System: (2S)-1-(4-nitrophenyl)-2-pyrrolidinemethanol
Use the dropdown to view details on the components
| 1) (2S)-1-(4-nitrophenyl)-2-pyrrolidinemethanol | |
|---|---|
| DECHEMA ID | 43725 |
| Formula | C11H14N2O3 |
| Synonym | NPP |
| Synonym | [(2S)-1-(4-nitrophenyl)-2-pyrrolidinyl]methanol |
| Synonym | [(2S)-1-(4-nitrophenyl)pyrrolidin-2-yl]methanol |
| Synonym | (S)-1-(4-nitrophenyl)-2-pyrrolidinemethanol |
| Synonym | (-)-1-(4-nitrophenyl)-2-pyrrolidinemethanol |
| Synonym | N-(4-nitrophenyl)-L-prolinol |
| Synonym | N-(4-nitrophenyl)-(S)-prolinol |
| InChi-Key | HCVBBVTZZJFVLA-NSHDSACASA-N |
| Registry No. | 88422-19-9 |
Available physical property data:
| Property | Phase | No. of tables | No. of lines | Data |
|---|---|---|---|---|
| enthalpy of fusion | - | 1 | 1 | View |
| fusion temperature | - | 1 | 1 | View |
| heat capacity (cp) | solid | 1 | 12 | View |