO3) rubidium salt/water/iodic acid (HIO3)
  451. iodic acid (HIO3) rubidium salt/water/iodic acid (HIO3) magnesium salt
  452. iodic acid (HIO3) rubidium salt/water/iodic acid (HIO3) potassium salt
  453. iodic acid (HIO3) rubidium salt/water/iodic acid (HIO3) zinc salt
  454. iodic acid (HIO3) rubidium salt/water/nitric acid potassium salt
  455. iodic acid (HIO3) samarium(3+) salt/ethanol/water
  456. iodic acid (HIO3) samarium(3+) salt/methanol/water
  457. iodic acid (HIO3) samarium(3+) salt/sulfinylbismethane/water
  458. iodic acid (HIO3) sodium salt pentahydrate/copper chloride (CuCl2)/water
  459. iodic acid (HIO3) sodium salt pentahydrate/potassium chloride (KCl)/water
  460. iodic acid (HIO3) sodium salt pentahydrate/sodium chloride (NaCl)/water
  461. iodic acid (HIO3) sodium salt/sodium iodide (NaI)/water
  462. iodic acid (HIO3) sodium salt/water/chloric acid sodium salt
  463. iodic acid (HIO3) sodium salt/water/iodic acid (HIO3)
  464. iodic acid (HIO3) sodium salt/water/iodic acid (HIO3) calcium salt
  465. iodic acid (HIO3) sodium salt/water/iodic acid (HIO3) magnesium salt
  466. iodic acid (HIO3) sodium salt/water/iodic acid (HIO3) potassium salt
  467. iodic acid (HIO3) sodium salt/water/sulfuric acid disodium salt
  468. iodic acid (HIO3) strontium salt/methanol/water
  469. iodic acid (HIO3) strontium salt/N,N-dimethylformamide/water
  470. iodic acid (HIO3) terbium(3+) salt/ethanol/water
  471. iodic acid (HIO3) terbium(3+) salt/methanol/water
  472. iodic acid (HIO3) terbium(3+) salt/sulfinylbismethane/water
  473. iodic acid (HIO3) thallium(1+) salt/1,2-ethanedisulfonic acid disodium salt/water
  474. iodic acid (HIO3) thallium(1+) salt/1,3-propanedisulfonic acid disodium salt/water
  475. iodic acid (HIO3) thallium(1+) salt/1,4-butanedisulfonic acid disodium salt/water
  476. iodic acid (HIO3) thallium(1+) salt/1,5-pentanedisulfonic acid disodium salt/water
  477. iodic acid (HIO3) thallium(1+) salt/DL-alanine/water
  478. iodic acid (HIO3) thallium(1+) salt/ethanol/water
  479. iodic acid (HIO3) thallium(1+) salt/glycine/water
  480. iodic acid (HIO3) thallium(1+) salt/methanedisulfonic acid disodium salt/water
  481. iodic acid (HIO3) thallium(1+) salt/methanol/water
  482. iodic acid (HIO3) thallium(1+) salt/perchloric acid sodium salt/water
  483. iodic acid (HIO3) thallium(1+) salt/perchloric acid/water
  484. iodic acid (HIO3) thallium(1+) salt/potassium chloride (KCl)/water
  485. iodic acid (HIO3) thallium(1+) salt/sodium chloride (NaCl)/water
  486. iodic acid (HIO3) thallium(1+) salt/sodium fluoride (NaF)/water
  487. iodic acid (HIO3) thallium(1+) salt/thiocyanic acid potassium salt/water
  488. iodic acid (HIO3) thallium(1+) salt/water/1,10-decanedisulfonic acid disodium salt
  489. iodic acid (HIO3) thallium(1+) salt/water/1,14-tetradecanedisulfonic acid disodium salt
  490. iodic acid (HIO3) thallium(1+) salt/water/sulfuric acid dipotassium salt
  491. iodic acid (HIO3) thulium(3+) salt/ethanol/water
  492. iodic acid (HIO3) thulium(3+) salt/methanol/water
  493. iodic acid (HIO3) thulium(3+) salt/sulfinylbismethane/water
  494. iodic acid (HIO3) ytterbium(3+) salt/ethanol/water
  495. iodic acid (HIO3) ytterbium(3+) salt/methanol/water
  496. iodic acid (HIO3) ytterbium(3+) salt/sulfinylbismethane/water
  497. iodic acid cobalt(2+) salt/iodic acid (HIO3) sodium salt/water
  498. iodic acid cobalt(2+) salt/lithium bromide (LiBr)/water
  499. iodic acid cobalt(2+) salt/lithium chloride (LiCl)/water
  500. iodic acid cobalt(2+) salt/sodium chloride (NaCl)/water
  501. iodic acid cobalt(2+) salt/water/iodic acid (HIO3) potassium salt
  502. iodic acid cobalt(2+) salt/water/nitric acid lithium salt
  503. iodic acid cobalt(2+) salt/water/perchloric acid lithium salt
  504. iodic acid nickel(2+) salt/lithium bromide (LiBr)/water
  505. iodic acid nickel(2+) salt/lithium chloride (LiCl)/water
  506. iodic acid nickel(2+) salt/water/nitric acid lithium salt
  507. iodic acid nickel(2+) salt/water/perchloric acid lithium salt
  508. iodide/2-propanone/water
  509. iodine oxide (I2O7)/magnesium oxide (MgO)/water
  510. iodine oxide (I2O7)/sulfur(VI) trioxide/water
  511. iodine/hydrochloric acid/water
  512. iodine/nitric acid sodium salt/water
  513. iodine/nitric acid/water
  514. iodine/potassium iodide (KI)/water
  515. iodine/sodium bromide (NaBr)/water
  516. iodine/sodium chloride (NaCl)/water
  517. iodine/sodium iodide (NaI)/water
  518. iodine/sulfuric acid/water
  519. iodine/water/cadmium iodide (CdI2)
  520. iodine/water/cesium iodide (CsI)
  521. iodine/water/Europium (III) iodide pentaurea
  522. iodine/water/iron(II) iodide tetraacetamide dihydrate
  523. iodine/water/lanthanum(III) iodide pentaurea
  524. iodine/water/magnesium chloride (MgCl2)
  525. iodine/water/manganese iodide (MnI2)
  526. iodine/water/nitric acid lithium salt
  527. iodine/water/nitric acid potassium salt
  528. iodine/water/potassium bromide (KBr)
  529. iodine/water/rubidium bromide (RbBr)
  530. iodine/water/rubidium iodide (RbI)
  531. iodine/water/Samarium(III) iodide pentaurea
  532. iodobenzene/ammonia/water
  533. iodobenzene/methanol/water
  534. iodobenzene/water/nitric acid silver(1+) salt
  535. iodoic acid (HIO3) barium salt/1,2,3-propanetriol/water
  536. iodoic acid (HIO3) barium salt/1,2-ethanediol/water
  537. iodoic acid (HIO3) barium salt/1,4-dioxane/water
  538. iodoic acid (HIO3) barium salt/1-propanol/water
  539. iodoic acid (HIO3) barium salt/2-propanone/water
  540. iodoic acid (HIO3) barium salt/acetic acid ethyl ester/water
  541. iodoic acid (HIO3) barium salt/chloric acid potassium salt/water
  542. iodoic acid (HIO3) barium salt/DL-alanine/water
  543. iodoic acid (HIO3) barium salt/ethanol/water
  544. iodoic acid (HIO3) barium salt/glycine/water
  545. iodoic acid (HIO3) barium salt/methanol/water
  546. iodoic acid (HIO3) barium salt/N,N-dimethylformamide/water
  547. iodoic acid (HIO3) barium salt/potassium chloride (KCl)/water
  548. iodoic acid (HIO3) barium salt/tetrahydrofuran/water
  549. iodoic acid (HIO3) barium salt/water/bromic acid potassium salt
  550. iodoic acid (HIO3) barium salt/water/iodic acid (HIO3) potassium salt
  551. iodoic acid (HIO3) barium salt/water/magnesium chloride (MgCl2)
  552. iodoic acid (HIO3) barium salt/water/nitric acid potassium salt
  553. iodoic acid (HIO3) barium salt/water/perchloric acid potassium salt
  554. iridium chloride (IrCl3)/ammonium chloride ((NH4)Cl)/water
  555. iridium chloride (IrCl4)/ammonium chloride ((NH4)Cl)/water
  556. iridium chloride (IrCl4)/potassium chloride (KCl)/water
  557. iron chloride (FeCl2) tetrahydrate/hydrochloric acid/water
  558. iron chloride (FeCl2)/tin chloride (SnCl2)/cerium chloride (CeCl3)
  559. iron chloride (FeCl3) hexahydrate/1,2,3-propanetriol/2-hydroxy-N,N,N-trimethylethanaminium chloride
  560. iron chloride (FeCl3) hexahydrate/1,2-ethanediol/2-hydroxy-N,N,N-trimethylethanaminium chloride
  561. iron chloride (FeCl3) hexahydrate/N-glycylglycine/water
  562. iron chloride (FeCl3)/copper chloride (CuCl)/trichlorobismuthine
  563. iron chloride (FeCl3)/nickel chloride (NiCl2)/water
  564. iron chloride (FeCl3)/sodium (T-4)-tetrachloroaluminate(1-)/trichlorobismuthine
  565. iron chloride (FeCl3)/water/iron chloride (FeCl2)
  566. iron chloride (FeCl3)/water/N-methylacetamide
  567. iron chloride (FeCl3)/water/oxygen
  568. iron oxide (Fe2O3)/1H-imidazole/1-ethyl-3-butylbenzotriazolium hexafluorophosphate(1-)
  569. iron oxide (Fe2O3)/1H-imidazole/2-hydroxy-N,N,N-trimethylethanaminium chloride
  570. iron oxide (Fe2O3)/ethanedioic acid/water
  571. iron oxide (Fe2O3)/hydrochloric acid/water
  572. iron oxide (Fe2O3)/lanthanum oxide (La2O3)/tin oxide (SnO2)
  573. iron oxide (Fe2O3)/magnesium oxide (MgO)/lead fluoride (PbF2)
  574. iron oxide (Fe2O3)/molybdenum oxide (MoO3)/vanadium oxide (V2O5)
  575. iron oxide (Fe2O3)/N,N,N-tributyl-1-butanaminium bromide/1H-imidazole
  576. iron oxide (Fe2O3)/phosphorus oxide (P2O5)/water
  577. iron oxide (Fe2O3)/propanedioic acid/2-hydroxy-N,N,N-trimethylethanaminium chloride
  578. iron oxide (Fe2O3)/sodium chloride (NaCl)/water
  579. iron oxide (Fe2O3)/sodium sulfide (Na2S)/water
  580. iron oxide (Fe2O3)/sulfur(VI) trioxide/water
  581. iron oxide (Fe2O3)/sulfuric acid/water
  582. iron oxide (Fe2O3)/urea/2-hydroxy-N,N,N-trimethylethanaminium chloride
  583. iron oxide (Fe2O3)/water/2-methylpropanoic acid
  584. iron oxide (Fe3O4)/hydrochloric acid/water
  585. iron oxide (Fe3O4)/propanedioic acid/2-hydroxy-N,N,N-trimethylethanaminium chloride
  586. iron oxide (Fe3O4)/sodium chloride (NaCl)/water
  587. iron oxide (Fe3O4)/urea/2-hydroxy-N,N,N-trimethylethanaminium chloride
  588. iron oxide (FeO)/hydrochloric acid/water
  589. iron oxide (FeO)/propanedioic acid/2-hydroxy-N,N,N-trimethylethanaminium chloride
  590. iron oxide (FeO)/sodium chloride (NaCl)/water
  591. iron oxide (FeO)/sulfur dioxide/water
  592. iron oxide (FeO)/urea/2-hydroxy-N,N,N-trimethylethanaminium chloride
  593. iron sulfide (FeS)/copper(II) sulfide/water
  594. iron yttrium oxide (YFeO3)/potassium hydroxide (K(OH))/water
  595. iron(+3) cation phosphate/phosphoric acid/water
  596. iron(3+) cation/perchloric acid/water
  597. iron/antimony/bismuth
  598. iron/carbon/chromium
  599. iron/carbon/sulfur
  600. iron/chromium/graphite
  601. iron/chromium/nitrogen
  602. iron/chromium/oxygen
  603. iron/lithium/magnesium
  604. iron/magnesium/carbon
  605. iron/manganese/graphite
  606. iron/manganese/silicon
  607. iron/nickel/chromium
  608. iron/nickel/hafnium
  609. iron/nickel/nitrogen
  610. iron/nickel/palladium
  611. iron/nickel/silicon
  612. iron/nickel/sulfur
  613. iron/nickel/titanium
  614. iron/nickel/zirconium
  615. iron/silicon/carbon
  616. iron/silicon/graphite
  617. iron/sulfur/graphite
  618. iron/vanadium/graphite
  619. isocyanatobenzene/1,1'-oxybis(2-methoxyethane)/phenylcarbamic acid methyl ester
  620. isoquinoline/benzene/1H-indene
  621. isoquinoline/benzene/naphthalene
  622. isoquinoline/naphthalene/1,2,4-trimethylbenzene
  623. isoquinoline/naphthalene/1H-indene
  624. isoquinoline/water/quinoline
  625. isothiocyanatobenzene/N-ethylethanamine/nitrobenzene
  626. isothiocyanatobenzene/piperidine/benzene
  627. isothiocyanatomethane/sodium chloride (NaCl)/water
  628. isoxazole/methane/water
  629. kaolin/1,2,3-propanetriol/water
  630. kerosene/gas oil/naphtha
  631. krypton/2,2,2-trifluoroethanol/water
  632. krypton/2,2-dimethylbutane/water
  633. krypton/2-methyl-2-propanol/water
  634. krypton/argon/helium
  635. krypton/argon/xenon
  636. krypton/helium/xenon
  637. krypton/neon/argon
  638. krypton/neon/deuterium
  639. krypton/neon/helium
  640. krypton/potassium bromide (KBr)/water-d2
  641. krypton/sodium chloride (NaCl)/water
  642. krypton/water-d2/methanol-d4
  643. krypton/water/1,1,1,3,3,3-hexafluoro-2-propanol
  644. krypton/water/methylcyclopentane
  645. krypton/water/potassium bromide (KBr)
  646. krypton/xenon/nitrogen
  647. kurnakovite (MgH7(BO3)3.3H2O)/hydrochloric acid/water
  648. L-alanine/β-D-fructofuranosyl α-D-glucopyranoside/water
  649. L-alanine/(2S-(2α,5α,6β(S&sup*;)))-6((aminophenylacetyl)amino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid/water
  650. L-alanine/1,2,3-propanetriol/2-hydroxy-N,N,N-trimethylethanaminium chloride
  651. L-alanine/1,2,3-propanetriol/water
  652. L-alanine/1,2-propanediol/water
  653. L-alanine/1-butanol/water
  654. L-alanine/1-dodecyl-3-methyl-1H-imidazolium bromide/water
  655. L-alanine/1-ethyl-3-methyl-1H-imidazolium chloride/water
  656. L-alanine/1-methyl-3-octyl-1H-imidazolium chloride/water
  657. L-alanine/1-propanol/water
  658. L-alanine/2-hydroxy-1,2,3-propanetricarboxylic acid trisodium salt/water
  659. L-alanine/2-hydroxypropane-1,2,3-tricarboxylic acid/water
  660. L-alanine/2-propanol/water
  661. L-alanine/2-propanone/water
  662. L-alanine/3-chloro-1-propanol/water
  663. L-alanine/3-[(4-amino-2-methyl-5-pyrimidinyl)methyl]-5-(2-hydroxyethyl)-4-methylthiazolium chloride monohydrochloride/water
  664. L-alanine/4-amino-N-[2-(diethylamino)ethyl]benzamide monohydrochloride/water
  665. L-alanine/4-O-α-D-glucopyranosyl-D-glucitol/water
  666. L-alanine/4-O-α-D-glucopyranosyl-D-glucose monohydrate/water
  667. L-alanine/4-O-α-D-glucopyranosyl-D-glucose/water
  668. L-alanine/4-O-β-D-galactopyranosyl-D-glucose/water
  669. L-alanine/5-hydroxy-6-methyl-3,4-pyridinedimethanol hydrochloride/water
  670. L-alanine/Aminourea hydrochloride/water
  671. L-alanine/cesium chloride (CsCl)/water
  672. L-alanine/D-fructose/water
  673. L-alanine/D-galactose/water
  674. L-alanine/D-mannitol/water
  675. L-alanine/D-xylose/water
  676. L-alanine/ethanedioic acid dipotassium salt/water
  677. L-alanine/ethanol/water
  678. L-alanine/formamide/water
  679. L-alanine/hydrochloric acid/water
  680. L-alanine/L-isoleucine/water
  681. L-alanine/L-leucine/water
  682. L-alanine/L-valine/water
  683. L-alanine/lithium chloride (LiCl)/water
  684. L-alanine/methane/water
  685. L-alanine/methanol/water
  686. L-alanine/methylurea/water
  687. L-alanine/N,N,N-triethylethanaminium bromide/water
  688. L-alanine/N,N,N-triethylethanaminium iodide/water
  689. L-alanine/N,N,N-trimethyl-1-hexadecanaminium bromide/water
  690. L-alanine/N,N,N-trimethylmethanaminium bromide/water
  691. L-alanine/N,N,N-trimethylmethanaminium iodide/water
  692. L-alanine/N,N-dimethylformamide/water
  693. L-alanine/nitric acid sodium salt/water
  694. L-alanine/perchloric acid sodium salt/water
  695. L-alanine/phosphoric acid disodium salt/water
  696. L-alanine/phosphoric acid monoammonium salt/water
  697. L-alanine/phosphoric acid monosodium salt/water
  698. L-alanine/potassium chloride (KCl)/water
  699. L-alanine/potassium iodide (KI)/water
  700. L-alanine/sodium bromide (NaBr)/water
  701. L-alanine/sodium chloride (NaCl)/water
  702. L-alanine/sodium fluoride (NaF)/water
  703. L-alanine/sodium iodide (NaI)/water
  704. L-alanine/sulfinylbismethane/water
  705. L-alanine/urea/water
  706. L-alanine/water/(2S)-2-hydroxypropanoic acid
  707. L-alanine/water/1-butyl-1-methylpyrrolidinium bromide
  708. L-alanine/water/1-butyl-2,3-dimethylimidazolium bromide
  709. L-alanine/water/1-butyl-3-methyl-1H-imidazolium bromide
  710. L-alanine/water/1-butyl-3-methyl-1H-imidazolium chloride
  711. L-alanine/water/1-butyl-3-methyl-1H-imidazolium salt with 2-hydroxybenzoic acid (1:1)
  712. L-alanine/water/1-butyl-3-methylimidazolium ibuprofenate
  713. L-alanine/water/1-butyl-3-propylimidazol-3-ium bromide
  714. L-alanine/water/1-Butyl-4-methylpyridinium iodide
  715. L-alanine/water/1-hexyl-3-methyl-1H-imidazolium bromide
  716. L-alanine/water/1-Hexyl-3-methylimidazolium salicylate
  717. L-alanine/water/1-methyl-3-propyl-1H-imidazolium bromide
  718. L-alanine/water/1-Octyl-3-methylimidazolium ibuprofenate
  719. L-alanine/water/1-Octyl-3-methylimidazolium salicylate
  720. L-alanine/water/1-Phenylpiperazinium tetrafluoroborate
  721. L-alanine/water/2-butanone
  722. L-alanine/water/2-hydroxy-1,2,3-propanetricarboxylic acid monopotassium salt
  723. L-alanine/water/2-hydroxy-1,2,3-propanetricarboxylic acid tripotassium salt
  724. L-alanine/water/3-(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ylidene)-N-methyl-1-propanamine hydrochloride
  725. L-alanine/water/3-chloro-1,2-propanediol
  726. L-alanine/water/Benzyldimethyldodecylammonium salicylate
  727. L-alanine/water/Cetylpyridinium salicylate
  728. L-alanine/water/D-(+)-Glucosamine hydrochloride
  729. L-alanine/water/Domiphen salicylate
  730. L-alanine/water/Hydralazine hydrochloride
  731. L-alanine/water/L-sorbose
  732. L-alanine/water/magnesium chloride (MgCl2)
  733. L-alanine/water/magnesium chloride (MgCl2) hexahydrate
  734. L-alanine/water/myo-inositol
  735. L-alanine/water/N,N'-dimethylurea
  736. L-alanine/water/N-methylacetamide
  737. L-alanine/water/nitric acid lithium salt
  738. L-alanine/water/nitric acid potassium salt
  739. L-alanine/water/phosphoric acid diammonium salt
  740. L-alanine/water/phosphoric acid dipotassium salt
  741. L-alanine/water/phosphoric acid monopotassium salt
  742. L-alanine/water/potassium bromide (KBr)
  743. L-alanine/water/potassium fluoride (KF)
  744. L-alanine/water/rubidium chloride (RbCl)
  745. L-alanine/water/sulfuric acid diammonium salt
  746. L-alanine/water/sulfuric acid dipotassium salt
  747. L-alanine/water/sulfuric acid disodium salt
  748. L-alanine/water/xylitol
  749. L-arabinose/2-hydroxybenzoic acid monosodium salt/water
  750. L-arabinose/4-pyridinecarboxylic acid hydrazide/water
  751. L-arabinose/acetonitrile/water
  752. L-arabinose/Aminourea hydrochloride/water
  753. L-arabinose/carboxymethyl-trimethylazanium chloride/water
  754. L-arabinose/D-xylose/water
  755. L-arabinose/ethanol/water
  756. L-arabinose/glycine/water
  757. L-arabinose/L-arginine/water
  758. L-arabinose/L-serine/water
  759. L-arabinose/methanol/water
  760. L-arabinose/N-glycylglycine/water
  761. L-arabinose/urea/water
  762. L-arabinose/water/1-butyl-3-methyl-1H-imidazolium bromide
  763. L-arginine monohydrochloride/methanol/water
  764. L-arginine/2,2,2-trifluoroethanol/water
  765. L-arginine/2-amino-2-(hydroxymethyl)propane-1,3-diol; 5-(benzoyl)-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid/water
  766. L-arginine/methane/water
  767. L-arginine/potassium chloride (KCl)/water
  768. L-arginine/sodium chloride (NaCl)/water
  769. L-arginine/water/Gentamicin sulphate
  770. L-arginine/water/myo-inositol
  771. L-arginine/water/xylitol
  772. L-ascorbic acid/β-D-fructofuranosyl α-D-glucopyranoside/water
  773. L-ascorbic acid/(S)-3-(1-methyl-2-pyrrolidinyl)pyridine/water
  774. L-ascorbic acid/1,1'-sulfinylbisethane/water
  775. L-ascorbic acid/1,2,3-propanetriol/water
  776. L-ascorbic acid/1-butanol/water
  777. L-ascorbic acid/1-propanol/water
  778. L-ascorbic acid/2-hydroxy-N,N,N-trimethylethanaminium chloride/sulfinylbismethane
  779. L-ascorbic acid/2-propanol/water
  780. L-ascorbic acid/4-O-α-D-glucopyranosyl-D-glucitol/water
  781. L-ascorbic acid/4-O-α-D-glucopyranosyl-D-glucose monohydrate/water
  782. L-ascorbic acid/cytidine/water
  783. L-ascorbic acid/D-fructose/water
  784. L-ascorbic acid/D-galactose/water
  785. L-ascorbic acid/D-glucose/water
  786. L-ascorbic acid/D-xylose/water
  787. L-ascorbic acid/DL-arginine/water
  788. L-ascorbic acid/ethanol/2-propanol
  789. L-ascorbic acid/ethanol/methanol
  790. L-ascorbic acid/ethanol/water
  791. L-ascorbic acid/galactitol/water
  792. L-ascorbic acid/glycine/water
  793. L-ascorbic acid/hydrochloric acid/water
  794. L-ascorbic acid/L-alanine/water
  795. L-ascorbic acid/L-arginine/water
  796. L-ascorbic acid/L-histidine/water
  797. L-ascorbic acid/L-threonine/water
  798. L-ascorbic acid/L-valine/water
  799. L-ascorbic acid/lithium chloride (LiCl)/water
  800. L-ascorbic acid/methanol/2-propanol
  801. L-ascorbic acid/N,N,N-trimethyl-1-hexadecanaminium bromide/water
  802. L-ascorbic acid/N-(N-glycylglycyl)glycine/water
  803. L-ascorbic acid/potassium chloride (KCl)/water
  804. L-ascorbic acid/sodium chloride (NaCl)/water
  805. L-ascorbic acid/sulfinylbismethane/water
  806. L-ascorbic acid/urea/water
  807. L-ascorbic acid/uridine/water
  808. L-ascorbic acid/water/1,8-diazabicyclo[5.4.0]undec-7-en-8-ium trifluoroacetate
  809. L-ascorbic acid/water/1-butyl-3-methyl-1H-imidazolium bromide
  810. L-ascorbic acid/water/1-Hexyl-4-(4-sulfobutyl)-1H-1,2,4-triazolium trifluoromethanesulfonate
  811. L-ascorbic acid/water/2-Keto-L-gulonic acid
  812. L-ascorbic acid/water/diethylethanolammonium propanoate
  813. L-ascorbic acid/water/magnesium chloride (MgCl2)
  814. L-ascorbic acid/water/mannitol
  815. L-ascorbic acid/water/methyl α-D-glucopyranoside
  816. L-ascorbic acid/water/xylitol
  817. L-asparagine monohydrate/1-propanol/water
  818. L-asparagine monohydrate/2-propanol/water
  819. L-asparagine monohydrate/4-O-β-D-galactopyranosyl-D-glucose/water
  820. L-asparagine monohydrate/ethanol/water
  821. L-asparagine monohydrate/methanol/water
  822. L-asparagine/β-cyclodextrin/water
  823. L-asparagine/1-propanol/water
  824. L-asparagine/acetonitrile/water
  825. L-asparagine/methane/water
  826. L-asparagine/nitric acid sodium salt/water
  827. L-asparagine/sodium chloride (NaCl)/water
  828. L-asparagine/water/(2R,3R)-2,3-dihydroxybutanedioic acid
  829. L-asparagine/water/(6-oxo-1H-pyridazin-3-yl) 3-(trifluoromethyl)benzoate
  830. L-asparagine/water/Gentamicin sulphate
  831. L-asparagine/water/manganese chloride (MnCl2)
  832. L-asparagine/water/nitric acid potassium salt
  833. L-aspartic acid compd. with L-ornithine (1:1)/methanol/water
  834. L-aspartic acid monosodium salt/potassium chloride (KCl)/water
  835. L-aspartic acid monosodium salt/sodium chloride (NaCl)/water
  836. L-aspartic acid/β-cyclodextrin/water
  837. L-aspartic acid/2-propanol/water
  838. L-aspartic acid/4-(2-aminoethyl)-1,2-benzenediol hydrochloride/water
  839. L-aspartic acid/acetic acid calcium salt/water
  840. L-aspartic acid/copper chloride (CuCl2)/water
  841. L-aspartic acid/ethanol/water
  842. L-aspartic acid/formic acid/water
  843. L-aspartic acid/hydrochloric acid/water
  844. L-aspartic acid/L-glutamic acid/water
  845. L-aspartic acid/L-leucine/water
  846. L-aspartic acid/methanol/water
  847. L-aspartic acid/N,N,N-trimethyl-1-hexadecanaminium bromide/water
  848. L-aspartic acid/N,N-dimethylmethanamine/water
  849. L-aspartic acid/nitric acid ammonium salt/water
  850. L-aspartic acid/nitric acid sodium salt/water
  851. L-aspartic acid/potassium chloride (KCl)/water
  852. L-aspartic acid/sodium chloride (NaCl)/water
  853. L-aspartic acid/urea/water
  854. L-aspartic acid/water/(2R)-(+)-2-chlorobutanedioic acid
  855. L-aspartic acid/water/magnesium chloride (MgCl2)
  856. L-aspartic acid/water/nitric acid potassium salt
  857. L-aspartic acid/water/Potassium sorbate
  858. L-aspartic acid/zinc chloride (ZnCl2)/water
  859. L-citrulline/ethanol/water
  860. L-cysteine/1-propanol/water
  861. L-cysteine/2-propanol/water
  862. L-cysteine/acetonitrile/water
  863. L-cysteine/ethanol/water
  864. L-cysteine/methanol/water
  865. L-cysteine/potassium iodide (KI)/water
  866. L-cysteine/sodium bromide (NaBr)/water
  867. L-cysteine/sodium chloride (NaCl)/water
  868. L-cysteine/sulfinylbismethane/water
  869. L-cysteine/water/1-hexyl-3-methyl-1H-imidazolium bromide
  870. L-cysteine/water/sulfuric acid disodium salt
  871. L-cystine/hydrochloric acid/water
  872. L-cystine/L-leucine/water
  873. L-cystine/L-tyrosine/water
  874. L-cystine/N,N,N-triethylethanaminium iodide/water
  875. L-cystine/N,N,N-trimethylmethanaminium chloride/water
  876. L-cystine/perchloric acid sodium salt/water
  877. L-cystine/sodium chloride (NaCl)/water
  878. L-cystine/water/magnesium chloride (MgCl2)
  879. L-glutamic acid disodium salt/water/oxygen
  880. L-glutamic acid hydrochloride/potassium chloride (KCl)/water
  881. L-glutamic acid hydrochloride/sodium chloride (NaCl)/water
  882. L-glutamic acid hydrochloride/water/oxygen
  883. L-glutamic acid monoammonium salt/water/oxygen
  884. L-glutamic acid monosodium salt/copper chloride (CuCl2)/water
  885. L-glutamic acid monosodium salt/guanidine monohydrochloride/water
  886. L-glutamic acid monosodium salt/potassium chloride (KCl)/water
  887. L-glutamic acid monosodium salt/sodium chloride (NaCl)/water
  888. L-glutamic acid monosodium salt/thiocyanic acid sodium salt/water
  889. L-glutamic acid monosodium salt/water/iron chloride (FeCl2)
  890. L-glutamic acid monosodium salt/water/magnesium chloride (MgCl2)
  891. L-glutamic acid monosodium salt/water/manganese chloride (MnCl2)
  892. L-glutamic acid monosodium salt/water/oxygen
  893. L-glutamic acid monosodium salt/water/sulfuric acid disodium salt
  894. L-glutamic acid/1-propanol/water
  895. L-glutamic acid/2-propanol/water
  896. L-glutamic acid/2-propanone/water
  897. L-glutamic acid/4-(2-aminoethyl)-1,2-benzenediol hydrochloride/water
  898. L-glutamic acid/acetic acid calcium salt/water
  899. L-glutamic acid/acetonitrile/water
  900. L-glutamic acid/ethanol/water
  901. L-glutamic acid/formic acid/water
  902. L-glutamic acid/hydrochloric acid/water
  903. L-glutamic acid/L-tyrosine/water
  904. L-glutamic acid/methanol/water
  905. L-glutamic acid/nitric acid sodium salt/water
  906. L-glutamic acid/potassium chloride (KCl)/water
  907. L-glutamic acid/sodium chloride (NaCl)/water
  908. L-glutamic acid/urea/water
  909. L-glutamic acid/water/L-Pyroglutamic acid
  910. L-glutamic acid/water/nitric acid potassium salt
  911. L-glutamic acid/water/Potassium sorbate
  912. L-glutamine/2-propanone/water
  913. L-glutamine/D-glutamine/water
  914. L-glutamine/ethanol/water
  915. L-glutamine/N,N,N-trimethylmethanaminium bromide/water
  916. L-glutamine/nickel chloride (NiCl2)/water
  917. L-glutamine/nitric acid sodium salt/water
  918. L-glutamine/potassium chloride (KCl)/water
  919. L-glutamine/sodium chloride (NaCl)/water
  920. L-glutamine/urea/water
  921. L-glutamine/water/(6-oxo-1H-pyridazin-3-yl) 3-(trifluoromethyl)benzoate
  922. L-glutamine/water/Gentamicin sulphate
  923. L-glutamine/water/nitric acid potassium salt
  924. L-glutamine/water/sulfuric acid dipotassium salt
  925. L-histidine/β-cyclodextrin/water
  926. L-histidine/hydrochloric acid/water
  927. L-histidine/methane/water
  928. L-histidine/N,N,N-triethylethanaminium bromide/water
  929. L-histidine/potassium chloride (KCl)/water
  930. L-histidine/sodium chloride (NaCl)/water
  931. L-histidine/water/(2S)-2-hydroxypropanoic acid
  932. L-histidine/water/Gentamicin sulphate
  933. L-histidine/water/nitric acid potassium salt
  934. L-histidine/water/potassium fluoride (KF)
  935. L-histidine/water/sulfuric acid zinc salt (1:1)
  936. L-isoleucine/2-methyl-2-propanol/water
  937. L-isoleucine/aluminum chloride (AlCl3)/water
  938. L-isoleucine/hydrochloric acid/water
  939. L-isoleucine/lithium chloride (LiCl)/water
  940. L-isoleucine/nitric acid sodium salt/water
  941. L-isoleucine/perchloric acid sodium salt/water
  942. L-isoleucine/potassium chloride (KCl)/water
  943. L-isoleucine/sodium chloride (NaCl)/water
  944. L-isoleucine/sulfuric acid magnesium salt (1:1)/water
  945. L-isoleucine/water/1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxo-7-(1-piperazinyl)-3-quinolinecarboxylic acid monohydrochloride
  946. L-isoleucine/water/magnesium chloride (MgCl2)
  947. L-isoleucine/water/nitric acid potassium salt
  948. L-isoleucine/water/sulfuric acid diammonium salt
  949. L-isoleucine/water/sulfuric acid dipotassium salt
  950. L-leucine/(2S-(2α,5α,6β(S&sup*;)))-6((aminophenylacetyl)amino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid/water
  951. L-leucine/1-butanol/water
  952. L-leucine/1-propanol/water
  953. L-leucine/2-methyl-2-propanol/water
  954. L-leucine/3-chloro-1-propanol/water
  955. L-leucine/3-[(4-amino-2-methyl-5-pyrimidinyl)methyl]-5-(2-hydroxyethyl)-4-methylthiazolium chloride monohydrochloride/water
  956. L-leucine/4-O-α-D-glucopyranosyl-D-glucose/water
  957. L-leucine/4-O-β-D-galactopyranosyl-D-glucose/water
  958. L-leucine/ethanol/water
  959. L-leucine/hydrochloric acid/water
  960. L-leucine/L-isoleucine/water
  961. L-leucine/L-valine/water
  962. L-leucine/methanol/water
  963. L-leucine/N,N,N-triethylethanaminium bromide/water
  964. L-leucine/nitric acid ammonium salt/water
  965. L-leucine/nitric acid sodium salt/water
  966. L-leucine/phosphoric acid monoammonium salt/water
  967. L-leucine/potassium chloride (KCl)/water
  968. L-leucine/sodium bromide (NaBr)/water
  969. L-leucine/sodium chloride (NaCl)/water
  970. L-leucine/sodium fluoride (NaF)/water
  971. L-leucine/sulfinylbismethane/water
  972. L-leucine/sulfuric acid magnesium salt (1:1)/water
  973. L-leucine/water/ω-hydroxy-α-(4-(1,1,3,3-tetramethylbutyl)phenyl)poly(oxy-1,2-ethanediyl)
  974. L-leucine/water/1-butyl-3-methyl-1H-imidazolium chloride
  975. L-leucine/water/1-butyl-3-propylimidazol-3-ium bromide
  976. L-leucine/water/1-hexyl-3-methyl-1H-imidazolium bromide
  977. L-leucine/water/3-chloro-1,2-propanediol
  978. L-leucine/water/Benzyldimethyldodecylammonium salicylate
  979. L-leucine/water/Cetylpyridinium salicylate
  980. L-leucine/water/Domiphen salicylate
  981. L-leucine/water/magnesium chloride (MgCl2)
  982. L-leucine/water/nitric acid potassium salt
  983. L-leucine/water/phosphoric acid copper(2+) salt (2:3)
  984. L-leucine/water/phosphoric acid diammonium salt
  985. L-leucine/water/potassium fluoride (KF)
  986. L-leucine/water/sulfuric acid dipotassium salt
  987. L-leucine/water/sulfuric acid disodium salt
  988. L-leucine/water/sulfuric acid zinc salt (1:1)
  989. L-leucine/zinc chloride (ZnCl2)/water
  990. L-lysine dihydrochloride/water/oxygen
  991. L-lysine homopolymer/methanol/water
  992. L-lysine monohydrochloride/4-O-α-D-glucopyranosyl-D-glucose/water
  993. L-lysine monohydrochloride/methanol/water
  994. L-lysine monohydrochloride/phosphoric acid monoammonium salt/water
  995. L-lysine monohydrochloride/water/ω-hydroxy-α-(4-(1,1,3,3-tetramethylbutyl)phenyl)poly(oxy-1,2-ethanediyl)
  996. L-lysine monohydrochloride/water/ω-hydroxy-α-(4-(1,1,3,3-tetramethylbutyl)phenyl)poly(oxy-1,2-ethanediyl)
  997. L-lysine monohydrochloride/water/oxygen
  998. L-lysine monohydrochloride/water/tributyl(tetradecyl)phosphonium chloride
  999. L-lysine/ethanol/water
  1000. L-lysine/hydrochloric acid/water
  1001. L-lysine/N,N,N-trimethylmethanaminium bromide/water
  1002. L-lysine/potassium iodide (KI)/water
  1003. L-lysine/sodium bromide (NaBr)/water
  1004. L-lysine/sodium chloride (NaCl)/water
  1005. L-lysine/tributylmethylphosphonium methylsulfate/water
  1006. L-lysine/urea/water
  1007. L-lysine/water/N,N'-dimethylurea
  1008. L-lysine/water/oxygen
  1009. L-lysine/water/sulfuric acid disodium salt
  1010. L-lysine/water/tributyl(tetradecyl)phosphonium chloride
  1011. L-lysylglutamic acid/ethanol/water
  1012. L-methionine/1-propanol/water
  1013. L-methionine/2-methyl-2-propanol/water
  1014. L-methionine/2-propanol/water
  1015. L-methionine/2-propanone/water
  1016. L-methionine/ethanol/water
  1017. L-methionine/hydrochloric acid/water
  1018. L-methionine/lithium chloride (LiCl)/water
  1019. L-methionine/methanol/water
  1020. L-methionine/potassium chloride (KCl)/water
  1021. L-methionine/potassium iodide (KI)/water
  1022. L-methionine/sodium chloride (NaCl)/water
  1023. L-methionine/water/magnesium chloride (MgCl2)
  1024. L-methionine/water/manganese chloride (MnCl2)
  1025. L-methionine/water/phosphoric acid copper(2+) salt (2:3)
  1026. L-methionine/water/sulfuric acid diammonium salt
  1027. L-methionine/water/sulfuric acid zinc salt (1:1)
  1028. L-methionine/zinc chloride (ZnCl2)/water
  1029. L-norleucine/hydrochloric acid/water
  1030. L-norleucine/L-isoleucine/water
  1031. l-norvaline/2-propanol/water
  1032. l-norvaline/L-valine/water
  1033. l-norvaline/methanol/water
  1034. L-Ornithine homopolymer/methanol/water
  1035. L-phenylalanine methyl ester/N-((phenylmethoxy)carbonyl)-L-α-aspartyl-L-phenylalanine/water
  1036. L-phenylalanine/β-cyclodextrin/water
  1037. L-phenylalanine/1-butanol/water
  1038. L-phenylalanine/1-propanol/water
  1039. L-phenylalanine/2-hydroxypropane-1,2,3-tricarboxylic acid/water
  1040. L-phenylalanine/2-propanol/water
  1041. L-phenylalanine/2-propanone/water
  1042. L-phenylalanine/ethanol/water
  1043. L-phenylalanine/hydrogen peroxide (H2O2)/water
  1044. L-phenylalanine/lithium chloride (LiCl)/water
  1045. L-phenylalanine/methane/water
  1046. L-phenylalanine/methanol/water
  1047. L-phenylalanine/N,N-dimethylformamide/water
  1048. L-phenylalanine/nitric acid ammonium salt/water
  1049. L-phenylalanine/nitric acid sodium salt/water
  1050. L-phenylalanine/perchloric acid sodium salt/water
  1051. L-phenylalanine/potassium chloride (KCl)/water
  1052. L-phenylalanine/sodium chloride (NaCl)/water
  1053. L-phenylalanine/water/1-butyl-2,3-dimethylimidazolium bromide
  1054. L-phenylalanine/water/1-hexyl-3-methyl-1H-imidazolium bromide
  1055. L-phenylalanine/water/magnesium chloride (MgCl2)
  1056. L-phenylalanine/water/nitric acid potassium salt
  1057. L-phenylalanine/water/sulfuric acid diammonium salt
  1058. L-phenylalanine/water/sulfuric acid disodium salt
  1059. L-phenylalanine/water/sulfuric acid zinc salt (1:1)
  1060. L-phenylalanine/zinc chloride (ZnCl2)/water
  1061. L-proline/α-D-glucopyranose/water
  1062. L-proline/α-hydro-ω-hydroxypoly(oxy(methyl-1,2-ethanediyl))/water
  1063. L-proline/β-D-fructofuranosyl α-D-glucopyranoside/water
  1064. L-proline/±-2-aminobutanoic acid/water
  1065. L-proline/(R&sup*;,R&sup*;)-±-2,3-dihydroxybutanedioic acid disodium salt/water
  1066. L-proline/1,2,3-propanetriol/water
  1067. L-proline/1-butanol/water
  1068. L-proline/1-butyl-3-methyl-1H-imidazolium salt with trifluoromethanesulfonic acid (1:1)/water
  1069. L-proline/1-butyl-3-methyl-1H-imidazolium tetrafluoroborate(1-)/water
  1070. L-proline/1-decyl-3-methyl-1H-imidazolium bromide/water
  1071. L-proline/1-dodecyl-3-methyl-1H-imidazolium bromide/water
  1072. L-proline/1-hexyl-3-methyl-1H-imidazolium chloride/water
  1073. L-proline/1H-imidazole/water
  1074. L-proline/2-((2,6-dichlorophenyl)amino)benzeneacetic acid monosodium salt/water
  1075. L-proline/2-(acetyloxy)benzoic acid/water
  1076. L-proline/2-hydroxybutanedioic acid/water
  1077. L-proline/2-propanol/water
  1078. L-proline/4-O-α-D-glucopyranosyl-D-glucose/water
  1079. L-proline/4-O-β-D-galactopyranosyl-D-glucose/water
  1080. L-proline/D-glucose/water
  1081. L-proline/D-xylose/water
  1082. L-proline/ethanol/2-propanone
  1083. L-proline/ethanol/acetonitrile
  1084. L-proline/ethanol/water
  1085. L-proline/glycine/water
  1086. L-proline/L-alanine/water
  1087. L-proline/L-arabinose/water
  1088. L-proline/L-leucine/water
  1089. L-proline/L-valine/water
  1090. L-proline/methane/water
  1091. L-proline/methanol/2-propanone
  1092. L-proline/methanol/acetonitrile
  1093. L-proline/methanol/water
  1094. L-proline/methylurea/water
  1095. L-proline/nitric acid copper(2+) salt/water
  1096. L-proline/nitric acid sodium salt/water
  1097. L-proline/potassium chloride (KCl)/water
  1098. L-proline/potassium iodide (KI)/water
  1099. L-proline/sodium chloride (NaCl)/water
  1100. L-proline/sulfinylbismethane/water
  1101. L-proline/sulfuric acid monododecyl ester sodium salt/water
  1102. L-proline/tetrabutylphosphonium bromide/water
  1103. L-proline/tributylmethylphosphonium methylsulfate/water
  1104. L-proline/urea/water
  1105. L-proline/water/1-butyl-3-methyl-1H-imidazolium chloride
  1106. L-proline/water/1-Phenylpiperazinium tetrafluoroborate
  1107. L-proline/water/hydroxyacetic acid
  1108. L-proline/water/manganese chloride (MnCl2)
  1109. L-proline/water/N,N'-dimethylurea
  1110. L-proline/water/nitric acid potassium salt
  1111. L-proline/water/potassium bromide (KBr)
  1112. L-proline/water/sulfuric acid diammonium salt
  1113. L-proline/water/sulfuric acid dipotassium salt
  1114. L-proline/water/tributyl(tetradecyl)phosphonium chloride
  1115. L-serine/β-D-fructofuranosyl α-D-glucopyranoside/water
  1116. L-serine/(2S-(2α,5α,6β(S&sup*;)))-6((aminophenylacetyl)amino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid/water
  1117. L-serine/1,2,3-propanetriol/water
  1118. L-serine/1,2-propanediol/water
  1119. L-serine/1-(carboxymethyl)-3-methyl-1H-imidazolium chloride/water
  1120. L-serine/1-butanol/water
  1121. L-serine/1-propanol/water
  1122. L-serine/2-propanol/water
  1123. L-serine/2-propanone/water
  1124. L-serine/3,7-dihydro-1,3,7-trimethyl-1H-purine-2,6-dione/water
  1125. L-serine/3-[(4-amino-2-methyl-5-pyrimidinyl)methyl]-5-(2-hydroxyethyl)-4-methylthiazolium chloride monohydrochloride/water
  1126. L-serine/4-O-α-D-glucopyranosyl-D-glucose monohydrate/water
  1127. L-serine/4-O-α-D-glucopyranosyl-D-glucose/water
  1128. L-serine/4-O-β-D-galactopyranosyl-D-glucose/water
  1129. L-serine/acetonitrile/water
  1130. L-serine/D-mannitol/water
  1131. L-serine/D-xylose/water
  1132. L-serine/ethanol/water
  1133. L-serine/formamide/water
  1134. L-serine/L-aspartic acid/water
  1135. L-serine/L-glutamic acid/water
  1136. L-serine/methane/water
  1137. L-serine/methanol/water
  1138. L-serine/methylurea/water
  1139. L-serine/N,N,N-trimethyl-1-hexadecanaminium bromide/water
  1140. L-serine/N,N,N-trimethylmethanaminium bromide/water
  1141. L-serine/N,N-dimethylformamide/water
  1142. L-serine/nitric acid sodium salt/water
  1143. L-serine/perchloric acid sodium salt/water
  1144. L-serine/phosphoric acid monoammonium salt/water
  1145. L-serine/potassium chloride (KCl)/water
  1146. L-serine/sodium bromide (NaBr)/water
  1147. L-serine/sodium chloride (NaCl)/water
  1148. L-serine/sulfinylbismethane/water
  1149. L-serine/urea/water
  1150. L-serine/water/1-(2-carboxyethyl)-3-methylimidazolium chloride
  1151. L-serine/water/1-butyl-3-methyl-1H-imidazolium bromide
  1152. L-serine/water/1-butyl-3-methyl-1H-imidazolium chloride
  1153. L-serine/water/1-butyl-3-propylimidazol-3-ium bromide
  1154. L-serine/water/1-Phenylpiperazinium tetrafluoroborate
  1155. L-serine/water/2-butanone
  1156. L-serine/water/3-pyridinecarboxamide
  1157. L-serine/water/D-(+)-Glucosamine hydrochloride
  1158. L-serine/water/L-sorbose
  1159. L-serine/water/myo-inositol
  1160. L-serine/water/N,N'-dimethylurea
  1161. L-serine/water/N-methylacetamide
  1162. L-serine/water/nitric acid lithium salt
  1163. L-serine/water/nitric acid potassium salt
  1164. L-serine/water/phosphoric acid diammonium salt
  1165. L-serine/water/sulfuric acid diammonium salt
  1166. L-serine/water/sulfuric acid disodium salt
  1167. L-threonine/2-methyl-2-propanol/water
  1168. L-threonine/hydrochloric acid/water
  1169. L-threonine/methane/water
  1170. L-threonine/potassium chloride (KCl)/water
  1171. L-threonine/water/(5,6)fullerene-C60-Ih
  1172. L-threonine/water/1-(2-carboxyethyl)-3-methylimidazolium chloride
  1173. L-threonine/water/1-butyl-3-methyl-1H-imidazolium bromide
  1174. L-threonine/water/1-butyl-3-methyl-1H-imidazolium chloride
  1175. L-threonine/water/1-butyl-3-propylimidazol-3-ium bromide
  1176. L-threonine/water/2-butanone
  1177. L-threonine/water/3-pyridinecarboxamide
  1178. L-threonine/water/D-(+)-Glucosamine hydrochloride
  1179. L-threonine/water/L-sorbose
  1180. L-threonine/water/myo-inositol
  1181. L-threonine/water/N,N'-dimethylurea
  1182. L-threonine/water/sulfuric acid diammonium salt
  1183. L-threonine/water/sulfuric acid zinc salt (1:1)
  1184. L-threonine/water/xylitol
  1185. L-threonine/zinc chloride (ZnCl2)/water
  1186. L-tryptophan/acetonitrile/water
  1187. L-tryptophan/cobalt chloride (CoCl2)/water
  1188. L-tryptophan/phosphoric acid monoammonium salt/water
  1189. L-tryptophan/potassium chloride (KCl)/water
  1190. L-tryptophan/water/nitric acid potassium salt
  1191. L-tryptophan/zinc chloride (ZnCl2)/water
  1192. L-tyrosine/1-butanol/water
  1193. L-tyrosine/1-propanol/water
  1194. L-tyrosine/ethanol/water
  1195. L-tyrosine/L-leucine/water
  1196. L-tyrosine/methanol/water
  1197. L-tyrosine/sodium chloride (NaCl)/water
  1198. L-tyrosine/sulfinylbismethane/water
  1199. L-tyrosine/water/magnesium bromide (MgBr2)
  1200. L-valine ethyl ester hydrochloride/ethanol/water
  1201. L-valine/1-propanol/water
  1202. L-valine/2-methyl-2-propanol/water
  1203. L-valine/hydrochloric acid/water
  1204. L-valine/L-isoleucine/water
  1205. L-valine/lithium bromide (LiBr)/water
  1206. L-valine/lithium chloride (LiCl)/water
  1207. L-valine/methane/water
  1208. L-valine/N,N,N-triethylethanaminium bromide/water
  1209. L-valine/N,N,N-trimethylmethanaminium iodide/water
  1210. L-valine/nitric acid sodium salt/water
  1211. L-valine/phosphoric acid disodium salt/water
  1212. L-valine/phosphoric acid monoammonium salt/water
  1213. L-valine/potassium chloride (KCl)/water
  1214. L-valine/potassium iodide (KI)/water
  1215. L-valine/sodium bromide (NaBr)/water
  1216. L-valine/sodium chloride (NaCl)/water
  1217. L-valine/sodium fluoride (NaF)/water
  1218. L-valine/sodium iodide (NaI)/water
  1219. L-valine/sulfuric acid magnesium salt (1:1)/water
  1220. L-valine/water/ω-hydroxy-α-(4-(1,1,3,3-tetramethylbutyl)phenyl)poly(oxy-1,2-ethanediyl)
  1221. L-valine/water/ω-hydroxy-α-(4-(1,1,3,3-tetramethylbutyl)phenyl)poly(oxy-1,2-ethanediyl)
  1222. L-valine/water/1-butyl-1-methylpyrrolidinium bromide
  1223. L-valine/water/1-butyl-2,3-dimethylimidazolium bromide
  1224. L-valine/water/1-butyl-3-methyl-1H-imidazolium bromide
  1225. L-valine/water/1-butyl-3-propylimidazol-3-ium bromide
  1226. L-valine/water/1-Butyl-4-methylpyridinium iodide
  1227. L-valine/water/1-hexyl-3-methyl-1H-imidazolium bromide
  1228. L-valine/water/1-methyl-3-propyl-1H-imidazolium bromide
  1229. L-valine/water/2-butanone
  1230. L-valine/water/2-hydroxy-1,2,3-propanetricarboxylic acid tripotassium salt
  1231. L-valine/water/3-(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ylidene)-N-methyl-1-propanamine hydrochloride
  1232. L-valine/water/3-chloro-1,2-propanediol
  1233. L-valine/water/Benzyldimethyldodecylammonium salicylate
  1234. L-valine/water/Cetylpyridinium salicylate
  1235. L-valine/water/Domiphen salicylate
  1236. L-valine/water/Hydralazine hydrochloride
  1237. L-valine/water/L-sorbose
  1238. L-valine/water/magnesium chloride (MgCl2)
  1239. L-valine/water/magnesium chloride (MgCl2) hexahydrate
  1240. L-valine/water/myo-inositol
  1241. L-valine/water/N,N'-dimethylurea
  1242. L-valine/water/nitric acid potassium salt
  1243. L-valine/water/phosphoric acid diammonium salt
  1244. L-valine/water/phosphoric acid monopotassium salt
  1245. L-valine/water/potassium bromide (KBr)
  1246. L-valine/water/potassium fluoride (KF)
  1247. L-valine/water/sulfuric acid diammonium salt
  1248. L-valine/water/sulfuric acid dipotassium salt
  1249. L-valine/water/sulfuric acid disodium salt
  1250. L-valine/water/xylitol
  1251. L-valine/zinc chloride (ZnCl2)/water
  1252. lanthanum bromide (LaBr3)/acetamide/water
  1253. lanthanum bromide (LaBr3)/N-(aminocarbonyl)acetamide/water
  1254. lanthanum bromide (LaBr3)/urea/water
  1255. lanthanum bromide (LaBr3)/water/cesium bromide (CsBr)
  1256. lanthanum bromide (LaBr3)/water/potassium bromide (KBr)
  1257. lanthanum chloride (LaCl3)/±-2-hydroxy-1,2-diphenylethanone/1-phenylethanone
  1258. lanthanum chloride (LaCl3)/±-DL-2-amino-3-phenylpropanoic acid/water
  1259. lanthanum chloride (LaCl3)/1,2-dihydro-1,5-dimethyl-2-phenyl-3H-pyrazol-3-one/water
  1260. lanthanum chloride (LaCl3)/1,2-ethanediamine dihydrochloride/water
  1261. lanthanum chloride (LaCl3)/1,6-hexanediamine dihydrochloride/water
  1262. lanthanum chloride (LaCl3)/1-butanamine hydrochloride/water
  1263. lanthanum chloride (LaCl3)/2,2',2''-nitrilotrisethanol hydrochloride/water
  1264. lanthanum chloride (LaCl3)/2,2'-iminobisethanol hydrochloride/water
  1265. lanthanum chloride (LaCl3)/2-methyl-2-propanol/water
  1266. lanthanum chloride (LaCl3)/2-propanone/water
  1267. lanthanum chloride (LaCl3)/4-(chloroacetyl)-1,2-dihydro-1,5-dimethyl-2-phenyl-3H-pyrazol-3-one/water
  1268. lanthanum chloride (LaCl3)/4-chloro-N-(1,5-dimethyl-3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)benzamide/water
  1269. lanthanum chloride (LaCl3)/5-fluoro-2,4(1H,3H)-pyrimidinedione/water
  1270. lanthanum chloride (LaCl3)/acetamide/water
  1271. lanthanum chloride (LaCl3)/acetic acid/water
  1272. lanthanum chloride (LaCl3)/ammonium chloride ((NH4)Cl)/water
  1273. lanthanum chloride (LaCl3)/barium chloride (BaCl2)/water
  1274. lanthanum chloride (LaCl3)/benzenamine hydrochloride/water
  1275. lanthanum chloride (LaCl3)/cadmium chloride (CdCl2)/water
  1276. lanthanum chloride (LaCl3)/cesium chloride (CsCl)/water
  1277. lanthanum chloride (LaCl3)/cyclohexanone/1-phenylethanone
  1278. lanthanum chloride (LaCl3)/DL-glutamic acid/water
  1279. lanthanum chloride (LaCl3)/DL-serine/water
  1280. lanthanum chloride (LaCl3)/ethanol/water
  1281. lanthanum chloride (LaCl3)/ethene/water
  1282. lanthanum chloride (LaCl3)/glycine/water
  1283. lanthanum chloride (LaCl3)/hexamethylene imine hydrochloride/water
  1284. lanthanum chloride (LaCl3)/hydrazine dihydrochloride/water
  1285. lanthanum chloride (LaCl3)/hydrochloric acid/water
  1286. lanthanum chloride (LaCl3)/hydrogen/water
  1287. lanthanum chloride (LaCl3)/hydroxylamine hydrochloride/water
  1288. lanthanum chloride (LaCl3)/imidodicarbonic diamide/water
  1289. lanthanum chloride (LaCl3)/iron chloride (FeCl2)/tin chloride (SnCl2)
  1290. lanthanum chloride (LaCl3)/lanthanum bromide (LaBr3)/water
  1291. lanthanum chloride (LaCl3)/lanthanum oxychloride/magnesium chloride (MgCl2)
  1292. lanthanum chloride (LaCl3)/lithium chloride (LiCl)/water
  1293. lanthanum chloride (LaCl3)/methanamine hydrochloride/water
  1294. lanthanum chloride (LaCl3)/methanol/water
  1295. lanthanum chloride (LaCl3)/N,N-diethylethanamine hydrochloride/water
  1296. lanthanum chloride (LaCl3)/N,N-dimethylmethanamine hydrochloride/water
  1297. lanthanum chloride (LaCl3)/n-butane/water
  1298. lanthanum chloride (LaCl3)/N-ethylethanamine hydrochloride/water
  1299. lanthanum chloride (LaCl3)/N-methylmethanamine hydrochloride/water
  1300. lanthanum chloride (LaCl3)/piperazine dihydrochloride/water
  1301. lanthanum chloride (LaCl3)/piperidine hydrochloride/water
  1302. lanthanum chloride (LaCl3)/potassium chloride (KCl)/lithium chloride (LiCl)
  1303. lanthanum chloride (LaCl3)/potassium chloride (KCl)/water
  1304. lanthanum chloride (LaCl3)/praseodymium chloride (PrCl3)/water
  1305. lanthanum chloride (LaCl3)/pyridine hydrochloride/water
  1306. lanthanum chloride (LaCl3)/quinoline hydrochloride/water
  1307. lanthanum chloride (LaCl3)/samarium chloride (SmCl3)/water
  1308. lanthanum chloride (LaCl3)/sodium chloride (NaCl)/water
  1309. lanthanum chloride (LaCl3)/strontium chloride (SrCl2)/water
  1310. lanthanum chloride (LaCl3)/sulfinylbismethane/water
  1311. lanthanum chloride (LaCl3)/sulfuric acid barium salt (1:1)/water
  1312. lanthanum chloride (LaCl3)/thiourea/water
  1313. lanthanum chloride (LaCl3)/trichloroacetic acid lanthanum(3+) salt/water
  1314. lanthanum chloride (LaCl3)/urea/water
  1315. lanthanum chloride (LaCl3)/water/(2-azaniumylphenyl)azanium dichloride
  1316. lanthanum chloride (LaCl3)/water/(4-azaniumylphenyl)azanium dichloride
  1317. lanthanum chloride (LaCl3)/water/1,1,2,3,4,4-hexachloro-1,3-butadiene
  1318. lanthanum chloride (LaCl3)/water/1-methyl-2-pyrrolidinone benzenesulfonate
  1319. lanthanum chloride (LaCl3)/water/1-methyl-2-pyrrolidinone p-toluenesulfonate
  1320. lanthanum chloride (LaCl3)/water/3-pyridinecarboxamide
  1321. lanthanum chloride (LaCl3)/water/cerium chloride (CeCl3)
  1322. lanthanum chloride (LaCl3)/water/Fullerenol-d
  1323. lanthanum chloride (LaCl3)/water/m-phenylenediaminium dichloride
  1324. lanthanum chloride (LaCl3)/water/magnesium chloride (MgCl2)
  1325. lanthanum chloride (LaCl3)/water/N,N'-bis(antipyrin-4-yl)oxamide
  1326. lanthanum chloride (LaCl3)/water/N,N'-bis(antipyrine-4-yl)-hexanedicarboxamide
  1327. lanthanum chloride (LaCl3)/water/N,N,N',N'-tetramethyl ethylenediaminium dichloride
  1328. lanthanum chloride (LaCl3)/water/N-methyl-2-pyrrolidonium methyl sulfonate
  1329. lanthanum chloride (LaCl3)/water/oxygen
  1330. lanthanum chloride (LaCl3)/water/Phthalimidoantipyrine
  1331. lanthanum chloride (LaCl3)/water/rubidium chloride (RbCl)
  1332. lanthanum chloride (LaCl3)/ytterbium chloride (YbCl3)/water
  1333. lanthanum chloride (LaCl3)/yttrium chloride (YCl3)/water
  1334. lanthanum fluoride (LaF3)/barium fluoride (BaF2)/lithium fluoride (LiF)
  1335. lanthanum fluoride (LaF3)/beryllium fluoride (BeF2)/potassium fluoride (KF)
  1336. lanthanum fluoride (LaF3)/hydrofluoric acid/water
  1337. lanthanum fluoride (LaF3)/lithium fluoride (LiF)/calcium fluoride (CaF2)
  1338. lanthanum fluoride (LaF3)/magnesium fluoride (MgF2)/lithium fluoride (LiF)
  1339. lanthanum fluoride (LaF3)/potassium tetrafluoroborate(1-)/potassium fluoride (KF)
  1340. lanthanum fluoride (LaF3)/sodium fluoride (NaF)/calcium fluoride (CaF2)
  1341. lanthanum fluoride (LaF3)/sodium fluoride (NaF)/lithium fluoride (LiF)
  1342. lanthanum fluoride (LaF3)/sodium fluoride (NaF)/potassium fluoride (KF)
  1343. lanthanum fluoride (LaF3)/sulfuric acid magnesium salt (1:1)/water
  1344. lanthanum fluoride (LaF3)/water/sulfuric acid manganese(2+) salt (1:1)
  1345. lanthanum fluoride (LaF3)/water/sulfuric acid zinc salt (1:1)
  1346. lanthanum hexacyanoferrate(III)/2-propanone/water
  1347. lanthanum hexacyanoferrate(III)/ethanol/water
  1348. lanthanum hexacyanoferrate(III)/glycine/water
  1349. lanthanum iodide (LaI3)/thiourea/water
  1350. lanthanum iodide (LaI3)/urea/water
  1351. lanthanum nickel oxide (La2NiO4.08)/hydrochloric acid/water
  1352. lanthanum nickel oxide (LaNiO2.99)/hydrochloric acid/water
  1353. lanthanum oxide (La2O3)/(T-4)-zirconium fluoride (ZrF4)/lithium fluoride (LiF)
  1354. lanthanum oxide (La2O3)/(T-4)-zirconium fluoride (ZrF4)/potassium fluoride (KF)
  1355. lanthanum oxide (La2O3)/hydrochloric acid/water
  1356. lanthanum oxide (La2O3)/phosphoric acid/water
  1357. lanthanum oxide (La2O3)/selenium oxide (SeO2)/water
  1358. lanthanum oxide (La2O3)/sodium fluoride (NaF)/(T-4)-zirconium fluoride (ZrF4)
  1359. lanthanum oxide (La2O3)/sodium fluoride (NaF)/aluminum fluoride (AlF3)
  1360. lanthanum sulfide (La2S3)/lanthanum oxide (La2O3)/bismuth sulfide (Bi2S3)
  1361. lanthanum(+3) cation trichloride heptahydrate/hydrochloric acid/water
  1362. lanthanum(+3) cation trichloride hexahydrate/hydrochloric acid/water
  1363. lanthanum(3+) (OC-6-11)-hexakis(cyano-κC)ferrate(3-) (1:1) tetrahydrate/2-propanone/formamide
  1364. lead azide (Pb(N3)2)/acetic acid ammonium salt/water
  1365. lead bromide (PbBr2)/ammonium bromide ((NH4)Br)/water
  1366. lead bromide (PbBr2)/barium bromide (BaBr2)/water
  1367. lead bromide (PbBr2)/barium chloride (BaCl2)/water
  1368. lead bromide (PbBr2)/cadmium bromide (CdBr2)/mercury bromide (HgBr2)
  1369. lead bromide (PbBr2)/cadmium chloride (CdCl2)/lead chloride (PbCl2)
  1370. lead bromide (PbBr2)/calcium chloride (CaCl2)/water
  1371. lead bromide (PbBr2)/cesium bromide (CsBr)/mercury bromide (HgBr2)
  1372. lead bromide (PbBr2)/hydrobromic acid/water
  1373. lead bromide (PbBr2)/lead chloride (PbCl2)/cadmium bromide (CdBr2)
  1374. lead bromide (PbBr2)/lead fluoride (PbF2)/lithium fluoride (LiF)
  1375. lead bromide (PbBr2)/lead iodide (PbI2)/cadmium iodide (CdI2)
  1376. lead bromide (PbBr2)/lead iodide (PbI2)/lead chloride (PbCl2)
  1377. lead bromide (PbBr2)/lead iodide (PbI2)/sodium bromide (NaBr)
  1378. lead bromide (PbBr2)/lithium bromide (LiBr)/cesium bromide (CsBr)
  1379. lead bromide (PbBr2)/lithium bromide (LiBr)/lithium fluoride (LiF)
  1380. lead bromide (PbBr2)/lithium bromide (LiBr)/potassium bromide (KBr)
  1381. lead bromide (PbBr2)/lithium bromide (LiBr)/water
  1382. lead bromide (PbBr2)/lithium chloride (LiCl)/potassium bromide (KBr)
  1383. lead bromide (PbBr2)/nitric acid lead(2+) salt/water
  1384. lead bromide (PbBr2)/nitric acid sodium salt/water
  1385. lead bromide (PbBr2)/perchloric acid sodium salt/water
  1386. lead bromide (PbBr2)/potassium bromide (KBr)/cadmium bromide (CdBr2)
  1387. lead bromide (PbBr2)/potassium bromide (KBr)/cesium bromide (CsBr)
  1388. lead bromide (PbBr2)/potassium bromide (KBr)/lead chloride (PbCl2)
  1389. lead bromide (PbBr2)/potassium bromide (KBr)/rubidium bromide (RbBr)
  1390. lead bromide (PbBr2)/potassium bromide (KBr)/thallium bromide (TlBr)
  1391. lead bromide (PbBr2)/potassium chloride (KCl)/lead chloride (PbCl2)
  1392. lead bromide (PbBr2)/potassium chloride (KCl)/lithium chloride (LiCl)
  1393. lead bromide (PbBr2)/potassium chloride (KCl)/water
  1394. lead bromide (PbBr2)/sodium bromide (NaBr)/cadmium bromide (CdBr2)
  1395. lead bromide (PbBr2)/sodium bromide (NaBr)/cesium bromide (CsBr)
  1396. lead bromide (PbBr2)/sodium bromide (NaBr)/lead chloride (PbCl2)
  1397. lead bromide (PbBr2)/sodium bromide (NaBr)/potassium bromide (KBr)
  1398. lead bromide (PbBr2)/sodium bromide (NaBr)/rubidium bromide (RbBr)
  1399. lead bromide (PbBr2)/sodium bromide (NaBr)/thallium bromide (TlBr)
  1400. lead bromide (PbBr2)/sodium bromide (NaBr)/water
  1401. lead bromide (PbBr2)/sodium chloride (NaCl)/lead chloride (PbCl2)
