System: N4-(7-chloroquinolin-4-yl)-N1,N1-diethylpentane-1,4-diamine phosphate (1:2)/water
Use the dropdown to view details on the components
| 1) N4-(7-chloroquinolin-4-yl)-N1,N1-diethylpentane-1,4-diamine phosphate (1:2) |
| DECHEMA ID | 28473 |
| Formula | C18H32ClN3O8P2 |
| Synonym | chloroquine diphosphate |
| Synonym | 7-chloro-4-((4-(diethylamino)-1-methylbutyl)amino)quinoline diphosphate |
| InChi-Key | QKICWELGRMTQCR-UHFFFAOYSA-N |
| Registry No. | 50-63-5 |
| 2) water |
| DECHEMA ID | 41137 |
| Formula | H2O |
| Synonym | refrigerant 718 |
| Synonym | ice |
| Synonym | dihydrogen oxide |
| Synonym | hydrogen oxide |
| InChi-Key | XLYOFNOQVPJJNP-UHFFFAOYSA-N |
| Registry No. | 7732-18-5 |
Available physical property data:
| Property | Phase | No. of tables | No. of lines | Data |
|---|
| density | liquid | 1 | 9 | View |
|---|
| solid-liquid equilibrium | - | 1 | 8 | View |
|---|
| viscosity, dynamic | liquid | 2 | 39 | View |
|---|