DETHERM database directory

Systems with 1 component(s): 80001 - 90000

The given links are permalinks. The order of the systems and the system number instead can change anytime.

  1. O-Ethyl dimethylacetamidium trifluoromethanesulfonate
  2. O-Ethyl dimethylformamidium bis(trifluoromethylsulfonyl)imide
  3. O-Ethyl dimethylformamidium trifluoromethanesulfonate
  4. O-Ethyl hexadecylsulfanylmethanethioate
  5. O-ethyl isobutoxymethylphosphonochloridothhioate
  6. O-ethyl isopropoxymethylphosphonochloridothhioate
  7. O-ethyl isopropoxymethylphosphorothiolo thionate
  8. O-ethyl methoxymethylphosphonochloridothhioate
  9. O-ethyl methoxymethylphosphorothiolo thionate
  10. O-ethyl N-(4-bromophenyl)carbamothioate
  11. O-ethyl N-(4-chlorophenyl)carbamothioate
  12. O-Ethyl N-ethylpyrrolidonium bis(trifluoromethylsulfonyl)imide
  13. O-Ethyl N-ethylpyrrolidonium trifluoromethanesulfonate
  14. O-Ethyl N-methylcaprolactamium bis(trifluoromethylsulfonyl)imide
  15. O-Ethyl N-methylcaprolactamium trifluoromethanesulfonate
  16. O-Ethyl N-methylpyrrolidonium bis(trifluoromethylsulfonyl)imide
  17. O-Ethyl N-methylpyrrolidonium trifluoromethanesulfonate
  18. O-Ethyl octan-2-ylsulfanylmethanethioate
  19. O-Ethyl octylsulfanylmethanethioate
  20. O-Ethyl s-prop-2-en-1-yl carbonodithioate
  21. O-Ethyl S-propan-2-yl carbonodithioate
  22. O-Ethyl-N,N,N’,N’-tetramethylisouronium trifluoromethanesulfonate
  23. O-hexadecyl N-(4-chlorophenyl)carbamothioate
  24. o-Hydroxyacetophenonylidene-4,5-dimethyl-O-phenylenediamine
  25. O-isobutyl N-(4-chlorophenyl)carbamothioate
  26. o-Methoxydiphenyl ether
  27. o-Methydiphenyl ether
  28. O-Methyl 4,4-dimethylpentanethioate
  29. O-Methyl diethylacetamidium bis(trifluoromethylsulfonyl)imide
  30. O-Methyl diethylacetamidium trifluoromethanesulfonate
  31. O-Methyl dimethylacetamidium bis(trifluoromethylsulfonyl)imide
  32. O-Methyl dimethylacetamidium trifluoromethanesulfonate
  33. O-Methyl dimethylformamidium bis(trifluoromethylsulfonyl)imide
  34. O-Methyl dimethylformamidium trifluoromethanesulfonate
  35. O-Methyl dimethylpropionamidium trifluoromethanesulfonate
  36. O-methyl methoxymethylphosphorothiolo thionate
  37. O-Methyl methylacetamidium trifluoromethanesulfonate
  38. O-Methyl N-ethylpyrrolidonium bis(trifluoromethylsulfonyl)imide
  39. O-Methyl N-ethylpyrrolidonium trifluoromethanesulfonate
  40. O-Methyl N-methylcaprolactamium bis(trifluoromethylsulfonyl)imide
  41. O-Methyl N-methylcaprolactamium trifluoromethanesulfonate
  42. O-Methyl N-methylpyrrolidonium bis(trifluoromethylsulfonyl)imide
  43. O-Methyl N-methylpyrrolidonium trifluoromethanesulfonate
  44. O-Methyl octylsulfanylmethanethioate
  45. O-methyl [(4-bromophenyl)amino]methanethioate
  46. O-methyl-DL-allothreonine
  47. O-methyl-DL-threonine
  48. O-methylhydroxylamine
  49. O-naphthalen-2-yl [methyl-(3-methylphenyl)amino]methanethioate
  50. o-Nitroaniline perchlorate
  51. o-nitrobenzenesulfenamide
  52. o-Nitrodiphenyl ether
  53. o-Nitrophenyltrimethylsilane
  54. o-Nitrosonitrobenzene dimer
  55. O-Octyl ethylsulfanylmethanethioate
  56. O-Octyl hexadecylsulfanylmethanethioate
  57. O-p-Toluenesulfonyl-L-tyrosine
  58. O-p-Toluenesulfonyl-N-acetyl-L-tyrosine
  59. O-p-Toluenesulfonyl-N-acetyl-L-tyrosine-methyl ester
  60. O-p-Toluenesulfonyl-N-bezoyl-L-tyrosine
  61. O-phenyl-S,S-dibutyldithiophosphite
  62. o-phenylenediacetic acid diethyl ester
  63. O-prop-2-enyl (phenylamino)methanethioate
  64. O-prop-2-enyl N-(4-chlorophenyl)carbamothioate
  65. O-Propan-2-yl chloromethanethioate
  66. O-Propan-2-yl hexadecylsulfanylmethanethioate
  67. O-Propan-2-yl octan-2-ylsulfanylmethanethioate
  68. O-Propan-2-yl octylsulfanylmethanethioate
  69. O-Propyl chloromethanethioate
  70. O-propyl N-(4-chlorophenyl)carbamothioate
  71. O-sec-butyl N-(4-chlorophenyl)carbamothioate
  72. O-tert-butyl (phenylamino)methanethioate
  73. O-tert-butyl N-(4-chlorophenyl)carbamothioate
  74. o-Toluenesulfonyl chloride
  75. o-Toluidine hydrochloride
  76. o-Tolyl-carbamic acid i-butyl ester
  77. o-Tolyl-carbamic acid n-butyl ester
  78. o-Tolyl-carbamic acid s-butyl ester
  79. O-tridecyl N-ethylcarbamothioate
  80. O-Trimethylsilyl-N-phenylsulfonylacetimidate
  81. O-Trimethylsilyl-O-methyl-chlorophosphate
  82. O-[2-(Benzylideneamino)ethyl] methylsulfanylmethanethioate
  83. O1-(2-ethylhexyl) O2-methyl benzene-1,2-dicarboxylate
  84. o2,2'-Cyclocytidine monoacetate
  85. O3-ethyl O5-methyl 2-(2-aminoethoxymethyl)-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate
  86. Oct-1-en-3-yl acetate
  87. Oct-1-ene-3,6-dione
  88. Oct-2-enoic acid methyl ester
  89. oct-2-enylbenzene
  90. Oct-2-yn-1-ol
  91. Oct-2-ynamide
  92. Oct-2-ynoic acid
  93. oct-3-en-1-ol
  94. oct-3-ene
  95. oct-3-yn-1-ol
  96. oct-3-yn-2-ol
  97. oct-4-en-1,8-diol
  98. oct-4-en-1-ol
  99. oct-4-ene
  100. oct-4-yne-3,6-diol
  101. Oct-5-enoic acid methyl ester
  102. octa(4-methoxyphenoxy)cyclotetraphosphazene
  103. Octa-1,4,5-triene
  104. octa-1,7-dien-4-yne
  105. Octa-1,7-dien-4-yne-3,6-diol
  106. Octa-2,6-diynedioic acid
  107. Octa-2,7-dien-5-yn-4-ol
  108. Octa-3,5-diyne
  109. Octa-3,5-diyne-2,7-diol
  110. Octa-3,7-dien-5-yn-2-ol
  111. octaaluminium pentasulfate tetradecahydroxide tetratriacontahydrate
  112. octaaquatetrakis(mu-(l-histidinato-κO:κO'))dierbium(2+) stereoisomer diperchlorate octaperchlorate tetrahydrate
  113. octaaquatetrakis(mu-(l-isoleucinato-κO:κO'))dierbium(2+) stereoisomer diperchlorate tetraperchlorate
  114. octaaquatetrakis(mu-(l-isoleucinato-κO:κO'))dineodymium(2+)stereoisomer diperchlorate tetraperchlorate
  115. octabenzoxycyclotetraphosphazene
  116. Octabismuth nonaselenide
  117. octabromobiphenyl
  118. octabutoxycyclotetraphosphazene
  119. octacadmium europium(III) chloride hexadecahydrate
  120. octacadmium lanthanum(III) chloride hexadecahydrate
  121. octacadmium neodymium(III) chloride hexadecahydrate
  122. octacadmium praseodymium(III) chloride eicosahydrate
  123. octacadmium samarium(III) chloride hexadecahydrate
  124. octacadmium tris(tetraethylammonium) chloride
  125. octacadmium yttrium (III) chloride pentadecahydrate
  126. Octacarbonylbis[mu-(ethanethiolato)]dimanganese
  127. Octacarbonylbis[mu-(methanethiolato)]dimanganese
  128. octacarbonyldicobalt (Co-Co)
  129. octacene
  130. octacerium decasodium sulfate octahydrate
  131. octachlorobutane
  132. octachlorocyclopentene
  133. octachlorodibenzofuran
  134. octachlorodibenzo[b,e][1,4]dioxin
  135. octachloronaphthalene
  136. octachloropropane
  137. octachlorotrisilane
  138. octacontane
  139. octacontylbenzene
  140. octacontylcyclohexane
  141. octacosafluorotridecane
  142. octacosamethyltridecasiloxane
  143. octacosane
  144. octacosanoic acid
  145. octacosanoic acid ethyl ester
  146. octacosanoic acid methyl ester
  147. Octacosanoic anhydride
  148. Octadec-8-ynoic acid methyl ester
  149. Octadeca-trans-9, cis-11-dien-1,8-diol
  150. octadecafluorocyclononane
  151. octadecafluorodecahydronaphthalene
  152. octadecafluorodecahydronaphthalene
  153. octadecafluorooctadecahydro(5,6)fullerene-C60-Ih
  154. octadecafluorooctane
  155. octadecahydro(5,6)fullerene-C60-Ih
  156. octadecahydrochrysene
  157. octadecahydronaphthacene
  158. octadecahydrotriphenylene
  159. octadecalithium hexapotassium tetracesium sulfate
  160. octadecalithium hexasodium tetracesium sulfate
  161. octadecamethylcyclononasiloxane
  162. octadecamethylenimine
  163. octadecamethyloctasiloxane
  164. octadecan-2-ol
  165. Octadecan-4-ol
  166. Octadecan-4-one
  167. Octadecan-5-ol
  168. Octadecan-6-ol
  169. Octadecan-7-ol
  170. Octadecan-8-ol
  171. octadecan-8-one
  172. Octadecan-9-ol
  173. octadecan-9-one
  174. Octadecanal
  175. octadecanamide
  176. octadecane
  177. Octadecane-1,2,17,18-tetrol
  178. Octadecane-5,8,11-trione
  179. octadecanedioic acid
  180. octadecanedioic acid bis(1-methylethyl) ester
  181. octadecanedioic acid bis(2-methylpropyl) ester
  182. octadecanedioic acid dibutyl ester
  183. octadecanedioic acid diethyl ester
  184. octadecanedioic acid dipentyl ester
  185. octadecanedioic acid dipropyl ester
  186. octadecanenitrile
  187. octadecanethioic acid S-butyl ester
  188. octadecanethioic acid S-decyl ester
  189. octadecanethioic acid S-dodecyl ester
  190. octadecanethioic acid S-hexadecyl ester
  191. octadecanethioic acid S-nonyl ester
  192. octadecanethioic acid S-octadecyl ester
  193. octadecanethioic acid S-tetradecyl ester
  194. octadecanethioic acid S-undecyl ester
  195. octadecanoic acid
  196. octadecanoic acid
  197. octadecanoic acid 1,2,3-propanetriyl ester
  198. octadecanoic acid 1,2-ethanediyl ester
  199. octadecanoic acid 1,3-propanediyl ester
  200. octadecanoic acid 1,5-pentanediyl ester
  201. octadecanoic acid 1,6-hexanediyl ester
  202. octadecanoic acid 1,7-heptanediyl ester
  203. octadecanoic acid 1,9-nonanediyl ester
  204. octadecanoic acid 1-((acetyloxy)methyl)-1,2-ethanediyl ester
  205. octadecanoic acid 1-methylethyl ester
  206. octadecanoic acid 1-methylheptyl ester
  207. octadecanoic acid 1-methylhexyl ester
  208. octadecanoic acid 1-methylpentyl ester
  209. octadecanoic acid 1-methylpropyl ester
  210. octadecanoic acid 1-[[(1-oxodecyl)oxy]methyl]-1,2-ethanediyl ester
  211. octadecanoic acid 1-[[(1-oxohexadecyl)oxy]methyl]-1,2-ethanediyl ester
  212. octadecanoic acid 1-[[(1-oxohexyl)oxy]methyl]-1,2-ethanediyl ester
  213. octadecanoic acid 1-[[(1-oxooctyl)oxy]methyl]-1,2-ethanediyl ester
  214. octadecanoic acid 1-[[(oxotetradecyl)oxy]methyl]-1,2-ethanediyl ester
  215. octadecanoic acid 2,3-bis((1-oxododecyl)oxy)propyl ester
  216. octadecanoic acid 2,3-bis((1-oxohexadecyl)oxy)propyl ester
  217. octadecanoic acid 2,3-bis(acetyloxy)propyl ester
  218. octadecanoic acid 2,3-dihydroxypropyl ester
  219. octadecanoic acid 2-((1-oxodecyl)oxy)-3-((1-oxohexadecyl)oxy)propyl ester
  220. octadecanoic acid 2-((1-oxodecyl)oxy)-3-((1-oxotetradecyl)oxy)propyl ester
  221. octadecanoic acid 2-((1-oxododecyl)oxy)-1-(((1-oxododecyl)oxy)methyl)ethyl ester
  222. octadecanoic acid 2-((1-oxododecyl)oxy)-3-((1-oxotetradecyl)oxy)propyl ester
  223. octadecanoic acid 2-((1-oxohexadecyl)oxy)-1-(((1-oxohexadecyl)oxy)methyl)ethyl ester
  224. octadecanoic acid 2-((1-oxohexadecyl)oxy)-3-((1-oxodecyl)oxy)propyl ester
  225. octadecanoic acid 2-((1-oxohexadecyl)oxy)-3-((1-oxododecyl)oxy)propyl ester
  226. octadecanoic acid 2-((1-oxohexadecyl)oxy)-3-((1-oxotetradecyl)oxy)propyl ester
  227. octadecanoic acid 2-(4-bromophenyl)-2-oxoethyl ester
  228. octadecanoic acid 2-(4-chlorophenyl)-2-oxoethyl ester
  229. octadecanoic acid 2-(acetyloxy)-1,3-propanediyl ester
  230. octadecanoic acid 2-chloro-1-(chloromethyl)ethyl ester
  231. Octadecanoic acid 2-chloroprop-2-enyl ester
  232. octadecanoic acid 2-ethylhexyl ester
  233. octadecanoic acid 2-hydroxy-1,3-propanediyl ester
  234. octadecanoic acid 2-hydroxy-1-(hydroxymethyl)ethyl ester
  235. octadecanoic acid 2-hydroxy-3-[(1-oxodecyl)oxy]propyl ester
  236. octadecanoic acid 2-hydroxy-3-[(1-oxododecyl)oxy]propyl ester
  237. octadecanoic acid 2-hydroxy-3-[(1-oxohexadecyl)oxy]propyl ester
  238. octadecanoic acid 2-hydroxy-3-[(1-oxotetradecyl)oxy]propyl ester
  239. octadecanoic acid 2-hydroxyethyl ester
  240. octadecanoic acid 2-methylbutyl ester
  241. Octadecanoic acid 2-methylprop-2-enyl ester
  242. octadecanoic acid 2-methylpropyl ester
  243. octadecanoic acid 2-phenyl-1,3-dioxan-5-yl ester
  244. octadecanoic acid 2-[(1-oxodecyl)oxy]-1,3-propanediyl ester
  245. octadecanoic acid 2-[(1-oxododecyl)oxy]-1,3-propanediyl ester
  246. octadecanoic acid 2-[(1-oxohexadecyl)oxy]-1,3-propanediyl ester
  247. octadecanoic acid 2-[(1-oxohexyl)oxy]-1,3-propanediyl ester
  248. octadecanoic acid 2-[(1-oxooctyl)oxy]-1,3-propanediyl ester
  249. octadecanoic acid 2-[(1-oxotetradecyl)oxy]-1,3-propanediyl ester
  250. octadecanoic acid 3-((1-oxodecyl)oxy)-2-((1-oxotetradecyl)oxy)propyl ester
  251. octadecanoic acid 3-((1-oxododecyl)oxy)-2-((1-oxodecyl)oxy)propyl ester
  252. octadecanoic acid 3-((1-oxododecyl)oxy)-2-((1-oxotetradecyl)oxy)propyl ester
  253. octadecanoic acid 3-((1-oxohexadecyl)oxy)-2-((1-oxododecyl)oxy)propyl ester
  254. octadecanoic acid 3-((1-oxohexadecyl)oxy)-2-((1-oxotetradecyl)oxy)propyl ester
  255. octadecanoic acid 3-(acetyloxy)-2-hydroxypropyl ester
  256. octadecanoic acid 3-[(1-oxodecyl)oxy]-2-[(1-oxododecyl)oxy]propyl ester
  257. octadecanoic acid 4-methylphenyl ester
  258. octadecanoic acid ammonium salt
  259. Octadecanoic acid but-3-en-2-yl ester
  260. octadecanoic acid butyl ester
  261. octadecanoic acid cerium(3+) salt
  262. octadecanoic acid chromium(3+) salt
  263. octadecanoic acid compd. with hexadecanoic acid (1:1)
  264. octadecanoic acid compd. with pentadecanoic acid (1:1)
  265. octadecanoic acid compd. with tetradecanoic acid (1:2)
  266. octadecanoic acid copper(2+) salt
  267. octadecanoic acid cyclohexylmethyl ester
  268. octadecanoic acid decyl ester
  269. octadecanoic acid docosyl ester
  270. octadecanoic acid dodecyl ester
  271. octadecanoic acid eicosyl ester
  272. octadecanoic acid ethenyl ester
  273. octadecanoic acid ethyl ester
  274. Octadecanoic acid furan-2-ylmethyl ester
  275. octadecanoic acid heneicosyl ester
  276. Octadecanoic acid hentriacontyl ester
  277. Octadecanoic acid heptacosyl ester
  278. octadecanoic acid heptadecyl ester
  279. octadecanoic acid heptyl ester
  280. octadecanoic acid hexadecyl ester
  281. octadecanoic acid hexyl ester
  282. octadecanoic acid lead(2+) salt
  283. octadecanoic acid lithium salt
  284. octadecanoic acid magnesium salt
  285. octadecanoic acid mercury(2+) salt
  286. octadecanoic acid methyl ester
  287. octadecanoic acid N,N-diphenylamide
  288. octadecanoic acid neodymium(3+) salt
  289. octadecanoic acid nonadecyl ester
  290. octadecanoic acid nonyl ester
  291. octadecanoic acid octadecyl ester
  292. octadecanoic acid octyl ester
  293. octadecanoic acid pentadecyl ester
  294. octadecanoic acid pentyl ester
  295. octadecanoic acid phenyl ester
  296. octadecanoic acid praseodymium(3+) salt
  297. Octadecanoic acid propen-2-yl ester
  298. octadecanoic acid propyl ester
  299. octadecanoic acid samarium(3+) salt
  300. octadecanoic acid sodium salt
  301. octadecanoic acid tetracosyl ester
  302. octadecanoic acid tetradecyl ester
  303. octadecanoic acid thallium(1+) salt
  304. Octadecanoic acid triacontyl ester
  305. octadecanoic acid tricosyl ester
  306. octadecanoic acid tridecyl ester
  307. octadecanoic acid undecyl ester
  308. octadecanoic acid zinc salt
  309. octadecanol
  310. octadecanoyl chloride
  311. octadecapotassium tetracerium (III) sulfate
  312. Octadecapotassium tetralanthanum(III) sulfate tetrahydrate
  313. octadecasodium magnesium sulfate tri(sodium chloride) (D'Ansite)
  314. Octadecathallium(I) tetracerium(III) sulfate
  315. Octadecathallium(I) tetralanthanum sulfate
  316. Octadecathallium(I) tetraneodymium sulfate
  317. Octadecathallium(I) tetrapraseodymium(III) sulfate
  318. octadecyl(trioctyl)silane
  319. Octadecyl-tetradecyl ether
  320. octadecylaniline
  321. octadecylbenzene
  322. octadecylcyclohexane
  323. octadecylcyclopentane
  324. octadecylsilane
  325. Octadiene
  326. octaethoxycyclotetraphosphazene
  327. octaethylcyclotetrasiloxane
  328. octaethyltrisiloxane
  329. Octafluoro-1,1'-biphenyl-4,4'-dithiol
  330. octafluoro-mu-methylenebis(trifluoromethyl)disulfur
  331. octafluorobis(trifluoromethyl)disulfur
  332. octafluorocyclobutane
  333. octafluorocyclopentene
  334. octafluorohexanedioic acid
  335. octafluorohexanedioyl fluoride
  336. octafluoroimidazolidine
  337. octafluoromethanetetramine
  338. octafluoronaphthalene
  339. octafluoropropane
  340. octafluoropyrazolidine
  341. octafluorotetrahydrofuran
  342. octafluorotetrahydrothiophene
  343. octafluorotetrahydrothiophene 1-oxide
  344. octaheptacontane
  345. Octaheptyltetraoxa[8]circulene
  346. octahexacontane
  347. octahydro-1,1,4,4-tetranitro-2,5-methanopentalene
  348. octahydro-1,2,4-ethanylylidene-1H-cyclobuta(cd)pentalene
  349. octahydro-1,2-dimethyl-1H-indole
  350. octahydro-1,3,4,6-tetraphenylimidazo(4,5-d)imidazole
  351. octahydro-1,3,5,7-tetranitro-1,3,5,7-tetrazocine
  352. octahydro-1H-indene
  353. octahydro-1H-indole
  354. octahydro-2(1H)-azecinone
  355. octahydro-2,4,7-trimethyl-1H-indole
  356. octahydro-2,5-methano-1H-indene
  357. octahydro-2-(1-methylheptadecyl)pentalene
  358. octahydro-2-methyl-2H-indole
  359. octahydro-2H-azonin-2-one
  360. octahydro-2H-benzimidazol-2-one
  361. octahydro-2H-benzimidazole-2-thione
  362. octahydro-3,5,1,7-(1,2,3,4)Butanetetraylnaphthalen-2(1H)-one
  363. octahydro-3,5,1,7-(1,2,3,4)butanetetraylnaphthalen-3(2H)-ol
  364. octahydro-3,5,1,7-[1,2,3,4]butanetetraylnaphthalen-1(2H)-ol
  365. octahydro-3-methyl-1H-indole
  366. octahydro-4,7-methano-1H-indene
  367. octahydro-4H-quinolizin-4-one-1,1-dicarboxylic acid diethyl ester
  368. octahydroazocine
  369. octahydrocyclopenta[b]thiopyran
  370. octahydrophenanthrene
  371. octahydrophenazine
  372. octaisopropoxycyclotetraphosphazene
  373. octakis(3,3,3-trifluoropropyl)pentacyclo[9.5.1.1(3,9).1(5,15).1(7,13)]octasiloxane
  374. Octakis(decanoyloxy)-anthracene-9,10-dione
  375. Octakis(dodecanoyloxy)-anthracene-9,10-dione
  376. Octakis(hexadecanoyloxy)-anthracene-9,10-dione
  377. octakis(Isopropoxy)dimolybdenum(II)
  378. Octakis(nonanoyloxy)-anthracene-9,10-dione
  379. Octakis(octanoyloxy)-anthracene-9,10-dione
  380. Octakis(pentadecanoyloxy)-anthracene-9,10-dione
