System: 4-chloro-α-(4-chlorophenyl)benzenemethanol
Use the dropdown to view details on the components
| 1) 4-chloro-α-(4-chlorophenyl)benzenemethanol | |
|---|---|
| DECHEMA ID | 44067 |
| Formula | C13H10Cl2O |
| Synonym | bis(4-chlorophenyl)carbinol |
| Synonym | 4,4'-dichloro-α-phenylbenzylic alcohol |
| Synonym | 4,4'-dichlorodiphenylmethanol |
| Synonym | bis(4-chlorophenyl)methanol |
| Synonym | 4,4'-dichlorobenzhydrol |
| Synonym | bis(p-chlorophenyl)methanol |
| InChi-Key | PHUYGURFBULKPA-UHFFFAOYSA-N |
| Registry No. | 90-97-1 |
Available physical property data:
| Property | Phase | No. of tables | No. of lines | Data |
|---|---|---|---|---|
| fusion temperature | - | 1 | 1 | View |