  1402. lead bromide (PbBr2)/sodium chloride (NaCl)/water
  1403. lead bromide (PbBr2)/strontium bromide (SrBr2)/water
  1404. lead bromide (PbBr2)/strontium chloride (SrCl2)/water
  1405. lead bromide (PbBr2)/thallium bromide (TlBr)/cadmium bromide (CdBr2)
  1406. lead bromide (PbBr2)/water/cadmium bromide (CdBr2)
  1407. lead bromide (PbBr2)/water/calcium bromide (CaBr2)
  1408. lead bromide (PbBr2)/water/lead fluoride (PbF2)
  1409. lead bromide (PbBr2)/water/potassium bromide (KBr)
  1410. lead chloride (PbCl2)/rubidium chloride (RbCl)/thallium chloride (TlCl)
  1411. lead chloride (PbCl2)/silver chloride (AgCl)/thallium chloride (TlCl)
  1412. lead chloride (PbCl2)/thallium iodide (TlI)/thallium chloride (TlCl)
  1413. lead chloride fluoride (PbClF)/acetic acid/water
  1414. lead hydroxide (Pb(OH)2)/carbonic acid lead(2+) salt (1:1)/sulfinylbismethane
  1415. lead iodide (PbI2)/ammonium iodide ((NH4)I)/water
  1416. lead iodide (PbI2)/cadmium chloride (CdCl2)/cadmium iodide (CdI2)
  1417. lead iodide (PbI2)/cadmium chloride (CdCl2)/lead chloride (PbCl2)
  1418. lead iodide (PbI2)/cesium iodide (CsI)/cadmium iodide (CdI2)
  1419. lead iodide (PbI2)/lead chloride (PbCl2)/cadmium iodide (CdI2)
  1420. lead iodide (PbI2)/lead chloride (PbCl2)/cesium iodide (CsI)
  1421. lead iodide (PbI2)/lead chloride (PbCl2)/thallium chloride (TlCl)
  1422. lead iodide (PbI2)/lead chloride (PbCl2)/thallium iodide (TlI)
  1423. lead iodide (PbI2)/lithium iodide (LiI)/water
  1424. lead iodide (PbI2)/potassium chloride (KCl)/lead chloride (PbCl2)
  1425. lead iodide (PbI2)/potassium chloride (KCl)/potassium iodide (KI)
  1426. lead iodide (PbI2)/potassium iodide (KI)/cadmium iodide (CdI2)
  1427. lead iodide (PbI2)/potassium iodide (KI)/cesium iodide (CsI)
  1428. lead iodide (PbI2)/potassium iodide (KI)/lead chloride (PbCl2)
  1429. lead iodide (PbI2)/potassium iodide (KI)/sodium iodide (NaI)
  1430. lead iodide (PbI2)/potassium iodide (KI)/thallium iodide (TlI)
  1431. lead iodide (PbI2)/potassium iodide (KI)/water
  1432. lead iodide (PbI2)/rubidium iodide (RbI)/cadmium iodide (CdI2)
  1433. lead iodide (PbI2)/sodium chloride (NaCl)/lead chloride (PbCl2)
  1434. lead iodide (PbI2)/sodium chloride (NaCl)/sodium iodide (NaI)
  1435. lead iodide (PbI2)/sodium chloride (NaCl)/water
  1436. lead iodide (PbI2)/sodium iodide (NaI)/cadmium iodide (CdI2)
  1437. lead iodide (PbI2)/sodium iodide (NaI)/cesium iodide (CsI)
  1438. lead iodide (PbI2)/sodium iodide (NaI)/lead chloride (PbCl2)
  1439. lead iodide (PbI2)/sodium iodide (NaI)/rubidium iodide (RbI)
  1440. lead iodide (PbI2)/sodium iodide (NaI)/thallium iodide (TlI)
  1441. lead iodide (PbI2)/sodium iodide (NaI)/water
  1442. lead iodide (PbI2)/water/cesium iodide (CsI)
  1443. lead iodide (PbI2)/water/lead chloride (PbCl2)
  1444. lead iodide (PbI2)/water/lead fluoride (PbF2)
  1445. lead ion (Pb(2+))/lithium chloride (LiCl)/potassium bromide (KBr)
  1446. lead oxide (PbO)/acetic acid lead(2+) salt/water
  1447. lead oxide (PbO)/ammonia/water
  1448. lead oxide (PbO)/boric acid (HBO2) lead(2+) salt/cadmium (T-4)-tungstate (WO4(2-)) (1:1)
  1449. lead oxide (PbO)/lead/bismuth
  1450. lead oxide (PbO)/nitric acid/water
  1451. lead oxide (PbO)/potassium bromide (KBr)/cesium bromide (CsBr)
  1452. lead oxide (PbO)/potassium chloride (KCl)/lead chloride (PbCl2)
  1453. lead oxide (PbO)/potassium chloride (KCl)/sodium chloride (NaCl)
  1454. lead oxide (PbO)/sulfur dioxide/water
  1455. lead oxide (PbO)/urea/2-hydroxy-N,N,N-trimethylethanaminium chloride
  1456. lead oxide (PbO)/water/(2R,3R)-2,3-dihydroxybutanedioic acid dipotassium salt
  1457. lead oxide (PbO)/water/(2R,3R)-2,3-dihydroxybutanedioic acid disodium salt
  1458. lead sulfide (PbS)/silver sulfide (Ag2S)/lead chloride (PbCl2)
  1459. lead sulfide (PbS)/sodium chloride (NaCl)/lead chloride (PbCl2)
  1460. lead sulfide (PbS)/sodium chloride (NaCl)/water
  1461. lead sulfide (PbS)/tin sulfide (SnS)/antimony sulfide (Sb2S3)
  1462. lead sulfide (PbS)/tin sulfide (SnS)/bismuth sulfide (Bi2S3)
  1463. lead sulfide (PbS)/tin sulfide (SnS)/lead chloride (PbCl2)
  1464. lead sulfide (PbS)/tin sulfide (SnS)/thallium sulfide (Tl2S)
  1465. lead sulfide (PbS)/water/hydrogen sulfide (H2S)
  1466. lead titanium oxide (PbTiO3)/boric acid (HBO2) potassium salt/Bismut(III) orthotantalat
  1467. lead(2+) (T-4)-molybdate (MoO4(2-)) (1:1)/sulfuric acid lead(2+) salt (1:1)/disodium (T-4)-molybdate (MoO4(2-))
  1468. lead(2+) (T-4)-molybdate (MoO4(2-)) (1:1)/sulfuric acid lead(2+) salt (1:1)/sulfuric acid disodium salt
  1469. lead(2+) (T-4)-tungstate (WO4(2-)) (1:1)/sulfuric acid dipotassium salt/dipotassium (T-4)-tungstate (WO4(2-))
  1470. lead(2+) (T-4)-vanadate (VO4(3-)) (3:2)/trilithium (T-4)-vanadate (VO4(3-))/lead chloride (PbCl2)
  1471. lead/antimony/bismuth
  1472. lead/antimony/gallium
  1473. lead/antimony/indium
  1474. lead/antimony/sulfur
  1475. lead/cadmium/zinc
  1476. lead/chromium/bismuth
  1477. lead/cobalt/bismuth
  1478. lead/copper/bismuth
  1479. lead/magnesium/bismuth
  1480. lead/magnesium/calcium
  1481. lead/mercury/bismuth
  1482. lead/mercury/thallium
  1483. lead/mercury/tin
  1484. lead/nickel/bismuth
  1485. lead/silver/copper
  1486. lead/silver/gold
  1487. lead/sodium/sodium chloride (NaCl)
  1488. lead/tin/antimony
  1489. lead/tin/bismuth
  1490. lead/tin/cadmium
  1491. lead/tin/indium
  1492. lead/tin/zinc
  1493. lead/uranium/bismuth
  1494. lead/zinc/indium
  1495. liquefied Natural Gas/separator gas/synthetic Natural Gas Mixture
  1496. lithium (T-4)-tetrachloroaluminate(1-)/lithium chloride (LiCl)/thionyl chloride
  1497. lithium (T-4)-tetrachloroaluminate(1-)/nitromethane/thionyl chloride
  1498. lithium (T-4)-tetrahydroaluminate(1-)/1,1'-oxybisethane/aluminum chloride (AlCl3)
  1499. lithium (T-4)-tetrahydroaluminate(1-)/1,1'-oxybisethane/benzene
  1500. lithium (T-4)-tetrahydroaluminate(1-)/1,1'-oxybisethane/lithium bromide (LiBr)
  1501. lithium (T-4)-tetrahydroaluminate(1-)/1,1'-oxybisethane/magnesium tetrahydroaluminate
  1502. lithium 2,4,6-trinitrophenolate/±-2-pentanol/water
  1503. lithium 2,4,6-trinitrophenolate/1,4,10,13-tetraoxa-7,16-diazoniacyclooctadecane/acetonitrile
  1504. lithium 2,4,6-trinitrophenolate/1,4,10,13-tetraoxa-7,16-diazoniacyclooctadecane/methanol
  1505. lithium 2,4,6-trinitrophenolate/1,4,7,10,13-pentaoxacyclopentadecane/acetonitrile
  1506. lithium 2,4,6-trinitrophenolate/1,4,7,10,13-pentaoxacyclopentadecane/methanol
  1507. lithium 2,4,6-trinitrophenolate/1,4,7,10,13-pentaoxacyclopentadecane/N,N-dimethylformamide
  1508. lithium 2,4,6-trinitrophenolate/1,4,7,10,13-pentaoxacyclopentadecane/nitromethane
  1509. lithium 2,4,6-trinitrophenolate/1-pentanol/water
  1510. lithium 2,4,6-trinitrophenolate/2-butanone/triphenylphosphine oxide
  1511. lithium 2,4,6-trinitrophenolate/3-pentanol/water
  1512. lithium 2,4,6-trinitrophenolate/7-dodecyl-16-methyl-1,4,10,13-tetraoxa-7,16-diazacyclooctadecane/acetonitrile
  1513. lithium 2,4,6-trinitrophenolate/acetonitrile/nitromethane
  1514. lithium 2,4,6-trinitrophenolate/hexamethylphosphoric triamide/2-butanone
  1515. lithium 2,4,6-trinitrophenolate/methanol/7-dodecyl-16-methyl-1,4,10,13-tetraoxa-7,16-diazacyclooctadecane
  1516. lithium 2,4,6-trinitrophenolate/sulfinylbismethane/2-butanone
  1517. lithium 2,4,6-trinitrophenolate/water/nitrobenzene
  1518. lithium azide (Li(N3))/acetonitrile/1,2-dimethylbenzene
  1519. lithium bis(oxalate)borate/carbonic acid dimethyl ester/1,3-dioxolan-2-one
  1520. lithium bis(trifluoromethylsulfonyl)azanide/1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide cesium salt/1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide sodium salt
  1521. lithium bis(trifluoromethylsulfonyl)azanide/1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide potassium salt/1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide cesium salt
  1522. lithium bis(trifluoromethylsulfonyl)azanide/1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide potassium salt/1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide sodium salt
  1523. lithium bis(trifluoromethylsulfonyl)azanide/1,3-dioxolan-2-one/dimethylethylbutylammonium bis(trifluoromethanesulfonyl)imide
  1524. lithium bromide (LiBr)/1-hexyl-3-methyl-1H-imidazolium thiocyanate/1-methyl-2-pyrrolidinone
  1525. lithium bromide (LiBr)/1-methyl-2-pyrrolidinone/1-methyl-3-octyl-1H-imidazolium thiocyanate
  1526. lithium bromide (LiBr)/ammonia/water
  1527. lithium bromide (LiBr)/bromine/potassium bromide (KBr)
  1528. lithium bromide (LiBr)/cesium bromide (CsBr)/calcium bromide (CaBr2)
  1529. lithium bromide (LiBr)/cesium bromide (CsBr)/lithium fluoride (LiF)
  1530. lithium bromide (LiBr)/cesium bromide (CsBr)/rubidium bromide (RbBr)
  1531. lithium bromide (LiBr)/hydrochloric acid/water
  1532. lithium bromide (LiBr)/iodine/water
  1533. lithium bromide (LiBr)/lithium fluoride (LiF)/rubidium bromide (RbBr)
  1534. lithium bromide (LiBr)/nitric acid cesium salt/nitric acid lithium salt
  1535. lithium bromide (LiBr)/nitric acid sodium salt/nitric acid lithium salt
  1536. lithium bromide (LiBr)/potassium bromide (KBr)/calcium bromide (CaBr2)
  1537. lithium bromide (LiBr)/potassium bromide (KBr)/cesium bromide (CsBr)
  1538. lithium bromide (LiBr)/potassium bromide (KBr)/chromic acid (H2CrO4) dipotassium salt
  1539. lithium bromide (LiBr)/potassium bromide (KBr)/lithium fluoride (LiF)
  1540. lithium bromide (LiBr)/potassium bromide (KBr)/rubidium bromide (RbBr)
  1541. lithium bromide (LiBr)/rubidium bromide (RbBr)/cadmium bromide (CdBr2)
  1542. lithium bromide (LiBr)/rubidium bromide (RbBr)/calcium bromide (CaBr2)
  1543. lithium bromide (LiBr)/rubidium bromide (RbBr)/nitric acid lithium salt
  1544. lithium bromide (LiBr)/sodium bromide (NaBr)/calcium bromide (CaBr2)
  1545. lithium bromide (LiBr)/sodium bromide (NaBr)/cesium bromide (CsBr)
  1546. lithium bromide (LiBr)/sodium bromide (NaBr)/potassium bromide (KBr)
  1547. lithium bromide (LiBr)/sodium bromide (NaBr)/rubidium bromide (RbBr)
  1548. lithium bromide (LiBr)/sodium bromide (NaBr)/water
  1549. lithium bromide (LiBr)/water/1,3-dimethyl-1H-imidazolium chloride
  1550. lithium bromide (LiBr)/water/1-(2-Hydroxyethyl)pyridinium bromide
  1551. lithium bromide (LiBr)/water/1-butyl-1-methylpiperidin-1-ium bromide
  1552. lithium bromide (LiBr)/water/1-butyl-1-methylpyrrolidinium bromide
  1553. lithium bromide (LiBr)/water/1-butyl-3-methyl-1H-imidazolium bromide
  1554. lithium bromide (LiBr)/water/1-butyl-3-methyl-1H-imidazolium chloride
  1555. lithium bromide (LiBr)/water/1-butylpyridinium bromide
  1556. lithium bromide (LiBr)/water/1-hexyl-3-methyl-1H-imidazolium thiocyanate
  1557. lithium bromide (LiBr)/water/1-hydroxyethyl-3-methylimidazolium bromide
  1558. lithium bromide (LiBr)/water/1-methyl-3-octyl-1H-imidazolium thiocyanate
  1559. lithium bromide (LiBr)/water/1-Pyridiniumpropane-3-sulfonate
  1560. lithium bromide (LiBr)/water/2-butanone
  1561. lithium bromide (LiBr)/water/3-(1-Methylmorpholinium)propane-1-sulfonate
  1562. lithium bromide (LiBr)/water/3-(Tributylammonio)propane-l-sulfonate
  1563. lithium bromide (LiBr)/water/3-(Triethylammonio)propane-l-sulfonate
  1564. lithium bromide (LiBr)/water/4-(Tributylammonio)butane-l-sulfonate
  1565. lithium bromide (LiBr)/water/4-(Tributylphosphonio)butane-l-sulfonate
  1566. lithium bromide (LiBr)/water/4-(Triethylammonio)butane-l-sulfonate
  1567. lithium bromide (LiBr)/water/4-butyl-4-methylmorpholinium bromide
  1568. lithium bromide (LiBr)/water/cadmium bromide (CdBr2)
  1569. lithium bromide (LiBr)/water/calcium bromide (CaBr2)
  1570. lithium bromide (LiBr)/water/copper bromide (CuBr)
  1571. lithium bromide (LiBr)/water/copper bromide (CuBr2)
  1572. lithium bromide (LiBr)/water/dihydro-2(3H)-furanone
  1573. lithium bromide (LiBr)/water/lithium 2-hydroxypropanoate
  1574. lithium bromide (LiBr)/water/magnesium bromide (MgBr2)
  1575. lithium bromide (LiBr)/water/N,N,N-Tri(2-hydroxyethyl)-N-methylammonium bromide
  1576. lithium bromide (LiBr)/water/N-(2-Acetyloxy)ethyl-N-methylmorpholinium bromide
  1577. lithium bromide (LiBr)/water/N-(Cyanomethyl)-N,N,N-triethylammonium bromide
  1578. lithium bromide (LiBr)/water/N-Hexyl-N-methylmorpholinium bromide
  1579. lithium bromide (LiBr)/water/N-Methyl-N-(2-ethoxy-2-oxoethyl)morpholinium bromide
  1580. lithium bromide (LiBr)/water/N-Methyl-N-(2-hydroxyethyl)morpholinium bromide
  1581. lithium bromide (LiBr)/water/N-Methyl-N-(2-hydroxyethyl)pyrrolidinium bromide
  1582. lithium bromide (LiBr)/water/nitric acid cesium salt
  1583. lithium bromide (LiBr)/water/nitric acid lithium salt
  1584. lithium bromide (LiBr)/water/nitric acid potassium salt
  1585. lithium bromide (LiBr)/water/perchloric acid lithium salt
  1586. lithium bromide (LiBr)/water/potassium bromide (KBr)
  1587. lithium bromide (LiBr)/water/sulfuric acid strontium salt (1:1)
  1588. lithium bromide (LiBr)/water/thallium bromide (TlBr)
  1589. lithium bromide (LiBr)/water/tribromobismuthine
  1590. lithium bromide (LiBr)/zinc bromide (ZnBr2)/water
  1591. lithium chloride (Li(7)Cl)/glycine/water
  1592. lithium chloride (LiCl)/1-hexyl-3-methyl-1H-imidazolium thiocyanate/1-methyl-2-pyrrolidinone
  1593. lithium chloride (LiCl)/1-methyl-2-pyrrolidinone/1-methyl-3-octyl-1H-imidazolium thiocyanate
  1594. lithium chloride (LiCl)/2-methyl-2-butanol/water
  1595. lithium chloride (LiCl)/2-methyl-2-propanol/water
  1596. lithium chloride (LiCl)/acetonitrile/water
  1597. lithium chloride (LiCl)/acetonitrile/water-d2
  1598. lithium chloride (LiCl)/ammonia/water
  1599. lithium chloride (LiCl)/barium fluoride (BaF2)/lithium fluoride (LiF)
  1600. lithium chloride (LiCl)/cesium chloride (CsCl)/copper chloride (CuCl)
  1601. lithium chloride (LiCl)/cesium chloride (CsCl)/lithium fluoride (LiF)
  1602. lithium chloride (LiCl)/cesium chloride (CsCl)/rubidium chloride (RbCl)
  1603. lithium chloride (LiCl)/cesium chloride (CsCl)/water
  1604. lithium chloride (LiCl)/cesium chloride (CsCl)/water-d2
  1605. lithium chloride (LiCl)/cobalt chloride (CoCl2)/water
  1606. lithium chloride (LiCl)/dichlorooxozirconium/water
  1607. lithium chloride (LiCl)/DL-norvaline/water
  1608. lithium chloride (LiCl)/formamide/2-furancarboxaldehyde
  1609. lithium chloride (LiCl)/hydrochloric acid/water
  1610. lithium chloride (LiCl)/iodine/water
  1611. lithium chloride (LiCl)/lithium bromide (LiBr)/lithium fluoride (LiF)
  1612. lithium chloride (LiCl)/lithium bromide (LiBr)/water
  1613. lithium chloride (LiCl)/lithium fluoride (LiF)/calcium fluoride (CaF2)
  1614. lithium chloride (LiCl)/lithium hydride (LiH)/lithium fluoride (LiF)
  1615. lithium chloride (LiCl)/mercury chloride (HgCl2)/water
  1616. lithium chloride (LiCl)/N,N,N-trimethylmethanaminium chloride/water
  1617. lithium chloride (LiCl)/nickel chloride (NiCl2)/water
  1618. lithium chloride (LiCl)/nitric acid silver(1+) salt/nitric acid lithium salt
  1619. lithium chloride (LiCl)/nitric acid silver(1+) salt/silver chloride (AgCl)
  1620. lithium chloride (LiCl)/nitric acid sodium salt/nitric acid lithium salt
  1621. lithium chloride (LiCl)/nitric acid sodium salt/sodium chloride (NaCl)
  1622. lithium chloride (LiCl)/nitrogen/water
  1623. lithium chloride (LiCl)/permanganic acid (HMnO4) potassium salt/water
  1624. lithium chloride (LiCl)/potassium bromide (KBr)/lead chloride (PbCl2)
  1625. lithium chloride (LiCl)/potassium iodide (KI)/lithium fluoride (LiF)
  1626. lithium chloride (LiCl)/silver chloride (AgCl)/nitric acid lithium salt
  1627. lithium chloride (LiCl)/sodium bromide (NaBr)/water
  1628. lithium chloride (LiCl)/sodium chloride (NaCl)/beryllium chloride (BeCl2)
  1629. lithium chloride (LiCl)/sodium chloride (NaCl)/calcium fluoride (CaF2)
  1630. lithium chloride (LiCl)/sodium chloride (NaCl)/cesium chloride (CsCl)
  1631. lithium chloride (LiCl)/sodium chloride (NaCl)/lithium fluoride (LiF)
  1632. lithium chloride (LiCl)/sodium chloride (NaCl)/nitric acid lithium salt
  1633. lithium chloride (LiCl)/sodium chloride (NaCl)/potassium bromide (KBr)
  1634. lithium chloride (LiCl)/sodium chloride (NaCl)/potassium fluoride (KF)
  1635. lithium chloride (LiCl)/sodium chloride (NaCl)/rubidium chloride (RbCl)
  1636. lithium chloride (LiCl)/sodium chloride (NaCl)/sodium fluoride (NaF)
  1637. lithium chloride (LiCl)/sodium chloride (NaCl)/sulfuric acid disodium salt
  1638. lithium chloride (LiCl)/sodium chloride (NaCl)/water
  1639. lithium chloride (LiCl)/sulfuric acid barium salt (1:1)/rubidium chloride (RbCl)
  1640. lithium chloride (LiCl)/sulfuric acid barium salt (1:1)/sulfuric acid calcium salt (1:1)
  1641. lithium chloride (LiCl)/sulfuric acid dipotassium salt/dipotassium (T-4)-tungstate (WO4(2-))
  1642. lithium chloride (LiCl)/sulfuric acid dirubidium salt/nitric acid sodium salt
  1643. lithium chloride (LiCl)/sulfuric acid magnesium salt (1:1)/water
  1644. lithium chloride (LiCl)/tetramethylsilane/water
  1645. lithium chloride (LiCl)/water/α-D-glucopyranosyl α-D-glucopyranoside
  1646. lithium chloride (LiCl)/water/ω-hydroxy-α-(4-(1,1,3,3-tetramethylbutyl)phenyl)poly(oxy-1,2-ethanediyl)
  1647. lithium chloride (LiCl)/water/1,3-dimethyl-1H-imidazolium chloride
  1648. lithium chloride (LiCl)/water/1-butyl-3-methyl-1H-imidazolium bromide
  1649. lithium chloride (LiCl)/water/1-hexyl-3-methyl-1H-imidazolium thiocyanate
  1650. lithium chloride (LiCl)/water/1-methyl-2-pyrrolidinone
  1651. lithium chloride (LiCl)/water/1-methyl-3-octyl-1H-imidazolium thiocyanate
  1652. lithium chloride (LiCl)/water/2-butanol
  1653. lithium chloride (LiCl)/water/2-butanone
  1654. lithium chloride (LiCl)/water/2-methyl-1-propanol
  1655. lithium chloride (LiCl)/water/2-methylpropanoic acid
  1656. lithium chloride (LiCl)/water/3,4,5-trihydroxybenzoic acid (2R,3R)-3,4-dihydro-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-2H-1-benzopyran-3-yl ester
  1657. lithium chloride (LiCl)/water/3,4-dihydroxybenzoic acid
  1658. lithium chloride (LiCl)/water/beryllium chloride (BeCl2)
  1659. lithium chloride (LiCl)/water/cadmium (T-4)-tungstate (WO4(2-)) (1:1)
  1660. lithium chloride (LiCl)/water/calcium (T-4)-tungstate (WO4(2-)) (1:1)
  1661. lithium chloride (LiCl)/water/cellulose carboxymethyl ether sodium salt
  1662. lithium chloride (LiCl)/water/cerium chloride (CeCl3)
  1663. lithium chloride (LiCl)/water/cesium bromide (CsBr)
  1664. lithium chloride (LiCl)/water/chromic acid (H2Cr2O7) dipotassium salt
  1665. lithium chloride (LiCl)/water/copper chloride (CuCl)
  1666. lithium chloride (LiCl)/water/Hexanediyl-1,6-bis(dimethylcetyl)ammonium bromide
  1667. lithium chloride (LiCl)/water/lead chloride (PbCl2)
  1668. lithium chloride (LiCl)/water/lithium pentaborate
  1669. lithium chloride (LiCl)/water/magnesium chloride (MgCl2)
  1670. lithium chloride (LiCl)/water/manganese chloride (MnCl2)
  1671. lithium chloride (LiCl)/water/myo-inositol
  1672. lithium chloride (LiCl)/water/N-methylacetamide
  1673. lithium chloride (LiCl)/water/nitric acid cesium salt
  1674. lithium chloride (LiCl)/water/nitric acid lithium salt
  1675. lithium chloride (LiCl)/water/nitric acid potassium salt
  1676. lithium chloride (LiCl)/water/nitric acid zinc salt
  1677. lithium chloride (LiCl)/water/oxygen
  1678. lithium chloride (LiCl)/water/perchloric acid lithium salt
  1679. lithium chloride (LiCl)/water/rubidium chloride (RbCl)
  1680. lithium chloride (LiCl)/water/silver chloride (AgCl)
  1681. lithium chloride (LiCl)/water/sulfuric acid calcium salt (1:1)
  1682. lithium chloride (LiCl)/water/sulfuric acid disodium salt
  1683. lithium chloride (LiCl)/water/sulfuric acid strontium salt (1:1)
  1684. lithium chloride (LiCl)/water/sulfurous acid barium salt (1:1)
  1685. lithium chloride (LiCl)/water/thallium chloride (TlCl)
  1686. lithium chloride (LiCl)/water/trichlorobismuthine
  1687. lithium chloride (LiCl)/water/water-d2
  1688. lithium chloride (LiCl)/zinc chloride (ZnCl2)/sodium chloride (NaCl)
  1689. lithium chloride (LiCl)/zinc chloride (ZnCl2)/sulfuric acid zinc salt (1:1)
  1690. lithium chloride (LiCl)/zinc chloride (ZnCl2)/tin chloride (SnCl2)
  1691. lithium chloride (LiCl)/zinc chloride (ZnCl2)/water
  1692. Lithium dodecyl sulfate/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)/water
  1693. Lithium dodecyl sulfate/methane/water
  1694. lithium fluoride (LiF)/calcium fluoride (CaF2)/dipotassium (T-4)-tungstate (WO4(2-))
  1695. lithium hexafluoroarsenate(1-)/1,1,2,2-tetrachloroethane/dihydro-2(3H)-furanone
  1696. lithium hexafluoroarsenate(1-)/acetonitrile/1,1,2,2-tetrachloroethane
  1697. lithium hexafluoroarsenate(1-)/carbonic acid dimethyl ester/1,3-dioxolan-2-one
  1698. lithium hexafluoroarsenate(1-)/carbonic acid dimethyl ester/sulfur dioxide
  1699. lithium hexafluoroarsenate(1-)/sulfurous acid dimethyl ester/1,1,2,2-tetrachloroethane
  1700. lithium hexafluoroarsenate(1-)/tetrahydro-2-methylfuran/1,3-dioxolan-2-one
  1701. lithium hexafluoroarsenate(1-)/tetrahydro-2-methylfuran/dihydro-2(3H)-furanone
  1702. lithium hexafluorophosphate(1-)/carbonic acid dimethyl ester/1,3-dioxolan-2-one
  1703. lithium hexafluorophosphate(1-)/carbonic acid dimethyl ester/sulfur dioxide
  1704. lithium hexafluorophosphate(1-)/carbonic acid ethyl methyl ester/1,3-dioxolan-2-one
  1705. lithium hydroxide (Li(OH)) monohydrate/ethanol/water
  1706. lithium hydroxide (Li(OH))/(2R,3R)-rel-2,3-dihydroxybutanedioic acid/water
  1707. lithium hydroxide (Li(OH))/1-butanol/water
  1708. lithium hydroxide (Li(OH))/2-propanone/water
  1709. lithium hydroxide (Li(OH))/aluminum hydroxide (Al(OH)3)/water
  1710. lithium hydroxide (Li(OH))/aluminum oxide (Al2O3)/water
  1711. lithium hydroxide (Li(OH))/arsenic oxide (As2O3)/water
  1712. lithium hydroxide (Li(OH))/carbonic acid dilithium salt/carbonic acid dipotassium salt
  1713. lithium hydroxide (Li(OH))/carbonic acid dilithium salt/water
  1714. lithium hydroxide (Li(OH))/cesium hydroxide (Cs(OH))/water
  1715. lithium hydroxide (Li(OH))/chloric acid lithium salt/water
  1716. lithium hydroxide (Li(OH))/chromic acid (H2CrO4) dilithium salt/chromic acid (H2CrO4) dipotassium salt
  1717. lithium hydroxide (Li(OH))/chromic acid (H2CrO4) dilithium salt/chromic acid (H2CrO4) disodium salt
  1718. lithium hydroxide (Li(OH))/chromic acid (H2CrO4) dilithium salt/water
  1719. lithium hydroxide (Li(OH))/chromium oxide (CrO3)/water
  1720. lithium hydroxide (Li(OH))/dilithium (T-4)-molybdate (MoO4(2-))/water
  1721. lithium hydroxide (Li(OH))/ethanol/water
  1722. lithium hydroxide (Li(OH))/formic acid lithium salt/water
  1723. lithium hydroxide (Li(OH))/hydrogen peroxide (H2O2)/water
  1724. lithium hydroxide (Li(OH))/hydrogen/water
  1725. lithium hydroxide (Li(OH))/iodic acid (HIO3) lithium salt/water
  1726. lithium hydroxide (Li(OH))/iodic acid (HIO3) lithium salt/water
  1727. lithium hydroxide (Li(OH))/lithium bromide (LiBr)/water
  1728. lithium hydroxide (Li(OH))/lithium chloride (LiCl)/nitric acid lithium salt
  1729. lithium hydroxide (Li(OH))/lithium chloride (LiCl)/water
  1730. lithium hydroxide (Li(OH))/mercury oxide (HgO)/water
  1731. lithium hydroxide (Li(OH))/molybdenum oxide (MoO3)/water
  1732. lithium hydroxide (Li(OH))/nitric acid sodium salt/nitric acid lithium salt
  1733. lithium hydroxide (Li(OH))/nitrous acid lithium salt/nitric acid lithium salt
  1734. lithium hydroxide (Li(OH))/phosphorus oxide (P2O5)/water
  1735. lithium hydroxide (Li(OH))/potassium chloride (KCl)/lithium chloride (LiCl)
  1736. lithium hydroxide (Li(OH))/rubidium hydroxide (Rb(OH))/water
  1737. lithium hydroxide (Li(OH))/sodium hydroxide (Na(OH))/chromic acid (H2CrO4) dilithium salt
  1738. lithium hydroxide (Li(OH))/sodium hydroxide (Na(OH))/chromic acid (H2CrO4) disodium salt
  1739. lithium hydroxide (Li(OH))/sodium hydroxide (Na(OH))/nitric acid sodium salt
  1740. lithium hydroxide (Li(OH))/sodium hydroxide (Na(OH))/water
  1741. lithium hydroxide (Li(OH))/uranium oxide (UO2)/water
  1742. lithium hydroxide (Li(OH))/water/Lithium tetrathioantimonate
  1743. lithium hydroxide (Li(OH))/water/nitric acid lithium salt
  1744. lithium hydroxide (Li(OH))/water/oxygen
  1745. lithium iodide (LiI)/(7R)-4-hydroxy-N,N,N-trimethyl-10-oxo-7-((1-oxooctyl)oxy)-3,5,9-trioxa-4-phosphaheptadecan-1-aminium inner salt 4-oxide/water
  1746. lithium iodide (LiI)/1,2-dimethoxyethane/α,α-bis(trifluoromethyl)benzenemethanol triester with boric acid (H3BO3)
  1747. lithium iodide (LiI)/1,2-dimethoxyethane/1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)-2-propanol triester withboric acid (H3BO3)
  1748. lithium iodide (LiI)/1,2-dimethoxyethane/1,1,1,3,3,3-hexafluoro-2-propanol triester with boric acid (H3BO3)
  1749. lithium iodide (LiI)/1,2-dimethoxyethane/2,2,2-trifluoroethanol triester with boric acid (H3BO3)
  1750. lithium iodide (LiI)/1,2-dimethoxyethane/2,2,3,3,4,4,4-heptafluoro-1-butanol triester with boric acid (H3BO3)
  1751. lithium iodide (LiI)/1,2-dimethoxyethane/2,3,5,6-tetrafluorophenol triester with boric acid (H3BO3)
  1752. lithium iodide (LiI)/1,2-dimethoxyethane/2,4-difluorophenol triester with boric acid (H3BO3)
  1753. lithium iodide (LiI)/1,2-dimethoxyethane/2,4-difluorophenyl triester with boric acid (H3BO3)
  1754. lithium iodide (LiI)/1,2-dimethoxyethane/3,5-bis(trilfuoromethyl)phenol triester with boic acid (H3PO3)
  1755. lithium iodide (LiI)/1,2-dimethoxyethane/3-(trifluoromethyl)phenol triester with boric acid (H3BO3)
  1756. lithium iodide (LiI)/1,2-dimethoxyethane/boric acid (H3BO3) trimethyl ester
  1757. lithium iodide (LiI)/1,2-dimethoxyethane/pentafluorophenol triester with boric acid (H3BO3)
  1758. lithium iodide (LiI)/1,2-dimethoxyethane/tris(pentafluorophenyl)borane
  1759. lithium iodide (LiI)/1,2-ethanediol/water
  1760. lithium iodide (LiI)/1,3-dioxolane/acetonitrile
  1761. lithium iodide (LiI)/1,4-dioxane/water
  1762. lithium iodide (LiI)/2-methoxyethanol/methanol
  1763. lithium iodide (LiI)/2-propanol/water
  1764. lithium iodide (LiI)/2-propanone/N,N-dimethylformamide
  1765. lithium iodide (LiI)/4-methyl-1,3-dioxolan-2-one/N,N-dimethylformamide
  1766. lithium iodide (LiI)/acetamide/water
  1767. lithium iodide (LiI)/aluminum oxide (Al2O3)/water
  1768. lithium iodide (LiI)/ammonium iodide ((NH4)I)/water
  1769. lithium iodide (LiI)/anthracene/N,N-dimethylformamide
  1770. lithium iodide (LiI)/benzenamine/water
  1771. lithium iodide (LiI)/boric acid (H3BO3) triphenyl ester/1,2-dimethoxyethane
  1772. lithium iodide (LiI)/carbon dioxide/ethanol
  1773. lithium iodide (LiI)/carbon dioxide/methanol
  1774. lithium iodide (LiI)/carbonic acid diethyl ester/acetonitrile
  1775. lithium iodide (LiI)/chromic acid (H2CrO4) dilithium salt/potassium iodide (KI)
  1776. lithium iodide (LiI)/decane/N,N-dimethylacetamide
  1777. lithium iodide (LiI)/ethanedioic acid manganese(2+) salt (1:1)/water
  1778. lithium iodide (LiI)/ethanol/1-butanol
  1779. lithium iodide (LiI)/ethanol/sodium iodide (NaI)
  1780. lithium iodide (LiI)/ethanol/water
  1781. lithium iodide (LiI)/glycine/water
  1782. lithium iodide (LiI)/helium/water
  1783. lithium iodide (LiI)/hexamethylphosphoric triamide/water
  1784. lithium iodide (LiI)/hexane/1-butanol
  1785. lithium iodide (LiI)/iodine/water
  1786. lithium iodide (LiI)/L-valine/water
  1787. lithium iodide (LiI)/lithium (T-4)-tetrahydroaluminate(1-)/1,1'-oxybisethane
  1788. lithium iodide (LiI)/lithium bromide (LiBr)/lithium fluoride (LiF)
  1789. lithium iodide (LiI)/lithium bromide (LiBr)/potassium iodide (KI)
  1790. lithium iodide (LiI)/lithium bromide (LiBr)/water
  1791. lithium iodide (LiI)/lithium chloride (LiCl)/lithium bromide (LiBr)
  1792. lithium iodide (LiI)/lithium chloride (LiCl)/lithium fluoride (LiF)
  1793. lithium iodide (LiI)/lithium chloride (LiCl)/lithium hydride (LiH)
  1794. lithium iodide (LiI)/lithium chloride (LiCl)/potassium iodide (KI)
  1795. lithium iodide (LiI)/methanol/water
  1796. lithium iodide (LiI)/methanol/zinc bromide (ZnBr2)
  1797. lithium iodide (LiI)/N,N-diethylethanamine/water
  1798. lithium iodide (LiI)/N,N-dimethylformamide/acetic acid methyl ester
  1799. lithium iodide (LiI)/N,N-dimethylformamide/dihydro-2(3H)-furanone
  1800. lithium iodide (LiI)/N,N-dimethylformamide/naphthalene
  1801. lithium iodide (LiI)/neon/water
  1802. lithium iodide (LiI)/potassium iodide (KI)/water
  1803. lithium iodide (LiI)/propanenitrile/acetonitrile
  1804. lithium iodide (LiI)/pyridine/acetonitrile
  1805. lithium iodide (LiI)/pyridine/decane
  1806. lithium iodide (LiI)/pyridine/N,N-dimethylformamide
  1807. lithium iodide (LiI)/sodium iodide (NaI)/water
  1808. lithium iodide (LiI)/urea/water
  1809. lithium iodide (LiI)/water/1,3-dioxolan-2-one
  1810. lithium iodide (LiI)/water/cadmium iodide (CdI2)
  1811. lithium iodide (LiI)/water/perchloric acid lithium salt
  1812. lithium iodide (LiI)/water/sulfuric acid strontium salt (1:1)
  1813. lithium iodide (LiI)/water/thallium iodide (TlI)
  1814. lithium oxide (Li2O)/aluminum oxide (Al2O3)/quartz (SiO2)
  1815. lithium oxide (Li2O)/aluminum oxide (Al2O3)/silica
  1816. lithium oxide (Li2O)/barium oxide (BaO)/quartz (SiO2)
  1817. lithium oxide (Li2O)/carbon dioxide/lithium chloride (LiCl)
  1818. lithium oxide (Li2O)/iron oxide (Fe2O3)/silica
  1819. lithium oxide (Li2O)/metaphosphoric acid (HPO3) lithium salt/lithium vanadate (VO3(1-))
  1820. lithium oxide (Li2O)/sodium oxide (Na2O)/quartz (SiO2)
  1821. lithium sulfide (Li2S)/carbonic acid dilithium salt/carbonic acid dipotassium salt
  1822. lithium sulfide (Li2S)/potassium sulfide (K2S)/carbonic acid dipotassium salt
  1823. lithium sulfide (Li2S)/silicic acid (H4SiO4) tetralithium salt/silicon sulfide (SiS2)
  1824. lithium sulfinylbismethane ion(1-)/methanol/sulfinylbismethane
  1825. lithium sulfinylbismethane ion(1-)/sulfinylbismethane/2-methyl-2-propanol
  1826. lithium tetrafluoroborate(1-)/4-ethyl-1,3-dioxolan-2-one/acetonitrile
  1827. lithium tetrafluoroborate(1-)/acetonitrile/1,3-dioxolan-2-one
  1828. lithium tetrafluoroborate(1-)/N,N-dimethylformamide/lithium chloride (LiCl)
  1829. lithium tetrafluoroborate(1-)/tetrahydro-2-methylfuran/dihydro-2(3H)-furanone
  1830. lithium tetrafluoroborate(1-)/water/dihydro-2(3H)-furanone
  1831. lithium tetraphenylborate(1-)/2-butanone/triphenylphosphine oxide
  1832. lithium tetraphenylborate(1-)/hexamethylphosphoric triamide/2-butanone
  1833. lithium uranium borate oxide (LiU(BO3)O2) hydrate (2:3)/hydrochloric acid/water
  1834. lithium vanadate (VO3(1-))/lithium bromide (LiBr)/lithium fluoride (LiF)
  1835. lithium vanadate (VO3(1-))/lithium bromide (LiBr)/potassium bromide (KBr)
  1836. lithium vanadate (VO3(1-))/lithium bromide (LiBr)/sodium bromide (NaBr)
  1837. lithium vanadate (VO3(1-))/lithium chloride (LiCl)/lithium bromide (LiBr)
  1838. lithium vanadate (VO3(1-))/lithium chloride (LiCl)/lithium fluoride (LiF)
  1839. lithium vanadate (VO3(1-))/potassium bromide (KBr)/lithium fluoride (LiF)
  1840. lithium vanadate (VO3(1-))/potassium bromide (KBr)/Lithium potassium molybdate
  1841. lithium vanadate (VO3(1-))/sodium bromide (NaBr)/lithium fluoride (LiF)
  1842. lithium vanadate (VO3(1-))/sodium bromide (NaBr)/potassium bromide (KBr)
  1843. lithium/gallium/zinc
  1844. lithium/germanium/indium
  1845. lithium/potassium/sodium
  1846. lithium/silver/antimony
  1847. lithium/tin/antimony
  1848. lithium/tin/cobalt
  1849. lithium/tin/copper
  1850. lithium/tin/gallium
  1851. lutetium chloride (LuCl3)/ethanol/water
  1852. lutetium chloride (LuCl3)/hydrochloric acid/water
  1853. lutetium chloride (LuCl3)/water/3-pyridinecarboxamide
  1854. magnesium (3S)-3-amino-4-hydroxy-4-oxobutanoate/guanidine monohydrochloride/water
  1855. magnesium (T-4)-molybdate (MoO4(2-)) (1:1)/disodium (T-4)-molybdate (MoO4(2-))/water
  1856. magnesium (T-4)-molybdate (MoO4(2-)) (1:1)/magnesium chloride (MgCl2)/calcium (T-4)-molybdate (MoO4(2-)) (1:1)
  1857. magnesium (T-4)-molybdate (MoO4(2-)) (1:1)/sulfuric acid magnesium salt (1:1)/water
  1858. magnesium (T-4)-molybdate (MoO4(2-)) (1:1)/thiourea/water
  1859. magnesium (T-4)-molybdate (MoO4(2-)) (1:1)/urea/water
  1860. magnesium (T-4)-molybdate (MoO4(2-)) (1:1)/water/magnesium chloride (MgCl2)
  1861. magnesium (T-4)-technetate (TcO4(1-)) (1:2)/sulfuric acid magnesium salt (1:1)/water
  1862. magnesium (T-4)-technetate (TcO4(1-)) (1:2)/water/magnesium chloride (MgCl2)
  1863. magnesium (T-4)-technetate (TcO4(1-)) (1:2)/water/sulfuric acid disodium salt
  1864. magnesium ammonium bromide/magnesium ammonium chloride/water
  1865. magnesium ammonium bromide/rubidium magnesium bromide/water
  1866. magnesium ammonium bromide/water/magnesium bromide (MgBr2)
  1867. magnesium chloride (MgCl2) dihydrate/methanol/water
  1868. magnesium fluoride (MgF2)/barium fluoride (BaF2)/calcium fluoride (CaF2)
  1869. magnesium fluoride (MgF2)/barium fluoride (BaF2)/lithium fluoride (LiF)
  1870. magnesium fluoride (MgF2)/lithium fluoride (LiF)/calcium fluoride (CaF2)
  1871. magnesium fluoride (MgF2)/magnesium chloride (MgCl2)/potassium fluoride (KF)
  1872. magnesium fluoride (MgF2)/potassium fluoride (KF)/lithium fluoride (LiF)
  1873. magnesium fluoride (MgF2)/strontium fluoride (SrF2)/lithium fluoride (LiF)
  1874. magnesium hexafluorosilicate(2-) (1:1)/dihydrogen hexafluorosilicate(2-)/water
  1875. magnesium hydroxide (Mg(OH)2)/hydrogen peroxide (H2O2)/water
  1876. magnesium hydroxide (Mg(OH)2)/molybdenum oxide (MoO3)/water
  1877. magnesium hydroxide (Mg(OH)2)/phosphorus oxide (P2O5)/water
  1878. magnesium hydroxide (Mg(OH)2)/sodium chloride (NaCl)/water
  1879. magnesium hydroxide (Mg(OH)2)/sulfuric acid magnesium salt (1:1)/water
  1880. magnesium hydroxide (Mg(OH)2)/water/magnesium chloride (MgCl2)
  1881. magnesium hydroxide (Mg(OH)2)/water/sulfuric acid dipotassium salt
  1882. magnesium hydroxide (Mg(OH)2)/water/sulfurous acid
  1883. magnesium hypophosphite/phosphinic acid sodium salt/water
  1884. magnesium hypophosphite/water/magnesium chloride (MgCl2)
  1885. magnesium iodide (MgI2)/1,1'-oxybisethane/ethanol
  1886. magnesium iodide (MgI2)/1,1'-oxybisethane/methanol
  1887. magnesium iodide (MgI2)/ethanol/potassium iodide (KI)
  1888. magnesium iodide (MgI2)/formamide/water
  1889. magnesium iodide (MgI2)/iodine/water
  1890. magnesium iodide (MgI2)/sodium iodide (NaI)/water
  1891. magnesium iodide (MgI2)/urea/water
  1892. magnesium iodide (MgI2)/water/magnesium chloride (MgCl2)
  1893. magnesium iodide (MgI2)/water/thallium iodide (TlI)
  1894. magnesium metavanadate/potassium vanadate (VO3(1-))/water
  1895. magnesium metavanadate/sodium vanadate (VO3(1-))/water
  1896. magnesium metavanadate/water/calcium metavanadate
  1897. magnesium nitride (Mg3N2)/hydrochloric acid/water
  1898. magnesium oxide (MgO)/1,2,3-propanetriol/2-hydroxy-N,N,N-trimethylethanaminium chloride
  1899. magnesium oxide (MgO)/acetic acid/water
  1900. magnesium oxide (MgO)/aluminum oxide (Al2O3)/quartz (SiO2)
  1901. magnesium oxide (MgO)/hydrochloric acid/water
  1902. magnesium oxide (MgO)/lanthanum oxide (La2O3)/aluminum oxide (Al2O3)
  1903. magnesium oxide (MgO)/neodymium oxide (Nd2O3)/aluminum oxide (Al2O3)
  1904. magnesium oxide (MgO)/nickel oxide (NiO)/silica
  1905. magnesium oxide (MgO)/phosphorus oxide (P2O5)/magnesium fluoride (MgF2)
  1906. magnesium oxide (MgO)/phosphorus oxide (P2O5)/water
  1907. magnesium oxide (MgO)/potassium bromide (KBr)/cesium bromide (CsBr)
  1908. magnesium oxide (MgO)/potassium chloride (KCl)/magnesium chloride (MgCl2)
  1909. magnesium oxide (MgO)/quartz (SiO2)/magnesium fluoride (MgF2)
  1910. magnesium oxide (MgO)/sodium chloride (NaCl)/magnesium chloride (MgCl2)
  1911. magnesium oxide (MgO)/sodium oxide (Na2O)/phosphorus oxide (P2O5)
  1912. magnesium oxide (MgO)/strontium oxide (SrO)/quartz (SiO2)
  1913. magnesium oxide (MgO)/sulfur dioxide/water
  1914. magnesium oxide (MgO)/water/magnesium chloride (MgCl2)
  1915. magnesium oxide (MgO)/water/propanoic acid
  1916. magnesium oxide (MgO)/zinc oxide (ZnO)/quartz (SiO2)
  1917. magnesium oxide (MgO)/zirconium oxide (ZrO2)/aluminum oxide (Al2O3)
  1918. magnesium oxide (MgO)/zirconium oxide (ZrO2)/yttrium oxide (Y2O3)
  1919. magnesium oxide sulfate (Mg6O5(SO4)) heptahydrate/hydrochloric acid/water
  1920. magnesium oxide sulfate (Mg6O5(SO4)) octahydrate/hydrochloric acid/water
  1921. magnesium potassium scandium chloride (MgKScCl6)/hydrochloric acid/water
  1922. magnesium scandium sodium chloride (MgScNaCl6)/hydrochloric acid/water
  1923. magnesium tetrahydroborate(1-) (1:2)/lithium tetrahydroborate(1-)/1,1'-oxybisethane
  1924. magnesium tetrahydroborate(1-) (1:2)/sodium tetrahydroborate(1-)/N,N-dimethylformamide
  1925. magnesium/nickel/copper
  1926. magnetite (Fe3O4)/2-hydroxypropane-1,2,3-tricarboxylic acid/water
  1927. maltohexaose/water/naphthalene
  1928. manganese bromide (MnBr2)/sodium bromide (NaBr)/water
  1929. manganese bromide (MnBr2)/water/cadmium bromide (CdBr2)
  1930. manganese bromide (MnBr2)/water/calcium bromide (CaBr2)
  1931. manganese bromide (MnBr2)/water/cesium bromide (CsBr)
  1932. manganese bromide (MnBr2)/water/magnesium bromide (MgBr2)
  1933. manganese bromide (MnBr2)/water/potassium bromide (KBr)
  1934. manganese bromide (MnBr2)/water/rubidium bromide (RbBr)
  1935. manganese bromide (MnBr2)/water/sulfuric acid manganese(2+) salt (1:1)
  1936. manganese chloride (MnCl2) tetrahydrate/octanol/water
  1937. manganese chloride (MnCl2)/manganese fluoride (MnF2)/potassium fluoride (KF)
  1938. manganese fluoride (MnF2)/potassium fluoride (KF)/lithium fluoride (LiF)
  1939. manganese hydroxide (Mn(OH)2)/hydrochloric acid/water
  1940. manganese hydroxide (Mn(OH)2)/sodium chloride (NaCl)/water
  1941. manganese ion (Mn(2+))/N,N-dimethylformamide/Manganese(II) (1,2-dihydroxyanthraquinone-3-sulfonate)sodium tetrahydrate
  1942. manganese oxide (Mn2O3)/hydrochloric acid/water
  1943. manganese oxide (Mn2O3)/manganese oxide (MnO)/quartz (SiO2)
  1944. manganese oxide (Mn2O3)/propanedioic acid/2-hydroxy-N,N,N-trimethylethanaminium chloride
  1945. manganese oxide (MnO)/hydrochloric acid/water
  1946. manganese oxide (MnO)/potassium bromide (KBr)/cesium bromide (CsBr)
  1947. manganese oxide (MnO)/potassium chloride (KCl)/sodium chloride (NaCl)
  1948. manganese oxide (MnO)/propanedioic acid/2-hydroxy-N,N,N-trimethylethanaminium chloride
  1949. manganese oxide (MnO2)/hydrochloric acid/water
  1950. manganese oxide (MnO2)/propanedioic acid/2-hydroxy-N,N,N-trimethylethanaminium chloride
  1951. manganese oxide (MnO2)/urea/2-hydroxy-N,N,N-trimethylethanaminium chloride
  1952. manganese oxide (MnO2)/water/2-methylpropanoic acid
  1953. manganese/aluminum chloride (AlCl3)/sodium chloride (NaCl)
  1954. manganese/gadolinium/germanium
  1955. manganese/gallium/germanium
  1956. manganese/germanium/yttrium
  1957. mannose/glycine/water
  1958. marbofloxacin/acetonitrile/water
  1959. marbofloxacin/ethanol/water
  1960. marbofloxacin/methanol/water
  1961. massicot (PbO)/ammonia/water
  1962. mercaptoacetic acid/water/1-octyl-3-methyl-1H-imidazolium (T-4)-tetrachloroaluminate(1-)
  1963. mercaptoacetic acid/water/1-Octyl-3-methylimidazolium perchlorate
  1964. mercaptoacetic acid/water/Thioglycolic acid 2-ethylhexyl ester
  1965. mercury chloride (HgCl2)/2-methyl-2-propanol/water
  1966. mercury chloride (HgCl2)/cesium chloride (CsCl)/water
  1967. mercury chloride (HgCl2)/cobalt chloride (CoCl2)/water
  1968. mercury chloride (HgCl2)/hydrochloric acid/water
  1969. mercury chloride (HgCl2)/mercury iodide (HgI2)/silver chloride (AgCl)
  1970. mercury chloride (HgCl2)/perchloric acid mercury(2+) salt/water
  1971. mercury chloride (HgCl2)/sodium chloride (NaCl)/water
  1972. mercury chloride (HgCl2)/water/beryllium chloride (BeCl2)
  1973. mercury chloride (HgCl2)/water/lead chloride (PbCl2)
  1974. mercury chloride (HgCl2)/water/magnesium chloride (MgCl2)
  1975. mercury chloride (HgCl2)/water/mercury iodide (HgI2)
  1976. mercury chloride (HgCl2)/water/rubidium chloride (RbCl)
  1977. mercury chloride (HgCl2)/water/thallium chloride (TlCl)
  1978. mercury cyanide (Hg(CN)2)/ammonia/water
  1979. mercury cyanide (Hg(CN)2)/ethanol/methanol
  1980. mercury cyanide (Hg(CN)2)/ethanol/water
  1981. mercury cyanide (Hg(CN)2)/methanol/water
  1982. mercury cyanide (Hg(CN)2)/water/water-d2
  1983. mercury iodide (HgI2)/silver chloride (AgCl)/silver iodide (AgI)
  1984. mercury oxide (HgO)/hydrochloric acid/water
  1985. mercury oxide (HgO)/hydrofluoric acid/water
  1986. mercury oxide (HgO)/mercury chloride (HgCl2)/water
  1987. mercury oxide (HgO)/nitric acid/water
  1988. mercury oxide (HgO)/selenium oxide (SeO2)/water
  1989. mercury/aluminum chloride (AlCl3)/sodium chloride (NaCl)
  1990. mercury/cadmium/zinc
  1991. mercury/cyclopentanol/paraffinic mineral oil
  1992. mercury/gallium/indium
  1993. mercury/potassium chloride (KCl)/lithium chloride (LiCl)
  1994. mercury/rubidium/sodium
  1995. mercury/sodium chloride (NaCl)/water
  1996. mercury/sodium/cesium
  1997. metaphosphoric acid (HPO3) lithium salt/sulfuric acid dipotassium salt/metaphosphoric acid (HPO3) potassium salt
  1998. metaphosphoric acid (HPO3) sodium salt/boric acid (HBO2) lithium salt/boric acid (HBO2) sodium salt
  1999. metaphosphoric acid (HPO3) sodium salt/boric acid (HBO2) lithium salt/metaphosphoric acid (HPO3) lithium salt
  2000. metaphosphoric acid (HPO3) sodium salt/boric acid (HBO2) potassium salt/metaphosphoric acid (HPO3) potassium salt
  2001. metaphosphoric acid (HPO3) sodium salt/boron sodium oxide (B4Na2O7)/diphosphoric acid tetrasodium salt
  2002. metaphosphoric acid (HPO3) sodium salt/boron sodium oxide (B4Na2O7)/metaphosphoric acid (HPO3) potassium salt
  2003. metaphosphoric acid (HPO3) sodium salt/carbon dioxide/water
  2004. metaphosphoric acid (HPO3) sodium salt/diphosphoric acid tetrasodium salt/sulfuric acid disodium salt
  2005. metaphosphoric acid (HPO3) sodium salt/disodium (T-4)-tungstate (WO4(2-))/dipotassium (T-4)-tungstate (WO4(2-))
  2006. metaphosphoric acid (HPO3) sodium salt/disodium (T-4)-tungstate (WO4(2-))/metaphosphoric acid (HPO3) potassium salt
  2007. metaphosphoric acid (HPO3) sodium salt/metaphosphoric acid (HPO3) calcium salt/sulfuric acid calcium salt (1:1)
  2008. metaphosphoric acid (HPO3) sodium salt/metaphosphoric acid (HPO3) calcium salt/sulfuric acid disodium salt
  2009. metaphosphoric acid (HPO3) sodium salt/sodium chloride (NaCl)/sulfuric acid disodium salt
  2010. metaphosphoric acid (HPO3) sodium salt/sodium fluoride (NaF)/metaphosphoric acid (HPO3) potassium salt
  2011. metaphosphoric acid (HPO3) sodium salt/sodium fluoride (NaF)/sulfuric acid disodium salt
  2012. metaphosphoric acid (HPO3) sodium salt/sulfuric acid disodium salt/boric acid (HBO2) sodium salt
  2013. metaphosphoric acid (HPO3) sodium salt/sulfuric acid disodium salt/sulfuric acid calcium salt (1:1)
  2014. methan-d3-ol/2-methyl-N,N,N-tris(2-methylpropyl)-1-propanaminium bromide/krypton
  2015. methan-d3-ol/argon/water
  2016. methan-d3-ol/hexamethylphosphoric triamide/water
  2017. methan-d3-ol/krypton/potassium bromide (KBr)
  2018. methan-d3-ol/krypton/water
  2019. methan-d3-ol/urea/krypton
  2020. methan-d3-ol/urea/water
  2021. methan-d3-ol/water/potassium bromide (KBr)
  2022. methanamine hydrochloride/lithium chloride (LiCl)/water
  2023. methanamine hydrochloride/methanol/water
  2024. methanamine hydrochloride/water/cerium chloride (CeCl3)
  2025. methanamine/ammonia/water
  2026. methanamine/sulfur dioxide/water
  2027. methane-d4/methane-d3/methane
  2028. methane/(1R,2R)-rel-2-methylcyclohexanol/water
  2029. methane/(1R,2S)-rel-2-methylcyclohexanol/water
  2030. methane/1,1-dimethylethyl hydroperoxide/water
  2031. methane/1-butyl-1H-imidazolium acetate/tetrabutylphosphonium bis(2,4,4-trimethylpentyl)phosphinate
  2032. methane/2,2,2-trifluoroethanol/water
  2033. methane/2,2-dimethylbutane/water
  2034. methane/2,2-dimethylbutane/water-d2
  2035. methane/2,3,3,3-tetrafluoro-1-propene/water
  2036. methane/2-methyl-2-propanamine/water
  2037. methane/2-methyl-2-propanol/sea water
  2038. methane/2-methyl-2-propanol/water
  2039. methane/2-methylpropane/water
  2040. methane/3,3-dimethyl-2-butanone/water
  2041. methane/acetaldehyde/water
  2042. methane/ammonia/nitrogen
  2043. methane/ammonia/water
  2044. methane/argon/nitrogen
  2045. methane/argon/water
  2046. methane/cesium chloride (CsCl)/water
  2047. methane/cis-4-methylcyclohexanol/water
  2048. methane/cyclopropane/water
  2049. methane/dichloromethane/water
  2050. methane/dichlorooxozirconium/water
  2051. methane/ethanamine/water
  2052. methane/ethane/2-methylpropane
  2053. methane/ethane/ammonia
  2054. methane/ethane/argon
  2055. methane/ethane/ethene
  2056. methane/ethane/hydrogen sulfide (H2S)
  2057. methane/ethane/nitrogen
  2058. methane/ethane/propane
  2059. methane/ethane/water
  2060. methane/ethanethiol/water
  2061. methane/ethene/2-methylpropane
  2062. methane/ethene/ethyne
  2063. methane/ethene/propane
  2064. methane/ethene/water
  2065. methane/helium/nitrogen
  2066. methane/helium/water
  2067. methane/hydrochloric acid/water
  2068. methane/krypton/water
  2069. methane/lithium bromide (LiBr)/water
  2070. methane/lithium chloride (LiCl)/water
  2071. methane/lubricating oil/water
  2072. methane/methanethiol/water
  2073. methane/methyloxirane/water
  2074. methane/N,N,N-trimethylmethanaminium chloride/water
  2075. methane/N,N,N-trimethylmethanaminium hydroxide/water
  2076. methane/nitrogen/hydrogen sulfide (H2S)
  2077. methane/nitrogen/oxygen
  2078. methane/nitrogen/water
  2079. methane/potassium chloride (KCl)/water
  2080. methane/potassium iodide (KI)/water
  2081. methane/propane/2-methylpropane
  2082. methane/propane/hydrogen sulfide (H2S)
  2083. methane/propane/nitrogen
  2084. methane/propane/water
  2085. methane/silica/water
  2086. methane/sodium bromide (NaBr)/water
  2087. methane/sodium chloride (NaCl)/water
  2088. methane/sodium iodide (NaI)/water
  2089. methane/sulfuric acid magnesium salt (1:1)/water
  2090. methane/sulfuric acid/water
  2091. methane/sulfurous acid monosodium salt/water
  2092. methane/tetrafluoromethane/water
  2093. methane/thiobismethane/water
  2094. methane/trans-4-methylcyclohexanol/water
  2095. methane/trifluoromethane/water
  2096. methane/water/(1Z)-cyclooctene
  2097. methane/water/1,1,1,3,3,3-hexafluoro-2-propanol
  2098. methane/water/1,2-dimethylbenzene
  2099. methane/water/1,3-dioxolan-2-one
  2100. methane/water/1-(2-hydroxyethyl)-3-methyl-1H-imidazolium chloride
  2101. methane/water/1-(2-hydroxyethyl)-3-methylimidazolium perchlorate
  2102. methane/water/1-(3-Cyanopropyl)-3-methylimidazolium dihydrogenphosphate
  2103. methane/water/1-butyl-3-methyl-1H-imidazolium bromide
  2104. methane/water/1-butyl-3-methyl-1H-imidazolium chloride
  2105. methane/water/1-butyl-3-methyl-1H-imidazolium salt with perchloric acid (1:1)
  2106. methane/water/1-butyl-3-methylimidazolium dihydrogenphosphate
  2107. methane/water/1-ethenyl-2-pyrrolidinone homopolymer
  2108. methane/water/1-Ethyl-3-methylimidazolium dihydrogenphosphate
  2109. methane/water/1-hexyl-3-methyl-1H-imidazolium bromide
  2110. methane/water/1-hydroxyethyl-3-methylimidazolium bromide
  2111. methane/water/1-methyl-2-pyrrolidinone
  2112. methane/water/2,3-dimethylbutane
  2113. methane/water/2-(2-aminoethoxy)ethanol
  2114. methane/water/2-methyl-1,3-butadiene
  2115. methane/water/2-methylbutane
  2116. methane/water/2-methylpropanal
  2117. methane/water/2-propenamide homopolymer
  2118. methane/water/3-methylpentane
  2119. methane/water/3-pentanone
  2120. methane/water/calcium bromide (CaBr2)
  2121. methane/water/chlorocyclopentane
  2122. methane/water/Clayey silt
  2123. methane/water/CPG
  2124. methane/water/crude Oil
  2125. methane/water/cyclopentanol
  2126. methane/water/Davisil
  2127. methane/water/Diethylenetriaminepentakis(methylphosphonic acid)
  2128. methane/water/Dimethylammonium formate
  2129. methane/water/Dimethylethyl ammonium formate
  2130. methane/water/ethylammonium methanoate
  2131. methane/water/guar gum
  2132. methane/water/hydrogen sulfide (H2S)
  2133. methane/water/Imino-bis(methylphosphonic acid)
  2134. methane/water/inhibex 301
  2135. methane/water/inhibex 501
  2136. methane/water/magnesium bromide (MgBr2)
  2137. methane/water/magnesium chloride (MgCl2)
  2138. methane/water/McKay River bitumen
  2139. methane/water/methylcyclopentane
  2140. methane/water/Mung starch
  2141. methane/water/N,N,N-tripentyl-1-pentanaminium bromide
  2142. methane/water/N-(hyxdroxyethyl)-N-methylmorpholinium chloride
  2143. methane/water/N-Butyl-N-methylmorpholinium acetate
  2144. methane/water/N-ethyl-N-methylmorpholinium tetrafluoroborate
  2145. methane/water/N-ethyl-N-methylpiperidinium tetrafluoroborate
  2146. methane/water/nitric acid potassium salt
  2147. methane/water/nonadecafluorooctanoic acid lithium salt
  2148. methane/water/pentanes (mixture)
  2149. methane/water/poly(ethylene glycol)-b-poly(propylene glycol)-b-poly(ethylene glycol) triblock copolmyer
  2150. methane/water/Polyaluminium chloride (PAC)
  2151. methane/water/potassium bromide (KBr)
  2152. methane/water/potassium methoxy-oxido-oxosilane
  2153. methane/water/SBA-15
  2154. methane/water/sulfuric acid copper(2+) salt (1:1)
  2155. methane/water/sulfuric acid dipotassium salt
  2156. methane/water/sulfuric acid disodium salt
  2157. methane/water/Tetrabutylammonium acrylate
  2158. methane/water/Tetrabutylphosphonium acetate
  2159. methane/water/tetrahydro-2-furanmethanol
  2160. methane/water/tetrahydro-2-methylfuran
  2161. methane/water/Tri-butylammonium hydrogensulfate
  2162. methane/water/Tributylammonium formate
  2163. methane/water/tributylphosphine oxide
  2164. methane/water/tripropylammonium hydrogen sulfate
  2165. methane/water/trisodium methyl(trioxido)silane
  2166. methane/water/xylitol
  2167. methane/xenon/water
  2168. methane/zinc bromide (ZnBr2)/water
  2169. methanesulfonic acid/water/1,3-dioxolan-2-one
  2170. methanesulfonic acid/water/Cobalt methanesulfonate
  2171. methanesulfonic acid/water/Nickel methanesulfonate
  2172. methanethiol/nitrogen/1-methyl-2-pyrrolidinone
  2173. methanethiol/sodium chloride (NaCl)/water
  2174. methanethiol/sulfuric acid/water
  2175. methanethiol/water/2-(2-aminoethoxy)ethanol
  2176. methanethiol/water/Natriummethanthiolat
  2177. methanethiol/water/sulfuric acid disodium salt
  2178. methanol barium salt/methanol/methanol tantalum(5+) salt
  2179. methanol magnesium salt/methanol/methanol tantalum(5+) salt
  2180. methanol sodium salt/methanol/benzene
  2181. methanol-(14)C/β-D-fructofuranosyl α-D-glucopyranoside/water
  2182. methanol-(14)C/urea/water
  2183. methanol-d/2-methyl-N,N,N-tris(2-methylpropyl)-1-propanaminium bromide/krypton
  2184. methanol-d/argon/water-d2
  2185. methanol-d/cesium iodide (CsI)/water-d2
  2186. methanol-d/hexamethylphosphoric triamide/water-d2
  2187. methanol-d/krypton/potassium bromide (KBr)
  2188. methanol-d/krypton/water-d2
  2189. methanol-d/potassium bromide (KBr)/water-d2
  2190. methanol/β-cyclodextrin/1-butyl-1-methylpyrrolidinium bromide
  2191. methanol/(1-methoxy-1-methylethyl)benzene/(1-methylethenyl)benzene
  2192. methanol/(1R,3R,4R,5R)-1,3,4,5-tetrahydroxycyclohexanecarboxylic acid/water
  2193. methanol/(2S,5R)-3,3-dimethyl-4,4,7-trioxo-4$l^6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid/water
  2194. methanol/(3β)-3-hydroxyurs-12-en-28-oic acid/water
  2195. methanol/(3R,5aS,6R,8aS,9R,10S,12R,12aR)-decahydro-10-methoxy-3,6,9-trimethyl-3,12-epoxy-12H-pyrano(4,3-j)-1,2-benzodioxepin/water
  2196. methanol/(8E,14E,16E,18E,20E)-(1R,3S,5R,7R,12R,22R,24S,25R,26S)-22-(3-amino-3,6-dideoxy-25-D-mannopyranosyloxy)-1,3,26-trihydroxy-12-methyl-10-oxo-6,11,28-trioxatricyclo[22,3,1,0(5,7)]octacosa-8,14,16,18,20-pentaene-25-carboxylic acid/water
  2197. methanol/1,1,1-trichloroethane/1,1,2,2-tetrachloro-1,2-difluoroethane
  2198. methanol/1,1,2,2-tetrachloro-1,2-difluoroethane/nitroethane
  2199. methanol/1,1,2,2-tetrachloro-1,2-difluoroethane/trichloroethene
  2200. methanol/1,1,2,2-tetrachloro-1,2-difluoroethane/water
  2201. methanol/1,1-dichloroethane/1,1,2-trichloro-1,2,2-trifluoroethane
  2202. methanol/1,12-bis(N-methylpyrrolidinium)dodecane salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)/3,3'-(1,12-dodecanediyl)bis[1-methylimidazolium] salt with 1,1,2,2,2-pentafluoro-N-((pentafluoroethyl)sulfonyl)ethanesulfon...