  381. Octakis(tetradecanoyloxy)-anthracene-9,10-dione
  382. Octakis(tridecanoyloxy)-anthracene-9,10-dione
  383. Octakis(undecanoyloxy)-anthracene-9,10-dione
  384. Octakisdecyltetraoxa[8]circulene
  385. octalead (II) divanadium (V) tridecaoxide
  386. octamethoxycyclotetraphosphazene
  387. octamethylcyclotetrasilane
  388. octamethyldiborane(4)tetramine
  389. octamethyldiphenylcyclopentasiloxane
  390. octamethyldiphenyltetrasiloxane
  391. octamethyldiphosphoramide
  392. octamethyldodecaoxooctasilicon
  393. octamethylenimine
  394. octamethylethenetetramine
  395. octamethylsilanetetramine
  396. octan-1-amine hydrochloride
  397. Octan-2-yl 3,5-dinitrobenzoate
  398. octan-2-yl 4-methylbenzene-1-sulfinate
  399. Octan-2-yl 4-[4-[3-(2-fluoro-4-tetradecoxyphenyl)prop-2-ynoyloxy]phenyl]benzoate
  400. Octan-2-yl 4-[4-[3-(3-fluoro-4-tetradecoxyphenyl)prop-2-ynoyloxy]phenyl]benzoate
  401. Octan-2-ylcyclohexane
  402. octanal
  403. Octanal (2,4-dinitrophenyl)hydrazone
  404. octanal oxime
  405. octanal, 2-methyl-
  406. octanamide
  407. octane
  408. octane-1,2,7,8-tetrol
  409. Octane-3,5-dione
  410. Octane-4,5-dione
  411. octane-d18
  412. octanebis(imidamide) dihydrochloride
  413. octanediamide
  414. octanedinitrile
  415. octanedioic acid
  416. octanedioic acid di-2-propenyl ester
  417. octanedioic acid dibutyl ester
  418. octanedioic acid didecyl ester
  419. octanedioic acid didodecyl ester
  420. octanedioic acid diethyl ester
  421. octanedioic acid diheptadecyl ester
  422. octanedioic acid diheptyl ester
  423. octanedioic acid dihexadecyl ester
  424. octanedioic acid dihexyl ester
  425. octanedioic acid dimethyl ester
  426. octanedioic acid dioctadecyl ester
  427. octanedioic acid dipentadecyl ester
  428. octanedioic acid dipropyl ester
  429. octanedioic acid ditetradecyl ester
  430. octanedioic acid ditridecyl ester
  431. octanedioic acid diundecyl ester
  432. octanedioyl dichloride
  433. octanenitrile
  434. octaneperoxoic acid
  435. octanoic acid
  436. octanoic acid (2E)-3,7-dimethyl-2,6-octadienyl ester
  437. octanoic acid 1,1-dimethylethyl ester
  438. octanoic acid 1,10-decanediyl ester
  439. octanoic acid 1,2,3-propanetriyl ester
  440. octanoic acid 1-methylethyl ester
  441. octanoic acid 1-methylheptyl ester
  442. octanoic acid 1-methylhexyl ester
  443. octanoic acid 1-methylpropyl ester
  444. octanoic acid 1-phenylethyl ester
  445. octanoic acid 2,2,2-trifluoroethyl ester
  446. octanoic acid 2,2-bis(((1-oxooctyl)oxy)methyl)-1,3-propanediyl ester
  447. octanoic acid 2,3-dihydroxypropyl ester
  448. octanoic acid 2-(hexyloxy)ethyl ester
  449. octanoic acid 2-butoxyethyl ester
  450. Octanoic acid 2-chloroprop-2-enyl ester
  451. octanoic acid 2-ethoxyethyl ester
  452. octanoic acid 2-ethylhexyl ester
  453. octanoic acid 2-methoxyethyl ester
  454. octanoic acid 2-methyl-2-(((1-oxooctyl)oxy)methyl)-1,3-propanediyl ester
  455. Octanoic acid 2-methylprop-2-enyl ester
  456. octanoic acid 2-propenyl ester
  457. octanoic acid 2-propoxyethyl ester
  458. octanoic acid 3,6-dihydroxy-1,2,4,5-benzenetetrayl ester
  459. octanoic acid 4-((4-nitrophenyl)azoxy)phenyl ester
  460. octanoic acid 4-methylphenyl ester
  461. octanoic acid ammonium salt
  462. Octanoic acid but-3-en-2-yl ester
  463. octanoic acid butyl ester
  464. octanoic acid cadmium(2+) salt
  465. octanoic acid calcium salt
  466. octanoic acid cerium(3+) salt
  467. octanoic acid cobalt(2+) salt
  468. octanoic acid copper(2+) salt
  469. octanoic acid cyclohexyl ester
  470. octanoic acid docosyl ester
  471. octanoic acid dodecyl ester
  472. octanoic acid eicosyl ester
  473. octanoic acid ethyl ester
  474. Octanoic acid furan-2-ylmethyl ester
  475. octanoic acid gadolinium(3+) salt
  476. octanoic acid heneicosyl ester
  477. octanoic acid heptadecyl ester
  478. octanoic acid heptyl ester
  479. octanoic acid hexadecyl ester
  480. octanoic acid hexyl ester
  481. octanoic acid lead(2+) salt
  482. octanoic acid lithium salt
  483. octanoic acid mercury(2+) salt
  484. octanoic acid methyl ester
  485. octanoic acid N,N-diphenylamide
  486. octanoic acid nonadecyl ester
  487. octanoic acid octadecyl ester
  488. octanoic acid octyl ester
  489. octanoic acid pentadecyl ester
  490. octanoic acid pentyl ester
  491. octanoic acid phenyl ester
  492. octanoic acid potassium salt
  493. octanoic acid propyl ester
  494. octanoic acid samarium(3+) salt
  495. octanoic acid sodium salt
  496. octanoic acid tetradecyl ester
  497. octanoic acid thallium(1+) salt
  498. octanoic acid tridecyl ester
  499. octanoic acid undecyl ester
  500. octanoic acid zinc(2+) salt
  501. octanoic acid, p-[(p-butoxybenzylidene)amino]phenyl ester
  502. octanonacontane
  503. Octanonyltetraoxa[8]circulene
  504. octanoyl chloride
  505. octanoyl octaneperoxoate
  506. octaoctacontane
  507. Octaoctyltetraoxa[8]circulene
  508. octapentacontane
  509. octaphenoxycyclotetraphosphazene
  510. octaphenylcyclotetrasiloxane
  511. octaphenylpentacyclo[9.5.1.1(3,9)1(5,15).1(7,13)]octasiloxane
  512. octaphenyltrisiloxane
  513. Octapotassium dilanthanum(III) sulfate monohydrate
  514. Octapropyltetraoxa[8]circulene
  515. Octasodium hexaneodymium sulfate hexahydrate
  516. Octasodium pentatitanium(IV) oxide
  517. octasodium sulfide dithioantimonate nonahydrate
  518. octasodium sulfide dithioantimonate pentahydrate
  519. octasodium sulfide dithioantimonate tetrahydrate
  520. octasodium sulfide dithioantimonite dihydrate
  521. octasodium sulfide hexathioindate monohydrate
  522. octasodium sulfide trithiotellurite tetrahydrate
  523. octasodium tricadmium sulfate trihydrate
  524. octasodium trizinc sulfate
  525. octatetracontafluorooctatetracontahydro(5,6)fullerene-C60-Ih
  526. octatetracontane
  527. Octatriacontabismuth zinc(II) oxide
  528. octatriacontan-1-ol
  529. octatriacontane
  530. octatriacontanoic acid
  531. Octatriacontanoic acid ethyl ester
  532. octatriacontanoic acid methyl ester
  533. octa[(naphthalen-2-yl)oxy]cyclotetraphosphazene
  534. Octene
  535. Octyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate
  536. Octyl 2,14-dimethyl-4,12-dioxo-3,5,8,11,13-pentaoxapentadecane-1,15-dioate
  537. Octyl 2,5-bis[(4-octoxybenzoyl)oxy]benzoate
  538. Octyl 2-butoxycarbonyloxypropanoate
  539. Octyl 2-ethoxycarbonyloxypropanoate
  540. Octyl 3,5-dinitrobenzoate
  541. Octyl 4-(4-{4-[4-(octoxycarbonyl)phenyl]phenyl}phenyl)benzoate
  542. Octyl 4-methylbenzenesulfinate
  543. Octyl 4-methylbenzenesulfonate
  544. Octyl 4-[(E)-[4-(4-hexanoylpiperazin-1-yl)phenyl]diazenyl]benzoate
  545. Octyl 6-[(octoxycarbonyl)amino]hexanoate
  546. Octyl N-butylcarbamate
  547. Octyl N-octylcarbamate
  548. Octyl nicotinate
  549. Octyl nitrite
  550. Octyl nonanoate
  551. octyl triethyl phosphonium 1,2,3-triazolide
  552. octyl triethyl phosphonium 2-methyl-5-nitropyrazolide
  553. octyl triethyl phosphonium 4-nitroimidazolide
  554. octyl triethyl phosphonium 4-nitropyrazolide
  555. Octyl(phenyl)phosphane
  556. octyl-β-D-glucopyranoside
  557. octyl-18-crown-6
  558. Octyl-allylmalonic acid diethyl ester
  559. Octyl-D6 2,3,4,6-tetra-O-acetyl-β-D-glucopyranoside
  560. Octyl-phenyl-propan-2-ylphosphane
  561. octyl-tributylphosphonium 2-cyanopyrrolide
  562. octyl-triethylammonium 2-cyanopyrrolide
  563. octyl-triethylphosphonium 2-cyanopyrrolide
  564. octyl-tripropylphosphonium 2-cyanopyrrolide
  565. octylbenzene
  566. octylboronic acid dioctyl ester
  567. octylcycloheptane
  568. octylcyclohexane
  569. Octylmalonic acid diethyl ester
  570. octyloxirane
  571. octylpentaethyleneglycol
  572. octylphosphane
  573. octylphosphonic acid dipropyl ester
  574. octylphosphonous dichloride
  575. octylpropanedioic acid
  576. Octylsulfanyl(propan-2-ylsulfanyl)methanethione
  577. octylurea
  578. oil
  579. oil fraction
  580. oil vapor-52
  581. oil xf-22
  582. Olanzapine
  583. Olaparib
  584. oleanolic acid
  585. Oleum
  586. oligochloro organosiloxane
  587. oligofluoro organosiloxane
  588. oligotrifluorochloroethylene
  589. olive oil
  590. olive oil
  591. olive oil biodiesel
  592. omeprazole
  593. orange peel oil
  594. orites 270 DS
  595. Orotic acid
  596. ortho sodium antimonate hexahydrate
  597. ortho-deuterium
  598. ortho-dideuterobenzene
  599. ortho-hydrogen
  600. Orthoacetic acid diethyl ester-phenyl ester
  601. Orthoacetic acid diphenyl ester-ethyl ester
  602. Orthobenzoic acid triethenyl ester
  603. Orthoformic acid diethyl ester-phenyl ester
  604. Orthoformic acid tri-(3-chlorobutan-2-yl) ester
  605. Orthoformic acid tris(3-chloroprop-1-en-2-yl) ester
  606. Orthoformic acid tris(3-ethoxyprop-1-en-2-yl) ester
  607. Orthoformic acid tris(3-methoxyprop-1-en-2-yl) ester
  608. Orthoformic acid tris(3-prop-2-yloxyprop-1-en-2-yl) ester
  609. Orthoformic acid tris(but-2-en-2-yl) ester
  610. osmium
  611. Osmium diantimony
  612. osmium fluoride oxide (OsF5O)
  613. osmium oxide (OsO2)
  614. Osmium(IV) tetrakis(N-methylcyclohexyl dithiocarbamate)
  615. Ovalene
  616. oxacyclododecan-2-one
  617. oxacycloheptadecan-2-one
  618. oxacycloheptadecane-2,10-dione
  619. oxacycloheptadecane-2,13-dione
  620. oxacyclohexadecan-2-one
  621. oxacyclooctadecan-2-one
  622. oxacyclopentadecan-2-one
  623. oxacyclotetradecan-2-one
  624. oxacyclotetradecane-2,10-dione
  625. oxacyclotridecane-2-one
  626. oxacycloundecan-2-one
  627. Oxalate (2-) Anion
  628. oxaldehydic acid
  629. oxalic acid monohydrate
  630. Oxaline (DES)
  631. Oxamniquin
  632. Oxan-2-ol
  633. Oxaprozin
  634. oxazole
  635. oxazole-4,5-dicarboxylic acid diethyl ester
  636. Oxcarbazepine
  637. oxepane
  638. oxepin
  639. Oxetan-2-ylmethanol
  640. Oxetan-2-ylmethyl 4-methylbenzenesulfonate
  641. oxetane
  642. oxido-(3-sulfophenyl)-(3-sulfophenyl)iminoazanium
  643. oxido-(trifluoromethyl)-(trifluoromethylimino)azanium
  644. oxiran-2-ylmethyl 3,5-dinitrobenzoate
  645. Oxiran-2-ylmethyl acetate
  646. oxirane
  647. oxirane compd. with nitrogen fluoride (HNF2) (1:1)
  648. oxirane-2-carbaldehyde
  649. oxirane-d4
  650. oxiranemethanol
  651. oxiranemethanol phenylcarbamate
  652. oxiranepropanoic acid methyl ester
  653. oxiranetetracarbonitrile
  654. oxirene
  655. oxo(sulfato(2-)-O)vanadium
  656. oxo(sulfato(2-)-O)vanadium trihydrate
  657. oxo(sulphato(2-)-κO,κO')titanium
  658. Oxo-bis(difluorophosphine)
  659. Oxo-bis[(phthalocyaninato)aluminum(III)]
  660. oxoacetic acid monohydrate
  661. oxoaluminum(1+)
  662. oxobis(2,4-pentanedionato)vanadium
  663. oxobis(8-quinolinolato-κN1,κO8)vanadium
  664. oxobis(propanoato-O)hafnium
  665. oxobis(propanoato-O)zirconium
  666. Oxobis(tri(m-tolyl)(2,4-dinitrobenzenesulfonato)antimony)
  667. oxobis(trifluoromethanolato)bis(trifluoromethyl)sulfur
  668. oxobismuth hydrochloride
  669. oxoborane
  670. oxobutanedioic acid
  671. oxobutanedioic acid diethyl ester
  672. oxocane
  673. oxodialuminate(1+)
  674. oxodinitrogen(1+)
  675. Oxolan-2-ylmethyl 2-butoxycarbonyloxypropanoate
  676. Oxolan-2-ylmethyl 2-decoxycarbonyloxypropanoate
  677. Oxolan-2-ylmethyl 2-dodecoxycarbonyloxypropanoate
  678. Oxolan-2-ylmethyl 2-ethoxycarbonyloxypropanoate
  679. oxolan-2-ylmethyl 2-hexoxycarbonyloxypropanoate
  680. Oxolan-2-ylmethyl 2-octoxycarbonyloxypropanoate
  681. oxolan-3-ol
  682. Oxolane-2-carboxylic acid
  683. Oxolane-2-carboxylic acid ethyl ester
  684. oxolane-3,4-diol
  685. oxomethyl
  686. oxonium
  687. oxonium tetrafluoroborate(1-)
  688. oxoniumylidene
  689. oxopropanedinitrile
  690. oxopropanedioic acid monohydrate
  691. Oxovanadium(2+) sulfate hydrate (1:1:5)
  692. oxo[C,C,C,2-tetrakis(1,1-dimethylethyl)-29H,31H-phthalocyaninato(2-)-κN29,κN30,κN31,κN32]vanadium
  693. oxyapatite
  694. oxyapatite (Ca10(PO4)6O)
  695. oxybis((difluoromethoxy)difluoromethane)
  696. oxybis(chloromethane)
  697. oxybis(diethylborane)
  698. oxybis(difluoromethane)
  699. oxybis(methane-d3)
  700. oxybis(methoxymethane)
  701. oxybis(methoxypropane)
  702. oxybis(trifluoromethane)
  703. oxybismethane
  704. oxybismethane compd. with nitrogen fluoride (HNF2) (1:1)
  705. oxybismethanol
  706. oxybispropanediol
  707. oxybispropanol
  708. oxybispropanol
  709. oxybis[(5-formyl-2-furanyl)methane]
  710. oxybis[bis(trifluoromethyl)]arsine
  711. Oxyclozanide
  712. oxygen
  713. oxygen fluoride ((O2)F2)
  714. oxygen fluoride ((O3)F2)
  715. oxygen fluoride ((O4)F2)
  716. oxygen fluoride (O2F)
  717. oxygen fluoride (OF)
  718. oxygen fluoride (OF2)
  719. oxygen ion (O(1-))
  720. ozone
  721. p,p'-dibutylazoxybenzene
  722. p,p'-dihexylazoxybenzene
  723. p,p'-dipentoxyazoxybenzene
  724. p,p'-dipentylazoxybenzene
  725. p,p'-dipropylazoxybenzene
  726. P,P-bis(trifluoromethyl)phosphinothioic amide
  727. p-(1,1-dimethylethyl)calix(8)arene
  728. p-(3-Hydroxypropyloxy)-p'-cyanobiphenyl
  729. p-(6-Hydroxyhexyloxy)-p'-cyanobiphenyl
  730. p-(8-Hydroxyoctyloxy)-p'-cyanobiphenyl
  731. P-(chloromethyl)-N,N'-bis(1-methylpropyl)phosphonothioic diamide
  732. P-(chloromethyl)-N-(1-methylethyl)phosphonamidothioic acid O-(2,4,5-trichlorophenyl) ester
  733. P-(chloromethyl)-N-(1-methylethyl)phosphonamidothioic acid O-(2,4-dichlorophenyl) ester
  734. P-(chloromethyl)-N-(1-methylpropyl)phosphonamidothioic acid O-(2-chloro-4-methylphenyl) ester
  735. p-(Di-(2-chloroethyl)amino)phenylacetic acid di(2-hydroxyethyl)amide
  736. p-(Di-(2-chloroethyl)amino)phenylacetic acid p-nitrophenyl ester
  737. p-(di-(2-chloroethyl)amino)phenylacetylmorpholide
  738. p-(Di-(2-chloroethyl)amino)phenylacetylpiperidide
  739. p-(Di-(2chloroethyl)amino)phenylacetylaminoethanol
  740. p-Acetamidobenzylidene fluoride
  741. P-Acetamidophenyl 4-morpholinoacetate hydrochloride
  742. p-Acetamidophenyl butyrate
  743. p-Acetamidophenyl chloroethylcarbonate
  744. p-Acetamidophenyl hexylcarbonate
  745. p-Acetamidophenyl hydrogen succinate
  746. p-Aminodiphenyl ether
  747. p-anisic acid, bicyclo[2,2,2]oct-1,4-ylene ester
  748. p-Azoanisolephenetole
  749. p-biphenyltrimethylammonium bromide
  750. p-bromophenylmercuric acetate
  751. p-butoxy-p'-pentylazobenzene
  752. p-butoxybenzoic acid, p-phenylene ester
  753. p-chloroacetoxy-2-chloroacetanilide
  754. p-Chlorobenzoic acid, p-phenylene ester
  755. p-Chlorophenylhydrazonoterephthalilydenaminophthalimide
  756. p-cyclopentylcyclohexanol
  757. p-Dimethylaminobenzyl phenylselenide
  758. p-ethoxybenzoic acid, p-phenylene ester
  759. P-ethyl-P-phenylphosphinic acid methyl ester
  760. p-Ethylbenzaldehyde
  761. p-Fluorobenzotribromide
  762. p-Fluorobenzyl fluoride
  763. p-Fluorobenzylidene bromide
  764. p-Fluorobenzylidene fluoride
  765. p-fluorophenylacetonitrile
  766. p-iodoacetoxy-2-iodoacetanilide
  767. p-iodophenyl p-bromobenzenesulfonate
  768. p-menthan-8,9-diol
  769. p-Methoxybenzyl benzylethanedithioamide
  770. p-Methoxydiphenyl ether
  771. P-methyl-P-(trifluoromethyl)phosphinous amide
  772. p-Methyldiphenyl ether
  773. p-n-Butoxybenzyliden-p'-n-hexyloxyaniline
  774. p-n-Ethoxybenzyliden-p'-n-hexyloxyaniline
  775. p-n-Heptoxybenzyliden-p'-n-hexyloxyaniline
  776. p-n-Hexyloxybenzyliden-p'-n-hexyloxyaniline
  777. p-n-Methoxybenzyliden-p'-n-hexyloxyaniline
  778. p-n-Octoxybenzyliden-p'-n-hexyloxyaniline
  779. p-n-Pentoxybenzyliden-p'-n-hexyloxyaniline
  780. p-n-Propoxybenzyliden-p'-n-hexyloxyaniline
  781. p-n-Propyloxy benylidene-p-aminobenzoic acid
  782. p-Nitro-m'-acethylaminodiphenyl selenide
  783. p-Nitro-m'-aminodiphenyl selenide
  784. p-Nitro-m'-dimethylaminodiphenyl selenide
  785. p-Nitro-m'-hydroxydiphenyl selenide
  786. p-Nitro-m'-methoxydiphenyl selenide
  787. p-Nitro-p'-acethylaminodiphenyl selenide
  788. p-Nitro-p'-aminodiphenyl selenide
  789. p-Nitro-p'-dimethylaminodiphenyl selenide
  790. p-Nitro-p'-hydroxydiphenyl selenide
  791. p-Nitro-p'-methoxydiphenyl selenide
  792. p-Nitroaniline perchlorate
  793. p-nitroazobenzene
  794. p-Nitrobenzoic acid L-bornylester
  795. p-nitrobenzyl N,N-diphenylcarbamate
  796. p-Nitrodiphenyl selenide
  797. p-Nitrophenyl -p'-acetylaminobenzyl selenide
  798. p-Nitrophenyl -p'-aminobenzyl selenide
  799. p-Nitrophenyl -p'-dimethylaminobenzyl selenide
  800. p-Nitrophenyl -p'-metoxybenzyl selenide
  801. p-Nitrophenyl benzyl selenide
  802. p-Nitrophenyltrimethylsilane
  803. p-octyloxybenzoic acid, bicyclo[2,2,2]oct-1,4-ylene ester
  804. p-propoxybenzoic acid, bicyclo[2,2,2]oct-1,4-ylene ester
  805. p-propoxybenzoic acid, p-phenylene ester
  806. p-Propylphenyl trans-p-(4-pentylcyclohexyl)benzoate
  807. p-Sexiphenyl
  808. p-terphenyl-D14
  809. p-Toluenesulfonic acid monohydrate
  810. p-Tolyl-carbamic acid i-butyl ester
  811. p-Tolyl-carbamic acid n-butyl ester
  812. p-Tolyl-carbamic acid s-butyl ester
  813. p-Trimethylsilylaniline
  814. p-Xylyl-bis(1-methylimidazolium) bis(trifluoromethylsulfonyl)imide
  815. p-[(p-Decyloxybenzylidene)amino]cinnamic acid, isopentyl ester
  816. p-[(p-Decyloxybenzylidene)amino]cinnamic acid, pentyl ester
  817. p-[(p-Dodecyloxybenzylidene)amino]cinnamic acid, isopentyl ester
  818. p-[(p-Dodecyloxyphenyl)azo]acetophenone
  819. p-[(p-Ethoxybenzylidene)amino]benzoic acid, trimethylene ester
  820. p-[(p-Ethoxybenzylidene)amino]cinnamic acid, methyl ester
  821. p-[(p-ethoxyphenyl)azo]benzoic acid, butyl ester
  822. p-[(p-Ethylthiobenzylidene)amino]cinnamic acid, ethyl ester
  823. p-[(p-Ethylthiobenzylidene)amino]cinnamic acid, methyl ester
  824. p-[(p-Hydroxyphenyl)azo]cinnamic acid, ethyl ester, acetate
  825. p-[(p-Hydroxyphenyl)azo]cinnamic acid, ethyl ester, benzoate
