System: phosphorothioic acid O-(2-chloro-4-nitrophenyl) O,O-dimethyl ester/water
Use the dropdown to view details on the components
| 1) phosphorothioic acid O-(2-chloro-4-nitrophenyl) O,O-dimethyl ester |
| DECHEMA ID | 17782 |
| Formula | C8H9ClNO5PS |
| Synonym | O-(2-chloro-4-nitrophenyl) O,O-dimethyl thiophosphate |
| Synonym | O-(2-chloro-4-nitrophenyl) O,O-dimethyl phosphorothioate |
| Synonym | p-nitro-o-chlorophenyl dimethyl thionophosphate |
| Synonym | dicapthon |
| InChi-Key | OTKXWJHPGBRXCR-UHFFFAOYSA-N |
| Registry No. | 2463-84-5 |
| 2) water |
| DECHEMA ID | 41137 |
| Formula | H2O |
| Synonym | ice |
| Synonym | refrigerant 718 |
| Synonym | hydrogen oxide |
| Synonym | dihydrogen oxide |
| InChi-Key | XLYOFNOQVPJJNP-UHFFFAOYSA-N |
| Registry No. | 7732-18-5 |
Available physical property data:
| Property | Phase | No. of tables | No. of lines | Data |
|---|
| solid-liquid equilibrium | - | 1 | 1 | View |
|---|