  2203. methanol/1,12-bis(N-methylpyrrolidinium)dodecane salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)/3,3'-(1,12-dodecanediyl)bis[1-methylimidazolium] tetrafluoroborate(1-) (1:2)
  2204. methanol/1-(ethenyloxy)propane/water
  2205. methanol/1-butanol/(1,1'-biphenyl)-4-carboxylic acid
  2206. methanol/1-butanol/2-methoxy-2-methylbutane
  2207. methanol/1-butanol/acetic acid methyl ester
  2208. methanol/1-butanol/benzene
  2209. methanol/1-butanol/cadmium iodide (CdI2)
  2210. methanol/1-butanol/cesium chloride (CsCl)
  2211. methanol/1-butanol/chloroacetic acid
  2212. methanol/1-butanol/Dipyridamole p-toluene sulfonate
  2213. methanol/1-butanol/Hexamethylenediamine glutarate
  2214. methanol/1-butanol/L-Carnitine fumarate
  2215. methanol/1-butanol/Methyleneaminoacetonitrile
  2216. methanol/1-butanol/N,N,N-triethylethanaminium salt with 2,4,6-trinitrophenol (1:1)
  2217. methanol/1-butanol/N,N,N-trimethylmethanaminium salt with 2,4,6-trinitrophenol (1:1)
  2218. methanol/1-butanol/phenanthrene
  2219. methanol/1-butanol/potassium chloride (KCl)
  2220. methanol/1-butanol/rubidium chloride (RbCl)
  2221. methanol/1-butanol/water
  2222. methanol/1-buten-3-yne/water
  2223. methanol/1-chloro-2,5-dimethoxy-4-nitrobenzene/water
  2224. methanol/1-cyclohexyl-2-pyrrolidinone/1-methyl-2-pyrrolidinone
  2225. methanol/1-methyl-1H-imidazole sulfate (1:1)/2-methyl-2-propenoic acid methyl ester
  2226. methanol/1-methyl-1H-imidazole sulfate (1:1)/acetic acid methyl ester
  2227. methanol/1-methyl-2-pyrrolidinone/2-Nitrobenzene-1,4-diamine
  2228. methanol/1-pentanol/acetic acid methyl ester
  2229. methanol/1-pentanol/water
  2230. methanol/1-propanol/1-butanol
  2231. methanol/1-propanol/2-amino-2-(hydroxymethyl)-1,3-propanediol
  2232. methanol/1-propanol/acetic acid methyl ester
  2233. methanol/1-propanol/Azlocillin sodium
  2234. methanol/1-propanol/chloroacetic acid
  2235. methanol/1-propanol/Dipyridamole p-toluene sulfonate
  2236. methanol/1-propanol/Hexamethylenediamine glutarate
  2237. methanol/1-propanol/L-Carnitine fumarate
  2238. methanol/1-propanol/Methyleneaminoacetonitrile
  2239. methanol/1-propanol/mixture/pseudocomponent #1
  2240. methanol/1-propanol/phenanthrene
  2241. methanol/1-propanol/sodium iodide (NaI)
  2242. methanol/1-propanol/tylosin tatrate
  2243. methanol/1-propanol/water
  2244. methanol/1-propyne/water
  2245. methanol/2,2'-oxybisbutane/water
  2246. methanol/2,2,2-trifluoroethanol/water
  2247. methanol/2,2-dichloro-N-((1S,2R)-1-(fluoromethyl)-2-hydroxy-2-(4-(methylsulfonyl)phenyl)ethyl)acetamide/water
  2248. methanol/2,3,5-trimethylphenol/water
  2249. methanol/2-amino-2-(hydroxymethyl)-1,3-propanediol/water
  2250. methanol/2-butanol/acetic acid methyl ester
  2251. methanol/2-butanone/1-ethyl-3-methyl-1H-imidazolium salt with phosphoric acid diethyl ester (1:1)
  2252. methanol/2-butanone/poly(1-phenylethylene)
  2253. methanol/2-hydroxy-1,2,3-propanetricarboxylic acid trisodium salt/water
  2254. methanol/2-hydroxybenzoic acid/water
  2255. methanol/2-hydroxypropane-1,2,3-tricarboxylic acid/water
  2256. methanol/2-methyl-1-propanol/2-chlorobenzenamine
  2257. methanol/2-methyl-2-butanol/acetic acid methyl ester
  2258. methanol/2-methyl-2-propanol/2-methyl-1-propanol
  2259. methanol/2-methyl-2-propanol/water
  2260. methanol/2-methyl-2-propenoic acid/2-methyl-2-propenoic acid methyl ester
  2261. methanol/2-methylbutane/2-methoxy-2-methylbutane
  2262. methanol/2-methylbutane/2-methyl-1,3-butadiene
  2263. methanol/2-methylpropane/water
  2264. methanol/2-propanol/(αR)-4-hydroxy-α-((3-methoxy-1-methyl-3-oxo-1-propenyl)amino)benzeneacetic acid monopotassium salt
  2265. methanol/2-propanol/1-propanol
  2266. methanol/2-propanol/2-chlorobenzenamine
  2267. methanol/2-propanol/2-hydroxypropane-1,2,3-tricarboxylic acid
  2268. methanol/2-propanol/2-methyl-2-butanol
  2269. methanol/2-propanol/2-propanone
  2270. methanol/2-propanol/3-pyridinecarboxamide
  2271. methanol/2-propanol/4,4'-(1-methylethylidene)bis(2,6-dibromophenol)
  2272. methanol/2-propanol/acetic acid methyl ester
  2273. methanol/2-propanol/argon
  2274. methanol/2-propanol/Azlocillin
  2275. methanol/2-propanol/Bifenthrin
  2276. methanol/2-propanol/Dipyrone monohydrate
  2277. methanol/2-propanol/Imatinib mesylate
  2278. methanol/2-propanol/L-Carnitine fumarate
  2279. methanol/2-propanol/Levamisole hydrochloride
  2280. methanol/2-propanol/magnesium chloride (MgCl2)
  2281. methanol/2-propanol/Methyleneaminoacetonitrile
  2282. methanol/2-propanol/Naphazoline hydrochloride
  2283. methanol/2-propanol/perchloric acid sodium salt
  2284. methanol/2-propanol/phenanthrene
  2285. methanol/2-propanol/potassium fluoride (KF)
  2286. methanol/2-propanol/sodium iodide (NaI)
  2287. methanol/2-propanol/tylosin tatrate
  2288. methanol/2-propanol/water
  2289. methanol/2-propanone/1,3-Bis(2,4,6-trimethylphenyl)imidazolinium chloride
  2290. methanol/2-propanone/1-butanol
  2291. methanol/2-propanone/1-butyl-3-methyl-1H-imidazolium bromide
  2292. methanol/2-propanone/1-ethyl-3-methyl-1H-imidazolium salt with phosphoric acid diethyl ester (1:1)
  2293. methanol/2-propanone/1-methyl-1H-imidazole acetate
  2294. methanol/2-propanone/1-methyl-3-octyl-1H-imidazolium thiocyanate
  2295. methanol/2-propanone/1-methyl-3-propyl-1H-imidazolium bromide
  2296. methanol/2-propanone/1-Methylimidazolium propionate
  2297. methanol/2-propanone/1-pentanol
  2298. methanol/2-propanone/1-propanol
  2299. methanol/2-propanone/1H-isoindole-1,3(2H)-dione
  2300. methanol/2-propanone/2,2-dichloro-N-((1S,2R)-1-(fluoromethyl)-2-hydroxy-2-(4-(methylsulfonyl)phenyl)ethyl)acetamide
  2301. methanol/2-propanone/2,2-dimethoxypropane
  2302. methanol/2-propanone/2,3-dimethylbutane
  2303. methanol/2-propanone/2-butanol
  2304. methanol/2-propanone/2-butanone
  2305. methanol/2-propanone/2-methyl-1-propanol
  2306. methanol/2-propanone/2-methyl-2-butanol
  2307. methanol/2-propanone/2-methyl-2-propenoic acid methyl ester
  2308. methanol/2-propanone/2-methyl-2-propenoic acid methyl ester star homopolymer
  2309. methanol/2-propanone/3-buten-2-one
  2310. methanol/2-propanone/3-pentanone
  2311. methanol/2-propanone/4,4'-sulfonyldiphenol
  2312. methanol/2-propanone/6-(2,3-dichlorophenyl)-1,2,4-triazine-3,5-diamine
  2313. methanol/2-propanone/9H-carbazole
  2314. methanol/2-propanone/acetic acid ethenyl ester homopolymer
  2315. methanol/2-propanone/acetic acid methyl ester
  2316. methanol/2-propanone/acetonitrile
  2317. methanol/2-propanone/Aniracetam
  2318. methanol/2-propanone/Azlocillin sodium
  2319. methanol/2-propanone/benzene
  2320. methanol/2-propanone/Benzyl 3-phenyl-L-alaninate hydrochloride
  2321. methanol/2-propanone/cadmium iodide (CdI2)
  2322. methanol/2-propanone/calcium bromide (CaBr2)
  2323. methanol/2-propanone/carbon disulfide
  2324. methanol/2-propanone/cobalt chloride (CoCl2)
  2325. methanol/2-propanone/dichloromethane
  2326. methanol/2-propanone/ethane
  2327. methanol/2-propanone/ethene
  2328. methanol/2-propanone/iodoethane
  2329. methanol/2-propanone/lithium bromide (LiBr)
  2330. methanol/2-propanone/lithium chloride (LiCl)
  2331. methanol/2-propanone/methylmidazolium DL-lactate
  2332. methanol/2-propanone/nitric acid lithium salt
  2333. methanol/2-propanone/nitric acid potassium salt
  2334. methanol/2-propanone/nitric acid silver(1+) salt
  2335. methanol/2-propanone/nitrous acid sodium salt
  2336. methanol/2-propanone/perchloric acid lithium salt
  2337. methanol/2-propanone/phosphoric acid, P,P'-1,4-phenylene P,P,P',P'-tetraphenyl ester
  2338. methanol/2-propanone/Pidotimod
  2339. methanol/2-propanone/potassium bromide (KBr)
  2340. methanol/2-propanone/potassium iodide (KI)
  2341. methanol/2-propanone/sodium bromide (NaBr)
  2342. methanol/2-propanone/sodium chloride (NaCl)
  2343. methanol/2-propanone/sodium iodide (NaI)
  2344. methanol/2-propanone/sulfur dioxide
  2345. methanol/2-propanone/trichloromethane
  2346. methanol/2-propanone/tylosin tatrate
  2347. methanol/2-propanone/water
  2348. methanol/2-propanone/zinc chloride (ZnCl2)
  2349. methanol/2-propenoic acid/2-propenoic acid methyl ester
  2350. methanol/3-ethyl-5-methylphenol/water
  2351. methanol/3-methyl-3-buten-1-ol/water
  2352. methanol/4,4-dimethyl-1,3-dioxane/water
  2353. methanol/4-amino-N,2-thiazolylbenzenesulfonamide/acetonitrile
  2354. methanol/4-amino-N-2-pyrimidinylbenzenesulfonamide/acetonitrile
  2355. methanol/4-amino-N-2-pyrimidinylbenzenesulfonamide/water
  2356. methanol/4-hydroxy-2-methyl-N-(5-methyl-2-thiazolyl)-2H-1,2-benzothiazin-3-carboxamide 1,1-dioxide/water
  2357. methanol/4-O-α-D-glucopyranosyl-D-glucose/water
  2358. methanol/acetaldehyde/acetic acid methyl ester
  2359. methanol/acetaldehyde/water
  2360. methanol/acetic acid methyl ester/1,2-dimethylbenzene
  2361. methanol/acetic acid methyl ester/1,3-Dimethyl-2-phenylimidazolinium bromide
  2362. methanol/acetic acid methyl ester/1-butyl-3-methyl-1H-imidazolium bromide
  2363. methanol/acetic acid methyl ester/1-butyl-3-methyl-1H-imidazolium chloride
  2364. methanol/acetic acid methyl ester/1-ethyl-3-methyl-1H-imidazolium salt with phosphoric acid diethyl ester (1:1)
  2365. methanol/acetic acid methyl ester/1-hexyl-3-methyl-1H-imidazolium bromide
  2366. methanol/acetic acid methyl ester/2,3-dimethyl-1-octyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  2367. methanol/acetic acid methyl ester/2-hydroxypropanoic acid ethyl ester
  2368. methanol/acetic acid methyl ester/2-propenoic acid methyl ester
  2369. methanol/acetonitrile/(4,7,13,16,21,24-hexaoxa-1,10-diazabicyclo[8.8.8]hexacosane-κN1,κN10,κO4,κO7,κO13,κO16,κO21,κO24)silver(1+) perchlorate
  2370. methanol/acetonitrile/1,2-benzisothiazol-3(2H)-one 1,1-dioxide
  2371. methanol/acetonitrile/1-butyl-3-methyl-1H-imidazolium bromide
  2372. methanol/acetonitrile/1-butyl-3-methyl-1H-imidazolium chloride
  2373. methanol/acetonitrile/1H-isoindole-1,3(2H)-dione
  2374. methanol/acetonitrile/2,4,6-trinitrophenol
  2375. methanol/acetonitrile/2,4-dihydro-3-methyl-1-phenyl-3H-pyrazol-3-one
  2376. methanol/acetonitrile/2-butanone
  2377. methanol/acetonitrile/2-chlorophenol
  2378. methanol/acetonitrile/2-ethoxybenzamide
  2379. methanol/acetonitrile/2-hydroxy-5-[1-hydroxy-2-[(1-methyl-3-phenyl-propyl)amino]ethyl]benzamide hydrochloride
  2380. methanol/acetonitrile/3,4,5-Trimethoxycinnamic acid
  2381. methanol/acetonitrile/4,4'-sulfonyldiphenol
  2382. methanol/acetonitrile/6-Hydroxy-3,4-dihydro-2(1H)-quinolinone
  2383. methanol/acetonitrile/Azlocillin sodium
  2384. methanol/acetonitrile/Bezafibrate
  2385. methanol/acetonitrile/bromic acid silver(1+) salt
  2386. methanol/acetonitrile/cesium chloride (CsCl)
  2387. methanol/acetonitrile/cesium iodide (CsI)
  2388. methanol/acetonitrile/D,L-Homocysteine thiolactone hydrochloride
  2389. methanol/acetonitrile/Deferasirox
  2390. methanol/acetonitrile/formamide
  2391. methanol/acetonitrile/iodic acid (HIO3) silver(1+) salt
  2392. methanol/acetonitrile/Lenalidomide
  2393. methanol/acetonitrile/loratadine
  2394. methanol/acetonitrile/N,N,N-tripentyl-1-pentanaminium bromide
  2395. methanol/acetonitrile/nitric acid silver(1+) salt
  2396. methanol/acetonitrile/perchloric acid lithium salt
  2397. methanol/acetonitrile/perchloric acid potassium salt
  2398. methanol/acetonitrile/perchloric acid sodium salt
  2399. methanol/acetonitrile/potassium iodide (KI)
  2400. methanol/acetonitrile/sodium bromide (NaBr)
  2401. methanol/acetonitrile/sodium chloride (NaCl)
  2402. methanol/acetonitrile/sodium iodide (NaI)
  2403. methanol/acetonitrile/Thiamethoxam
  2404. methanol/acetonitrile/water
  2405. methanol/aluminum chloride (AlCl3)/water
  2406. methanol/ammonia/magnesium chloride (MgCl2)
  2407. methanol/ammonia/water
  2408. methanol/argon/acetonitrile
  2409. methanol/argon/sodium iodide (NaI)
  2410. methanol/argon/water
  2411. methanol/benzene/(9Z,12Z)-9,12-octadecadienoic acid lanthanum(3+) salt
  2412. methanol/benzene/(S)-hydroxybutanedioic acid
  2413. methanol/benzene/1-Decyl-3-methylimidazolium acetate
  2414. methanol/benzene/1-hexyl-3-methyl-1H-imidazolium acetate
  2415. methanol/benzene/1-methyl-2-nitrobenzene
  2416. methanol/benzene/1-octyl-3-methyl-1H-imidazolium acetate
  2417. methanol/benzene/2-butanol
  2418. methanol/benzene/2-butanone
  2419. methanol/benzene/6,13-dibromo-3,10-dimethyl triphenodioxazine
  2420. methanol/benzene/6,13-dichloro-3,10-dimethyl triphenodioxazine
  2421. methanol/benzene/acetic acid ethenyl ester homopolymer
  2422. methanol/benzene/acetic acid methyl ester
  2423. methanol/benzene/acetonitrile
  2424. methanol/benzene/cadmium iodide (CdI2)
  2425. methanol/benzene/carbon disulfide
  2426. methanol/benzene/cesium chloride (CsCl)
  2427. methanol/benzene/decanoic acid iron(3+) salt
  2428. methanol/benzene/Europium(III) dodecanoate
  2429. methanol/benzene/Europium(III) octanoate
  2430. methanol/benzene/methane
  2431. methanol/benzene/methanol lithium salt
  2432. methanol/benzene/methanol potassium salt
  2433. methanol/benzene/N,N,N-triethylethanaminium bromide
  2434. methanol/benzene/N-benzylquinolinium chloride
  2435. methanol/benzene/nitric acid potassium salt
  2436. methanol/benzene/nitric acid silver(1+) salt
  2437. methanol/benzene/nitrobenzene
  2438. methanol/benzene/poly(1-phenylethylene)
  2439. methanol/benzene/potassium bromide (KBr)
  2440. methanol/benzene/potassium chloride (KCl)
  2441. methanol/benzene/sodium chloride (NaCl)
  2442. methanol/benzene/sodium iodide (NaI)
  2443. methanol/benzene/tetradecanoic acid iron(3+) salt
  2444. methanol/benzene/trichloroacetic acid
  2445. methanol/benzene/water
  2446. methanol/benzene/zinc chloride (ZnCl2)
  2447. methanol/biodiesel/diesel like fuel
  2448. methanol/bis(1-methyl-1-phenylethyl) peroxide/(1-methylethyl)benzene
  2449. methanol/black oil/formation brine
  2450. methanol/brine/black oil
  2451. methanol/brine/gas Condensate
  2452. methanol/bromic acid silver(1+) salt/1-methyl-2-pyrrolidinone
  2453. methanol/bromoethane/2-methylbutane
  2454. methanol/bromoethane/carbon disulfide
  2455. methanol/carbon disulfide/acetic acid methyl ester
  2456. methanol/carbon disulfide/thiobismethane
  2457. methanol/cesium chloride (CsCl)/water
  2458. methanol/cobalt chloride (CoCl2)/water
  2459. methanol/cobalt chloride (CoCl3) compd. with 1,3,6,8,10,13,16,19-octaazabicyclo[6.6.6]eicosane (1:1)/water
  2460. methanol/copper chloride (CuCl2)/water
  2461. methanol/crude Oil/brine
  2462. methanol/D-mannitol/water
  2463. methanol/dichloromethane/water
  2464. methanol/dipotassium sulfonatooxy sulfate/water
  2465. methanol/disodium [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1(2H)-yl)-3,4-dihydroxytetrahydrofuran-2-yl]methyl phosphate/water
  2466. methanol/ethane/nitrogen
  2467. methanol/ethane/water
  2468. methanol/ethene/nitrogen
  2469. methanol/ethene/water
  2470. methanol/ethyne/water
  2471. methanol/formamide/ammonia
  2472. methanol/formamide/sodium iodide (NaI)
  2473. methanol/formamide/water
  2474. methanol/helium/sodium iodide (NaI)
  2475. methanol/helium/water
  2476. methanol/hexamethylphosphoric triamide/water
  2477. methanol/hydrochloric acid/sodium chloride (NaCl)
  2478. methanol/hydrochloric acid/water
  2479. methanol/hydrofluoric acid/beryllium fluoride (BeF2)
  2480. methanol/hydrogen peroxide (H2O2)/water
  2481. methanol/iodic acid (HIO3) silver(1+) salt/1-methyl-2-pyrrolidinone
  2482. methanol/iodine/potassium iodide (KI)
  2483. methanol/iodoethane/water
  2484. methanol/iodomethane/carbon disulfide
  2485. methanol/iodomethane/water
  2486. methanol/krypton/potassium bromide (KBr)
  2487. methanol/krypton/water
  2488. methanol/L-arginine/water
  2489. methanol/L-asparagine/water
  2490. methanol/L-histidine/water
  2491. methanol/L-threonine/water
  2492. methanol/L-tryptophan/water
  2493. methanol/L-valine/water
  2494. methanol/lithium bromide (LiBr)/sodium bromide (NaBr)
  2495. methanol/lithium bromide (LiBr)/water
  2496. methanol/lithium bromide (LiBr)/zinc bromide (ZnBr2)
  2497. methanol/lithium bromide (LiBr)/zinc chloride (ZnCl2)
  2498. methanol/lithium chloride (LiCl)/acetic acid methyl ester
  2499. methanol/lithium chloride (LiCl)/dichloromethane
  2500. methanol/lithium chloride (LiCl)/lithium bromide (LiBr)
  2501. methanol/lithium chloride (LiCl)/nickel chloride (NiCl2)
  2502. methanol/lithium chloride (LiCl)/sodium chloride (NaCl)
  2503. methanol/lithium chloride (LiCl)/tetramethylsilane
  2504. methanol/lithium chloride (LiCl)/water
  2505. methanol/lithium chloride (LiCl)/zinc bromide (ZnBr2)
  2506. methanol/magnesium chloride (MgCl2)/acetic acid methyl ester
  2507. methanol/mercaptobutanedioic acid/water
  2508. methanol/mercury chloride (HgCl2)/acetic acid methyl ester
  2509. methanol/mercury chloride (HgCl2)/water
  2510. methanol/methanamine/ammonia
  2511. methanol/methanamine/water
  2512. methanol/methane/ethane
  2513. methanol/methane/sea water
  2514. methanol/methane/sodium bromide (NaBr)
  2515. methanol/methane/water
  2516. methanol/methanol lithium salt/methanol tantalum(5+) salt
  2517. methanol/N,N,N-triethylethanaminium bromide/acetonitrile
  2518. methanol/N,N,N-triethylethanaminium bromide/formamide
  2519. methanol/N,N,N-triethylethanaminium bromide/water
  2520. methanol/N,N,N-triethylethanaminium iodide/benzene
  2521. methanol/N,N,N-triethylethanaminium iodide/water
  2522. methanol/N,N,N-triethylethanaminium salt with 2,4,6-trinitrophenol (1:1)/water
  2523. methanol/N,N,N-trimethylmethanaminium chloride/water
  2524. methanol/N,N,N-trimethylmethanaminium iodide/water
  2525. methanol/N,N,N-trimethylmethanaminium salt with 2,4,6-trinitrophenol (1:1)/water
  2526. methanol/N,N-dimethylformamide/(T-4)-dichlorodioxouranium
  2527. methanol/N,N-dimethylformamide/2-methyl-2-propanamine
  2528. methanol/N,N-dimethylformamide/5-nitroisoindole-1,3-dione
  2529. methanol/N,N-dimethylformamide/5-Norbornene-2,3-dicarboximide
  2530. methanol/N,N-dimethylformamide/acetonitrile
  2531. methanol/N,N-dimethylformamide/argon
  2532. methanol/N,N-dimethylformamide/benzene
  2533. methanol/N,N-dimethylformamide/bromic acid silver(1+) salt
  2534. methanol/N,N-dimethylformamide/Carbazochrome
  2535. methanol/N,N-dimethylformamide/ethyne
  2536. methanol/N,N-dimethylformamide/Hexamethylenediamine glutarate
  2537. methanol/N,N-dimethylformamide/lithium bromide (LiBr)
  2538. methanol/N,N-dimethylformamide/Macitentan
  2539. methanol/N,N-dimethylformamide/N,N,N-triethylethanaminium bromide
  2540. methanol/N,N-dimethylformamide/nitric acid potassium salt
  2541. methanol/N,N-dimethylformamide/nitric acid silver(1+) salt
  2542. methanol/N,N-dimethylformamide/perchloric acid silver(1+) salt
  2543. methanol/N,N-dimethylformamide/perchloric acid sodium salt
  2544. methanol/N,N-dimethylformamide/potassium bromide (KBr)
  2545. methanol/N,N-dimethylformamide/propane
  2546. methanol/N,N-dimethylformamide/propanoic acid
  2547. methanol/N,N-dimethylformamide/sodium bromide (NaBr)
  2548. methanol/N,N-dimethylformamide/sodium iodide (NaI)
  2549. methanol/N,N-dimethylformamide/trichlorobismuthine
  2550. methanol/N,N-dimethylformamide/water
  2551. methanol/N,N-dimethylformamide/Zirconium(IV)(bis(2-hydroxynaphthyl)-p-phenylenedialdimine) trichloride tetrahydrate
  2552. methanol/N,N-dimethylmethanamine/ammonia
  2553. methanol/N,N-dimethylmethanamine/water
  2554. methanol/N-[2-[[[2-[(dimethylamino)methyl]-4-thiazolyl]methyl]thio]ethyl]-N'-methyl-2-nitro-1,1-ethenediamine/water
  2555. methanol/natural gas/brine
  2556. methanol/neon/water
  2557. methanol/nickel chloride (NiCl2)/water
  2558. methanol/nitric acid lithium salt/acetic acid methyl ester
  2559. methanol/nitric acid silver(1+) salt/nitroethane
  2560. methanol/nitric acid sodium salt/water
  2561. methanol/nitric acid zinc salt/acetic acid methyl ester
  2562. methanol/nitrogen/hydrogen sulfide (H2S)
  2563. methanol/nitrogen/oxygen
  2564. methanol/nitrogen/water
  2565. methanol/nitromethane/nitric acid silver(1+) salt
  2566. methanol/nitromethane/sodium bromide (NaBr)
  2567. methanol/nitromethane/sodium iodide (NaI)
  2568. methanol/nitromethane/water
  2569. methanol/nitrous acid sodium salt/water
  2570. methanol/perchloric acid lithium salt/calix(4)arenebis(crown-6)
  2571. methanol/perchloric acid potassium salt/1,3-dioxolan-2-one
  2572. methanol/perchloric acid potassium salt/calix(4)arenebis(crown-6)
  2573. methanol/perchloric acid sodium salt/calix(4)arenebis(crown-6)
  2574. methanol/perchloric acid sodium salt/water
  2575. methanol/perchloric acid/water
  2576. methanol/phosphoric acid disodium salt/water
  2577. methanol/phosphoric acid monoammonium salt/water
  2578. methanol/phosphoric acid monosodium salt/water
  2579. methanol/phosphoric acid/water
  2580. methanol/potassium bromide (KBr)/naphthalene
  2581. methanol/potassium chloride (KCl)/hydrochloric acid
  2582. methanol/potassium chloride (KCl)/lithium chloride (LiCl)
  2583. methanol/potassium chloride (KCl)/naphthalene
  2584. methanol/potassium chloride (KCl)/sodium chloride (NaCl)
  2585. methanol/potassium chloride (KCl)/water
  2586. methanol/potassium iodide (KI)/sodium iodide (NaI)
  2587. methanol/potassium iodide (KI)/water
  2588. methanol/propane/1-methyl-2-pyrrolidinone
  2589. methanol/propane/water
  2590. methanol/quinoline/2-methylphenol
  2591. methanol/sodium bromide (NaBr)/sodium iodide (NaI)
  2592. methanol/sodium bromide (NaBr)/water
  2593. methanol/sodium chloride (NaCl)/naphthalene
  2594. methanol/sodium chloride (NaCl)/sodium bromide (NaBr)
  2595. methanol/sodium chloride (NaCl)/water
  2596. methanol/sodium fluoride (NaF)/water
  2597. methanol/sodium iodide (NaI)/water
  2598. methanol/sulfinylbismethane/(T-4)-dichlorodioxouranium
  2599. methanol/sulfinylbismethane/acetic acid methyl ester
  2600. methanol/sulfinylbismethane/benzene
  2601. methanol/sulfinylbismethane/bromic acid silver(1+) salt
  2602. methanol/sulfinylbismethane/lithium chloride (LiCl)
  2603. methanol/sulfinylbismethane/mercury iodide (HgI2)
  2604. methanol/sulfinylbismethane/perchloric acid lithium salt
  2605. methanol/sulfinylbismethane/perchloric acid potassium salt
  2606. methanol/sulfinylbismethane/perchloric acid silver(1+) salt
  2607. methanol/sulfinylbismethane/perchloric acid sodium salt
  2608. methanol/sulfinylbismethane/sodium bromide (NaBr)
  2609. methanol/sulfinylbismethane/Thiamethoxam
  2610. methanol/sulfinylbismethane/tris(3-nitrobenzoato)(1,10-phenanthroline)dysprosium dimer tetrahydrate
  2611. methanol/sulfinylbismethane/water
  2612. methanol/sulfur dioxide/acetic acid methyl ester
  2613. methanol/sulfur dioxide/water
  2614. methanol/sulfuric acid dipotassium salt/sulfuric acid diammonium salt
  2615. methanol/sulfuric acid dirubidium salt/water
  2616. methanol/sulfuric acid magnesium salt (1:1)/water
  2617. methanol/sulfuric acid/oxygen
  2618. methanol/sulfuric acid/sulfuric acid disodium salt
  2619. methanol/sulfuric acid/water
  2620. methanol/tetrachlorostannane/N,N'-dimethylurea
  2621. methanol/tetramethylsilane/water
  2622. methanol/tetraphenylarsonium iodide/water
  2623. methanol/trichloroacetic acid/water
  2624. methanol/trichloromethane/2,3-dimethylbutane
  2625. methanol/trichloromethane/acetic acid methyl ester
  2626. methanol/trichloromethane/benzene
  2627. methanol/trichloromethane/camptothecin
  2628. methanol/trichloromethane/iodine
  2629. methanol/trichloromethane/lithium chloride (LiCl)
  2630. methanol/trichloromethane/mercury chloride (HgCl2)
  2631. methanol/trichloromethane/S-bis (5,5-dimethyl-1,3-dioxaphosphorinanyl-2-oxy phosphate ester)
  2632. methanol/trichloromethane/sodium iodide (NaI)
  2633. methanol/trichloromethane/sulfinylbismethane
  2634. methanol/trichloromethane/water
  2635. methanol/trifluoromethane/water
  2636. methanol/vegetable fats and glyceridic oils/vegetable-oil fatty acids Me esters
  2637. methanol/water/(1,1'-biphenyl)-4,4'-diol
  2638. methanol/water/(1,1'-biphenyl)-4-ol
  2639. methanol/water/(1,1-dimethylethyl)benzene
  2640. methanol/water/(1-methylethyl)benzene
  2641. methanol/water/(1R)-4-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-18-[(1R,4R)-4-hydroxy-2,6,6-trimethylcyclohex-2-en-1-yl]-3,7,12,16-tetramethyloctadeca-1,3,5,7,9,11,13,15,17-nonaenyl]-3,5,5-trimethylcyclohex-3-en-1-ol
  2642. methanol/water/(1R,2R)-(+)-1,2-Diaminocyclohexane L-tartrate
  2643. methanol/water/(2-Naphthylthio)acetic acid
  2644. methanol/water/(2E)-2-butenedioic acid monomethyl ester sodium salt
  2645. methanol/water/(2R,3S,4R,5R)-2,3,4,5-tetrahydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyhexanal
  2646. methanol/water/(2S)-2-Amino-4-(hydroxymethylphosphinyl)butanoic acid
  2647. methanol/water/(2S)-2-Amino-4-(hydroxymethylphosphinyl)butanoic acid hydrochloride
  2648. methanol/water/(2S)-2-Amino-5-(ethylamino)-5-oxopentanoic acid
  2649. methanol/water/(6R,7R)-7-[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino-3-(6,7-dihydro-5H-cyclopenta[b]pyridinium-1-ylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate sulfate (1:1)
  2650. methanol/water/(OC-6-11')-bis(N,N'-(2,6-pyridinediyldiethylidyne)bis(4-methylbenzenamine)-N,N',N'')iron(2+) diperchlorate
  2651. methanol/water/1,1'-biphenyl
  2652. methanol/water/1,1,2,3,4,4-hexachloro-1,3-butadiene
  2653. methanol/water/1,2,3-benzenetriol
  2654. methanol/water/1,2-benzenediamine
  2655. methanol/water/1,2-benzenedicarboxylic acid
  2656. methanol/water/1,2-benzenedicarboxylic acid dibutyl ester
  2657. methanol/water/1,2-benzisothiazol-3(2H)-one 1,1-dioxide
  2658. methanol/water/1,2-dichloro-4-nitrobenzene
  2659. methanol/water/1,2-dichlorobenzene
  2660. methanol/water/1,2-dihydro-5-nitro-3H-1,2,4-triazol-3-one
  2661. methanol/water/1,2-dimethylbenzene
  2662. methanol/water/1,3-diethyl-1H-imidazolium diethylphosphate
  2663. methanol/water/1,4-benzenedicarboxylic acid bis(2-hydroxyethyl) ester
  2664. methanol/water/1-(2-Bromo-phenyl)-pyrrole-2,5-dione
  2665. methanol/water/1-(4-(1,1-dimethylethyl)-2,6-dimethyl-3,5-dinitrophenyl)ethanone
  2666. methanol/water/1-ethyl-3-methyl-1H-imidazolium salt with phosphoric acid diethyl ester (1:1)
  2667. methanol/water/1-ethyl-3-methyl-1H-imidazolium salt with phosphoric acid dimethyl ester (1:1)
  2668. methanol/water/1-ethyl-3-methyl-1H-imidazolium salt with sulfuric acid 2-(2-methoxyethoxy)ethyl ester (1:1)
  2669. methanol/water/1-Methyl-4-nitropyrazole
  2670. methanol/water/1-methylnaphthalene
  2671. methanol/water/1-naphthaleneacetic acid
  2672. methanol/water/1-naphthalenecarboxylic acid
  2673. methanol/water/1-naphthalenol
  2674. methanol/water/11α,17α-Dihydroxy-4-pregnene-3,20-dione
  2675. methanol/water/2,2'-azobis(2-methylpropanenitrile)
  2676. methanol/water/2,3-dihydro-2-(3-(methylphenylamino)-2-propenylidene)-1H-inden-1-one
  2677. methanol/water/2,4,6-trinitrophenol
  2678. methanol/water/2,4,6-Trinitroresorcinol 2/3-Hydrate
  2679. methanol/water/2,4-dihydro-3-methyl-1-phenyl-3H-pyrazol-3-one
  2680. methanol/water/2,4-dinitrobenzoic acid sodium salt
  2681. methanol/water/2,5-dimethylphenol
  2682. methanol/water/2,6,6-trimethylbicyclo[3.1.1]hept-2-ene
  2683. methanol/water/2,6-Dimethoxy-4-aminopyrimidine
  2684. methanol/water/2-(1-methylethyl)phenol
  2685. methanol/water/2-(2-aminoethoxy)ethanol
  2686. methanol/water/2-(phenylamino)benzoic acid
  2687. methanol/water/2-Amino-3-chloropyrazine
  2688. methanol/water/2-Amino-5-bromopyrazine
  2689. methanol/water/2-Amino-5-chloropyrazine
  2690. methanol/water/2-Bromo-5-hydroxypyrazine
  2691. methanol/water/2-chloro-4-nitrobenzoic acid
  2692. methanol/water/2-ethoxy-2-methylbutane
  2693. methanol/water/2-ethoxyphenol
  2694. methanol/water/2-ethylphenol
  2695. methanol/water/2-furancarboxaldehyde
  2696. methanol/water/2-Hydroxy-5-nitrobenzaldehyde
  2697. methanol/water/2-hydroxy-5-nitrobenzoic acid
  2698. methanol/water/2-Mercapto-1,3,4-thiadiazol
  2699. methanol/water/2-methoxy-2-methylbutane
  2700. methanol/water/2-methoxyphenol
  2701. methanol/water/2-methyl-1,3-butadiene
  2702. methanol/water/2-methyl-1-propanol
  2703. methanol/water/2-methyl-2-propenal
  2704. methanol/water/2-methyl-2-propenoic acid methyl ester
  2705. methanol/water/2-methyl-5-nitro-1H-imidazole
  2706. methanol/water/2-methylbutane
  2707. methanol/water/2-methylphenol
  2708. methanol/water/2-naphthalenecarboxylic acid
  2709. methanol/water/2-nitrophenol
  2710. methanol/water/2-propenamide homopolymer
  2711. methanol/water/2-propenoic acid
  2712. methanol/water/2-propenoic acid methyl ester
  2713. methanol/water/2-pyridinecarboxylic acid
  2714. methanol/water/2-[1-(Aminomethyl)cyclohexyl]acetic acid hydrate
  2715. methanol/water/2H-1-benzopyran-2-one
  2716. methanol/water/3,3'-Sulphonyldianiline
  2717. methanol/water/3,4-dimethylphenol
  2718. methanol/water/3,5-dinitrobenzoic acid
  2719. methanol/water/3-aminobenzoic acid
  2720. methanol/water/3-methylbenzoic acid
  2721. methanol/water/3-Nitropyrazole
  2722. methanol/water/3-pyridinecarboxamide
  2723. methanol/water/4,4'-sulfonylbisbenzenamine
  2724. methanol/water/4-(1,1-dimethylethyl)benzoic acid
  2725. methanol/water/4-(1-methylethyl)phenol
  2726. methanol/water/4-amino-N-(6-chloro-3-pyridazinyl)benzenesulfonamide
  2727. methanol/water/4-aminobenzoic acid ethyl ester
  2728. methanol/water/4-bromo-1,1'-biphenyl
  2729. methanol/water/4-Bromo-1H-pyrazole
  2730. methanol/water/4-Hydroxy-L-proline
  2731. methanol/water/4-hydroxybenzoic acid methyl ester
  2732. methanol/water/4-hydroxybenzoic acid propyl ester
  2733. methanol/water/4-Methoxy-N,6-dimethyl-1,3,5-triazin-2-amine
  2734. methanol/water/4-methylbenzoic acid
  2735. methanol/water/5-bromo-2-hydroxybenzoic acid
  2736. methanol/water/6-Chloropurine
  2737. methanol/water/6-Phenyl-2H-pyridazin-3-one
  2738. methanol/water/8,13-dihydroindolo[2',3':3,4]pyrido[2,1-b]quinazolin-5(7H)-one
  2739. methanol/water/8-Isoquinolinamine
  2740. methanol/water/Acetamiprid
  2741. methanol/water/acetic acid methyl ester
  2742. methanol/water/Acipimox
  2743. methanol/water/Actarit
  2744. methanol/water/allisartan isoproxil
  2745. methanol/water/Apixaban
  2746. methanol/water/Aprepitant
  2747. methanol/water/Arbidol
  2748. methanol/water/Barium bis(dimethylarsinate)
  2749. methanol/water/benzoic acid methyl ester
  2750. methanol/water/Bezafibrate
  2751. methanol/water/bis(1-methyl-1-phenylethyl) peroxide
  2752. methanol/water/blood serum albumins
  2753. methanol/water/bromic acid potassium salt
  2754. methanol/water/bromic acid silver(1+) salt
  2755. methanol/water/butanedioic acid mono((3R,5aS,6R,8aS,9R,10R,12R,12aR&sup*;)-decahydro-3,6,9-trimethyl-3,12-epoxy-12H-pyrano(4,3-j)-1,2-benzodioxepin-10-yl) ester
  2756. methanol/water/C.I. basic Violet 1
  2757. methanol/water/cadmium bromide (CdBr2)
  2758. methanol/water/cadmium iodide (CdI2)
  2759. methanol/water/Calcium bis(dimethylarsinate)
  2760. methanol/water/calcium bromide (CaBr2)
  2761. methanol/water/Calcium D-pantothenate
  2762. methanol/water/cesium bromide (CsBr)
  2763. methanol/water/cesium iodide (CsI)
  2764. methanol/water/Chlorhexidine
  2765. methanol/water/chloric acid sodium salt
  2766. methanol/water/chloroacetic acid
  2767. methanol/water/chromic acid (H2Cr2O7) dipotassium salt
  2768. methanol/water/chromic acid (H2CrO4) disodium salt
  2769. methanol/water/chromic acid (H2CrO4) strontium salt (1:1)
  2770. methanol/water/Cinosulfuron
  2771. methanol/water/cis-3-(2,5-Dimethylphenyl)-4-hydroxy-8-methoxy-1-azaspiro[4.5]dec-3-en-2-one
  2772. methanol/water/cis-dichlorobis(ethylenediamine)chromium(III) dianilinetetraisothiocyanatochromate(III)
  2773. methanol/water/condensate Fluid
  2774. methanol/water/D-Glucosamine-2-sulfate sodium salt
  2775. methanol/water/dichloroacetic acid
  2776. methanol/water/Dienogest
  2777. methanol/water/diphenoxylate
  2778. methanol/water/Dipyridamole
  2779. methanol/water/Doxofylline
  2780. methanol/water/Etonogestrel
  2781. methanol/water/Fenbendazole
  2782. methanol/water/Flufenoxuron
  2783. methanol/water/Fluoxetine hydrochloride
  2784. methanol/water/formic acid compd. with 2-(2-aminoethoxy)ethanol (1:1)
  2785. methanol/water/gas Condensate
  2786. methanol/water/Gestodene
  2787. methanol/water/glycerol poly(propylene glycol) ether
  2788. methanol/water/Halosulfuron-methyl
  2789. methanol/water/hydrogen sulfide (H2S)
  2790. methanol/water/Inamrinone
  2791. methanol/water/iodic acid (HIO3) calcium salt
  2792. methanol/water/iodic acid (HIO3) magnesium salt
  2793. methanol/water/iodic acid (HIO3) potassium salt
  2794. methanol/water/isoquinoline phosphate (1:1)
  2795. methanol/water/L-(-)-fucose
  2796. methanol/water/L-Arginine dihydrate
  2797. methanol/water/L-Carnosine
  2798. methanol/water/L-Histidine hydrochloride hydrate
  2799. methanol/water/L-Lysine monohydrochloride dihydrate
  2800. methanol/water/L-Pyroglutamic acid
  2801. methanol/water/Lanosterol
  2802. methanol/water/lean Gas (natural gas poor in C4+)
  2803. methanol/water/Linezolid
  2804. methanol/water/lithium fluoride (LiF)
  2805. methanol/water/magnesium bromide (MgBr2)
  2806. methanol/water/magnesium chloride (MgCl2)
  2807. methanol/water/manganese (OC-6-11)-hexakis(cyano-C)ferrate(4-)
  2808. methanol/water/mercury bromide (HgBr2)
  2809. methanol/water/mercury iodide (HgI2)
  2810. methanol/water/methoxyethene homopolymer
  2811. methanol/water/Methyl (2Z)-2-methoxyimino-2-[2-[[(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]acetate
  2812. methanol/water/Methyl 3-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoylsulfamoyl]thiophene-2-carboxylate
  2813. methanol/water/Methyldopa
  2814. methanol/water/Methyleneaminoacetonitrile
  2815. methanol/water/mifepristone
  2816. methanol/water/Monosodium fumarate
  2817. methanol/water/Moxidectin
  2818. methanol/water/myo-inositol
  2819. methanol/water/N,N,N-triethyl-1-decanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  2820. methanol/water/N,N,N-triethyl-1-dodecanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  2821. methanol/water/N,N,N-trimethyl-1-octadecanaminium ethanedioate (2:1)
  2822. methanol/water/N,N,N-trimethyl-1-octadecanaminium iodate
  2823. methanol/water/N,N,N-tripentyl-1-pentanaminium bromide
  2824. methanol/water/N,N-diethyl-2,5-dimethylbenzamide
  2825. methanol/water/N,N-diethyl-N-methyl-1-ethanaminium dimethylphosphate
  2826. methanol/water/N-acetyl-L-glutamine
  2827. methanol/water/N-Methyl-3,4,5-trinitropyrazole
  2828. methanol/water/N-methylacetamide
  2829. methanol/water/N-tert-Butyl-2-benzothiazolesulfenamide
  2830. methanol/water/N-[((3,5-dichloro-2,4-difluorophenyl)amino)carbonyl]-2,6-difluorobenzamide
  2831. methanol/water/naphthalene
  2832. methanol/water/natural gas
  2833. methanol/water/nitric acid cesium salt
  2834. methanol/water/nitric acid lithium salt
  2835. methanol/water/nitric acid potassium salt
  2836. methanol/water/nitric acid silver(1+) salt
  2837. methanol/water/oxygen
  2838. methanol/water/perchloric acid lithium salt
  2839. methanol/water/perchloric acid potassium salt
  2840. methanol/water/periodic acid (HIO4) potassium salt
  2841. methanol/water/phenanthrene
  2842. methanol/water/phosphoric acid dipotassium salt
  2843. methanol/water/phosphoric acid monopotassium salt
  2844. methanol/water/phosphoric acid tripotassium salt
  2845. methanol/water/physic nut oil methyl ester
  2846. methanol/water/potassium bromide (KBr)
  2847. methanol/water/potassium fluoride (KF)
  2848. methanol/water/Potassium thioantimonate
  2849. methanol/water/propanamide
  2850. methanol/water/propanoic acid
  2851. methanol/water/Pyridoxal-5-phosphate monohydrate
  2852. methanol/water/Quetiapine fumarate
  2853. methanol/water/quinoline
  2854. methanol/water/Quizalofop-p-ethyl
  2855. methanol/water/Rebaudioside A
  2856. methanol/water/reservoir Fluid
  2857. methanol/water/Ribavirin
  2858. methanol/water/rich Gas (natural gas containing significant amount of components other than CH4)
  2859. methanol/water/Rimsulfuron
  2860. methanol/water/Rubidate
  2861. methanol/water/rubidium bromide (RbBr)
  2862. methanol/water/rubidium chloride (RbCl)
  2863. methanol/water/silver chloride (AgCl)
  2864. methanol/water/silver iodide (AgI)
  2865. methanol/water/Sodium nitroprusside
  2866. methanol/water/Sodium thioglycolate
  2867. methanol/water/sour Natural Gas
  2868. methanol/water/Spirotetramat
  2869. methanol/water/Strontium bis(dimethylarsinate)
  2870. methanol/water/sulfuric acid calcium salt (1:1)
  2871. methanol/water/sulfuric acid copper(2+) salt (1:1)
  2872. methanol/water/sulfuric acid diammonium salt
  2873. methanol/water/sulfuric acid dipotassium salt
  2874. methanol/water/sulfuric acid disodium salt
  2875. methanol/water/sulfuric acid manganese(2+) salt (1:1)
  2876. methanol/water/sulfuric acid monoammonium salt
  2877. methanol/water/sulfuric acid nickel(2+) salt (1:1)
  2878. methanol/water/sulfuric acid strontium salt (1:1)
  2879. methanol/water/sulfuric acid zinc salt (1:1)
  2880. methanol/water/tetrafluorosilane
  2881. methanol/water/tetramethylgermane
  2882. methanol/water/tetrapropylgermane
  2883. methanol/water/thallium chloride (TlCl)
  2884. methanol/water/thiosulfuric acid (H2S2O3) disodium salt
  2885. methanol/water/Tirofiban
  2886. methanol/water/trichloroethene
  2887. methanol/water/tris(2-ethyl-3-hydroxy-1-methyl-4(1H)-pyridinonato-O,O')aluminum
  2888. methanol/xenon/water
  2889. methanol/zinc chloride (ZnCl2)/acetic acid methyl ester
  2890. methanol/zinc chloride (ZnCl2)/phosphoric acid
  2891. methanol/zinc chloride (ZnCl2)/water
  2892. methoxyacetic acid methyl ester/methanol/water
  2893. methoxybenzene/α-hydro-ω-hydroxypoly(oxy(methyl-1,2-ethanediyl))/α-hydro-ω-methoxypoly(oxy-1,2-ethanediyl)
  2894. methoxybenzene/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)/α-hydro-ω-hydroxypoly(oxy(methyl-1,2-ethanediyl))
  2895. methoxybenzene/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)
  2896. methoxybenzene/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)
  2897. methoxybenzene/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)
  2898. methoxybenzene/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)/α-hydro-ω-methoxypoly(oxy-1,2-ethanediyl)
  2899. methoxybenzene/1,2-ethanediol/1,2-butanediol
  2900. methoxybenzene/1,2-ethanediol/acetic acid ethyl ester
  2901. methoxybenzene/1,3-butadiene/(2Z)-2-butene
  2902. methoxybenzene/1,3-propanediol ester with 2,3,5,6-tetrachloro-1,4-benzenedicarboxylic acid monopropyl ester (1:2)/2,3,5,6-tetrachloro-1,4-benzenedicarboxylic acid ester with 3-((4-(propoxycarbonyl)-2,3,5,6-tetrachlorobenzoyl)oxy)-1-propanol (1:2)
  2903. methoxybenzene/1-butanol/benzene
  2904. methoxybenzene/1-decanol/benzene
  2905. methoxybenzene/1-hexanol/benzene
  2906. methoxybenzene/1-pentanol/benzene
  2907. methoxybenzene/2,2,3,3-tetrafluoro-1-propanol/water
  2908. methoxybenzene/2-butoxyethanol/benzene
  2909. methoxybenzene/2-hexanone/1-pentanol
  2910. methoxybenzene/2-methoxy-2-methylpropane/bis(fluorosulfonyl)imide lithium salt
  2911. methoxybenzene/2-methylpropanoic acid/2,6,6-trimethylbicyclo[3.1.1]hept-2-ene
  2912. methoxybenzene/2-propanol/benzene
  2913. methoxybenzene/ammonia/water
  2914. methoxybenzene/benzene/2-methyl-2-propanol
  2915. methoxybenzene/benzene/water
  2916. methoxybenzene/bromoacetic acid ethyl ester/2,6,6-trimethylbicyclo[3.1.1]hept-2-ene
  2917. methoxybenzene/carbon dioxide/1-methylnaphthalene
  2918. methoxybenzene/carbonic acid dimethyl ester/water
  2919. methoxybenzene/carbonic acid methyl phenyl ester/water
  2920. methoxybenzene/cis-decahydronaphthalene/trans-decahydronaphthalene
  2921. methoxybenzene/cyclohexane/1-pentanol
  2922. methoxybenzene/cyclohexane/benzene
  2923. methoxybenzene/cyclohexanol/2,6,6-trimethylbicyclo[3.1.1]hept-2-ene
  2924. methoxybenzene/cyclohexanol/benzene
  2925. methoxybenzene/cyclohexanone/2,6,6-trimethylbicyclo[3.1.1]hept-2-ene
  2926. methoxybenzene/dichloromethane/iodine
  2927. methoxybenzene/dichloromethane/iodine chloride (ICl)
  2928. methoxybenzene/ethane/1-methylnaphthalene
  2929. methoxybenzene/heptane/hydrochloric acid
  2930. methoxybenzene/hexadecanoic acid 1,2,3-propanetriyl ester/hexadecanoic acid
  2931. methoxybenzene/hexane/iodine
  2932. methoxybenzene/hexane/iodine chloride (ICl)
  2933. methoxybenzene/methanol/water
  2934. methoxybenzene/methylbenzene/hexane
  2935. methoxybenzene/N,N,N-tributyl-1-butanaminium salt with 2,4,6-trinitrophenol (1:1)/nitrobenzene
  2936. methoxybenzene/N,N,N-triethylethanaminium salt with 2,4,6-trinitrophenol (1:1)/nitrobenzene
  2937. methoxybenzene/nitric acid/water
  2938. methoxybenzene/nonane/1-pentanol
  2939. methoxybenzene/phenol/2-methylphenol
  2940. methoxybenzene/poly(1-phenylethylene)/2-methyl-2-propenoic acid methyl ester homopolymer
  2941. methoxybenzene/tetrachloromethane/iodine
  2942. methoxybenzene/tetrachloromethane/iodine chloride (ICl)
  2943. methoxybenzene/tetrahydrofuran/methanol
  2944. methoxybenzene/trichloromethane/iodine
  2945. methoxybenzene/trichloromethane/iodine chloride (ICl)
  2946. methoxybenzene/water/magnesium chloride (MgCl2)
  2947. methoxybenzene/water/nitric acid silver(1+) salt
  2948. methoxycyclopentane/1-propanol/water
  2949. methoxycyclopentane/2-propanol/water
  2950. methoxycyclopentane/acetic acid/water
  2951. methoxycyclopentane/ethanol/water
  2952. methoxycyclopentane/methanol/water
  2953. methoxycyclopentane/water/2-furancarboxaldehyde
  2954. methoxycyclopentane/water/2-propenoic acid
  2955. methyl α-D-galactopyranoside/benzene/water
  2956. methyl α-D-galactopyranoside/water/1,1'-biphenyl
  2957. methyl α-D-galactopyranoside/water/naphthalene
  2958. methyl β-D-galactopyranoside/benzene/water
  2959. methyl β-D-galactopyranoside/water/1,1'-biphenyl
  2960. methyl β-D-galactopyranoside/water/naphthalene
  2961. methyl β-D-glucopyranoside/benzene/water
  2962. methyl β-D-glucopyranoside/water/1,1'-biphenyl
  2963. methyl β-D-glucopyranoside/water/naphthalene
  2964. methyl β-D-xylopyranoside/potassium chloride (KCl)/water
  2965. Methyl 2,4-dihydroxy-3,6-dimethylbenzoate/ethanol/water
  2966. methyl 2-amino-2-(4-hydroxyphenyl)acetate/ethanol/water
  2967. methyl 2-amino-2-(4-hydroxyphenyl)acetate/methanol/water
  2968. methyl 2-amino-2-(4-hydroxyphenyl)acetate/water/Methyl D-(-)-4-hydroxyphenylglycinate hydrochloride
  2969. Methyl 4-tert-butylbenzoate/methanol/4-(1,1-dimethylethyl)benzoic acid
  2970. methyl N-[2-[[1-(4-chlorophenyl)pyrazol-3-yl]oxymethyl]phenyl]-N-methoxycarbamate/ethanol/Methyl N-[2-[[1-(4-chlorophenyl)pyrazol-3-yl]oxymethyl]phenyl]-N-hydroxycarbamate
  2971. methyl N-[2-[[1-(4-chlorophenyl)pyrazol-3-yl]oxymethyl]phenyl]-N-methoxycarbamate/N,N-dimethylformamide/Methyl N-[2-[[1-(4-chlorophenyl)pyrazol-3-yl]oxymethyl]phenyl]-N-hydroxycarbamate
  2972. methyl-α-D-mannopyranoside/phosphoric acid monoammonium salt/water
  2973. methyl-α-D-mannopyranoside/phosphoric acid monosodium salt/water
  2974. methyl-α-D-mannopyranoside/water/phosphoric acid monopotassium salt
  2975. methyl-β-cyclodextrin/1,8-diethyl-1,3,4,9-tetrahydropyrano[3,4-b]indole-1-acetic acid/water
  2976. methyl-d3-cyclopentane-d9/ethenyl-d3-benzene-d5 homopolymer/methylcyclopentane
  2977. methyl-d3-cyclopentane-d9/poly(1-phenylethylene)/methylcyclopentane
  2978. methylbenzene/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)/2-methyl-2-propenoic acid methyl ester homopolymer
  2979. methylbenzene/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)/water
  2980. methylbenzene/α-methyl-ω-methoxypoly(oxy-1,2-ethanediyl)/1,3-dioxolan-2-one
  2981. methylbenzene/β,β-carotene/2-butanone
  2982. methylbenzene/β,β-carotene/2-methoxy-2-methylbutane
  2983. methylbenzene/β-D-fructofuranosyl α-D-glucopyranoside/water
  2984. methylbenzene/(1-methylethenyl)benzene homopolymer/(1-methylethenyl)benzene
  2985. methylbenzene/(1-methylethyl)benzene/(1-methylethenyl)benzene
  2986. methylbenzene/(1-methylethyl)benzenesulfonic acid sodium salt/water
  2987. methylbenzene/(2-ethylhexyl)phosphonic acid, mono(2-ethylhexyl) ester/alamine 336
  2988. methylbenzene/(9Z)-9-octadecenoic acid methyl ester/water
  2989. methylbenzene/(9Z)-9-octadecenoic acid/N,N,N-triethylethanaminium chloride
  2990. methylbenzene/(S)-3-(1-methyl-2-pyrrolidinyl)pyridine/water
  2991. methylbenzene/1,1'-(methylenebis(oxy))bisethane/water
  2992. methylbenzene/1,1'-oxybis(2-methoxyethane)/β,β-carotene
  2993. methylbenzene/1,1'-oxybis(2-methoxyethane)/water
  2994. methylbenzene/1,1'-oxybisbutane/β,β-carotene
  2995. methylbenzene/1,1'-oxybisbutane/1-butanol
  2996. methylbenzene/1,1'-oxybisbutane/1-pentanol
  2997. methylbenzene/1,1'-oxybisbutane/1-propanol
  2998. methylbenzene/1,1'-oxybisbutane/2-methyl-2-propenoic acid methyl ester
  2999. methylbenzene/1,1'-oxybisbutane/ethanol
  3000. methylbenzene/1,1'-oxybisbutane/water
  3001. methylbenzene/1,1'-oxybisethane/4-chlorobenzoic acid
  3002. methylbenzene/1,1'-oxybisethane/ethanol
  3003. methylbenzene/1,1'-oxybisethane/water
  3004. methylbenzene/1,1'-sulfinylbiscyclohexane/heptane
  3005. methylbenzene/1,1,1,2,2,3,3,4,4-nonafluoro-4-methoxybutane/tetradecafluorohexane
  3006. methylbenzene/1,1,2,2,3,3,3-heptafluoro-N,N-bis(1,1,2,2,3,3,3-heptafluoropropyl)-1-propanamine/1,1,1,2,2,3,3,5,5,5-decafluoro-4-(trifluoromethyl)-4-methoxypentane
  3007. methylbenzene/1,1,2,3,3,3-hexafluoro-1-propene/trifluoro(trifluoromethyl)oxirane
  3008. methylbenzene/1,12-bis(N-methylpyrrolidinium)dodecane salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)/3,3'-(1,12-dodecanediyl)bis[1-methylimidazolium] salt with 1,1,2,2,2-pentafluoro-N-((pentafluoroethyl)sulfonyl)ethanes...