  826. p-[(p-Hydroxyphenyl)azo]cinnamic acid, ethyl ester, ethyl carbonate
  827. p-[(p-methoxybenzylidene)amino]α-methylcinnamic acid, propyl ester
  828. p-[(p-Methoxybenzylidene)amino]cinnamic acid, ethyl ester
  829. p-[(p-Methoxybenzylidene)amino]cinnamic acid, methyl ester
  830. p-[(p-Methoxyphenyl)azo]cinnamic acid, ethyl ester
  831. p-[(p-Nonyloxybenzylidene)amino]cinnamic acid, pentyl ester
  832. p-[(p-Octyloxybenzylidene)amino]cinnamic acid, isopentyl ester
  833. p-[(p-Phenylbenzylidene)amino]cinnamic acid, ethyl ester
  834. p-[p-(Phenylbenzylidene)amino]benzoic acid, ethyl ester
  835. Paclobutrazol
  836. Pagodan
  837. Palbociclib
  838. Paliperidone palmitate
  839. palladium
  840. palladium (hydrate)(N,N-dimethylbenzylamino)(10-phenyl-10H-9-thia-10-phosphaanthracene-9,9-dioxide) hexafluoroantimonate
  841. palladium (hydrate)(N,N-dimethylbenzylamino)(10-phenyl-10H-9-thia-10-phosphaanthracene-9,9-dioxide) hexfluorophosphate
  842. palladium (trifluoromethanesulfonate)(N,N-dimethylbenzylamino)(10-phenyl-10H-9-thia-10-phosphaanthracene-9,9-dioxide)
  843. palladium alloy base Pd 76,Si 18,Cu 6
  844. Palladium bis-(2,2,6,6-tetramethyl-3,5-heptanedionate)
  845. palladium chloride (PdCl2)
  846. palladium compd. with thulium (1:1)
  847. palladium compd. with ytterbium (1:1)
  848. Palladium Gallium (PdGa)
  849. palladium oxide (PdO)
  850. Palladium titanium
  851. Palladium(II) 2,6-diacetylpyridine-mono(cabohydrazone) dichloride dihydrate
  852. Palladium(II) 3-dimethylaminomethyl indole salicylaldehydeoxime chloride
  853. Palladium(II) 8-ethyltheophyline dichloride
  854. Palladium(II) 8-isopropyltheophyline dichloride
  855. Palladium(II) 8-pentyltheophyline dichloride
  856. Palladium(II) 8-propyltheophyline dichloride
  857. Palladium(II) bis(α-nitroso-β-naphthate)
  858. Palladium(II) bis(1,3,8-trimethylxanthine) dichloride
  859. Palladium(II) bis(1,4-dithiane) dichloride
  860. Palladium(II) bis(1,4-thioxane) dichloride
  861. Palladium(II) bis(3,8-dimethylxanthine) dichloride
  862. Palladium(II) bis(4,6-dimethyl-2-thiopyrimidine) dichloride
  863. Palladium(II) bis(4-pentylpyridine) dichloride
  864. Palladium(II) bis(caffeine) dichloride
  865. Palladium(II) bis(dibutyldithiocarbamate)
  866. Palladium(II) bis(diethyldithiocarbamate)
  867. Palladium(II) bis(diisobutyldithiocarbamate)
  868. Palladium(II) bis(dipentyldithiocarbamate)
  869. Palladium(II) bis(dipropyldithiocarbamate)
  870. Palladium(II) bis(morpholine) dichloride
  871. Palladium(II) bis(N,N'-dimethylpiperazine) dichloride
  872. Palladium(II) bis(N-methylcyclohexyl dithiocarbamate)
  873. Palladium(II) bis(N-methylmorpholine) dichloride
  874. Palladium(II) bis(O-methyl dithiocarbonate)
  875. Palladium(II) bis(piperidine chloride)
  876. Palladium(II) bis(theobromine) dichloride
  877. Palladium(II) bis(theophylline) dichloride
  878. Palladium(II) bis(xanthine) dichloride
  879. Palladium(II) salicylaldehydeoxime chloride
  880. palladiummonochloride(N,N-dimethylbenzylamino)(10-phenyl-10H-9-thia-10-phosphaanthracene-9,9-dioxide)
  881. palm kernel oil
  882. palm oil
  883. palm Oil Biodiesel
  884. palm oil ethyl ester
  885. Palmatine chloride
  886. Pandermite
  887. para-deuterium
  888. para-hydrogen
  889. paracelsian strontium (Al2Sr(SiO4)2)
  890. paraffin
  891. paraffin wax
  892. paraffin wax
  893. paraffin wax
  894. paraffin wax
  895. paraffin wax
  896. paraffin wax
  897. paraffin wax
  898. paraffin wax
  899. paraffin wax
  900. paraffinic mineral oil
  901. paraformaldehyde
  902. Paraxanthin
  903. Patchoulene
  904. Patulin
  905. Pazopanib
  906. Pb (2+) cation
  907. peace river bitumen
  908. peace river bitumen
  909. Peanut oil
  910. peanut oil biodiesel
  911. Pent-1-en-1-yl trifluoromethanesulfonate
  912. Pent-1-en-3-yl acetate
  913. pent-1-enylbenzene
  914. pent-1-yn-3-ol
  915. Pent-1-ynylbenzene
  916. Pent-2-en-1-ol
  917. Pent-2-en-3-ylbenzene
  918. Pent-2-enenitrile
  919. Pent-2-enyl acetate
  920. pent-2-yne-1,4-diol
  921. Pent-3-en-2-yl acetate
  922. Pent-3-yn-2-one
  923. Pent-3-ynylcyclohexane
  924. pent-4-en-1-amine
  925. pent-4-en-1-ynylbenzene
  926. pent-4-en-2-yl acetate
  927. Pent-4-en-2-yn-1-ol
  928. Pent-4-enedithioic acid
  929. Pent-4-enoyl chloride
  930. Pent-4-yn-1-ol
  931. Pent-4-yn-1-yl 4-methylbenzene-1-sulfonate
  932. Pent-4-ynoic acid propyl ester
  933. Pent-4-ynylcyclohexane
  934. penta(cerium(IV) dihydroxo sulfate) cerium(IV) hydroxide pentahydrate
  935. penta(lead(II) oxide) tri(potassium sodium tartrate)
  936. pentaaluminium triiodate hexasulfate 42-hydrate
  937. pentaammonium antimony chloride
  938. pentaammonium silver thiocyanate
  939. Pentaantipyrine copper(II) perchlorate
  940. Pentaantipyrine copper(II) tetrafluoroborate
  941. Pentaantipyrine uranyl perchlorate
  942. Pentaaqua tris(4-propyl-1,2,4-triazole) iron(II) trifluoromethanesulfonate
  943. pentaaqua(l-threoninato-κO,κO1)holmium(2+) dichloride hydrochloride
  944. pentaaquabis(l-prolinato-κN1,κO2)erbium(3+) trichloride
  945. Pentabarium tris(manganate(V)) chloride
  946. Pentabasic lead(II) styphnate dihydrate
  947. pentaborane(11)
  948. pentaborane(9)
  949. pentaborane(9)-d9
  950. Pentabromobenzene
  951. pentabromomethoxybenzene
  952. pentabromomethylbenzene
  953. pentabromophosphorane
  954. pentacadmium diyttrium (III) chloride hexacosahydrate
  955. pentacadmium neodymium(III) chloride tridecahydrate
  956. pentacalcium ammonium sulfate monohydrate
  957. pentacalcium ammonium undecanitrate decahydrate
  958. Pentacalcium cesium nitrate decahydrate
  959. pentacalcium diammonium hexasulfate monohydrate
  960. pentacalcium dipotassium sulfate monohydrate
  961. pentacalcium disodium sulfate trihydrate
  962. pentacalcium potassium nitrate decahydrate
  963. pentacarbonyl chromium piperidine
  964. pentacarbonyl chromium pyrazole
  965. pentacarbonyl Chromium pyridine
  966. pentacarbonyl chromium thiazole
  967. pentacarbonyl Molybdenum pyridine
  968. pentacarbonyl tungsten pyrazine
  969. pentacarbonyl tungsten pyrazole
  970. pentacarbonyl tungsten pyridine
  971. Pentacarbonyl(triphenylphosphine)molybdenum
  972. Pentacarbonyl-N-methylcyano molybdenum
  973. pentacarbonylsilylmanganese
  974. pentacene
  975. pentacesium diantimony(III) chloride
  976. pentacesium dicerium bromide 22-hydrate
  977. pentacesium dieuropium bromide eicosahydrate
  978. pentacesium dilanthanum bromide 22-hydrate
  979. pentacesium dineodymium bromide docosahydrate
  980. pentacesium disamarium bromide docosahydrate
  981. Pentacesium dysprosium octachloride hexahydrate
  982. pentacesium holmium(III) chloride tetrahydrate
  983. pentacesium terbium chloride hexahydrate
  984. pentacesium tridysprosium bromide tetracosahydrate
  985. pentachloro(trichloroethenyl)benzene
  986. pentachloro-1,1'-biphenyl
  987. pentachloro-pentafluoro-cyclopentane
  988. pentachlorobenzene
  989. pentachlorobenzene-d1
  990. pentachlorobuta-1,3-diene
  991. Pentachlorocyclopropane
  992. pentachlorodecane
  993. pentachlorododecane
  994. pentachloroethane
  995. pentachloroethylbenzene
  996. pentachlorofluoroethane
  997. pentachloromethylbenzene
  998. pentachloromethyldisilane
  999. pentachloronitrobenzene
  1000. pentachlorophenol
  1001. pentachlorophenol ion(1-)
  1002. pentachlorophenol sodium salt
  1003. pentachlorophenoxybenzene
  1004. pentachlorophosphorane
  1005. pentachloropyridine
  1006. pentachloroundecane
  1007. Pentachromium trisilicide
  1008. pentacobalt chloride tetrasulfate octaurea heptadecahydrate
  1009. pentacontafluoro-2,5,8,11,14,17,20,23,26,29,32,35-dodecaoxahexatriacontane
  1010. pentacontafluorotetracosane
  1011. Pentacontan-1-ol
  1012. pentacontane
  1013. Pentacontanoic acid propyl ester
  1014. pentacontylbenzene
  1015. pentacontylcyclohexane
  1016. Pentacopper dibismuth tetraboron oxide
  1017. Pentacopper erbium
  1018. Pentacopper lanthanum
  1019. Pentacos-2-yn-1-ol
  1020. Pentacos-24-yn-1-ol
  1021. Pentacosabismuth trilutetium dirhenium oxide
  1022. Pentacosabismuth(III) gallium(III) oxide
  1023. Pentacosabismuth(III) iron(III) oxide
  1024. pentacosane
  1025. pentacosanenitrile
  1026. pentacosanoic acid
  1027. pentacosanoic acid ethyl ester
  1028. pentacosanoic acid methyl ester
  1029. pentacosylbenzene
  1030. pentacosylcyclohexane
  1031. pentacyclo(3.3.0.0(2,4).0(3,7).0(6,8))octane-2,6-dicarboxylic acid dimethyl ester
  1032. pentacyclo(4.4.0.0(2,5).0(3,8).0(4,7))dec-9-ene
  1033. pentacyclo[19.3.1.1(3,7).1(9,13).1(15,19)]octacosa-1(25),3,5,7(28),9,11,13(27),15,17,19(26),21,23-dodecaene-25,26,27,28-tetrol
  1034. pentacyclo[4.2.0.0(2,5).0(3,8).0(4,7)]octane
  1035. pentacyclo[4.2.0.0(2,5).0(3,8).0(4,7)]octane-1,4-dicarboxylic acid
  1036. pentacyclo[4.2.0.0(2,5).0(3,8).0(4,7)]octane-1,4-dicarboxylic acid dimethyl ester
  1037. pentacyclo[4.3.0.0(2,5).0(3,8).0(4,7)]nonane-4-carboxylic acid
  1038. pentacyclo[4.3.0.0(2,5).0(3,8).0(4,7)]nonane-4-carboxylic acid methyl ester
  1039. Pentacyclo[8.2.1.14,7.02,9.03,8]tetradecane
  1040. Pentadec-14-ene-2,5-dione
  1041. Pentadec-2-enoic amide
  1042. Pentadec-6-yn-8-one
  1043. Pentadec-7-ene
  1044. pentadecafluoro-N-(3-hydroxyphenyl)octanamide
  1045. pentadecafluoroheptyl perchlorate
  1046. pentadecafluorooctanal
  1047. pentadecafluorooctanoic acid ammonium salt
  1048. pentadecafluorooctanoic acid methyl ester
  1049. pentadecafluorooctanoyl chloride
  1050. Pentadecalithium tetrasilicide
  1051. pentadecamethylenimine
  1052. pentadecan-1-al
  1053. pentadecan-1-amine hydrochloride
  1054. pentadecan-3-one
  1055. pentadecan-4-ol
  1056. pentadecan-4-one
  1057. Pentadecan-5-ol
  1058. pentadecan-5-one
  1059. pentadecan-6-ol
  1060. Pentadecan-6-one
  1061. pentadecan-7-ol
  1062. Pentadecan-7-one
  1063. pentadecan-8-ol
  1064. pentadecanamide
  1065. pentadecane
  1066. Pentadecane-1,2,14,15-tetrol
  1067. Pentadecane-3,6,9-trione
  1068. pentadecanedioic acid
  1069. Pentadecanedioic acid dimethyl ester
  1070. pentadecanedioic acid dipropyl ester
  1071. Pentadecanedioic acid monomethyl ester
  1072. pentadecanenitrile
  1073. pentadecanoic acid
  1074. pentadecanoic acid 1,10-decanediyl ester
  1075. pentadecanoic acid 1,2,3-propanetriyl ester
  1076. pentadecanoic acid 1,3-propanediyl ester
  1077. pentadecanoic acid 1,4-butanediyl ester
  1078. pentadecanoic acid 1,5-pentanediyl ester
  1079. pentadecanoic acid 1,6-hexanediyl ester
  1080. pentadecanoic acid 1,7-heptanediyl ester
  1081. pentadecanoic acid 1,8-octanediyl ester
  1082. pentadecanoic acid 1,9-nonanediyl ester
  1083. pentadecanoic acid butyl ester
  1084. pentadecanoic acid decyl ester
  1085. pentadecanoic acid docosyl ester
  1086. pentadecanoic acid dodecyl ester
  1087. pentadecanoic acid eicosyl ester
  1088. pentadecanoic acid ethyl ester
  1089. pentadecanoic acid heneicosyl ester
  1090. pentadecanoic acid heptadecyl ester
  1091. pentadecanoic acid heptyl ester
  1092. pentadecanoic acid hexadecyl ester
  1093. pentadecanoic acid hexyl ester
  1094. pentadecanoic acid lithium salt
  1095. pentadecanoic acid methyl ester
  1096. pentadecanoic acid nonadecyl ester
  1097. pentadecanoic acid nonyl ester
  1098. pentadecanoic acid octadecyl ester
  1099. pentadecanoic acid octyl ester
  1100. pentadecanoic acid pentadecyl ester
  1101. pentadecanoic acid pentyl ester
  1102. pentadecanoic acid propyl ester
  1103. pentadecanoic acid sodium salt
  1104. pentadecanoic acid tetradecyl ester
  1105. pentadecanoic acid tricosyl ester
  1106. pentadecanoic acid tridecyl ester
  1107. pentadecanoic acid undecyl ester
  1108. Pentadecanoyl chloride
  1109. pentadecarubidium tetraneodymium nitrate
  1110. Pentadecyl 2-(4-decoxyphenyl)cyclohepta[d]imidazole-6-carboxylate
  1111. Pentadecyl 2-(4-dodecoxyphenyl)cyclohepta[d]imidazole-6-carboxylate
  1112. Pentadecyl 2-(4-octoxyphenyl)cyclohepta[d]imidazole-6-carboxylate
  1113. Pentadecyl benzoate
  1114. Pentadecyl N-naphthalen-1-ylcarbamate
  1115. pentadecylazanium acetate
  1116. pentadecylbenzene
  1117. pentadecylcyclohexane
  1118. pentadecylcyclopentane
  1119. Pentadecylurea
  1120. Pentaerythritol 2-methylpropionate
  1121. Pentaerythritol dibromide
  1122. pentaerythritol ester lubricants
  1123. Pentaerythritol tetra-3-methylbutanoate
  1124. pentaerythritol tetra-cis-9-octadecenoate
  1125. pentaerythritol tetraacrylate
  1126. pentaerythritol tetradodecanoate
  1127. pentaerythritol tetraoctadecanoate
  1128. pentaerythritol tetratetradecanoate
  1129. pentaethylbenzene
  1130. pentaethylgermanamine
  1131. pentaethylsilanamine
  1132. pentaethylstannanamine
  1133. Pentafluoro(1,1,2,2,2-pentafluoroethyl)-sulfane
  1134. pentafluoro(1,1,2,2-tetrafluoroethoxy)ethane
  1135. pentafluoro(1,2,2,2-tetrafluoro-1-((fluorosulfonyl)oxy)ethyl)sulfur
  1136. pentafluoro(1,2,2,2-tetrafluoroethyl)sulfur
  1137. pentafluoro(2,2,2-trifluoro-1-((fluorosulfonyl)oxy)-1-(trifluoromethyl)ethyl)sulfur
  1138. pentafluoro(2,2,2-trifluoro-1-(trifluoromethyl)ethyl)sulfur
  1139. pentafluoro(2,2,2-trifluoroethoxy)ethane
  1140. pentafluoro(2,2,2-trifluoroethyl)sulfur
  1141. pentafluoro(2,2,3,3,4,4,5-heptafluoro-5-oxopentaneperoxoato)sulfur
  1142. pentafluoro(3,3,3-trifluoro-1-propynyl)benzene
  1143. pentafluoro(3,3,4,4,5,5,5-heptafluoro-1-pentynyl)benzene
  1144. pentafluoro(difluoromethyl)benzene
  1145. pentafluoro(fluoromethyl)benzene
  1146. pentafluoro(pentafluoropropaneperoxoato)sulfur
  1147. pentafluoro(trifluoroethaneperoxoato)sulfur
  1148. pentafluoro(trifluoromethoxy)ethane
  1149. pentafluoro(trifluoromethyl)benzene
  1150. Pentafluoro(trifluoromethylsulfonato)sulfur
  1151. Pentafluoro-(1-bromo-2,2,2-trifluoroethyl)sulfur
  1152. pentafluoro-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluoro-1-nonynyl)benzene
  1153. pentafluoro-1-propanol
  1154. pentafluoro-2-propenylbenzene
  1155. pentafluoroacetamide
  1156. pentafluoroarsorane
  1157. pentafluorobenzaldehyde
  1158. pentafluorobenzene
  1159. pentafluorobenzoic acid
  1160. pentafluorobenzonitrile
  1161. pentafluorobenzoyl chloride
  1162. pentafluoroethane
  1163. pentafluoroethane mixt. with 1,1,1,2-tetrafluoroethane and 1,1,1-trifluoroethane
  1164. pentafluoroethane mixt. with 1,1,1-trifluoroethane
  1165. pentafluoroethane mixt. with difluoromethane
  1166. pentafluoroethane mixt. with difluoromethane and 1,1,1,2-tetrafluoroethane
  1167. pentafluoroethaneselenenyl chloride
  1168. pentafluoroethanesulfinyl chloride
  1169. pentafluoroethanesulfinyl fluoride
  1170. pentafluoroguanidine
  1171. pentafluoroiodobenzene
  1172. pentafluoroiodoethane
  1173. pentafluoroisocyanatoethane
  1174. pentafluoromethanamine
  1175. pentafluoromethoxyethane
  1176. pentafluoromethylbenzene
  1177. pentafluoronitrobenzene
  1178. pentafluoronitrosobenzene
  1179. pentafluorophenol
  1180. pentafluorophenyl 3,5-dinitrobenzoate
  1181. pentafluorophosphorane
  1182. pentafluoropropanoic acid
  1183. pentafluoropropanoic acid 3-methylphenyl ester
  1184. pentafluoropropanoic acid 4-methylphenyl ester
  1185. pentafluoropropanoic acid anhydride with hypofluorous acid
  1186. pentafluoropropanoic acid butyl ester
  1187. pentafluoropropanoic acid cyclohexyl ester
  1188. pentafluoropropanoic acid methyl ester
  1189. pentafluoropyridine
  1190. pentafluoroselenium hypofluorite
  1191. pentafluorosulfurfluorosulfonate
  1192. Pentafluorovinylsulfur
  1193. Pentafluoroxenonium tetrafluoroborate
  1194. Pentahafnium triantimony
  1195. pentahectane
  1196. pentaheptacontane
  1197. pentaheptacontylbenzene
  1198. pentaheptacontylcyclohexane
  1199. pentahexacontane
  1200. pentahexacontylbenzene
  1201. pentahexacontylcyclohexane
  1202. pentahydrogen (T-4)-bis(μ-oxotetraoxodiborato(4-))borate(5-) compd. with 1,3,5,7-tetraazatricyclo(3.3.1.1(3,7))decane hydrate (2:2:1)
  1203. pentahydroxycyclohexane
  1204. Pentailead(II) selen(IV) oxide
  1205. pentakis (biuret) tetrahydrate
  1206. Pentakis(dimethylamino)tantalum(V)
  1207. pentakis(dimethylammonium) di-my3-chloro-tri-my2-chlorohexachlorotricadmate(II)
  1208. pentakis(dimethylammonium) tricadmium undecachloride
  1209. pentakis(heptafluoropropyl)cyclopentaphosphane
  1210. pentakis(pentafluorethyl)cyclopentaphosphine
  1211. pentakis(sodium oxide) di(aluminium oxide) octacosahydrate(2.5Na2O*Al2O3*14H2O)
  1212. pentakis(trifluoromethyl)pentaphospholane
  1213. pentakis(trifluoromethyl)triphosphine
  1214. pentalead trigermanium undecaoxide
  1215. Pentalead(II) tellurium(IV) oxide
  1216. Pentalithium(I) dinitrosyl fluoride
  1217. pentamagnesium oxide magnesium chloride heptadecahydrate
  1218. pentamanganese aluminium sulfate 23-hydrate
  1219. pentamethyl(pentamethyldisilanyl)disiloxane
  1220. Pentamethyl-(2-phenylethyl)-1,3,5-triazine-2,4,6-triamine
  1221. pentamethylarsinous diamide
  1222. pentamethylbenzene
  1223. pentamethylbenzoic acid
  1224. Pentamethylcyclopentadienylrhodium(III) aniline
  1225. Pentamethylcyclopentadienylrhodium(III) p-bromoaniline
  1226. Pentamethylcyclopentadienylrhodium(III) p-chloroaniline
  1227. Pentamethylcyclopentadienylrhodium(III) p-methoxyaniline
  1228. Pentamethylcyclopentadienylrhodium(III) p-methylaniline
  1229. Pentamethyldiphosphonium chloride
  1230. pentamethyldisilanecarbonitrile
  1231. pentamethyldisilanyl isocyanate
  1232. pentamethyldisiloxanol acetate
  1233. pentamethylene glycoldimethyl ether
  1234. pentamethylphenol
  1235. pentamethylphenylcyclotrisiloxane
  1236. pentamethylphenyldisiloxane
  1237. pentamethylsilanamine
  1238. pentamethyltriphenyltrisiloxane
