System: phosphorothioic acid O-(3-chloro-4-nitrophenyl) O,O-dimethyl ester
Use the dropdown to view details on the components
| 1) phosphorothioic acid O-(3-chloro-4-nitrophenyl) O,O-dimethyl ester | |
|---|---|
| DECHEMA ID | 28491 |
| Formula | C8H9ClNO5PS |
| Synonym | O-(3-chloro-4-nitrophenyl) O,O-dimethyl phosphorothioate |
| Synonym | thiophosphoric acid O-(3-chloro-4-nitro-phenyl) O',O''-dimethyl ester |
| Synonym | O,O-dimethyl O-(3-chloro-4-nitrophenyl) phosphorothioate |
| Synonym | O,O-dimethyl O-(p-nitro-m-chlorophenyl) thiophosphate |
| Synonym | chlorthion |
| Synonym | O-(3-chloro-4-nitrophenyl) O,O-dimethyl monothiophosphate |
| InChi-Key | NZNRRXXETLSZRO-UHFFFAOYSA-N |
| Registry No. | 500-28-7 |
Available physical property data:
| Property | Phase | No. of tables | No. of lines | Data |
|---|---|---|---|---|
| melting point | - | 1 | 1 | View |
| octanol/water partition coefficient | - | 1 | 1 | View |
| vapor pressure | - | 1 | 1 | View |