  3009. methylbenzene/1,12-bis(N-methylpyrrolidinium)dodecane salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)/3,3'-(1,12-dodecanediyl)bis[1-methylimidazolium] tetrafluoroborate(1-) (1:2)
  3010. methylbenzene/1,2,3,4-tetrahydronaphthalene/1-methylnaphthalene
  3011. methylbenzene/1,2,3,4-tetramethylbenzene/hydrochloric acid
  3012. methylbenzene/1,2,3,5-tetramethylbenzene/hydrochloric acid
  3013. methylbenzene/1,2,3-propanetriol/1-butyl-3-methyl-1H-imidazolium chloride
  3014. methylbenzene/1,2,3-propanetriol/1-ethyl-1-methylpyrrolidin-1-ium bromide
  3015. methylbenzene/1,2,3-propanetriol/2,6-dimethylphenol
  3016. methylbenzene/1,2,3-propanetriol/2-hydroxy-N,N,N-trimethylethanaminium chloride
  3017. methylbenzene/1,2,3-propanetriol/methanol
  3018. methylbenzene/1,2,3-propanetriol/N,N,N-trimethylmethanaminium chloride
  3019. methylbenzene/1,2,3-propanetriol/water
  3020. methylbenzene/1,2,3-trimethylbenzene/hydrochloric acid
  3021. methylbenzene/1,2-benzenedicarboxylic acid dimethyl ester/heptane
  3022. methylbenzene/1,2-benzenedicarboxylic acid dinonyl ester/1,3,5-trinitrobenzene
  3023. methylbenzene/1,2-dimethoxyethane/β,β-carotene
  3024. methylbenzene/1,2-dimethylbenzene/1-chloro-2-methylbenzene
  3025. methylbenzene/1,2-dimethylbenzene/2-methylbenzenamine
  3026. methylbenzene/1,2-oxathiolane 2,2-dioxide/heptane
  3027. methylbenzene/1,2-propanediol/water
  3028. methylbenzene/1,3-bis(dimethylamino)-2-propanol/water
  3029. methylbenzene/1,3-butadiene homopolymer/poly(1-phenylethylene)
  3030. methylbenzene/1,3-dioxolane/1,2-dimethylbenzene
  3031. methylbenzene/1,3-dioxolane/benzene
  3032. methylbenzene/1,3-dioxolane/formamide
  3033. methylbenzene/1,3-propanediol ester with 2,3,5,6-tetrachloro-1,4-benzenedicarboxylic acid monopropyl ester (1:2)/2,3,5,6-tetrachloro-1,4-benzenedicarboxylic acid ester with 3-((4-(propoxycarbonyl)-2,3,5,6-tetrachlorobenzoyl)oxy)-1-propanol (1:2)
  3034. methylbenzene/1,3-propanediol/2,6-dimethylphenol
  3035. methylbenzene/1,4,7,10,13,16-hexaoxacyclooctadecane/water
  3036. methylbenzene/1,4-butanediol/2,6-dimethylphenol
  3037. methylbenzene/1,4-butanediol/heptane
  3038. methylbenzene/1,4-dioxane/1,2-propanediamine
  3039. methylbenzene/1,4-dioxane/2-methyl-1-propanol
  3040. methylbenzene/1,4-dioxane/2-methylbenzenamine
  3041. methylbenzene/1,4-dioxane/2-propanone
  3042. methylbenzene/1,4-dioxane/benzenamine
  3043. methylbenzene/1,4-dioxane/ethanol
  3044. methylbenzene/1,4-dioxane/N,N-dimethylformamide
  3045. methylbenzene/1,4-dioxane/nitrobenzene
  3046. methylbenzene/1,4-dioxane/pyrazinecarboxamide
  3047. methylbenzene/1,4-dioxane/trichloromethane
  3048. methylbenzene/1,4-dioxane/water
  3049. methylbenzene/1,5-pentanediol/2-chloro-N,N,N-trimethylethanaminium chloride
  3050. methylbenzene/1,6-hexanediol/1-ethyl-1-methylpyrrolidin-1-ium bromide
  3051. methylbenzene/1,6-hexanediol/N,N,N-trimethylmethanaminium chloride
  3052. methylbenzene/1,8-dinitronaphthalene/methanol
  3053. methylbenzene/1-(3-dimethylaminopropyl)-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile hydrobromide/ethanol
  3054. methylbenzene/1-butanol/2-methyl-2-propenoic acid methyl ester
  3055. methylbenzene/1-butanol/2-propenoic acid methyl ester
  3056. methylbenzene/1-butanol/benzene
  3057. methylbenzene/1-butanol/nitrobenzene
  3058. methylbenzene/1-butanol/Tiopronin
  3059. methylbenzene/1-butanol/water
  3060. methylbenzene/1-butyl-3-methyl-1H-imidazolium chloride/bitumen
  3061. methylbenzene/1-butyl-3-methyl-1H-imidazolium chloride/heavy crude oil
  3062. methylbenzene/1-butyl-3-methyl-1H-imidazolium hexafluorophosphate(1-)/carbonic acid dimethyl ester
  3063. methylbenzene/1-butyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)/1-butyl-3-methyl-1H-imidazolium chloride
  3064. methylbenzene/1-butyl-3-methyl-1H-imidazolium salt with cyanocyanamide (1:1)/carbonic acid dimethyl ester
  3065. methylbenzene/1-butyl-3-methyl-1H-imidazolium salt with thiocyanic acid (1:1)/heavy crude oil
  3066. methylbenzene/1-butyl-3-methyl-1H-imidazolium tetrafluoroborate(1-)/heavy crude oil
  3067. methylbenzene/1-butyl-3-methyl-1H-imidazolium(triiodide)/heptane
  3068. methylbenzene/1-butylpyridinium nitrate/1-octylpyridinium nitrate
  3069. methylbenzene/1-butylpyridinium tetrafluoroborate(1-)/1-butyl-4-methylpyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3070. methylbenzene/1-Chlorobenzotriazole/1,1'-biphenyl
  3071. methylbenzene/1-decyl-3-methyl-1H-imidazolium chloride/bitumen
  3072. methylbenzene/1-decyl-3-methyl-1H-imidazolium chloride/heavy crude oil
  3073. methylbenzene/1-dodecyl-3-methyl-1H-imidazolium chloride/1-butyl-3-methyl-1H-imidazolium chloride
  3074. methylbenzene/1-dodecyl-3-methyl-1H-imidazolium chloride/bitumen
  3075. methylbenzene/1-dodecyl-3-methyl-1H-imidazolium chloride/heavy crude oil
  3076. methylbenzene/1-ethyl-3-methyl-1H-imidazolium bromide/β-cyclodextrin
  3077. methylbenzene/1-ethyl-3-methyl-1H-imidazolium chloride/aluminum chloride (AlCl3)
  3078. methylbenzene/1-ethyl-3-methyl-1H-imidazolium chloride/bitumen
  3079. methylbenzene/1-ethyl-3-methyl-1H-imidazolium chloride/heavy crude oil
  3080. methylbenzene/1-ethyl-3-methyl-1H-imidazolium salt with cyanocyanamide (1:1)/1-ethyl-4-methylpyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3081. methylbenzene/1-ethyl-3-methyl-1H-imidazolium salt with cyanocyanamide (1:1)/2,3-dimethylpentane
  3082. methylbenzene/1-ethyl-3-methyl-1H-imidazolium salt with cyanocyanamide (1:1)/carbonic acid dimethyl ester
  3083. methylbenzene/1-heptanol/2-methyl-2-propenoic acid methyl ester
  3084. methylbenzene/1-hexanamine/benzene
  3085. methylbenzene/1-hexanol/1-octanol
  3086. methylbenzene/1-hexanol/anthracene
  3087. methylbenzene/1-hexene/1-butanol
  3088. methylbenzene/1-hexene/1-methyl-3-octyl-1H-imidazolium thiocyanate
  3089. methylbenzene/1-hexene/2-butanol
  3090. methylbenzene/1-hexene/2-ethoxy-2-methylpropane
  3091. methylbenzene/1-hexene/sulfinylbismethane
  3092. methylbenzene/1-hexyl-3-methyl-1H-imidazolium chloride/bitumen
  3093. methylbenzene/1-hexyl-3-methyl-1H-imidazolium chloride/heavy crude oil
  3094. methylbenzene/1-hexyl-3-methyl-1H-imidazolium hexafluorophosphate(1-)/carbonic acid dimethyl ester
  3095. methylbenzene/1-hexyl-3-methyl-1H-imidazolium hexafluorophosphate(1-)/sulfur
  3096. methylbenzene/1-hydroxy-2-propanone/water
  3097. methylbenzene/1-isocyanatohexane homopolymer/1-isocyanatohexane homopolymer
  3098. methylbenzene/1-methyl-3-octyl-1H-imidazolium chloride/bitumen
  3099. methylbenzene/1-methyl-3-octyl-1H-imidazolium chloride/heavy crude oil
  3100. methylbenzene/1-methyl-3-octyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)/β-cyclodextrin
  3101. methylbenzene/1-octanol/β,β-carotene
  3102. methylbenzene/1-octanol/water
  3103. methylbenzene/1-octene/hydrochloric acid
  3104. methylbenzene/1-pentanol/2-methyl-2-propenoic acid methyl ester
  3105. methylbenzene/1-pentanol/nitrobenzene
  3106. methylbenzene/1-propanol/1-(ethenyloxy)propane
  3107. methylbenzene/1-propanol/1-methyl-2-pyrrolidinone
  3108. methylbenzene/1-propanol/1-phenylethanone
  3109. methylbenzene/1-propanol/2-propenoic acid methyl ester
  3110. methylbenzene/1-propanol/acetonitrile
  3111. methylbenzene/1-propanol/iodoethane
  3112. methylbenzene/1-propanol/nitrobenzene
  3113. methylbenzene/1-propanol/water
  3114. methylbenzene/1-propene/carbon monoxide
  3115. methylbenzene/1-propene/hydrogen
  3116. methylbenzene/1-propene/nitromethane
  3117. methylbenzene/1H-indole/1-ethyl-3-methyl-1H-imidazolium nitrate
  3118. methylbenzene/1H-indole/1-ethyl-3-methyl-1H-imidazolium salt with 4-methylbenzenesulfonic acid (1:1)
  3119. methylbenzene/1H-pyrrole/1-ethyl-3-methyl-1H-imidazolium nitrate
  3120. methylbenzene/1H-pyrrole/1-ethyl-3-methyl-1H-imidazolium salt with 4-methylbenzenesulfonic acid (1:1)
  3121. methylbenzene/2(or 5)-methyl-5(or 2)-(1-methylethyl)benzenesulfonic acid sodium salt/water
  3122. methylbenzene/2,2'-(1,2-ethanediylbis(oxy))bisethanol/1-ethyl-1-methylpyrrolidin-1-ium bromide
  3123. methylbenzene/2,2'-(1,2-ethanediylbis(oxy))bisethanol/decane
  3124. methylbenzene/2,2'-(1,2-ethanediylbis(oxy))bisethanol/heptane
  3125. methylbenzene/2,2'-(1,2-ethanediylbis(oxy))bisethanol/N,N,N-tributyl-1-butanaminium bromide
  3126. methylbenzene/2,2'-(1,2-ethanediylbis(oxy))bisethanol/tetrahydrothiophene 1,1-dioxide
  3127. methylbenzene/2,2'-(1,2-ethanediylbis(oxy))bisethanol/water
  3128. methylbenzene/2,2'-iminobisethanol/water
  3129. methylbenzene/2,2'-oxybisethanol/1,2-benzenedicarboxylic acid diethyl ester
  3130. methylbenzene/2,2'-oxybisethanol/1-ethyl-1-methylpyrrolidin-1-ium bromide
  3131. methylbenzene/2,2'-oxybisethanol/4-morpholinecarboxaldehyde
  3132. methylbenzene/2,2'-oxybisethanol/decane
  3133. methylbenzene/2,2'-oxybisethanol/heptane
  3134. methylbenzene/2,2'-oxybisethanol/N,N,N-tributyl-1-butanaminium bromide
  3135. methylbenzene/2,2'-oxybisethanol/octane
  3136. methylbenzene/2,2'-oxybisethanol/water
  3137. methylbenzene/2,2'-thiobisethanol/heptane
  3138. methylbenzene/2,2'-[oxybis(2,1-ethanediyloxy)]bisethanol/heptane
  3139. methylbenzene/2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene/acetonitrile
  3140. methylbenzene/2,2,4-trimethylpentane/1-butanol
  3141. methylbenzene/2,2,4-trimethylpentane/2-ethoxy-2-methylpropane
  3142. methylbenzene/2,2,4-trimethylpentane/2-furancarboxaldehyde
  3143. methylbenzene/2,2,4-trimethylpentane/2-methoxybenzenamine
  3144. methylbenzene/2,2,4-trimethylpentane/2-methyl-2-propanol
  3145. methylbenzene/2,2,4-trimethylpentane/2-propanone
  3146. methylbenzene/2,2,4-trimethylpentane/benzenamine
  3147. methylbenzene/2,2,4-trimethylpentane/ethane
  3148. methylbenzene/2,2,4-trimethylpentane/ethanol
  3149. methylbenzene/2,2,4-trimethylpentane/ethene
  3150. methylbenzene/2,2,4-trimethylpentane/methanol
  3151. methylbenzene/2,2,4-trimethylpentane/phenanthrene
  3152. methylbenzene/2,2,4-trimethylpentane/tetrachloromethane
  3153. methylbenzene/2,2,4-trimethylpentane/water
  3154. methylbenzene/2,2,5-trimethylhexane/methanol
  3155. methylbenzene/2,2-dimethyl-1,3-dioxolane/water
  3156. methylbenzene/2,3,5,6-tetrachloro-2,5-cyclohexadiene-1,4-dione/sulfinylbismethane
  3157. methylbenzene/2,3-dimethylpentane/1-ethyl-4-methylpyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3158. methylbenzene/2,4,6,8,10,12-hexanitro-2,4,6,8,10,12-hexaazatetracyclo[5.5.0.0(3,11).0(5,9)]dodecane/acetic acid ethyl ester
  3159. methylbenzene/2,4,6-trimethylbenzenesulfonic acid sodium salt/water
  3160. methylbenzene/2,4,6-trimethylbenzoic acid sodium salt/water
  3161. methylbenzene/2,4-dimethylbenzoic acid sodium salt/water
  3162. methylbenzene/2,5-bis(1-methylethyl)benzenesulfonic acid sodium salt/water
  3163. methylbenzene/2,6,10,15,19,23-hexamethyltetracosane/carbon dioxide
  3164. methylbenzene/2,6,10,15,19,23-hexamethyltetracosane/fluoranthene
  3165. methylbenzene/2,6-bis(1,1-dimethylethyl)-4-methylphenol/water
  3166. methylbenzene/2-(1-methylethoxy)ethanol/water
  3167. methylbenzene/2-(2-butoxyethoxy)ethanol/water
  3168. methylbenzene/2-(2-ethoxyethoxy)ethanol/hydrochloric acid
  3169. methylbenzene/2-(2-methoxyethoxy)ethanol/2,2,4-trimethylpentane
  3170. methylbenzene/2-aminobenzoic acid methyl ester/water
  3171. methylbenzene/2-aminoethanol/water
  3172. methylbenzene/2-butanone/2-methyl-1-propene homopolymer
  3173. methylbenzene/2-butanone/2-methyl-2-propenoic acid methyl ester homopolymer
  3174. methylbenzene/2-butenal/2-butanone
  3175. methylbenzene/2-butenal/water
  3176. methylbenzene/2-butoxyethanol/2-methyl-2-propenoic acid methyl ester
  3177. methylbenzene/2-butoxyethanol/water
  3178. methylbenzene/2-chlorobenzoic acid/1,1'-oxybisethane
  3179. methylbenzene/2-ethoxy-2-methylpropane/methanol
  3180. methylbenzene/2-ethoxyethanol/2-butanone
  3181. methylbenzene/2-ethoxyethanol/2-butenal
  3182. methylbenzene/2-ethoxyethanol/2-propanone
  3183. methylbenzene/2-ethoxyethanol/acetic acid butyl ester
  3184. methylbenzene/2-ethoxyethanol/water
  3185. methylbenzene/2-methoxy-2-methylpropane/β,β-carotene
  3186. methylbenzene/2-methoxy-2-methylpropane/1-butanol
  3187. methylbenzene/2-methoxy-2-methylpropane/1-hexene
  3188. methylbenzene/2-methoxy-2-methylpropane/2,2,4-trimethylpentane
  3189. methylbenzene/2-methoxy-2-methylpropane/benzene
  3190. methylbenzene/2-methoxy-2-methylpropane/methanol
  3191. methylbenzene/2-methoxy-2-methylpropane/Sofosbuvir
  3192. methylbenzene/2-methoxy-2-methylpropane/water
  3193. methylbenzene/2-methoxyethanol/acetic acid butyl ester
  3194. methylbenzene/2-methoxyethanol/acetic acid ethyl ester
  3195. methylbenzene/2-methoxyethanol/hexadecane
  3196. methylbenzene/2-methoxyethanol/sulfinylbismethane
  3197. methylbenzene/2-methoxyethanol/water
  3198. methylbenzene/2-methyl-1-propanol/Tiopronin
  3199. methylbenzene/2-methyl-1-propene homopolymer/poly(1-phenylethylene)
  3200. methylbenzene/2-methyl-2-butanol/water
  3201. methylbenzene/2-methyl-2-propanol/2-methylbutane
  3202. methylbenzene/2-methyl-2-propanol/water
  3203. methylbenzene/2-methyl-2-propenoic acid 1,1-dimethylethyl ester homopolymer/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)
  3204. methylbenzene/2-methyl-2-propenoic acid 2-(dimethylamino)ethyl ester/water
  3205. methylbenzene/2-methyl-2-propenoic acid ethyl ester homopolymer/Bis(7-methyloctyl) cyclohexane-1,2-dicarboxylate
  3206. methylbenzene/2-methyl-2-propenoic acid ethyl ester homopolymer/Diisooctyl azelate
  3207. methylbenzene/2-methylpropanoic acid methyl ester/acetonitrile
  3208. methylbenzene/2-propanol/1-methyl-2-pyrrolidinone
  3209. methylbenzene/2-propanol/2-furancarboxaldehyde
  3210. methylbenzene/2-propanol/2-propanone
  3211. methylbenzene/2-propanol/9H-carbazole
  3212. methylbenzene/2-propanol/benzene
  3213. methylbenzene/2-propanol/water
  3214. methylbenzene/2-propanone/β,β-carotene
  3215. methylbenzene/2-propanone/2-methyl-1-propanol
  3216. methylbenzene/2-propanone/9H-carbazole
  3217. methylbenzene/2-propanone/benzene
  3218. methylbenzene/2-propanone/pyrazinecarboxamide
  3219. methylbenzene/2-propanone/trichloromethane
  3220. methylbenzene/2-propanone/water
  3221. methylbenzene/2-propenoic acid butyl ester/2-methyl-2-propenoic acid methyl ester
  3222. methylbenzene/2-pyrrolidinone/1,2-dimethylbenzene
  3223. methylbenzene/2-pyrrolidinone/1-propanol
  3224. methylbenzene/2-pyrrolidinone/benzene
  3225. methylbenzene/3,3'-thiobispropanenitrile/heptane
  3226. methylbenzene/3,3'-thiobispropanenitrile/water
  3227. methylbenzene/3-ethoxy-1,1,1,2,3,4,4,5,5,6,6,6-dodecafluoro-2-(trifluoromethyl)hexane/1,1,2,2,3,3,3-heptafluoro-N,N-bis(1,1,2,2,3,3,3-heptafluoropropyl)-1-propanamine
  3228. methylbenzene/3-ethylphenol/water
  3229. methylbenzene/3-methyl-2-butanone/water
  3230. methylbenzene/3-pyridinamine/ethanol
  3231. methylbenzene/4-(1,1-dimethylethyl)benzoic acid sodium salt/water
  3232. methylbenzene/4-(1-methylethyl)benzenesulfonic acid sodium salt/water
  3233. methylbenzene/4-aminobenzenesulfonamide/2-propanone
  3234. methylbenzene/4-aminobenzenesulfonamide/ethanol
  3235. methylbenzene/4-aminobenzenesulfonamide/methanol
  3236. methylbenzene/4-ethoxybenzenamine/2,2,4-trimethylpentane
  3237. methylbenzene/4-ethylbenzenesulfonic acid sodium salt/water
  3238. methylbenzene/4-hydroxy-3-methoxybenzeneacetic acid/2-propanol
  3239. methylbenzene/4-methoxyphenol/water
  3240. methylbenzene/4-methylbenzenesulfonic acid sodium salt/water
  3241. methylbenzene/4-morpholinecarboxaldehyde/3-methylthiophene
  3242. methylbenzene/4-morpholinecarboxaldehyde/benzene
  3243. methylbenzene/4-morpholinecarboxaldehyde/methanol
  3244. methylbenzene/4-morpholinecarboxaldehyde/water
  3245. methylbenzene/4-oxopentanoic acid/2-(acetyloxy)-N,N,N-trimethylethanaminium chloride
  3246. methylbenzene/4-oxopentanoic acid/2-hydroxy-N,N,N-trimethylethanaminium chloride
  3247. methylbenzene/5-(1,1-dimethylethyl)-2-methylbenzenesulfonic acid sodium salt/water
  3248. methylbenzene/8-chloro-11-(4-methyl-1-piperazinyl)-5H-dibenzo[b,e][1,4]diazepine/2-propanone
  3249. methylbenzene/8-chloro-11-(4-methyl-1-piperazinyl)-5H-dibenzo[b,e][1,4]diazepine/trichloromethane
  3250. methylbenzene/acetaldehyde/water
  3251. methylbenzene/acetic acid 2-methylpropyl ester/1-butanol
  3252. methylbenzene/acetic acid butyl ester/1-butanol
  3253. methylbenzene/acetic acid butyl ester/1-propanol
  3254. methylbenzene/acetic acid butyl ester/2-propanone
  3255. methylbenzene/acetic acid butyl ester/acetic acid methyl ester
  3256. methylbenzene/acetic acid butyl ester/benzene
  3257. methylbenzene/acetic acid ethyl ester/1-butanol
  3258. methylbenzene/acetic acid ethyl ester/benzene
  3259. methylbenzene/acetic acid ethyl ester/ethanol
  3260. methylbenzene/acetic acid ethyl ester/Sofosbuvir
  3261. methylbenzene/acetic acid ethyl ester/triphenylphosphine oxide
  3262. methylbenzene/acetic acid ethyl ester/water
  3263. methylbenzene/acetic acid pentyl ester/trichloromethane
  3264. methylbenzene/acetic acid phenyl ester/1-phenylethanone
  3265. methylbenzene/acetic acid phenylmethyl ester/benzoic acid
  3266. methylbenzene/acetic acid sodium salt/ethanol
  3267. methylbenzene/acetic acid/benzene
  3268. methylbenzene/acetic acid/benzoic acid
  3269. methylbenzene/acetic acid/tetrachlorostannane
  3270. methylbenzene/acetic acid/water
  3271. methylbenzene/acetic acid/zinc chloride (ZnCl2)
  3272. methylbenzene/acetonitrile/water
  3273. methylbenzene/alamine 336/bis(2,4,4-trimethylpentyl)phosphinic acid
  3274. methylbenzene/aluminum bromide (AlBr3)/cesium bromide (CsBr)
  3275. methylbenzene/aluminum bromide (AlBr3)/potassium bromide (KBr)
  3276. methylbenzene/aluminum bromide (AlBr3)/rubidium bromide (RbBr)
  3277. methylbenzene/aluminum chloride (AlCl3)/lithium chloride (LiCl)
  3278. methylbenzene/ammonia/water
  3279. methylbenzene/ammonium chloride ((NH4)Cl)/water
  3280. methylbenzene/anthracene/1-butanol
  3281. methylbenzene/anthracene/1-pentanol
  3282. methylbenzene/anthracene/1-propanol
  3283. methylbenzene/anthracene/2,2,4-trimethylpentane
  3284. methylbenzene/anthracene/2-butanol
  3285. methylbenzene/anthracene/2-methyl-1-propanol
  3286. methylbenzene/anthracene/2-propanol
  3287. methylbenzene/anthracene/3-methyl-1-butanol
  3288. methylbenzene/anthracene/benzene
  3289. methylbenzene/anthracene/carbon disulfide
  3290. methylbenzene/anthracene/cyclooctane
  3291. methylbenzene/anthracene/heptane
  3292. methylbenzene/anthracene/iodine
  3293. methylbenzene/anthracene/methanol
  3294. methylbenzene/anthracene/phenanthrene
  3295. methylbenzene/anthracene/tetrachloromethane
  3296. methylbenzene/anthracene/trichloromethane
  3297. methylbenzene/benzenamine/1,3-dioxolane
  3298. methylbenzene/benzenamine/1-propanol
  3299. methylbenzene/benzenamine/2-methyl-1-propanol
  3300. methylbenzene/benzenamine/benzene
  3301. methylbenzene/benzenamine/carbon monoxide
  3302. methylbenzene/benzenamine/ethanol
  3303. methylbenzene/benzenamine/methanol
  3304. methylbenzene/benzenamine/water
  3305. methylbenzene/benzene/(1-methylethenyl)benzene
  3306. methylbenzene/benzene/(1-methylethyl)benzene
  3307. methylbenzene/benzene/1,2-dimethylbenzene
  3308. methylbenzene/benzene/1-chloro-2-methylbenzene
  3309. methylbenzene/benzene/1-methyl-2-pyrrolidinone
  3310. methylbenzene/benzene/2,4,6-trinitrophenol
  3311. methylbenzene/benzene/2-methyl-2-propenoic acid methyl ester homopolymer
  3312. methylbenzene/benzene/2-methylbenzenamine
  3313. methylbenzene/benzene/acetic acid methyl ester
  3314. methylbenzene/benzene/dibromomethane
  3315. methylbenzene/benzene/hydrochloric acid
  3316. methylbenzene/benzene/iodine
  3317. methylbenzene/benzene/naphthalene
  3318. methylbenzene/benzene/nitrobenzene
  3319. methylbenzene/benzene/poly(1-phenylethylene)
  3320. methylbenzene/benzene/triphenylphosphine oxide
  3321. methylbenzene/benzene/water
  3322. methylbenzene/benzenesulfonic acid sodium salt/water
  3323. methylbenzene/benzoic acid phenylmethyl ester/benzoic acid
  3324. methylbenzene/benzoic acid sodium salt/water
  3325. methylbenzene/benzoic acid/1,1'-biphenyl
  3326. methylbenzene/bicyclo[2.2.1]hept-2-ene/ethene
  3327. methylbenzene/bitumen/N-dodecylthiazolium chloride
  3328. methylbenzene/butanal/benzene
  3329. methylbenzene/butanenitrile/hexadecafluorooxonane
  3330. methylbenzene/butanoic acid butyl ester/methanol
  3331. methylbenzene/butylcyclohexane/hexadecane
  3332. methylbenzene/carbon dioxide/1,2-benzenedicarboxylic acid dinonyl ester
  3333. methylbenzene/carbon dioxide/1,3-butadiene homopolymer
  3334. methylbenzene/carbon dioxide/1-butyltetrahydrothiophenium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3335. methylbenzene/carbon dioxide/1-methylnaphthalene
  3336. methylbenzene/carbon dioxide/2-methyl-2-propenoic acid methyl ester homopolymer
  3337. methylbenzene/carbon dioxide/2-naphthalenol
  3338. methylbenzene/carbon dioxide/2-propanol
  3339. methylbenzene/carbon dioxide/acetic acid ethenyl ester homopolymer
  3340. methylbenzene/carbon dioxide/ethoxyethene homopolymer
  3341. methylbenzene/carbon dioxide/heavy crude oil
  3342. methylbenzene/carbon dioxide/heptane
  3343. methylbenzene/carbon dioxide/hexa-tert-butylhexaperi-hexabenzocoronene
  3344. methylbenzene/carbon dioxide/hydrogen
  3345. methylbenzene/carbon dioxide/hydrogen sulfide (H2S)
  3346. methylbenzene/carbon dioxide/methane
  3347. methylbenzene/carbon dioxide/methyloxirane
  3348. methylbenzene/carbon dioxide/naphthalene
  3349. methylbenzene/carbon dioxide/oxirane
  3350. methylbenzene/carbon dioxide/phenanthrene
  3351. methylbenzene/carbon dioxide/poly(1-phenylethylene)
  3352. methylbenzene/carbon dioxide/poly(dimethylsiloxane)
  3353. methylbenzene/carbon dioxide/Polypropylene carbonate
  3354. methylbenzene/carbon dioxide/tetradecafluorohexane
  3355. methylbenzene/carbon dioxide/violanthrone-79
  3356. methylbenzene/carbon dioxide/water
  3357. methylbenzene/carbon monoxide/1-naphthalenol
  3358. methylbenzene/carbon monoxide/acetic acid
  3359. methylbenzene/carbon monoxide/naphthalene
  3360. methylbenzene/carbon monoxide/nitrobenzene
  3361. methylbenzene/carbon monoxide/phenanthrene
  3362. methylbenzene/carbon monoxide/propane
  3363. methylbenzene/carbonic acid dimethyl ester/ethanol
  3364. methylbenzene/carbonic acid dimethyl ester/methanol
  3365. methylbenzene/carbonic acid dimethyl ester/water
  3366. methylbenzene/carbonic acid monopotassium salt/water
  3367. methylbenzene/chloric acid potassium salt/methanol
  3368. methylbenzene/chlorobenzene/1-hexanol
  3369. methylbenzene/chlorobenzene/2-propanone
  3370. methylbenzene/chlorobenzene/benzene
  3371. methylbenzene/chlorobenzene/cyclohexane
  3372. methylbenzene/chlorobenzene/hexane
  3373. methylbenzene/chlorobenzene/hydrochloric acid
  3374. methylbenzene/chlorobenzene/N,N-dimethylformamide
  3375. methylbenzene/chlorobenzene/pyridine
  3376. methylbenzene/chlorotrifluoromethane/nitroethane
  3377. methylbenzene/cis-decahydronaphthalene/trans-decahydronaphthalene
  3378. methylbenzene/cyclohexanamine/benzenamine
  3379. methylbenzene/cyclohexanamine/cyclohexanol
  3380. methylbenzene/cyclohexanamine/water
  3381. methylbenzene/cyclohexane/γ-butyrolactamium acetate
  3382. methylbenzene/cyclohexane/1,1'-oxybisbutane
  3383. methylbenzene/cyclohexane/1,2-benzenedicarboxylic acid dimethyl ester
  3384. methylbenzene/cyclohexane/1,3-dimethyl-2-imidazolidinone
  3385. methylbenzene/cyclohexane/1,3-dioxolan-2-one
  3386. methylbenzene/cyclohexane/1-butanol
  3387. methylbenzene/cyclohexane/1-butyl-1-methylpyrrolidinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3388. methylbenzene/cyclohexane/1-butyl-1-methylpyrrolidinium salt with trifluoromethanesulfonic acid (1:1)
  3389. methylbenzene/cyclohexane/1-butyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3390. methylbenzene/cyclohexane/1-butyl-3-methyl-1H-imidazolium salt with sulfuric acid methyl ester (1:1)
  3391. methylbenzene/cyclohexane/1-butyl-3-methyl-1H-imidazolium salt with trifluoromethanesulfonic acid (1:1)
  3392. methylbenzene/cyclohexane/1-butyl-4-methylpyridinium tetrafluoroborate(1-)
  3393. methylbenzene/cyclohexane/1-ethyl-3-methyl-1H-imidazolium acetate
  3394. methylbenzene/cyclohexane/1-ethyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3395. methylbenzene/cyclohexane/1-ethyl-3-methyl-1H-imidazolium salt with cyanocyanamide (1:1)
  3396. methylbenzene/cyclohexane/1-ethyl-3-methyl-1H-imidazolium salt with sulfuric acid monoethyl ester (1:1)
  3397. methylbenzene/cyclohexane/1-ethyl-3-methyl-1H-imidazolium salt with sulfuric acid monomethyl ester (1:1)
  3398. methylbenzene/cyclohexane/1-ethyl-3-methylpyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3399. methylbenzene/cyclohexane/1-ethyl-3-methylpyridinium salt with sulfuric acid ethyl ester
  3400. methylbenzene/cyclohexane/1-ethyl-4-methylpyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3401. methylbenzene/cyclohexane/1-hexyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3402. methylbenzene/cyclohexane/1-hexyl-3-methyl-1H-imidazolium salt with trifluoromethanesulfonic acid (1:1)
  3403. methylbenzene/cyclohexane/1-methyl-2-pyrrolidinone
  3404. methylbenzene/cyclohexane/1-methyl-3-octyl-1H-imidazolium thiocyanate
  3405. methylbenzene/cyclohexane/1-methyl-3-propyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3406. methylbenzene/cyclohexane/2-butanol
  3407. methylbenzene/cyclohexane/2-methoxy-2-methylpropane
  3408. methylbenzene/cyclohexane/2-methoxybenzenamine
  3409. methylbenzene/cyclohexane/2-propanol
  3410. methylbenzene/cyclohexane/2-propanone
  3411. methylbenzene/cyclohexane/3-methoxybenzenamine
  3412. methylbenzene/cyclohexane/4-ethoxybenzenamine
  3413. methylbenzene/cyclohexane/acetonitrile
  3414. methylbenzene/cyclohexane/anthracene
  3415. methylbenzene/cyclohexane/benzenamine
  3416. methylbenzene/cyclohexane/benzene
  3417. methylbenzene/cyclohexane/dichloromethane
  3418. methylbenzene/cyclohexane/dihydro-2(3H)-furanone
  3419. methylbenzene/cyclohexane/ethanol
  3420. methylbenzene/cyclohexane/heptane
  3421. methylbenzene/cyclohexane/hydrogen
  3422. methylbenzene/cyclohexane/methanol
  3423. methylbenzene/cyclohexane/naphthalene
  3424. methylbenzene/cyclohexane/nitrobenzene
  3425. methylbenzene/cyclohexane/poly(1-phenylethylene)
  3426. methylbenzene/cyclohexane/sulfinylbismethane
  3427. methylbenzene/cyclohexane/tetrachloroethene
  3428. methylbenzene/cyclohexane/tetrachloromethane
  3429. methylbenzene/cyclohexane/tetrahydrothiophene 1,1-dioxide
  3430. methylbenzene/cyclohexane/trichloromethane
  3431. methylbenzene/cyclohexane/water
  3432. methylbenzene/cyclohexanol/sulfinylbismethane
  3433. methylbenzene/cyclohexanol/water
  3434. methylbenzene/cyclohexanone/β,β-carotene
  3435. methylbenzene/cyclohexanone/cyclohexane
  3436. methylbenzene/cyclohexanone/water
  3437. methylbenzene/cyclohexene/1-butyl-3-methyl-1H-imidazolium salt with sulfuric acid methyl ester (1:1)
  3438. methylbenzene/cyclohexene/3-methoxybenzenamine
  3439. methylbenzene/cyclohexene/hydrochloric acid
  3440. methylbenzene/cyclohexene/tetrahydrothiophene 1,1-dioxide
  3441. methylbenzene/cyclooctane/1-butyl-3-methyl-1H-imidazolium salt with sulfuric acid methyl ester (1:1)
  3442. methylbenzene/cyclooctane/1-ethyl-3-methyl-1H-imidazolium salt with sulfuric acid monoethyl ester (1:1)
  3443. methylbenzene/cyclooctane/1-ethyl-3-methylpyridinium salt with sulfuric acid ethyl ester
  3444. methylbenzene/cyclooctane/benzene
  3445. methylbenzene/cyclooctane/hexadecane
  3446. methylbenzene/cyclopentanone/water
  3447. methylbenzene/D-gluconic acid/water
  3448. methylbenzene/D-glucose/water
  3449. methylbenzene/decane/1,2,3-propanetriol
  3450. methylbenzene/decane/1-butylpyridinium nitrate
  3451. methylbenzene/decane/4-morpholinecarboxaldehyde
  3452. methylbenzene/decane/carbon dioxide
  3453. methylbenzene/decane/ethanol
  3454. methylbenzene/decane/formic acid compd. with 2-aminoethanol (1:1)
  3455. methylbenzene/decane/methanol
  3456. methylbenzene/decane/N-hexylpyridinium nitrate
  3457. methylbenzene/decane/sulfinylbismethane
  3458. methylbenzene/decane/tetrahydrothiophene 1,1-dioxide
  3459. methylbenzene/decane/water
  3460. methylbenzene/dibenzothiophene/water
  3461. methylbenzene/dibromomethane/1,2-dimethylbenzene
  3462. methylbenzene/dichloro(methyl)silane/trichloromethylsilane
  3463. methylbenzene/dichloroethenylmethylsilane/dichloro(methyl)silane
  3464. methylbenzene/dichloroethenylmethylsilane/trichloromethylsilane
  3465. methylbenzene/dimethoxymethane/water
  3466. methylbenzene/dimethylbenzene/benzene
  3467. methylbenzene/diphenylethanedione/benzene
  3468. methylbenzene/docosanoic acid/acetic acid butyl ester
  3469. methylbenzene/dodecane/1-ethyl-3-methyl-1H-imidazolium salt with sulfuric acid monomethyl ester (1:1)
  3470. methylbenzene/dodecane/2-furancarboxaldehyde
  3471. methylbenzene/dodecane/2-furanmethanol
  3472. methylbenzene/dodecane/ethanol
  3473. methylbenzene/dodecane/methanol
  3474. methylbenzene/dodecane/water
  3475. methylbenzene/ethane/poly(1-phenylethylene)
  3476. methylbenzene/ethanedioic acid/2-hydroxy-N,N,N-trimethylethanaminium chloride
  3477. methylbenzene/ethanedioic acid/water
  3478. methylbenzene/ethanol/1-Decyl-3-methylimidazolium acetate
  3479. methylbenzene/ethanol/2-methoxy-2-methylbutane
  3480. methylbenzene/ethanol/2-methyl-2-propanol
  3481. methylbenzene/ethanol/2-propanone
  3482. methylbenzene/ethanol/9H-carbazole
  3483. methylbenzene/ethanol/benzene
  3484. methylbenzene/ethanol/benzoic acid
  3485. methylbenzene/ethanol/copper chloride (CuCl2)
  3486. methylbenzene/ethanol/iodoethane
  3487. methylbenzene/ethanol/methanol
  3488. methylbenzene/ethanol/oxygen
  3489. methylbenzene/ethanol/sodium bromide (NaBr)
  3490. methylbenzene/ethanol/water
  3491. methylbenzene/ethylbenzenesulfonic acid sodium salt/water
  3492. methylbenzene/formic acid ethyl ester/2-butanone
  3493. methylbenzene/formic acid/water
  3494. methylbenzene/guanidine monohydrochloride/water
  3495. methylbenzene/heptane/ε-caprolactamium acetate
  3496. methylbenzene/heptane/γ-butyrolactamium acetate
  3497. methylbenzene/heptane/γ-Butyrolactamium butyrate
  3498. methylbenzene/heptane/(OC-6-11)-sulfur fluoride (SF6)
  3499. methylbenzene/heptane/1,1'-(1,3-propanediyl)bis(3-methyl-1H-imidazole) sulfate (1:2)
  3500. methylbenzene/heptane/1,1'-(1,6-hexanediyl)bis(3-methyl-1H-imidazole) sulfate (1:2)
  3501. methylbenzene/heptane/1,1'-(sulfinylbis(methylene)bisbenzene)
  3502. methylbenzene/heptane/1,1'-oxybisbutane
  3503. methylbenzene/heptane/1,1'-sulfinylbisbenzene
  3504. methylbenzene/heptane/1,1'-sulfinylbispentane
  3505. methylbenzene/heptane/1,1'-sulfonylbisethene
  3506. methylbenzene/heptane/1,1'-sulfonylbispropane
  3507. methylbenzene/heptane/1,2,3-propanetriol
  3508. methylbenzene/heptane/1,2-dimethyl-3-propyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3509. methylbenzene/heptane/1,2-dimethylbenzene
  3510. methylbenzene/heptane/1,3,2-dioxathiolane 2-oxide
  3511. methylbenzene/heptane/1,3-dimethyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3512. methylbenzene/heptane/1,3-dimethyl-1H-imidazolium salt with phosphoric acid dimethyl ester (1:1)
  3513. methylbenzene/heptane/1,3-dimethyl-1H-imidazolium salt with sulfuric acid monomethyl ester (1:1)
  3514. methylbenzene/heptane/1,3-dimethyl-2-imidazolidinone
  3515. methylbenzene/heptane/1,3-dioxolan-2-one
  3516. methylbenzene/heptane/1-(phenylmethyl)pyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3517. methylbenzene/heptane/1-allyl-3-methylimidazolium dicyanamide
  3518. methylbenzene/heptane/1-benzyl-3-methylimidazolium dicyanamide
  3519. methylbenzene/heptane/1-benzyl-3-vinylimidazolium bis(trifluoromethylsulfonyl)imide
  3520. methylbenzene/heptane/1-butyl-1-methylpyrrolidinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3521. methylbenzene/heptane/1-butyl-1-methylpyrrolidinium salt with trifluoromethanesulfonic acid (1:1)
  3522. methylbenzene/heptane/1-butyl-2,3-dimethyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3523. methylbenzene/heptane/1-butyl-2-methylpyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3524. methylbenzene/heptane/1-butyl-2-methylpyridinium tetrafluoroborate(1-)
  3525. methylbenzene/heptane/1-butyl-3-methyl-1H-imidazolium (T-4)-tetrachloroferrate(1-)
  3526. methylbenzene/heptane/1-butyl-3-methyl-1H-imidazolium hexafluorophosphate(1-)
  3527. methylbenzene/heptane/1-butyl-3-methyl-1H-imidazolium nitrate
  3528. methylbenzene/heptane/1-butyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3529. methylbenzene/heptane/1-butyl-3-methyl-1H-imidazolium salt with cyanocyanamide (1:1)
  3530. methylbenzene/heptane/1-butyl-3-methyl-1H-imidazolium salt with phosphoric acid dibutyl ester (1:1)
  3531. methylbenzene/heptane/1-butyl-3-methyl-1H-imidazolium salt with sulfuric acid methyl ester (1:1)
  3532. methylbenzene/heptane/1-butyl-3-methyl-1H-imidazolium salt with thiocyanic acid (1:1)
  3533. methylbenzene/heptane/1-butyl-3-methyl-1H-imidazolium salt with trifluoromethanesulfonic acid (1:1)
  3534. methylbenzene/heptane/1-butyl-3-methylimidazolium salt with sulfuric acid (1:1)
  3535. methylbenzene/heptane/1-butyl-3-methylpyridinium compd. with tricyanomethane
  3536. methylbenzene/heptane/1-butyl-3-methylpyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3537. methylbenzene/heptane/1-butyl-3-methylpyridinium salt with cyanocyanamide (1:1)
  3538. methylbenzene/heptane/1-butyl-3-methylpyridinium tetrafluoroborate(1-)
  3539. methylbenzene/heptane/1-butyl-3-methylpyridinium tetrakis(cyano-κC)borate(1-)
  3540. methylbenzene/heptane/1-butyl-4-methylpyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3541. methylbenzene/heptane/1-butyl-4-methylpyridinium tetrafluoroborate(1-)
  3542. methylbenzene/heptane/1-butyl-4-methylpyridinium tricyanomethanide
  3543. methylbenzene/heptane/1-butylpyridinium nitrate
  3544. methylbenzene/heptane/1-butylpyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3545. methylbenzene/heptane/1-butylpyridinium tetrafluoroborate(1-)
  3546. methylbenzene/heptane/1-butyltetrahydrothiophenium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3547. methylbenzene/heptane/1-ethyl-2,3-dimethyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3548. methylbenzene/heptane/1-ethyl-2-methylpyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3549. methylbenzene/heptane/1-ethyl-3-methyl-1H-imidazol-3-ium trifluorotris(1,1,2,2,2-pentafluoroethyl)phosphate(1-) (1:1)
  3550. methylbenzene/heptane/1-ethyl-3-methyl-1H-imidazolium (triiodide)
  3551. methylbenzene/heptane/1-ethyl-3-methyl-1H-imidazolium acetate
  3552. methylbenzene/heptane/1-ethyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3553. methylbenzene/heptane/1-ethyl-3-methyl-1H-imidazolium salt with 1,1,2,2-tetrafluoroethanesulfonic acid
  3554. methylbenzene/heptane/1-ethyl-3-methyl-1H-imidazolium salt with cyanocyanamide (1:1)
  3555. methylbenzene/heptane/1-ethyl-3-methyl-1H-imidazolium salt with methanesulfonic acid
  3556. methylbenzene/heptane/1-ethyl-3-methyl-1H-imidazolium salt with phosphoric acid diethyl ester (1:1)
  3557. methylbenzene/heptane/1-ethyl-3-methyl-1H-imidazolium salt with sulfuric acid (1:1)
  3558. methylbenzene/heptane/1-ethyl-3-methyl-1H-imidazolium salt with sulfuric acid monoethyl ester (1:1)
  3559. methylbenzene/heptane/1-ethyl-3-methyl-1H-imidazolium salt with sulfuric acid monomethyl ester (1:1)
  3560. methylbenzene/heptane/1-ethyl-3-methyl-1H-imidazolium salt with trifluoromethanesulfonic acid (1:1)
  3561. methylbenzene/heptane/1-ethyl-3-methyl-1H-imidazolium thiocyanate
  3562. methylbenzene/heptane/1-ethyl-3-methyl-1H-imidazolium tricyanomethanide
  3563. methylbenzene/heptane/1-ethyl-3-methylpyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3564. methylbenzene/heptane/1-ethyl-3-methylpyridinium salt with sulfuric acid ethyl ester
  3565. methylbenzene/heptane/1-ethyl-4-methylpyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3566. methylbenzene/heptane/1-ethylpyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3567. methylbenzene/heptane/1-heptene
  3568. methylbenzene/heptane/1-hexyl-3-methyl-1H-imidazolium hexafluorophosphate(1-)
  3569. methylbenzene/heptane/1-hexyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3570. methylbenzene/heptane/1-hexyl-3-methyl-1H-imidazolium salt with trifluoromethanesulfonic acid (1:1)
  3571. methylbenzene/heptane/1-hexyl-3-methylpyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3572. methylbenzene/heptane/1-methyl-1H-imidazole sulfate (1:1)
  3573. methylbenzene/heptane/1-methyl-2-pyrrolidinone
  3574. methylbenzene/heptane/1-methyl-3-(phenylmethyl)-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3575. methylbenzene/heptane/1-methyl-3-octyl-1H-imidazolium salt with nitric acid (1:1)
  3576. methylbenzene/heptane/1-methyl-3-octyl-1H-imidazolium tetrafluoroborate(1-)
  3577. methylbenzene/heptane/1-methyl-3-propyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3578. methylbenzene/heptane/1-methylimidazolium bis(trifluoromethylsulfonyl)imide
  3579. methylbenzene/heptane/2,2,4-trimethylpentane
  3580. methylbenzene/heptane/2-butanone
  3581. methylbenzene/heptane/2-ethoxy-2-methylpropane
  3582. methylbenzene/heptane/2-furancarboxaldehyde
  3583. methylbenzene/heptane/2-mercaptoethanol
  3584. methylbenzene/heptane/2-methyl-1-propanol
  3585. methylbenzene/heptane/2-pyrrolidinone
  3586. methylbenzene/heptane/3,3'-oxybispropanenitrile
  3587. methylbenzene/heptane/3-methyl-1-(2-propenyl)-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3588. methylbenzene/heptane/4-methyl-2-thiazolamine
  3589. methylbenzene/heptane/4-methyl-3-morpholinone
  3590. methylbenzene/heptane/4-morpholinecarboxaldehyde
  3591. methylbenzene/heptane/8-Ethyl-1,8-diazabicyclo[5.4.0]undec-7-ene hydroxyde
  3592. methylbenzene/heptane/acetic acid
  3593. methylbenzene/heptane/acetonitrile
  3594. methylbenzene/heptane/ammonia
  3595. methylbenzene/heptane/benzenamine
  3596. methylbenzene/heptane/benzene
  3597. methylbenzene/heptane/bitumen
  3598. methylbenzene/heptane/cyclooctane
  3599. methylbenzene/heptane/dihydro-2(3H)-furanone
  3600. methylbenzene/heptane/ethanol
  3601. methylbenzene/heptane/ethylimidazolium bis(trifluoromethanesulfonyl)amide
  3602. methylbenzene/heptane/heptene
  3603. methylbenzene/heptane/hexadecafluorooxonane
  3604. methylbenzene/heptane/hexafluorobenzene
  3605. methylbenzene/heptane/hydrochloric acid
  3606. methylbenzene/heptane/methanol
  3607. methylbenzene/heptane/N,N-dimethylformamide
  3608. methylbenzene/heptane/N-allyl-N-methylmorpholinium bis(trifluoromethylsulfonyl)imide
  3609. methylbenzene/heptane/N-benzyl-N-methylmorpholinium bis(trifluoromethylsulfonyl)imide
  3610. methylbenzene/heptane/N-hexylpyridinium nitrate
  3611. methylbenzene/heptane/nitromethane
  3612. methylbenzene/heptane/phenanthrene
  3613. methylbenzene/heptane/pregn-4-ene-3,20-dione
  3614. methylbenzene/heptane/sulfinylbismethane
  3615. methylbenzene/heptane/sulfur dioxide
  3616. methylbenzene/heptane/sulfuric acid dimethyl ester
  3617. methylbenzene/heptane/tetrachloromethane
  3618. methylbenzene/heptane/tetrahydro-3-methylthiophene 1,1-dioxide
  3619. methylbenzene/heptane/tetrahydrothiophene 1-oxide
  3620. methylbenzene/heptane/triethyloctylphosphonium bis(trifluoromethylsulfonyl)imide
  3621. methylbenzene/heptane/tris(2-hydroxyethyl)methylammonium salt with sulfic acid monomethyl ester (1:1)
  3622. methylbenzene/heptane/water
  3623. methylbenzene/hexadecafluorooxonane/N,N-dimethylformamide
  3624. methylbenzene/hexadecane/1,3-dimethyl-2-imidazolidinone
  3625. methylbenzene/hexadecane/1-methyl-2-pyrrolidinone
  3626. methylbenzene/hexadecane/2-furanmethanol
  3627. methylbenzene/hexadecane/acetonitrile
  3628. methylbenzene/hexadecane/naphthalene
  3629. methylbenzene/hexadecane/tetradecane
  3630. methylbenzene/hexadecane/water
  3631. methylbenzene/hexadecanoic acid 1,2,3-propanetriyl ester/hexadecanoic acid
  3632. methylbenzene/hexadecanoic acid methyl ester/water
  3633. methylbenzene/hexadecanoic acid/water
  3634. methylbenzene/hexane/1,2-benzenedicarboxylic acid dimethyl ester
  3635. methylbenzene/hexane/1,3-dimethyl-2-imidazolidinone
  3636. methylbenzene/hexane/1-butyl-3-methyl-1H-imidazolium hexafluorophosphate(1-)
  3637. methylbenzene/hexane/1-butyl-3-methyl-1H-imidazolium nitrate
  3638. methylbenzene/hexane/1-butyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3639. methylbenzene/hexane/1-butyl-3-methyl-1H-imidazolium salt with sulfuric acid methyl ester (1:1)
  3640. methylbenzene/hexane/1-butylpyridinium tetrafluoroborate(1-)
  3641. methylbenzene/hexane/1-ethyl-3-methyl-1H-imidazolium salt with cyanocyanamide (1:1)
  3642. methylbenzene/hexane/1-ethyl-3-methyl-1H-imidazolium salt with sulfuric acid monoethyl ester (1:1)
  3643. methylbenzene/hexane/1-ethyl-3-methyl-1H-imidazolium thiocyanate
  3644. methylbenzene/hexane/1-ethyl-3-methylpyridinium salt with sulfuric acid ethyl ester
  3645. methylbenzene/hexane/1-ethyl-4-methylpyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3646. methylbenzene/hexane/1-hexanol
  3647. methylbenzene/hexane/1-hexylpyridinium tetrafluoroborate(1-)
  3648. methylbenzene/hexane/1-methyl-2-pyrrolidinone
  3649. methylbenzene/hexane/1-methyl-3-octyl-1H-imidazolium salt with nitric acid (1:1)
  3650. methylbenzene/hexane/1-methyl-3-octyl-1H-imidazolium tetrafluoroborate(1-)
  3651. methylbenzene/hexane/2-Chloro-N-(4-methylphenyl)propanamide
  3652. methylbenzene/hexane/2-furancarboxaldehyde
  3653. methylbenzene/hexane/2-furancarboxylic acid
  3654. methylbenzene/hexane/2-furanmethanol
  3655. methylbenzene/hexane/2-methoxy-2-methylpropane
  3656. methylbenzene/hexane/2-methyl-1-butene
  3657. methylbenzene/hexane/2-methyl-2-butene
  3658. methylbenzene/hexane/2-methylbutane
  3659. methylbenzene/hexane/2-propanol
  3660. methylbenzene/hexane/2-propanone
  3661. methylbenzene/hexane/4-morpholinecarboxaldehyde
  3662. methylbenzene/hexane/anthracene
  3663. methylbenzene/hexane/benzene
  3664. methylbenzene/hexane/carbon dioxide
  3665. methylbenzene/hexane/cyclohexane
  3666. methylbenzene/hexane/dihydro-2(3H)-furanone
  3667. methylbenzene/hexane/ethanol
  3668. methylbenzene/hexane/heptane
  3669. methylbenzene/hexane/hexanedinitrile
  3670. methylbenzene/hexane/McKay River bitumen
  3671. methylbenzene/hexane/methanol
  3672. methylbenzene/hexane/N-methylformamide
  3673. methylbenzene/hexane/N-[3-[[2,6-bis(1-methylethyl)phenyl]amino]-1-methyl-2-butenylidene]-2,6-bis(1-methylethyl)-benzamine dimethylaluminium complex
  3674. methylbenzene/hexane/N-[3-[[2,6-bis(1-methylethyl)phenyl]amino]-1-methyl-2-butenylidene]-2,6-bis(1-methylethyl)-benzamine n-butylmagnesium complex
  3675. methylbenzene/hexane/naphthalene
  3676. methylbenzene/hexane/sulfinylbismethane
  3677. methylbenzene/hexane/tetrachloromethane
  3678. methylbenzene/hexane/tetrahydrothiophene 1,1-dioxide
  3679. methylbenzene/hexane/water
  3680. methylbenzene/hexanedinitrile/water
  3681. methylbenzene/hydrazine/water
  3682. methylbenzene/hydrochloric acid/(trifluoromethyl)benzene
  3683. methylbenzene/hydrochloric acid/1,2,4-trimethylbenzene
  3684. methylbenzene/hydrochloric acid/1,2-dimethylbenzene
  3685. methylbenzene/hydrogen/benzene
  3686. methylbenzene/hydrogen/carbon monoxide
  3687. methylbenzene/hydrogen/methane
  3688. methylbenzene/hydrogen/propane
  3689. methylbenzene/lithium (T-4)-tetrahydroaluminate(1-)/1,1'-oxybisethane
  3690. methylbenzene/lithium bromide (LiBr)/aluminum bromide (AlBr3)
  3691. methylbenzene/lithium chloride (LiCl)/water
  3692. methylbenzene/lithium tetrahydroborate(1-)/1,1'-oxybisethane
  3693. methylbenzene/methane/hydrogen sulfide (H2S)
  3694. methylbenzene/methane/phenanthrene
  3695. methylbenzene/methane/propane
  3696. methylbenzene/methane/water
  3697. methylbenzene/methanol/1-butylpyridinium bromide
  3698. methylbenzene/methanol/1-Decyl-3-methylimidazolium acetate
  3699. methylbenzene/methanol/1-methyl-2-nitrobenzene
  3700. methylbenzene/methanol/1-Tetradecyl-3-methylimidazolium acetate
  3701. methylbenzene/methanol/9H-carbazole
  3702. methylbenzene/methanol/acetic acid ethenyl ester homopolymer
  3703. methylbenzene/methanol/acetonitrile
  3704. methylbenzene/methanol/aliquat acetate
  3705. methylbenzene/methanol/benzene
  3706. methylbenzene/methanol/cesium chloride (CsCl)
  3707. methylbenzene/methanol/iodoethane
  3708. methylbenzene/methanol/methane
  3709. methylbenzene/methanol/nitric acid potassium salt
  3710. methylbenzene/methanol/nitrobenzene
  3711. methylbenzene/methanol/potassium bromide (KBr)
  3712. methylbenzene/methanol/potassium chloride (KCl)
  3713. methylbenzene/methanol/pyrazinecarboxamide
  3714. methylbenzene/methanol/sodium bromide (NaBr)
  3715. methylbenzene/methanol/sodium chloride (NaCl)
  3716. methylbenzene/methanol/water
  3717. methylbenzene/methoxyethene homopolymer/poly(1-phenylethylene)
  3718. methylbenzene/methyl 2-(2-aminophenyl)acetate hydrochloride/methanol
  3719. methylbenzene/methyltriphenylphosphonium bromide/acetic acid
  3720. methylbenzene/Montmorillonite ((Al1.33-1.67Mg0.33-0.67)(Ca0-1Na0-1)0.33Si4(OH)2O10*xH2O)/water
  3721. methylbenzene/morpholine/1,4-dioxane
  3722. methylbenzene/morpholine/water
  3723. methylbenzene/N,N,N-tributyl-1-butanaminium bromide/(trifluoromethyl)benzene
  3724. methylbenzene/N,N,N-tributyl-1-butanaminium bromide/water
  3725. methylbenzene/N,N,N-tributyl-1-butanaminium hydroxide/water
  3726. methylbenzene/N,N,N-tributyl-1-butanaminium iodide/acetonitrile
  3727. methylbenzene/N,N,N-tributyl-1-butanaminium tetraphenylborate(1-)/methanol
  3728. methylbenzene/N,N,N-triethyl-1-butanaminium iodide/acetonitrile
  3729. methylbenzene/N,N,N-triethyl-2-butanaminium iodide/acetonitrile
  3730. methylbenzene/N,N,N-triethyl-2-methyl-1-propanaminium iodide/acetonitrile
  3731. methylbenzene/N,N,N-triethyl-2-methyl-2-propanaminium iodide/acetonitrile
  3732. methylbenzene/N,N,N-triethylbenzenemethanaminium bromide/water
  3733. methylbenzene/N,N,N-triethylethanaminium bromide/water
  3734. methylbenzene/N,N,N-trimethyl-1-dodecanaminium chloride/water
  3735. methylbenzene/N,N,N-trimethyl-1-hexadecanaminium bromide/water
  3736. methylbenzene/N,N,N-trimethyl-1-hexadecanaminium chloride/water
  3737. methylbenzene/N,N,N-tripropyl-1-propanaminium bromide/1,6-hexanediol
  3738. methylbenzene/N,N,N-tripropyl-1-propanaminium bromide/acetic acid
  3739. methylbenzene/N,N,N-tripropyl-1-propanaminium bromide/acetonitrile
  3740. methylbenzene/N,N,N-tripropyl-1-propanaminium iodide/acetonitrile
  3741. methylbenzene/N,N-diethylethanamine/acetic acid
  3742. methylbenzene/N,N-dimethylformamide/1-(4-bromo-3,5-difluorophenyl)-1H-pyrrole-2,5-dione
  3743. methylbenzene/N,N-dimethylformamide/perchloric acid potassium salt
  3744. methylbenzene/N,N-dimethylformamide/water
  3745. methylbenzene/N,N-dioctyl-1-octanamine/propanoic acid
  3746. methylbenzene/N,N-dioctyl-1-octanamine/water
  3747. methylbenzene/N-(1,1-dimethyl-3-oxobutyl)-2-propenamide/water
  3748. methylbenzene/N-dodecyl-N,N-dimethylbenzenemethanaminium nitrate/N,N-dimethyl-N-tetradecylbenzenemethanaminium nitrate
  3749. methylbenzene/N-ethylethanamine/water
  3750. methylbenzene/N-methyl-N,N-dioctyl-1-octanaminium chloride/water
  3751. methylbenzene/N-methylformamide/heptane
  3752. methylbenzene/N-methylmethanamine/water
  3753. methylbenzene/nitrogen/oxygen
  3754. methylbenzene/nitromethane/1,2-dichloro-1,1,2,2-tetrafluoroethane
  3755. methylbenzene/nitromethane/dichlorodifluoromethane
  3756. methylbenzene/nonane/1-butyl-3-methyl-1H-imidazolium hexafluorophosphate(1-)
  3757. methylbenzene/nonane/1-butyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3758. methylbenzene/nonane/1-butyl-3-methyl-1H-imidazolium salt with sulfuric acid methyl ester (1:1)
  3759. methylbenzene/nonane/1-ethyl-3-methyl-1H-imidazolium salt with sulfuric acid monoethyl ester (1:1)
  3760. methylbenzene/nonane/1-ethyl-3-methylpyridinium salt with sulfuric acid ethyl ester
  3761. methylbenzene/nonane/1-methyl-2-pyrrolidinone
  3762. methylbenzene/nonane/1-methyl-3-octyl-1H-imidazolium hexafluorophosphate(1-)
  3763. methylbenzene/nonane/1-methyl-3-propyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3764. methylbenzene/nonane/4-morpholinecarboxaldehyde
  3765. methylbenzene/nonane/cyclooctane
  3766. methylbenzene/nonane/methanol
  3767. methylbenzene/nonane/tetrahydrothiophene 1,1-dioxide
  3768. methylbenzene/octadecanoic acid butyl ester/poly(1-phenylethylene)
  3769. methylbenzene/octane/1,3-dimethyl-2-imidazolidinone
  3770. methylbenzene/octane/1,3-dioxolan-2-one
  3771. methylbenzene/octane/1-butyl-3-methyl-1H-imidazolium nitrate
  3772. methylbenzene/octane/1-butyl-4-methylpyridinium tricyanomethanide
  3773. methylbenzene/octane/1-butylpyridinium nitrate
  3774. methylbenzene/octane/1-ethyl-3-methyl-1H-imidazolium salt with cyanocyanamide (1:1)
  3775. methylbenzene/octane/1-ethyl-3-methyl-1H-imidazolium salt with sulfuric acid monoethyl ester (1:1)
  3776. methylbenzene/octane/1-ethyl-3-methyl-1H-imidazolium tricyanomethanide
  3777. methylbenzene/octane/1-ethyl-3-methylpyridinium salt with sulfuric acid ethyl ester
  3778. methylbenzene/octane/1-ethyl-4-methylpyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3779. methylbenzene/octane/1-methyl-3-octyl-1H-imidazolium salt with nitric acid (1:1)
  3780. methylbenzene/octane/anthracene
  3781. methylbenzene/octane/benzene
  3782. methylbenzene/octane/ethylcyclohexane
  3783. methylbenzene/octane/hexadecane
  3784. methylbenzene/octane/methanol
  3785. methylbenzene/octane/N-hexylpyridinium nitrate
  3786. methylbenzene/octane/sulfinylbismethane
  3787. methylbenzene/octane/tetradecane
  3788. methylbenzene/octane/tetrahydrothiophene 1,1-dioxide
  3789. methylbenzene/octanoic acid sodium salt/water
  3790. methylbenzene/oxybis(methoxymethane)/water
  3791. methylbenzene/pentanal/1-octene
  3792. methylbenzene/pentane/2-propanol
  3793. methylbenzene/pentane/benzene
  3794. methylbenzene/pentane/cyclohexane
  3795. methylbenzene/pentane/tetrahydrothiophene 1,1-dioxide
  3796. methylbenzene/phenanthrene/9H-carbazole
  3797. methylbenzene/phenol/1,2-butanediol
  3798. methylbenzene/phenol/1,2-propanediol
  3799. methylbenzene/phenol/2,2'-oxybisethanol
  3800. methylbenzene/phenol/2,2,4-trimethylpentane
  3801. methylbenzene/phenol/2,2,5-trimethylhexane
  3802. methylbenzene/phenol/2-hydroxy-N,N,N-trimethylethanaminium chloride
  3803. methylbenzene/phenol/2-propanone
  3804. methylbenzene/phenol/3-hydroxy-4-trimethylazaniumylbutanoate
  3805. methylbenzene/phenol/9H-carbazole
  3806. methylbenzene/phenol/anthracene
  3807. methylbenzene/phenol/benzenamine
  3808. methylbenzene/phenol/dodecane
  3809. methylbenzene/phenol/heptane
  3810. methylbenzene/phenol/N,N,N-triethylethanaminium chloride
  3811. methylbenzene/phenol/N,N,N-trimethylmethanaminium chloride
  3812. methylbenzene/phenol/water
  3813. methylbenzene/phosphoric acid bis(2-ethylhexyl) ester/alamine 336
  3814. methylbenzene/phosphoric acid bis(2-ethylhexyl) ester/benzene
  3815. methylbenzene/phosphoric acid bis(2-ethylhexyl) ester/Europium di(2-ethylhexyl)phosphate
  3816. methylbenzene/phosphoric acid bis(2-ethylhexyl) ester/Gadolinium di(2-ethylhexyl)phosphate
  3817. methylbenzene/phosphoric acid bis(2-ethylhexyl) ester/Samarium di(2-ethylhexyl)phosphate
  3818. methylbenzene/phosphoric acid tributyl ester/benzene
  3819. methylbenzene/phosphoric acid tributyl ester/water
  3820. methylbenzene/phosphoric acid/water
  3821. methylbenzene/picene/water
  3822. methylbenzene/poly(1-phenylethylene)/2-methyl-2-propenoic acid methyl ester homopolymer
  3823. methylbenzene/poly(dimethylsiloxane)/ethanol
  3824. methylbenzene/potassium chloride (KCl)/water
  3825. methylbenzene/potassium iodide (KI)/water
  3826. methylbenzene/propanal/water
  3827. methylbenzene/propanedioic acid/2-hydroxy-N,N,N-trimethylethanaminium chloride
  3828. methylbenzene/propanoic acid methyl ester/benzene
  3829. methylbenzene/pyrene/2,2,4-trimethylpentane
  3830. methylbenzene/pyrene/2-propanol
  3831. methylbenzene/pyrene/ethanol
  3832. methylbenzene/pyrene/heptane
  3833. methylbenzene/pyrene/methanol
  3834. methylbenzene/pyridine/1-butanol
  3835. methylbenzene/pyridine/1-butyl-3-methyl-1H-imidazolium salt with perchloric acid (1:1)
  3836. methylbenzene/pyridine/1-butyl-3-methylimidazolium dihydrogenphosphate
  3837. methylbenzene/pyridine/1-butyl-3-methylimidazolium salt with sulfuric acid (1:1)
  3838. methylbenzene/pyridine/1-hexyl-3,5-dimethylpyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3839. methylbenzene/pyridine/1-methyl-3-(phenylmethyl)-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3840. methylbenzene/pyridine/2-butanone
  3841. methylbenzene/pyridine/2-propanone
  3842. methylbenzene/pyridine/3-methyl-1-butanol
  3843. methylbenzene/pyridine/3-methyl-1-pentyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3844. methylbenzene/pyridine/9H-carbazole
  3845. methylbenzene/pyridine/anthracene
  3846. methylbenzene/pyridine/copper chloride (CuCl2)
  3847. methylbenzene/pyridine/nitrobenzene
  3848. methylbenzene/pyridine/water
  3849. methylbenzene/quaternary ammonium compounds, tri-C8-10-alkylmethyl, chlorides/water
  3850. methylbenzene/sodium (T-4)-tetraethylaluminate(1-)/1,1'-oxybisethane
  3851. methylbenzene/sodium bromide (NaBr)/aluminum bromide (AlBr3)
  3852. methylbenzene/sodium bromide (NaBr)/water
  3853. methylbenzene/sodium chloride (NaCl)/water
  3854. methylbenzene/Sodium cyclohexanecarboxylate/water
  3855. methylbenzene/sodium tetrahydroborate(1-)/1,4,7,10,13-pentaoxacyclopentadecane
  3856. methylbenzene/sodium tetraphenylborate(1-)/acetonitrile
  3857. methylbenzene/sulfinylbismethane/potassium iodide (KI)
  3858. methylbenzene/sulfinylbismethane/water
  3859. methylbenzene/sulfobutanedioic acid 1,4-dibutyl ester/water
  3860. methylbenzene/sulfobutanedioic acid 1,4-didecyl ester/water
  3861. methylbenzene/sulfobutanedioic acid 1,4-dihexyl ester/water
  3862. methylbenzene/sulfobutanedioic acid 1,4-dioctyl ester/water
  3863. methylbenzene/sulfuric acid magnesium salt (1:1)/water
  3864. methylbenzene/sulfuric acid mono(2-butoxyethyl) ester sodium salt/water
  3865. methylbenzene/sulfuric acid monododecyl ester sodium salt/water
  3866. methylbenzene/sulfuric acid/water
  3867. methylbenzene/tetrachloroethene/hydrochloric acid
  3868. methylbenzene/tetrachloromethane/(5,6)fullerene-C60-Ih
  3869. methylbenzene/tetrachloromethane/2-propanol
  3870. methylbenzene/tetrachloromethane/9H-carbazole
  3871. methylbenzene/tetrachloromethane/benzene
  3872. methylbenzene/tetrachloromethane/ethanol
  3873. methylbenzene/tetrachloromethane/iodine
  3874. methylbenzene/tetrachloromethane/naphthalene
  3875. methylbenzene/tetrachloromethane/sulfinylbismethane
  3876. methylbenzene/tetrachloromethane/trichloromethane
  3877. methylbenzene/tetradecane/1,3-dimethyl-2-imidazolidinone
  3878. methylbenzene/tetradecane/1-methyl-2-pyrrolidinone
  3879. methylbenzene/tetradecane/benzene
  3880. methylbenzene/tetrahydro-2H-pyran/1,2-dimethylbenzene
  3881. methylbenzene/tetrahydro-2H-pyran/1-chloro-2-methylbenzene
  3882. methylbenzene/tetrahydro-2H-pyran/2-methylbenzenamine
  3883. methylbenzene/tetrahydro-2H-pyran/benzene
  3884. methylbenzene/tetrahydrofuran/1,1'-oxybisethane
  3885. methylbenzene/tetrahydrofuran/2-methylbutane
  3886. methylbenzene/tetrahydrofuran/8-chloro-11-(4-methyl-1-piperazinyl)-5H-dibenzo[b,e][1,4]diazepine
  3887. methylbenzene/tetrahydrofuran/acetonitrile
  3888. methylbenzene/tetrahydrofuran/ethanol
  3889. methylbenzene/tetrahydrofuran/methanol
  3890. methylbenzene/tetrahydrofuran/sodium (T-4)-tetrahydroaluminate(1-)
  3891. methylbenzene/tetrahydrofuran/water
  3892. methylbenzene/tetrahydrothiophene 1,1-dioxide/1-heptene
  3893. methylbenzene/tetrahydrothiophene 1,1-dioxide/1-hexene
  3894. methylbenzene/tetrahydrothiophene 1,1-dioxide/1-methyl-2-pyrrolidinone
  3895. methylbenzene/tetrahydrothiophene 1,1-dioxide/2,3-dimethylpentane
  3896. methylbenzene/tetrahydrothiophene 1,1-dioxide/2-mercaptoethanol
  3897. methylbenzene/tetrahydrothiophene 1,1-dioxide/cis-1,2-dimethylcyclohexane
  3898. methylbenzene/tetrahydrothiophene 1,1-dioxide/heptane
  3899. methylbenzene/tetrahydrothiophene 1,1-dioxide/potassium iodide (KI)
  3900. methylbenzene/tetrahydrothiophene 1,1-dioxide/sodium iodide (NaI)
  3901. methylbenzene/tetrahydrothiophene 1,1-dioxide/tetrahydro-3-methylthiophene 1,1-dioxide
  3902. methylbenzene/tetrahydrothiophene 1,1-dioxide/thiocyanic acid potassium salt
  3903. methylbenzene/tetrahydrothiophene 1,1-dioxide/water
  3904. methylbenzene/thiocyanic acid compd. with 4,4'-methylenebis(1,2-dihydro-1,5-dimethyl-2-phenyl-3H-pyrazol-3-one) (2:1)/nitrobenzene
  3905. methylbenzene/thiocyanic acid compd. with 4,4'-methylenebis(1,2-dihydro-1,5-dimethyl-2-phenyl-3H-pyrazol-3-one) (2:1)/trichloromethane
  3906. methylbenzene/thiocyanic acid potassium salt/ethanol
  3907. methylbenzene/thiophene/1-ethyl-3-methyl-1H-imidazolium acetate
  3908. methylbenzene/thiophene/1-ethyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3909. methylbenzene/thiophene/1-ethyl-3-methyl-1H-imidazolium salt with phosphoric acid diethyl ester (1:1)
  3910. methylbenzene/thiophene/1-ethyl-3-methyl-1H-imidazolium salt with sulfuric acid monoethyl ester (1:1)
  3911. methylbenzene/thiophene/1-hexyl-2,4-dimethylpyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3912. methylbenzene/thiophene/1-hexyl-3,5-dimethylpyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3913. methylbenzene/thiophene/1-methyl-3-(phenylmethyl)-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3914. methylbenzene/thiophene/1-methyl-3-octyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3915. methylbenzene/thiophene/1-methyl-3-octyl-1H-imidazolium tetrafluoroborate(1-)
  3916. methylbenzene/thiophene/3-methyl-1-pentyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  3917. methylbenzene/thiophene/hydrochloric acid
  3918. methylbenzene/tributylhexadecylphosphonium bromide/water
  3919. methylbenzene/trichloromethane/2-methyl-1-propanol
  3920. methylbenzene/trichloromethane/water
  3921. methylbenzene/tricosane/2-propanone
  3922. methylbenzene/tricosane/nitroethane
  3923. methylbenzene/trimethylene glycol dimethyl ether/water
  3924. methylbenzene/triphenyl(phenylmethyl)phosphonium chloride/methanol
  3925. methylbenzene/undecane/1-butyl-3-methyl-1H-imidazolium hexafluorophosphate(1-)
  3926. methylbenzene/undecane/1-methyl-3-octyl-1H-imidazolium hexafluorophosphate(1-)
  3927. methylbenzene/undecane/carbon dioxide
  3928. methylbenzene/urea/2-hydroxy-N,N,N-trimethylethanaminium chloride
  3929. methylbenzene/urea/water
  3930. methylbenzene/water/α-D-glucopyranosyl α-D-glucopyranoside
  3931. methylbenzene/water/ω-hydroxy-α-(4-(1,1,3,3-tetramethylbutyl)phenyl)poly(oxy-1,2-ethanediyl)