  1239. pentamine zinc sulfate
  1240. pentamminezinc iodide monohydrate
  1241. Pentan-2-yl 3,5-dinitrobenzoate
  1242. Pentan-2-yl 4-[({4-[(4-methylphenyl)carbonyloxy]phenyl}methylidene)amino]benzoate
  1243. Pentan-2-yl 4-[[(4-{[4-(acetyloxy)phenyl]carbonyloxy}phenyl)methylidene]amino]benzoate
  1244. Pentan-2-yl 4-[[4-(4-methoxybenzoyl)oxyphenyl]methylideneamino]benzoate
  1245. Pentan-3-one phenylhydrazone
  1246. Pentan-3-yl 4-[[4-(4-methoxybenzoyl)oxyphenyl]methylideneamino]benzoate
  1247. pentanal
  1248. pentanamide
  1249. pentane
  1250. Pentane-1,5-diyl bis(2-ethylbutanoate)
  1251. Pentane-1,5-diyl bis(2-ethylhexanoate)
  1252. Pentane-1,5-diyl bis(2-methylpentanoate)
  1253. Pentane-2,2,4,4-tetracarboxylic acid tetraethyl ester
  1254. Pentane-2,4-diyl dihexanoate
  1255. pentane-d12
  1256. pentanedial
  1257. pentanediamide
  1258. pentanedinitrile
  1259. pentanedioic acid
  1260. pentanedioic acid 2-(trimethylaminium)ethyl ester chloride
  1261. pentanedioic acid bis(1,1-dimethylethyl) ester
  1262. pentanedioic acid bis(1-(2-methylpropyl)-4-ethyloctyl) ester
  1263. pentanedioic acid bis(1-methylethyl) ester
  1264. pentanedioic acid bis(2-ethylhexyl) ester
  1265. Pentanedioic acid bis(2-methylpentyl) ester
  1266. Pentanedioic acid bis(3,5,5-trimethylhexyl) ester
  1267. pentanedioic acid bis(4-ethyl-1-methyloctyl) ester
  1268. pentanedioic acid dibutyl ester
  1269. pentanedioic acid dicyclohexyl ester
  1270. pentanedioic acid didecyl ester
  1271. pentanedioic acid didodecyl ester
  1272. pentanedioic acid diethenyl ester
  1273. pentanedioic acid diethyl ester
  1274. pentanedioic acid diheptadecyl ester
  1275. pentanedioic acid dihexadecyl ester
  1276. pentanedioic acid dimethyl ester
  1277. pentanedioic acid dinonyl ester
  1278. pentanedioic acid dioctadecyl ester
  1279. pentanedioic acid dipentadecyl ester
  1280. pentanedioic acid dipropyl ester
  1281. pentanedioic acid ditetradecyl ester
  1282. pentanedioic acid ditridecyl ester
  1283. pentanedioic acid diundecyl ester
  1284. pentanedioic acid ethenyl methyl ester
  1285. pentanedioic acid monoammonium salt
  1286. pentanedioic acid monoethyl ester
  1287. pentanedioic acid monomethyl ester
  1288. pentanedioic acid monooctadecyl ester
  1289. pentanedioyl dichloride
  1290. pentanenitrile
  1291. pentanickel dihydrogen tetraarsenate octahydrate
  1292. Pentanitrophenol
  1293. pentanoic acid
  1294. pentanoic acid 1,2,3-propanetriyl ester
  1295. pentanoic acid 1,2-ethanediyl ester
  1296. pentanoic acid 1-methylbutyl ester
  1297. pentanoic acid 1-methyldecyl ester
  1298. pentanoic acid 1-methylethyl ester
  1299. pentanoic acid 1-methylheptyl ester
  1300. pentanoic acid 1-methylhexyl ester
  1301. pentanoic acid 1-methylpentyl ester
  1302. pentanoic acid 1-methylpropyl ester
  1303. pentanoic acid 1-phenylethyl ester
  1304. pentanoic acid 2,2,2-trifluoroethyl ester
  1305. pentanoic acid 2,2-bis(((1-oxopentyl)oxy)methyl)-1,3-propanediyl ester
  1306. pentanoic acid 2,3-dihydroxypropyl ester
  1307. pentanoic acid 2-(acetyloxy)-1-(chloromethyl)ethyl ester
  1308. pentanoic acid 2-butyne-1,4-diyl ester
  1309. pentanoic acid 2-methyl-2-(((1-oxopentyl)oxy)methyl)-1,3-propanediyl ester
  1310. pentanoic acid 2-methylpropyl ester
  1311. pentanoic acid 2-propynyl ester
  1312. pentanoic acid 3-fluoropropyl ester
  1313. pentanoic acid 3-methylbutyl ester
  1314. pentanoic acid ammonium salt
  1315. pentanoic acid anhydride
  1316. pentanoic acid butyl ester
  1317. pentanoic acid calcium salt
  1318. pentanoic acid cyclohexyl ester
  1319. pentanoic acid d-1-methylpropyl ester
  1320. pentanoic acid ethyl ester
  1321. pentanoic acid heptadecyl ester
  1322. pentanoic acid heptyl ester
  1323. pentanoic acid hexyl ester
  1324. pentanoic acid lithium salt
  1325. pentanoic acid methyl ester
  1326. pentanoic acid monoester with 1,2,3-propanetriol
  1327. pentanoic acid octyl ester
  1328. pentanoic acid pentyl ester
  1329. pentanoic acid phenyl ester
  1330. pentanoic acid potassium salt
  1331. Pentanoic acid prop-2-enyl ester
  1332. pentanoic acid propyl ester
  1333. pentanoic acid samarium(3+) salt
  1334. pentanoic acid silver(1+) salt
  1335. pentanoic acid sodium salt
  1336. pentanoic acid thallium(1+) salt
  1337. pentanoic acid thiobis(2,1-ethanediyl) ester
  1338. pentanoic acid triethylsilyl ester
  1339. pentanoic acid trimethylsilyl ester
  1340. pentanoic acid undecyl ester
  1341. pentanoic acid zinc salt (2:1)
  1342. pentanoic acid, 4-[(4-methoxyphenyl)iminomethyl]phenyl ester
  1343. pentanoic acid, p-[(p-methoxybenzylidene)amino]phenyl ester
  1344. pentanonacontane
  1345. pentanonacontylbenzene
  1346. pentanonacontylcyclohexane
  1347. pentanoyl chloride
  1348. pentanoyl iodide
  1349. pentaoctacontane
  1350. pentaoctacontylbenzene
  1351. pentaoctacontylcyclohexane
  1352. pentapentacontane
  1353. pentapentacontylbenzene
  1354. pentapentacontylcyclohexane
  1355. pentaphenylantimony
  1356. pentapotassium dicerium(IV) fluoride
  1357. pentapotassium dihydroxy arsenate octahydrate
  1358. pentapotassium erbium(III)formate
  1359. pentapotassium pentanickel chloride nonahydrate
  1360. pentapotassium tetrahydrogen triphosphate monohydrate
  1361. Pentapotassium tetrazinc chloride trihydrate
  1362. Pentapotassium thorium nonafluoride
  1363. pentapotassium tricerium(IV) fluoride
  1364. pentapotassium trihydrogen sulfate
  1365. pentapotassium trihydrogen sulfate pentahydrate
  1366. pentapotassium trimanganese chloride
  1367. pentapotassium yttrium (III) formate
  1368. pentarubidium dineodymium nitrate dihydrate
  1369. pentarubidium dipraseodymium nitrate
  1370. pentarubidium fluoride bis(tungsten(VI)oxide) dihydrate
  1371. Pentarubidium fluoride tetra(acetic acid)
  1372. pentarubidium tetraneodymium nitrate
  1373. pentarubidium tetrapraseodymium nitrate
  1374. pentasilane
  1375. Pentasodium dibismut bromide dodecahydrate
  1376. pentasodium dizirconium fluoride
  1377. pentasodium lanthanum tetramolybdate
  1378. pentasodium perchlorate bis(hexamethylene tetramine) dihydrate
  1379. pentasodium sulfide thioantimonate monohydrate
  1380. pentasodium sulfide thioantimonite hexahydrate
  1381. pentasodium sulfide thioantimonite nonahydrate
  1382. pentasodium sulfide thioantimonite trihydrate
  1383. pentasodium trialuminium fluoride (Chiolite)
  1384. pentasodium tricerium(IV) fluoride
  1385. pentasodium trisilver tetrathiosulfate dihydrate
  1386. Pentasodium zinc chloride semihydrate
  1387. Pentasol
  1388. pentastrontium acetate penta(acetic acid) nonahydrate
  1389. pentastrontium dihydrogen tetraarsenate dihydrate
  1390. pentastrontium octanitrite dihydroxide octahydrate
  1391. pentatetracontane
  1392. pentatetracontylbenzene
  1393. pentatetracontylcyclohexane
  1394. pentathallium(I) thallium(III) sulfate
  1395. pentathionic acid diammonium salt
  1396. pentathionic acid dipotassium salt
  1397. pentathionic acid disodium salt
  1398. pentatriacontane
  1399. pentatriacontanoic acid
  1400. pentatriacontylbenzene
  1401. pentatriacontylcyclohexane
  1402. pentatricontafluoro-5,8,11,14,17,20,23,26-octakis(trifluoromethyl)-3,6,9,12,15,18,21,24,27-nonaoxatriacontane
  1403. pentazirconium tetrasilicide
  1404. pentlandite
  1405. Pentoxyverine citrate
  1406. pentyl 10-acetyloxydecanoate
  1407. pentyl 10-hydroxydecanoate
  1408. pentyl 2-hydroxyacetate
  1409. Pentyl 2-pentoxycarbonyloxypropanoate
  1410. Pentyl 3,5-dinitrobenzoate
  1411. Pentyl 3-chloropropanoate
  1412. Pentyl 3-phenylpropanoate
  1413. Pentyl 4-(4-{4-[4-(pentoxycarbonyl)phenyl]phenyl}phenyl)benzoate
  1414. Pentyl 4-({4-[2-(4-butoxy-2,3,5,6-tetrafluorophenyl)ethynyl]phenyl}methoxy)benzoate
  1415. Pentyl 4-({4-[2-(4-ethoxy-2,3,5,6-tetrafluorophenyl)ethynyl]phenyl}methoxy)benzoate
  1416. Pentyl 4-({4-[2-(4-methoxy-2,3,5,6-tetrafluorophenyl)ethynyl]phenyl}methoxy)benzoate
  1417. Pentyl 4-({4-[2-(4-propoxy-2,3,5,6-tetrafluorophenyl)ethynyl]phenyl}methoxy)benzoate
  1418. Pentyl 4-[(4-iodophenyl)methoxy]benzoate
  1419. Pentyl 4-[(4-{2-[4-(octyloxy)phenyl]ethynyl}phenyl)methoxy]benzoate
  1420. Pentyl 4-[({4-[(4-methylphenyl)carbonyloxy]phenyl}methylidene)amino]benzoate
  1421. Pentyl 4-[4-(4-chlorobenzoyloxy)benzylideneamino]benzoate
  1422. Pentyl 4-[[(4-{[4-(acetyloxy)phenyl]carbonyloxy}phenyl)methylidene]amino]benzoate
  1423. Pentyl 4-[[4-(4-methoxybenzoyl)oxyphenyl]methylideneamino]benzoate
  1424. Pentyl 4-[[4-[(4-pentoxycarbonylphenyl)iminomethyl]phenyl]methylideneamino]benzoate
  1425. Pentyl 4-[[4-[2-(2,3,5,6-tetrafluoro-4-heptoxyphenyl)ethynyl]phenyl]methoxy]benzoate
  1426. Pentyl 4-[[4-[2-(2,3,5,6-tetrafluoro-4-hexoxyphenyl)ethynyl]phenyl]methoxy]benzoate
  1427. Pentyl 4-[[4-[2-(2,3,5,6-tetrafluoro-4-nonoxyphenyl)ethynyl]phenyl]methoxy]benzoate
  1428. Pentyl 4-[[4-[2-(2,3,5,6-tetrafluoro-4-octoxyphenyl)ethynyl]phenyl]methoxy]benzoate
  1429. Pentyl 4-[[4-[2-(2,3,5,6-tetrafluoro-4-pentoxyphenyl)ethynyl]phenyl]methoxy]benzoate
  1430. pentyl dipentoxy phosphine
  1431. pentyl N,N-diphenylcarbamate
  1432. Pentyl N-butylcarbamate
  1433. Pentyl N-pentylcarbamate
  1434. Pentyl prop-2-ene-1-sulfinate
  1435. pentyl(nitrato-κO)mercury
  1436. pentyl-tris-pentafluoropropanoyloxy-silane
  1437. Pentylamine trimethylborane
  1438. pentylarsonous dichloride
  1439. pentylbenzene
  1440. Pentylboronic acid diethanolamine ester
  1441. pentylcyclohexane
  1442. pentylcyclopentane
  1443. pentylcyclopropane
  1444. pentylnaphthalene
  1445. pentyloxirane
  1446. pentyloxyacetic acid pentyl ester
  1447. pentylphosphonic acid dipropyl ester
  1448. pentylphosphonous dichloride
  1449. pentylpropanedinitrile
  1450. pentylpropanedioic acid
  1451. pentylpropanedioic acid dibutyl ester
  1452. pentylpropanedioic acid diethyl ester
  1453. pentylpropanedioic acid dimethyl ester
  1454. pentylpropanedioic acid dipropyl ester
  1455. pentylsilane
  1456. Pentylurea
  1457. pentylzinc
  1458. perboric acid (HBO(O2)) sodium salt
  1459. perboric acid (HBO(O2)) sodium salt tetrahydrate
  1460. perbromic acid ammonium salt
  1461. perbromic acid potassium salt
  1462. perbromyl fluoride
  1463. perchlorate
  1464. perchloric acid
  1465. perchloric acid 1,2,2-trichloro-1,2-difluoroethyl ester
  1466. perchloric acid 1,2-dichloro-1,2,2-trifluoroethyl ester
  1467. perchloric acid 2-bromo-1,1,2,3,3,3-hexafluoropropyl ester
  1468. perchloric acid 2-bromo-1-chloro-1,2,2-trifluoroethyl ester
  1469. perchloric acid 2-chloro-1,1,2,2-tetrafluoroethyl ester
  1470. perchloric acid 2-chloro-1,1,2,3,3,3-hexafluoropropyl ester
  1471. perchloric acid aluminum salt
  1472. perchloric acid ammonium salt
  1473. perchloric acid barium salt
  1474. perchloric acid beryllium salt
  1475. perchloric acid cadmium salt
  1476. perchloric acid cadmium salt dihydrate
  1477. perchloric acid cadmium salt hexahydrate
  1478. perchloric acid calcium salt
  1479. perchloric acid calcium salt tetrahydrate
  1480. perchloric acid cerium(3+) salt
  1481. perchloric acid cesium salt
  1482. perchloric acid chromium(3+) salt nonahydrate
  1483. perchloric acid cobalt(2+) salt
  1484. perchloric acid cobalt(2+) salt hexahydrate
  1485. perchloric acid copper(2+) salt
  1486. perchloric acid copper(2+) salt hexahydrate
  1487. Perchloric acid diacetamide
  1488. perchloric acid dihydrate
  1489. perchloric acid dysprosium(3+) salt
  1490. perchloric acid erbium(3+) salt
  1491. perchloric acid europium(3+) salt
  1492. perchloric acid gadolinium(3+) salt
  1493. perchloric acid gallium(3+) salt
  1494. perchloric acid hexahydrate
  1495. perchloric acid holmium(3+) salt
  1496. perchloric acid indium(3+) salt
  1497. perchloric acid iron(2+) salt
  1498. perchloric acid iron(3+) salt
  1499. perchloric acid lanthanum(3+) 1H-inidazolium salt (7:1:4) compd. with 1H-imidazolium L-glutamate (2:1) (1:1) tetrahydrate
  1500. perchloric acid lanthanum(3+) salt
  1501. perchloric acid lanthanum(3+) salt octahydrate
  1502. perchloric acid lead(2+) salt
  1503. perchloric acid lithium salt
  1504. perchloric acid lithium salt compd. with N,N-dimethylformamide (1:2)
  1505. perchloric acid lithium salt dihydrate
  1506. perchloric acid lithium salt monohydrate
  1507. perchloric acid lithium salt trihydrate
  1508. perchloric acid lutetium(3+) salt
  1509. perchloric acid magnesium salt
  1510. perchloric acid magnesium salt hexahydrate
  1511. perchloric acid manganese(2+) salt
  1512. perchloric acid mercury(2+) salt
  1513. Perchloric acid monoacetamide
  1514. perchloric acid monohydrate
  1515. perchloric acid neodymium(3+) salt
  1516. perchloric acid nickel(2+) salt
  1517. perchloric acid nickel(2+) salt hexahydrate
  1518. perchloric acid pentafluoroethyl ester
  1519. perchloric acid potassium salt
  1520. perchloric acid potassium salt
  1521. perchloric acid praseodymium(3+) salt
  1522. perchloric acid rubidium salt
  1523. perchloric acid samarium(3+) salt
  1524. perchloric acid scandium(3+) salt
  1525. perchloric acid silver(1+) salt
  1526. perchloric acid silver(1+) salt compd. with benzene (1:1)
  1527. perchloric acid silver(1+) salt monohydrate
  1528. perchloric acid sodium salt
  1529. perchloric acid strontium salt
  1530. perchloric acid strontium salt trihydrate
  1531. perchloric acid terbium(3+) salt
  1532. perchloric acid tetrahydrate
  1533. perchloric acid thallium(1+) salt
  1534. perchloric acid thulium(3+) salt
  1535. perchloric acid trifluoromethyl ester
  1536. perchloric acid trihydrate
  1537. perchloric acid uranium(4+) salt
  1538. perchloric acid ytterbium(3+) salt
  1539. perchloric acid ytterbium(3+) salt octahydrate
  1540. perchloric acid yttrium(3+) salt
  1541. perchloric acid zinc salt
  1542. perchloryl fluoride ((ClO3)F)
  1543. perdeutero-o-xylene
  1544. perdeuterodecane
  1545. Perfluidone
  1546. Perfluoro(1,2,2,6,6-pentamethylpiperidine)
  1547. Perfluoro(1,2-di-tert-butoxyethane)
  1548. Perfluoro(2,2,5-trimethyltetrahydrofuran)
  1549. Perfluoro(2,2,5-trimethyltetrahydropyran)
  1550. perfluoro(2,3-dichloro-1-methylazetidine)
  1551. perfluoro(4,5-dichloro-2-methyl-3,4,5,6-tetrahydro-2H-1,2-oxazine)
  1552. Perfluoro(cyclohexyl neopentyl ether)
  1553. Perfluoro-(1,3-diethoxy-2,2-dimethylpropane)
  1554. Perfluoro-(pentaerythrityltetramethyl ether)
  1555. Perfluoro-1,3-diethoxypropane
  1556. Perfluoro-1,4-diethoxybutane
  1557. perfluoro-1-(2-cyclobutylcyclobutyl)cyclobut-1-ene
  1558. Perfluoro-1-aza-4-methylcyclohexene-1
  1559. Perfluoro-2,4,6,8,10,13,15,17,19,21-decaoxy-n-docosane
  1560. Perfluoro-2,4,6,8,11,13,15,17-octaoxy-n-octadecane
  1561. Perfluoro-2,4,6,9,11,13-hexaoxy-n-tetradecane
  1562. perfluoro-2-(tetrafluoro-2-nitroethyl)-1,2-oxazetidine
  1563. perfluoro-2-methyl-3-methylene-1,2-oxazetidine
  1564. perfluoro-2-methyl-4-methylimino-1,2-oxazetidine
  1565. Perfluoro-5,8,11,14-tetramethyl-3,6,9,12,15-oxaoctadecane
  1566. perfluoro-di-n-hexylether
  1567. perfluorobutyl phosphonic acid
  1568. perfluorobutyl sulfonic acid
  1569. Perfluorodiglyme
  1570. Perfluorodimethylnaphthalane
  1571. perfluorodioxecan
  1572. perfluoroheptan-1-ol acrylate
  1573. Perfluoropentaethylene glycol di(difluoromethyl) ether
  1574. perfluoropolyether
  1575. perfluoropolyether oil
  1576. Perfluorotetraethylene glycol di(difluoromethyl) ether
  1577. Perfluorotetraglyme
  1578. Perfluorotriethyleneglycol di(difluoromethyl)ether
  1579. Perfluorotriglyme
  1580. Perfluorovinyl mercury bromide
  1581. Perfluorovinyl mercury chloride
  1582. perfluorovinylsulfur pentafluoride
  1583. perhydro(bisxylyltoluol)
  1584. perhydrodecacene
  1585. perhydrodibenzyltoluene
  1586. perhydroheptacene
  1587. perhydrohexacene
  1588. perhydrononacene
  1589. perhydrooctacene
  1590. perhydropentacene
  1591. Perhydrophenalene
  1592. perilla oils
  1593. periodate (IO4(1-))
  1594. periodic acid (H3IO5) trisilver(1+) salt
  1595. periodic acid (H4I2O9) dipotassium salt
  1596. periodic acid (H4I2O9) tetrapotassium salt nonahydrate
  1597. periodic acid (H5IO6)
  1598. periodic acid (H5IO6) compd. with nitrourea (1:2)
  1599. periodic acid (H5IO6) diammonium salt
  1600. periodic acid (H5IO6) dipotassium salt
  1601. periodic acid (H5IO6) disilver(1+) salt
  1602. periodic acid (H5IO6) pentalithium salt
  1603. periodic acid (HIO4)
  1604. periodic acid (HIO4) ammonium salt
  1605. periodic acid (HIO4) cesium salt
  1606. periodic acid (HIO4) compd. with pyridine (1:1)
  1607. periodic acid (HIO4) potassium salt
  1608. periodic acid (HIO4) rubidium salt
  1609. periodic acid (HIO4) sodium salt
  1610. permanganic acid (HMnO4) cesium salt
  1611. permanganic acid (HMnO4) lithium salt
  1612. permanganic acid (HMnO4) potassium salt
  1613. permanganic acid (HMnO4) rubidium salt
  1614. permanganic acid (HMnO4) silver(1+) salt
  1615. permanganic acid (HMnO4) sodium salt
  1616. peroxydicarbonic acid dicyclohexyl ester
  1617. peroxydicarbonic difluoride
  1618. peroxydisulfuric acid (((HO)S(O)2)2O2) barium salt (1:1)
  1619. peroxydisulfuric acid (((HO)S(O)2)2O2) dicesium salt
  1620. peroxydisulfuric acid (((HO)S(O)2)2O2) dirubidium salt
  1621. peroxydisulfuryl difluoride
  1622. peroxyhypochlorous acid trifluoromethyl ester
  1623. peroxyhypofluorous acid trifluoromethyl ester
  1624. peroxymonosulfuric acid bis(trifluoromethyl) ester
  1625. peroxymonosulfuric acid monopotassium salt
  1626. peroxynitric acid trifluoromethyl ester
  1627. peroxyphosphorodifluoric acid trifluormethyl ester
  1628. perylene
  1629. perylene-D12
  1630. Petalite
  1631. petroleum ether
