System: 3-chloro-α-(3-chlorophenyl)benzenemethanol
Use the dropdown to view details on the components
| 1) 3-chloro-α-(3-chlorophenyl)benzenemethanol |
| DECHEMA ID | 58004 |
| Formula | C13H10Cl2O |
| Synonym | 3,3'-dichlorobenzhydrol |
| Synonym | bis(m-chlorophenyl)methanol |
| Synonym | 3.3'-dichloro-α-phenylbenzylic alcohol |
| Synonym | 3,3'-dichlorodiphenylmethanol |
| Synonym | bis(3-chlorophenyl)methanol |
| Synonym | bis(3-chlorophenyl)carbinol |
| InChi-Key | IBLHIEZLGKFQRW-UHFFFAOYSA-N |
| Registry No. | 35190-12-6 |
Available physical property data:
| Property | Phase | No. of tables | No. of lines | Data |
|---|
| fusion temperature | - | 1 | 1 | View |
|---|