  3932. methylbenzene/water/1-hexyl-3-methyl-1H-imidazolium acetate
  3933. methylbenzene/water/1-methyl-2-pyrrolidinone
  3934. methylbenzene/water/1-naphthalenol
  3935. methylbenzene/water/2,4-dimethylbenzenesulfonic acid sodium salt
  3936. methylbenzene/water/2-(2-aminoethoxy)ethanol
  3937. methylbenzene/water/2-butanol
  3938. methylbenzene/water/2-butanone
  3939. methylbenzene/water/2-furancarboxaldehyde
  3940. methylbenzene/water/2-hydroxy-3,5-bis(1-methylethyl)benzoic acid monosodium salt
  3941. methylbenzene/water/2-methoxy-2-methylbutane
  3942. methylbenzene/water/2-methyl-1-propanol
  3943. methylbenzene/water/2-methyl-2-propenoic acid methyl ester
  3944. methylbenzene/water/2-methylphenol
  3945. methylbenzene/water/2-methylpropanal
  3946. methylbenzene/water/2-propenamide
  3947. methylbenzene/water/2-propenoic acid
  3948. methylbenzene/water/3-buten-2-one
  3949. methylbenzene/water/9H-carbazole
  3950. methylbenzene/water/acetic acid methyl ester
  3951. methylbenzene/water/asphaltenes (petroleum)
  3952. methylbenzene/water/athabasca bitumen
  3953. methylbenzene/water/cesium bromide (CsBr)
  3954. methylbenzene/water/crude Oil
  3955. methylbenzene/water/lecithin
  3956. methylbenzene/water/magnesium chloride (MgCl2)
  3957. methylbenzene/water/N,N-dimethylcyclohexanamine
  3958. methylbenzene/water/naphthalene
  3959. methylbenzene/water/nitric acid potassium salt
  3960. methylbenzene/water/nitric acid silver(1+) salt
  3961. methylbenzene/water/perchloric acid silver(1+) salt
  3962. methylbenzene/water/phenanthrene
  3963. methylbenzene/water/potassium bromide (KBr)
  3964. methylbenzene/water/potassium fluoride (KF)
  3965. methylbenzene/water/propanoic acid
  3966. methylbenzene/water/sulfobutanedioic acid 1,4-bis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl) ester
  3967. methylbenzene/water/sulfobutanedioic acid 1,4-bis(2,2,3,3,4,4,5,5-octafluoropentyl) ester
  3968. methylbenzene/water/sulfobutanedioic acid 1,4-bis(2,2,3,3-tetrafluoropropyl) ester
  3969. methylbenzene/water/sulfuric acid copper(2+) salt (1:1)
  3970. methylbenzene/water/sulfuric acid diammonium salt
  3971. methylbenzene/water/sulfuric acid dipotassium salt
  3972. methylbenzene/water/sulfuric acid disodium salt
  3973. methylbenzene/water/sulfuric acid zinc salt (1:1)
  3974. methylbenzene/water/tetramethylene glycoldimethyl ether
  3975. methylbenzene/zinc chloride (ZnCl2)/phosphoric acid
  3976. methylcyclohexane/1,1'-oxybis(2-methoxyethane)/anthracene
  3977. methylcyclohexane/1,1'-oxybisbutane/1-butanol
  3978. methylcyclohexane/1,1'-oxybisbutane/1-propanol
  3979. methylcyclohexane/1,1'-oxybisbutane/9H-carbazole
  3980. methylcyclohexane/1,1'-thiobisethane/2,2,4-trimethylpentane
  3981. methylcyclohexane/1,1,1,2,2,3,3,4,4-nonafluoro-4-methoxybutane/2-(difluoromethoxymethyl)-1,1,1,2,3,3,3-heptafluoropropane
  3982. methylcyclohexane/1,2,3-propanetriol/1-ethyl-1-methylpyrrolidin-1-ium bromide
  3983. methylcyclohexane/1,2-benzenedicarboxylic acid dinonyl ester/1,3,5-trinitrobenzene
  3984. methylcyclohexane/1,2-ethanediol diacetate/poly(1-phenylethylene)
  3985. methylcyclohexane/1,3-propanediol ester with 2,3,5,6-tetrachloro-1,4-benzenedicarboxylic acid monopropyl ester (1:2)/2,3,5,6-tetrachloro-1,4-benzenedicarboxylic acid ester with 3-((4-(propoxycarbonyl)-2,3,5,6-tetrachlorobenzoyl)oxy)-1-propanol (1:2)
  3986. methylcyclohexane/1,4-dichlorobutane/anthracene
  3987. methylcyclohexane/1,4-dichlorobutane/pyrene
  3988. methylcyclohexane/1,6-hexanediol/1-ethyl-1-methylpyrrolidin-1-ium bromide
  3989. methylcyclohexane/1-bromobutane/nitrobenzene
  3990. methylcyclohexane/1-butanol/acetonitrile
  3991. methylcyclohexane/1-butyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)/benzene
  3992. methylcyclohexane/1-butyl-3-methyl-1H-imidazolium salt with sulfuric acid methyl ester (1:1)/benzene
  3993. methylcyclohexane/1-chlorobutane/anthracene
  3994. methylcyclohexane/1-chlorobutane/heptane
  3995. methylcyclohexane/1-chlorooctane/anthracene
  3996. methylcyclohexane/1-dodecyl-3-methyl-1H-imidazolium chloride/1-butyl-3-methyl-1H-imidazolium chloride
  3997. methylcyclohexane/1-ethyl-3-methyl-1H-imidazolium salt with cyanocyanamide (1:1)/benzene
  3998. methylcyclohexane/1-ethyl-3-methyl-1H-imidazolium salt with sulfuric acid monoethyl ester (1:1)/benzene
  3999. methylcyclohexane/1-ethyl-3-methyl-1H-imidazolium thiocyanate/benzene
  4000. methylcyclohexane/1-heptanol/tetrachloroethene
  4001. methylcyclohexane/1-heptanol/trichloroethene
  4002. methylcyclohexane/1-heptanol/water
  4003. methylcyclohexane/1-methyl-3-propyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)/benzene
  4004. methylcyclohexane/1-octanol/anthracene
  4005. methylcyclohexane/1-octanol/pyrene
  4006. methylcyclohexane/1-pentene/2-furancarboxaldehyde
  4007. methylcyclohexane/1-propanol/acetonitrile
  4008. methylcyclohexane/2,2'-(1,2-ethanediylbis(oxy))bisethanol/1-ethyl-1-methylpyrrolidin-1-ium bromide
  4009. methylcyclohexane/2,2'-(1,2-ethanediylbis(oxy))bisethanol/tetrahydrothiophene 1,1-dioxide
  4010. methylcyclohexane/2,2'-oxybisethanol/1,2-benzenedicarboxylic acid diethyl ester
  4011. methylcyclohexane/2,2'-oxybisethanol/1-ethyl-1-methylpyrrolidin-1-ium bromide
  4012. methylcyclohexane/2,2'-oxybisethanol/water
  4013. methylcyclohexane/2,2,4,4,6,8,8-heptamethylnonane/cis-decahydronaphthalene
  4014. methylcyclohexane/2,2,4-trimethylpentane/2-ethoxy-2-methylpropane
  4015. methylcyclohexane/2,2,4-trimethylpentane/2-methyl-2-propanol
  4016. methylcyclohexane/2,2,4-trimethylpentane/methanol
  4017. methylcyclohexane/2,2,4-trimethylpentane/tetrahydro-2-methylfuran
  4018. methylcyclohexane/2,6,10,15,19,23-hexamethyltetracosane/fluoranthene
  4019. methylcyclohexane/2-(1-methylethoxy)ethanol/anthracene
  4020. methylcyclohexane/2-(2-ethoxyethoxy)ethanol/1-hexene
  4021. methylcyclohexane/2-(acetyloxy)benzoic acid/1-propanol
  4022. methylcyclohexane/2-(acetyloxy)benzoic acid/2-propanone
  4023. methylcyclohexane/2-(acetyloxy)benzoic acid/ethanol
  4024. methylcyclohexane/2-butoxyethanol/anthracene
  4025. methylcyclohexane/2-ethoxyethanol/anthracene
  4026. methylcyclohexane/2-ethoxyethanol/hydrochloric acid
  4027. methylcyclohexane/2-methoxy-2-methylpropane/methanol
  4028. methylcyclohexane/2-methoxybenzenamine/1,2-dimethylbenzene
  4029. methylcyclohexane/2-methyl-2-butanol/water
  4030. methylcyclohexane/2-methylpyrazine/water
  4031. methylcyclohexane/2-methylpyridine/2,2'-(1,2-ethanediylbis(oxy))bisethanol
  4032. methylcyclohexane/2-methylpyridine/water
  4033. methylcyclohexane/2-propanol/acetonitrile
  4034. methylcyclohexane/2-propanol/benzene
  4035. methylcyclohexane/2-propanone/water
  4036. methylcyclohexane/3-iodo-1-propene/3-pentanone
  4037. methylcyclohexane/4-ethoxybenzenamine/1,1'-biphenyl
  4038. methylcyclohexane/4-ethoxybenzenamine/1,2-dimethylbenzene
  4039. methylcyclohexane/4-ethoxybenzenamine/benzene
  4040. methylcyclohexane/4-ethoxybenzenamine/naphthalene
  4041. methylcyclohexane/4-morpholinecarboxaldehyde/benzene
  4042. methylcyclohexane/acetic acid ethyl ester/2-(acetyloxy)benzoic acid
  4043. methylcyclohexane/acetic acid/water
  4044. methylcyclohexane/acetonitrile/2-butanol
  4045. methylcyclohexane/air/undecafluoro(trifluoromethyl)cyclohexane
  4046. methylcyclohexane/anthracene/1,1'-oxybisbutane
  4047. methylcyclohexane/anthracene/1,4-dioxane
  4048. methylcyclohexane/anthracene/1-butanol
  4049. methylcyclohexane/anthracene/1-pentanol
  4050. methylcyclohexane/anthracene/1-propanol
  4051. methylcyclohexane/anthracene/2-butanol
  4052. methylcyclohexane/anthracene/2-methoxy-2-methylpropane
  4053. methylcyclohexane/anthracene/2-methyl-1-propanol
  4054. methylcyclohexane/anthracene/2-methyl-2-propanol
  4055. methylcyclohexane/anthracene/2-propanol
  4056. methylcyclohexane/anthracene/2-propoxyethanol
  4057. methylcyclohexane/anthracene/3-methoxy-1-butanol
  4058. methylcyclohexane/anthracene/3-methyl-1-butanol
  4059. methylcyclohexane/anthracene/acetic acid butyl ester
  4060. methylcyclohexane/anthracene/acetic acid ethyl ester
  4061. methylcyclohexane/anthracene/benzene
  4062. methylcyclohexane/anthracene/chlorocyclohexane
  4063. methylcyclohexane/anthracene/ethanedioic acid dibutyl ester
  4064. methylcyclohexane/anthracene/ethanol
  4065. methylcyclohexane/anthracene/hexanedioic acid diethyl ester
  4066. methylcyclohexane/anthracene/hexanedioic acid dimethyl ester
  4067. methylcyclohexane/anthracene/tetrachloromethane
  4068. methylcyclohexane/anthracene/tetrahydro-2H-pyran
  4069. methylcyclohexane/benzenamine/1,2-dimethylbenzene
  4070. methylcyclohexane/benzenamine/benzene
  4071. methylcyclohexane/benzenamine/water
  4072. methylcyclohexane/benzene/1-ethyl-3-methylpyridinium salt with sulfuric acid ethyl ester
  4073. methylcyclohexane/benzene/1-ethylpyridinium ethylsulfate
  4074. methylcyclohexane/benzene/1-methyl-3-octyl-1H-imidazolium thiocyanate
  4075. methylcyclohexane/benzene/2-methoxybenzenamine
  4076. methylcyclohexane/benzene/2-methyl-2-propanol
  4077. methylcyclohexane/benzene/acetonitrile
  4078. methylcyclohexane/butanenitrile/hexadecafluorooxonane
  4079. methylcyclohexane/carbon dioxide/hydrogen
  4080. methylcyclohexane/carbon dioxide/methane
  4081. methylcyclohexane/carbon dioxide/poly(1-phenylethylene)
  4082. methylcyclohexane/carbon dioxide/water
  4083. methylcyclohexane/chlorobenzene/acetonitrile
  4084. methylcyclohexane/cyclohexanamine/benzenamine
  4085. methylcyclohexane/cyclohexanamine/water
  4086. methylcyclohexane/cyclohexane/9H-carbazole
  4087. methylcyclohexane/cyclohexane/acetonitrile
  4088. methylcyclohexane/cyclohexane/benzene
  4089. methylcyclohexane/cyclohexane/heptane
  4090. methylcyclohexane/cyclohexane/hydrogen
  4091. methylcyclohexane/cyclohexane/methylcyclopentane
  4092. methylcyclohexane/cyclohexane/octane
  4093. methylcyclohexane/cyclohexane/poly(1-phenylethylene)
  4094. methylcyclohexane/cyclohexane/thianthrene
  4095. methylcyclohexane/cyclohexanol/(1S,5R)-6,8-Dioxabicyclo(3.2.1)octan-4-one
  4096. methylcyclohexane/cyclohexanone/(1S,5R)-6,8-Dioxabicyclo(3.2.1)octan-4-one
  4097. methylcyclohexane/cyclopentanone/water
  4098. methylcyclohexane/cyclopropanemethanol/(3aR,4S,7R,7aS)-rel-octahydro-4,7-methano-1H-indene
  4099. methylcyclohexane/decahydronaphthalene/cyclopentanol
  4100. methylcyclohexane/diphenylethanedione/1,1'-oxybisbutane
  4101. methylcyclohexane/diphenylethanedione/2-methoxy-2-methylpropane
  4102. methylcyclohexane/diphenylethanedione/cyclooctane
  4103. methylcyclohexane/ethane/water
  4104. methylcyclohexane/ethanol/2-methoxy-2-methylbutane
  4105. methylcyclohexane/ethanol/2-methyl-2-propanol
  4106. methylcyclohexane/ethanol/3-methylpentane
  4107. methylcyclohexane/ethanol/acetonitrile
  4108. methylcyclohexane/ethanol/benzene
  4109. methylcyclohexane/ethanol/methanol
  4110. methylcyclohexane/ethanol/water
  4111. methylcyclohexane/fluoromethane/water
  4112. methylcyclohexane/heptane/(OC-6-11)-sulfur fluoride (SF6)
  4113. methylcyclohexane/heptane/1-methylnaphthalene
  4114. methylcyclohexane/heptane/2-chlorbutane
  4115. methylcyclohexane/heptane/2-chloro-2-methylpropane
  4116. methylcyclohexane/heptane/2-furancarboxaldehyde
  4117. methylcyclohexane/heptane/2-propanone
  4118. methylcyclohexane/heptane/benzenamine
  4119. methylcyclohexane/heptane/nitrogen
  4120. methylcyclohexane/heptane/tetrahydro-2-methylfuran
  4121. methylcyclohexane/hexadecane/(1,1-dimethylethyl)benzene
  4122. methylcyclohexane/hexafluorobenzene/benzene
  4123. methylcyclohexane/hexane/cyclohexane
  4124. methylcyclohexane/hexane/methanol
  4125. methylcyclohexane/hydrogen/benzene
  4126. methylcyclohexane/hydrogen/methane
  4127. methylcyclohexane/hydrogen/water
  4128. methylcyclohexane/krypton/water
  4129. methylcyclohexane/methane/hydrogen sulfide (H2S)
  4130. methylcyclohexane/methane/methylcyclopentane
  4131. methylcyclohexane/methane/water
  4132. methylcyclohexane/methanol/1-butanol
  4133. methylcyclohexane/methanol/1-propanol
  4134. methylcyclohexane/methanol/2-butanol
  4135. methylcyclohexane/methanol/2-methoxy-2-methylbutane
  4136. methylcyclohexane/methanol/2-methyl-1-propanol
  4137. methylcyclohexane/methanol/2-methyl-2-propanol
  4138. methylcyclohexane/methanol/2-propanol
  4139. methylcyclohexane/methanol/acetonitrile
  4140. methylcyclohexane/methanol/benzene
  4141. methylcyclohexane/methanol/methane
  4142. methylcyclohexane/methanol/N,N-dimethylformamide
  4143. methylcyclohexane/methoxycyclopentane/(1S,5R)-6,8-Dioxabicyclo(3.2.1)octan-4-one
  4144. methylcyclohexane/methylbenzene/(1S,5R)-6,8-Dioxabicyclo(3.2.1)octan-4-one
  4145. methylcyclohexane/methylbenzene/1-butyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  4146. methylcyclohexane/methylbenzene/1-butyl-3-methyl-1H-imidazolium salt with sulfuric acid methyl ester (1:1)
  4147. methylcyclohexane/methylbenzene/1-butyl-3-methyl-1H-imidazolium tetrakis(cyano-κC)borate(1-)
  4148. methylcyclohexane/methylbenzene/1-chlorobutane
  4149. methylcyclohexane/methylbenzene/1-ethyl-3-methyl-1H-imidazolium salt with sulfuric acid monoethyl ester (1:1)
  4150. methylcyclohexane/methylbenzene/1-ethyl-3-methylpyridinium salt with sulfuric acid ethyl ester
  4151. methylcyclohexane/methylbenzene/1-hexyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  4152. methylcyclohexane/methylbenzene/1-hexyl-3-methyl-1H-imidazolium tetrakis(cyano-κC)borate(1-)
  4153. methylcyclohexane/methylbenzene/1-methyl-3-octyl-1H-imidazolium thiocyanate
  4154. methylcyclohexane/methylbenzene/1-octylquinolinium bis(1,2-benzenediolato(2-)-O,O')borate
  4155. methylcyclohexane/methylbenzene/1-octylquinolinium bis(trifluoromethylsulfonyl)amide
  4156. methylcyclohexane/methylbenzene/2-chlorbutane
  4157. methylcyclohexane/methylbenzene/2-chloro-2-methylpropane
  4158. methylcyclohexane/methylbenzene/2-furancarboxaldehyde
  4159. methylcyclohexane/methylbenzene/2-methoxybenzenamine
  4160. methylcyclohexane/methylbenzene/2-methyl-2-propanol
  4161. methylcyclohexane/methylbenzene/4-ethoxybenzenamine
  4162. methylcyclohexane/methylbenzene/4-morpholinecarboxaldehyde
  4163. methylcyclohexane/methylbenzene/acetonitrile
  4164. methylcyclohexane/methylbenzene/anthracene
  4165. methylcyclohexane/methylbenzene/benzenamine
  4166. methylcyclohexane/methylbenzene/ethanol
  4167. methylcyclohexane/methylbenzene/furancarboxaldehyde
  4168. methylcyclohexane/methylbenzene/heptane
  4169. methylcyclohexane/methylbenzene/hydrogen
  4170. methylcyclohexane/methylbenzene/methanol
  4171. methylcyclohexane/methylbenzene/morpholine
  4172. methylcyclohexane/methylbenzene/N-[2-(2-hydroxyethoxy)ethyl]-N-2-[2-(2-hydroxyethoxy)ethoxy]ethyl-N-methyl-1-tridecanaminium salt with sulfuric acid methyl ester (1:1)
  4173. methylcyclohexane/methylbenzene/nitromethane
  4174. methylcyclohexane/methylbenzene/pentadecafluorooctanoic acid methyl ester
  4175. methylcyclohexane/methylbenzene/phenol
  4176. methylcyclohexane/methylbenzene/tetrahydrothiophene 1,1-dioxide
  4177. methylcyclohexane/morpholine/water
  4178. methylcyclohexane/N,N-dimethylformamide/benzene
  4179. methylcyclohexane/N,N-dimethylformamide/water
  4180. methylcyclohexane/nitroethane/poly(1-phenylethylene)
  4181. methylcyclohexane/nitrogen/water
  4182. methylcyclohexane/nitromethane/2-furancarboxaldehyde
  4183. methylcyclohexane/pentane/2-furancarboxaldehyde
  4184. methylcyclohexane/phenol/water
  4185. methylcyclohexane/phosphoric acid/water
  4186. methylcyclohexane/propane/water
  4187. methylcyclohexane/propanoic acid methyl ester/nitromethane
  4188. methylcyclohexane/pyrene/1,1'-oxybisbutane
  4189. methylcyclohexane/pyrene/1-butanol
  4190. methylcyclohexane/pyrene/1-propanol
  4191. methylcyclohexane/pyrene/2-butanol
  4192. methylcyclohexane/pyrene/2-methyl-1-propanol
  4193. methylcyclohexane/pyrene/2-propanol
  4194. methylcyclohexane/sodium chloride (NaCl)/water
  4195. methylcyclohexane/sulfinylbismethane/(1-methylethyl)benzene
  4196. methylcyclohexane/sulfuric acid/water
  4197. methylcyclohexane/tetrahydrofuran/2,2,4-trimethylpentane
  4198. methylcyclohexane/tetrahydrofuran/heptane
  4199. methylcyclohexane/tetrahydrofuran/water
  4200. methylcyclohexane/tetrahydrothiophene 1,1-dioxide/1-methyl-2-pyrrolidinone
  4201. methylcyclohexane/tetrahydrothiophene 1,1-dioxide/tetrahydro-3-methylthiophene 1,1-dioxide
  4202. methylcyclohexane/tetrahydrothiophene 1,1-dioxide/water
  4203. methylcyclohexane/thiophene/1-ethyl-3-methyl-1H-imidazolium salt with sulfuric acid monoethyl ester (1:1)
  4204. methylcyclohexane/thiophene/1-methyl-3-octyl-1H-imidazolium tetrafluoroborate(1-)
  4205. methylcyclohexane/thiophene/3-methyl-1-octylpyridinium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  4206. methylcyclohexane/water/1-methyl-2-pyrrolidinone
  4207. methylcyclohexane/water/2-butanol
  4208. methylcyclohexane/water/2-methoxy-2-methylbutane
  4209. methylcyclohexane/water/hydrogen sulfide (H2S)
  4210. methylcyclohexane/water/natural gas
  4211. methylcyclohexane/water/propanoic acid
  4212. methylcyclohexane/xenon/water
  4213. methylcyclohexanol/acetic acid/water
  4214. methylcyclohexanol/formic acid/water
  4215. methylcyclohexanol/water/propanoic acid
  4216. methylcyclohexanone/2-hydroxypropane-1,2,3-tricarboxylic acid/water
  4217. methylcyclohexanone/2-hydroxypropane-1,2,3-tricarboxylic acid/water
  4218. methylcyclohexanone/3,4,5-trihydroxybenzoic acid/water
  4219. methylcyclohexanone/3,4,5-trihydroxybenzoic acid/water
  4220. methylcyclohexanone/acetic acid/water
  4221. methylenecyclobutane/2-methyl-2-butene/N,N-dimethylformamide
  4222. methylenecyclobutene/1,3-cyclopentadiene/N,N-dimethylformamide
  4223. methyloxirane block polymer with oxirane/2-hydroxy-1,2,3-propanetricarboxylic acid trisodium salt/water
  4224. methyloxirane block polymer with oxirane/nitric acid sodium salt/water
  4225. methyloxirane block polymer with oxirane/sulfuric acid magnesium salt (1:1)/water
  4226. methyloxirane block polymer with oxirane/water/(2R,3R)-2,3-dihydroxybutanedioic acid disodium salt
  4227. methyloxirane block polymer with oxirane/water/sulfuric acid disodium salt
  4228. methyloxirane block polymer with oxirane/water/sulfuric acid zinc salt (1:1)
  4229. methyloxirane/nitrogen/oxygen
  4230. methyloxirane/nitrogen/water
  4231. methyloxirane/water/1,2-dichloropropane
  4232. methylphosphonic acid bis(3-methylbutyl) ester/aluminum chloride (AlCl3)/water
  4233. methylphosphonic acid bis(3-methylbutyl) ester/lithium bromide (LiBr)/water
  4234. methylphosphonic acid bis(3-methylbutyl) ester/lithium chloride (LiCl)/water
  4235. methylphosphonic acid bis(3-methylbutyl) ester/water/magnesium chloride (MgCl2)
  4236. methylpropanedioic acid diethyl ester/acetic acid/water
  4237. methyltriphenylphosphonium bromide/1,2,3-propanetriol/benzene
  4238. methyltriphenylphosphonium bromide/1,2,3-propanetriol/sodium chloride (NaCl)
  4239. methyltris(2-methylpropyl)phosphonium salt with 4-methylbenzenesulfonic acid (1:1)/hexadecane/benzo[b]thiophene
  4240. methyltris(2-methylpropyl)phosphonium salt with 4-methylbenzenesulfonic acid (1:1)/water/phosphoric acid tripotassium salt
  4241. methylurea/2-hydroxy-N,N,N-trimethylethanaminium chloride/ammonia
  4242. methylurea/L-threonine/water
  4243. methylurea/L-valine/water
  4244. methylurea/N,N,N-trimethylmethanaminium bromide/water
  4245. methylurea/N,N-dimethylformamide/water
  4246. methylurea/sodium bromide (NaBr)/water
  4247. methylurea/sodium chloride (NaCl)/water
  4248. methylurea/sodium iodide (NaI)/water
  4249. methylurea/water-d2/3,6,9,12,15-pentaoxaheneicosan-1-ol
  4250. methylurea/water/N-methylacetamide
  4251. mol. sulfur (S8)/1,2-dichloroethane/benzene
  4252. mol. sulfur (S8)/1,2-dichloroethane/methylbenzene
  4253. mol. sulfur (S8)/1,3-dimethylbenzene/benzene
  4254. mol. sulfur (S8)/1,3-dimethylbenzene/methylbenzene
  4255. mol. sulfur (S8)/1,3-dimethylbenzene/tetrachloromethane
  4256. mol. sulfur (S8)/1,3-dimethylbenzene/trichloromethane
  4257. mol. sulfur (S8)/chlorobenzene/1,2-dichlorobenzene
  4258. mol. sulfur (S8)/methylbenzene/tetrachloromethane
  4259. mol. sulfur (S8)/methylbenzene/trichloromethane
  4260. mol. sulfur (S8)/tetrachloromethane/benzene
  4261. mol. sulfur (S8)/tetrachloromethane/trichloromethane
  4262. mol. sulfur (S8)/trichloromethane/benzene
  4263. molybdenum chloride (MoCl3)/sodium chloride (NaCl)/titanium chloride (TiCl3)
  4264. molybdenum chloride (MoCl5)/aluminum chloride (AlCl3)/iron chloride (FeCl3)
  4265. molybdenum chloride (MoCl5)/aluminum chloride (AlCl3)/sodium chloride (NaCl)
  4266. molybdenum oxide (MoO3)/ammonia/water
  4267. molybdenum oxide (MoO3)/cesium fluoride (CsF)/water
  4268. molybdenum oxide (MoO3)/dicesium (T-4)-molybdate (MoO4(2-))/cesium chloride (CsCl)
  4269. molybdenum oxide (MoO3)/dilithium (T-4)-molybdate (MoO4(2-))/disodium (T-4)-molybdate (MoO4(2-))
  4270. molybdenum oxide (MoO3)/dipotassium (T-4)-molybdate (MoO4(2-))/dicesium (T-4)-molybdate (MoO4(2-))
  4271. molybdenum oxide (MoO3)/dipotassium (T-4)-molybdate (MoO4(2-))/dilithium (T-4)-molybdate (MoO4(2-))
  4272. molybdenum oxide (MoO3)/disodium (T-4)-molybdate (MoO4(2-))/barium (T-4)-molybdate (MoO4(2-)) (1:1)
  4273. molybdenum oxide (MoO3)/disodium (T-4)-molybdate (MoO4(2-))/sulfuric acid disodium salt
  4274. molybdenum oxide (MoO3)/hydrochloric acid/water
  4275. molybdenum oxide (MoO3)/hydrofluoric acid/water
  4276. molybdenum oxide (MoO3)/nitric acid aluminum salt/water
  4277. molybdenum oxide (MoO3)/nitric acid potassium salt/nitric acid cesium salt
  4278. molybdenum oxide (MoO3)/nitric acid/water
  4279. molybdenum oxide (MoO3)/perchloric acid/water
  4280. molybdenum oxide (MoO3)/sodium chloride (NaCl)/water
  4281. molybdenum oxide (MoO3)/sulfuric acid dipotassium salt/sulfuric acid lithium potassium salt (2:2:2)
  4282. molybdenum oxide (MoO3)/sulfuric acid/water
  4283. molybdenum oxide (MoO3)/tungsten oxide (WO3)/metaphosphoric acid (HPO3) potassium salt
  4284. molybdenum oxide (MoO3)/water/sulfuric acid diammonium salt
  4285. molybdenum/aluminum chloride (AlCl3)/sodium chloride (NaCl)
  4286. molybdenum/nickel/chromium
  4287. molybdenum/nickel/vanadium
  4288. molybdenum/rhenium/tungsten
  4289. Montmorillonite ((Al1.33-1.67Mg0.33-0.67)(Ca0-1Na0-1)0.33Si4(OH)2O10*xH2O)/air/water
  4290. Montmorillonite ((Al1.33-1.67Mg0.33-0.67)(Ca0-1Na0-1)0.33Si4(OH)2O10*xH2O)/methane/water
  4291. morpholine hydrochloride/hydrochloric acid/water
  4292. morpholine hydrochloride/terbium chloride (TbCl3)/water
  4293. morpholine/1,2-benzenedicarboxylic acid dimethyl ester/water
  4294. morpholine/1,4-dimethylcyclohexane/water
  4295. morpholine/1,4-dioxane/nitrobenzene
  4296. morpholine/1-octanol/water
  4297. morpholine/2-aminoethanol/benzene
  4298. morpholine/3-methyl-1-butanol/water
  4299. morpholine/benzene/water
  4300. morpholine/carbon dioxide/water
  4301. morpholine/decane/acetonitrile
  4302. morpholine/dodecane/acetonitrile
  4303. morpholine/heptane/acetonitrile
  4304. morpholine/heptane/methanol
  4305. morpholine/heptane/water
  4306. morpholine/lead oxide (PbO)/water
  4307. morpholine/massicot (PbO)/water
  4308. morpholine/nonanoic acid ethyl ester/water
  4309. morpholine/octane/acetonitrile
  4310. morpholine/octane/water
  4311. morpholine/sodium hydroxide (Na(OH))/water
  4312. morpholine/sulfur dioxide/water
  4313. morpholine/water/1,2-dimethylbenzene
  4314. morpholine/water/litharge (PbO)
  4315. morpholine/water/methylcyclopentane
  4316. morpholine/water/thallium chloride (TlCl)
  4317. N'-(3,4-dichlorophenyl)-N,N-dimethylurea/1-pentanol/water
  4318. N'-(3,4-dichlorophenyl)-N,N-dimethylurea/2-propanone/water
  4319. N'-(3,4-dichlorophenyl)-N,N-dimethylurea/methanol/water
  4320. N'-(3,4-dichlorophenyl)-N,N-dimethylurea/water/2-methyl-1-propanol
  4321. N(2)-L-alanyl-L-glutamine/2-propanol/water
  4322. N(2)-L-alanyl-L-glutamine/ethanol/water
  4323. N(2)-L-alanyl-L-glutamine/methanol/water
  4324. N,4-dimethyl-2-pentanamine/sodium chloride (NaCl)/water
  4325. N,N''-methylenebisurea/potassium chloride (KCl)/water
  4326. N,N''-methylenebisurea/sodium chloride (NaCl)/water
  4327. N,N''-methylenebisurea/sulfuric acid magnesium salt (1:1)/water
  4328. N,N''-methylenebisurea/water/magnesium chloride (MgCl2)
  4329. N,N''-methylenebisurea/water/phosphoric acid diammonium salt
  4330. N,N''-methylenebisurea/water/sulfuric acid disodium salt
  4331. N,N'-1,2-ethanediylbis(N-(carboxymethyl))glycine/water/3-mercapto-1,2-propanediol
  4332. N,N'-1,2-ethanediylbis[1-(2-pyridinyl)methanimine]/3-methyl-1-pentyl-1H-imidazolium bromide/acetonitrile
  4333. N,N'-1,2-ethanediylbis[1-(2-pyridinyl)methanimine]/3-methyl-1-pentyl-1H-imidazolium bromide/N,N-dimethylformamide
  4334. N,N'-1,2-ethanediylbis[1-(2-pyridinyl)methanimine]/acetonitrile/1-hexyl-3-methyl-1H-imidazolium bromide
  4335. N,N'-1,2-ethanediylbis[1-(2-pyridinyl)methanimine]/acetonitrile/1-methyl-3-propyl-1H-imidazolium bromide
  4336. N,N'-1,2-ethanediylbis[1-(2-pyridinyl)methanimine]/N,N-dimethylformamide/1-hexyl-3-methyl-1H-imidazolium bromide
  4337. N,N'-1,2-ethanediylbis[1-(2-pyridinyl)methanimine]/N,N-dimethylformamide/1-methyl-3-propyl-1H-imidazolium bromide
  4338. N,N'-1,6-hexanediylbisacetamide/lithium chloride (LiCl)/water
  4339. N,N'-1,6-hexanediylbisacetamide/potassium chloride (KCl)/water
  4340. N,N'-1,6-hexanediylbisacetamide/sodium bromide (NaBr)/water
  4341. N,N'-1,6-hexanediylbisacetamide/sodium chloride (NaCl)/water
  4342. N,N'-1,6-hexanediylbisacetamide/sodium fluoride (NaF)/water
  4343. N,N'-1,6-hexanediylbisacetamide/sodium iodide (NaI)/water
  4344. N,N'-1,6-hexanediylbisacetamide/water/rubidium chloride (RbCl)
  4345. N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine/2-propanone/acetonitrile
  4346. N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine/acetonitrile/acetic acid methyl ester
  4347. N,N'-bis(2-aminoethyl)-1,2-ethanediamine/2-amino-2-methyl-1-propanol/water
  4348. N,N'-bis(2-aminoethyl)-1,2-ethanediamine/carbon dioxide/water
  4349. N,N'-bis(2-pyridinylmethylene)-1,2-benzenediamine-bis(nitrato) cupper (II) complex/5-hydroxy-6-methyl-3,4-pyridinedimethanol hydrochloride/methanol
  4350. N,N'-bis(hydroxymethyl)urea/sodium chloride (NaCl)/water
  4351. N,N'-carbonylbis(acetamide)/water/perchloric acid ammonium salt
  4352. N,N'-diethylurea/sodium iodide (NaI)/water
  4353. N,N'-dimethylethane-1,2-diamine/carbon dioxide/water
  4354. N,N'-diphenylguanidine compd. with 2,4,6-trinitrophenol (1:1)/ethanol/nitrobenzene
  4355. N,N'-diphenylurea/ethanol/quinoline
  4356. N,N'-diphenylurea/pyridine/water
  4357. N,N'-ethylenebis-(salicylideneiminato)-diaquochromium(III) chloride/1-butyl-2,3-dimethyl-1H-imidazolium tetrafluoroborate(1-)/methanol
  4358. N,N'-ethylenebis-(salicylideneiminato)-diaquochromium(III) chloride/sulfinylbismethane/water
  4359. N,N'-ethylenebis-(salicylideneiminato)-iron(III) chloride/methanol/water
  4360. N,N'-ethylenebis-(salicylideneiminato)-iron(III) chloride/N,N-dimethylformamide/acetonitrile
  4361. N,N'-methylenebis(formamide)/water/sulfuric acid manganese(2+) salt (1:1)
  4362. N,N,α-trimethyl-10H-phenothiazine-10-ethanamine monohydrochloride/sodium chloride (NaCl)/water
  4363. N,N,N',N'-tetramethyl-1,2-ethanediamine/carbon dioxide/water
  4364. N,N,N',N'-tetramethyl-1,3-propanediamine/carbon dioxide/water
  4365. N,N,N',N'-tetramethyl-1,4-benzenediamine/butanenitrile/N,N,N-tributyl-1-butanaminium perchlorate
  4366. N,N,N',N'-tetramethyl-1,4-benzenediamine/N,N,N-tributyl-1-butanaminium perchlorate/acetonitrile
  4367. N,N,N',N'-tetramethyl-1,4-benzenediamine/N,N,N-tributyl-1-butanaminium perchlorate/dichloromethane
  4368. N,N,N',N'-tetramethyl-1,4-benzenediamine/N,N,N-tributyl-1-butanaminium perchlorate/N,N-dimethylformamide
  4369. N,N,N',N'-tetramethyl-1,4-benzenediamine/N,N,N-tributyl-1-butanaminium perchlorate/sulfinylbismethane
  4370. N,N,N',N'-tetramethyl-1,4-benzenediamine/propanenitrile/N,N,N-tributyl-1-butanaminium perchlorate
  4371. N,N,N',N'-tetramethyl-1,6-hexanediamine/carbon dioxide/water
  4372. N,N,N-octylpentyldimethylammonium chloride/β-cyclodextrin/water
  4373. N,N,N-octylpentyldimethylammonium chloride/dimethyl-dioctylazanium chloride/water
  4374. N,N,N-octylpentyldimethylammonium chloride/urea/water
  4375. N,N,N-octylpentyldimethylammonium chloride/water/N,N,N-octylbutyldimethylammonium chloride
  4376. N,N,N-tributyl-1-butanaminium (OC-6-11)-diamminetetrakis(thiocyanato-N)chromate(1-)/methanol/water
  4377. N,N,N-tributyl-1-butanaminium (OC-6-11)-diamminetetrakis(thiocyanato-N)chromate(1-)/perchloric acid sodium salt/water
  4378. N,N,N-tributyl-1-butanaminium bis(benzenamine)tetrakis(thiocyanato-N)chromate(1-)/2-methyl-2-propanol/water
  4379. N,N,N-tributyl-1-butanaminium bis(benzenamine)tetrakis(thiocyanato-N)chromate(1-)/acetonitrile/water
  4380. N,N,N-tributyl-1-butanaminium bis(benzenamine)tetrakis(thiocyanato-N)chromate(1-)/methanol/water
  4381. N,N,N-tributyl-1-butanaminium bis(benzenamine)tetrakis(thiocyanato-N)chromate(1-)/perchloric acid sodium salt/water
  4382. N,N,N-tributyl-1-butanaminium bromide/α-hydro-ω-hydroxypoly(oxy(methyl-1,2-ethanediyl))/water
  4383. N,N,N-tributyl-1-butanaminium bromide/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)/water
  4384. N,N,N-tributyl-1-butanaminium bromide/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)/water
  4385. N,N,N-tributyl-1-butanaminium bromide/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)/water
  4386. N,N,N-tributyl-1-butanaminium bromide/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)/water
  4387. N,N,N-tributyl-1-butanaminium bromide/β-D-fructofuranosyl α-D-glucopyranoside/formamide
  4388. N,N,N-tributyl-1-butanaminium bromide/β-D-fructofuranosyl α-D-glucopyranoside/water
  4389. N,N,N-tributyl-1-butanaminium bromide/(2R,3R)-2,3-dihydroxybutanedioic acid monopotassium monosodium salt/water
  4390. N,N,N-tributyl-1-butanaminium bromide/(OC-6-11)-tris(1,2-ethanediamine-κN,κN')cobalt(3+) (OC-6-11)-hexakis(cyano-κC)ferrate(3-)/water
  4391. N,N,N-tributyl-1-butanaminium bromide/(OC-6-11)-tris(2,4-pentanedionato-κO,κO')cobalt/water
  4392. N,N,N-tributyl-1-butanaminium bromide/(OC-6-21)-tris(β-alaninato-κN,κO)cobalt/water
  4393. N,N,N-tributyl-1-butanaminium bromide/(OC-6-21)-tris(2-(amino-κN)butanoato-κO)cobalt/water
  4394. N,N,N-tributyl-1-butanaminium bromide/(OC-6-21)-tris(glycinato-κN,κO)cobalt/water
  4395. N,N,N-tributyl-1-butanaminium bromide/(OC-6-21)-tris(norvalinato-κN,κO)cobalt/water
  4396. N,N,N-tributyl-1-butanaminium bromide/(OC-6-21-λ)-tris(L-alaninato-κN,κO)cobalt/water
  4397. N,N,N-tributyl-1-butanaminium bromide/(OC-6-21-λ)-tris(L-leucinato-κN,κO)cobalt/water
  4398. N,N,N-tributyl-1-butanaminium bromide/(OC-6-21-λ)-tris(L-serinato-κN,κO1)cobalt/water
  4399. N,N,N-tributyl-1-butanaminium bromide/(OC-6-21-λ)-tris(L-threoninato-κN,κO1)cobalt/water
  4400. N,N,N-tributyl-1-butanaminium bromide/(OC-6-21-λ)-tris(L-valinato-κN,κO)cobalt/water
  4401. N,N,N-tributyl-1-butanaminium bromide/(OC-6-22-δ)-tris(L-prolinato-N1,O2)cobalt/water
  4402. N,N,N-tributyl-1-butanaminium bromide/1,2,3-propanetriol/methanol
  4403. N,N,N-tributyl-1-butanaminium bromide/1,2,3-propanetriol/water
  4404. N,N,N-tributyl-1-butanaminium bromide/1,2-propanediol/water
  4405. N,N,N-tributyl-1-butanaminium bromide/1,3,4,6-tetrakis-O-(2-cyanoethyl)-β-D-fructofuranosyl 2,3,4,6-tetrakis-O-(2-cyanoethyl)glucopyranoside/acetonitrile
  4406. N,N,N-tributyl-1-butanaminium bromide/1-dodecyl-3-methyl-1H-imidazolium bromide/water
  4407. N,N,N-tributyl-1-butanaminium bromide/1-propanol/water
  4408. N,N,N-tributyl-1-butanaminium bromide/1H-imidazole/benzoic acid
  4409. N,N,N-tributyl-1-butanaminium bromide/1H-imidazole/D-glucose
  4410. N,N,N-tributyl-1-butanaminium bromide/1H-imidazole/lithium chloride (LiCl)
  4411. N,N,N-tributyl-1-butanaminium bromide/1H-imidazole/magnesium chloride (MgCl2)
  4412. N,N,N-tributyl-1-butanaminium bromide/1H-imidazole/zinc chloride (ZnCl2)
  4413. N,N,N-tributyl-1-butanaminium bromide/2-hydroxy-1,2,3-propanetricarboxylic acid trisodium salt/water
  4414. N,N,N-tributyl-1-butanaminium bromide/2-methyl-2-butanol/water
  4415. N,N,N-tributyl-1-butanaminium bromide/2-methyl-2-propanol/N-methylacetamide
  4416. N,N,N-tributyl-1-butanaminium bromide/2-methyl-2-propanol/water
  4417. N,N,N-tributyl-1-butanaminium bromide/2-propanol/2-propanone
  4418. N,N,N-tributyl-1-butanaminium bromide/2-propanol/water
  4419. N,N,N-tributyl-1-butanaminium bromide/2-propanone/1,1,1,3,3,3-hexafluoro-2-propanol
  4420. N,N,N-tributyl-1-butanaminium bromide/2-propanone/1-propanol
  4421. N,N,N-tributyl-1-butanaminium bromide/2-propanone/sulfinylbismethane
  4422. N,N,N-tributyl-1-butanaminium bromide/2-propanone/water
  4423. N,N,N-tributyl-1-butanaminium bromide/3-methyl-2-butanol/water
  4424. N,N,N-tributyl-1-butanaminium bromide/4-ethyl-1,3-dioxolan-2-one/acetonitrile
  4425. N,N,N-tributyl-1-butanaminium bromide/acetic acid/hydrogen sulfide (H2S)
  4426. N,N,N-tributyl-1-butanaminium bromide/acetic acid/water
  4427. N,N,N-tributyl-1-butanaminium bromide/acetonitrile/water
  4428. N,N,N-tributyl-1-butanaminium bromide/argon/water
  4429. N,N,N-tributyl-1-butanaminium bromide/benzene/water
  4430. N,N,N-tributyl-1-butanaminium bromide/carbonic acid disodium salt/water
  4431. N,N,N-tributyl-1-butanaminium bromide/D-arabinitol/water
  4432. N,N,N-tributyl-1-butanaminium bromide/D-fructose/water
  4433. N,N,N-tributyl-1-butanaminium bromide/D-glucitol/water
  4434. N,N,N-tributyl-1-butanaminium bromide/D-glucose/1,2,3-propanetriol
  4435. N,N,N-tributyl-1-butanaminium bromide/D-glucose/water
  4436. N,N,N-tributyl-1-butanaminium bromide/D-mannitol/water
  4437. N,N,N-tributyl-1-butanaminium bromide/difluoromethane/water
  4438. N,N,N-tributyl-1-butanaminium bromide/ethane/water
  4439. N,N,N-tributyl-1-butanaminium bromide/ethanol/water
  4440. N,N,N-tributyl-1-butanaminium bromide/formamide/water
  4441. N,N,N-tributyl-1-butanaminium bromide/formic acid/hydrogen sulfide (H2S)
  4442. N,N,N-tributyl-1-butanaminium bromide/glycine/water
  4443. N,N,N-tributyl-1-butanaminium bromide/helium/water
  4444. N,N,N-tributyl-1-butanaminium bromide/hexamethylphosphoric triamide/water
  4445. N,N,N-tributyl-1-butanaminium bromide/hydrogen sulfide (H2S)/propanoic acid
  4446. N,N,N-tributyl-1-butanaminium bromide/krypton/water
  4447. N,N,N-tributyl-1-butanaminium bromide/L-alanine/water
  4448. N,N,N-tributyl-1-butanaminium bromide/L-ascorbic acid/water
  4449. N,N,N-tributyl-1-butanaminium bromide/L-leucine/water
  4450. N,N,N-tributyl-1-butanaminium bromide/L-lysine monohydrochloride/water
  4451. N,N,N-tributyl-1-butanaminium bromide/L-valine/water
  4452. N,N,N-tributyl-1-butanaminium bromide/Lithium dodecyl sulfate/water
  4453. N,N,N-tributyl-1-butanaminium bromide/methane/water
  4454. N,N,N-tributyl-1-butanaminium bromide/methanol/2-butanone
  4455. N,N,N-tributyl-1-butanaminium bromide/methanol/acetonitrile
  4456. N,N,N-tributyl-1-butanaminium bromide/methanol/benzene
  4457. N,N,N-tributyl-1-butanaminium bromide/methanol/formamide
  4458. N,N,N-tributyl-1-butanaminium bromide/methanol/N,N-dimethylformamide
  4459. N,N,N-tributyl-1-butanaminium bromide/methanol/nitrobenzene
  4460. N,N,N-tributyl-1-butanaminium bromide/methanol/nitromethane
  4461. N,N,N-tributyl-1-butanaminium bromide/methanol/salicylaldehyde anil zinc(II) complex
  4462. N,N,N-tributyl-1-butanaminium bromide/methanol/sulfinylbismethane
  4463. N,N,N-tributyl-1-butanaminium bromide/methanol/water
  4464. N,N,N-tributyl-1-butanaminium bromide/methylurea/water
  4465. N,N,N-tributyl-1-butanaminium bromide/N,N,N-tributyl-1-butanaminium hydroxide/water
  4466. N,N,N-tributyl-1-butanaminium bromide/N,N,N-triethylethanaminium bromide/water
  4467. N,N,N-tributyl-1-butanaminium bromide/N,N,N-trimethylmethanaminium bromide/water
  4468. N,N,N-tributyl-1-butanaminium bromide/N,N-dimethylformamide/2-butanone
  4469. N,N,N-tributyl-1-butanaminium bromide/N,N-dimethylformamide/water
  4470. N,N,N-tributyl-1-butanaminium bromide/N,N-dimethylurea/water
  4471. N,N,N-tributyl-1-butanaminium bromide/N-(1-methylethyl)-2-propenamide homopolymer/water
  4472. N,N,N-tributyl-1-butanaminium bromide/N-glycylglycine/water
  4473. N,N,N-tributyl-1-butanaminium bromide/nitrogen/water
  4474. N,N,N-tributyl-1-butanaminium bromide/phosphoric acid disodium salt/water
  4475. N,N,N-tributyl-1-butanaminium bromide/phosphoric acid monosodium salt/water
  4476. N,N,N-tributyl-1-butanaminium bromide/phosphoric acid trisodium salt/water
  4477. N,N,N-tributyl-1-butanaminium bromide/propane/water
  4478. N,N,N-tributyl-1-butanaminium bromide/ribitol/water
  4479. N,N,N-tributyl-1-butanaminium bromide/sulfinylbismethane/acetonitrile
  4480. N,N,N-tributyl-1-butanaminium bromide/sulfinylbismethane/nitromethane
  4481. N,N,N-tributyl-1-butanaminium bromide/sulfinylbismethane/water
  4482. N,N,N-tributyl-1-butanaminium bromide/sulfuric acid magnesium salt (1:1)/water
  4483. N,N,N-tributyl-1-butanaminium bromide/tetrabutylphosphonium bromide/water
  4484. N,N,N-tributyl-1-butanaminium bromide/tetrachloromethane/2-propanone
  4485. N,N,N-tributyl-1-butanaminium bromide/tetrachloromethane/ethanol
  4486. N,N,N-tributyl-1-butanaminium bromide/tetrachloromethane/methanol
  4487. N,N,N-tributyl-1-butanaminium bromide/tetrachloromethane/nitrobenzene
  4488. N,N,N-tributyl-1-butanaminium bromide/tetrafluoromethane/water
  4489. N,N,N-tributyl-1-butanaminium bromide/tetramethylsilane/water
  4490. N,N,N-tributyl-1-butanaminium bromide/tetramethylurea/water
  4491. N,N,N-tributyl-1-butanaminium bromide/urea/formamide
  4492. N,N,N-tributyl-1-butanaminium bromide/urea/water
  4493. N,N,N-tributyl-1-butanaminium bromide/water/1-butyl-2,3-dimethyl-1H-imidazolium chloride
  4494. N,N,N-tributyl-1-butanaminium bromide/water/2-hydroxy-1,2,3-propanetricarboxylic acid tripotassium salt
  4495. N,N,N-tributyl-1-butanaminium bromide/water/3-pyridinecarboxamide
  4496. N,N,N-tributyl-1-butanaminium bromide/water/cobalt bromide (CoBr2)
  4497. N,N,N-tributyl-1-butanaminium bromide/water/copper bromide (CuBr2)
  4498. N,N,N-tributyl-1-butanaminium bromide/water/dihydro-2(3H)-furanone
  4499. N,N,N-tributyl-1-butanaminium bromide/water/hydrogen sulfide (H2S)
  4500. N,N,N-tributyl-1-butanaminium bromide/water/magnesium bromide (MgBr2)
  4501. N,N,N-tributyl-1-butanaminium bromide/water/N,N'-dimethylurea
  4502. N,N,N-tributyl-1-butanaminium bromide/water/N,N,N-tributyl-1-butanaminium salt with sulfuric acid dodecyl ester
  4503. N,N,N-tributyl-1-butanaminium bromide/water/natural gas
  4504. N,N,N-tributyl-1-butanaminium bromide/water/phosphoric acid dipotassium salt
  4505. N,N,N-tributyl-1-butanaminium bromide/water/phosphoric acid tripotassium salt
  4506. N,N,N-tributyl-1-butanaminium bromide/water/potassium bromide (KBr)
  4507. N,N,N-tributyl-1-butanaminium bromide/water/sulfuric acid disodium salt
  4508. N,N,N-tributyl-1-butanaminium bromide/xenon/water
  4509. N,N,N-tributyl-1-butanaminium butanoate/methane/water
  4510. N,N,N-tributyl-1-butanaminium butanoate/water/phosphoric acid tripotassium salt
  4511. N,N,N-tributyl-1-butanaminium chloride/α-hydro-ω-hydroxypoly(oxy(methyl-1,2-ethanediyl))/water
  4512. N,N,N-tributyl-1-butanaminium chloride/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)/water
  4513. N,N,N-tributyl-1-butanaminium chloride/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)/water
  4514. N,N,N-tributyl-1-butanaminium chloride/β-D-fructofuranosyl α-D-glucopyranoside/formamide
  4515. N,N,N-tributyl-1-butanaminium chloride/β-D-fructofuranosyl α-D-glucopyranoside/water
  4516. N,N,N-tributyl-1-butanaminium chloride/(2R,3R)-2,3-dihydroxybutanedioic acid monopotassium monosodium salt/water
  4517. N,N,N-tributyl-1-butanaminium chloride/1,2,3-propanetriol/benzene
  4518. N,N,N-tributyl-1-butanaminium chloride/2-imidazolidinone/sulfur dioxide
  4519. N,N,N-tributyl-1-butanaminium chloride/2-propanol/2-propanone
  4520. N,N,N-tributyl-1-butanaminium chloride/2-propanone/1,1,1,3,3,3-hexafluoro-2-propanol
  4521. N,N,N-tributyl-1-butanaminium chloride/2-propanone/1-propanol
  4522. N,N,N-tributyl-1-butanaminium chloride/4-oxopentanoic acid/carbon dioxide
  4523. N,N,N-tributyl-1-butanaminium chloride/argon/water
  4524. N,N,N-tributyl-1-butanaminium chloride/carbon dioxide/(2S)-2-hydroxypropanoic acid
  4525. N,N,N-tributyl-1-butanaminium chloride/carbon dioxide/decanoic acid
  4526. N,N,N-tributyl-1-butanaminium chloride/carbon dioxide/water
  4527. N,N,N-tributyl-1-butanaminium chloride/carbonic acid disodium salt/water
  4528. N,N,N-tributyl-1-butanaminium chloride/decanoic acid/ethane
  4529. N,N,N-tributyl-1-butanaminium chloride/decanoic acid/ethene
  4530. N,N,N-tributyl-1-butanaminium chloride/ethane/water
  4531. N,N,N-tributyl-1-butanaminium chloride/guanidine monohydrochloride/water
  4532. N,N,N-tributyl-1-butanaminium chloride/hydrochloric acid/water
  4533. N,N,N-tributyl-1-butanaminium chloride/hydrogen/water
  4534. N,N,N-tributyl-1-butanaminium chloride/methane/water
  4535. N,N,N-tributyl-1-butanaminium chloride/methanol/acetonitrile
  4536. N,N,N-tributyl-1-butanaminium chloride/methanol/water
  4537. N,N,N-tributyl-1-butanaminium chloride/N,N,N-tributyl-1-butanaminium bromide/water
  4538. N,N,N-tributyl-1-butanaminium chloride/nitrogen/water
  4539. N,N,N-tributyl-1-butanaminium chloride/potassium chloride (KCl)/water
  4540. N,N,N-tributyl-1-butanaminium chloride/sodium chloride (NaCl)/water
  4541. N,N,N-tributyl-1-butanaminium chloride/sulfinylbismethane/acetonitrile
  4542. N,N,N-tributyl-1-butanaminium chloride/sulfur dioxide/N,N'-dimethylurea
  4543. N,N,N-tributyl-1-butanaminium chloride/tetramethylsilane/water
  4544. N,N,N-tributyl-1-butanaminium chloride/urea/formamide
  4545. N,N,N-tributyl-1-butanaminium chloride/water/2-hydroxy-1,2,3-propanetricarboxylic acid tripotassium salt
  4546. N,N,N-tributyl-1-butanaminium chloride/water/phosphoric acid dipotassium salt
  4547. N,N,N-tributyl-1-butanaminium chloride/xenon/water
  4548. N,N,N-tributyl-1-butanaminium decanoate/water/phosphoric acid tripotassium salt
  4549. N,N,N-tributyl-1-butanaminium fluoride/methane/water
  4550. N,N,N-tributyl-1-butanaminium fluoride/nitrogen/water
  4551. N,N,N-tributyl-1-butanaminium fluoride/water/potassium fluoride (KF)
  4552. N,N,N-tributyl-1-butanaminium heptanoate/water/phosphoric acid tripotassium salt
  4553. N,N,N-tributyl-1-butanaminium hydroxide/methane/water
  4554. N,N,N-tributyl-1-butanaminium hydroxide/N,N-dimethylformamide/water
  4555. N,N,N-tributyl-1-butanaminium hydroxide/sulfinylbismethane/water
  4556. N,N,N-tributyl-1-butanaminium iodide/β-D-fructofuranosyl α-D-glucopyranoside/formamide
  4557. N,N,N-tributyl-1-butanaminium iodide/β-D-fructofuranosyl α-D-glucopyranoside/water
  4558. N,N,N-tributyl-1-butanaminium iodide/1-propanol/water
  4559. N,N,N-tributyl-1-butanaminium iodide/2-methyl-2-propanol/N-methylacetamide
  4560. N,N,N-tributyl-1-butanaminium iodide/2-methyl-2-propanol/water
  4561. N,N,N-tributyl-1-butanaminium iodide/2-propanol/2-propanone
  4562. N,N,N-tributyl-1-butanaminium iodide/2-propanol/water
  4563. N,N,N-tributyl-1-butanaminium iodide/2-propanone/1,1,1,3,3,3-hexafluoro-2-propanol
  4564. N,N,N-tributyl-1-butanaminium iodide/2-propanone/1-propanol
  4565. N,N,N-tributyl-1-butanaminium iodide/2-propanone/N,N-dimethylformamide
  4566. N,N,N-tributyl-1-butanaminium iodide/2-propanone/sulfinylbismethane
  4567. N,N,N-tributyl-1-butanaminium iodide/2-propanone/water
  4568. N,N,N-tributyl-1-butanaminium iodide/acetonitrile/water
  4569. N,N,N-tributyl-1-butanaminium iodide/argon/water
  4570. N,N,N-tributyl-1-butanaminium iodide/ethanol/water
  4571. N,N,N-tributyl-1-butanaminium iodide/glycine/water
  4572. N,N,N-tributyl-1-butanaminium iodide/L-alanine/water
  4573. N,N,N-tributyl-1-butanaminium iodide/L-valine/water
  4574. N,N,N-tributyl-1-butanaminium iodide/methanol/acetonitrile
  4575. N,N,N-tributyl-1-butanaminium iodide/methanol/benzene
  4576. N,N,N-tributyl-1-butanaminium iodide/methanol/sulfinylbismethane
  4577. N,N,N-tributyl-1-butanaminium iodide/methanol/water
  4578. N,N,N-tributyl-1-butanaminium iodide/N,N-dimethylformamide/acetonitrile
  4579. N,N,N-tributyl-1-butanaminium iodide/N,N-dimethylformamide/water
  4580. N,N,N-tributyl-1-butanaminium iodide/N-acetylglycine/water
  4581. N,N,N-tributyl-1-butanaminium iodide/sulfinylbismethane/acetonitrile
  4582. N,N,N-tributyl-1-butanaminium iodide/sulfinylbismethane/water
  4583. N,N,N-tributyl-1-butanaminium iodide/tetrachloromethane/methanol
  4584. N,N,N-tributyl-1-butanaminium iodide/tetrachloromethane/N,N-dimethylformamide
  4585. N,N,N-tributyl-1-butanaminium iodide/tetrachloromethane/nitrobenzene
  4586. N,N,N-tributyl-1-butanaminium iodide/tetramethylsilane/water
  4587. N,N,N-tributyl-1-butanaminium iodide/tetramethylurea/water
  4588. N,N,N-tributyl-1-butanaminium iodide/urea/formamide
  4589. N,N,N-tributyl-1-butanaminium iodide/water/1,3-dioxolan-2-one
  4590. N,N,N-tributyl-1-butanaminium iodide/water/2-butanone
  4591. N,N,N-tributyl-1-butanaminium iodide/water/blood serum albumins
  4592. N,N,N-tributyl-1-butanaminium nitrate/1-pentanol/2-methylpropanenitrile
  4593. N,N,N-tributyl-1-butanaminium nitrate/2-methylpropanenitrile/1,2-dichlorobenzene
  4594. N,N,N-tributyl-1-butanaminium nitrate/2-propanone/sulfinylbismethane
  4595. N,N,N-tributyl-1-butanaminium nitrate/argon/water
  4596. N,N,N-tributyl-1-butanaminium nitrate/benzene/2-methylpropanenitrile
  4597. N,N,N-tributyl-1-butanaminium nitrate/benzene/acetonitrile
  4598. N,N,N-tributyl-1-butanaminium nitrate/ethanol/acetonitrile
  4599. N,N,N-tributyl-1-butanaminium nitrate/methane/water
  4600. N,N,N-tributyl-1-butanaminium nitrate/methanol/acetonitrile
  4601. N,N,N-tributyl-1-butanaminium nitrate/N,N-dimethylformamide/acetonitrile
  4602. N,N,N-tributyl-1-butanaminium nitrate/nitrogen/water
  4603. N,N,N-tributyl-1-butanaminium nitrate/sulfinylbismethane/acetonitrile
  4604. N,N,N-tributyl-1-butanaminium nitrate/tetrachloromethane/2-methylpropanenitrile
  4605. N,N,N-tributyl-1-butanaminium nitrate/tetrachloromethane/acetonitrile
  4606. N,N,N-tributyl-1-butanaminium nitrate/tetrachloromethane/nitrobenzene
  4607. N,N,N-tributyl-1-butanaminium pentanoate/water/phosphoric acid tripotassium salt
  4608. N,N,N-tributyl-1-butanaminium perchlorate/1,1'-diheptyl-4,4'-bipyridinium/acetonitrile
  4609. N,N,N-tributyl-1-butanaminium perchlorate/1-pentanol/2-methylpropanenitrile
  4610. N,N,N-tributyl-1-butanaminium perchlorate/2-methylpropanenitrile/1,2-dichlorobenzene
  4611. N,N,N-tributyl-1-butanaminium perchlorate/2-propanol/2-propanone
  4612. N,N,N-tributyl-1-butanaminium perchlorate/2-propanone/1,1,1,3,3,3-hexafluoro-2-propanol
  4613. N,N,N-tributyl-1-butanaminium perchlorate/2-propanone/1-propanol
  4614. N,N,N-tributyl-1-butanaminium perchlorate/2-propanone/acetonitrile
  4615. N,N,N-tributyl-1-butanaminium perchlorate/2-propanone/N,N-dimethylformamide
  4616. N,N,N-tributyl-1-butanaminium perchlorate/2-propanone/water
  4617. N,N,N-tributyl-1-butanaminium perchlorate/4-ethyl-1,3-dioxolan-2-one/acetonitrile
  4618. N,N,N-tributyl-1-butanaminium perchlorate/acetic acid/water
  4619. N,N,N-tributyl-1-butanaminium perchlorate/acetonitrile/water
  4620. N,N,N-tributyl-1-butanaminium perchlorate/benzene/2-methylpropanenitrile
  4621. N,N,N-tributyl-1-butanaminium perchlorate/benzene/acetonitrile
  4622. N,N,N-tributyl-1-butanaminium perchlorate/dihydro-2(3H)-furanone/1,3-dioxolan-2-one
  4623. N,N,N-tributyl-1-butanaminium perchlorate/ethanol/acetonitrile
  4624. N,N,N-tributyl-1-butanaminium perchlorate/ethanol/water
  4625. N,N,N-tributyl-1-butanaminium perchlorate/methanol/acetonitrile
  4626. N,N,N-tributyl-1-butanaminium perchlorate/methanol/sulfinylbismethane
  4627. N,N,N-tributyl-1-butanaminium perchlorate/methanol/water
  4628. N,N,N-tributyl-1-butanaminium perchlorate/N,N,N-triethylethanaminium iodide/dichloromethane
  4629. N,N,N-tributyl-1-butanaminium perchlorate/N,N-dimethylformamide/acetonitrile
  4630. N,N,N-tributyl-1-butanaminium perchlorate/sulfinylbismethane/acetonitrile
  4631. N,N,N-tributyl-1-butanaminium perchlorate/sulfuric acid/water
  4632. N,N,N-tributyl-1-butanaminium perchlorate/tetrachloromethane/2-methylpropanenitrile
  4633. N,N,N-tributyl-1-butanaminium perchlorate/tetrachloromethane/acetonitrile
  4634. N,N,N-tributyl-1-butanaminium perchlorate/tetramethylsilane/water
  4635. N,N,N-tributyl-1-butanaminium salt with 1,1,2,2,3,3,4,4,4-nonafluoro-1-butanesulfonic acid (1:1)/nonafluoropentanoic acid/1,1,1,2-tetrafluoroethane
  4636. N,N,N-tributyl-1-butanaminium salt with 1,1,2,2,3,3,4,4,4-nonafluoro-1-butanesulfonic acid (1:1)/nonafluoropentanoic acid/difluoromethane
  4637. N,N,N-tributyl-1-butanaminium salt with 1,1,2,2,3,3,4,4,4-nonafluoro-1-butanesulfonic acid (1:1)/nonafluoropentanoic acid/pentafluoroethane
  4638. N,N,N-tributyl-1-butanaminium sulfate (1:1)/3-pyridinecarboxylic acid/water
  4639. N,N,N-tributyl-1-butanaminium sulfate (1:1)/3-[(4-amino-2-methyl-5-pyrimidinyl)methyl]-5-(2-hydroxyethyl)-4-methylthiazolium chloride monohydrochloride/water
  4640. N,N,N-tributyl-1-butanaminium sulfate (1:1)/L-ascorbic acid/water
  4641. N,N,N-tributyl-1-butanaminium tetrabutylborate(1-)/2-propanone/N,N-dimethylformamide
  4642. N,N,N-tributyl-1-butanaminium tetrafluoroborate(1-)/1,2-dichlorobenzene/(5,6)fullerene-C60-Ih
  4643. N,N,N-tributyl-1-butanaminium tetrafluoroborate(1-)/dihydro-2(3H)-furanone/1,3-dioxolan-2-one
  4644. N,N,N-tributyl-1-butanaminium tetraphenylborate(1-)/1,3,4,6-tetrakis-O-(2-cyanoethyl)-β-D-fructofuranosyl 2,3,4,6-tetrakis-O-(2-cyanoethyl)glucopyranoside/acetonitrile
  4645. N,N,N-tributyl-1-butanaminium tetraphenylborate(1-)/1-pentanol/2-methylpropanenitrile
  4646. N,N,N-tributyl-1-butanaminium tetraphenylborate(1-)/2-methyl-2-propanol/water
  4647. N,N,N-tributyl-1-butanaminium tetraphenylborate(1-)/2-methylpropanenitrile/1,2-dichlorobenzene
  4648. N,N,N-tributyl-1-butanaminium tetraphenylborate(1-)/2-propanol/water
  4649. N,N,N-tributyl-1-butanaminium tetraphenylborate(1-)/2-propanone/acetonitrile
  4650. N,N,N-tributyl-1-butanaminium tetraphenylborate(1-)/2-propanone/sulfinylbismethane
  4651. N,N,N-tributyl-1-butanaminium tetraphenylborate(1-)/2-propanone/water
  4652. N,N,N-tributyl-1-butanaminium tetraphenylborate(1-)/acetonitrile/2-methylpropanenitrile
  4653. N,N,N-tributyl-1-butanaminium tetraphenylborate(1-)/acetonitrile/water
  4654. N,N,N-tributyl-1-butanaminium tetraphenylborate(1-)/benzene/2-methylpropanenitrile
  4655. N,N,N-tributyl-1-butanaminium tetraphenylborate(1-)/benzene/acetonitrile
  4656. N,N,N-tributyl-1-butanaminium tetraphenylborate(1-)/ethanol/acetonitrile
  4657. N,N,N-tributyl-1-butanaminium tetraphenylborate(1-)/methanol/acetonitrile
  4658. N,N,N-tributyl-1-butanaminium tetraphenylborate(1-)/methanol/N,N-dimethylformamide
  4659. N,N,N-tributyl-1-butanaminium tetraphenylborate(1-)/methanol/sulfinylbismethane
  4660. N,N,N-tributyl-1-butanaminium tetraphenylborate(1-)/N,N-dimethylformamide/acetonitrile
  4661. N,N,N-tributyl-1-butanaminium tetraphenylborate(1-)/nitromethane/nitrobenzene
  4662. N,N,N-tributyl-1-butanaminium tetraphenylborate(1-)/sulfinylbismethane/acetonitrile
  4663. N,N,N-tributyl-1-butanaminium tetraphenylborate(1-)/tetrachloromethane/acetonitrile
  4664. N,N,N-tributyl-1-butanaminium tetraphenylborate(1-)/tetrachloromethane/nitrobenzene
  4665. N,N,N-tributyl-1-butanaminium tetraphenylborate(1-)/water/2-butanone
  4666. N,N,N-tributyl-1-butanaminium/1,4-dimethylbenzene/4-methyl-1,3-dioxolan-2-one
  4667. N,N,N-tributyl-1-butanaminium/2-propanone/water
  4668. N,N,N-tributylbenzenemethanaminium chloride/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)/water
  4669. N,N,N-tributylbenzenemethanaminium chloride/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)/water
  4670. N,N,N-tributylbenzenemethanaminium chloride/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)/water
  4671. N,N,N-tributylbenzenemethanaminium chloride/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)/water
  4672. N,N,N-tributylbenzenemethanaminium chloride/ethanol/water
  4673. N,N,N-triethyl-1-butanaminium bromide/lithium bromide (LiBr)/water
  4674. N,N,N-triethyl-1-heptanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)/methanol/water
  4675. N,N,N-triethyl-1-hexanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)/methanol/water
  4676. N,N,N-triethyl-1-octanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)/1-butanol/water
  4677. N,N,N-triethyl-1-octanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)/acetonitrile/water
  4678. N,N,N-triethyl-1-octanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)/benzeneethanol/water
  4679. N,N,N-triethyl-1-octanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)/methanol/water
  4680. N,N,N-triethyl-2-hydroxyethanaminium bromide/lithium bromide (LiBr)/water
  4681. N,N,N-triethyl-2-hydroxyethanaminium bromide/N,N-dimethylformamide/water
  4682. N,N,N-triethylbenzenemethanaminium bromide/benzene/water
  4683. N,N,N-triethylbenzenemethanaminium bromide/water/nitrobenzene
  4684. N,N,N-triethylbenzenemethanaminium chloride/2-propanone/benzene
  4685. N,N,N-triethylbenzenemethanaminium chloride/ethanol/water
  4686. N,N,N-triethylbenzenemethanaminium chloride/sulfinylbismethane/water
  4687. N,N,N-triethylethanaminium benzoate/benzoic acid/acetonitrile
  4688. N,N,N-triethylethanaminium bis(benzenamine)tetrakis(thiocyanato-N)chromate(1-)/2-methyl-2-propanol/water
  4689. N,N,N-triethylethanaminium bis(benzenamine)tetrakis(thiocyanato-N)chromate(1-)/acetonitrile/water
  4690. N,N,N-triethylethanaminium bis(benzenamine)tetrakis(thiocyanato-N)chromate(1-)/methanol/water
  4691. N,N,N-triethylethanaminium bis(benzenamine)tetrakis(thiocyanato-N)chromate(1-)/perchloric acid sodium salt/water
  4692. N,N,N-triethylethanaminium bromide/(OC-6-22-δ)-tris(L-prolinato-N1,O2)cobalt/water
  4693. N,N,N-triethylethanaminium bromide/2-methyl-2-butanol/water
  4694. N,N,N-triethylethanaminium bromide/2-methyl-2-propanol/water
  4695. N,N,N-triethylethanaminium bromide/acetonitrile/water
  4696. N,N,N-triethylethanaminium bromide/argon/water
  4697. N,N,N-triethylethanaminium bromide/bromine/nitrobenzene
  4698. N,N,N-triethylethanaminium bromide/ethane/water
  4699. N,N,N-triethylethanaminium bromide/formamide/water
  4700. N,N,N-triethylethanaminium bromide/L-threonine/water
  4701. N,N,N-triethylethanaminium bromide/methane/water
  4702. N,N,N-triethylethanaminium bromide/N,N-dibutyl-1-butanamine N-oxide/water
  4703. N,N,N-triethylethanaminium bromide/propane/water
  4704. N,N,N-triethylethanaminium bromide/sodium bromide (NaBr)/water
  4705. N,N,N-triethylethanaminium bromide/water/1,3-dioxolan-2-one
  4706. N,N,N-triethylethanaminium bromide/water/1-Tetradecyl-3-methylimidazolium bromide
  4707. N,N,N-triethylethanaminium bromide/water/blood serum albumins
  4708. N,N,N-triethylethanaminium bromide/water/cadmium bromide (CdBr2)
  4709. N,N,N-triethylethanaminium bromide/water/cobalt bromide (CoBr2)
  4710. N,N,N-triethylethanaminium bromide/water/copper bromide (CuBr2)
  4711. N,N,N-triethylethanaminium bromide/water/L-sorbose
  4712. N,N,N-triethylethanaminium bromide/water/magnesium bromide (MgBr2)
  4713. N,N,N-triethylethanaminium bromide/water/N,N,N-tributyl-1-butanaminium salt with sulfuric acid dodecyl ester
  4714. N,N,N-triethylethanaminium bromide/water/N-glycyl-L-leucine
  4715. N,N,N-triethylethanaminium bromide/water/potassium bromide (KBr)
  4716. N,N,N-triethylethanaminium bromide/water/xylitol
  4717. N,N,N-triethylethanaminium chloride/1,2,3-propanetriol/benzene
  4718. N,N,N-triethylethanaminium chloride/acetic acid/benzene
  4719. N,N,N-triethylethanaminium chloride/acetonitrile/water
  4720. N,N,N-triethylethanaminium chloride/argon/2-methyl-2-propanol
  4721. N,N,N-triethylethanaminium chloride/argon/water
  4722. N,N,N-triethylethanaminium chloride/cobalt chloride (CoCl2)/water
  4723. N,N,N-triethylethanaminium chloride/copper chloride (CuCl2)/water
  4724. N,N,N-triethylethanaminium chloride/methane/water
  4725. N,N,N-triethylethanaminium chloride/methanol/water
  4726. N,N,N-triethylethanaminium chloride/N,N,N-triethylethanaminium bromide/water
  4727. N,N,N-triethylethanaminium chloride/nickel chloride (NiCl2)/water
  4728. N,N,N-triethylethanaminium chloride/sulfinylbismethane/water
  4729. N,N,N-triethylethanaminium chloride/water/1,3-dinitrobenzene
  4730. N,N,N-triethylethanaminium hexafluorophosphate(1-)/dihydro-2(3H)-furanone/1,3-dioxolan-2-one
  4731. N,N,N-triethylethanaminium iodide/1-propanol/water
  4732. N,N,N-triethylethanaminium iodide/2-methyl-2-propanol/water
  4733. N,N,N-triethylethanaminium iodide/acetonitrile/nitrobenzene
  4734. N,N,N-triethylethanaminium iodide/acetonitrile/water
  4735. N,N,N-triethylethanaminium iodide/argon/water
  4736. N,N,N-triethylethanaminium iodide/L-valine/water
  4737. N,N,N-triethylethanaminium iodide/methane/water
  4738. N,N,N-triethylethanaminium iodide/N,N,N-trimethylmethanaminium salt with 2,4,6-trinitrophenol (1:1)/dichloromethane
  4739. N,N,N-triethylethanaminium iodide/N,N-dimethylformamide/naphthalene
  4740. N,N,N-triethylethanaminium iodide/N,N-dimethylformamide/water
  4741. N,N,N-triethylethanaminium iodide/water/1,2-benzenedicarboxylic acid
  4742. N,N,N-triethylethanaminium nitrate/cobalt(2+) tetrafluoroborate(1-) (1:2)/acetonitrile
  4743. N,N,N-triethylethanaminium nitrate/dichloromethane/potassium iodide (KI)
  4744. N,N,N-triethylethanaminium perchlorate/2-propanone/water
  4745. N,N,N-triethylethanaminium perchlorate/acetonitrile/water
  4746. N,N,N-triethylethanaminium perchlorate/bromine/nitrobenzene
  4747. N,N,N-triethylethanaminium perchlorate/cadmium cyanide (Cd(CN)2)/N,N-dimethylformamide
  4748. N,N,N-triethylethanaminium perchlorate/dichloromethane/sodium iodide (NaI)
  4749. N,N,N-triethylethanaminium perchlorate/dihydro-2(3H)-furanone/1,3-dioxolan-2-one
  4750. N,N,N-triethylethanaminium perchlorate/ethanol/2-propanone
  4751. N,N,N-triethylethanaminium perchlorate/ethanol/water
  4752. N,N,N-triethylethanaminium perchlorate/methanol/2-propanol
  4753. N,N,N-triethylethanaminium perchlorate/methanol/acetonitrile
  4754. N,N,N-triethylethanaminium perchlorate/methanol/water
  4755. N,N,N-triethylethanaminium perchlorate/N,N-dimethylformamide/copper chloride (CuCl2)
  4756. N,N,N-triethylethanaminium perchlorate/N,N-dimethylformamide/water
  4757. N,N,N-triethylethanaminium perchlorate/sulfinylbismethane/water
  4758. N,N,N-triethylethanaminium perchlorate/tetrachloromethane/methanol
  4759. N,N,N-triethylethanaminium perchlorate/water/1,3-dioxolan-2-one
  4760. N,N,N-triethylethanaminium perchlorate/water/2-butanone
  4761. N,N,N-triethylethanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)/N,N,N-tributyl-1-butanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)/N,N,N-tributyl-1-butanaminium salt ...