  1632. petroleum ether
  1633. petroleum products from fluid catalytic cracking (FCC)
  1634. PFMS 6
  1635. PFMS 6
  1636. PFMS-4
  1637. phen-d5-ol
  1638. phenaleno[1,9-gh]quinoline
  1639. Phenanthren-3-yl acetate
  1640. phenanthrene
  1641. phenanthrene
  1642. phenanthrene compd. with 2,4,6-trinitrophenol (1:1)
  1643. Phenanthrene-1-carboxylic acid
  1644. Phenanthrene-1-carboxylic acid methyl ester
  1645. phenanthrene-2-carboxylic acid
  1646. Phenanthrene-9-carbaldehyde
  1647. phenanthrene-d10
  1648. phenanthridine
  1649. Phenanthridine cobalt(II) dichloride
  1650. Phenanthridine copper(II) dichloride
  1651. Phenanthridine nickel(II) dibromide
  1652. Phenanthridine zinc(II) dichloride
  1653. phenanthro(1.10.9.8-opqra)perylene
  1654. phenanthroline
  1655. phenanthro[4,5-bcd]thiophene
  1656. phenazine
  1657. phenazine 5,10-dioxide
  1658. phenazine 5-oxide
  1659. Phenethyl thioglycolic acid
  1660. Phenformin
  1661. phenol
  1662. phenol barium salt
  1663. phenol calcium salt
  1664. phenol lithium salt
  1665. phenol magnesium salt
  1666. phenol potassium salt
  1667. phenol rubidium salt
  1668. phenol sodium salt
  1669. phenol strontium salt
  1670. phenol-d
  1671. phenol-d6
  1672. phenoxathiin
  1673. phenoxyacetamide
  1674. phenoxyacetic acid
  1675. phenoxyacetic acid ethyl ester
  1676. phenoxyacetic acid methyl ester
  1677. Phenoxyacetone
  1678. phenoxyethyne
  1679. phenoxypropanedioic acid
  1680. Phenyl (2,3,4,5,6-pentachlorophenyl) oxalate
  1681. Phenyl (2-chloroethoxy)acetate
  1682. phenyl 2-methoxypiperidine-1-carboxylate
  1683. phenyl 2-methoxypyrrolidine-1-carboxylate
  1684. phenyl 3-phenyl-2-[(2,2,2-trifluoroacetyl)amino]propanoate
  1685. Phenyl 4-(4-phenoxycarbonylphenyl)benzoate
  1686. Phenyl 4-({4-[(phenylmethylidene)amino]phenyl}carbonyloxy)benzoate
  1687. Phenyl 4-chloro-3-[(phenoxycarbonyl)oxy]phenyl carbonate
  1688. Phenyl 4-[(4-butoxyphenyl)methylideneamino]benzoate
  1689. Phenyl 4-[(4-decoxyphenyl)methylideneamino]benzoate
  1690. Phenyl 4-[(4-ethoxyphenyl)methylideneamino]benzoate
  1691. Phenyl 4-[(4-heptoxyphenyl)methylideneamino]benzoate
  1692. Phenyl 4-[(4-hexoxyphenyl)methylideneamino]benzoate
  1693. Phenyl 4-[(4-methoxyphenyl)methylideneamino]benzoate
  1694. Phenyl 4-[(4-octoxyphenyl)methylideneamino]benzoate
  1695. Phenyl 4-[(4-pentoxyphenyl)methylideneamino]benzoate
  1696. Phenyl 4-[(4-phenylphenyl)methylideneamino]benzoate
  1697. Phenyl 4-[(4-propoxyphenyl)methylideneamino]benzoate
  1698. Phenyl 4-[N-(4-cyanophenyl)carboximidoyl]benzoate
  1699. Phenyl 4-[N-(4-ethoxyphenyl)carboximidoyl]benzoate
  1700. Phenyl 4-[N-(4-methoxyphenyl)carboximidoyl]benzoate
  1701. Phenyl 4-[N-(4-nitrophenyl)carboximidoyl]benzoate
  1702. Phenyl 4-[[(4-cyanophenyl)methylidene]amino]benzoate
  1703. Phenyl 4-[[(4-nitrophenyl)methylidene]amino]benzoate
  1704. Phenyl 4-[[N-(4-phenylphenyl)imino]methyl]benzoate
  1705. Phenyl 4-[[[4-(benzoyloxy)phenyl]imino]methyl]benzoate
  1706. Phenyl 4-[[[4-(benzoyloxy)phenyl]methylidene]amino]benzoate
  1707. Phenyl 4-[[[4-(phenoxycarbonyl)phenyl]imino]methyl]benzoate
  1708. Phenyl 4-[[[4-phenyldiazenylphenyl]imino]methyl]benzoate
  1709. phenyl 6-hydroxyhexanoate
  1710. phenyl acrylate
  1711. phenyl benzenesulfonate
  1712. Phenyl cholest-5-ene-3β-carboxylate
  1713. phenyl cyanoformate
  1714. Phenyl diethylcarbamate
  1715. Phenyl dimethyl N,N-dimethylamino silane
  1716. phenyl ester 2-phenoxybenzoic acid
  1717. phenyl hex-5-enoate
  1718. Phenyl mercuric acetate 2,2,2-nitrilotrisethanol
  1719. Phenyl methacrylate
  1720. phenyl N,N'-bis(p-methoxyphenyl)phosphorodiamidite
  1721. phenyl N,N-di-sec-butylcarbamate
  1722. phenyl N,N-diisobutylcarbamate
  1723. Phenyl N-(1-hydroxy-2-methylpropan-2-yl)carbamate
  1724. phenyl N-(2,4-dimethoxyphenyl)carbamate
  1725. Phenyl N-(2-(2-methoxyethoxy)ethyl)carbamate
  1726. phenyl N-(2-aminopyridin-3-yl)carbamate hydrochloride
  1727. Phenyl N-(2-hydroxyethyl)carbamate
  1728. Phenyl N-(2-methoxyethyl)-N-methylcarbamate
  1729. Phenyl N-(2-methoxyethyl)carbamate
  1730. phenyl N-(3,4,5-trimethoxyphenyl)carbamate
  1731. Phenyl N-(3-hydroxypropyl)carbamate
  1732. phenyl N-(4-hydroxyphenyl)carbamate
  1733. phenyl N-(4-methoxyphenyl)carbamate
  1734. phenyl N-(4-methylsulfonylphenyl)carbamate
  1735. phenyl N-butyl-N-phenylcarbamate
  1736. phenyl N-ethyl-N-phenylcarbamate
  1737. phenyl N-isopentyl-N-phenylcarbamate
  1738. phenyl N-isopropyl-N-phenylcarbamate
  1739. phenyl N-propyl-N-phenylcarbamate
  1740. phenyl N-[(2-dimethylamino)phenyl]carbamate hydrochloride
  1741. phenyl N-[(4-diethylamino)-2-methylphenyl]carbamate
  1742. phenyl N-[(4-diethylamino)-2-methylphenyl]carbamate hydrochloride
  1743. phenyl N-[(4-diethylamino)phenyl]carbamate
  1744. phenyl N-[(4-dimethylamino)phenyl]carbamate
  1745. phenyl N-[(4-methylsulfanyl)phenyl]carbamate
  1746. phenyl N-[2-(phenylthiolcarbonato)ethyl]carbamate
  1747. phenyl N-[3-(dimethylamino)propyl]-N-phenylcarbamate hydrochloride
  1748. phenyl N-[4-(phenoxycarbonylamino)phenyl]carbamate
  1749. Phenyl P,P-dibutyl phosponoundecanoate
  1750. Phenyl P,P-diethylphosphonostearate
  1751. Phenyl phosphorodifluoridate
  1752. Phenyl piperidine-1-carboxylate
  1753. phenyl pyridin-2-ylcarbamate
  1754. phenyl pyridin-3-ylcarbamate
  1755. phenyl pyridin-3-ylcarbamate hydrochloride
  1756. phenyl pyridin-4-ylcarbamate
  1757. phenyl pyrrolidine-1-carboxylate
  1758. Phenyl quinolin-8-yl carbonate
  1759. phenyl(2,4,5-trimethylphenyl)methanone
  1760. phenyl(2,4,6-trimethylphenyl)methanone
  1761. phenyl(2,4,6-tris(1-methylethyl)phenyl)methanone
  1762. phenyl(2-pyridinyl)methanone 2-quinolynylhydrazone
  1763. phenyl(2-pyridinyl)methanone 6-chloro-4-pyridinylhydrazone
  1764. phenyl(2-pyridyl)acetamide
  1765. Phenyl(dipropyl)arsane
  1766. Phenyl(heptafluoropropyl) sulfide
  1767. phenyl(phenyl(phenylhydrazono)methyl)diazene
  1768. Phenyl(pyridin-4-yl)methanol
  1769. Phenyl(pyridin-4-yl)methyl 4,5-dichloroisothiazole-3-carboxylate
  1770. Phenyl(pyridin-4-yl)methyl 5-(p-tolyl)isoxazole-3-carboxylate
  1771. Phenyl(pyridin-4-yl)methyl 5-phenylisoxazole-3-carboxylate
  1772. Phenyl-(2-phenylcyclopropyl)methanone
  1773. Phenyl-(4,4,9,9-tetraphenyl-3,8-dioxa-6-azatricyclo[5.2.0.02,5]nonan-6-yl)methanone
  1774. phenyl-18-crown-6
  1775. phenyl-2-pyridinylmethanone
  1776. phenyl-4-pyridinylmethanone
  1777. Phenyl-acetaldehyde phenylhydrazone
  1778. Phenyl-carbamic acid isobutyl ester
  1779. phenyl-piperidin-1-ylmethanone
  1780. phenyl-piperidin-2-ylmethanol
  1781. phenyl-pyridin-2-ylmethanol
  1782. phenyl-pyridin-3-ylmethanone
  1783. phenyl-pyrrolidin-1-ylmethanone
  1784. Phenyl-trimethylsilanyloxy-acetonitrile
  1785. phenyl-tripropoxysilane
  1786. phenyl-tris-difluoroacetoxy-silane
  1787. phenyl-tris-heptafluorobutanoyloxy-silane
  1788. phenyl-tris-pentafluoropropanoyloxy-silane
  1789. phenyl-tris-trifluoroacetoxy-silane
  1790. Phenyl-[4-[6-(4-phenyldiazenylphenoxy)hexoxy]phenyl]diazene
  1791. Phenyl-[4-[6-[4-[(4-propylphenyl)diazenyl]phenoxy]hexoxy]phenyl]diazene
  1792. Phenylacetaldehyde oxime
  1793. phenylalanine 2-amino-1-oxopropyl ester
  1794. phenylalanine 2-amino-3-methyl-1-oxobutyl ester
  1795. Phenylalanine hydrobromide
  1796. Phenylalanine hydrochloride
  1797. Phenylalanine hydrofluoride
  1798. phenylamino-propylmercaptane
  1799. Phenylammonium oxalate
  1800. Phenylarsenic tetrafluoride
  1801. phenylarsonic acid
  1802. phenylarsonous dichloride
  1803. Phenylazanium sulfate
  1804. phenylazanium; 2,4,6-trinitrophenolate
  1805. phenylboronic acid
  1806. phenylboronic acid bis(1,1-dimethylpropyl) ester
  1807. phenylboronic acid bis(1-methylethyl) ester
  1808. phenylboronic acid bis(1-methylheptyl) ester
  1809. phenylboronic acid bis(1-methylpropyl) ester
  1810. phenylboronic acid bis(2-chloroethyl) ester
  1811. phenylboronic acid bis(2-methylphenyl) ester
  1812. phenylboronic acid bis(2-methylpropyl) ester
  1813. phenylboronic acid bis(phenylmethyl) ester
  1814. phenylboronic acid dibutyl ester
  1815. phenylboronic acid diethyl ester
  1816. phenylboronic acid dimethyl ester
  1817. phenylboronic acid dioctyl ester
  1818. phenylboronic acid dipropyl ester
  1819. Phenylboronic acid N-butyldiethanolamine ester
  1820. Phenylboronic acid pinacol ester
  1821. phenylbutanedioic acid
  1822. phenylcarbamic acid 1-methylethyl ester
  1823. phenylcarbamic acid 2-methylcyclohexyl ester
  1824. phenylcarbamic acid 2-phenylethyl ester
  1825. phenylcarbamic acid butyl ester
  1826. phenylcarbamic acid ethyl ester
  1827. phenylcarbamic acid hexyl ester
  1828. phenylcarbamic acid methyl ester
  1829. phenylcarbamic acid nonyl ester
  1830. phenylcarbamic acid octadecyl ester
  1831. phenylcarbamic acid pentyl ester
  1832. phenylcarbamic acid phenylmethyl ester
  1833. phenylcarbamic acid propyl ester
  1834. phenylcarbamic chloride
  1835. phenylcarbamimidothioic acid 1,4,5,6-tetrahydro-1-(4-methylphenyl)-4,6-dioxo-2-pyrimidinyl ester monohydrochloride
  1836. phenylcarbamimidothioic acid 1-(4-chlorophenyl)-1,4,5,6-tetrahydro-4,6-dioxo-2-pyrimidinyl ester monohydrochloride
  1837. phenylcarbonimidic dichloride
  1838. phenyldiazenecarboxaldehyde phenylhydrazone
  1839. Phenyldifluoroarsine
  1840. Phenyldithiopyrylmethane
  1841. phenylenebis[2-(chlorodimethylsilyl)ethan]
  1842. phenylethanedithioamide
  1843. phenylethanolamine
  1844. phenylhydrazine
  1845. phenylhydrazine monohydrochloride
  1846. Phenylhydrazonoterephthalilydenaminophthalimide
  1847. phenylimidosulfurous difluoride
  1848. Phenylmalonamic acid
  1849. phenylmercuric nitrate
  1850. Phenylmercuric triethanolammonium lactate
  1851. Phenylmercury butyrate
  1852. Phenylmercury methacrylate
  1853. Phenylmercury propionate
  1854. phenylmercury(1+) acetate
  1855. Phenylmethanaminium 2-((4,5-dibromo-1-(thietan-3-yl)-1H-imidazol-2-yl)sulfanyl)acetate
  1856. phenylmethanediol diacetate
  1857. Phenylmethanediol dipropanoate
  1858. Phenylmethanesulfinamide
  1859. Phenylmethanesulfonamide
  1860. phenylmethyl
  1861. phenylmethyl 2-methoxypiperidine-1-carboxylate
  1862. phenylmethyl 3,5-dinitrobenzoate
  1863. phenylmethylsulfanylmethylsulfanylmethylbenzene
  1864. phenylmethylsulfinylmethylsulfinylmethylbenzene
  1865. Phenylnorbornane
  1866. phenyloxirane
  1867. phenylphosphinic acid
  1868. phenylphosphonic acid
  1869. phenylphosphonic acid 4-bromo-2,5-dichlorophenyl methyl ester
  1870. phenylphosphonic acid diethyl ester
  1871. phenylphosphonic dichloride
  1872. Phenylphosphonic difluoride
  1873. phenylphosphonochloridothioic acid, O-phenyl ester
  1874. phenylphosphonothioic acid O-(4-bromo-2,5-dichlorophenyl) O-methyl ester
  1875. phenylphosphonothioic acid O-ethyl O-(4-nitrophenyl) ester
  1876. phenylphosphonothioic dichloride
  1877. phenylphosphonous acid diethyl ester
  1878. phenylphosphonous dichloride
  1879. phenylpropanal
  1880. Phenylseleninylheptafluoropropane
  1881. phenylsilane
  1882. phenylsilanetriol triacetate
  1883. phenylsulfonyl 2,2,2-trifluoroacetate
  1884. phenylsulfonylacetic acid methyl ester
  1885. phenylsulfur pentafluoride
  1886. phenylthiourea
  1887. phenyltri-2-propenylsilane
  1888. Phenyltris(dimethylsiloxy)silane
  1889. phenylurea
  1890. Phloracetophenone
  1891. phoshoric acid O,O-diethyl O-(2,6-dichloro-4-(methylsulfonyl)phenyl) ester
  1892. phoshoric acid O,O-diethyl O-(2,6-dichloro-4-(methylthio)phenyl) ester
  1893. phoshoric acid O,O-diethyl O-(2-chloro-4-(methylthio)phenyl) ester
  1894. phoshoric acid O,O-diethyl O-(2-methyl-4-(methylsulfonyl)phenyl) ester
  1895. phoshoric acid O,O-diethyl O-(2-nitro-4-(methylsulfonyl)phenyl) ester
  1896. phoshoric acid O,O-diethyl O-(3-chloro-4-(methylthio)phenyl) ester
  1897. phoshoric acid O,O-diethyl O-(3-methyl-4-(methylthio)phenyl) ester
  1898. phoshoric acid O-(2-nitro-4-(methylthio)phenyl) ester
  1899. phosphane (red)
  1900. phosphane (red)
  1901. phosphane (red)
  1902. phosphane (red)
  1903. phosphanylidynemanganese
  1904. phosphate
  1905. phosphenothious fluoride
  1906. phosphenyl phenylhydrazone
  1907. phosphine
  1908. phosphine-d3
  1909. phosphinic acid
  1910. phosphinic acid barium salt (2:1)
  1911. phosphinic acid calcium salt
  1912. phosphinic acid manganese(2+) salt (2:1)
  1913. phosphinic acid monoammonium salt
  1914. phosphinic acid monopotassium salt
  1915. phosphinic acid scandium(3+) salt (3:1)
  1916. phosphinic acid sodium salt
  1917. phosphinic acid thallium(1+) salt
  1918. phosphinidene
  1919. phosphino
  1920. phospholane
  1921. Phosphomolybdic acid hexahydrate
  1922. phosphonato phosphate; rubidium(+1) cation
  1923. phosphonic acid barium salt (2:1)
  1924. phosphonic acid bis(1-methylethyl) ester
  1925. phosphonic acid bis(2-(heptyloxy)ethyl) ester
  1926. phosphonic acid bis(2-(hexyloxy)ethyl) ester
  1927. phosphonic acid bis(2-butoxyethyl) ester
  1928. phosphonic acid bis(2-ethoxyethyl) ester
  1929. phosphonic acid bis(2-methylpropyl) ester
  1930. phosphonic acid bis(2-propoxyethyl) ester
  1931. phosphonic acid calcium salt (1:1)
  1932. phosphonic acid calcium salt (2:1)
  1933. phosphonic acid dibutyl ester
  1934. phosphonic acid diethyl ester
  1935. phosphonic acid diheptyl ester
  1936. phosphonic acid dihexyl ester
  1937. phosphonic acid dilithium salt
  1938. phosphonic acid dimethyl ester
  1939. phosphonic acid dimethyl propyl ester
  1940. phosphonic acid dioctyl ester
  1941. phosphonic acid dipentyl ester
  1942. phosphonic acid dipotassium salt
  1943. phosphonic acid disodium salt
  1944. phosphonic acid magnesium salt (1:1)
  1945. phosphonic acid magnesium salt (2:1)
  1946. phosphonic acid monolithium salt
  1947. phosphonic acid strontium salt (1:1)
  1948. phosphonic acid strontium salt (2:1)
  1949. phosphonic acid thallium(1+) salt (1:2)
  1950. Phosphonic difluoride
  1951. phosphonium bromide ((PH4)Br)
  1952. phosphonium chloride ((PH4)Cl)
  1953. phosphonium iodide ((PH4)I)
  1954. Phosphonothioic difluoride
  1955. Phosphoramidic acid, N,N'-1,2-ethanediylbis-P,P,P',P'-tetrakis(2,6-dimethyl)phenyl ester
  1956. Phosphoramidic acid, N,N'-dimethyl-N,N'-1,2-ethanediylbis-P,P,P',P'-tetrakis(2,6-dimethyl)phenyl ester
  1957. phosphoramidic acid, N-(phenylmethyl)-, diphenyl ester
  1958. phosphoramidothioic acid O,S-diethyl ester
  1959. phosphoramidothioic acid O,S-dimethyl ester
  1960. phosphoramidothioic acid O,S-dipropyl ester
  1961. phosphoric acid
  1962. phosphoric acid (2-ethylhexyl) methyl 3,6-dioxa-1,4,7-trimethyl-1,8-octanediyl ester (2:2:2:1)
  1963. phosphoric acid (2-ethylhexyl) methyl 3,6-dioxa-1,8-octanediyl ester (2:2:2:1)
  1964. phosphoric acid (Z)-2-chloro-1-(2,4,5-trichlorophenyl)ethenyl dimethyl ester
  1965. phosphoric acid 1,4-butanediyl tetrabutyl ester
  1966. phosphoric acid 1,4-phenylene tetrabutyl ester
  1967. phosphoric acid 2,2-dichloroethenyl dimethyl ester
  1968. phosphoric acid 2-chloro-1-(2,4-dichlorophenyl)ethenyl diethyl ester
  1969. phosphoric acid 2-chloro-3-(diethylamino)-1-methyl-3-oxo-1-propenyl dimethyl ester
  1970. phosphoric acid 2-ethylhexyl diphenyl ester
  1971. phosphoric acid 4-(1-methylethyl)phenyl diphenyl ester
  1972. phosphoric acid 4-(methylthio)phenyl dipropyl ester
  1973. phosphoric acid aluminum salt (1:1)
  1974. phosphoric acid ammonium magnesium salt (1:1:1) monohydrate
  1975. phosphoric acid ammonium salt (2:3)
  1976. phosphoric acid barium zirconium(4+) salt (2:1:1)
  1977. phosphoric acid barium zirconium(4+) salt (6:1:4)
  1978. phosphoric acid bis(2-ethylhexyl) ester
  1979. phosphoric acid bis(2-methyl-5-(1-methylethyl)phenyl) 2-methylphenyl ester
  1980. phosphoric acid bis(2-methyl-5-(1-methylethyl)phenyl)-6-chloro(1,1'-biphenyl)-2-yl ester
  1981. phosphoric acid butyl bis(methylphenyl) ester
  1982. phosphoric acid butyl diethyl ester
  1983. phosphoric acid butyl diphenyl ester
  1984. phosphoric acid calcium salt (1:1)
  1985. phosphoric acid calcium salt (2:1)
  1986. phosphoric acid calcium salt (2:1) monohydate
  1987. phosphoric acid calcium salt (2:3)
  1988. phosphoric acid cerium(3+) salt (1:1)
  1989. phosphoric acid cerium(4+) salt (4:3)
  1990. phosphoric acid cesium magnesium salt (1:1:1)
  1991. phosphoric acid cesium zirconium(4+) salt (3:1:2)
  1992. phosphoric acid cobalt(2+) salt (2:3)
  1993. phosphoric acid copper(1+) salt (1:2)
  1994. phosphoric acid copper(2+) salt (1:1)
  1995. phosphoric acid copper(2+) salt (2:3)
  1996. phosphoric acid copper(2+) salt (2:3) trihydrate
  1997. phosphoric acid decyl diethyl ester
  1998. phosphoric acid diammonium salt
  1999. phosphoric acid dibutyl ester
  2000. phosphoric acid dibutyl ester cerium(3+) salt
  2001. phosphoric acid dibutyl ester gadolinium(3+) salt (3:1)
  2002. phosphoric acid dibutyl ester holmium(3+) salt (3:1)
  2003. phosphoric acid dibutyl ester lanthanum(3+) salt (3:1)
  2004. phosphoric acid dibutyl ester neodymium(3+) salt (3:1)
  2005. phosphoric acid dibutyl ester praseodymium(3+) salt (3:1)
  2006. phosphoric acid dibutyl ester terbium(3+) salt (3:1)
  2007. phosphoric acid dibutyl ester ytterbium(3+) salt (3:1)
  2008. phosphoric acid dibutyl ester yttrium(3+) salt (3:1)
  2009. phosphoric acid dibutyl ethyl ester
  2010. phosphoric acid dibutyl hexyl ester
  2011. phosphoric acid dibutyl methyl ester
  2012. phosphoric acid dibutyl methylphenyl ester
  2013. phosphoric acid dibutyl octyl ester
  2014. phosphoric acid diethyl 1-[2-(methyl)phenyl)ethylideneamino ester
  2015. phosphoric acid diethyl 2-methyl-4-(methylthio)phenyl ester
