System: N4-(7-chloroquinolin-4-yl)-N1,N1-diethylpentane-1,4-diamine phosphate (1:2)/ethanol
Use the dropdown to view details on the components
| 1) N4-(7-chloroquinolin-4-yl)-N1,N1-diethylpentane-1,4-diamine phosphate (1:2) |
| DECHEMA ID | 28473 |
| Formula | C18H32ClN3O8P2 |
| Synonym | 7-chloro-4-((4-(diethylamino)-1-methylbutyl)amino)quinoline diphosphate |
| Synonym | chloroquine diphosphate |
| InChi-Key | QKICWELGRMTQCR-UHFFFAOYSA-N |
| Registry No. | 50-63-5 |
| 2) ethanol |
| DECHEMA ID | 36190 |
| Formula | C2H6O |
| Synonym | ethyl alcohol |
| Synonym | alcohol EtOH |
| Synonym | ethyl hydrate |
| Synonym | ethyl hydroxide |
| Synonym | methyl carbinol |
| InChi-Key | LFQSCWFLJHTTHZ-UHFFFAOYSA-N |
| Registry No. | 64-17-5 |
Available physical property data:
| Property | Phase | No. of tables | No. of lines | Data |
| solid-liquid equilibrium | - | 1 | 8 | View |
| solid-liquid equilibrium, isobaric | - | 1 | 9 | View |