  4762. N,N,N-triethylethanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)/tetrapropylammonium bis(trifluoromethanesulfonyl)imide/N,N,N-tributyl-1-butanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]metha...
  4763. N,N,N-triethylethanaminium salt with 2,4,6-trinitrophenol (1:1)/acetonitrile/water
  4764. N,N,N-triethylethanaminium salt with 2,4,6-trinitrophenol (1:1)/dichloromethane/potassium iodide (KI)
  4765. N,N,N-triethylethanaminium salt with 2,4,6-trinitrophenol (1:1)/dichloromethane/sodium iodide (NaI)
  4766. N,N,N-triethylethanaminium salt with 2,4,6-trinitrophenol (1:1)/dichloromethane/water
  4767. N,N,N-triethylethanaminium salt with 2,4,6-trinitrophenol (1:1)/nitric acid sodium salt/water
  4768. N,N,N-triethylethanaminium salt with 2-hydroxybenzoic acid (1:1)/2-hydroxybenzoic acid/acetonitrile
  4769. N,N,N-triethylethanaminium tetrafluoroborate(1-)/dihydro-2(3H)-furanone/1,3-dioxolan-2-one
  4770. N,N,N-triethylethanaminium tetrafluoroborate(1-)/water/ω-hydroxy-α-(4-(1,1,3,3-tetramethylbutyl)phenyl)poly(oxy-1,2-ethanediyl)
  4771. N,N,N-triethylethanaminium tetrafluoroborate(1-)/water/2-[2-[3,4-bis(2-hydroxyethoxy)oxolan-2-yl]-2-(2-hydroxyethoxy)ethoxy]ethyl dodecanoate
  4772. N,N,N-triethylethanaminium tetrafluoroborate(1-)/water/poly(ethylene glycol) sorbitan monooleate
  4773. N,N,N-triethylethanaminium tetrafluoroborate(1-)/water/polyethylene glycol hexadecyl ether (Brij 56)
  4774. N,N,N-triethylethanaminium tetrafluoroborate(1-)/water/polyethylene glycol hexadecyl ether (Brij 58)
  4775. N,N,N-triethylethanaminium tetraphenylborate(1-)/1,4-dioxane/2-methylpropanenitrile
  4776. N,N,N-triethylethanaminium tetraphenylborate(1-)/2-methyl-2-propanol/water
  4777. N,N,N-triethylethanaminium tetraphenylborate(1-)/2-propanol/water
  4778. N,N,N-triethylethanaminium tetraphenylborate(1-)/acetonitrile/water
  4779. N,N,N-triethylethanaminium tetraphenylborate(1-)/benzene/2-methylpropanenitrile
  4780. N,N,N-triethylethanaminium tetraphenylborate(1-)/tetrachloromethane/2-methylpropanenitrile
  4781. N,N,N-triethylethanaminium tetraphenylborate(1-)/tetrachloromethane/acetonitrile
  4782. N,N,N-triheptyl-1-heptanaminium bromide/formamide/water
  4783. N,N,N-triheptyl-1-heptanaminium bromide/hexamethylphosphoric triamide/water
  4784. N,N,N-triheptyl-1-heptanaminium bromide/methanol/acetonitrile
  4785. N,N,N-triheptyl-1-heptanaminium bromide/methanol/water
  4786. N,N,N-triheptyl-1-heptanaminium chloride/tetrahydrofuran/tetrachloromethane
  4787. N,N,N-trihexyl-1-hexanaminium bromide/1,2,3-propanetriol/benzene
  4788. N,N,N-trihexyl-1-hexanaminium bromide/2-propanone/water
  4789. N,N,N-trihexyl-1-hexanaminium bromide/formamide/water
  4790. N,N,N-trihexyl-1-hexanaminium bromide/hexamethylphosphoric triamide/water
  4791. N,N,N-trihexyl-1-hexanaminium bromide/methanol/acetonitrile
  4792. N,N,N-trihexyl-1-hexanaminium bromide/methanol/water
  4793. N,N,N-trihexyl-1-hexanaminium iodide/β-D-fructofuranosyl α-D-glucopyranoside/formamide
  4794. N,N,N-trihexyl-1-hexanaminium iodide/N,N-dimethylformamide/water
  4795. N,N,N-trihexyl-1-hexanaminium iodide/urea/formamide
  4796. N,N,N-trihexyl-1-hexanaminium perchlorate/methanol/acetonitrile
  4797. N,N,N-trimethyl-1-butanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)/acetic acid/water
  4798. N,N,N-trimethyl-1-butanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)/benzeneethanol/water
  4799. N,N,N-trimethyl-1-decanaminium bromide/1-butanol/water
  4800. N,N,N-trimethyl-1-decanaminium bromide/1-pentanol/water
  4801. N,N,N-trimethyl-1-decanaminium bromide/1-propanol/water
  4802. N,N,N-trimethyl-1-decanaminium bromide/argon/water
  4803. N,N,N-trimethyl-1-decanaminium bromide/ethane/water
  4804. N,N,N-trimethyl-1-decanaminium bromide/methane/water
  4805. N,N,N-trimethyl-1-decanaminium bromide/propane/water
  4806. N,N,N-trimethyl-1-decanaminium bromide/sodium bromide (NaBr)/water
  4807. N,N,N-trimethyl-1-decanaminium bromide/tetrafluoromethane/water
  4808. N,N,N-trimethyl-1-decanaminium bromide/water/oxygen
  4809. N,N,N-trimethyl-1-dodecanaminium bromide/α-hydro-ω-hydroxypoly(oxy(methyl-1,2-ethanediyl))/water
  4810. N,N,N-trimethyl-1-dodecanaminium bromide/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)/water
  4811. N,N,N-trimethyl-1-dodecanaminium bromide/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)/water
  4812. N,N,N-trimethyl-1-dodecanaminium bromide/β-cyclodextrin/water
  4813. N,N,N-trimethyl-1-dodecanaminium bromide/(6R,7R)-7-[[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid hydrate/water
  4814. N,N,N-trimethyl-1-dodecanaminium bromide/1-butanol/water
  4815. N,N,N-trimethyl-1-dodecanaminium bromide/1-dodecyl-3-methyl-1H-imidazolium bromide/water
  4816. N,N,N-trimethyl-1-dodecanaminium bromide/1-pentanol/sodium bromide (NaBr)
  4817. N,N,N-trimethyl-1-dodecanaminium bromide/1-pentanol/water
  4818. N,N,N-trimethyl-1-dodecanaminium bromide/1-propanol/water
  4819. N,N,N-trimethyl-1-dodecanaminium bromide/2-hydroxy-1,2,3-propanetricarboxylic acid trisodium salt/water
  4820. N,N,N-trimethyl-1-dodecanaminium bromide/2-propanol/water
  4821. N,N,N-trimethyl-1-dodecanaminium bromide/argon/water
  4822. N,N,N-trimethyl-1-dodecanaminium bromide/carbonic acid disodium salt/water
  4823. N,N,N-trimethyl-1-dodecanaminium bromide/glycine/water
  4824. N,N,N-trimethyl-1-dodecanaminium bromide/L-glutamine/water
  4825. N,N,N-trimethyl-1-dodecanaminium bromide/methanol/water
  4826. N,N,N-trimethyl-1-dodecanaminium bromide/N,N,N-tributyl-1-butanaminium bromide/water
  4827. N,N,N-trimethyl-1-dodecanaminium bromide/N,N,N-tributyl-1-butanaminium nitrate/water
  4828. N,N,N-trimethyl-1-dodecanaminium bromide/N,N,N-tripentyl-1-pentanaminium nitrate/water
  4829. N,N,N-trimethyl-1-dodecanaminium bromide/N,N,N-tripropyl-1-propanaminium bromide/water
  4830. N,N,N-trimethyl-1-dodecanaminium bromide/N,N,N-tripropyl-1-propanaminium nitrate/water
  4831. N,N,N-trimethyl-1-dodecanaminium bromide/N,N-dimethyl-1-dodecanamine N-oxide/water
  4832. N,N,N-trimethyl-1-dodecanaminium bromide/nitrogen/water
  4833. N,N,N-trimethyl-1-dodecanaminium bromide/phosphoric acid disodium salt/water
  4834. N,N,N-trimethyl-1-dodecanaminium bromide/phosphoric acid monosodium salt/water
  4835. N,N,N-trimethyl-1-dodecanaminium bromide/phosphoric acid trisodium salt/water
  4836. N,N,N-trimethyl-1-dodecanaminium bromide/sodium bromide (NaBr)/water
  4837. N,N,N-trimethyl-1-dodecanaminium bromide/sodium chloride (NaCl)/water
  4838. N,N,N-trimethyl-1-dodecanaminium bromide/urea/water
  4839. N,N,N-trimethyl-1-dodecanaminium bromide/water/1-Hexadecyl-3-methylimidazolium chloride
  4840. N,N,N-trimethyl-1-dodecanaminium bromide/water/N,N,N-tripentyl-1-pentanaminium bromide
  4841. N,N,N-trimethyl-1-dodecanaminium bromide/water/sulfuric acid disodium salt
  4842. N,N,N-trimethyl-1-dodecanaminium bromide/water/Tetrapentylammonium acetate
  4843. N,N,N-trimethyl-1-dodecanaminium bromide/water/Tetrapropylammonium acetate
  4844. N,N,N-trimethyl-1-dodecanaminium chloride/1,1,1,2-tetrachloroethane/2-propanol
  4845. N,N,N-trimethyl-1-dodecanaminium chloride/1,1,1,2-tetrachloroethane/ethanol
  4846. N,N,N-trimethyl-1-dodecanaminium chloride/1,1,1,2-tetrachloroethane/methanol
  4847. N,N,N-trimethyl-1-dodecanaminium chloride/1-pentanol/water
  4848. N,N,N-trimethyl-1-dodecanaminium chloride/2-butoxy-N-[2-(diethylamino)ethyl]-4-quinolinecarboxamide monohydrochloride/water
  4849. N,N,N-trimethyl-1-dodecanaminium chloride/ethanol/water
  4850. N,N,N-trimethyl-1-dodecanaminium chloride/trichloromethane/N,N,N-trimethylmethanaminium chloride
  4851. N,N,N-trimethyl-1-dodecanaminium chloride/water/dodecyldiethoxylamine oxide
  4852. N,N,N-trimethyl-1-dodecanaminium chloride/water/N-Tetradecyl-N,N-dimethyl-N-(2,3-epoxypropyl)ammonium chloride
  4853. N,N,N-trimethyl-1-hexadecanaminium bromide/β-D-fructofuranosyl α-D-glucopyranoside/water
  4854. N,N,N-trimethyl-1-hexadecanaminium bromide/1-butanol/water
  4855. N,N,N-trimethyl-1-hexadecanaminium bromide/1-ethyl-3-methyl-1H-imidazolium bromide/water
  4856. N,N,N-trimethyl-1-hexadecanaminium bromide/1-pentanol/water
  4857. N,N,N-trimethyl-1-hexadecanaminium bromide/1-propanol/water
  4858. N,N,N-trimethyl-1-hexadecanaminium bromide/2-hydroxypropane-1,2,3-tricarboxylic acid/water
  4859. N,N,N-trimethyl-1-hexadecanaminium bromide/2-propanol/water
  4860. N,N,N-trimethyl-1-hexadecanaminium bromide/4-O-α-D-glucopyranosyl-D-glucose/water
  4861. N,N,N-trimethyl-1-hexadecanaminium bromide/5-hydroxy-6-methyl-3,4-pyridinedimethanol hydrochloride/water
  4862. N,N,N-trimethyl-1-hexadecanaminium bromide/argon/water
  4863. N,N,N-trimethyl-1-hexadecanaminium bromide/D-mannitol/water
  4864. N,N,N-trimethyl-1-hexadecanaminium bromide/D-xylose/water
  4865. N,N,N-trimethyl-1-hexadecanaminium bromide/DL-proline/formamide
  4866. N,N,N-trimethyl-1-hexadecanaminium bromide/ethane/water
  4867. N,N,N-trimethyl-1-hexadecanaminium bromide/L-leucine/water
  4868. N,N,N-trimethyl-1-hexadecanaminium bromide/L-lysine monohydrochloride/water
  4869. N,N,N-trimethyl-1-hexadecanaminium bromide/L-valine/water
  4870. N,N,N-trimethyl-1-hexadecanaminium bromide/methane/water
  4871. N,N,N-trimethyl-1-hexadecanaminium bromide/methanol/water
  4872. N,N,N-trimethyl-1-hexadecanaminium bromide/poly(dimethylsiloxane)/water
  4873. N,N,N-trimethyl-1-hexadecanaminium bromide/propane/water
  4874. N,N,N-trimethyl-1-hexadecanaminium bromide/sodium bromide (NaBr)/water
  4875. N,N,N-trimethyl-1-hexadecanaminium bromide/sodium chloride (NaCl)/water
  4876. N,N,N-trimethyl-1-hexadecanaminium bromide/tetrafluoromethane/water
  4877. N,N,N-trimethyl-1-hexadecanaminium bromide/water/ω-hydroxy-α-(4-(1,1,3,3-tetramethylbutyl)phenyl)poly(oxy-1,2-ethanediyl)
  4878. N,N,N-trimethyl-1-hexadecanaminium bromide/water/1-butyl-2,3-dimethylimidazolium bromide
  4879. N,N,N-trimethyl-1-hexadecanaminium bromide/water/1-butyl-3-methyl-1H-imidazolium bromide
  4880. N,N,N-trimethyl-1-hexadecanaminium bromide/water/1-butyl-3-methyl-1H-imidazolium chloride
  4881. N,N,N-trimethyl-1-hexadecanaminium bromide/water/1-ethenyl-2-pyrrolidinone homopolymer
  4882. N,N,N-trimethyl-1-hexadecanaminium bromide/water/2,6-di-tert-butyl-4-(hydroxymethyl)phenol
  4883. N,N,N-trimethyl-1-hexadecanaminium bromide/water/3-(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ylidene)-N-methyl-1-propanamine hydrochloride
  4884. N,N,N-trimethyl-1-hexadecanaminium bromide/water/4,4'-(1-methylethylidene)bis(2,6-dibromophenol)
  4885. N,N,N-trimethyl-1-hexadecanaminium bromide/water/4,4'-(1-methylethylidene)bisphenol
  4886. N,N,N-trimethyl-1-hexadecanaminium bromide/water/Butanediyl-1,4-bis(dimethylcetyl)ammonium bromide
  4887. N,N,N-trimethyl-1-hexadecanaminium bromide/water/gelatin
  4888. N,N,N-trimethyl-1-hexadecanaminium bromide/water/L-sorbose
  4889. N,N,N-trimethyl-1-hexadecanaminium bromide/water/lysozyme
  4890. N,N,N-trimethyl-1-hexadecanaminium bromide/water/oxygen
  4891. N,N,N-trimethyl-1-hexadecanaminium bromide/water/Rutin trihydrate
  4892. N,N,N-trimethyl-1-hexadecanaminium bromide/water/trichloroethene
  4893. N,N,N-trimethyl-1-hexadecanaminium bromide/water/xylitol
  4894. N,N,N-trimethyl-1-hexadecanaminium chloride/1,1,1,2-tetrachloroethane/2-propanol
  4895. N,N,N-trimethyl-1-hexadecanaminium chloride/1,1,1,2-tetrachloroethane/ethanol
  4896. N,N,N-trimethyl-1-hexadecanaminium chloride/1,1,1,2-tetrachloroethane/methanol
  4897. N,N,N-trimethyl-1-hexadecanaminium chloride/2-bromo-2-chloro-1,1,1-trifluoroethane/water
  4898. N,N,N-trimethyl-1-hexadecanaminium chloride/2-chloro-2-(difluoromethoxy)-1,1,1-trifluoroethane/water
  4899. N,N,N-trimethyl-1-hexadecanaminium chloride/benzene/nitrobenzene
  4900. N,N,N-trimethyl-1-hexadecanaminium chloride/sodium chloride (NaCl)/water
  4901. N,N,N-trimethyl-1-hexadecanaminium chloride/water/gelatin
  4902. N,N,N-trimethyl-1-octadecanaminium chloride/methanol/water
  4903. N,N,N-trimethyl-1-octadecanaminium formate/methanol/water
  4904. N,N,N-trimethyl-1-octanaminium bromide/2-propanol/water
  4905. N,N,N-trimethyl-1-octanaminium bromide/ethanol/water
  4906. N,N,N-trimethyl-1-tetradecanaminium bromide/β-D-fructofuranosyl α-D-glucopyranoside/ethanol
  4907. N,N,N-trimethyl-1-tetradecanaminium bromide/1-butanol/water
  4908. N,N,N-trimethyl-1-tetradecanaminium bromide/1-pentanol/water
  4909. N,N,N-trimethyl-1-tetradecanaminium bromide/2-propanol/water
  4910. N,N,N-trimethyl-1-tetradecanaminium bromide/acetonitrile/water
  4911. N,N,N-trimethyl-1-tetradecanaminium bromide/argon/water
  4912. N,N,N-trimethyl-1-tetradecanaminium bromide/ethanol/sodium chloride (NaCl)
  4913. N,N,N-trimethyl-1-tetradecanaminium bromide/ethanol/water
  4914. N,N,N-trimethyl-1-tetradecanaminium bromide/L-valine/water
  4915. N,N,N-trimethyl-1-tetradecanaminium bromide/N,N-dimethyl-1-dodecanamine N-oxide/water
  4916. N,N,N-trimethyl-1-tetradecanaminium bromide/nitrogen/water
  4917. N,N,N-trimethyl-1-tetradecanaminium bromide/sodium bromide (NaBr)/water
  4918. N,N,N-trimethyl-1-tetradecanaminium bromide/water/potassium bromide (KBr)
  4919. N,N,N-trimethylbenzenaminium benzenesulfonate/2-methyl-2-propanol/N-methylacetamide
  4920. N,N,N-trimethylbenzenaminium bromide/2-methyl-2-propanol/N-methylacetamide
  4921. N,N,N-trimethylbenzenemethanaminium chloride/sodium chloride (NaCl)/water
  4922. N,N,N-trimethylmethanaminium (OC-6-11)-diamminetetrakis(thiocyanato-N)chromate(1-)/perchloric acid sodium salt/water
  4923. N,N,N-trimethylmethanaminium (T-4)-tetrachlorozincate(2-) (2:1)/ethanol/water
  4924. N,N,N-trimethylmethanaminium acetate/(7R)-4-hydroxy-N,N,N-trimethyl-10-oxo-7-((1-oxooctyl)oxy)-3,5,9-trioxa-4-phosphaheptadecan-1-aminium inner salt 4-oxide/water
  4925. N,N,N-trimethylmethanaminium acetate/2,5-piperazinedione/water
  4926. N,N,N-trimethylmethanaminium bis(benzenamine)tetrakis(thiocyanato-N)chromate(1-)/2-methyl-2-propanol/water
  4927. N,N,N-trimethylmethanaminium bis(benzenamine)tetrakis(thiocyanato-N)chromate(1-)/acetonitrile/water
  4928. N,N,N-trimethylmethanaminium bis(benzenamine)tetrakis(thiocyanato-N)chromate(1-)/methanol/water
  4929. N,N,N-trimethylmethanaminium bis(benzenamine)tetrakis(thiocyanato-N)chromate(1-)/perchloric acid sodium salt/water
  4930. N,N,N-trimethylmethanaminium bromide/2-methyl-2-butanol/water
  4931. N,N,N-trimethylmethanaminium bromide/2-methyl-2-propanol/water
  4932. N,N,N-trimethylmethanaminium bromide/2-propanol/water
  4933. N,N,N-trimethylmethanaminium bromide/acetonitrile/water
  4934. N,N,N-trimethylmethanaminium bromide/cesium bromide (CsBr)/water-d2
  4935. N,N,N-trimethylmethanaminium bromide/ethane/water
  4936. N,N,N-trimethylmethanaminium bromide/hexamethylphosphoric triamide/water
  4937. N,N,N-trimethylmethanaminium bromide/L-arginine/water
  4938. N,N,N-trimethylmethanaminium bromide/L-histidine/water
  4939. N,N,N-trimethylmethanaminium bromide/L-threonine/water
  4940. N,N,N-trimethylmethanaminium bromide/lithium bromide (LiBr)/water-d2
  4941. N,N,N-trimethylmethanaminium bromide/methane/water
  4942. N,N,N-trimethylmethanaminium bromide/methanol/acetonitrile
  4943. N,N,N-trimethylmethanaminium bromide/methanol/benzene
  4944. N,N,N-trimethylmethanaminium bromide/methanol/N,N-dimethylformamide
  4945. N,N,N-trimethylmethanaminium bromide/methanol/water
  4946. N,N,N-trimethylmethanaminium bromide/N,N,N-triethylethanaminium bromide/water
  4947. N,N,N-trimethylmethanaminium bromide/N,N-dimethylformamide/water
  4948. N,N,N-trimethylmethanaminium bromide/potassium bromide (KBr)/water-d2
  4949. N,N,N-trimethylmethanaminium bromide/propane/water
  4950. N,N,N-trimethylmethanaminium bromide/sodium bromide (NaBr)/water
  4951. N,N,N-trimethylmethanaminium bromide/sulfinylbismethane/water
  4952. N,N,N-trimethylmethanaminium bromide/water/1,3-dioxolan-2-one
  4953. N,N,N-trimethylmethanaminium bromide/water/cadmium bromide (CdBr2)
  4954. N,N,N-trimethylmethanaminium bromide/water/calcium bromide (CaBr2)
  4955. N,N,N-trimethylmethanaminium bromide/water/cobalt bromide (CoBr2)
  4956. N,N,N-trimethylmethanaminium bromide/water/copper bromide (CuBr2)
  4957. N,N,N-trimethylmethanaminium bromide/water/magnesium bromide (MgBr2)
  4958. N,N,N-trimethylmethanaminium bromide/water/N,N'-dimethylurea
  4959. N,N,N-trimethylmethanaminium bromide/water/potassium bromide (KBr)
  4960. N,N,N-trimethylmethanaminium carbonate (1:1)/carbonic acid dimethyl ester/methanol
  4961. N,N,N-trimethylmethanaminium carbonate (1:1)/methanol/water
  4962. N,N,N-trimethylmethanaminium chloride/2,2,2-trifluoroethanol/water
  4963. N,N,N-trimethylmethanaminium chloride/sodium chloride (NaCl)/water
  4964. N,N,N-trimethylmethanaminium chloride/water/1,2-benzenedicarboxylic acid
  4965. N,N,N-trimethylmethanaminium chloride/water/1,3-dioxolan-2-one
  4966. N,N,N-trimethylmethanaminium chloride/water/3-methylbenzoic acid
  4967. N,N,N-trimethylmethanaminium chloride/water/4-hydroxybenzoic acid
  4968. N,N,N-trimethylmethanaminium chloride/water/4-methylbenzoic acid
  4969. N,N,N-trimethylmethanaminium chloride/water/hydroxyacetic acid
  4970. N,N,N-trimethylmethanaminium hexafluorophosphate(1-)/N,N-dimethylformamide/water
  4971. N,N,N-trimethylmethanaminium iodide/2-methyl-2-propanol/water
  4972. N,N,N-trimethylmethanaminium nitrate/methanol/water
  4973. N,N,N-trimethylmethanaminium nitrate/tetrachloromethane/acetonitrile
  4974. N,N,N-trimethylmethanaminium perchlorate/2-propanone/water
  4975. N,N,N-trimethylmethanaminium perchlorate/acetic acid/water
  4976. N,N,N-trimethylmethanaminium perchlorate/acetonitrile/water
  4977. N,N,N-trimethylmethanaminium perchlorate/ethanol/water
  4978. N,N,N-trimethylmethanaminium perchlorate/methanol/acetonitrile
  4979. N,N,N-trimethylmethanaminium perchlorate/methanol/water
  4980. N,N,N-trimethylmethanaminium perchlorate/N,N-dimethylformamide/water
  4981. N,N,N-trimethylmethanaminium perchlorate/perchloric acid/water
  4982. N,N,N-trimethylmethanaminium perchlorate/sulfinylbismethane/water
  4983. N,N,N-trimethylmethanaminium perchlorate/water/2-butanone
  4984. N,N,N-trimethylmethanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)/N,N,N-triethylethanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)/N,N,N-tributyl-1-butanaminium salt w...
  4985. N,N,N-trimethylmethanaminium salt with 1-propene-1,1,2,3,3-pentacarbonitrile/tetrachloromethane/2-propanone
  4986. N,N,N-trimethylmethanaminium salt with 1-propene-1,1,2,3,3-pentacarbonitrile/tetrachloromethane/nitrobenzene
  4987. N,N,N-trimethylmethanaminium salt with 2,4,6-trinitrophenol (1:1)/dichloromethane/water
  4988. N,N,N-trimethylmethanaminium salt with 2,4,6-trinitrophenol (1:1)/nitric acid sodium salt/water
  4989. N,N,N-trimethylmethanaminium tetraphenylborate(1-)/2-methyl-2-propanol/water
  4990. N,N,N-trimethylmethanaminium tetraphenylborate(1-)/2-propanol/water
  4991. N,N,N-trimethylmethanaminium tetraphenylborate(1-)/acetonitrile/water
  4992. N,N,N-trimethylmethanaminium tetraphenylborate(1-)/tetrachloromethane/acetonitrile
  4993. N,N,N-trimethylmethanaminium thiocyanate/methanol/water
  4994. N,N,N-trimethylmethanaminium/2-propanone/water
  4995. N,N,N-trioctyl-1-octanaminium bromide/decanoic acid/water
  4996. N,N,N-trioctyl-1-octanaminium bromide/methanol/water
  4997. N,N,N-tripentyl-1-pentanaminium hydroxide/methane/water
  4998. N,N,N-tripentyl-1-pentanaminium iodide/β-D-fructofuranosyl α-D-glucopyranoside/formamide
  4999. N,N,N-tripentyl-1-pentanaminium iodide/sulfinylbismethane/water
  5000. N,N,N-tripentyl-1-pentanaminium iodide/urea/formamide
  5001. N,N,N-tripentyl-1-pentanaminium perchlorate/2-propanol/water
  5002. N,N,N-tripropyl-1-propanaminium (OC-6-11)-diamminetetrakis(thiocyanato-N)chromate(1-)/perchloric acid sodium salt/water
  5003. N,N,N-tripropyl-1-propanaminium bis(benzenamine)tetrakis(thiocyanato-N)chromate(1-)/2-methyl-2-propanol/water
  5004. N,N,N-tripropyl-1-propanaminium bis(benzenamine)tetrakis(thiocyanato-N)chromate(1-)/acetonitrile/water
  5005. N,N,N-tripropyl-1-propanaminium bis(benzenamine)tetrakis(thiocyanato-N)chromate(1-)/methanol/water
  5006. N,N,N-tripropyl-1-propanaminium bis(benzenamine)tetrakis(thiocyanato-N)chromate(1-)/perchloric acid sodium salt/water
  5007. N,N,N-tripropyl-1-propanaminium bromide/α-hydro-ω-hydroxypoly(oxy(methyl-1,2-ethanediyl))/water
  5008. N,N,N-tripropyl-1-propanaminium bromide/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)/water
  5009. N,N,N-tripropyl-1-propanaminium bromide/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)/water
  5010. N,N,N-tripropyl-1-propanaminium bromide/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)/water
  5011. N,N,N-tripropyl-1-propanaminium bromide/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)/water
  5012. N,N,N-tripropyl-1-propanaminium bromide/(OC-6-11)-tris(2,4-pentanedionato-κO,κO')cobalt/water
  5013. N,N,N-tripropyl-1-propanaminium bromide/(OC-6-21-λ)-tris(L-alaninato-κN,κO)cobalt/water
  5014. N,N,N-tripropyl-1-propanaminium bromide/1,2-propanediol/water
  5015. N,N,N-tripropyl-1-propanaminium bromide/1,6-hexanediol/1-propanol
  5016. N,N,N-tripropyl-1-propanaminium bromide/1,6-hexanediol/2-butanone
  5017. N,N,N-tripropyl-1-propanaminium bromide/1,6-hexanediol/2-propanol
  5018. N,N,N-tripropyl-1-propanaminium bromide/1,6-hexanediol/2-propanone
  5019. N,N,N-tripropyl-1-propanaminium bromide/1,6-hexanediol/acetic acid methyl ester
  5020. N,N,N-tripropyl-1-propanaminium bromide/1,6-hexanediol/benzene
  5021. N,N,N-tripropyl-1-propanaminium bromide/1,6-hexanediol/ethanol
  5022. N,N,N-tripropyl-1-propanaminium bromide/1,6-hexanediol/methanol
  5023. N,N,N-tripropyl-1-propanaminium bromide/1-dodecyl-3-methyl-1H-imidazolium bromide/water
  5024. N,N,N-tripropyl-1-propanaminium bromide/1-heptene/1,6-hexanediol
  5025. N,N,N-tripropyl-1-propanaminium bromide/1-heptyne/1,6-hexanediol
  5026. N,N,N-tripropyl-1-propanaminium bromide/1-hexene/1,6-hexanediol
  5027. N,N,N-tripropyl-1-propanaminium bromide/1-octyne/1,6-hexanediol
  5028. N,N,N-tripropyl-1-propanaminium bromide/1-propanol/water
  5029. N,N,N-tripropyl-1-propanaminium bromide/2-hydroxy-1,2,3-propanetricarboxylic acid trisodium salt/water
  5030. N,N,N-tripropyl-1-propanaminium bromide/2-methyl-2-butanol/water
  5031. N,N,N-tripropyl-1-propanaminium bromide/2-methyl-2-propanol/N-methylacetamide
  5032. N,N,N-tripropyl-1-propanaminium bromide/2-methyl-2-propanol/water
  5033. N,N,N-tripropyl-1-propanaminium bromide/2-propanol/water
  5034. N,N,N-tripropyl-1-propanaminium bromide/2-propanone/sulfinylbismethane
  5035. N,N,N-tripropyl-1-propanaminium bromide/3-methyl-2-butanol/water
  5036. N,N,N-tripropyl-1-propanaminium bromide/acetonitrile/water
  5037. N,N,N-tripropyl-1-propanaminium bromide/benzene/water
  5038. N,N,N-tripropyl-1-propanaminium bromide/carbonic acid disodium salt/water
  5039. N,N,N-tripropyl-1-propanaminium bromide/cycloheptane/1,6-hexanediol
  5040. N,N,N-tripropyl-1-propanaminium bromide/cyclooctane/1,6-hexanediol
  5041. N,N,N-tripropyl-1-propanaminium bromide/cyclopentane/1,6-hexanediol
  5042. N,N,N-tripropyl-1-propanaminium bromide/DL-alanine/water
  5043. N,N,N-tripropyl-1-propanaminium bromide/DL-valine/water
  5044. N,N,N-tripropyl-1-propanaminium bromide/ethane/water
  5045. N,N,N-tripropyl-1-propanaminium bromide/ethanol/water
  5046. N,N,N-tripropyl-1-propanaminium bromide/glycine/water
  5047. N,N,N-tripropyl-1-propanaminium bromide/hexamethylphosphoric triamide/water
  5048. N,N,N-tripropyl-1-propanaminium bromide/L-leucine/water
  5049. N,N,N-tripropyl-1-propanaminium bromide/lithium bromide (LiBr)/water
  5050. N,N,N-tripropyl-1-propanaminium bromide/methane/water
  5051. N,N,N-tripropyl-1-propanaminium bromide/methanol/acetonitrile
  5052. N,N,N-tripropyl-1-propanaminium bromide/methanol/N,N-dimethylformamide
  5053. N,N,N-tripropyl-1-propanaminium bromide/methanol/water
  5054. N,N,N-tripropyl-1-propanaminium bromide/N,N,N-triethylethanaminium bromide/water
  5055. N,N,N-tripropyl-1-propanaminium bromide/N,N,N-trimethylmethanaminium bromide/water
  5056. N,N,N-tripropyl-1-propanaminium bromide/N,N-dimethylformamide/2-butanone
  5057. N,N,N-tripropyl-1-propanaminium bromide/N,N-dimethylformamide/water
  5058. N,N,N-tripropyl-1-propanaminium bromide/N-(1-methylethyl)-2-propenamide homopolymer/water
  5059. N,N,N-tripropyl-1-propanaminium bromide/phosphoric acid disodium salt/water
  5060. N,N,N-tripropyl-1-propanaminium bromide/phosphoric acid monosodium salt/water
  5061. N,N,N-tripropyl-1-propanaminium bromide/phosphoric acid trisodium salt/water
  5062. N,N,N-tripropyl-1-propanaminium bromide/propane/water
  5063. N,N,N-tripropyl-1-propanaminium bromide/sodium bromide (NaBr)/water
  5064. N,N,N-tripropyl-1-propanaminium bromide/sulfinylbismethane/acetonitrile
  5065. N,N,N-tripropyl-1-propanaminium bromide/sulfinylbismethane/water
  5066. N,N,N-tripropyl-1-propanaminium bromide/water/1-butyl-2,3-dimethyl-1H-imidazolium chloride
  5067. N,N,N-tripropyl-1-propanaminium bromide/water/cesium bromide (CsBr)
  5068. N,N,N-tripropyl-1-propanaminium bromide/water/N,N,N-tributyl-1-butanaminium salt with sulfuric acid dodecyl ester
  5069. N,N,N-tripropyl-1-propanaminium bromide/water/potassium bromide (KBr)
  5070. N,N,N-tripropyl-1-propanaminium bromide/water/sulfuric acid disodium salt
  5071. N,N,N-tripropyl-1-propanaminium chloride/ethanol/water
  5072. N,N,N-tripropyl-1-propanaminium chloride/methanol/water
  5073. N,N,N-tripropyl-1-propanaminium chloride/sodium chloride (NaCl)/water
  5074. N,N,N-tripropyl-1-propanaminium hydroxide/methane/water
  5075. N,N,N-tripropyl-1-propanaminium iodide/2-methyl-2-propanol/N-methylacetamide
  5076. N,N,N-tripropyl-1-propanaminium iodide/2-methyl-2-propanol/water
  5077. N,N,N-tripropyl-1-propanaminium iodide/acetonitrile/water
  5078. N,N,N-tripropyl-1-propanaminium iodide/ethanol/water
  5079. N,N,N-tripropyl-1-propanaminium iodide/methanol/water
  5080. N,N,N-tripropyl-1-propanaminium iodide/N,N-dimethylformamide/water
  5081. N,N,N-tripropyl-1-propanaminium iodide/sulfinylbismethane/water
  5082. N,N,N-tripropyl-1-propanaminium perchlorate/2-propanone/water
  5083. N,N,N-tripropyl-1-propanaminium perchlorate/acetic acid/water
  5084. N,N,N-tripropyl-1-propanaminium perchlorate/ethanol/water
  5085. N,N,N-tripropyl-1-propanaminium perchlorate/methanol/water
  5086. N,N,N-tripropyl-1-propanaminium salt with 2,4,6-trinitrophenol (1:1)/dichloromethane/water
  5087. N,N,N-tripropyl-1-propanaminium salt with 2,4,6-trinitrophenol (1:1)/nitric acid sodium salt/water
  5088. N,N,N-tripropyl-1-propanaminium tetraphenylborate(1-)/2-methyl-2-propanol/water
  5089. N,N,N-tripropyl-1-propanaminium tetraphenylborate(1-)/2-propanol/water
  5090. N,N,N-tripropyl-1-propanaminium tetraphenylborate(1-)/acetonitrile/water
  5091. N,N,N-tripropyl-1-propanaminium tetraphenylborate(1-)/benzene/2-methylpropanenitrile
  5092. N,N,N-tripropyl-1-propanaminium tetraphenylborate(1-)/ethanol/water
  5093. N,N,N-tripropyl-1-propanaminium tetraphenylborate(1-)/methanol/water
  5094. N,N,N-tripropyl-1-propanaminium tetraphenylborate(1-)/tetrachloromethane/2-methylpropanenitrile
  5095. N,N,N-tripropyl-1-propanaminium tetraphenylborate(1-)/tetrachloromethane/acetonitrile
  5096. N,N,N-tripropyl-1-propanaminium/2-propanone/water
  5097. N,N-bis(carboxymethyl)glycine disodium salt/nitric acid/water
  5098. N,N-bis(carboxymethyl)glycine/formic acid lanthanum(3+) salt/water
  5099. N,N-dibutyl-1-butanamine compd. with 2,4,6-trinitrophenol (1:1)/1,1'-oxybisethane/1,2-dichlorobenzene
  5100. N,N-dibutyl-1-butanamine compd. with 2,4,6-trinitrophenol (1:1)/1,2-dichlorobenzene/dihydro-2(3H)-furanone
  5101. N,N-dibutyl-1-butanamine compd. with 2,4,6-trinitrophenol (1:1)/1-propanol/1,2-dichlorobenzene
  5102. N,N-dibutyl-1-butanamine compd. with 2,4,6-trinitrophenol (1:1)/2-butanone/triphenylphosphine oxide
  5103. N,N-dibutyl-1-butanamine compd. with 2,4,6-trinitrophenol (1:1)/2-methyl-2-propanol/1,2-dichlorobenzene
  5104. N,N-dibutyl-1-butanamine compd. with 2,4,6-trinitrophenol (1:1)/2-propanol/1,2-dichlorobenzene
  5105. N,N-dibutyl-1-butanamine compd. with 2,4,6-trinitrophenol (1:1)/acetonitrile/1,2-dichlorobenzene
  5106. N,N-dibutyl-1-butanamine compd. with 2,4,6-trinitrophenol (1:1)/hexamethylphosphoric triamide/2-butanone
  5107. N,N-dibutyl-1-butanamine compd. with 2,4,6-trinitrophenol (1:1)/methanol/1,2-dichlorobenzene
  5108. N,N-dibutyl-1-butanamine compd. with 2,4,6-trinitrophenol (1:1)/pyridine 1-oxide/1,2-dichlorobenzene
  5109. N,N-dibutyl-1-butanamine compd. with 2,4,6-trinitrophenol (1:1)/triphenylphosphine oxide/1,2-dichlorobenzene
  5110. N,N-dibutyl-1-butanamine compd. with 2,4,6-trinitrophenol (1:1)/triphenylphosphine oxide/nitrobenzene
  5111. N,N-dibutyl-1-butanamine hydriodide/water/nitrobenzene
  5112. N,N-dibutyl-1-butanamine hydrobromide/water/nitrobenzene
  5113. N,N-dibutyl-1-butanamine hydrochloride/water/nitrobenzene
  5114. N,N-dibutyl-1-butanamine N-oxide/sodium chloride (NaCl)/water
  5115. N,N-dibutyl-1-butanamine perchlorate/water/nitrobenzene
  5116. N,N-dibutyl-1-butanamine/1-octanol/water
  5117. N,N-dibutyl-1-butanamine/2-methyl-2-propanol/water
  5118. N,N-dibutyl-1-butanamine/boron oxide (B2O3)/water
  5119. N,N-dibutyl-1-butanamine/cyclohexane/1-propanol
  5120. N,N-dibutyl-1-butanamine/cyclohexane/benzene
  5121. N,N-dibutyl-1-butanamine/hexane/1-butanol
  5122. N,N-dibutyl-1-butanamine/hexane/1-hexanol
  5123. N,N-dibutyl-1-butanamine/hexane/1-propanol
  5124. N,N-dibutyl-1-butanamine/N,N-dibutyl-1-butanamine compd. with 2,4,6-trinitrophenol (1:1)/1,2-dichlorobenzene
  5125. N,N-dibutyl-2,2-dimethylbutanamide/heptane/N,N-dibutyl-2-ethylhexanamide
  5126. N,N-dibutyl-2,2-dimethylbutanamide/N,N-dibutyl-2-ethylhexanamide/2,3-dimethylbutane
  5127. N,N-dibutyl-2,2-dimethylbutanamide/N,N-dibutyl-2-ethylhexanamide/benzene
  5128. N,N-dibutyl-2,2-dimethylbutanamide/N,N-dibutyl-2-ethylhexanamide/dichloromethane
  5129. N,N-dibutyl-2,2-dimethylbutanamide/N,N-dibutyl-2-ethylhexanamide/trichloromethane
  5130. N,N-dibutyl-N-methyl-1-butanaminium bromide/N,N-dimethylformamide/water
  5131. N,N-dibutyl-N-methyl-1-butanaminium chloride/β-D-fructofuranosyl α-D-glucopyranoside/water
  5132. N,N-dibutyl-N-methyl-1-butanaminium chloride/4-O-β-D-galactopyranosyl-D-glucose/water
  5133. N,N-dibutyl-N-methyl-1-butanaminium iodide/triphenylphosphine oxide/1,2-dichlorobenzene
  5134. N,N-dibutyl-N-methyl-1-butanaminium perchlorate/tributylphosphine oxide/1,2-dichlorobenzene
  5135. N,N-dibutyl-N-methyl-1-butanaminium perchlorate/triphenylphosphine oxide/1,2-dichlorobenzene
  5136. N,N-dibutyl-N-methyl-1-butanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)/methanol/2-butanone
  5137. N,N-didodecyl-1-dodecanamine hydriodide/water/nitrobenzene
  5138. N,N-didodecyl-1-dodecanamine hydrobromide/water/nitrobenzene
  5139. N,N-didodecyl-1-dodecanamine hydrochloride/tetrachloromethane/N,N-didodecyl-1-dodecanamine perchlorate
  5140. N,N-didodecyl-1-dodecanamine hydrochloride/water/nitrobenzene
  5141. N,N-didodecyl-1-dodecanamine perchlorate/water/nitrobenzene
  5142. N,N-diethyl-1,3-propanediamine/cyclohexane/heptane
  5143. N,N-diethyl-2,4,6-trinitrobenzenamine/ethanol/water
  5144. N,N-diethyl-2-hydroxy-N-(2-hydroxyethyl)ethanaminium bromide/N,N-dimethylformamide/water
  5145. N,N-diethyl-2-propenamide homopolymer/methanol/water
  5146. N,N-diethyl-2-propenamide homopolymer/water-d2/methanol-d4
  5147. N,N-diethyl-N-methylethanaminium tetrafluoroborate(1-)/acetonitrile/dihydro-2(3H)-furanone
  5148. N,N-diethylacetamide/formamide/water
  5149. N,N-diethylacetamide/water/4-hydroxybenzoic acid methyl ester
  5150. N,N-diethylcyclohexanamine hydrochloride/acetonitrile/nitrobenzene
  5151. N,N-diethylethanamine acetate/acetic acid/water
  5152. N,N-diethylethanamine acetate/glycine/water
  5153. N,N-diethylethanamine acetate/N-glycylglycine/water
  5154. N,N-diethylethanamine hydriodide/benzene/acetonitrile
  5155. N,N-diethylethanamine hydriodide/benzene/nitrobenzene
  5156. N,N-diethylethanamine hydrobromide/benzene/acetonitrile
  5157. N,N-diethylethanamine hydrobromide/benzene/nitrobenzene
  5158. N,N-diethylethanamine hydrochloride/benzene/acetonitrile
  5159. N,N-diethylethanamine hydrochloride/benzene/nitrobenzene
  5160. N,N-diethylethanamine hydrochloride/phosphoric acid monoammonium salt/water
  5161. N,N-diethylethanamine hydrochloride/potassium chloride (KCl)/water
  5162. N,N-diethylethanamine hydrochloride/sodium chloride (NaCl)/water
  5163. N,N-diethylethanamine hydrochloride/water/cerium chloride (CeCl3)
  5164. N,N-diethylethanamine hydrochloride/water/phosphoric acid diammonium salt
  5165. N,N-diethylethanamine hydrochloride/water/rubidium chloride (RbCl)
  5166. N,N-diethylethanamine hydrochloride/water/sulfuric acid diammonium salt
  5167. N,N-diethylethanamine nitrate/benzene/acetonitrile
  5168. N,N-diethylethanamine nitrate/benzene/nitrobenzene
  5169. N,N-diethylethanamine phosphate (1:1)/glycine/water
  5170. N,N-diethylethanamine phosphate (1:1)/N-glycylglycine/water
  5171. N,N-diethylethanamine sulfate (1:1)/benzene/acetonitrile
  5172. N,N-diethylethanamine sulfate (1:1)/benzene/nitrobenzene
  5173. N,N-diethylethanamine sulfate (1:1)/ethanol/water
  5174. N,N-diethylethanamine sulfate (1:1)/glycine/water
  5175. N,N-diethylethanamine sulfate (1:1)/N,N-diethylethanamine hydrochloride/water
  5176. N,N-diethylethanamine sulfate (1:1)/N-glycylglycine/water
  5177. N,N-diethylethanamine sulfate (2:1)/N,N-diethylethanamine hydrochloride/water
  5178. N,N-diethylethanamine sulfate (2:1)/water/sulfuric acid diammonium salt
  5179. N,N-diethylethanamine/β-D-fructofuranosyl α-D-glucopyranoside/water
  5180. N,N-diethylethanamine/(1R,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one/water
  5181. N,N-diethylethanamine/1,1'-oxybisethane/water
  5182. N,N-diethylethanamine/1,12-bis(N-methylpyrrolidinium)dodecane salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)/3,3'-(1,12-dodecanediyl)bis[1-methylimidazolium] salt with 1,1,2,2,2-pentafluoro-N-((pentafluoroethyl)sulfonyl...