  2016. phosphoric acid diethyl 2-methylpropyl ester
  2017. phosphoric acid diethyl 4-(methylthio)phenyl ester
  2018. phosphoric acid diethyl 4-nitrophenyl ester
  2019. phosphoric acid diethyl 6-methyl-2-(1-methylethyl)-4-pyrimidinyl ester
  2020. phosphoric acid diethyl pentyl ester
  2021. phosphoric acid diethyl phenyl ester
  2022. phosphoric acid dilithium salt
  2023. phosphoric acid dimethyl 4-nitrophenyl ester
  2024. phosphoric acid dimethyl ester cerium(3+) salt (3:1)
  2025. phosphoric acid dimethyl ester erbium(3+) salt (3:1)
  2026. phosphoric acid dimethyl ester gadolinium(3+) salt
  2027. phosphoric acid dimethyl ester lanthanum(3+) salt (3:1)
  2028. phosphoric acid dimethyl ester neodymium(3+) salt (3:1)
  2029. phosphoric acid dimethyl ester praseodymium(3+) salt (3:1)
  2030. phosphoric acid dimethyl ester samarium(3+) salt (3:1)
  2031. phosphoric acid dimethyl ester ytterbium(3+) salt
  2032. phosphoric acid dimethyl ester yttrium(3+) salt (3:1)
  2033. phosphoric acid dioctadecyl ester sodium salt
  2034. phosphoric acid dipentyl ester lanthanum(3+) salt (3:1)
  2035. phosphoric acid dipentyl ester terbium(3+) salt (3:1)
  2036. phosphoric acid dipotassium salt
  2037. phosphoric acid dipropyl ester lanthanum(3+) salt (3:1)
  2038. phosphoric acid dipropyl ester terbium(3+) salt (3:1)
  2039. phosphoric acid dipropyl ester yttrium(3+) salt (3:1)
  2040. phosphoric acid disodium salt
  2041. phosphoric acid disodium salt dodecahydrate
  2042. phosphoric acid disodium salt hexahydrate
  2043. phosphoric acid dysprosium(3+) salt (1:1)
  2044. phosphoric acid erbium(3+) salt (1:1)
  2045. phosphoric acid europium(3+) salt (1:1)
  2046. phosphoric acid europium(3+) zirconium(4+) salt (9:1:6)
  2047. phosphoric acid gadolinium(3+) salt (1:1)
  2048. phosphoric acid gallium salt (1:1)
  2049. phosphoric acid hafnium(4+) sodium salt (3:1:5)
  2050. phosphoric acid hafnium(4+) sodium salt (3:2:1)
  2051. phosphoric acid holmium(3+) salt (1:1)
  2052. phosphoric acid hydrate (2:1)
  2053. phosphoric acid isooctyl diphenyl ester
  2054. phosphoric acid lanthanum(3+) salt (1:1)
  2055. phosphoric acid lanthanum(3+) zirconium(4+) salt (9:1:6)
  2056. phosphoric acid lead(2+) salt (2:3)
  2057. phosphoric acid lithium zirconium(4+) salt (3:1:2)
  2058. phosphoric acid lutetium(3+) salt
  2059. phosphoric acid lutetium(3+) zirconium(4+) salt (9:1:6)
  2060. phosphoric acid magnesium potassium salt (1:1:1) hexahydrate
  2061. phosphoric acid magnesium salt (2:1)
  2062. phosphoric acid magnesium salt (2:3)
  2063. phosphoric acid magnesium sodium salt (2:1:4)
  2064. phosphoric acid manganese(2+) salt (1:1)
  2065. phosphoric acid methyl diphenyl ester
  2066. phosphoric acid monoammonium monosodium salt tetrahydrate
  2067. phosphoric acid monoammonium salt
  2068. phosphoric acid monoammonium salt
  2069. phosphoric acid monoammonium salt
  2070. phosphoric acid monobutyl ester
  2071. phosphoric acid monohexyl ester
  2072. phosphoric acid monolithium salt
  2073. phosphoric acid monopotassium salt
  2074. phosphoric acid monopotassium salt labeled with deuterium
  2075. phosphoric acid monorubidium salt
  2076. phosphoric acid monosodium salt
  2077. phosphoric acid monosodium salt dihydrate
  2078. phosphoric acid monothallium(1+) salt
  2079. phosphoric acid N-acetyl-4-bromoanilinium salt (1:1)
  2080. phosphoric acid neodymium(3+) salt (1:1)
  2081. phosphoric acid neodymium(3+) zirconium(4+) salt (9:1:6)
  2082. phosphoric acid nickel(2+) salt (2:3)
  2083. phosphoric acid nickel(2+) zirconium(4+) salt (6:1:4)
  2084. phosphoric acid plutonium(3+) salt (1:1)
  2085. phosphoric acid potassium zirconium(4+) salt (3:1:2)
  2086. phosphoric acid rubidium zirconium(4+) salt (3:1:2)
  2087. phosphoric acid samarium(3+) salt (1:1)
  2088. phosphoric acid scandium(3+) salt (1:1)
  2089. phosphoric acid sodium titanium(4+) salt (3:1:2)
  2090. phosphoric acid sodium titanium(4+) salt (3:5:1)
  2091. phosphoric acid sodium zirconium(4+) salt (3:5:1)
  2092. phosphoric acid strontium zirconium(4+) salt (6:1:4)
  2093. phosphoric acid thulium(3+) salt (1:1)
  2094. phosphoric acid triammonium salt
  2095. phosphoric acid tributyl ester
  2096. phosphoric acid tridodecyl ester
  2097. phosphoric acid triethyl ester
  2098. phosphoric acid triheptyl ester
  2099. phosphoric acid trihexyl ester
  2100. phosphoric acid trilithium salt
  2101. phosphoric acid trimethyl ester
  2102. phosphoric acid trioctyl ester
  2103. phosphoric acid tripentyl ester
  2104. phosphoric acid triphenyl ester
  2105. phosphoric acid tripotassium salt
  2106. phosphoric acid tripropyl ester
  2107. phosphoric acid trirubidium salt
  2108. phosphoric acid tris(1-methylethyl) ester
  2109. phosphoric acid tris(2-chlorophenyl) ester
  2110. phosphoric acid tris(2-ethylhexyl) ester
  2111. phosphoric acid tris(2-methylphenyl) ester
  2112. phosphoric acid tris(2-methylpropyl) ester
  2113. phosphoric acid tris(3-chlorophenyl) ester
  2114. phosphoric acid tris(3-methylphenyl) ester
  2115. phosphoric acid tris(4-chlorophenyl) ester
  2116. phosphoric acid tris(4-methylphenyl) ester
  2117. phosphoric acid tris(decyl) ester
  2118. phosphoric acid tris(methylphenyl) ester
  2119. phosphoric acid tris(methylphenyl) ester
  2120. phosphoric acid trisilver(1+) salt
  2121. phosphoric acid trisodium salt
  2122. phosphoric acid trisodium salt decahydrate
  2123. phosphoric acid trisodium salt dodecahydrate
  2124. phosphoric acid trithallium(1+) salt
  2125. phosphoric acid yttrium(3+) salt (1:1)
  2126. phosphoric acid zinc salt (1:1) dihydrate
  2127. phosphoric acid zinc salt (1:1) tetrahydrate
  2128. phosphoric acid zinc salt (2:3)
  2129. phosphoric acid zirconium(4+) salt (4:3)
  2130. phosphoric acid, P,P'-1,4-phenylene P,P,P',P'-tetraphenyl ester
  2131. phosphoric acid-d2 monothallium(1+) salt
  2132. phosphoric acid; N'-propan-2-ylpyridine-4-carbohydrazide
  2133. phosphoric acid; quinolin-8-ol
  2134. phosphoric acid; sodium; hydrate
  2135. phosphoric dichloride fluoride
  2136. phosphoric triamide
  2137. phosphorinane
  2138. phosphorisocyanatic difluoride
  2139. phosphorochloridic acid diethyl ester
  2140. phosphorochloridic acid diphenyl ester
  2141. phosphorochloridothioic acid O,O-diethyl ester
  2142. phosphorochloridothioic acid O,O-dimethyl ester
  2143. phosphorochloridous acid diethyl ester
  2144. phosphorochloridousfluoridous acid methyl ester
  2145. phosphorodichloridic acid (1,1'-biphenyl)-2-yl ester
  2146. phosphorodichloridic acid 4-(1,1-dimethylethyl)phenyl ester
  2147. phosphorodichloridic acid methyl ester
  2148. phosphorodichloridous acid butyl ester
  2149. phosphorodichloridous acid ethyl ester
  2150. phosphorodichloridous acid methyl ester
  2151. phosphorodichloridous acid phenyl ester
  2152. phosphorodichloridous acid propyl ester
  2153. phosphorodifluoric acid trifluormethyl ester
  2154. phosphorodifluoridic acid
  2155. phosphorodifluoridic acid potassium salt
  2156. phosphorodifluoridodithioic acid methyl ester
  2157. phosphorodifluoridothioic acid S-(trifluoromethyl) ester
  2158. phosphorodifluoridothioic acid S-methyl ester
  2159. phosphorodifluoridothious acid trifluoromethyl ester
  2160. phosphorodifluoridous acid methyl ester
  2161. phosphorodithioic acid O,O-bis(1-methylethyl) S-[2-[(phenylsulfonyl)amino]ethyl] ester
  2162. phosphorodithioic acid O,O-diethyl S-((4-oxo-1,2,3-benzotriazin-3(4H)-yl)methyl) ester
  2163. phosphorodithioic acid O,O-diethyl S-((ethylsulfinyl)methyl) ester
  2164. phosphorodithioic acid O,O-diethyl S-((ethylsulfonyl)methyl) ester
  2165. phosphorodithioic acid O,O-diethyl S-(2-(ethylsulfinyl)ethyl) ester
  2166. phosphorodithioic acid O,O-diethyl S-(2-(ethylsulfonyl)ethyl) ester
  2167. phosphorodithioic acid O,O-diethyl S-(2-(ethylthio)ethyl) ester
  2168. phosphorodithioic acid O,O-diethyl S-(ethylthio)methyl ester
  2169. phosphorodithioic acid O,O-dimethyl S-((4-oxo-1,2,3-benzotriazin-3(4H)-yl)methyl) ester
  2170. phosphorodithioic acid O,O-dimethyl S-(2-(methylamino)-2-oxoethyl) ester
  2171. phosphorodithioic acid O-(2,4-dichlorophenyl) O-ethyl S-propyl ester
  2172. phosphorodithioic acid O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl ester
  2173. phosphorodithioic acid O-ethyl S,S-diphenyl ester
  2174. phosphorodithioic acid S-(((1,1-dimethylethyl)sulfinyl)methyl) O,O-diethyl ester
  2175. phosphorodithioic acid S-(((1,1-dimethylethyl)sulfonyl)methyl) O,O-diethyl ester
  2176. phosphorodithioic acid S-(((1,1-dimethylethyl)thio)methyl) O,O-diethyl ester
  2177. phosphorodithioic acid S-(((4-chlorophenyl)thio)methyl) O,O-dimethyl ester
  2178. phosphorodithioic acid S-((1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)methyl) O,O-dimethyl ester
  2179. phosphorodithioic acid S-((5-methoxy-2-oxo-1,3,4-thiadiazol-3(2H)-yl)methyl) O,O-dimethyl ester
  2180. phosphorodithioic acid S-((6-chloro-2-oxo-3(2H)-benzoxazolyl)methyl) O,O-diethyl ester
  2181. phosphorodithioic acid S-(2-chloro-1-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)ethyl) O,O-diethyl ester
  2182. phosphorodithioic acid S-[2-(ethylthio)ethyl] O,O-dimethyl ester
  2183. phosphorodithioic aicd S-(2-(2-methyl-1-piperidinyl)-2-oxoethyl) O,O-dipropyl ester
  2184. phosphorofluoridic acid bis(1-methylethyl) ester
  2185. phosphorofluoridic acid diethyl ester
  2186. phosphorotetrathioic acid cadmium salt (2:3)
  2187. phosphorothioic acid O,O,O-triethyl ester
  2188. phosphorothioic acid O,O,O-trimethyl ester
  2189. phosphorothioic acid O,O,O-triphenyl ester
  2190. phosphorothioic acid O,O,O-tris(2,4-dimethylphenyl) ester
  2191. phosphorothioic acid O,O,O-tris(4-chlorophenyl) ester
  2192. phosphorothioic acid O,O,O-tris(4-methylphenyl) ester
  2193. phosphorothioic acid O,O,S-triethyl ester
  2194. phosphorothioic acid O,O-bis(1-methylethyl) ester comdp. with diethylamine (1:1)
  2195. phosphorothioic acid O,O-bis(1-methylethyl) S-(phenylmethyl) ester
  2196. phosphorothioic acid O,O-diethyl O-(1-phenyl-1H-1,2,4-triazol-3-yl) ester
  2197. phosphorothioic acid O,O-diethyl O-(2,6-dichloro-4-(methylsulfonyl)phenyl) ester
  2198. phosphorothioic acid O,O-diethyl O-(2,6-dichloro-4-methylthiophenyl) ester
  2199. phosphorothioic acid O,O-diethyl O-(2-(ethylthio)ethyl) ester
  2200. phosphorothioic acid O,O-diethyl O-(2-chloro-4-methylthiophenyl) ester
  2201. phosphorothioic acid O,O-diethyl O-(2-methyl-4-methylthiophenyl) ester
  2202. phosphorothioic acid O,O-diethyl O-(2-nitro-4-(methylsulfonyl)phenyl) ester
  2203. phosphorothioic acid O,O-diethyl O-(2-nitro-4-methylthiophenyl) ester
  2204. phosphorothioic acid O,O-diethyl O-(3,5,6-trichloro-2-pyridyl) ester
  2205. phosphorothioic acid O,O-diethyl O-(4-(methylsulfinyl)phenyl) ester
  2206. phosphorothioic acid O,O-diethyl O-(4-(methylsulfonyl)phenyl) ester
  2207. phosphorothioic acid O,O-diethyl O-(4-(methylthio)phenyl) ester
  2208. phosphorothioic acid O,O-diethyl O-(4-nitrophenyl) ester
  2209. phosphorothioic acid O,O-diethyl O-(5-phenyl-3-isoxazolyl) ester
  2210. phosphorothioic acid O,O-diethyl O-(6-methyl-2-(1-methylethyl)-4-pyrimidinyl) ester
  2211. phosphorothioic acid O,O-diethyl O-phenyl ester
  2212. phosphorothioic acid O,O-diethyl S-((4-oxo-1,2,3-benzotriazin-3(4H)-yl)methyl) ester
  2213. phosphorothioic acid O,O-diethyl S-(2-(ethylthio)ethyl) ester
  2214. phosphorothioic acid O,O-diethyl S-(4-nitrophenyl) ester
  2215. phosphorothioic acid O,O-dimethyl O-(2,4,5-trichlorophenyl) ester
  2216. phosphorothioic acid O,O-dimethyl O-(3,5,6-trichloro-2-pyridinyl) ester
  2217. phosphorothioic acid O,O-dimethyl O-(3-methyl-4-(methylthio)phenyl) ester
  2218. phosphorothioic acid O,O-dimethyl O-(3-methyl-4-nitrophenyl) ester
  2219. phosphorothioic acid O,O-dimethyl O-(4-nitrophenyl) ester
  2220. phosphorothioic acid O,O-dimethyl O-phenyl ester
  2221. phosphorothioic acid O,O-dimethyl O-[4-(methylsulfanyl)phenyl] ester
  2222. phosphorothioic acid O,O-dimethyl S-((4-oxo-1,2,3-benzotriazin-3(4H)-yl)methyl) ester
  2223. phosphorothioic acid O,S-diethyl O-(4-nitrophenyl) ester
  2224. phosphorothioic acid O-(1,6-dihydro-6-oxo-1-phenyl-3-pyridazinyl) O,O-diethyl ester
  2225. phosphorothioic acid O-(2,4-dichlorophenyl) O,O-diethyl ester
  2226. phosphorothioic acid O-(2,5-dichloro-4-iodophenyl) O,O-dimethyl ester
  2227. phosphorothioic acid O-(2,6-dichloro-4-methylphenyl) O,O-dimethyl ester
  2228. phosphorothioic acid O-(2-(diethylamino)-6-methyl-4-pyrimidinyl) O,O-diethyl ester
  2229. phosphorothioic acid O-(2-(diethylamino)-6-methyl-4-pyrimidinyl) O,O-dimethyl ester
  2230. phosphorothioic acid O-(2-(ethylthio)ethyl) O,O-dimethyl ester
  2231. phosphorothioic acid O-(2-chloro-4-nitrophenyl) O,O-dimethyl ester
  2232. phosphorothioic acid O-(3-chloro-4-methyl-2-oxo-2H-1-benzopyran-7-yl) O,O-diethyl ester
  2233. phosphorothioic acid O-(3-chloro-4-nitrophenyl) O,O-dimethyl ester
  2234. phosphorothioic acid O-(4-aminophenyl) O,O-diethyl ester
  2235. phosphorothioic acid O-(4-bromo-2,5-dichlorophenyl) O,O-diethyl ester
  2236. phosphorothioic acid O-(4-bromo-2,5-dichlorophenyl) O,O-dimethyl ester
  2237. phosphorothioic acid O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl ester
  2238. phosphorothioic acid O-(4-chloro-2-cyanophenyl) O,O-dimethyl ester
  2239. phosphorothioic acid O-(4-cyanophenyl) O,O-dimethyl ester
  2240. phosphorothioic acid O-(5-chloro-1-(1-methylethyl)-1H-1,2,4-triazol-3-yl) O,O-diethyl ester
  2241. phosphorothioic acid O-(6-ethoxy-2-ethyl-4-pyrimidinyl) O,O-dimethyl ester
  2242. phosphorothioic acid S-(2-(ethylthio)ethyl) O,O-dimethyl ester
  2243. phosphorothioic acid tributyl ester
  2244. Phosphorothioic dichloride fluoride
  2245. phosphorothious acid S-(2-(bis(1-methylethyl)amino)ethyl) O-ethyl O-methyl ester
  2246. phosphorotrithious acid triethyl ester
  2247. phosphorous acid
  2248. phosphorous acid propyl propylene ester
  2249. phosphorous acid tributyl ester
  2250. phosphorous acid triethyl ester
  2251. phosphorous acid triheptyl ester
  2252. phosphorous acid trihexyl ester
  2253. phosphorous acid trimethyl ester
  2254. phosphorous acid trioctyl ester
  2255. phosphorous acid tripentyl ester
  2256. phosphorous acid triphenyl ester
  2257. phosphorous acid tripropyl ester
  2258. phosphorous acid tris(1-methylethyl) ester
  2259. phosphorous acid tris(2-chlorophenyl) ester
  2260. phosphorous acid tris(2-methylphenyl) ester
  2261. phosphorous acid tris(3-chlorophenyl) ester
  2262. phosphorous acid tris(3-methylphenyl) ester
  2263. phosphorous acid tris(4-chlorophenyl) ester
  2264. phosphorous acid tris(4-methylphenyl) ester
  2265. phosphorous bis(trifluoromethyl)nitroxide difluoride
  2266. phosphorous bis[bis(trifluoromethyl)nitroxide] trifluoride
  2267. phosphorous bromide difluoride
  2268. phosphorous chloride difluoride
  2269. phosphorous dibromide fluoride
  2270. phosphorous dichloride fluoride
  2271. phosphorous nitride
  2272. phosphorous oxide (PO2)
  2273. phosphorous tribromide
  2274. phosphorous trichloride
  2275. phosphorous tricyanide
  2276. phosphorous trifluoride
  2277. phosphorous triiodide
  2278. phosphorous triisocyanate
  2279. phosphorous tris[bis(trifluoromethyl)nitroxide]difluoride
  2280. phosphorus (violet)
  2281. phosphorus chloride (PCl)
  2282. phosphorus mol. (P4)
  2283. phosphorus mol. (P4)
  2284. phosphorus nitride (P3N5)
  2285. phosphorus oxide (P2O3)
  2286. phosphorus oxide (P2O5)
  2287. phosphorus oxide (P4O6)
  2288. phosphorus oxide (PO)
  2289. phosphorus pentasulfide
  2290. phosphorus sulfide (PS)
  2291. phosphorus(black)
  2292. Phosphorus(III) tris(dipropyldithiocarbamate)
  2293. Phosphorus-tris(N,N-diethyldithiocarbamate)
  2294. phosphoryl bis(trifluoromethyl)nitroxide difluoride
  2295. phosphoryl bromide
  2296. Phosphoryl bromide chloride fluoride
  2297. phosphoryl bromide difluoride
  2298. phosphoryl chloride
  2299. phosphoryl chloride fluoride (POClF2)
  2300. Phosphoryl dichlorothiocyanate
  2301. Phosphoryl difluoride fluorosulfonate
  2302. phosphoryl fluoride
  2303. phosphorylbromide fluoride (POBr2F)
  2304. phosphrofluoridic acid dimethyl ester
  2305. phosporic acid dimethyl (1E)-1-methyl-3-(methylamino)-3-oxo-1-propenyl ester
  2306. phosporic acid ethyl dimethyl ester
  2307. phosporic acid manganese(2+) salt (2:3)
  2308. phosporic acid monocesium salt
  2309. phthalazine
  2310. Phthalic acid 2,4-dimethylhex-3-yl ester
  2311. Phthalic acid bis(1H,1H,5H-octafluoropentyl) ester
  2312. Phthalic acid hept-3-yl ester
  2313. phthalic acid mono-ethyl mono-vinyl ester
  2314. Phthalimidine
  2315. Phytosterines
  2316. phytosterol
  2317. picene
  2318. Picloram
  2319. Picotamide
  2320. Pidotimod
  2321. Pinacoline phenylhydrazone
  2322. Pindone
  2323. Pinic acid bis(1H,1H,7H-dodecafluoroheptyl) ester
  2324. Pinic acid diheptyl ester
  2325. Pinonic acid
  2326. piperazine
  2327. piperazine dihydrochloride
  2328. piperazine hexahydrate
  2329. piperazine sulfate(1:1)
  2330. piperazinium dichloride monohydrate
  2331. piperazinium dinitrate
  2332. piperidin-1-yl-[3-(trifluoromethyl)phenyl]methanone
  2333. piperidine
  2334. Piperidine 2,4-dichlorophenoxyacetic acid
  2335. Piperidine boron trichloride complex
  2336. piperidine compd. with 2,4,6-trinitrophenol (1:1)
  2337. piperidine conjugate acid
  2338. piperidine hydrochloride
  2339. piperidine nitrate
  2340. Piperidine pentamethylenedithiocarbamate
  2341. Piperidinium 2-((4,5-dibromo-1-(thietan-3-yl)-1H-imidazol-2-yl)sulfanyl)acetate
  2342. piperidinium propionate
