System: 2-chloro-α-(2-chlorophenyl)benzenemethanol
Use the dropdown to view details on the components
| 1) 2-chloro-α-(2-chlorophenyl)benzenemethanol | |
|---|---|
| DECHEMA ID | 35889 |
| Formula | C13H10Cl2O |
| Synonym | 2,2'-dichloro-α-phenylbenzylic alcohol |
| Synonym | bis(o-chlorophenyl)methanol |
| Synonym | bis(2-chlorophenyl)carbinol |
| Synonym | 2,2'-dichlorodiphenylmethanol |
| Synonym | bis(2-chlorophenyl)methanol |
| Synonym | 2,2'-dichlorobenzhydrol |
| InChi-Key | YVZIETKZIJPLJM-UHFFFAOYSA-N |
| Registry No. | 6335-15-5 |
Available physical property data:
| Property | Phase | No. of tables | No. of lines | Data |
|---|---|---|---|---|
| fusion temperature | - | 1 | 1 | View |
| vapor pressure | - | 1 | 1 | View |