  5183. N,N-diethylethanamine/1,12-bis(N-methylpyrrolidinium)dodecane salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)/3,3'-(1,12-dodecanediyl)bis[1-methylimidazolium] tetrafluoroborate(1-) (1:2)
  5184. N,N-diethylethanamine/1,3-dioxolane/perchloric acid lithium salt
  5185. N,N-diethylethanamine/1,4-dioxane/1,2-propanediol
  5186. N,N-diethylethanamine/1-propanol/2-butanone
  5187. N,N-diethylethanamine/2-methyl-2-propanol/water
  5188. N,N-diethylethanamine/2-naphthalenol/benzene
  5189. N,N-diethylethanamine/acetic acid/benzene
  5190. N,N-diethylethanamine/acetic acid/nitrobenzene
  5191. N,N-diethylethanamine/acetic acid/trichloromethane
  5192. N,N-diethylethanamine/acetic acid/water
  5193. N,N-diethylethanamine/acetonitrile/3,5-dinitrobenzoic acid
  5194. N,N-diethylethanamine/ammonium bromide ((NH4)Br)/water
  5195. N,N-diethylethanamine/benzene/1-naphthalenol
  5196. N,N-diethylethanamine/benzene/2-methylphenol
  5197. N,N-diethylethanamine/benzene/propanoic acid
  5198. N,N-diethylethanamine/benzoic acid lithium salt/water
  5199. N,N-diethylethanamine/benzoic acid/water
  5200. N,N-diethylethanamine/boron oxide (B2O3)/water
  5201. N,N-diethylethanamine/carbon dioxide/water
  5202. N,N-diethylethanamine/carbon monoxide/water
  5203. N,N-diethylethanamine/carbonic acid dipotassium salt/water
  5204. N,N-diethylethanamine/chloroacetic acid/nitrobenzene
  5205. N,N-diethylethanamine/D-mannitol/water
  5206. N,N-diethylethanamine/dichloroacetic acid/nitrobenzene
  5207. N,N-diethylethanamine/diphenylethanedione/water
  5208. N,N-diethylethanamine/ethanamine/water
  5209. N,N-diethylethanamine/ethanol/1-propanol
  5210. N,N-diethylethanamine/ethanol/methanol
  5211. N,N-diethylethanamine/ethanol/water
  5212. N,N-diethylethanamine/formamide/2-butanone
  5213. N,N-diethylethanamine/formic acid lithium salt/water
  5214. N,N-diethylethanamine/heptane/1-butanol
  5215. N,N-diethylethanamine/heptane/1-propanol
  5216. N,N-diethylethanamine/hydrazine/water
  5217. N,N-diethylethanamine/lithium 2,4,6-trinitrophenolate/2-butanone
  5218. N,N-diethylethanamine/methanol/trichloromethane
  5219. N,N-diethylethanamine/N,N,N-tributyl-1-butanaminium bromide/water
  5220. N,N-diethylethanamine/N,N,N-triethylethanaminium chloride/water
  5221. N,N-diethylethanamine/N,N-dimethylmethanamine compd. with 2,4,6-trinitrophenol (1:1)/nitrobenzene
  5222. N,N-diethylethanamine/N-phenylbenzenamine/benzene
  5223. N,N-diethylethanamine/nitric acid sodium salt/water
  5224. N,N-diethylethanamine/nitrobenzene/N-hydroxy-N,N-dimethylmethanaminium salt with 2,4,6-trinitrophenol (1:1)
  5225. N,N-diethylethanamine/nitromethane/water
  5226. N,N-diethylethanamine/potassium chloride (KCl)/water
  5227. N,N-diethylethanamine/potassium hydroxide (K(OH))/water
  5228. N,N-diethylethanamine/potassium iodide (KI)/water
  5229. N,N-diethylethanamine/Sodium 2,4,6-trinitrophenolate/2-butanone
  5230. N,N-diethylethanamine/sodium chloride (NaCl)/water
  5231. N,N-diethylethanamine/sodium hydroxide (Na(OH))/water
  5232. N,N-diethylethanamine/sulfinylbismethane/2-butanone
  5233. N,N-diethylethanamine/tetrachloromethane/acetic acid
  5234. N,N-diethylethanamine/thiocyanic acid potassium salt/water
  5235. N,N-diethylethanamine/trichloroacetic acid/nitrobenzene
  5236. N,N-diethylethanamine/trichloromethane/benzene
  5237. N,N-diethylethanamine/trifluoroacetic acid/nitrobenzene
  5238. N,N-diethylethanamine/water/2-butanone
  5239. N,N-diethylethanamine/water/2-furancarboxaldehyde
  5240. N,N-diethylethanamine/water/naphthalene
  5241. N,N-diethylethanamine/water/nitric acid cesium salt
  5242. N,N-diethylethanamine/water/nitric acid potassium salt
  5243. N,N-diethylethanamine/water/potassium bromide (KBr)
  5244. N,N-diethylethanamine/water/sulfuric acid dipotassium salt
  5245. N,N-diethylethanamine/water/water-d2
  5246. N,N-diethylformamide/benzene/formamide
  5247. N,N-diethylformamide/cesium chloride (CsCl)/water
  5248. N,N-diethylformamide/formamide/water
  5249. N,N-diethylformamide/potassium chloride (KCl)/water
  5250. N,N-diethylformamide/sodium chloride (NaCl)/water
  5251. N,N-diethylformamide/water/4-hydroxybenzoic acid methyl ester
  5252. N,N-diethylformamide/water/rubidium chloride (RbCl)
  5253. N,N-dihexyl-1-hexanamine hydriodide/water/nitrobenzene
  5254. N,N-dihexyl-1-hexanamine hydrobromide/water/nitrobenzene
  5255. N,N-dihexyl-1-hexanamine hydrochloride/water/nitrobenzene
  5256. N,N-dihexyl-1-hexanamine perchlorate/water/nitrobenzene
  5257. N,N-dimethyl-1,3-propanediamine/carbon dioxide/water
  5258. N,N-dimethyl-1,3-propanediamine/glycine/water
  5259. N,N-dimethyl-1-dodecanamine N-oxide/1-butanol/water
  5260. N,N-dimethyl-1-dodecanamine N-oxide/1-pentanol/water
  5261. N,N-dimethyl-1-dodecanamine N-oxide/N,N,N-trimethyl-1-decanaminium bromide/water
  5262. N,N-dimethyl-1-dodecanamine N-oxide/water/N-Tetradecyl-N,N-dimethyl-N-(2,3-epoxypropyl)ammonium chloride
  5263. N,N-dimethyl-10H-phenothiazine-10-propanamine monohydrochloride/N,N,N-trimethyl-1-hexadecanaminium bromide/water
  5264. N,N-dimethyl-2-propenamide polymer with N-(1,1-dimethylethyl)-2-propenamide/carbonic acid monosodium salt/water
  5265. N,N-dimethyl-2-propenamide polymer with N-(1,1-dimethylethyl)-2-propenamide/phosphoric acid monoammonium salt/water
  5266. N,N-dimethyl-2-propenamide polymer with N-(1,1-dimethylethyl)-2-propenamide/sodium chloride (NaCl)/water
  5267. N,N-dimethyl-2-propenamide polymer with N-(1,1-dimethylethyl)-2-propenamide/water/phosphoric acid monopotassium salt
  5268. N,N-dimethyl-4-nitrosobenzenamine/benzenamine/2-nitrophenol
  5269. N,N-dimethyl-4-nitrosobenzenamine/benzenamine/nitrobenzene
  5270. N,N-dimethyl-N-(3-sulfopropyl)-1-dodecanaminium inner salt/1-butanol/water
  5271. N,N-dimethyl-N-(3-sulfopropyl)-1-dodecanaminium inner salt/1-pentanol/water
  5272. N,N-dimethyl-N-(3-sulfopropyl)-1-dodecanaminium inner salt/N,N-dimethyl-N-(3-sulfopropyl)-1-decanaminium inner salt/water
  5273. N,N-dimethyl-N-(3-sulfopropyl)-1-dodecanaminium inner salt/N,N-dimethyl-N-(3-sulfopropyl)-1-tetradecanaminium inner salt/water
  5274. N,N-dimethyl-N-(3-sulfopropyl)-1-hexadecanaminium inner salt/water/2,4,6-trichlorophenol
  5275. N,N-dimethyl-N-(3-sulfopropyl)-1-hexadecanaminium inner salt/water/2-nitrophenol
  5276. N,N-dimethyl-N-(3-sulfopropyl)-1-tetradecanaminium inner salt/N,N-dimethyl-N-(3-sulfopropyl)-1-decanaminium inner salt/water
  5277. N,N-dimethyl-N-(sulfomethyl)-1-dodecanaminium inner salt/β-cyclodextrin/water
  5278. N,N-dimethyl-N-octadecyl-1-octadecanaminium hydroxide/sodium chloride (NaCl)/water
  5279. N,N-dimethylacetamide/α-D-glucopyranose/water
  5280. N,N-dimethylacetamide/β-D-fructofuranosyl α-D-glucopyranoside/water
  5281. N,N-dimethylacetamide/(2E)-2-butene/water
  5282. N,N-dimethylacetamide/(2Z)-2-butene/water
  5283. N,N-dimethylacetamide/(4-acetamidophenyl) 2-acetyloxybenzoate/acetic acid pentyl ester
  5284. N,N-dimethylacetamide/(OC-6-22)-dichlorobis(1,2-ethanediamine-κN,κN')cobalt(1+) chloride/water
  5285. N,N-dimethylacetamide/1,1'-oxybisbutane/water
  5286. N,N-dimethylacetamide/1,1'-oxybisethane/2-propanone
  5287. N,N-dimethylacetamide/1,2,3-propanetriol/water
  5288. N,N-dimethylacetamide/1,2-butanediol/water
  5289. N,N-dimethylacetamide/1,2-propanediol/water
  5290. N,N-dimethylacetamide/1,4,7,10,13,16-hexaoxacyclooctadecane/water
  5291. N,N-dimethylacetamide/1,4,7,10,13-pentaoxacyclopentadecane/water
  5292. N,N-dimethylacetamide/1,4,7,10-tetraoxacyclododecane/water
  5293. N,N-dimethylacetamide/1-bromotricyclo[3.3.1.1(3,7)]decane/water
  5294. N,N-dimethylacetamide/1-butanamine perchlorate/acetonitrile
  5295. N,N-dimethylacetamide/1-butanol/1-phenylethanone
  5296. N,N-dimethylacetamide/1-butanol/water
  5297. N,N-dimethylacetamide/1-buten-3-yne/water
  5298. N,N-dimethylacetamide/1-butyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)/acetic acid
  5299. N,N-dimethylacetamide/1-butyl-3-methyl-1H-imidazolium salt with trifluoromethanesulfonic acid (1:1)/2-hydroxy-1,2,3-propanetricarboxylic acid trisodium salt
  5300. N,N-dimethylacetamide/1-butyl-3-methyl-1H-imidazolium tetrafluoroborate(1-)/2-hydroxy-1,2,3-propanetricarboxylic acid trisodium salt
  5301. N,N-dimethylacetamide/1-hexyl-3-methyl-1H-imidazolium chloride/N,N'-1,2-ethanediylbis[1-(2-pyridinyl)methanimine]
  5302. N,N-dimethylacetamide/1-methyl-3-propyl-1H-imidazolium bromide/vanadyl (N,N'-salicylideneethylendiamine)
  5303. N,N-dimethylacetamide/1-pentanol/1-phenylethanone
  5304. N,N-dimethylacetamide/1-pentanol/water
  5305. N,N-dimethylacetamide/1-propanol/1-phenylethanone
  5306. N,N-dimethylacetamide/1-propanol/water
  5307. N,N-dimethylacetamide/2,2'-bis-[1,2-phenylenebis(nitrilomethylidyne)]diphenol/1-butyl-3-methyl-1H-imidazolium bromide
  5308. N,N-dimethylacetamide/2,3,5,6,8,9,11,12-octahydro-1,4,7,10,13-benzopentaoxacyclopentadecin/water
  5309. N,N-dimethylacetamide/2-methyl-1-butanol/formamide
  5310. N,N-dimethylacetamide/2-methyl-2-butene/2-methyl-1,3-butadiene
  5311. N,N-dimethylacetamide/2-methyl-2-butene/2-methylbutane
  5312. N,N-dimethylacetamide/2-methylbutane/2-methyl-1,3-butadiene
  5313. N,N-dimethylacetamide/2-propanone/benzene
  5314. N,N-dimethylacetamide/2-propanone/cellulose
  5315. N,N-dimethylacetamide/2-propanone/cellulose carboxymethyl ether sodium salt
  5316. N,N-dimethylacetamide/2-propanone/water
  5317. N,N-dimethylacetamide/2-propenenitrile homopolymer/cellulose
  5318. N,N-dimethylacetamide/2-propenenitrile homopolymer/poly(1-phenylethylene)
  5319. N,N-dimethylacetamide/2-propenoic acid ethyl ester/1-butanol
  5320. N,N-dimethylacetamide/2-propenoic acid ethyl ester/2-methyl-1-propanol
  5321. N,N-dimethylacetamide/2-propenoic acid ethyl ester/2-methyl-2-propanol
  5322. N,N-dimethylacetamide/3-nitrophenol/sulfinylbismethane
  5323. N,N-dimethylacetamide/4-methylmorpholine 4-oxide monohydrate/cellulose
  5324. N,N-dimethylacetamide/4-O-α-D-glucopyranosyl-D-glucose/water
  5325. N,N-dimethylacetamide/acetamide/potassium iodide (KI)
  5326. N,N-dimethylacetamide/acetic acid ethyl ester/2-methyl-2-butanol
  5327. N,N-dimethylacetamide/acetic acid ethyl ester/5-hydroxy-2-(hydroxymethyl)-4H-pyran-4-one
  5328. N,N-dimethylacetamide/acetic acid ethyl ester/rivaroxaban
  5329. N,N-dimethylacetamide/acetic acid ethyl ester/water
  5330. N,N-dimethylacetamide/acetic acid/benzene
  5331. N,N-dimethylacetamide/acetic acid/lithium chloride (LiCl)
  5332. N,N-dimethylacetamide/acetic acid/sulfinylbismethane
  5333. N,N-dimethylacetamide/acetic acid/water
  5334. N,N-dimethylacetamide/acetonitrile/Hexylammonium perchlorate
  5335. N,N-dimethylacetamide/acetonitrile/Octylammonium perchlorate
  5336. N,N-dimethylacetamide/acetonitrile/Propylammonium perchlorate
  5337. N,N-dimethylacetamide/acetonitrile/sodium iodide (NaI)
  5338. N,N-dimethylacetamide/aluminum chloride (AlCl3)/water
  5339. N,N-dimethylacetamide/benzene/chloroacetic acid
  5340. N,N-dimethylacetamide/benzene/N-methylacetamide
  5341. N,N-dimethylacetamide/benzene/trichloroacetic acid
  5342. N,N-dimethylacetamide/carbon monoxide/1,1,1-trichloroethane
  5343. N,N-dimethylacetamide/carbon monoxide/1,2-benzenedicarboxylic acid dibutyl ester
  5344. N,N-dimethylacetamide/cesium chloride (CsCl)/water
  5345. N,N-dimethylacetamide/cesium tetraphenylborate(1-)/water
  5346. N,N-dimethylacetamide/Copper(I)perchlorate/acetonitrile
  5347. N,N-dimethylacetamide/D-fructose/water
  5348. N,N-dimethylacetamide/D-glucose/4-methylmorpholine 4-oxide
  5349. N,N-dimethylacetamide/D-glucose/water
  5350. N,N-dimethylacetamide/dichloromethane/water
  5351. N,N-dimethylacetamide/ethanamine perchlorate/acetonitrile
  5352. N,N-dimethylacetamide/ethanol/2-methyl-1-propanol
  5353. N,N-dimethylacetamide/ethanol/2-propanol
  5354. N,N-dimethylacetamide/ethanol/Ipriflavone
  5355. N,N-dimethylacetamide/ethanol/nitric acid lithium salt
  5356. N,N-dimethylacetamide/ethanol/water
  5357. N,N-dimethylacetamide/etoricoxib/water
  5358. N,N-dimethylacetamide/formamide/water
  5359. N,N-dimethylacetamide/glycine/water
  5360. N,N-dimethylacetamide/L-alanine/water
  5361. N,N-dimethylacetamide/L-serine/water
  5362. N,N-dimethylacetamide/lithium chloride (LiCl)/water
  5363. N,N-dimethylacetamide/methanamine perchlorate/acetonitrile
  5364. N,N-dimethylacetamide/methane/water
  5365. N,N-dimethylacetamide/methanol/Thiamethoxam
  5366. N,N-dimethylacetamide/methanol/water
  5367. N,N-dimethylacetamide/N,N,N',N'-tetramethylguanidine compd. with 2,4,6-trinitrophenol (1:1)/nitrobenzene
  5368. N,N-dimethylacetamide/N,N,N-tributyl-1-butanaminium bromide/water
  5369. N,N-dimethylacetamide/N,N,N-tributyl-1-butanaminium perchlorate/acetonitrile
  5370. N,N-dimethylacetamide/N,N,N-tributyl-1-butanaminium tetraphenylborate(1-)/acetonitrile
  5371. N,N-dimethylacetamide/N,N,N-triethylethanaminium bromide/water
  5372. N,N-dimethylacetamide/N,N,N-triethylethanaminium iodide/water
  5373. N,N-dimethylacetamide/N,N,N-trihexyl-1-hexanaminium bromide/water
  5374. N,N-dimethylacetamide/N,N,N-trimethylmethanaminium bromide/water
  5375. N,N-dimethylacetamide/N,N,N-tripropyl-1-propanaminium bromide/water
  5376. N,N-dimethylacetamide/N,N-dimethylformamide/sodium iodide (NaI)
  5377. N,N-dimethylacetamide/N,N-dimethylformamide/water
  5378. N,N-dimethylacetamide/N-DL-alanyl-DL-valine/water
  5379. N,N-dimethylacetamide/N-ethylacetamide/potassium iodide (KI)
  5380. N,N-dimethylacetamide/nitric acid copper(2+) salt/water
  5381. N,N-dimethylacetamide/nitric acid nickel(2+) salt/water
  5382. N,N-dimethylacetamide/poly[oxy-1,4-phenylenesulfonyl-1,4-phenyleneoxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene]/1-butanol
  5383. N,N-dimethylacetamide/poly[oxy-1,4-phenylenesulfonyl-1,4-phenyleneoxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene]/1-pentanol
  5384. N,N-dimethylacetamide/poly[oxy-1,4-phenylenesulfonyl-1,4-phenyleneoxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene]/ethanol
  5385. N,N-dimethylacetamide/poly[oxy-1,4-phenylenesulfonyl-1,4-phenyleneoxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene]/water
  5386. N,N-dimethylacetamide/potassium chloride (KCl)/water
  5387. N,N-dimethylacetamide/potassium iodide (KI)/water
  5388. N,N-dimethylacetamide/propane/water
  5389. N,N-dimethylacetamide/rubidium tetraphenylborate(1-)/water
  5390. N,N-dimethylacetamide/sodium bromide (NaBr)/water
  5391. N,N-dimethylacetamide/sodium chloride (NaCl)/water
  5392. N,N-dimethylacetamide/sodium iodide (NaI)/water
  5393. N,N-dimethylacetamide/sodium tetraphenylborate(1-)/acetonitrile
  5394. N,N-dimethylacetamide/sodium tetraphenylborate(1-)/water
  5395. N,N-dimethylacetamide/sulfamic acid/sulfinylbismethane
  5396. N,N-dimethylacetamide/sulfinylbismethane/2-methylphenol
  5397. N,N-dimethylacetamide/sulfinylbismethane/2-nitrophenol
  5398. N,N-dimethylacetamide/sulfinylbismethane/chloroacetic acid
  5399. N,N-dimethylacetamide/sulfinylbismethane/copper chloride (CuCl2)
  5400. N,N-dimethylacetamide/sulfinylbismethane/trichloroacetic acid
  5401. N,N-dimethylacetamide/sulfinylbismethane/water
  5402. N,N-dimethylacetamide/tetrachloromethane/acetic acid
  5403. N,N-dimethylacetamide/tetrachloromethane/benzene
  5404. N,N-dimethylacetamide/tetrachloromethane/chloroacetic acid
  5405. N,N-dimethylacetamide/tetrachloromethane/dichloroacetic acid
  5406. N,N-dimethylacetamide/tetrachloromethane/trichloroacetic acid
  5407. N,N-dimethylacetamide/tetraphenylarsonium bromide/water
  5408. N,N-dimethylacetamide/tetraphenylarsonium chloride/water
  5409. N,N-dimethylacetamide/tetraphenylarsonium iodide/water
  5410. N,N-dimethylacetamide/tetraphenylphosphonium iodide/acetonitrile
  5411. N,N-dimethylacetamide/thiocyanic acid potassium salt/water
  5412. N,N-dimethylacetamide/thiocyanic acid sodium salt/water
  5413. N,N-dimethylacetamide/trichloromethane/water
  5414. N,N-dimethylacetamide/urea/N,N-dimethylformamide
  5415. N,N-dimethylacetamide/urea/water
  5416. N,N-dimethylacetamide/water/(2R,3S,4R,5R)-2,3,4,5-tetrahydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyhexanal
  5417. N,N-dimethylacetamide/water/(OC-6-22)-dichlorobis(1,2-ethanediamine-κN,κN')cobalt(1+) bromide
  5418. N,N-dimethylacetamide/water/4-hydroxybenzoic acid methyl ester
  5419. N,N-dimethylacetamide/water/6-Chloropurine
  5420. N,N-dimethylacetamide/water/cadmium bromide (CdBr2)
  5421. N,N-dimethylacetamide/water/cadmium iodide (CdI2)
  5422. N,N-dimethylacetamide/water/cesium iodide (CsI)
  5423. N,N-dimethylacetamide/water/Diacerein
  5424. N,N-dimethylacetamide/water/Glimepiride
  5425. N,N-dimethylacetamide/water/magnesium chloride (MgCl2)
  5426. N,N-dimethylacetamide/water/N,N,N-tripentyl-1-pentanaminium bromide
  5427. N,N-dimethylacetamide/water/nitric acid silver(1+) salt
  5428. N,N-dimethylacetamide/water/nitric acid zinc salt
  5429. N,N-dimethylacetamide/water/poly(vinyl chloride)
  5430. N,N-dimethylacetamide/water/rubidium chloride (RbCl)
  5431. N,N-dimethylacetamide/water/sulfuric acid copper(2+) salt (1:1)
  5432. N,N-dimethylacetamide/water/Thiamethoxam
  5433. N,N-dimethylbenzenamine/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)/water
  5434. N,N-dimethylbenzenamine/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)/water
  5435. N,N-dimethylbenzenamine/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)/water
  5436. N,N-dimethylbenzenamine/1-butanol/benzene
  5437. N,N-dimethylbenzenamine/2-propanone/benzene
  5438. N,N-dimethylbenzenamine/acetic acid/benzene
  5439. N,N-dimethylbenzenamine/acetic acid/water
  5440. N,N-dimethylbenzenamine/benzene/acetonitrile
  5441. N,N-dimethylbenzenamine/benzene/water
  5442. N,N-dimethylbenzenamine/boric acid (H2B10O16) disodium salt/water
  5443. N,N-dimethylbenzenamine/formic acid/water
  5444. N,N-dimethylbenzenamine/methanol/dichloromethane
  5445. N,N-dimethylbenzenamine/N,N-dimethylbenzenamine compd. with 2,4,6-trinitrophenol (1:1)/nitrobenzene
  5446. N,N-dimethylbenzenamine/poly(1-phenylethylene)/2-methyl-2-propenoic acid methyl ester homopolymer
  5447. N,N-dimethylbenzenamine/sulfinylbismethane/trifluoroacetic acid
  5448. N,N-dimethylbenzenamine/water/2-furancarboxaldehyde
  5449. N,N-dimethylbenzenamine/water/lithium pentaborate
  5450. N,N-dimethylbenzenamine/water/propanoic acid
  5451. N,N-dimethylbenzenemethanamine/carbon dioxide/water
  5452. N,N-dimethylbenzenemethanamine/water/2-furancarboxaldehyde
  5453. N,N-dimethyldodecan-1-amine hydrochloride/1-pentanol/water
  5454. N,N-dimethyldodecan-1-amine hydrochloride/ethanol/water
  5455. N,N-dimethylformamide/1,2-dichloro-1,1,2,2-tetrafluoroethane/water
  5456. N,N-dimethylformamide/1-bromotricyclo[3.3.1.1(3,7)]decane/water
  5457. N,N-dimethylformamide/1-butanol/1-phenylethanone
  5458. N,N-dimethylformamide/1-butanol/2-butanone
  5459. N,N-dimethylformamide/1-butanol/2-Chloro-3-(trifluoromethyl)pyridine
  5460. N,N-dimethylformamide/1-butanol/3-nitrobenzaldehyde
  5461. N,N-dimethylformamide/1-butanol/3-pentanone
  5462. N,N-dimethylformamide/1-butanol/benzene
  5463. N,N-dimethylformamide/1-butanol/water
  5464. N,N-dimethylformamide/1-buten-3-yne/water
  5465. N,N-dimethylformamide/1-butyl-3-methyl-1H-imidazolium chloride/cellulose
  5466. N,N-dimethylformamide/1-ethylpyridinium iodide/naphthalene
  5467. N,N-dimethylformamide/1-pentanol/1-phenylethanone
  5468. N,N-dimethylformamide/1-pentanol/2-butanone
  5469. N,N-dimethylformamide/1-pentanol/3-pentanone
  5470. N,N-dimethylformamide/1-pentanol/water
  5471. N,N-dimethylformamide/1-propanol/1-butanol
  5472. N,N-dimethylformamide/1-propanol/1-phenylethanone
  5473. N,N-dimethylformamide/1-propanol/2-butanone
  5474. N,N-dimethylformamide/1-propanol/3-nitrobenzaldehyde
  5475. N,N-dimethylformamide/1-propanol/3-pentanone
  5476. N,N-dimethylformamide/1-propanol/acetonitrile
  5477. N,N-dimethylformamide/1-propanol/benzene
  5478. N,N-dimethylformamide/1-propanol/Carbazochrome
  5479. N,N-dimethylformamide/1-propanol/Macitentan
  5480. N,N-dimethylformamide/1-propanol/nitric acid lithium salt
  5481. N,N-dimethylformamide/1-propanol/potassium iodide (KI)
  5482. N,N-dimethylformamide/1-propanol/propanoic acid
  5483. N,N-dimethylformamide/1-propanol/sodium iodide (NaI)
  5484. N,N-dimethylformamide/1-propanol/water
  5485. N,N-dimethylformamide/1-propyne/water
  5486. N,N-dimethylformamide/1H-purin-6-amine/water
  5487. N,N-dimethylformamide/2-hydroxybenzoic acid/water
  5488. N,N-dimethylformamide/2-hydroxypropane-1,2,3-tricarboxylic acid/water
  5489. N,N-dimethylformamide/2-methyl-2-butanol/water
  5490. N,N-dimethylformamide/2-methyl-2-propanol/water
  5491. N,N-dimethylformamide/2-methylbutane/2-methyl-1,3-butadiene
  5492. N,N-dimethylformamide/2-[(1,1-dimethylethyl)imino]tetrahydro-3-(1-methylethyl)-5-phenyl-4H-1,3,5-thiadiazin-4-one/water
  5493. N,N-dimethylformamide/3a,4,7,7a-tetrahydro-4,7-methano-1H-indene/2-methyl-1,3-butadiene
  5494. N,N-dimethylformamide/4-amino-2(1H)-pyrimidinone/water
  5495. N,N-dimethylformamide/4-amino-N-2-pyrimidinylbenzenesulfonamide/water
  5496. N,N-dimethylformamide/4-chlorobenzoic acid/water
  5497. N,N-dimethylformamide/4-hydroxy-2-methyl-N-(5-methyl-2-thiazolyl)-2H-1,2-benzothiazin-3-carboxamide 1,1-dioxide/water
  5498. N,N-dimethylformamide/4-methylmorpholine 4-oxide monohydrate/cellulose
  5499. N,N-dimethylformamide/4-O-α-D-glucopyranosyl-D-glucose/water
  5500. N,N-dimethylformamide/5,7-dichloro-8-quinolinol/water
  5501. N,N-dimethylformamide/acetonitrile/(T-4)-dichlorodioxouranium
  5502. N,N-dimethylformamide/acetonitrile/2-chlorophenol
  5503. N,N-dimethylformamide/acetonitrile/3-Bromo-2-methylbenzoic acid
  5504. N,N-dimethylformamide/acetonitrile/3-Methylflavone-8-carboxylic acid
  5505. N,N-dimethylformamide/acetonitrile/cesium iodide (CsI)
  5506. N,N-dimethylformamide/acetonitrile/nitric acid silver(1+) salt
  5507. N,N-dimethylformamide/acetonitrile/perchloric acid lithium salt
  5508. N,N-dimethylformamide/acetonitrile/perchloric acid potassium salt
  5509. N,N-dimethylformamide/acetonitrile/perchloric acid sodium salt
  5510. N,N-dimethylformamide/acetonitrile/potassium bromide (KBr)
  5511. N,N-dimethylformamide/acetonitrile/potassium fluoride (KF)
  5512. N,N-dimethylformamide/acetonitrile/potassium iodide (KI)
  5513. N,N-dimethylformamide/acetonitrile/rubidium iodide (RbI)
  5514. N,N-dimethylformamide/acetonitrile/sodium iodide (NaI)
  5515. N,N-dimethylformamide/acetonitrile/trichlorobismuthine
  5516. N,N-dimethylformamide/acetonitrile/water
  5517. N,N-dimethylformamide/aluminum bromide (AlBr3)/nitrobenzene
  5518. N,N-dimethylformamide/aluminum chloride (AlCl3)/lithium chloride (LiCl)
  5519. N,N-dimethylformamide/aluminum chloride (AlCl3)/water
  5520. N,N-dimethylformamide/argon/acetonitrile
  5521. N,N-dimethylformamide/argon/water
  5522. N,N-dimethylformamide/benzene/2-butanol
  5523. N,N-dimethylformamide/benzene/2-methyl-1-propanol
  5524. N,N-dimethylformamide/benzene/2-methyl-2-propanol
  5525. N,N-dimethylformamide/benzene/chloroacetic acid
  5526. N,N-dimethylformamide/benzene/cobalt chloride (CoCl2)
  5527. N,N-dimethylformamide/benzene/perchloric acid lithium salt
  5528. N,N-dimethylformamide/benzene/perchloric acid potassium salt
  5529. N,N-dimethylformamide/benzene/trichloroacetic acid
  5530. N,N-dimethylformamide/benzene/water
  5531. N,N-dimethylformamide/benzene/Yttrium butyrate
  5532. N,N-dimethylformamide/benzene/Yttrium caproate
  5533. N,N-dimethylformamide/benzene/Yttrium valerate
  5534. N,N-dimethylformamide/benzene/Yttrium(III) caprate
  5535. N,N-dimethylformamide/benzene/Yttrium(III) octanoate
  5536. N,N-dimethylformamide/cesium chloride (CsCl)/perchloric acid potassium salt
  5537. N,N-dimethylformamide/cesium chloride (CsCl)/water
  5538. N,N-dimethylformamide/chlorodifluoromethane/1,2-benzenedicarboxylic acid dibutyl ester
  5539. N,N-dimethylformamide/chlorodifluoromethane/1-chloro-1,1-difluoroethane
  5540. N,N-dimethylformamide/chlorodifluoromethane/water
  5541. N,N-dimethylformamide/chlorotrifluoromethane/water
  5542. N,N-dimethylformamide/cobalt chloride (CoCl2)/water
  5543. N,N-dimethylformamide/copper chloride (CuCl2)/1H-benzotriazole
  5544. N,N-dimethylformamide/copper chloride (CuCl2)/formamide
  5545. N,N-dimethylformamide/copper chloride (CuCl2)/hydrazinecarbothioamide
  5546. N,N-dimethylformamide/copper chloride (CuCl2)/lithium chloride (LiCl)
  5547. N,N-dimethylformamide/copper chloride (CuCl2)/perchloric acid lithium salt
  5548. N,N-dimethylformamide/copper chloride (CuCl2)/water
  5549. N,N-dimethylformamide/copper fluoride (CuF2)/perchloric acid lithium salt
  5550. N,N-dimethylformamide/D-mannitol/water
  5551. N,N-dimethylformamide/dichlorodifluoromethane/water
  5552. N,N-dimethylformamide/dichloromethane/water
  5553. N,N-dimethylformamide/DL-norvaline/water
  5554. N,N-dimethylformamide/ethyne/sodium iodide (NaI)
  5555. N,N-dimethylformamide/ethyne/water
  5556. N,N-dimethylformamide/formamide/cobalt chloride (CoCl2)
  5557. N,N-dimethylformamide/formamide/potassium iodide (KI)
  5558. N,N-dimethylformamide/formamide/sodium iodide (NaI)
  5559. N,N-dimethylformamide/formamide/water
  5560. N,N-dimethylformamide/hexamethylphosphoric triamide/water
  5561. N,N-dimethylformamide/hydrochloric acid/perchloric acid lithium salt
  5562. N,N-dimethylformamide/hydrochloric acid/water
  5563. N,N-dimethylformamide/iodine/potassium iodide (KI)
  5564. N,N-dimethylformamide/iodine/water
  5565. N,N-dimethylformamide/L-arabinitol/water
  5566. N,N-dimethylformamide/L-histidine/water
  5567. N,N-dimethylformamide/L-valine/water
  5568. N,N-dimethylformamide/lithium bromide (LiBr)/cadmium bromide (CdBr2)
  5569. N,N-dimethylformamide/lithium bromide (LiBr)/mercury bromide (HgBr2)
  5570. N,N-dimethylformamide/lithium bromide (LiBr)/naphthalene
  5571. N,N-dimethylformamide/lithium bromide (LiBr)/water
  5572. N,N-dimethylformamide/lithium bromide (LiBr)/zinc bromide (ZnBr2)
  5573. N,N-dimethylformamide/lithium chloride (LiCl)/2-butanone
  5574. N,N-dimethylformamide/lithium chloride (LiCl)/copper fluoride (CuF2)
  5575. N,N-dimethylformamide/lithium chloride (LiCl)/naphthalene
  5576. N,N-dimethylformamide/lithium chloride (LiCl)/water
  5577. N,N-dimethylformamide/mercury iodide (HgI2)/cesium iodide (CsI)
  5578. N,N-dimethylformamide/mercury iodide (HgI2)/rubidium iodide (RbI)
  5579. N,N-dimethylformamide/methane/water
  5580. N,N-dimethylformamide/N,N,N-triethylethanaminium bromide/2-butanone
  5581. N,N-dimethylformamide/N,N,N-triethylethanaminium bromide/naphthalene
  5582. N,N-dimethylformamide/N,N,N-triethylethanaminium bromide/water
  5583. N,N-dimethylformamide/N,N,N-trimethylmethanaminium chloride/water
  5584. N,N-dimethylformamide/N,N,N-trimethylmethanaminium iodide/water
  5585. N,N-dimethylformamide/naphthalene/1-methylpyridinium iodide
  5586. N,N-dimethylformamide/nitric acid lithium salt/2-butanone
  5587. N,N-dimethylformamide/nitric acid sodium salt/water
  5588. N,N-dimethylformamide/nitromethane/potassium iodide (KI)
  5589. N,N-dimethylformamide/nitrous acid sodium salt/1,2-dimethylbenzene
  5590. N,N-dimethylformamide/nitrous acid sodium salt/water
  5591. N,N-dimethylformamide/perchloric acid lithium salt/2-butanone
  5592. N,N-dimethylformamide/perchloric acid lithium salt/acetic acid methyl ester
  5593. N,N-dimethylformamide/perchloric acid lithium salt/dihydro-2(3H)-furanone
  5594. N,N-dimethylformamide/perchloric acid lithium salt/naphthalene
  5595. N,N-dimethylformamide/perchloric acid potassium salt/rubidium chloride (RbCl)
  5596. N,N-dimethylformamide/perchloric acid sodium salt/naphthalene
  5597. N,N-dimethylformamide/perchloric acid sodium salt/water
  5598. N,N-dimethylformamide/phenanthrene/9H-carbazole
  5599. N,N-dimethylformamide/potassium bromide (KBr)/water-d2
  5600. N,N-dimethylformamide/potassium chloride (KCl)/acetonitrile
  5601. N,N-dimethylformamide/potassium chloride (KCl)/magnesium chloride (MgCl2)
  5602. N,N-dimethylformamide/potassium chloride (KCl)/water
  5603. N,N-dimethylformamide/potassium iodide (KI)/acetic acid methyl ester
  5604. N,N-dimethylformamide/potassium iodide (KI)/dihydro-2(3H)-furanone
  5605. N,N-dimethylformamide/potassium iodide (KI)/mercury iodide (HgI2)
  5606. N,N-dimethylformamide/potassium iodide (KI)/water
  5607. N,N-dimethylformamide/potassium iodide electrode/platinum electrode
  5608. N,N-dimethylformamide/propane/water
  5609. N,N-dimethylformamide/sodium bromide (NaBr)/naphthalene
  5610. N,N-dimethylformamide/sodium bromide (NaBr)/water
  5611. N,N-dimethylformamide/sodium bromide (NaBr)/water-d2
  5612. N,N-dimethylformamide/sodium chloride (NaCl)/perchloric acid potassium salt
  5613. N,N-dimethylformamide/sodium chloride (NaCl)/water
  5614. N,N-dimethylformamide/sodium iodide (NaI)/2-methyl-1-propanol
  5615. N,N-dimethylformamide/sodium iodide (NaI)/mercury iodide (HgI2)
  5616. N,N-dimethylformamide/sodium iodide (NaI)/naphthalene
  5617. N,N-dimethylformamide/sodium iodide (NaI)/water
  5618. N,N-dimethylformamide/sulfur dioxide/acetonitrile
  5619. N,N-dimethylformamide/sulfur dioxide/nitromethane
  5620. N,N-dimethylformamide/sulfur dioxide/water
  5621. N,N-dimethylformamide/sulfuric acid copper(2+) salt (1:1)/hydrazinecarbothioamide
  5622. N,N-dimethylformamide/sulfuric acid dirubidium salt/water
  5623. N,N-dimethylformamide/sulfuric acid magnesium salt (1:1)/water
  5624. N,N-dimethylformamide/tetraphenylarsonium iodide/acetonitrile
  5625. N,N-dimethylformamide/water/(2-Naphthylthio)acetic acid
  5626. N,N-dimethylformamide/water/(OC-6-22)-dichlorobis(1,2-ethanediamine-κN,κN')cobalt(1+) bromide
  5627. N,N-dimethylformamide/water/1,2-dimethylbenzene
  5628. N,N-dimethylformamide/water/1-(2,4-dihydroxyphenyl)ethanone
  5629. N,N-dimethylformamide/water/1-(4-(1,1-dimethylethyl)-2,6-dimethyl-3,5-dinitrophenyl)ethanone
  5630. N,N-dimethylformamide/water/2,2'-(Vinylenedi-4-phenylene)bis(benzoxazole)
  5631. N,N-dimethylformamide/water/2,4,5-Trimethoxybenzaldehyde
  5632. N,N-dimethylformamide/water/2,6-Dimethoxy-4-aminopyrimidine
  5633. N,N-dimethylformamide/water/2-Amino-3-chloropyrazine
  5634. N,N-dimethylformamide/water/2-Amino-6-chloropurine
  5635. N,N-dimethylformamide/water/2-Bromo-5-hydroxypyrazine
  5636. N,N-dimethylformamide/water/2-butanol
  5637. N,N-dimethylformamide/water/2-butanone
  5638. N,N-dimethylformamide/water/2-ethoxybenzamide
  5639. N,N-dimethylformamide/water/2-furancarboxaldehyde
  5640. N,N-dimethylformamide/water/2-hydroxy-5-nitrobenzoic acid
  5641. N,N-dimethylformamide/water/2-methyl-1,3-butadiene
  5642. N,N-dimethylformamide/water/2-methyl-1-propanol
  5643. N,N-dimethylformamide/water/2-nitrobenzenamine
  5644. N,N-dimethylformamide/water/3,3'-(oxidi-2,1-ethanediyl)bis[1-methyl-imidazolium] dihexafluorophosphate
  5645. N,N-dimethylformamide/water/3,3'-Sulphonyldianiline
  5646. N,N-dimethylformamide/water/3,4,5-trimethoxybenzaldehyde
  5647. N,N-dimethylformamide/water/3,9-dipyrolidino-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane-3,9-dioxide
  5648. N,N-dimethylformamide/water/3-Bromo-2-methylbenzoic acid
  5649. N,N-dimethylformamide/water/3-Methyl-6-nitroindazole
  5650. N,N-dimethylformamide/water/3-nitrobenzoic acid sodium salt
  5651. N,N-dimethylformamide/water/3-pyridinecarboxamide
  5652. N,N-dimethylformamide/water/4-hydroxybenzoic acid methyl ester
  5653. N,N-dimethylformamide/water/4-Methoxy-N,6-dimethyl-1,3,5-triazin-2-amine
  5654. N,N-dimethylformamide/water/5,10,15,20-tetrakis(4-chlorophenyl) porphyrin manganese(III) chloride
  5655. N,N-dimethylformamide/water/5,10,15,20-tetraphenyl-21H,23H-porphine
  5656. N,N-dimethylformamide/water/5-Chloro-4-hydroxy-1H-pyridin-2-one
  5657. N,N-dimethylformamide/water/5-nitroisoindole-1,3-dione
  5658. N,N-dimethylformamide/water/6-Chloropurine
  5659. N,N-dimethylformamide/water/9-Fluorenylmethylsuccinimidyl carbonate
  5660. N,N-dimethylformamide/water/Arbidol
  5661. N,N-dimethylformamide/water/Biapenem
  5662. N,N-dimethylformamide/water/bis(1-methyl-1-phenylethyl) peroxide
  5663. N,N-dimethylformamide/water/blood serum albumins
  5664. N,N-dimethylformamide/water/boric acid (HBO2) sodium salt
  5665. N,N-dimethylformamide/water/C.I. basic Violet 1
  5666. N,N-dimethylformamide/water/cadmium bromide (CdBr2)
  5667. N,N-dimethylformamide/water/cadmium iodide (CdI2)
  5668. N,N-dimethylformamide/water/Carbazochrome
  5669. N,N-dimethylformamide/water/Cerium(III) tris(salicylidene-β-alanine)
  5670. N,N-dimethylformamide/water/cesium bromide (CsBr)
  5671. N,N-dimethylformamide/water/cesium iodide (CsI)
  5672. N,N-dimethylformamide/water/Chlorhexidine
  5673. N,N-dimethylformamide/water/chloroacetic acid
  5674. N,N-dimethylformamide/water/Cinosulfuron
  5675. N,N-dimethylformamide/water/Ciprofibrate
  5676. N,N-dimethylformamide/water/copper bromide (CuBr2)
  5677. N,N-dimethylformamide/water/D-Histidine
  5678. N,N-dimethylformamide/water/Domperidone
  5679. N,N-dimethylformamide/water/Etonogestrel
  5680. N,N-dimethylformamide/water/Europium(III) tris(salicylidene-β-alanine)
  5681. N,N-dimethylformamide/water/Fenbendazole
  5682. N,N-dimethylformamide/water/Flubendazole
  5683. N,N-dimethylformamide/water/Flufenoxuron
  5684. N,N-dimethylformamide/water/Gadolinium(III) tris(salicylidene-β-alanine)
  5685. N,N-dimethylformamide/water/Glimepiride
  5686. N,N-dimethylformamide/water/Halosulfuron-methyl
  5687. N,N-dimethylformamide/water/hydrogen sulfide (H2S)
  5688. N,N-dimethylformamide/water/Inamrinone
  5689. N,N-dimethylformamide/water/iodic acid (HIO3) calcium salt
  5690. N,N-dimethylformamide/water/magnesium chloride (MgCl2)
  5691. N,N-dimethylformamide/water/mannitol
  5692. N,N-dimethylformamide/water/Maraviroc
  5693. N,N-dimethylformamide/water/Methyl 3-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoylsulfamoyl]thiophene-2-carboxylate
  5694. N,N-dimethylformamide/water/methylcyclopentane
  5695. N,N-dimethylformamide/water/Methyldopa
  5696. N,N-dimethylformamide/water/Milrinone
  5697. N,N-dimethylformamide/water/myo-inositol
  5698. N,N-dimethylformamide/water/N,N'-dimethylurea
  5699. N,N-dimethylformamide/water/N,N,N-tripentyl-1-pentanaminium bromide
  5700. N,N-dimethylformamide/water/N-(2,4-difluorophenyl)-2-(3-(trifluoromethyl)phenoxy)-3-pyridinecarboxamide
  5701. N,N-dimethylformamide/water/N-[((3,5-dichloro-2,4-difluorophenyl)amino)carbonyl]-2,6-difluorobenzamide
  5702. N,N-dimethylformamide/water/naphthalene
  5703. N,N-dimethylformamide/water/natural gas
  5704. N,N-dimethylformamide/water/Nitazoxanide
  5705. N,N-dimethylformamide/water/nitric acid lithium salt
  5706. N,N-dimethylformamide/water/nitric acid potassium salt
  5707. N,N-dimethylformamide/water/nitric acid silver(1+) salt
  5708. N,N-dimethylformamide/water/nitric acid zinc salt
  5709. N,N-dimethylformamide/water/nitrobenzene
  5710. N,N-dimethylformamide/water/perchloric acid lithium salt
  5711. N,N-dimethylformamide/water/perchloric acid potassium salt
  5712. N,N-dimethylformamide/water/Phenformin
  5713. N,N-dimethylformamide/water/polyetherurethane
  5714. N,N-dimethylformamide/water/potassium bromide (KBr)
  5715. N,N-dimethylformamide/water/Praseodymium(III) tris(salicylidene-β-alanine)
  5716. N,N-dimethylformamide/water/Quinocetone
  5717. N,N-dimethylformamide/water/Rimsulfuron
  5718. N,N-dimethylformamide/water/rubidium bromide (RbBr)
  5719. N,N-dimethylformamide/water/rubidium chloride (RbCl)
  5720. N,N-dimethylformamide/water/silver bromide (AgBr)
  5721. N,N-dimethylformamide/water/silver chloride (AgCl)
  5722. N,N-dimethylformamide/water/silver iodide (AgI)
  5723. N,N-dimethylformamide/water/sulfuric acid calcium salt (1:1)
  5724. N,N-dimethylformamide/water/sulfuric acid copper(2+) salt (1:1)
  5725. N,N-dimethylformamide/water/sulfuric acid diammonium salt
  5726. N,N-dimethylformamide/water/sulfuric acid dipotassium salt
  5727. N,N-dimethylformamide/water/sulfuric acid manganese(2+) salt (1:1)
  5728. N,N-dimethylformamide/water/sulfuric acid nickel(2+) salt (1:1)
  5729. N,N-dimethylformamide/water/Thenalidine
  5730. N,N-dimethylformamide/water/xylitol
  5731. N,N-dimethylformamide/water/Zirconium(IV)(bis-(2-hydroxynaphthyl) benzidine trichloride) monohydrate
  5732. N,N-dimethylformamide/water/Zirconium(IV)(bis-(2-hydroxynaphthyl)-o-phenylenedialdimine dichloride)
  5733. N,N-dimethylformamide/water/Zonisamide
  5734. N,N-dimethylformamide/zinc chloride (ZnCl2)/water
  5735. N,N-dimethylmethanamine hydrochloride/dichlorooxozirconium/water
  5736. N,N-dimethylmethanamine hydrochloride/ethanol/water
  5737. N,N-dimethylmethanamine hydrochloride/hydrochloric acid/water
  5738. N,N-dimethylmethanamine hydrochloride/N,N-dimethylmethanamine/water
  5739. N,N-dimethylmethanamine hydrochloride/water/cerium chloride (CeCl3)
  5740. N,N-dimethylmethanamine N-oxide/α-hydro-ω-hydroxypoly(oxy(methyl-1,2-ethanediyl))/water
  5741. N,N-dimethylmethanamine N-oxide/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)/water
  5742. N,N-dimethylmethanamine N-oxide/±-2-aminobutanoic acid/water
  5743. N,N-dimethylmethanamine N-oxide/3-hydroxy-4-trimethylazaniumylbutanoate/water
  5744. N,N-dimethylmethanamine N-oxide/glycine/water
  5745. N,N-dimethylmethanamine N-oxide/L-alanine/water
  5746. N,N-dimethylmethanamine N-oxide/L-leucine/water
  5747. N,N-dimethylmethanamine N-oxide/L-valine/water
  5748. N,N-dimethylmethanamine N-oxide/N-(N-(N-glycylglycyl)glycyl)glycine/water
  5749. N,N-dimethylmethanamine N-oxide/N-(N-glycylglycyl)glycine/water
  5750. N,N-dimethylmethanamine N-oxide/N-glycylglycine/water
  5751. N,N-dimethylmethanamine N-oxide/water/L-Leucylglycylglycine
  5752. N,N-dimethylmethanamine N-oxide/water/N-glycyl-L-leucine
  5753. N,N-dimethylmethanamine N-oxide/water/N-methylacetamide
  5754. N,N-dimethylmethanamine/ammonia/water
  5755. N,N-dimethylmethanamine/sodium chloride (NaCl)/water
  5756. N,N-dimethylpropanamide/water/4-hydroxybenzoic acid methyl ester
  5757. N,N-dimethylurea/hydrochloric acid/water
  5758. N,N-dimethylurea/methanol/tetrachlorostannane
  5759. N,N-dimethylurea/N,N,N-trimethylmethanaminium bromide/water
  5760. N,N-dimethylurea/N,N-dimethylformamide/water
  5761. N,N-dimethylurea/nitric acid/water
  5762. N,N-dimethylurea/perchloric acid sodium salt/water
  5763. N,N-dimethylurea/perchloric acid/water
  5764. N,N-dimethylurea/phosphoric acid/water
  5765. N,N-dimethylurea/sodium bromide (NaBr)/water
  5766. N,N-dimethylurea/sodium chloride (NaCl)/water
  5767. N,N-dimethylurea/sulfuric acid/water
  5768. N,N-dimethylurea/water/chromic acid (H2CrO4) diammonium salt
  5769. N,N-dimethylurea/water/iodic acid (HIO3)
  5770. N,N-dimethylurea/water/nitric acid zinc salt
  5771. N,N-dimethylurea/water/perchloric acid ammonium salt
  5772. N,N-dimethylurea/water/selenic acid
  5773. N,N-dimethylurea/water/selenious acid
  5774. N,N-dioctyl-1-octanamine 4-methylbenzenesulfonate/tetrachloromethane/nitrobenzene
  5775. N,N-dioctyl-1-octanamine hydriodide/water/nitrobenzene
  5776. N,N-dioctyl-1-octanamine hydrobromide/water/nitrobenzene
  5777. N,N-dioctyl-1-octanamine hydrochloride/water/nitrobenzene
  5778. N,N-dioctyl-1-octanamine perchlorate/water/nitrobenzene
  5779. N,N-dioctyl-1-octanamine/acetic acid/2-propanol
  5780. N,N-dioctyl-1-octanamine/acetic acid/trichloromethane
  5781. N,N-dioctyl-1-octanamine/benzene/propanoic acid
  5782. N,N-dioctyl-1-octanamine/decane/water
  5783. N,N-dioctyl-1-octanamine/ethanol/acetic acid
  5784. N,N-dioctyl-1-octanamine/ethanol/propanoic acid
  5785. N,N-dioctyl-1-octanamine/nitric acid/water
  5786. N,N-dioctyl-1-octanamine/phosphoric acid tributyl ester/phosphoric acid
  5787. N,N-dioctyl-1-octanamine/tetrachloromethane/acetic acid
  5788. N,N-dipentyl-1-pentanamine hydriodide/water/nitrobenzene
  5789. N,N-dipentyl-1-pentanamine hydrobromide/water/nitrobenzene
  5790. N,N-dipentyl-1-pentanamine hydrochloride/water/nitrobenzene
  5791. N,N-dipentyl-1-pentanamine perchlorate/water/nitrobenzene
  5792. N,N-diphenylbenzenamine/ethanol/water
  5793. N,N-diphenylbenzenamine/methanol/water
  5794. N,N-diphenyldodecanamide/ethanol/water
  5795. N,N-diphenylhexadecanamide/ethanol/water
  5796. N,N-dipropyl-1-propanamine compd. with 2,4,6-trinitrophenol (1:1)/Sodium 2,4,6-trinitrophenolate/water
  5797. N,N-dipropyl-1-propanamine compd. with 2,4,6-trinitrophenol (1:1)/sodium chloride (NaCl)/water
  5798. N,N-dipropyl-1-propanamine hydriodide/water/nitrobenzene
  5799. N,N-dipropyl-1-propanamine hydrobromide/water/nitrobenzene
  5800. N,N-dipropyl-1-propanamine hydrochloride/water/nitrobenzene
  5801. N,N-dipropyl-1-propanamine perchlorate/water/nitrobenzene
  5802. N,N-dipropyl-1-propanamine/carbon dioxide/water
  5803. N,N-dipropyl-1-propanamine/N-propyl-1-propanamine/water
  5804. N-β-alanyl-β-alanine/sulfinylbismethane/water
  5805. N-β-alanylglycine/sulfinylbismethane/water
  5806. N-((4-aminophenyl)sulfonyl)acetamide/β-D-fructofuranosyl α-D-glucopyranoside/2-hydroxy-N,N,N-trimethylethanaminium chloride
  5807. N-((4-aminophenyl)sulfonyl)acetamide/1,2,3-propanetriol/2-hydroxy-N,N,N-trimethylethanaminium chloride
  5808. N-((4-aminophenyl)sulfonyl)acetamide/1,2-propanediol/water
  5809. N-((4-aminophenyl)sulfonyl)acetamide/2-hydroxy-N,N,N-trimethylethanaminium chloride/xylitol
  5810. N-((4-aminophenyl)sulfonyl)acetamide/4-O-α-D-glucopyranosyl-D-glucopyranose/2-hydroxy-N,N,N-trimethylethanaminium chloride
  5811. N-((4-aminophenyl)sulfonyl)acetamide/D-fructose/2-hydroxy-N,N,N-trimethylethanaminium chloride
  5812. N-((4-aminophenyl)sulfonyl)acetamide/D-glucitol/2-hydroxy-N,N,N-trimethylethanaminium chloride
  5813. N-((4-aminophenyl)sulfonyl)acetamide/D-glucose/2-hydroxy-N,N,N-trimethylethanaminium chloride
  5814. N-((4-aminophenyl)sulfonyl)acetamide/ethanol/water
  5815. N-((phenylmethoxy)carbonyl)glycine/urea/water
  5816. N-(1,1-dimethylethyl)formamide/urea/water
  5817. N-(1-((phenylmethoxy)carbonyl)-L-prolyl)-D-leucine/sodium chloride (NaCl)/water
  5818. N-(1-methylethyl)-2-propanamine/1-propene/water
  5819. N-(1-methylethyl)-2-propanamine/2-propanamine/water
  5820. N-(1-methylethyl)-2-propanamine/2-propanol/water
  5821. N-(1-methylethyl)-2-propanamine/carbon dioxide/1-methyl-2-pyrrolidinone
  5822. N-(1-methylethyl)-2-propanamine/carbon dioxide/water
  5823. N-(1-methylethyl)-2-propanamine/formic acid lithium salt/water
  5824. N-(1-methylethyl)-2-propanamine/methane/water
  5825. N-(1-methylethyl)-2-propanamine/sodium chloride (NaCl)/water
  5826. N-(1-methylethyl)-2-propanamine/water/hydrogen sulfide (H2S)
  5827. N-(1-methylethyl)-2-propenamide homopolymer/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)/water
  5828. N-(1-methylethyl)-2-propenamide homopolymer/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)/water
  5829. N-(1-methylethyl)-2-propenamide homopolymer/1,2,3-propanetriol/water
  5830. N-(1-methylethyl)-2-propenamide homopolymer/1,3-propanediol/water
  5831. N-(1-methylethyl)-2-propenamide homopolymer/1-butanol/water
  5832. N-(1-methylethyl)-2-propenamide homopolymer/1-propanol/water
  5833. N-(1-methylethyl)-2-propenamide homopolymer/2-propanol/water
  5834. N-(1-methylethyl)-2-propenamide homopolymer/ethanol/water
  5835. N-(1-methylethyl)-2-propenamide homopolymer/methanol/water
  5836. N-(1-methylethyl)-2-propenamide homopolymer/N,N,N-triethylethanaminium bromide/water
  5837. N-(1-methylethyl)-2-propenamide homopolymer/N,N,N-trimethylmethanaminium bromide/water
  5838. N-(1-methylethyl)-2-propenamide homopolymer/potassium chloride (KCl)/water
  5839. N-(1-methylethyl)-2-propenamide homopolymer/potassium iodide (KI)/water
  5840. N-(1-methylethyl)-2-propenamide homopolymer/sodium bromide (NaBr)/water
  5841. N-(1-methylethyl)-2-propenamide homopolymer/sodium chloride (NaCl)/water
  5842. N-(1-methylethyl)-2-propenamide homopolymer/sodium iodide (NaI)/water
  5843. N-(1-methylethyl)-2-propenamide homopolymer/sulfinylbismethane/water
  5844. N-(1-methylethyl)-2-propenamide homopolymer/urea/water
  5845. N-(1-methylethyl)-2-propenamide homopolymer/water/albumine bovine
  5846. N-(1-methylethyl)-2-propenamide homopolymer/water/N,N,N-tripentyl-1-pentanaminium bromide
  5847. N-(1-methylethyl)-2-propenamide homopolymer/water/oxirane triblock polymer with hexadecafluoro-1-octene and oxirane
  5848. N-(1-methylethyl)-2-propenamide homopolymer/water/potassium bromide (KBr)
  5849. N-(1-oxopentyl)-N-((2'-(1H-tetrazol-5-yl)(1,1'-biphenyl)-4-yl)methyl)-L-valine/acetic acid ethyl ester/2-butanone
  5850. N-(2,4-dibromophenyl)acetamide/hydrochloric acid/water
  5851. N-(2,4-dibromophenyl)acetamide/perchloric acid/water
  5852. N-(2,4-dibromophenyl)acetamide/phosphoric acid/water
  5853. N-(2,4-dibromophenyl)acetamide/sulfuric acid/water
  5854. N-(2-(nitrooxy)ethyl)-3-pyridinecarboxamide/2-propanol/water
  5855. N-(2-(nitrooxy)ethyl)-3-pyridinecarboxamide/methanol/water
  5856. N-(2-(nitrooxy)ethyl)-3-pyridinecarboxamide/N,N-dimethylformamide/water
  5857. N-(2-amino-2-oxoethyl)acetamide/tetramethylurea/water
  5858. N-(2-amino-2-oxoethyl)acetamide/urea/water
  5859. N-(2-aminoethyl)-1,2-ethanediamine/1,1'-oxybis(2-methoxyethane)/water
  5860. N-(2-aminoethyl)-1,2-ethanediamine/carbon dioxide/water
  5861. N-(2-aminoethyl)-1,2-ethanediamine/sulfinylbismethane/water
  5862. N-(2-aminoethyl)-1,2-ethanediamine/tetrahydrothiophene 1,1-dioxide/water
  5863. N-(2-aminoethyl)-N'-(2-((2-aminoethyl)amino)ethyl)-1,2-ethanediamine/carbon dioxide/1-ethyl-3-methyl-1H-imidazolium acetate
  5864. N-(2-aminoethyl)-N'-(2-((2-aminoethyl)amino)ethyl)-1,2-ethanediamine/carbon dioxide/water
  5865. N-(2-furanylmethyl)-1H-purin-6-amine/ethanol/water
  5866. N-(2-hydroxyethyl)-1-tetradecanamine/hydrochloric acid/water
  5867. N-(2-hydroxyethyl)-N,N-dimethyl-1-butanaminium bromide/lithium bromide (LiBr)/water
  5868. N-(2-hydroxyethyl)-N,N-dimethylbenzenemethanaminium chloride/water/phosphoric acid tripotassium salt
  5869. N-(2-methylphenyl)acetamide/periodic acid (HIO4)/water
  5870. N-(2-methylphenyl)acetamide/water/iodic acid (HIO3)
  5871. N-(2-nitrophenyl)-4-nitrobenzamide/N,N-dimethylformamide/water
  5872. N-(2-nitrophenyl)acetamide/1-propanol/water
  5873. N-(2-nitrophenyl)acetamide/ethanol/water
  5874. N-(2-nitrophenyl)acetamide/N,N-dimethylformamide/water
  5875. N-(3-aminophenyl)acetamide/tetrahydrofuran/2-propanol
  5876. N-(3-aminophenyl)acetamide/tetrahydrofuran/acetic acid ethyl ester
  5877. N-(3-aminopropyl)-1,3-propanediamine/carbonic acid dipotassium salt/water
  5878. N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine hydrochloride/2-propanol/poly(ethylene glycol) sorbitan monooleate
  5879. N-(3-ethynylphenyl)-6,7-bis(2-methoxyethoxy)quinazolin-4-amine hydrochloride/2-propanone/poly(ethylene glycol) sorbitan monooleate
  5880. N-(4-(((aminoiminomethyl)amino)sulfonyl)phenyl)acetamide/ethanol/water
  5881. N-(4-bromophenyl)acetamide/hydrochloric acid/water
  5882. N-(4-bromophenyl)acetamide/perchloric acid/water
  5883. N-(4-ethoxyphenyl)acetamide/acetic acid/water
  5884. N-(4-ethoxyphenyl)acetamide/acetonitrile/water
  5885. N-(4-ethoxyphenyl)acetamide/ethanol/quinoline
  5886. N-(4-ethoxyphenyl)acetamide/ethanol/water
  5887. N-(4-ethoxyphenyl)acetamide/methanol/water
  5888. N-(4-ethoxyphenyl)acetamide/N,N-dimethylformamide/water
  5889. N-(4-ethoxyphenyl)acetamide/sulfinylbismethane/water
  5890. N-(4-ethoxyphenyl)acetamide/trichloromethane/water
  5891. N-(4-hydroxyphenyl)acetamide/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)/ethanol
  5892. N-(4-hydroxyphenyl)acetamide/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)/water
  5893. N-(4-hydroxyphenyl)acetamide/1,2,3-propanetriol/2-hydroxy-N,N,N-trimethylethanaminium chloride
  5894. N-(4-hydroxyphenyl)acetamide/1,2-ethanediol/2-hydroxy-N,N,N-trimethylethanaminium chloride
  5895. N-(4-hydroxyphenyl)acetamide/1,2-propanediol/ethanol
  5896. N-(4-hydroxyphenyl)acetamide/1,2-propanediol/water
  5897. N-(4-hydroxyphenyl)acetamide/1,4-dioxane/water
  5898. N-(4-hydroxyphenyl)acetamide/1-butyl-4-methylpyridinium bromide/water
  5899. N-(4-hydroxyphenyl)acetamide/1-hexyl-4-methylpyridinium bromide/water
  5900. N-(4-hydroxyphenyl)acetamide/1-methyl-3-octyl-1H-imidazolium bromide/water
  5901. N-(4-hydroxyphenyl)acetamide/1-octanol/water
  5902. N-(4-hydroxyphenyl)acetamide/1-propanol/water
  5903. N-(4-hydroxyphenyl)acetamide/2-(2-ethoxyethoxy)ethanol/water
  5904. N-(4-hydroxyphenyl)acetamide/2-diethylaminoethyl 1-cyclohexylcyclohexane-1-carboxylate; hydron; chloride/1-propanol
  5905. N-(4-hydroxyphenyl)acetamide/2-diethylaminoethyl 1-cyclohexylcyclohexane-1-carboxylate; hydron; chloride/water
  5906. N-(4-hydroxyphenyl)acetamide/2-hydroxy-N,N,N-trimethylethanaminium glycinate/water
  5907. N-(4-hydroxyphenyl)acetamide/2-hydroxy-N,N,N-trimethylethanaminium L-alaninate/water
  5908. N-(4-hydroxyphenyl)acetamide/2-hydroxybenzoic acid monosodium salt/water
  5909. N-(4-hydroxyphenyl)acetamide/2-propanol/water
  5910. N-(4-hydroxyphenyl)acetamide/2-propanone/water
  5911. N-(4-hydroxyphenyl)acetamide/4-morpholinecarboxaldehyde/water
  5912. N-(4-hydroxyphenyl)acetamide/acetic acid ethyl ester/ethanol
  5913. N-(4-hydroxyphenyl)acetamide/acetic acid ethyl ester/methanol
  5914. N-(4-hydroxyphenyl)acetamide/acetonitrile/water
  5915. N-(4-hydroxyphenyl)acetamide/carbon dioxide/2-propanone
  5916. N-(4-hydroxyphenyl)acetamide/carbon dioxide/ethanol
  5917. N-(4-hydroxyphenyl)acetamide/cyclohexane/ethanol
  5918. N-(4-hydroxyphenyl)acetamide/ethanedioic acid/2-hydroxy-N,N,N-trimethylethanaminium chloride
  5919. N-(4-hydroxyphenyl)acetamide/ethanol/methanol
  5920. N-(4-hydroxyphenyl)acetamide/ethanol/water
  5921. N-(4-hydroxyphenyl)acetamide/methanol/2-diethylaminoethyl 1-cyclohexylcyclohexane-1-carboxylate; hydron; chloride
  5922. N-(4-hydroxyphenyl)acetamide/methanol/water
  5923. N-(4-hydroxyphenyl)acetamide/methylbenzene/2-propanone
  5924. N-(4-hydroxyphenyl)acetamide/N,N-dimethylformamide/water
  5925. N-(4-hydroxyphenyl)acetamide/propanedioic acid/2-hydroxy-N,N,N-trimethylethanaminium chloride
  5926. N-(4-hydroxyphenyl)acetamide/sodium chloride (NaCl)/water
  5927. N-(4-hydroxyphenyl)acetamide/sulfinylbismethane/water
  5928. N-(4-hydroxyphenyl)acetamide/tetradecanoic acid 1-methylethyl ester/water
  5929. N-(4-hydroxyphenyl)acetamide/trichloromethane/water
  5930. N-(4-hydroxyphenyl)acetamide/urea/2-hydroxy-N,N,N-trimethylethanaminium chloride
  5931. N-(4-hydroxyphenyl)acetamide/urea/water
  5932. N-(4-hydroxyphenyl)acetamide/water/1-butyl-3-methyl-1H-imidazolium bromide
  5933. N-(4-hydroxyphenyl)acetamide/water/1-butyl-3-methyl-1H-imidazolium chloride
  5934. N-(4-hydroxyphenyl)acetamide/water/1-hexyl-3-methyl-1H-imidazolium bromide
  5935. N-(4-hydroxyphenyl)acetamide/water/1-Octyl-4-methylpyridinium bromide
  5936. N-(4-hydroxyphenyl)acetamide/water/2-hydroxy-N,N,N-trimethylethanaminium salt with 2-hydroxypropanoic acid (1:1)
  5937. N-(4-hydroxyphenyl)acetamide/water/3-pyridinecarboxamide
  5938. N-(4-hydroxyphenyl)acetamide/water/cholinium bitartrate
  5939. N-(4-hydroxyphenyl)acetamide/water/Cholinium L-valinate
  5940. N-(4-methoxyphenyl)acetamide/ethanol/water
  5941. N-(4-methylphenyl)acetamide/1,1'-oxybisethane/trichloromethane
  5942. N-(4-methylphenyl)acetamide/cyclohexane/benzenamine
  5943. N-(4-methylphenyl)acetamide/ethanol/carbon disulfide
  5944. N-(4-methylphenyl)acetamide/ethanol/water
  5945. N-(4-methylphenyl)acetamide/methanol/carbon disulfide
  5946. N-(4-methylphenyl)acetamide/tetrachloromethane/benzene
  5947. N-(4-methylphenyl)acetamide/tetrachloromethane/ethanol
  5948. N-(4-nitrophenyl)-4-nitrobenzamide/N,N-dimethylformamide/water
  5949. N-(4-nitrophenyl)benzamide/N,N-dimethylformamide/water
  5950. N-(5-(bis(2-(acetyloxy)ethyl)amino)-2-((2-bromo-4,6-dinitrophenyl)azo)-4-ethoxyphenyl)acetamide/carbon dioxide/ethanol
  5951. N-(5-(bis(2-(acetyloxy)ethyl)amino)-2-((2-bromo-4,6-dinitrophenyl)azo)-4-ethoxyphenyl)acetamide/carbon dioxide/N,N-dimethyl-2-propenamide
  5952. N-(aminocarbonyl)acetamide/lithium chloride (LiCl)/water
  5953. N-(aminocarbonyl)acetamide/sulfuric acid magnesium salt (1:1)/water
  5954. N-(aminocarbonyl)acetamide/water/cadmium bromide (CdBr2)
  5955. N-(aminocarbonyl)acetamide/water/cadmium iodide (CdI2)
  5956. N-(aminocarbonyl)acetamide/water/iodic acid (HIO3)
  5957. N-(aminocarbonyl)acetamide/water/lithium pentaborate
  5958. N-(aminocarbonyl)acetamide/water/sulfuric acid zinc salt (1:1)
  5959. N-(aminocarbonyl)acetamide/zinc chloride (ZnCl2)/water
  5960. N-(aminocarbonyl)glycin/ethanol/water
  5961. N-(aminoiminomethyl)-N-methylglycine/ethanol/water
  5962. N-(N-((phenylmethoxy)carbonyl)glycyl)glycine/urea/water
  5963. N-(N-(N-(N-(N-glycylglycyl)glycyl)glycyl)glycyl)glycine/ethanol/water
  5964. N-(N-(N-glycylglycyl)glycyl)glycine/ethanol/water
  5965. N-(N-(N-glycylglycyl)glycyl)glycine/potassium chloride (KCl)/water
  5966. N-(N-(N-glycylglycyl)glycyl)glycine/water/potassium bromide (KBr)
  5967. N-(N-Glycylglycyl)-L-leucine/N,N,N-triethylethanaminium bromide/water
  5968. N-(N-glycylglycyl)glycine/β-cyclodextrin/water
  5969. N-(N-glycylglycyl)glycine/β-D-fructofuranosyl α-D-glucopyranoside/water
  5970. N-(N-glycylglycyl)glycine/1,2,3-propanetriol/water
  5971. N-(N-glycylglycyl)glycine/1-propanol/water
  5972. N-(N-glycylglycyl)glycine/2-propanol/water
  5973. N-(N-glycylglycyl)glycine/3,7-dihydro-1,3,7-trimethyl-1H-purine-2,6-dione/water
  5974. N-(N-glycylglycyl)glycine/4-O-α-D-glucopyranosyl-D-glucose/water
  5975. N-(N-glycylglycyl)glycine/acetonitrile/water
  5976. N-(N-glycylglycyl)glycine/D-fructose/water
  5977. N-(N-glycylglycyl)glycine/D-mannitol/water
  5978. N-(N-glycylglycyl)glycine/ethanol/water
  5979. N-(N-glycylglycyl)glycine/potassium chloride (KCl)/water
  5980. N-(N-glycylglycyl)glycine/sodium chloride (NaCl)/water
  5981. N-(N-glycylglycyl)glycine/sodium iodide (NaI)/water
  5982. N-(N-glycylglycyl)glycine/sulfinylbismethane/water
  5983. N-(N-glycylglycyl)glycine/urea/water
  5984. N-(N-glycylglycyl)glycine/water/3-(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ylidene)-N-methyl-1-propanamine hydrochloride
  5985. N-(N-glycylglycyl)glycine/water/myo-inositol
  5986. N-(N-glycylglycyl)glycine/water/potassium bromide (KBr)
  5987. N-(N-glycylglycyl)glycine/water/xylitol
  5988. N-(phenylmethyl)-1H-purin-6-amine/2-propanone/N,N-dimethylformamide
  5989. N-(phosphonomethyl)glycine/1-propanol/water
  5990. N-(phosphonomethyl)glycine/2-propanol/water
  5991. N-(phosphonomethyl)glycine/ethanol/water
  5992. N-(phosphonomethyl)glycine/sodium chloride (NaCl)/water
  5993. N-1-naphthalenylacetamide/ethanol/water
  5994. N-3-acetyl-4-[2-hydroxy-3-((1-methylethyl)amino)propoxy]phenylbutanamide monohydrochloride/sodium chloride (NaCl)/water
  5995. N-6,9-dihydro-9-[(2-hydroxyethoxy)methyl]-6-oxo-1H-purin-2-ylacetamide/1-heptanol/water
  5996. N-6,9-dihydro-9-[(2-hydroxyethoxy)methyl]-6-oxo-1H-purin-2-ylacetamide/1-nonanol/water
  5997. N-6,9-dihydro-9-[(2-hydroxyethoxy)methyl]-6-oxo-1H-purin-2-ylacetamide/1-octanol/water
  5998. N-9-[(2-hydroxyethoxy)methyl]-9H-purin-2-ylacetamide/1-nonanol/water
  5999. N-acetyl-L-cysteine/water/1-hexyl-3-methyl-1H-imidazolium bromide
  6000. N-acetyl-L-seryl-L-phenylalanyl-L-valylglycine methyl ester/2,2,2-trifluoroethanol/water
  6001. N-acetyl-L-seryl-L-phenylalanyl-L-valylglycine methyl ester/ethanol/water
  6002. N-acetylglycine/β-D-fructofuranosyl α-D-glucopyranoside/water
  6003. N-acetylglycine/1-dodecyl-3-methyl-1H-imidazolium bromide/water
  6004. N-acetylglycine/2-hydroxy-1,2,3-propanetricarboxylic acid trisodium salt/water
  6005. N-acetylglycine/D-fructose/water
  6006. N-acetylglycine/methanol/acetonitrile
  6007. N-acetylglycine/N,N,N-triethylethanaminium iodide/water
  6008. N-acetylglycine/phosphoric acid disodium salt/water
  6009. N-acetylglycine/potassium chloride (KCl)/water
  6010. N-acetylglycine/sodium chloride (NaCl)/water
  6011. N-acetylglycine/water/2-hydroxy-1,2,3-propanetricarboxylic acid tripotassium salt
  6012. N-acetylglycine/water/magnesium chloride (MgCl2)
  6013. N-acetylglycine/water/phosphoric acid dipotassium salt
  6014. N-benzoylglycine/ethanol/quinoline
  6015. N-benzoylglycine/water/Potassium hippurate
  6016. n-butane/(1-methylethenyl)benzene/Copper(I) hexafluoroacetyl acetonate
  6017. n-butane/(2Z)-2-butene/2-furancarboxaldehyde
  6018. n-butane/(2Z)-2-butene/acetonitrile
  6019. n-butane/1,2-propadiene/1-propyne
  6020. n-butane/1,3-butadiene/(2E)-2-butene
  6021. n-butane/1,3-butadiene/1-butyne
  6022. n-butane/1,3-butadiene/2-methylpropane
  6023. n-butane/1,3-butadiene/acetonitrile
  6024. n-butane/1-butanol/water
  6025. n-butane/1-buten-3-yne/2-methylpropane
  6026. n-butane/1-butene/1,3-butadiene
  6027. n-butane/1-butene/2-furancarboxaldehyde
  6028. n-butane/1-butene/morpholine
  6029. n-butane/1-butene/N,N-dimethylformamide
  6030. n-butane/1-butene/water
  6031. n-butane/1-butyl-3-methyl-1H-imidazolium hexafluorophosphate(1-)/water
  6032. n-butane/1-butyl-3-methyl-1H-imidazolium tetrafluoroborate(1-)/water
  6033. n-butane/1-chloro-4-ethenylbenzene homopolymer/2-propanone
  6034. n-butane/1-chloro-4-ethenylbenzene homopolymer/ethanol
  6035. n-butane/1-chloro-4-ethenylbenzene/1-chloro-4-ethenylbenzene homopolymer
  6036. n-butane/1-ethyl-3-methyl-1H-imidazolium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)/water
  6037. n-butane/1-ethyl-3-methyl-1H-imidazolium salt with trifluoromethanesulfonic acid (1:1)/water
  6038. n-butane/1-octanol/water
  6039. n-butane/2,2'-iminobisethanol/1-methyl-2-pyrrolidinone
  6040. n-butane/2,2'-iminobisethanol/water
  6041. n-butane/2-aminoethanol/1-methyl-2-pyrrolidinone
  6042. n-butane/2-methyl-1-propene/2-methylpropane
  6043. n-butane/2-methyl-2-propanol/water
  6044. n-butane/2-methylbutane/1,1,1,2-tetrafluoroethane
  6045. n-butane/2-methylpropane/water
  6046. n-butane/2-propanone/1-butanol
  6047. n-butane/2-propanone/1-propanol
  6048. n-butane/2-propanone/water
  6049. n-butane/4-morpholinecarboxaldehyde/water
  6050. n-butane/acetic acid/water