  2343. Piperidinium tetrakis(1,3-diphenyl-1,3-propanediono)europium(III)
  2344. Piperidinium tetrakis(1,3-diphenyl-1,3-propanediono)europium(III) trihydrate
  2345. Piperidinium tetrakis(1-phenyl-1,3-butanediono)europium(III)
  2346. Piperidinium tetrakis(1-phenyl-1,3-butanediono)europium(III) hydrate
  2347. Piperidinobenzyl benzamide
  2348. Piroxicam pivalate
  2349. Pivalic acid N-[chloro(dimethyl)silylmethyl]-N-methylamide
  2350. Plalladium(II) diethyldithiocarbamate chloride
  2351. Plalladium(II) dimethyldithiocarbamate bromide
  2352. Plalladium(II) dimethyldithiocarbamate chloride
  2353. Plalladium(II) methyldiethyldithiocarbamate dichloride
  2354. Plalladium(II) methyldimethyldithiocarbamate dibromide
  2355. Plalladium(II) methyldimethyldithiocarbamate dichloride
  2356. plasminogen
  2357. platinum
  2358. platinum (IV) chloride trihydrate
  2359. Platinum (IV) oxide
  2360. platinum alloy base Pt 90,Rh 10
  2361. platinum chloride (PtCl2)
  2362. Platinum diantimony
  2363. platinum iodide (PtI)
  2364. platinum iodide (PtI2)
  2365. platinum iodide (PtI3)
  2366. Platinum(II) 3-dimethylaminomethyl indole salicylaldehydeoxime chloride
  2367. Platinum(II) bis(4,6-dimethyl-2-thiopyrimidine) dichloride
  2368. Platinum(II) bis(4-aminophenazone dithiocarbamate)
  2369. Platinum(II) bis(diethyldithiocarbamate)
  2370. Platinum(II) bis(N-methylcyclohexyl dithiocarbamate)
  2371. Platinum(II) dimethyldithiocarbamate bromide
  2372. Platinum(II) dimethyldithiocarbamate chloride
  2373. Platinum(II) dimethyldithiocarbamate diethyldithiocarbamate
  2374. Platinum(II) methyl bis(diethyldithiocarbamate) chloride
  2375. Platinum(II) methyldimethyldithiocarbamate dibromide
  2376. Platinum(II) methyldimethyldithiocarbamate dichloride
  2377. Platinum(II) methyldimethyldithiocarbamate diethyldithiocarbamate chloride
  2378. Platinum(II) salicylaldehydeoxime chloride
  2379. Platinum(II) tetrakis(1-hexanamine) dibromide
  2380. Platinum(II) tetrakis(1-hexanamine) dichloride
  2381. Platinum(II) tris(1-hexanamine) dibromide
  2382. Platinum(II) tris(1-hexanamine) dichloride
  2383. Platinum(IV) bis(6-amino-5-nitrosopyrimidine-2,4-diol) antipyrine dichloride
  2384. Platinum(IV) bis(6-amino-5-nitrosopyrimidine-2,4-diol) dichloride
  2385. platinum(IV) chloride pentahydrate
  2386. plumbane
  2387. plumbylidyne
  2388. plutonium
  2389. plutonium alloy base Pu 99,Zr 1
  2390. plutonium carbide (PuC)
  2391. plutonium chloride (PuCl3)
  2392. plutonium fluoride ((242)PuF4)
  2393. plutonium fluoride (PuF3)
  2394. plutonium fluoride (PuF4)
  2395. plutonium nitride (PuN)
  2396. plutonium oxide (Pu2O3)
  2397. plutonium oxide (PuO)
  2398. plutonium oxide (PuO2)
  2399. plutonium telluride (PuTe)
  2400. plutonium(III) bromide
  2401. plutonium(IV) oxalate hexahydrate
  2402. plutonium(VI) fluoride
  2403. plutonyl fluoride
  2404. Plutonyl fluoride dihydrate
  2405. PMS-100
  2406. PMS-1000
  2407. PMS-200
  2408. PMS-400
  2409. PMS-476
  2410. PMS-50
  2411. PMS-700
  2412. POE 68
  2413. POE ISO VG100
  2414. POE75
  2415. POE85 lubricant oil
  2416. pollucite (Cs0.77Na0.14Rb0.04Al0.91Si2.08O6*0.34H2O)
  2417. pollucite (Cs0.84Na0.11Al0.88Si2.10O6*0.17H2O)
  2418. polonium
  2419. poly((1,3-diphenyl-1,3:1,3-disiloxanediylidene)-1,3-bis(oxy))
  2420. poly((8-amino-1,3,4,6,7,9,9b-heptaazaphenalene-2,5-diyl)imino)
  2421. poly((bis(4-methoxyphenyl)germylene)-1,3-butadiyne-1,4-diyl)
  2422. poly(1-heptene-1,7-diyl)
  2423. poly(1-phenylethylene)
  2424. poly(1-phenylethylene)
  2425. poly(1-vinylpyrrolidone-co-vinyl acetate)
  2426. poly(2,2'',3,3'',6,6''-hexaphenyl(1,1':4',1'':ar'',1'''-quaterphenyl)-ar,4'''-diyl)
  2427. Poly(butyl(4-ethylbenzyl)imidazolium chloride)
  2428. Poly(butylethylbenzyl)imidazolium bis(trifluoromethyl sulfonyl)imide)
  2429. Poly(butylethylbenzyl)imidazolium bromide)
  2430. poly(carbonate) bisphenol-A
  2431. poly(dimethylsiloxane)
  2432. poly(dimethylsiloxane)
  2433. poly(dimethylsiloxane)
  2434. poly(dimethylsiloxane)
  2435. poly(dimethylsiloxane)
  2436. poly(dimethylsiloxane)
  2437. poly(ethylene glycol) butyl ether
  2438. poly(ethylene glycol) diacrylate
  2439. poly(ethylene glycol) mono p-(1,1,3,3-tetramethylbutyl)-phenyl ether
  2440. poly(ethylene glycol) mono-4-octylphenyl ether
  2441. poly(ethylene oxide)-block-poly(propylene oxide)-block-poly(ethylene oxide)
  2442. poly(hexahydro-2H-azepin-2-one)
  2443. poly(nitrilo(bis(2,2,2-trifluoroethoxy)phosphoranylidyne))
  2444. poly(oxy(1,4-dioxo-1,4-butanediyl)oxy-1,4-butanediyl]
  2445. poly(oxy(methylsilylene))
  2446. poly(oxy-1,2-ethanediyloxycarbonyl-1,4-phenylenecarbonyl)
  2447. poly(oxy-1,4-phenylenesulfonyl-1,4-phenylene)
  2448. poly(oxycarbonylimino-1,5-pentanediyl)
  2449. poly(oxycarbonylimino-1,6-hexanediyl)
  2450. poly(tetramethylene oxide)
  2451. poly(vinyl alcohol)
  2452. poly(vinyl chloride)
  2453. Poly-α-olefin (PAO)
  2454. polyalkylene glycol
  2455. Polyalphaolefin 20
  2456. Polyalphaolefin 32
  2457. Polyalphaolefin 40
  2458. Polyalphaolefin 6
  2459. Polyaluminium chloride (PAC)
  2460. polycarbonates
  2461. polyester
  2462. polyethylene
  2463. polyethylene
  2464. polyethylene
  2465. polyethylene glycol 35
  2466. polyethylene glycol monooleyl ether
  2467. polymethyl siloxane
  2468. polyol ester
  2469. Polyol ester POE ISO 10
  2470. Polyol ester POE ISO 22
  2471. Polyoxymethylene dimethyl ether
  2472. polyphosphoric acid (H3O14P5) lanthanum(3+) salt (1:1)
  2473. polypropylene
  2474. poly[imino(1-oxo-1,11-undecanediyl)]
  2475. poly[oxy(1-oxo-1,6-hexanediyl)]
  2476. poly[oxy(ethylsilylene)]
  2477. poly[oxy-1,4-phenylenesulfonyl-1,4-phenyleneoxy-1,4-phenylene(1-methylethylidene)-1,4-phenylene]
  2478. Pomalidomide
  2479. porfiromycin
  2480. Posaconazole
  2481. potassate (KO(1-))
  2482. potassium
  2483. potassium μ-chlorotetrachlorodiplumbate(1-)
  2484. potassium μ-oxodioxo(trioxovanadate)uranate(1-)
  2485. potassium (1R)-1,2,3,4,5,6-hexadydro-1,5-methano-8H-pyrido(1,2-a)(1,5)diazocin-8-onedithiocarbamate
  2486. potassium (OC-6-11)-hexachloroniobate(1-)
  2487. potassium (OC-6-11)-hexachloroniobate(2-)
  2488. potassium (OC-6-11)-hexachlorotantalate(1-)
  2489. potassium (OC-6-11)-hexafluoroantimonate(1-)
  2490. potassium (OC-6-11)-hexafluoroniobate(1-)
  2491. potassium (OC-6-11)-hexafluorotantalate(1-)
  2492. potassium (orthoarsenato(3-)-κO)dioxouranate(1-)
  2493. potassium (T-4)-rhenate (ReO4(1-))
  2494. potassium (T-4)-technetate (TcO4(1-))
  2495. potassium (T-4)-tetrachloroaluminate(1-)
  2496. potassium (T-4)-tetrachloroferrate(1-)
  2497. potassium (T-4)-tetrafluoroaluminate(1-)
  2498. potassium (T-4)-tetrahydroaluminate(1-)
  2499. potassium (T-4)-trifluoromethoxyborate(1-)
  2500. Potassium 1-anthraquinonesulfonate
  2501. Potassium 2,2,6,6-tetramethyl-3,5-heptanedione
  2502. potassium 2,2-dimethylpropanoate
  2503. potassium 2,3,4,5,6-pentafluorophenolate
  2504. potassium 2,3,5,6-tetrachloro-2,5-cyclohexadiene-1,4-dione radical ion(1-)
  2505. potassium 2,6-dimethylphenolate
  2506. Potassium 2-anthraquinonesulfonate
  2507. potassium 3-ethoxy-3-oxopropanoate
  2508. potassium 3-methoxy-3-oxopropanoate
  2509. Potassium 3-nitro-1,2,4-triazol-5-onate
  2510. potassium 4-hydroxybenzoate trihydrate
  2511. Potassium 4-hydroxybutan-1-olate
  2512. potassium 4-methylbenzenesulfonate
  2513. Potassium 5-chlor-anthraquinone-1-sulfonate
  2514. Potassium 6-chlor-anthraquinone-1-sulfonate
  2515. Potassium 7-chlor-anthraquinone-1-sulfonate
  2516. Potassium 8-chlor-anthraquinone-1-sulfonate
  2517. potassium acetate bis(acetic acid)
  2518. Potassium acetate dihydrate
  2519. potassium acetic acid acetate
  2520. potassium alloy base K 63,Cs 37
  2521. potassium alloy base K 63,Na 37
  2522. potassium alloy base K 77,Na 23
  2523. potassium alloy base K 78,Na 22
  2524. potassium alloy base K 87,Na 13
  2525. potassium aluminate (AlO2(1-))
  2526. potassium aluminate dihydrate
  2527. potassium aluminate trihydrate
  2528. potassium aluminium nitrate nonahydrate
  2529. potassium aluminium selenate dodecahydrate
  2530. potassium ammonium dimanganese sulfate
  2531. potassium ammonium paratungstate hexahydrate
  2532. potassium ammonium paratungstate undecahydrate
  2533. potassium ammonium trihydrogen orthoperiodate
  2534. Potassium anthraquinone-1,6-disulfonate
  2535. Potassium anthraquinone-1,7-disulfonate
  2536. Potassium anthraquinone-2,6-sulfonate
  2537. Potassium anthraquinone-2,7-sulfonate
  2538. Potassium antimony fluoride
  2539. potassium arsenate decahydrate
  2540. potassium arsenate heptahydrate
  2541. potassium arsenate monohydrate
  2542. potassium arsenate trihydrate
  2543. potassium azide (K(N3))
  2544. Potassium B-paratungstate
  2545. potassium benzoate dihydrate
  2546. potassium benzoate tetrahydrate
  2547. potassium biarsenate pentahydrate
  2548. Potassium bis(2-amino-1-butanol) imidazolate
  2549. Potassium bis(2-amino-2-methyl-1-propanol) imidazolate
  2550. potassium bis(cyano-C)argentate(1-)
  2551. potassium bis(diethyldithiocarbamodithioato-κS,κS')dioxouranate(1-)
  2552. Potassium bis(DL-1-amino-2-propanol) imidazolate
  2553. Potassium bis(monoethanolamine) imidazolate
  2554. potassium borate hydrogen peroxide
  2555. potassium bromide (KBr)
  2556. potassium bromide (KBr)
  2557. potassium bromide dodecahydrododecaborate
  2558. potassium bromide tetraammonia
  2559. potassium bromomethanedisulfonate
  2560. potassium bromomethanedisulfonate hydrate
  2561. potassium cadmium formate
  2562. potassium cadmium nitrite
  2563. potassium calcium nitrite dihydrate
  2564. potassium carbonate hexahydrate
  2565. Potassium carbonate hydrogencarbonate 1.5 hydrate
  2566. potassium carbonate pentahydrate
  2567. potassium carbonate sodium hydrogencarbonate dihydrate
  2568. potassium carbonate tetrahydrate
  2569. potassium cerium(IV) fluoride
  2570. potassium cesium dichromate
  2571. potassium chlorate triacontaperchlorate
  2572. potassium chloride (K2Cl2)
  2573. potassium chloride (KCl)
  2574. potassium chloride iodide
  2575. potassium chloride magnesium sulfate trihydrate (Kainit)
  2576. potassium chloride mono(selenium oxychloride)
  2577. potassium chloride monohydrate
  2578. potassium chloride tetrahydrate
  2579. potassium chlorohexafluorozirconate
  2580. potassium chloromethanedisulfonate
  2581. potassium chloromethanedisulfonate dihydrate
  2582. potassium chromium(+3) cation disulfate dodecahydrate
  2583. potassium cobalt acetate
  2584. potassium copper heptaborate hydrate
  2585. potassium copper(I) chloride monohydrate
  2586. potassium copper(I) cyanide
  2587. potassium copper(II) bromide
  2588. potassium cyanide (K(CN))
  2589. Potassium D-gluconate
  2590. potassium deuteroxide di(deuterium oxide)
  2591. Potassium diantimony fluoride
  2592. potassium dibromoiodate(1-)
  2593. Potassium dicalcium sodium tetraniobate
  2594. Potassium dicesium lanthanum(III) hexachloride
  2595. potassium dichloroiodate(1-)
  2596. potassium dicopper(II) acetate di(acetic acid)
  2597. potassium dideuterium orthophosphate
  2598. potassium dideuterium orthophosphate bis(dipotassium deuterium orthophosphate) deuterium oxide
  2599. potassium dideuterium phosphate trideuterophosphoric acid
  2600. Potassium difluorobromoacetate
  2601. Potassium difluorochloroacetate
  2602. Potassium digadolinium(III) heptafluoride
  2603. Potassium dihydrogen arsenide
  2604. potassium dihydrogen phosphate orthophosphoric acid
  2605. Potassium dimagnesium(II) hexaboron(III) oxide
  2606. Potassium dinitramide
  2607. potassium dioxo(phosphato(3-)-κO)uranate(1-)
  2608. potassium dioxo(phosphato(3-)-κO)uranate(1-) trihydrate
  2609. Potassium dioxouranium phosphate hexahydrate
  2610. Potassium dirubidium lanthanum(III) hexachloride
  2611. Potassium disilicate
  2612. potassium disilver cyanide monohydrate
  2613. Potassium ditert-butyl(imino)phosphanium
  2614. potassium dithorium tri(phosphate)
  2615. potassium erbium(III) diphosphate
  2616. potassium erbium(III)formate monohydrate
  2617. potassium ethanesulfonate
  2618. potassium ethanethiolate
  2619. potassium fluoride (K(HF2))
  2620. potassium fluoride (KF)
  2621. potassium fluoride (KF) tetrahydrate
  2622. potassium fluoride 0.3-hydrate
  2623. Potassium fluoride acetic acid
  2624. potassium fluoride di(acetic acid)
  2625. potassium fluoride di(hydrogen fluoride)
  2626. potassium fluoride dihydrate
  2627. potassium fluoride hexafluorosilicate(2-) (3:1:1)
  2628. Potassium fluoride semi(acetic acid)
  2629. Potassium fluoride sulfate
  2630. potassium fluoride sulfate (K3F(SO4))
  2631. potassium fluoride tetra(hydrogen fluoride)
  2632. potassium fluoride tri(hydrogen fluoride)
  2633. potassium fluoride tris(hydrogen peroxide)
  2634. potassium formate 1.5-hydrate
  2635. potassium formate di(formic acid)
  2636. potassium formate tris(formic acid)
  2637. Potassium gadolinium(III) tetrafluoride
  2638. potassium gallium(III) disulfate dodecahydrate
  2639. potassium gold(I) cyanide
  2640. potassium hafnium fluoride monohydrate
  2641. Potassium heptafluorodiantimonate(III)
  2642. potassium heptaiodide monohydrate
  2643. Potassium Hexabromotellurate(IV)
  2644. Potassium hexachlorouranate(IV)
  2645. Potassium hexafluoronickelate(IV)
  2646. Potassium hexafluorophosphate mono(formic acid)
  2647. potassium hexafluorophosphate monoacetic acid
  2648. Potassium hexafluorophosphate semi(formic acid)
  2649. potassium hexafluorophosphate(1-)
  2650. potassium hexahydroxoaluminate
  2651. potassium hexaiodotellurate(IV)
  2652. potassium hexaniobate decahydrate
  2653. potassium hexapermanganate tetrafluoroborate
  2654. potassium hydride (KH)
  2655. potassium hydrogen (orthosilicato(4-)-κO)dioxouranate(2-) monohydrate
  2656. potassium hydrogen pyrophosphate trihydrate
  2657. potassium hydrogen pyrosulfate
  2658. potassium hydrogen succinate tetrahydrate
  2659. potassium hydrogen sulfate mono(sulfuric acid) monohydrate
  2660. potassium hydrogen sulfate monohydrate
  2661. potassium hydroxide (K(OD))
  2662. potassium hydroxide (K(OH))
  2663. potassium hydroxide (K(OH)) dihydrate
  2664. potassium hydroxide (K(OH)) monohydrate
  2665. potassium hydroxide (K2(OH)2)
  2666. potassium hydroxide tetrahydrate
  2667. potassium indium disulfate dihydrate
  2668. potassium iodate di(iodic acid)
  2669. potassium iodic acid iodate
  2670. potassium iodide (K(I3))
  2671. potassium iodide (K(I7))
  2672. potassium iodide (KI)
  2673. potassium iodide bismuth triiodide
  2674. potassium iodide hexaammonia
  2675. potassium iodide mono(dimethylformamide)
  2676. potassium iodide tetraammonia
  2677. potassium iodide tris(dimethylformamide)
  2678. potassium ion (K(1+))
  2679. Potassium Iron Phosphate hexahydrate
  2680. potassium iron titanium oxide (K2Fe2Ti6O16)
  2681. potassium iron(II) chloride dihydrate
  2682. Potassium iron(III) sulfate tetrahydrate
  2683. Potassium isocyanate
  2684. potassium lanthanum(III) sulfate dihydrate
  2685. potassium lead(II) selenocyanate
  2686. potassium lithium hexafluorosilicate
  2687. Potassium lutetium molybdate
  2688. potassium magnesium bromide hexahydrate
  2689. potassium magnesium chloride dihydrate
  2690. potassium magnesium decavanadate hexadecahydrate
  2691. Potassium magnesium dihydrogen fluoride
  2692. potassium magnesium hydrogen carbonate tetrahydrate
  2693. Potassium magnesium hydrogen fluoride
  2694. potassium magnesium manganese neodymium oxide (K3Mg3Mn4NdO12)
  2695. potassium mandelate dimandelic acid
  2696. potassium mandelate monomandelic acid
  2697. potassium mandelate trimandelic acid
  2698. potassium manganese triformate
  2699. potassium mercury thiocyanate
  2700. potassium mercury(II) iodide
  2701. potassium mercury(II) iodide ethanol
  2702. potassium mercury(II) iodide monohydrate
  2703. potassium metaborate monohydrate
  2704. potassium metaborate monourea
  2705. potassium metaborate tetrahydrate
  2706. potassium metavanadate monohydrate
  2707. potassium metavanadate trihydrate
  2708. Potassium methanesulfonate
  2709. potassium methyl sulfate
  2710. potassium morpholinedithiocarbamate
  2711. potassium neodymium (III) chloride pentahydrate
  2712. potassium nickel chloride
  2713. potassium nickel fluoride monohydrate
  2714. potassium nickel formate
  2715. potassium nickel(+2) cation sulfate hexahydrate
  2716. potassium niobate(NbO3(1-))
  2717. potassium niobium uranium oxide (KNbUO6) hydrate (2:3)
  2718. Potassium niobium(V) tellurium hexaoxide
  2719. potassium nitrate * Dinitric acid
  2720. potassium nitrate * Nitric acid
  2721. potassium octacyanomolybdate(IV)
  2722. potassium orthophosphate hepta(deuterium oxide)
  2723. potassium orthophosphate metavanadate pentadecahydrate
  2724. potassium orthophosphate metavanadate undecahydrate
  2725. potassium orthophosphate sulfate nonahydrate
  2726. potassium orthophosphate sulfate pentadecahydrate
  2727. potassium orthophosphate sulfate undecahydrate
  2728. potassium orthophosphate tri(deuterium oxide)
  2729. potassium orthovanadate hexahydrate
  2730. potassium orthovanadate pentahydrate
  2731. potassium orthovanadate trihydrate
  2732. potassium oxalate monohydrogen peroxidate
  2733. potassium oxide (K2O)
  2734. potassium oxide (KO)
  2735. potassium oxide bis(boric oxide) tetrahydrate
  2736. potassium oxide penta(boric oxide) octahydrate
  2737. Potassium p-aminobenzoate
  2738. potassium paratungstate (5K2O*12WO3)
  2739. potassium paratungstate decahydrate (5K2O*12WO3*10H2O)
