System: phosphorothioic acid O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl ester
Use the dropdown to view details on the components
| 1) phosphorothioic acid O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl ester |
| DECHEMA ID | 25970 |
| Formula | C11H15BrClO3PS |
| Synonym | Selecron |
| Synonym | Profenophos |
| Synonym | profenofos |
| Synonym | O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl phosphorothioate |
| Synonym | thiophosphoric acid O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl ester |
| InChi-Key | QYMMJNLHFKGANY-UHFFFAOYSA-N |
| Registry No. | 41198-08-7 |
Available physical property data:
| Property | Phase | No. of tables | No. of lines | Data |
|---|
| octanol/water partition coefficient | - | 4 | 4 | View |
|---|