  6051. n-butane/acetonitrile/water
  6052. n-butane/air/ethene
  6053. n-butane/air/hydrogen
  6054. n-butane/air/methane
  6055. n-butane/air/propane
  6056. n-butane/anthracene/carbon dioxide
  6057. n-butane/benzene/sulfur dioxide
  6058. n-butane/carbon dioxide/2,2',3,4,4',5,5'-heptachloro-1,1'-biphenyl
  6059. n-butane/carbon dioxide/2,2',4,4',5,5'-hexachloro-1,1'-biphenyl
  6060. n-butane/carbon dioxide/2,2',4,5,5'-pentachloro-1,1'-biphenyl
  6061. n-butane/carbon dioxide/2,2'-dichloro-1,1'-biphenyl
  6062. n-butane/carbon dioxide/2,4',5-trichloro-1,1'-biphenyl
  6063. n-butane/carbon dioxide/2-chloro-1,1'-biphenyl
  6064. n-butane/carbon dioxide/3,3',4,4'-tetrachloro-1,1'-biphenyl
  6065. n-butane/carbon dioxide/4,4'-dichloro-1,1'-biphenyl
  6066. n-butane/carbon dioxide/4-chloro-1,1'-biphenyl
  6067. n-butane/carbon dioxide/butylcyclohexane
  6068. n-butane/carbon dioxide/ethane
  6069. n-butane/carbon dioxide/methane
  6070. n-butane/carbon dioxide/nitrogen
  6071. n-butane/carbon dioxide/perylene
  6072. n-butane/carbon dioxide/phenanthrene
  6073. n-butane/carbon dioxide/poly(vinyl stearate)
  6074. n-butane/carbon dioxide/propane
  6075. n-butane/carbon dioxide/pyrene
  6076. n-butane/carbon dioxide/water
  6077. n-butane/cyclohexane/benzene
  6078. n-butane/cyclohexane/methanol
  6079. n-butane/decane/carbon dioxide
  6080. n-butane/decane/methane
  6081. n-butane/decane/nitrogen
  6082. n-butane/decane/tridecane
  6083. n-butane/dodecane/methane
  6084. n-butane/dodecane/pentadecane
  6085. n-butane/ethane/nitrogen
  6086. n-butane/ethane/propane
  6087. n-butane/ethane/water
  6088. n-butane/ethanol/2-methylpropane
  6089. n-butane/ethanol/2-propanone
  6090. n-butane/ethanol/water
  6091. n-butane/guanidine monohydrochloride/water
  6092. n-butane/heptane/ethane
  6093. n-butane/heptane/hexadecane
  6094. n-butane/heptane/methane
  6095. n-butane/hexadecane/methane
  6096. n-butane/hexadecane/propane
  6097. n-butane/hexahydro-1-methyl-2H-azepin-2-one/water
  6098. n-butane/hexane/decane
  6099. n-butane/hexane/ethane
  6100. n-butane/hexane/octane
  6101. n-butane/hydrochloric acid/water
  6102. n-butane/hydrogen/9-methylanthracene
  6103. n-butane/lithium chloride (LiCl)/water
  6104. n-butane/methane/ethane
  6105. n-butane/methane/hydrogen sulfide (H2S)
  6106. n-butane/methane/nitrogen
  6107. n-butane/methane/propane
  6108. n-butane/methane/water
  6109. n-butane/methanol/2-propanone
  6110. n-butane/methanol/benzene
  6111. n-butane/methanol/water
  6112. n-butane/methylbenzene/polypropylene
  6113. n-butane/N,N,N-tributyl-1-butanaminium bromide/water
  6114. n-butane/N,N,N-triethylethanaminium bromide/water
  6115. n-butane/N,N,N-triethylethanaminium chloride/water
  6116. n-butane/N,N,N-triethylethanaminium iodide/water
  6117. n-butane/N,N,N-trimethylmethanaminium bromide/water
  6118. n-butane/N,N,N-trimethylmethanaminium chloride/water
  6119. n-butane/N,N,N-tripropyl-1-propanaminium bromide/water
  6120. n-butane/N,N-dimethylacetamide/water
  6121. n-butane/N,N-dimethylmethanamine/ammonia
  6122. n-butane/nitrogen/1-methyl-2-pyrrolidinone
  6123. n-butane/nitrogen/oxygen
  6124. n-butane/nonane/tridecane
  6125. n-butane/octane/methane
  6126. n-butane/octane/pentadecane
  6127. n-butane/octane/tetradecane
  6128. n-butane/octanoic acid sodium salt/water
  6129. n-butane/oxybismethane/ethanol
  6130. n-butane/oxybismethane/water
  6131. n-butane/pentafluoroethane/1,1,1,2-tetrafluoroethane
  6132. n-butane/pentane/ethane
  6133. n-butane/phenol/1,2,3,4-tetrahydronaphthalene
  6134. n-butane/potassium chloride (KCl)/water
  6135. n-butane/potassium iodide (KI)/water
  6136. n-butane/propane/1,1'-biphenyl
  6137. n-butane/propane/1-phenylethanone
  6138. n-butane/propane/2-methylpropane
  6139. n-butane/propane/naphthalene
  6140. n-butane/propane/water
  6141. n-butane/sodium chloride (NaCl)/water
  6142. n-butane/sulfuric acid monododecyl ester sodium salt/water
  6143. n-butane/urea/water
  6144. n-butane/water/2-butanol
  6145. n-butane/water/2-furancarboxaldehyde
  6146. n-butane/water/albumine bovine
  6147. n-butane/water/hemoglobin
  6148. n-butane/water/McKay River bitumen
  6149. n-butane/water/sea salts
  6150. N-butyl-1-butanamine hydrobromide/sodium hydroxide (Na(OH))/water
  6151. N-butyl-1-butanamine hydrochloride/phosphoric acid monoammonium salt/water
  6152. N-butyl-1-butanamine hydrochloride/water/cerium chloride (CeCl3)
  6153. N-butyl-1-butanamine/ammonia/water
  6154. N-butyl-1-butanamine/heptane/1-pentanol
  6155. N-butyl-1-butanamine/sulfur dioxide/water
  6156. N-butyl-3-methyl-N,N-bis(3-methylbutyl)-1-butanaminium iodide/acetic acid/water
  6157. N-butyl-3-methyl-N,N-bis(3-methylbutyl)-1-butanaminium iodide/acetonitrile/nitromethane
  6158. N-butyl-3-methyl-N,N-bis(3-methylbutyl)-1-butanaminium iodide/acetonitrile/water
  6159. N-butyl-3-methyl-N,N-bis(3-methylbutyl)-1-butanaminium iodide/methanol/acetonitrile
  6160. N-butyl-3-methyl-N,N-bis(3-methylbutyl)-1-butanaminium iodide/methanol/nitromethane
  6161. N-butyl-3-methyl-N,N-bis(3-methylbutyl)-1-butanaminium iodide/sulfinylbismethane/water
  6162. N-butyl-3-methyl-N,N-bis(3-methylbutyl)-1-butanaminium iodide/tetramethylsilane/water
  6163. N-butyl-3-methyl-N,N-bis(3-methylbutyl)-1-butanaminium salt with 2,4,6-trinitrophenol (1:1)/1,4-dioxane/2,10,11-trioxa-6-aza-1-borabicyclo[4,4,4]tetradecane
  6164. N-butyl-3-methyl-N,N-bis(3-methylbutyl)-1-butanaminium salt with 2,4,6-trinitrophenol (1:1)/acetonitrile/nitromethane
  6165. N-butyl-3-methyl-N,N-bis(3-methylbutyl)-1-butanaminium salt with 2,4,6-trinitrophenol (1:1)/ethanol/water
  6166. N-butyl-3-methyl-N,N-bis(3-methylbutyl)-1-butanaminium salt with 2,4,6-trinitrophenol (1:1)/methanol/acetonitrile
  6167. N-butyl-3-methyl-N,N-bis(3-methylbutyl)-1-butanaminium salt with 2,4,6-trinitrophenol (1:1)/methanol/nitromethane
  6168. N-butyl-3-methyl-N,N-bis(3-methylbutyl)-1-butanaminium tetraphenylborate(1-)/acetonitrile/nitromethane
  6169. N-butyl-3-methyl-N,N-bis(3-methylbutyl)-1-butanaminium tetraphenylborate(1-)/acetonitrile/water
  6170. N-butyl-3-methyl-N,N-bis(3-methylbutyl)-1-butanaminium tetraphenylborate(1-)/ethanol/water
  6171. N-butyl-3-methyl-N,N-bis(3-methylbutyl)-1-butanaminium tetraphenylborate(1-)/methanol/acetonitrile
  6172. N-butyl-3-methyl-N,N-bis(3-methylbutyl)-1-butanaminium tetraphenylborate(1-)/methanol/nitromethane
  6173. N-butylacetamide/N,N-dimethylformamide/water
  6174. N-butylpyridinium chloride/carbonic acid disodium salt/water
  6175. N-butylpyridinium hexafluorophosphate(1-)/methanol/2-propanone
  6176. N-chloro-4-methylbenzenesulfonamide sodium salt/1-propanol/water
  6177. N-chloro-4-methylbenzenesulfonamide sodium salt/2-propanol/water
  6178. N-chloro-4-methylbenzenesulfonamide sodium salt/ethanol/2-propanol
  6179. N-chlorobenzenesulfonamide sodium salt/ethanol/2-propanol
  6180. N-DL-alanyl-DL-alanine/1-propanol/water
  6181. N-DL-alanyl-DL-alanine/2-propanol/water
  6182. N-DL-alanyl-DL-alanine/2-propanone/water
  6183. N-DL-alanyl-DL-alanine/acetonitrile/water
  6184. N-DL-alanyl-DL-alanine/ethanol/water
  6185. N-DL-alanyl-DL-alanine/N,N-dimethylformamide/water
  6186. N-DL-alanyl-DL-alanine/potassium chloride (KCl)/water
  6187. N-DL-alanyl-DL-alanine/sodium chloride (NaCl)/water
  6188. N-DL-alanyl-DL-alanine/sodium iodide (NaI)/water
  6189. N-DL-alanyl-DL-alanine/sulfinylbismethane/water
  6190. N-DL-alanyl-DL-alanine/water/2,8,14,20-tetrakis[methyl(aminoformyl)]-4,6,10,12,16,18,22,24-octahydroxycalix[4]arene
  6191. N-DL-alanyl-DL-alanine/water/D-α-manno-naphtho-18 crown-6-ether
  6192. N-DL-alanyl-DL-valine/1-propanol/water
  6193. N-DL-alanyl-DL-valine/2-propanol/water
  6194. N-DL-alanyl-DL-valine/ethanol/water
  6195. N-DL-alanyl-DL-valine/formamide/water
  6196. N-DL-alanyl-DL-valine/N,N-diethylformamide/water
  6197. N-DL-alanyl-DL-valine/N,N-dimethylformamide/water
  6198. N-DL-alanyl-DL-valine/sulfinylbismethane/water
  6199. N-DL-alanylglycine/β-D-fructofuranosyl α-D-glucopyranoside/water
  6200. N-DL-alanylglycine/1,4-dioxane/water
  6201. N-DL-alanylglycine/1-propanol/water
  6202. N-DL-alanylglycine/2-propanol/water
  6203. N-DL-alanylglycine/2-propanone/water
  6204. N-DL-alanylglycine/4-O-α-D-glucopyranosyl-D-glucose/water
  6205. N-DL-alanylglycine/acetonitrile/water
  6206. N-DL-alanylglycine/ethanol/water
  6207. N-DL-alanylglycine/N,N-dimethylformamide/water
  6208. N-DL-alanylglycine/sulfinylbismethane/water
  6209. N-dodecyl-1-dodecanamine/ethanol/water
  6210. N-dodecyl-N,N-dimethyl-1-dodecanaminium bromide/1,1,1,2-tetrachloroethane/2-propanol
  6211. N-dodecyl-N,N-dimethyl-1-dodecanaminium bromide/1,1,1,2-tetrachloroethane/ethanol
  6212. N-dodecyl-N,N-dimethyl-1-dodecanaminium bromide/1,1,1,2-tetrachloroethane/methanol
  6213. N-dodecyl-N,N-dimethyl-1-dodecanaminium bromide/water/gelatin
  6214. n-dodecylammonium butyrate/ethanol/water
  6215. n-dodecylammonium formate/ethanol/water
  6216. N-ethenylacetamide homopolymer/water/(2R,3S,4R,5R)-2,3,4,5-tetrahydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyhexanal
  6217. N-ethenylacetamide homopolymer/water/sulfuric acid disodium salt
  6218. N-ethyl-2-butanamine/sodium chloride (NaCl)/water
  6219. N-ethyl-2-hydroxy-N,N-dimethyl-1-ethanaminium bromide/water/phosphoric acid tripotassium salt
  6220. N-ethyl-2-methyl-2-propanamine/sodium chloride (NaCl)/water
  6221. N-ethyl-2-propenamide homopolymer/potassium chloride (KCl)/water
  6222. N-ethyl-N-methylethanamine/sodium chloride (NaCl)/water
  6223. N-ethyl-N-methylethanamine/water/nitric acid potassium salt
  6224. N-ethyl-N-methylethanamine/water/sulfuric acid disodium salt
  6225. N-ethyl-N-methylpiperidinium bromide/lithium bromide (LiBr)/water
  6226. N-ethyl-N-methylpiperidinium bromide/methane/water
  6227. N-ethyl-N-methylpiperidinium bromide/water/1-butyl-1-methylpiperidin-1-ium bromide
  6228. N-ethyl-N-methylpiperidinium bromide/water/1-methyl-1-propylpiperidinium bromide
  6229. N-ethyl-N-methylpiperidinium bromide/water/phosphoric acid dipotassium salt
  6230. N-ethylacetamide/potassium iodide (KI)/water
  6231. N-ethylacetamide/water/4-hydroxybenzoic acid methyl ester
  6232. N-ethylacetamide/water/N-methylacetamide
  6233. N-ethylbenzenamine/water/N,N-diethylbenzenamine
  6234. N-ethylethanamine acetate/glycine/water
  6235. N-ethylethanamine acetate/N-glycylglycine/water
  6236. N-ethylethanamine hydrochloride/potassium chloride (KCl)/water
  6237. N-ethylethanamine hydrochloride/sodium chloride (NaCl)/water
  6238. N-ethylethanamine hydrochloride/water/cerium chloride (CeCl3)
  6239. N-ethylethanamine sulfate (1:1)/methane/water
  6240. N-ethylethanamine/1-butanol/benzene
  6241. N-ethylethanamine/1-octanol/water
  6242. N-ethylethanamine/2,2,2-trichloro-1,1-ethanediol/water
  6243. N-ethylethanamine/2-propanone/benzene
  6244. N-ethylethanamine/acetic acid ethyl ester/heptane
  6245. N-ethylethanamine/acetic acid/benzene
  6246. N-ethylethanamine/acetic acid/N,N-dimethylformamide
  6247. N-ethylethanamine/carbon dioxide/water
  6248. N-ethylethanamine/carbon monoxide/water
  6249. N-ethylethanamine/carbonic acid compd. with N-ethylethanamine (1:2)/water
  6250. N-ethylethanamine/carbonic acid disodium salt/water
  6251. N-ethylethanamine/cyclohexane/sulfinylbismethane
  6252. N-ethylethanamine/dodecane/methanol
  6253. N-ethylethanamine/ethanamine/water
  6254. N-ethylethanamine/ethanedioic acid/water
  6255. N-ethylethanamine/heptane/methanol
  6256. N-ethylethanamine/hexane/1-(4-chlorophenyl)ethanone
  6257. N-ethylethanamine/hexane/1-(4-methylphenyl)ethanone
  6258. N-ethylethanamine/hexane/1-phenylethanone
  6259. N-ethylethanamine/hexane/2-butanone
  6260. N-ethylethanamine/hexane/2-butenal
  6261. N-ethylethanamine/hexane/2-chlorobenzaldehyde
  6262. N-ethylethanamine/hexane/2-propanone
  6263. N-ethylethanamine/hexane/4-methoxybenzaldehyde
  6264. N-ethylethanamine/hexane/cycloheptanone
  6265. N-ethylethanamine/hexane/cyclooctanone
  6266. N-ethylethanamine/hexane/cyclopentanone
  6267. N-ethylethanamine/hexane/pentanal
  6268. N-ethylethanamine/hexane/propanal
  6269. N-ethylethanamine/methane/water
  6270. N-ethylethanamine/N,N-diethylethanamine/acetic acid ethyl ester
  6271. N-ethylethanamine/N,N-diethylethanamine/ethanol
  6272. N-ethylethanamine/N,N-diethylethanamine/water
  6273. N-ethylethanamine/nitric acid sodium salt/water
  6274. N-ethylethanamine/potassium chloride (KCl)/water
  6275. N-ethylethanamine/sodium chloride (NaCl)/water
  6276. N-ethylethanamine/trichloroacetic acid/water
  6277. N-ethylethanamine/water/2-furancarboxaldehyde
  6278. N-ethylethanamine/water/nitric acid cesium salt
  6279. N-ethylethanamine/water/nitric acid potassium salt
  6280. N-ethylethanamine/water/sulfuric acid dipotassium salt
  6281. N-ethylformamide/formamide/water
  6282. N-ethylformamide/potassium iodide (KI)/water
  6283. N-ethylformamide/sodium iodide (NaI)/water
  6284. N-ethylformamide/water/4-hydroxybenzoic acid methyl ester
  6285. N-ethylpropanamide/water/4-hydroxybenzoic acid methyl ester
  6286. N-formylglycine/ethanol/water
  6287. N-formylleucine/ethanol/water
  6288. N-glycyl-DL-leucine/N,N,N-triethylethanaminium bromide/water
  6289. N-glycyl-L-alanine/sodium chloride (NaCl)/water
  6290. N-glycyl-L-alanine/water/sulfuric acid diammonium salt
  6291. N-glycyl-L-alanine/water/sulfuric acid disodium salt
  6292. N-glycyl-L-valine/α-D-glucopyranose/water
  6293. N-glycyl-L-valine/β-D-fructofuranosyl α-D-glucopyranoside/water
  6294. N-glycyl-L-valine/1-octylpyridin-1-ium bromide/water
  6295. N-glycyl-L-valine/sodium chloride (NaCl)/water
  6296. N-glycyl-L-valine/water/Benzyldimethyldodecylammonium salicylate
  6297. N-glycylglycine/β-cyclodextrin/water
  6298. N-glycylglycine/β-D-fructofuranosyl α-D-glucopyranoside/water
  6299. N-glycylglycine/(R-(R&sup*;,R&sup*;))-2,2-dichloro-N-(2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl)acetamide/water
  6300. N-glycylglycine/1,2,3-propanetriol/water
  6301. N-glycylglycine/1-ethyl-3-methyl-1H-imidazolium chloride/water
  6302. N-glycylglycine/1-methyl-3-octyl-1H-imidazolium chloride/water
  6303. N-glycylglycine/1-propanol/water
  6304. N-glycylglycine/2-hydroxypropane-1,2,3-tricarboxylic acid/water
  6305. N-glycylglycine/2-propanol/water
  6306. N-glycylglycine/3,7-dihydro-1,3,7-trimethyl-1H-purine-2,6-dione/water
  6307. N-glycylglycine/4-amino-2(1H)-pyrimidinone/water
  6308. N-glycylglycine/4-amino-N,2-thiazolylbenzenesulfonamide/water
  6309. N-glycylglycine/4-aminobenzenesulfonamide/water
  6310. N-glycylglycine/4-O-α-D-glucopyranosyl-D-glucitol/water
  6311. N-glycylglycine/4-O-α-D-glucopyranosyl-D-glucose/water
  6312. N-glycylglycine/5-methyl-2,4(1H,3H)-pyrimidinedione/water
  6313. N-glycylglycine/acetic acid manganese(2+) salt/water
  6314. N-glycylglycine/acetonitrile/water
  6315. N-glycylglycine/carboxymethyl-trimethylazanium chloride/water
  6316. N-glycylglycine/cobalt chloride (CoCl2)/water
  6317. N-glycylglycine/copper chloride (CuCl2)/water
  6318. N-glycylglycine/D-fructose/water
  6319. N-glycylglycine/D-galactose/water
  6320. N-glycylglycine/D-mannitol/water
  6321. N-glycylglycine/D-xylose/water
  6322. N-glycylglycine/ethanol/water
  6323. N-glycylglycine/iron chloride (FeCl3)/water
  6324. N-glycylglycine/N,N,N-triethylethanaminium bromide/water
  6325. N-glycylglycine/N,N,N-trimethyl-1-hexadecanaminium bromide/water
  6326. N-glycylglycine/N,N,N-trimethylmethanaminium bromide/water
  6327. N-glycylglycine/N,N-Dimethylmethanamine acetate/water
  6328. N-glycylglycine/N-ethylethanamine sulfate (1:1)/water
  6329. N-glycylglycine/nickel chloride (NiCl2)/water
  6330. N-glycylglycine/nitric acid sodium salt/water
  6331. N-glycylglycine/potassium chloride (KCl)/water
  6332. N-glycylglycine/sodium bromide (NaBr)/water
  6333. N-glycylglycine/sodium chloride (NaCl)/water
  6334. N-glycylglycine/sodium fluoride (NaF)/water
  6335. N-glycylglycine/sodium iodide (NaI)/water
  6336. N-glycylglycine/sulfinylbismethane/water
  6337. N-glycylglycine/urea/water
  6338. N-glycylglycine/water/1,3-dimethyl-2,4(1H,3H)-pyrimidinedione
  6339. N-glycylglycine/water/1-butyl-3-methyl-1H-imidazolium bromide
  6340. N-glycylglycine/water/1-butyl-3-methyl-1H-imidazolium chloride
  6341. N-glycylglycine/water/1-hexyl-3-methyl-1H-imidazolium bromide
  6342. N-glycylglycine/water/2-hydroxy-5-sulfobenzoic acid
  6343. N-glycylglycine/water/3-(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ylidene)-N-methyl-1-propanamine hydrochloride
  6344. N-glycylglycine/water/Acetate buffer
  6345. N-glycylglycine/water/Benzyldimethyldodecylammonium salicylate
  6346. N-glycylglycine/water/Cetylpyridinium salicylate
  6347. N-glycylglycine/water/Citrate buffer
  6348. N-glycylglycine/water/iron chloride (FeCl2)
  6349. N-glycylglycine/water/magnesium chloride (MgCl2)
  6350. N-glycylglycine/water/manganese chloride (MnCl2)
  6351. N-glycylglycine/water/myo-inositol
  6352. N-glycylglycine/water/nitric acid potassium salt
  6353. N-glycylglycine/water/oxygen
  6354. N-glycylglycine/water/potassium bromide (KBr)
  6355. N-glycylglycine/water/sulfuric acid diammonium salt
  6356. N-glycylglycine/water/sulfuric acid dipotassium salt
  6357. N-glycylglycine/water/sulfuric acid disodium salt
  6358. N-glycylglycine/water/xylitol
  6359. N-glycylglycine/zinc chloride (ZnCl2)/water
  6360. n-heptadecane/sulfinylbismethane/1-butanol
  6361. N-hexadecyl-N,N-dimethylbenzenemethanaminium chloride/water/cellulose 2-hydroxypropyl ether
  6362. n-hexatriacontane/1-methylnaphthalene/decahydronaphthalene
  6363. n-hexatriacontane/carbon disulfide/1-methylnaphthalene
  6364. N-iodoacetamide/acetonitrile/water
  6365. N-iodoacetamide/sulfinylbismethane/water
  6366. N-L-alanyl-L-alanine/(2S-(2α,5α,6β(S&sup*;)))-6((aminophenylacetyl)amino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid/water
  6367. N-L-alanyl-L-alanine/1,3-diethyl-5-methyl-2,4(1H,3H)-pyrimidinedione/water
  6368. N-L-alanyl-L-alanine/1,4,10,13-tetraoxa-7,16-diazoniacyclooctadecane/water
  6369. N-L-alanyl-L-alanine/1,4,7,10,13-pentaoxacyclopentadecane/water
  6370. N-L-alanyl-L-alanine/1,4,7,10-tetraoxacyclododecane/water
  6371. N-L-alanyl-L-alanine/1-propanol/water
  6372. N-L-alanyl-L-alanine/2-propanol/water
  6373. N-L-alanyl-L-alanine/2-propanone/water
  6374. N-L-alanyl-L-alanine/3,7-dihydro-1,3,7-trimethyl-1H-purine-2,6-dione/water
  6375. N-L-alanyl-L-alanine/4-amino-2(1H)-pyrimidinone/water
  6376. N-L-alanyl-L-alanine/5-methyl-2,4(1H,3H)-pyrimidinedione/water
  6377. N-L-alanyl-L-alanine/acetonitrile/water
  6378. N-L-alanyl-L-alanine/ethanol/water
  6379. N-L-alanyl-L-alanine/formamide/water
  6380. N-L-alanyl-L-alanine/N,N-diethylformamide/water
  6381. N-L-alanyl-L-alanine/N,N-dimethylformamide/water
  6382. N-L-alanyl-L-alanine/sulfinylbismethane/water
  6383. N-L-alanyl-L-alanine/water/1,3-dimethyl-2,4(1H,3H)-pyrimidinedione
  6384. N-L-prolyl-L-leucine/sodium chloride (NaCl)/water
  6385. N-L-seryl-L-leucine/water/2,8,14,20-tetrakis[methyl(aminoformyl)]-4,6,10,12,16,18,22,24-octahydroxycalix[4]arene
  6386. N-L-seryl-L-leucine/water/D-α-manno-naphtho-18 crown-6-ether
  6387. N-methyl-N,2,4,6-tetranitrobenzenamine/2,2-bis((nitrooxy)methyl)-1,3-propanediol dinitrate/1,3,5-trinitrobenzene
  6388. N-methyl-N,2,4,6-tetranitrobenzenamine/ethanol/water
  6389. N-methyl-N,N-dioctyl-1-octanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)/1-butanol/water
  6390. N-methyl-N,N-dioctyl-1-octanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)/benzeneethanol/water
  6391. N-methyl-N,N-dioctyl-1-octanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)/ethanol/acetic acid methyl ester
  6392. N-methyl-N,N-dioctyl-1-octanaminium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)/methanol/acetic acid methyl ester
  6393. N-methyl-N-(1-methylethyl)-N-(2-((9H-xanthen-9-ylcarbonyl)oxy)ethyl)-2-propanaminium bromide/sodium bromide (NaBr)/water
  6394. N-methyl-N-phenylacetamide/ethanol/water
  6395. N-methylbenzenamine/1,2-ethanediol/benzenamine
  6396. N-methylbenzenamine/1,2-ethanediol/N,N-dimethylbenzenamine
  6397. N-methylbenzenamine/1-ethyl-3-methyl-1H-imidazolium tetrafluoroborate(1-)/2-methylbenzenamine
  6398. N-methylbenzenamine/2,3,5,6-tetrachloro-2,5-cyclohexadiene-1,4-dione/sulfinylbismethane
  6399. N-methylbenzenamine/2-propenenitrile/benzene
  6400. N-methylbenzenamine/benzene/acetonitrile
  6401. N-methylbenzenamine/ethanol/water
  6402. N-methylbenzenamine/hexane/1-(4-chlorophenyl)ethanone
  6403. N-methylbenzenamine/hexane/1-(4-methylphenyl)ethanone
  6404. N-methylbenzenamine/hexane/1-phenylethanone
  6405. N-methylbenzenamine/hexane/iodine
  6406. N-methylbenzenamine/isothiocyanatobenzene/benzene
  6407. N-methylcyclohexanamine/1,4-dimethylbenzene/1-butanol
  6408. N-methylcyclohexanamine/1,4-dimethylbenzene/1-pentanol
  6409. N-methylcyclohexanamine/1,4-dimethylbenzene/1-propanol
  6410. N-methylcyclohexanamine/1-butanol/benzene
  6411. N-methylcyclohexanamine/1-butanol/nitrobenzene
  6412. N-methylcyclohexanamine/1-pentanol/benzene
  6413. N-methylcyclohexanamine/1-pentanol/nitrobenzene
  6414. N-methylcyclohexanamine/1-propanol/benzene
  6415. N-methylcyclohexanamine/1-propanol/nitrobenzene
  6416. N-methylcyclohexanamine/bromobenzene/1-butanol
  6417. N-methylcyclohexanamine/bromobenzene/1-pentanol
  6418. N-methylcyclohexanamine/bromobenzene/1-propanol
  6419. N-methylcyclohexanamine/carbon dioxide/water
  6420. N-methylcyclohexanamine/chlorobenzene/1-butanol
  6421. N-methylcyclohexanamine/chlorobenzene/1-pentanol
  6422. N-methylcyclohexanamine/chlorobenzene/1-propanol
  6423. N-methylcyclohexanamine/methylbenzene/1-butanol
  6424. N-methylcyclohexanamine/methylbenzene/1-pentanol
  6425. N-methylcyclohexanamine/methylbenzene/1-propanol
  6426. N-methylformamide/1,1',1'',1'''-methanetetrayltetrakisbenzene/water
  6427. N-methylformamide/1,2-butanediol/water
  6428. N-methylformamide/1,2-propanediol/water
  6429. N-methylformamide/1,4,7,10,13-pentaoxacyclopentadecane/water
  6430. N-methylformamide/1,4-dioxane/water
  6431. N-methylformamide/1-hexene/water
  6432. N-methylformamide/2,3,5,6,8,9,11,12-octahydro-1,4,7,10,13-benzopentaoxacyclopentadecin/water
  6433. N-methylformamide/2-((2,6-dichlorophenyl)amino)benzeneacetic acid monosodium salt/water
  6434. N-methylformamide/4-amino-N-(2-pyrimidinyl)benzenesulfonamide monosodium salt/water
  6435. N-methylformamide/4-hydroxy-2-methyl-N-(5-methyl-2-thiazolyl)-2H-1,2-benzothiazin-3-carboxamide 1,1-dioxide/water
  6436. N-methylformamide/acetic acid ethyl ester/water
  6437. N-methylformamide/benzene/N-methylacetamide
  6438. N-methylformamide/benzene/water
  6439. N-methylformamide/cesium chloride (CsCl)/water
  6440. N-methylformamide/cesium fluoride (CsF)/water
  6441. N-methylformamide/cesium tetraphenylborate(1-)/water
  6442. N-methylformamide/ethanol/potassium bromide (KBr)
  6443. N-methylformamide/ethanol/potassium chloride (KCl)
  6444. N-methylformamide/ethanol/potassium fluoride (KF)
  6445. N-methylformamide/ethanol/water
  6446. N-methylformamide/formamide/potassium bromide (KBr)
  6447. N-methylformamide/formamide/potassium fluoride (KF)
  6448. N-methylformamide/formamide/water
  6449. N-methylformamide/glycine/water
  6450. N-methylformamide/heptane/benzene
  6451. N-methylformamide/heptane/water
  6452. N-methylformamide/hexadecane/benzenamine
  6453. N-methylformamide/hexadecane/quinoline
  6454. N-methylformamide/L-alanine/water
  6455. N-methylformamide/L-serine/water
  6456. N-methylformamide/lithium chloride (LiCl)/water
  6457. N-methylformamide/methane/water
  6458. N-methylformamide/methanol/water
  6459. N-methylformamide/N,N-dimethylformamide/sodium iodide (NaI)
  6460. N-methylformamide/N,N-dimethylformamide/water
  6461. N-methylformamide/N-DL-alanyl-DL-valine/water
  6462. N-methylformamide/N-L-alanyl-L-alanine/water
  6463. N-methylformamide/potassium chloride (KCl)/formamide
  6464. N-methylformamide/potassium chloride (KCl)/water
  6465. N-methylformamide/potassium tetraphenylborate(1-)/water
  6466. N-methylformamide/rubidium tetraphenylborate(1-)/water
  6467. N-methylformamide/sodium bromide (NaBr)/water
  6468. N-methylformamide/sodium chloride (NaCl)/water
  6469. N-methylformamide/sodium fluoride (NaF)/water
  6470. N-methylformamide/sodium iodide (NaI)/water
  6471. N-methylformamide/sulfuric acid beryllium salt (1:1)/water
  6472. N-methylformamide/sulfuric acid dirubidium salt/water
  6473. N-methylformamide/tetrachloromethane/benzene
  6474. N-methylformamide/tetrachloromethane/water
  6475. N-methylformamide/tetrahydro-2H-pyran/1-chloro-2-methylbenzene
  6476. N-methylformamide/tetrahydro-2H-pyran/2-methylbenzenamine
  6477. N-methylformamide/tetramethylurea/N,N-dimethylformamide
  6478. N-methylformamide/tetraphenylarsonium bromide/water
  6479. N-methylformamide/tetraphenylarsonium chloride/water
  6480. N-methylformamide/tetraphenylarsonium iodide/water
  6481. N-methylformamide/tetraphenylarsonium tetraphenylborate(1-)/water
  6482. N-methylformamide/trimethyl-(10-trimethylazaniumyldecyl)azanium dibromide/water
  6483. N-methylformamide/urea/N,N-dimethylformamide
  6484. N-methylformamide/urea/water
  6485. N-methylformamide/water/4-hydroxybenzoic acid methyl ester
  6486. N-methylformamide/water/cesium bromide (CsBr)
  6487. N-methylformamide/water/magnesium chloride (MgCl2)
  6488. N-methylformamide/water/rubidium bromide (RbBr)
  6489. N-methylglycine/±-2-aminobutanoic acid/water
  6490. N-methylglycine/1-piperazineethanamine/water
  6491. N-methylglycine/carbon dioxide/water
  6492. N-methylglycine/D-glucose/water
  6493. N-methylglycine/glycine/water
  6494. N-methylglycine/L-alanine/water
  6495. N-methylglycine/N-(2-aminoethyl)-1,2-ethanediamine/water
  6496. N-methylmethanamine hydrochloride/1,2,3-propanetriol/water
  6497. N-methylmethanamine hydrochloride/hydrochloric acid/water
  6498. N-methylmethanamine hydrochloride/urea/water
  6499. N-methylmethanamine hydrochloride/water/cerium chloride (CeCl3)
  6500. N-methylmethanamine/ammonia/water
  6501. N-methylmethanamine/methanamine/N,N-dimethylmethanamine
  6502. N-methylmethanamine/methane/water
  6503. N-methylmethanamine/methanol/ammonia
  6504. N-methylmethanamine/methanol/water
  6505. N-methylmethanamine/nitric acid sodium salt/water
  6506. N-methylmethanamine/sulfuric acid/water
  6507. N-methylpropanamide/1,3-benzenedisulfonic acid copper(2+) salt (1:1)/water
  6508. N-methylpropanamide/water/4-hydroxybenzoic acid methyl ester
  6509. N-o-tolyl-4-chlorobenzohydroxamic acid/2-propanone/water
  6510. N-octadecyl-1-octadecanamine/ethanol/water
  6511. N-octyl-1-octanamine/ethanol/water
  6512. N-pentadecyl-1-pentadecanamine/ethanol/water
  6513. N-phenylacetamide/1,1'-oxybisethane/trichloromethane
  6514. N-phenylacetamide/1,2-dihydro-1,5-dimethyl-2-phenyl-3H-pyrazol-3-one/N-(4-ethoxyphenyl)acetamide
  6515. N-phenylacetamide/1,2-dihydro-1,5-dimethyl-2-phenyl-3H-pyrazol-3-one/water
  6516. N-phenylacetamide/1,3-benzenediol/N-(4-ethoxyphenyl)acetamide
  6517. N-phenylacetamide/1,4-dioxane/water
  6518. N-phenylacetamide/1-butanol/benzene
  6519. N-phenylacetamide/1-hexanol/benzene
  6520. N-phenylacetamide/1-octanol/water
  6521. N-phenylacetamide/1-propanol/benzene
  6522. N-phenylacetamide/1-propanol/water
  6523. N-phenylacetamide/2,2-bis(ethylsulfonyl)propane/N-(4-ethoxyphenyl)acetamide
  6524. N-phenylacetamide/2-hydroxybenzoic acid monosodium salt/water
  6525. N-phenylacetamide/2-naphthalenol/urea
  6526. N-phenylacetamide/2-propanol/benzene
  6527. N-phenylacetamide/2-propanone/benzene
  6528. N-phenylacetamide/2-propanone/carbon disulfide
  6529. N-phenylacetamide/4-(dimethylamino)-1,2-dihydro-1,5-dimethyl-2-phenyl-3H-pyrazol-3-one/water
  6530. N-phenylacetamide/acetic acid ethyl ester/ethanol
  6531. N-phenylacetamide/acetic acid/water
  6532. N-phenylacetamide/benzenamine/nitrobenzene
  6533. N-phenylacetamide/carbamic acid ethyl ester/nitrobenzene
  6534. N-phenylacetamide/carbon disulfide/nitrobenzene
  6535. N-phenylacetamide/cyclohexane/benzenamine
  6536. N-phenylacetamide/cyclohexane/ethanol
  6537. N-phenylacetamide/ethanol/benzene
  6538. N-phenylacetamide/ethanol/quinoline
  6539. N-phenylacetamide/ethanol/water
  6540. N-phenylacetamide/hexane/1-butanol
  6541. N-phenylacetamide/hexane/1-hexanol
  6542. N-phenylacetamide/hexane/1-propanol
  6543. N-phenylacetamide/hexane/2-propanol
  6544. N-phenylacetamide/hexane/ethanol
  6545. N-phenylacetamide/methanol/benzene
  6546. N-phenylacetamide/methanol/carbon disulfide
  6547. N-phenylacetamide/phenol/benzenamine
  6548. N-phenylacetamide/phosphoric acid/water
  6549. N-phenylacetamide/pyridine/water
  6550. N-phenylacetamide/sulfuric acid/water
  6551. N-phenylacetamide/tetrachloromethane/ethanol
  6552. N-phenylacetamide/tetradecanoic acid 1-methylethyl ester/water
  6553. N-phenylacetamide/trichloromethane/water
  6554. N-phenylacetamide/urea/2-hydroxybenzoic acid
  6555. N-phenylacetamide/urea/N-(4-ethoxyphenyl)acetamide
  6556. N-phenylacetamide/water/selenic acid
  6557. N-phenylbenzenamine/1,3-dichlorobenzene/1,2-dichlorobenzene
  6558. N-phenylbenzenamine/benzene/1,3-dinitrobenzene
  6559. N-phenylbenzenamine/benzene/nitrobenzene
  6560. N-phenylbenzenamine/copper chloride (CuCl2)/water
  6561. N-phenylbenzenamine/ethanol/water
  6562. N-phenylbenzenamine/N,N-dimethylformamide/water
  6563. N-phenylbenzenamine/sulfinylbismethane/trifluoroacetic acid
  6564. N-phenylbenzenamine/sulfur/2-naphthalenamine
  6565. N-phenyldodecanamide/ethanol/water
  6566. N-phenyloctadecanamide/ethanol/water
  6567. N-propyl-1-propanamine/1-propanol/water
  6568. N-propyl-1-propanamine/ethanol/water
  6569. N-propylacetamide/water/4-hydroxybenzoic acid methyl ester
  6570. N-propylpropanamide/water/4-hydroxybenzoic acid methyl ester
  6571. n-tetracosane/methane/propane
  6572. N-tetradecyl-1-tetradecanamine/ethanol/water
  6573. N-tridecyl-1-tridecanamine/ethanol/water
  6574. N-[(7S)-1,2,3,10-tetramethoxy-9-oxo-6,7-dihydro-5H-benzo[d]heptalen-7-yl]acetamide/sodium chloride (NaCl)/water
  6575. N-[4-(acetyloxy)phenyl]acetamide/ethanol/water
  6576. N-[9-[[2-(acetyloxy)ethoxy]methyl]-9H-purin-2-yl]acetamide/1-nonanol/water
  6577. N.N'-1,2-ethanediylbis[N-(carboxymethyl)glycine] disodium salt/carbonic acid barium salt (1:1)/water
  6578. N.N'-1,2-ethanediylbis[N-(carboxymethyl)glycine] disodium salt/carbonic acid strontium salt (1:1)/water
  6579. N.N'-1,2-ethanediylbis[N-(carboxymethyl)glycine] disodium salt/formic acid lanthanum(3+) salt/water
  6580. N.N'-1,2-ethanediylbis[N-(carboxymethyl)glycine] disodium salt/water/blood serum albumins
  6581. N.N'-1,2-ethanediylbis[N-(carboxymethyl)glycine] disodium salt/water/boric acid (HBO2) sodium salt
  6582. N.N'-1,2-ethanediylbis[N-(carboxymethyl)glycine] disodium salt/water/calcium 2,2',2'',2'''-(1,2-ethanediyldiammonio)tetraacetate
  6583. N.N'-1,2-ethanediylbis[N-(carboxymethyl)glycine] disodium salt/water/sulfuric acid disodium salt
  6584. N2-glycyl-L-glutamine/butanoic acid sodium salt/water
  6585. N2-glycyl-L-glutamine/sulfuric acid monododecyl ester sodium salt/water
  6586. N4-(7-chloroquinolin-4-yl)-N1,N1-diethylpentane-1,4-diamine phosphate (1:2)/2-propanol/N,N-dimethylformamide
  6587. N4-(7-chloroquinolin-4-yl)-N1,N1-diethylpentane-1,4-diamine phosphate (1:2)/ethanol/N,N-dimethylformamide
  6588. N4-(7-chloroquinolin-4-yl)-N1,N1-diethylpentane-1,4-diamine phosphate (1:2)/L-alanine/water
  6589. N4-(7-chloroquinolin-4-yl)-N1,N1-diethylpentane-1,4-diamine phosphate (1:2)/L-valine/water
  6590. naphtha/separator gas/synthetic Natural Gas Mixture
  6591. naphthalene/1,1':3',1''-terphenyl/1,1'-biphenyl
  6592. naphthalene/1,3-bis(1-methylethyl)benzene/1-(3-Hydroxypropyl)-1-methylmorpholinium dicyanamide
  6593. naphthalene/1,3-bis(1-methylethyl)benzene/1-butyl-4-methylpyridinium salt with cyanocyanamide (1:1)
  6594. naphthalene/1,3-bis(1-methylethyl)benzene/N-Hydroxyethylpyridinium tricyanomethanide
  6595. naphthalene/1,3-dinitrobenzene/1-methyl-4-nitrobenzene
  6596. naphthalene/1-allyl-3-methylimidazolium dicyanamide/1,3-bis(1-methylethyl)benzene
  6597. naringin dihydrochalcone/ethanol/water
  6598. naringin dihydrochalcone/methanol/water
  6599. natural gas/brine/Clay
  6600. neodymium bromide (NdBr3)/water/cesium bromide (CsBr)
  6601. neodymium chloride (NdCl3)/2-propanone/water
  6602. neodymium chloride (NdCl3)/acetic acid/water
  6603. neodymium chloride (NdCl3)/aluminum chloride (AlCl3)/cesium chloride (CsCl)
  6604. neodymium chloride (NdCl3)/aluminum chloride (AlCl3)/potassium chloride (KCl)
  6605. neodymium chloride (NdCl3)/aluminum chloride (AlCl3)/sodium chloride (NaCl)
  6606. neodymium chloride (NdCl3)/ammonium chloride ((NH4)Cl)/water
  6607. neodymium chloride (NdCl3)/barium chloride (BaCl2)/lithium chloride (LiCl)
  6608. neodymium chloride (NdCl3)/barium chloride (BaCl2)/sodium chloride (NaCl)
  6609. neodymium chloride (NdCl3)/benzenamine hydrochloride/water
  6610. neodymium chloride (NdCl3)/cadmium chloride (CdCl2)/water
  6611. neodymium chloride (NdCl3)/calcium chloride (CaCl2)/sodium chloride (NaCl)
  6612. neodymium chloride (NdCl3)/calcium chloride (CaCl2)/water
  6613. neodymium chloride (NdCl3)/cesium chloride (CsCl)/water
  6614. neodymium chloride (NdCl3)/chromium chloride (CrCl3)/cesium chloride (CsCl)
  6615. neodymium chloride (NdCl3)/europium chloride (EuCl3)/water
  6616. neodymium chloride (NdCl3)/gadolinium chloride (GdCl3)/water
  6617. neodymium chloride (NdCl3)/gallium chloride (GaCl3)/sulfuryl chloride
  6618. neodymium chloride (NdCl3)/hexamethylphosphoric triamide/water
  6619. neodymium chloride (NdCl3)/holmium chloride (HoCl3)/water
  6620. neodymium chloride (NdCl3)/hydrochloric acid/water
  6621. neodymium chloride (NdCl3)/lanthanum chloride (LaCl3)/water
  6622. neodymium chloride (NdCl3)/lithium chloride (LiCl)/sodium chloride (NaCl)
  6623. neodymium chloride (NdCl3)/lithium chloride (LiCl)/water
  6624. neodymium chloride (NdCl3)/N,N-dimethylformamide/water
  6625. neodymium chloride (NdCl3)/N,N-dimethylmethanamine hydrochloride/water
  6626. neodymium chloride (NdCl3)/N-ethylethanamine hydrochloride/water
  6627. neodymium chloride (NdCl3)/neodymium oxychloride/magnesium chloride (MgCl2)
  6628. neodymium chloride (NdCl3)/phenylhydrazine monohydrochloride/water
  6629. neodymium chloride (NdCl3)/phosphoryl chloride/zinc chloride (ZnCl2)
  6630. neodymium chloride (NdCl3)/potassium chloride (KCl)/iron chloride (FeCl2)
  6631. neodymium chloride (NdCl3)/potassium chloride (KCl)/lithium chloride (LiCl)
  6632. neodymium chloride (NdCl3)/potassium chloride (KCl)/magnesium chloride (MgCl2)
  6633. neodymium chloride (NdCl3)/potassium chloride (KCl)/water
  6634. neodymium chloride (NdCl3)/praseodymium chloride (PrCl3)/water
  6635. neodymium chloride (NdCl3)/samarium chloride (SmCl3)/water
  6636. neodymium chloride (NdCl3)/sodium chloride (NaCl)/water
  6637. neodymium chloride (NdCl3)/sodium vanadate (VO3(1-))/water
  6638. neodymium chloride (NdCl3)/sulfinylbismethane/water
  6639. neodymium chloride (NdCl3)/urea/water
  6640. neodymium chloride (NdCl3)/water/1,1,2,3,4,4-hexachloro-1,3-butadiene
  6641. neodymium chloride (NdCl3)/water/3-pyridinecarboxamide
  6642. neodymium chloride (NdCl3)/water/cerium chloride (CeCl3)
  6643. neodymium chloride (NdCl3)/water/N,N'-Methylenediacetamide
  6644. neodymium chloride (NdCl3)/water/rubidium chloride (RbCl)
  6645. neodymium chloride (NdCl3)/ytterbium chloride (YbCl3)/water
  6646. neodymium fluoride (NdF3)/lithium fluoride (LiF)/calcium fluoride (CaF2)
  6647. neodymium fluoride (NdF3)/magnesium fluoride (MgF2)/lithium fluoride (LiF)
  6648. neodymium fluoride (NdF3)/potassium tetrafluoroborate(1-)/potassium fluoride (KF)
  6649. neodymium iodide (NdI3)/thiourea/water
  6650. neodymium iodide (NdI3)/urea/water
  6651. neodymium oxide (Nd2O3)/lanthanum fluoride (LaF3)/lithium fluoride (LiF)
  6652. neodymium oxide (Nd2O3)/neodymium fluoride (NdF3)/lithium fluoride (LiF)
  6653. neodymium oxide (Nd2O3)/phosphoric acid/water
  6654. neon/2,2,2-trifluoroethanol/water
  6655. neon/argon/deuterium
  6656. neon/argon/helium
  6657. neon/beryllium fluoride (BeF2)/lithium fluoride (LiF)
  6658. neon/cesium chloride (CsCl)/water
  6659. neon/helium/deuterium
  6660. neon/helium/nitrogen
  6661. neon/helium/xenon
  6662. neon/hydrochloric acid/water
  6663. neon/iron chloride (FeCl3)/water
  6664. neon/lithium chloride (LiCl)/water
  6665. neon/nitrogen/oxygen
  6666. neon/potassium chloride (KCl)/water
  6667. neon/potassium iodide (KI)/water
  6668. neon/sodium bromide (NaBr)/water
  6669. neon/sodium chloride (NaCl)/water
  6670. neon/sodium fluoride (NaF)/(T-4)-zirconium fluoride (ZrF4)
  6671. neon/sodium iodide (NaI)/water
  6672. neon/sulfuric acid magnesium salt (1:1)/water
  6673. neon/water/1,1,1,3,3,3-hexafluoro-2-propanol
  6674. neon/water/calcium bromide (CaBr2)
  6675. neon/water/magnesium chloride (MgCl2)
  6676. neon/water/potassium bromide (KBr)
  6677. neon/water/potassium fluoride (KF)
  6678. neon/water/rubidium chloride (RbCl)
  6679. neon/water/water-d2
  6680. nickel bromide (NiBr2)/N,N-dimethylurea/water
  6681. nickel bromide (NiBr2)/sulfinylbismethane/water
  6682. nickel bromide (NiBr2)/urea/water
  6683. nickel bromide (NiBr2)/water/cesium bromide (CsBr)
  6684. nickel bromide (NiBr2)/water/potassium bromide (KBr)
  6685. nickel bromide (NiBr2)/water/rubidium bromide (RbBr)
  6686. nickel chloride (NiCl2)/water/hydrazinecarbothioamide
  6687. nickel chloride (NiCl2)/water/iron chloride (FeCl2)
  6688. nickel chloride (NiCl2)/water/magnesium chloride (MgCl2)
  6689. nickel chloride (NiCl2)/water/manganese chloride (MnCl2)
  6690. nickel chloride (NiCl2)/water/oxygen
  6691. nickel chloride (NiCl2)/water/rubidium chloride (RbCl)
  6692. nickel chloride (NiCl2)/water/sulfuric acid nickel(2+) salt (1:1)
  6693. nickel fluoride (NiF2)/ammonium fluoride ((NH4)F)/water
  6694. nickel fluoride (NiF2)/hydrofluoric acid/water
  6695. nickel fluoride (NiF2)/rubidium fluoride (RbF)/water
  6696. nickel fluoride (NiF2)/water/potassium fluoride (KF)
  6697. nickel hydroxide (Ni(OH)2)/arsenic oxide (As2O5)/water
  6698. nickel hydroxide (Ni(OH)2)/hydrochloric acid/water
  6699. nickel hydroxide (Ni(OH)2)/sodium hydroxide (Na(OH))/water
  6700. nickel iodide (NiI2)/iodine/water
  6701. nickel iodide (NiI2)/potassium iodide (KI)/water
  6702. nickel iodide (NiI2)/urea/water
  6703. nickel ion (Ni(2+))/N,N-dimethylformamide/Nickel(II) (1,2-dihydroxyanthraquinone-3-sulfonate)sodium chloride tetrahydrate
  6704. nickel oxide (NiO)/carbonic acid dilithium salt/carbonic acid dipotassium salt
  6705. nickel oxide (NiO)/carbonic acid disodium salt/carbonic acid dilithium salt
  6706. nickel oxide (NiO)/hydrochloric acid/water
  6707. nickel oxide (NiO)/potassium bromide (KBr)/cesium bromide (CsBr)
  6708. nickel oxide (NiO)/propanedioic acid/2-hydroxy-N,N,N-trimethylethanaminium chloride
  6709. nickel oxide (NiO)/sodium chloride (NaCl)/water
  6710. nickel oxide (NiO)/sulfur(VI) trioxide/water
  6711. nickel oxide (NiO)/urea/2-hydroxy-N,N,N-trimethylethanaminium chloride
  6712. nickel(+2) cation; phosphonato phosphate/diphosphoric acid/water
  6713. nickel/bismuth/indium
  6714. nickel/carbon/cobalt
  6715. nickel/chromium/nitrogen
  6716. nickel/cobalt/zirconium
  6717. nickel/copper/hafnium
  6718. nickel/copper/sulfur
  6719. nickel/germanium/gold
  6720. nickel/palladium/gold
  6721. nickel/silicon/chromium
  6722. nickel/silicon/copper
  6723. nickel/silver/bismuth
  6724. nickel/tin/zinc
  6725. nickel/titanium/zirconium
  6726. nickel/tungsten/chromium
  6727. niobium chloride (NbCl3)/potassium chloride (KCl)/lithium chloride (LiCl)
  6728. niobium chloride (NbCl4)/potassium chloride (KCl)/sodium chloride (NaCl)
  6729. niobium chloride (NbCl5)/aluminum chloride (AlCl3)/potassium chloride (KCl)
  6730. niobium chloride (NbCl5)/aluminum chloride (AlCl3)/sodium chloride (NaCl)
  6731. niobium chloride (NbCl5)/aluminum chloride (AlCl3)/tantalum chloride (TaCl5)
  6732. niobium chloride (NbCl5)/aluminum chloride (AlCl3)/titanium chloride (TiCl4)
  6733. niobium chloride (NbCl5)/hexachlorobenzene/titanium chloride (TiCl4)
  6734. niobium chloride (NbCl5)/lithium chloride (LiCl)/palladium chloride (PdCl2)
  6735. niobium chloride (NbCl5)/potassium chloride (KCl)/magnesium chloride (MgCl2)
  6736. niobium chloride (NbCl5)/potassium chloride (KCl)/sodium chloride (NaCl)
  6737. niobium chloride (NbCl5)/potassium chloride (KCl)/tantalum chloride (TaCl5)
  6738. niobium chloride (NbCl5)/sodium chloride (NaCl)/iron chloride (FeCl3)
  6739. niobium chloride (NbCl5)/sodium chloride (NaCl)/tantalum chloride (TaCl5)
  6740. niobium chloride (NbCl5)/titanium chloride (TiCl4)/iron chloride (FeCl3)
  6741. niobium chloride (NbCl5)/titanium chloride (TiCl4)/tantalum chloride (TaCl5)
  6742. niobium oxide (Nb2O5)/dipotassium heptafluoroniobate(2-)/potassium fluoride (KF)
  6743. niobium oxide (Nb2O5)/hydrofluoric acid/water
  6744. niobium oxide (Nb2O5)/sulfur(VI) trioxide/water
  6745. niobium/chromium/zirconium
  6746. niobium/uranium/zirconium
  6747. nitrate/ammonium/water
  6748. nitrate/magnesium ion (Mg(2+))/water
  6749. nitrate/potassium ion (K(1+))/water
  6750. nitrate/sodium ion (Na(1+))/water
  6751. nitric acid 1-methylethyl ester/ethanol/water
  6752. nitric acid aluminum salt/α-hydro-ω-hydroxypoly(oxy-1,2-ethanediyl)/water
  6753. nitric acid aluminum salt/ethyne/water
  6754. nitric acid aluminum salt/nitric acid ammonium salt/water
  6755. nitric acid aluminum salt/nitric acid sodium salt/water
  6756. nitric acid aluminum salt/nitric acid/water
  6757. nitric acid aluminum salt/trisodium (OC-6-11)-hexafluoroaluminate(3-)/water
  6758. nitric acid aluminum salt/urea/water
  6759. nitric acid aluminum salt/water/aluminum fluoride (AlF3)
  6760. nitric acid aluminum salt/water/chromic acid (H2CrO4) disilver(1+) salt
  6761. nitric acid aluminum salt/water/N,N,N-tributyl-1-butanaminium salt with sulfuric acid dodecyl ester
  6762. nitric acid aluminum salt/water/N,N,N-tributyl-1-butanamium dodecylbenzenesulfonate
  6763. nitric acid aluminum salt/water/N-methylacetamide
  6764. nitric acid aluminum salt/water/nitric acid cesium salt
  6765. nitric acid aluminum salt/water/nitric acid potassium salt
  6766. nitric acid aluminum salt/water/nitric acid zinc salt
  6767. nitric acid aluminum salt/water/oxygen
  6768. nitric acid ammonium salt/1-propanol/water
  6769. nitric acid ammonium salt/2-methyl-2-propanol/water
  6770. nitric acid ammonium salt/2-propanol/sodium chloride (NaCl)
  6771. nitric acid ammonium salt/2-propanol/water
  6772. nitric acid ammonium salt/2-propanone/water
  6773. nitric acid ammonium salt/acetonitrile/water
  6774. nitric acid ammonium salt/ammonia/water
  6775. nitric acid ammonium salt/ethene/water
  6776. nitric acid ammonium salt/ethyne/water
  6777. nitric acid ammonium salt/formamide/water
  6778. nitric acid ammonium salt/methanol/water
  6779. nitric acid ammonium salt/N,N-dimethylformamide/water
  6780. nitric acid ammonium salt/nitric acid potassium salt/1,2-dihydro-5-nitro-3H-1,2,4-triazol-3-one
  6781. nitric acid ammonium salt/nitric acid potassium salt/nitric acid lithium salt
  6782. nitric acid ammonium salt/nitric acid potassium salt/sulfuric acid diammonium salt
  6783. nitric acid ammonium salt/nitric acid potassium salt/sulfuric acid dipotassium salt
  6784. nitric acid ammonium salt/nitric acid sodium salt/nitric acid potassium salt
  6785. nitric acid ammonium salt/nitric acid sodium salt/sodium chloride (NaCl)
  6786. nitric acid ammonium salt/nitric acid sodium salt/water
  6787. nitric acid ammonium salt/nitric acid/water
  6788. nitric acid ammonium salt/phosphoric acid monoammonium salt/nitric acid potassium salt
  6789. nitric acid ammonium salt/phosphoric acid monoammonium salt/phosphoric acid diammonium salt
  6790. nitric acid ammonium salt/phosphoric acid monoammonium salt/phosphoric acid monopotassium salt
  6791. nitric acid ammonium salt/phosphoric acid monoammonium salt/water
  6792. nitric acid ammonium salt/phosphoric acid/water
  6793. nitric acid ammonium salt/potassium chloride (KCl)/nitric acid potassium salt
  6794. nitric acid ammonium salt/potassium chloride (KCl)/water
  6795. nitric acid ammonium salt/sodium chloride (NaCl)/ammonia
  6796. nitric acid ammonium salt/sodium chloride (NaCl)/water
  6797. nitric acid ammonium salt/sulfinylbismethane/water
  6798. nitric acid ammonium salt/sulfur dioxide/water
  6799. nitric acid ammonium salt/water/2-furancarboxaldehyde
  6800. nitric acid ammonium salt/water/Alkylbenzyldimethylammonium chloride (Catamine AB)
  6801. nitric acid ammonium salt/water/ammonium vanadate (VO3(1-))
  6802. nitric acid ammonium salt/water/arsenic acid (H3AsO4) monostrontium salt
  6803. nitric acid ammonium salt/water/chloric acid sodium salt
  6804. nitric acid ammonium salt/water/chromic acid (H2Cr2O7) diammonium salt
  6805. nitric acid ammonium salt/water/chromic acid (H2CrO4) disilver(1+) salt
  6806. nitric acid ammonium salt/water/chymotrypsinogen
  6807. nitric acid ammonium salt/water/hydrogen sulfide (H2S)
  6808. nitric acid ammonium salt/water/nitric acid cesium salt
  6809. nitric acid ammonium salt/water/nitric acid lithium salt
  6810. nitric acid ammonium salt/water/nitric acid potassium salt
  6811. nitric acid ammonium salt/water/nitric acid silver(1+) salt
  6812. nitric acid ammonium salt/water/nitric acid zinc salt
  6813. nitric acid ammonium salt/water/oxygen
  6814. nitric acid ammonium salt/water/perchloric acid ammonium salt
  6815. nitric acid ammonium salt/water/phosphoric acid calcium salt (2:3)
  6816. nitric acid ammonium salt/water/phosphoric acid diammonium salt
  6817. nitric acid ammonium salt/water/phosphoric acid monopotassium salt
  6818. nitric acid ammonium salt/water/sulfuric acid calcium salt (1:1)
  6819. nitric acid ammonium salt/water/sulfuric acid diammonium salt
  6820. nitric acid ammonium salt/water/sulfuric acid dipotassium salt
  6821. nitric acid ammonium salt/water/sulfuric acid monoammonium salt
  6822. nitric acid ammonium salt/water/sulfuric acid strontium salt (1:1)
  6823. nitric acid barium salt/β-D-fructofuranosyl α-D-glucopyranoside/water
  6824. nitric acid barium salt/(T-4)-bis(nitrato-κO)dioxouranium/water
  6825. nitric acid barium salt/1,2,3-propanetriol triacetate/water
  6826. nitric acid barium salt/1,2,3-propanetriol/water
  6827. nitric acid barium salt/1,2-ethanediol diacetate/water
  6828. nitric acid barium salt/1,2-ethanediol/water
  6829. nitric acid barium salt/1,4,7,10,13,16-hexaoxacyclooctadecane/water
  6830. nitric acid barium salt/1,4-dioxane/water
  6831. nitric acid barium salt/1-propanol/water
  6832. nitric acid barium salt/2-propanone/water
  6833. nitric acid barium salt/acetic acid ethyl ester/water
  6834. nitric acid barium salt/acetic acid silver(1+) salt/water
  6835. nitric acid barium salt/ammonium bromide ((NH4)Br)/ethanol
  6836. nitric acid barium salt/barium (T-4)-molybdate (MoO4(2-)) (1:1)/nitric acid lithium salt
  6837. nitric acid barium salt/barium bromide (BaBr2)/nitric acid sodium salt
  6838. nitric acid barium salt/barium bromide (BaBr2)/sodium bromide (NaBr)
  6839. nitric acid barium salt/barium bromide (BaBr2)/water
  6840. nitric acid barium salt/barium chloride (BaCl2)/potassium chloride (KCl)
  6841. nitric acid barium salt/barium chloride (BaCl2)/water
  6842. nitric acid barium salt/barium hydroxide (Ba(OH)2)/water
  6843. nitric acid barium salt/benzamide/water
  6844. nitric acid barium salt/benzenamine/water
  6845. nitric acid barium salt/bromic acid barium salt/water
  6846. nitric acid barium salt/butanoic acid/water
  6847. nitric acid barium salt/calcium chloride (CaCl2)/nitric acid calcium salt
  6848. nitric acid barium salt/calcium chloride (CaCl2)/water
  6849. nitric acid barium salt/chloric acid barium salt/water
  6850. nitric acid barium salt/chloroacetic acid silver(1+) salt/water
  6851. nitric acid barium salt/ethanol/water
  6852. nitric acid barium salt/formamide/water
  6853. nitric acid barium salt/formic acid sodium salt/water
  6854. nitric acid barium salt/glycine/water
  6855. nitric acid barium salt/iodoic acid (HIO3) barium salt/water
  6856. nitric acid barium salt/iron chloride (FeCl3)/water
  6857. nitric acid barium salt/L-alanine/water
  6858. nitric acid barium salt/L-valine/water
  6859. nitric acid barium salt/lead bromide (PbBr2)/water
  6860. nitric acid barium salt/lithium chloride (LiCl)/nitric acid lithium salt
  6861. nitric acid barium salt/methanol/water
  6862. nitric acid barium salt/N,N-dimethylformamide/water
  6863. nitric acid barium salt/neon/water
  6864. nitric acid barium salt/nitric acid aluminum salt/water
  6865. nitric acid barium salt/nitric acid ammonium salt/water
  6866. nitric acid barium salt/nitric acid beryllium salt/water
  6867. nitric acid barium salt/nitric acid calcium salt/barium chloride (BaCl2)
  6868. nitric acid barium salt/nitric acid calcium salt/nitric acid potassium salt
  6869. nitric acid barium salt/nitric acid calcium salt/water
  6870. nitric acid barium salt/nitric acid cerium(3+) salt/water
  6871. nitric acid barium salt/nitric acid cobalt(2+) salt/water
  6872. nitric acid barium salt/nitric acid lanthanum(3+) salt/water
  6873. nitric acid barium salt/nitric acid lead(2+) salt/nitric acid sodium salt
  6874. nitric acid barium salt/nitric acid lead(2+) salt/water
  6875. nitric acid barium salt/nitric acid manganese(2+) salt/water
  6876. nitric acid barium salt/nitric acid neodymium(3+) salt/water
  6877. nitric acid barium salt/nitric acid nickel(2+) salt/water
  6878. nitric acid barium salt/nitric acid potassium salt/nitric acid lithium salt
  6879. nitric acid barium salt/nitric acid potassium salt/nitrous acid potassium salt
  6880. nitric acid barium salt/nitric acid potassium salt/silver chloride (AgCl)
  6881. nitric acid barium salt/nitric acid rubidium salt/nitrous acid barium salt
  6882. nitric acid barium salt/nitric acid rubidium salt/nitrous acid rubidium salt
  6883. nitric acid barium salt/nitric acid rubidium salt/water
  6884. nitric acid barium salt/nitric acid sodium salt/nitric acid lithium salt
  6885. nitric acid barium salt/nitric acid sodium salt/nitric acid potassium salt
  6886. nitric acid barium salt/nitric acid sodium salt/sodium bromide (NaBr)
  6887. nitric acid barium salt/nitric acid sodium salt/sodium chloride (NaCl)
  6888. nitric acid barium salt/nitric acid sodium salt/water
  6889. nitric acid barium salt/nitric acid strontium salt/nitric acid potassium salt
  6890. nitric acid barium salt/nitric acid strontium salt/water
  6891. nitric acid barium salt/nitric acid thallium(1+) salt/nitrous acid thallium(1+) salt
  6892. nitric acid barium salt/nitric acid thorium(4+) salt/water
  6893. nitric acid barium salt/nitric acid yttrium(3+) salt/water
  6894. nitric acid barium salt/nitric acid/water
  6895. nitric acid barium salt/nitrous acid barium salt/nitric acid potassium salt
  6896. nitric acid barium salt/nitrous acid barium salt/nitrous acid lithium salt
  6897. nitric acid barium salt/nitrous acid barium salt/nitrous acid rubidium salt
  6898. nitric acid barium salt/nitrous acid barium salt/nitrous acid thallium(1+) salt
  6899. nitric acid barium salt/nitrous acid cesium salt/nitric acid cesium salt
  6900. nitric acid barium salt/nitrous acid cesium salt/nitrous acid barium salt
  6901. nitric acid barium salt/perchloric acid barium salt/water
  6902. nitric acid barium salt/phenol/water
  6903. nitric acid barium salt/potassium chloride (KCl)/nitric acid potassium salt
  6904. nitric acid barium salt/sodium bromide (NaBr)/water
  6905. nitric acid barium salt/sulfinylbismethane/water
  6906. nitric acid barium salt/sulfuric acid barium salt (1:1)/nitric acid lithium salt
  6907. nitric acid barium salt/thiourea/water
  6908. nitric acid barium salt/urea/nitric acid lithium salt
  6909. nitric acid barium salt/urea/nitric acid potassium salt
  6910. nitric acid barium salt/urea/nitric acid sodium salt
  6911. nitric acid barium salt/urea/water
  6912. nitric acid barium salt/water/bromic acid silver(1+) salt
  6913. nitric acid barium salt/water/iodic acid (HIO3) silver(1+) salt
  6914. nitric acid barium salt/water/nitric acid cesium salt
  6915. nitric acid barium salt/water/nitric acid lithium salt
  6916. nitric acid barium salt/water/nitric acid potassium salt
  6917. nitric acid barium salt/water/nitric acid silver(1+) salt
  6918. nitric acid barium salt/water/nitric acid zinc salt
  6919. nitric acid barium salt/water/oxygen
  6920. nitric acid barium salt/water/perchloric acid potassium salt
  6921. nitric acid barium salt/water/silver chloride (AgCl)
  6922. nitric acid barium salt/zinc hydroxide (Zn(OH)2)/water
  6923. nitric acid beryllium salt/1-butanol/water
  6924. nitric acid beryllium salt/1-propanol/water
  6925. nitric acid beryllium salt/2-propanol/water
  6926. nitric acid beryllium salt/methanol/water
  6927. nitric acid beryllium salt/nitric acid/water
  6928. nitric acid beryllium salt/water/2-methyl-1-propanol
  6929. nitric acid beryllium salt/water/nitric acid cesium salt
  6930. nitric acid beryllium salt/water/nitric acid lithium salt
  6931. nitric acid bismuth(3+) salt/2-propanone/water
  6932. nitric acid cadmium salt tetrahydrate/nitric acid potassium salt/nitric acid lithium salt
  6933. nitric acid cadmium salt/1,2-ethanediol/water
  6934. nitric acid cadmium salt/1,4-dioxane/water
  6935. nitric acid cadmium salt/acetamide/water
  6936. nitric acid cadmium salt/cesium chloride (CsCl)/water
  6937. nitric acid cadmium salt/D-galactose/water
  6938. nitric acid cadmium salt/D-glucose/water
  6939. nitric acid cadmium salt/D-ribose/water
  6940. nitric acid cadmium salt/D-xylose/water
  6941. nitric acid cadmium salt/lithium chloride (LiCl)/water
  6942. nitric acid cadmium salt/methanol/water
  6943. nitric acid cadmium salt/N,N-dimethylurea/water
  6944. nitric acid cadmium salt/nitric acid aluminum salt/water
  6945. nitric acid cadmium salt/nitric acid ammonium salt/nitric acid sodium salt
  6946. nitric acid cadmium salt/nitric acid beryllium salt/water
  6947. nitric acid cadmium salt/nitric acid iron(3+) salt/water
  6948. nitric acid cadmium salt/nitric acid magnesium salt/water
  6949. nitric acid cadmium salt/nitric acid potassium salt/nitric acid lithium salt
  6950. nitric acid cadmium salt/nitric acid potassium salt/nitric acid silver(1+) salt
  6951. nitric acid cadmium salt/nitric acid rubidium salt/nitric acid potassium salt
  6952. nitric acid cadmium salt/nitric acid sodium salt/nitric acid lithium salt
  6953. nitric acid cadmium salt/nitric acid sodium salt/nitric acid potassium salt
  6954. nitric acid cadmium salt/nitric acid sodium salt/water
  6955. nitric acid cadmium salt/nitric acid/water
  6956. nitric acid cadmium salt/potassium chloride (KCl)/water
  6957. nitric acid cadmium salt/potassium iodide (KI)/water
  6958. nitric acid cadmium salt/sodium chloride (NaCl)/water
  6959. nitric acid cadmium salt/sulfinylbismethane/water
  6960. nitric acid cadmium salt/thiourea/water
  6961. nitric acid cadmium salt/urea/nitric acid potassium salt
  6962. nitric acid cadmium salt/urea/nitric acid sodium salt
  6963. nitric acid cadmium salt/urea/water
  6964. nitric acid cadmium salt/water/bromic acid silver(1+) salt
  6965. nitric acid cadmium salt/water/nitric acid cesium salt
  6966. nitric acid cadmium salt/water/nitric acid lithium salt
  6967. nitric acid cadmium salt/water/nitric acid potassium salt
  6968. nitric acid cadmium salt/water/oxygen
  6969. nitric acid calcium salt tetrahydrate/guanidine mononitrate/water
  6970. nitric acid calcium salt tetrahydrate/lithium bromide (LiBr)/water
  6971. nitric acid calcium salt tetrahydrate/sulfuric acid monododecyl ester sodium salt/acetamide
  6972. nitric acid calcium salt tetrahydrate/water/chloric acid magnesium salt hexahydrate
  6973. nitric acid calcium salt/β-D-fructofuranosyl α-D-glucopyranoside/water
  6974. nitric acid calcium salt/1,2,3-propanetriol/water
  6975. nitric acid calcium salt/1,4-dioxane/water
  6976. nitric acid calcium salt/1-butanol/nitric acid lithium salt
  6977. nitric acid calcium salt/1-hexanol/water
  6978. nitric acid calcium salt/1-propanol/nitric acid lithium salt
  6979. nitric acid calcium salt/1-propanol/water
  6980. nitric acid calcium salt/2-aminoethanol/water
  6981. nitric acid calcium salt/2-hydroxyethanamine nitrate/water
  6982. nitric acid calcium salt/2-methoxy-2-methylpropane/methanol
  6983. nitric acid calcium salt/2-propanol/nitric acid lithium salt
  6984. nitric acid calcium salt/2-propanol/water
  6985. nitric acid calcium salt/2-propanone/nitric acid lithium salt
  6986. nitric acid calcium salt/2-propen-1-ol/water
  6987. nitric acid calcium salt/5,9-dioxo-2,4,6,8,10,12-hexaazatridecanediamide/water
  6988. nitric acid calcium salt/5-oxo-2,4,6,8-tetraazanonanediamide/water
  6989. nitric acid calcium salt/acetamide/water
  6990. nitric acid calcium salt/acetic acid ethyl ester/ethanol
  6991. nitric acid calcium salt/acetic acid ethyl ester/water
  6992. nitric acid calcium salt/acetic acid silver(1+) salt/water
  6993. nitric acid calcium salt/acetic acid/water
  6994. nitric acid calcium salt/acetonitrile/water
  6995. nitric acid calcium salt/ammonia/water
  6996. nitric acid calcium salt/barium chloride (BaCl2)/water
  6997. nitric acid calcium salt/benzamide/water
  6998. nitric acid calcium salt/bromic acid (HBrO3) lead(2+) salt/water
  6999. nitric acid calcium salt/calcium hydroxide (Ca(OH)2)/water
  7000. nitric acid calcium salt/carbon dioxide/water
  7001. nitric acid calcium salt/chloroacetic acid silver(1+) salt/water
  7002. nitric acid calcium salt/chromic acid (H2CrO4) calcium salt (1:1)/water
  7003. nitric acid calcium salt/decane/N,N-dimethylacetamide
  7004. nitric acid calcium salt/ethanol/2-propanone
  7005. nitric acid calcium salt/ethanol/