  2740. potassium paratungstate undecahydrate
  2741. potassium pentafluorozirconate monohydrate
  2742. potassium pentafluorozirconate(1-)
  2743. potassium perchlorate dimethylformamide
  2744. potassium perchlorate ditetrafluoroborate
  2745. potassium perchlorate octa(tetrafluoroborate)
  2746. potassium peroxide (K2(O2))
  2747. potassium phosphate octahydrate
  2748. Potassium phosphide
  2749. potassium platinocyanide dihydrate
  2750. potassium platinocyanide monohydrate
  2751. potassium platinocyanide pentahydrate
  2752. potassium platinocyanide trihydrate
  2753. Potassium pyrazine-2-carboxylate
  2754. potassium pyrophosphate dihydrate
  2755. potassium pyrophosphate trihydrate
  2756. potassium pyrovanadate tetrahydrate
  2757. potassium salicylate monohydrate
  2758. potassium samarium(3+) 2,2',2'',2'''-(ethane-1,2-diyldinitrilo)tetraacetate
  2759. potassium samarium(III) ethylenediamine tetraacetate octahydrate
  2760. potassium selenite tetrahydrate
  2761. potassium selenite tri(potassium hydrogenselenite)
  2762. Potassium silver nitrate
  2763. potassium silver thiocyanate
  2764. potassium sodium calcium thorium silicate
  2765. potassium sodium magnesium chromate heptahydrate
  2766. potassium sodium magnesium sulfate nitrate hexahydrate (Humberstonit)
  2767. potassium sodium nitrate
  2768. potassium sodium tartrate trihydrate
  2769. Potassium sodium thorium(IV) hexafluoride
  2770. potassium sulfate copper(II) chloride
  2771. potassium sulfate dizinc chloride pentahydrate
  2772. potassium sulfate hexa(hydrogen sulfate)
  2773. potassium sulfate hexa(hydrogen sulfate) monohydrate
  2774. potassium sulfate monohydrate
  2775. potassium sulfate pentahydrate
  2776. potassium sulfate phosphate (2:1:1)
  2777. potassium sulfate tetra(hydrogen sulfate) monohydrate
  2778. potassium sulfate tetrahydrate
  2779. potassium sulfate tri(hydrogen sulfate)
  2780. potassium sulfate tri(hydrogen sulfate) dihydrate
  2781. potassium sulfide (K2S)
  2782. potassium superoxide (K(O2))
  2783. potassium tantalate(TaO3(1-))
  2784. potassium telluride (K2(Te2))
  2785. potassium telluride (K2(Te3))
  2786. potassium telluride (K2Te)
  2787. potassium telluride (K5Te3)
  2788. potassium terbium molybdate phosphate
  2789. Potassium tetraarsenate
  2790. potassium tetraborate hexahydrate
  2791. potassium tetraborate octahydrate
  2792. potassium tetraborate pentahydrate
  2793. potassium tetrachloroiodate monohydrate
  2794. potassium tetrachloroiodate(1-)
  2795. potassium tetrachlorooxoniobate(1-)
  2796. potassium tetrachromate
  2797. potassium tetrafluoroborate(1-)
  2798. potassium tetrahydroborate monohydrate
  2799. potassium tetrahydroborate tetrahydrate
  2800. potassium tetrahydroborate trihydrate
  2801. potassium tetrahydroborate(1-)
  2802. Potassium tetrantimony fluoride
  2803. potassium tetraphenylborate(1-)
  2804. Potassium tetrasilicate
  2805. potassium tetrastrontium orthoborate
  2806. potassium thallium cyanide
  2807. potassium thiocyanate dimethylformamide
  2808. potassium thiocyanate monourea
  2809. potassium thulium tellurite
  2810. potassium titanium oxide (K2TiO3)
  2811. potassium titanium oxide phosphate (KTiO(PO4))
  2812. Potassium titanyl arsenate
  2813. potassium titanyl oxalate dihydrate
  2814. Potassium triarsenate
  2815. potassium triarsenate tetrahydrate
  2816. potassium tribromocadmate(1-)
  2817. potassium trichlorocadmate(1-)
  2818. potassium trichlorocalciate(1-)
  2819. potassium trichlorocuprate(1-)
  2820. potassium trichlorocuprate(1-) dihydrate
  2821. potassium trichloromagnesate(1-)
  2822. potassium trichloromagnesate(1-) dihydrate
  2823. potassium trichloromagnesate(1-) hexahydrate
  2824. potassium trichloroplumbate(1-) hydrate (3:1)
  2825. potassium trichromate
  2826. potassium trifluoroacetate mono(trifluoroacetic acid)
  2827. potassium trifluorocadmate(1-)
  2828. potassium trifluorocalciate(1-)
  2829. potassium trifluorocobaltate(1-)
  2830. potassium trifluoromanganate(1-)
  2831. potassium trifluoromethanesulfonate
  2832. potassium trifluoronickelate(1-)
  2833. potassium trifluorozincate(1-)
  2834. potassium trihydroxyfluorborate
  2835. potassium triiodide monohydrate
  2836. potassium tripolyphosphate dihydrate
  2837. potassium tris(nitrato-κO)dioxouranate(1-)
  2838. potassium tungsten oxide (K2W2O7)
  2839. potassium tungsten oxide (K2W3O10)
  2840. potassium tungsten uranium oxide (K2W2UO10)
  2841. Potassium undecanoate
  2842. potassium uranate (UO3(1-))
  2843. potassium uranium arsenate oxide (KU(AsO4)O2)
  2844. potassium uranium arsenate oxide (KU(AsO4)O2) hydrate (2:1)
  2845. potassium uranium arsenate oxide (KU(AsO4)O2) trihydrate
  2846. potassium uranium borate oxide (KU(BO3)O2)
  2847. potassium uranium borate oxide (KU(BO3)O2) monohydrate
  2848. potassium uranium oxide (K2U4O12)
  2849. potassium uranium oxide (K2U4O13)
  2850. Potassium uranium(III) chloride
  2851. Potassium uranoniobate
  2852. potassium uranyl molybdate
  2853. potassium vanadate (VO3(1-))
  2854. potassium ytterbium(3+) molybdate (MoO4(2-)) (1:1:2)
  2855. potassium ytterbium(III)nitrate dihydrate
  2856. potassium yttrium (III) formate monohydrate
  2857. Potassium yttrium(III) formate
  2858. Potassium yttrium(III) tetra(1,1,1-trifluoro-5,5,5-trimethylacetylacetonate)
  2859. potassium zinc chloride (K5Zn4Cl13)
  2860. potassium zinc chloride dihydrate
  2861. potassium zinc chloride monohydrate
  2862. Potassium zirconium sulfate dihydrate
  2863. Potassium(I) benzo-15-crown-5 thiocyanate
  2864. potassium; 2-hydroxy-2-oxoacetate; oxalic acid; dihydrate
  2865. potassium; hydrogen sulfate; sulfuric acid
  2866. Potasssium iron triiodide
  2867. Praesodymium(III) β-resorcylate
  2868. Pramipexole
  2869. Praseodimium(III) chloride di(methylenediacetamide) dihydrate
  2870. praseodymium
  2871. praseodymium (III) bromate nonahydrate
  2872. praseodymium (III) fluorosulfide
  2873. praseodymium (III) nitrate trihydrate
  2874. praseodymium (III) orthovanadate
  2875. praseodymium (III) trichloroacetate trihydrate
  2876. Praseodymium acetate triurea
  2877. Praseodymium acetate triurea sesquihydrate
  2878. praseodymium bromid heptahydrate
  2879. praseodymium bromide (PrBr3)
  2880. Praseodymium calcium germanate
  2881. praseodymium carbide (Pr2C3)
  2882. praseodymium carbide (PrC2)
  2883. praseodymium cesium sulfate octahydrate
  2884. praseodymium chloride (PrCl3)
  2885. praseodymium chloride (PrCl3) comp. with L-alanine (1:3) trihydrate
  2886. praseodymium chloride (PrCl3) heptahydrate
  2887. praseodymium chloride (PrCl3) hexahydrate
  2888. praseodymium chloride oxide (PrClO)
  2889. Praseodymium di(8-methylquinolinium) nitrate dihydrate
  2890. praseodymium fluoride (PrF3)
  2891. Praseodymium hafnate
  2892. Praseodymium hexacadmiumate
  2893. praseodymium hydride (PrH2)
  2894. praseodymium hydrogen selenite
  2895. Praseodymium hydrogen uranosilicate
  2896. Praseodymium hydrogen uranosilicate decahydrate
  2897. praseodymium hydroxide (Pr(OH)3)
  2898. praseodymium iodide (PrI3)
  2899. Praseodymium nitrilotriacetate
  2900. Praseodymium nitrilotriacetate trihydrate
  2901. praseodymium oxide (Pr2O3)
  2902. praseodymium oxide (Pr6O11)
  2903. praseodymium pentapotassium sulfate monohydrate
  2904. Praseodymium perchlorate dithiourea decahydrate
  2905. praseodymium phosphide (PrP)
  2906. praseodymium pyrostannate
  2907. praseodymium rubidium sulfate octahydrate
  2908. praseodymium selenide
  2909. praseodymium selenide (Pr3Se4)
  2910. praseodymium selenite monohydrate
  2911. praseodymium silicide (Pr5Si3)
  2912. praseodymium silicide (Pr5Si4)
  2913. praseodymium sulfide (Pr2S3)
  2914. praseodymium sulfide (Pr2S3)
  2915. praseodymium sulfide (Pr3S4)
  2916. praseodymium sulfide (PrS)
  2917. praseodymium sulfide (PrS2)
  2918. praseodymium tellurium oxide (Pr2TeO6)
  2919. praseodymium tetra(triethylammonium) nitrate
  2920. praseodymium tetraboride
  2921. praseodymium tetrapotassium sulfate monohydrate
  2922. praseodymium trifluoroacetate tri(trifluoroacetic acid)
  2923. praseodymium triniobium nonaoxide
  2924. praseodymium tripotassium sulfate dihydrate
  2925. Praseodymium undecacadmiumate
  2926. praseodymium(+3) cation phosphate
  2927. praseodymium(+3) cation trinitrate pentahydrate
  2928. praseodymium(3+) acetate (1:3) compd. with thiourea (1:1) monohydrate
  2929. praseodymium(3+) sodium 2,2',2'',2'''-(ethane-1,2-diyldinitrilo)tetraacetate
  2930. praseodymium(3+) vanadate (V6O17(4-)) (4:3)
  2931. praseodymium(3+) vanadate (VO3(1-)) (1:3)
  2932. praseodymium(III) arsenite trihydrate
  2933. Praseodymium(III) bis(1,10-phenanthroline 1-oxide) trichloride
  2934. praseodymium(III) chloride 4.5-hydrate
  2935. praseodymium(III) chloride dihydrate
  2936. praseodymium(III) chloride dipropanol
  2937. praseodymium(III) chloride hexaurea
  2938. praseodymium(III) chloride tetra(trimethylammoniumchloride)
  2939. praseodymium(III) chloride tetraurea
  2940. praseodymium(III) chloride tris(dimethylammoniumchloride)
  2941. praseodymium(III) chromate octahydrate
  2942. praseodymium(III) ethylsulfate
  2943. Praseodymium(III) histidine trinitrate monohydrate
  2944. praseodymium(III) hydrogen diselenite
  2945. praseodymium(III) metaborate hexahydrate
  2946. praseodymium(III) metavanadate tetrahydrate
  2947. praseodymium(III) nitrate ethylenediammonium nitrate tetrahydrate
  2948. praseodymium(III) nitrate hexahydrate
  2949. praseodymium(III) nitrate monohydrate
  2950. Praseodymium(III) nitrate tetracyclohexylammonium nitrate
  2951. praseodymium(III) nitrate tri(hydrazine dinitrate)
  2952. praseodymium(III) perchlorate heptahydrate
  2953. Praseodymium(III) perchlorate hexahydrate
  2954. Praseodymium(III) perchlorate hexaurea
  2955. Praseodymium(III) perchlorate nonahydrate
  2956. Praseodymium(III) perchlorate nonaurea
  2957. Praseodymium(III) perchlorate tetraurea
  2958. praseodymium(III) pyrophosphate tetracosahydrate
  2959. praseodymium(III) rubidium chloride pentahydrate
  2960. praseodymium(III) rubidium chloride tetrahydrate
  2961. praseodymium(III) selenate dodecahydrate
  2962. praseodymium(III) selenate monohydrate
  2963. praseodymium(III) selenate pentahydrate
  2964. praseodymium(III) sulfate hexahydrate
  2965. praseodymium(III) sulfate hexaurea
  2966. praseodymium(III) sulfate octahydrate
  2967. praseodymium(III) sulfate pentahydrate
  2968. praseodymium(III) sulfosalicylate heptahydrate
  2969. Praseodymium(III) tetrakis(5,6-benzoquinoline) trinitrate
  2970. Praseodymium(III) triindium(I)
  2971. Praseodymium(III) triisothiocyanate tris(2,6-Dimethylpicoline-N-oxide)
  2972. Praseodymium(III) trilead(I)
  2973. Praseodymium(III) tripotassium hexabromide
  2974. Praseodymium(III) triquinolinium nitrate monohydrate
  2975. Praseodymium(III) tris(1,4-thioxane-S-oxide trifluoroacetate)
  2976. Praseodymium(III) tris(2,6-dichlorobenzoic acid)
  2977. Praseodymium(III) tris(3-Methoxybenzoate)
  2978. Praseodymium(III) tris(3-nitro-1,2,4-triazol-5-onate)
  2979. Praseodymium(III) tris(3-nitro-1,2,4-triazol-5-onate) heptahydrate
  2980. Praseodymium(III) tris(indole-3-acetate)
  2981. Praseodymium(III) tris(N-phenylbenzohydroxamate)
  2982. Praseodymium(III) tris(salicylate)
  2983. Praseodymium(III) tris(salicylidene-β-alanine)
  2984. Praseodymium(III) trithallium(I)
  2985. Praseodymium(III) trithiocyanate heptahydrate
  2986. Praseodymium(III) tritin(I)
  2987. Praseodymium(III)-2,5-dihydroxybenzoate
  2988. praseodymium(III)iodide nonahydrate
  2989. praseodymium(III)iodide pentaurea
  2990. Praseodymium(III)trifluoromethanesulphonate octa(4-picoline-N-oxide)
  2991. Praseodymium(IV) tetrakis(hydrogen-3-nitro-1,2,4-triazol-5-onate hydrate) dihydrate
  2992. Praseodymium(IV) tetrakis(hydrogen-3-nitro-1,2,4-triazol-5-onate)
  2993. Prazepam
  2994. prazosin
  2995. precirol Ato5
  2996. pregabalin
  2997. pregn-4-ene-3,20-dione
  2998. Pregnenolone acetate
  2999. Premafloxacin
  3000. Primene JM-T
  3001. Proline, 1-(N-(trifluoroacetyl)-1-leucyl)methyl ester
  3002. promethium fluoride (PmF3)
  3003. promethium sulfide (Pm2S3)
  3004. Prop-2-en-1-yl 2-butyl-2-cyanohexanoate
  3005. Prop-2-enyl (2,4,5-trichlorophenyl) carbonate
  3006. Prop-2-enyl 1-cyanocyclohexane-1-carboxylate
  3007. Prop-2-enyl 1-cyanocyclopentane-1-carboxylate
  3008. Prop-2-enyl 2-benzyl-4-chlorophenyl carbonate
  3009. Prop-2-enyl 2-methylpropanedithioate
  3010. Prop-2-enyl 2-prop-2-enoxycarbonyloxypropanoate
  3011. prop-2-enyl 3,5-dinitrobenzoate
  3012. Prop-2-enyl 4-methylbenzenesulfinate
  3013. Prop-2-enyl N-butylcarbamate
  3014. prop-2-enyl N-naphthalen-1-ylcarbamate
  3015. Prop-2-enyl N-prop-2-enylcarbamate
  3016. prop-2-enyl nitrate
  3017. Prop-2-enyl quinolin-8-yl carbonate
  3018. Prop-2-enylphosphane
  3019. prop-2-ynoic acid (1-methylethylidene)di-4,1-phenylene ester
  3020. prop-2-ynoic acid 1,4-phenylene ester
  3021. prop-2-ynoic acid 1,5-naphthalenediyl ester
  3022. prop-2-ynoic acid 1,7-naphthalenediyl ester
  3023. prop-2-ynoic acid 2,7-naphthalenediyl ester
  3024. prop-2-ynoic acid oxydi-4,1-phenylene ester
  3025. prop-2-ynoic acid sulfonyldi-4,1-phenylene ester
  3026. prop-2-ynoic acid thiodi-4,1-phenylene ester
  3027. prop-2-ynoic acid [1,1'-biphenyl]-4,4'-diyl ester
  3028. prop-2-ynoic acid [2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]di-4,1-phenylene ester
  3029. Prop-2-ynoxybenzene
  3030. prop-2-ynyl (2E,4E)-3,7,11-trimethyldodeca-2,4-dienoate
  3031. Prop-2-ynylbenzene
  3032. Prop-2-ynylphosphane
  3033. Propacetamol hydrochloride
  3034. propafenone Hydrochloride
  3035. Propan-2-yl (2S)-2-hydroxy-2-phenylacetate
  3036. Propan-2-yl (E)-4-(2-nitroanilino)-4-oxobut-2-enoate
  3037. propan-2-yl 2,2-dimethylpropanoate
  3038. Propan-2-yl 2-acetoxypropanoate
  3039. propan-2-yl 3,5-dinitrobenzoate
  3040. Propan-2-yl 4-[(4-(4-chlorobenzoyloxy)phenyl)methylideneamino]benzoate
  3041. Propan-2-yl 4-[(4-(4-nitrobenzoyloxy)phenyl)methylideneamino]benzoate
  3042. Propan-2-yl 4-[({4-[(4-methylphenyl)carbonyloxy]phenyl}methylidene)amino]benzoate
  3043. Propan-2-yl 4-[4-(4-acetoxybenzoyloxy)benzylideneamino]benzoate
  3044. Propan-2-yl 4-[4-[4-(4-propan-2-yloxycarbonylphenyl)phenyl]phenyl]benzoate
  3045. Propan-2-yl 4-[[4-(4-methoxybenzoyl)oxyphenyl]methylideneamino]benzoate
  3046. Propan-2-yl prop-2-ene-1-sulfinate
  3047. Propan-2-ylboronic acid
  3048. Propan-2-ylidenecyclopentane
  3049. propanal
  3050. propanal dipropylhydrazone
  3051. propanal oxime
  3052. propanal propylhydrazone
  3053. propanamide
  3054. Propanaminium p-toluenesulfonate
  3055. propane
  3056. propane hydrate
  3057. propane(dithioic) acid ethyl ester
  3058. Propane-1,1,3,3-tetracarboxylic acid tetraethyl ester
  3059. Propane-1,2,3-trithiol
  3060. Propane-1,3-diyl bis(2-ethylhexanoate)
  3061. Propane-2-methyl-1,1,3,3-tetracarboxylic acid tetraethyl ester
  3062. Propane-2-phenyl-1,1,3,3-tetracarboxylic acid tetraethyl ester
  3063. Propane-2-sulfinyl Chloride
  3064. Propane-d8
  3065. propanediamide
  3066. propanedinitrile
  3067. propanedioate; tris(2-hydroxyethyl)azanium
  3068. propanedioic acid
  3069. propanedioic acid barium salt
  3070. propanedioic acid bis(1,1-dimethylethyl) ester
  3071. propanedioic acid bis(1-methylethyl) ester
  3072. propanedioic acid bis(2-methylbutyl) ester
  3073. propanedioic acid calcium salt
  3074. propanedioic acid dibutyl ester
  3075. propanedioic acid dicyclohexyl ester
  3076. propanedioic acid didecyl ester
  3077. propanedioic acid didodecyl ester
  3078. propanedioic acid diethyl ester
  3079. propanedioic acid diheptadecyl ester
  3080. propanedioic acid dihexadecyl ester
  3081. propanedioic acid dihydrazide
  3082. propanedioic acid dimethyl ester
  3083. propanedioic acid dioctadecyl ester
  3084. propanedioic acid dipentadecyl ester
  3085. propanedioic acid dipentyl ester
  3086. propanedioic acid dipotassium salt
  3087. propanedioic acid dipropyl ester
  3088. propanedioic acid ditetradecyl ester
  3089. propanedioic acid ditridecyl ester
  3090. propanedioic acid ethyl hexadecyl ester
  3091. Propanedioic acid monoethyl ester
  3092. propanedioic acid monopotassium salt
  3093. propanedioic acid monosodium salt
  3094. propanedioic acid strontium salt (1:1)
  3095. propanedioic-d2 acid-d2
  3096. propanediol
  3097. propanedioyl dichloride
  3098. Propanedioyl difluoride
  3099. Propanehydrazide
  3100. Propanehydrazide hydrogen chloride
  3101. propanenitrile
  3102. propaneperoxoic acid
  3103. Propanesulfonic acid propyl ester
  3104. propanesulfonic acid trimethylsilyl ester
  3105. propanethioic acid O-ethyl ester
  3106. propanethioic acid S-trifluoromethyl ester
  3107. propanoic acid
  3108. propanoic acid (2-propenyl)cyclohexyl ester
  3109. propanoic acid 1,1-dimethylethyl ester
  3110. propanoic acid 1-methyldecyl ester
  3111. propanoic acid 1-methylethyl ester
  3112. propanoic acid 1-methylhexyl ester
  3113. propanoic acid 1-methylpentyl ester
  3114. propanoic acid 1-methylpropyl ester
  3115. propanoic acid 1-methylpropyl ester
  3116. Propanoic acid 1-phenylvinyl ester
  3117. propanoic acid 2-(1-oxopropyl)hydrazide
  3118. propanoic acid 2-butyne-1,4-diyl ester
  3119. propanoic acid 2-methylpropyl ester
  3120. propanoic acid 2-propenyl ester
  3121. propanoic acid 3,3-dimethylbutyl ester
  3122. propanoic acid 3,3-dimethylpentyl ester
  3123. propanoic acid 3-chloropropenyl ester
  3124. propanoic acid ammonium salt
  3125. propanoic acid anhydride
  3126. propanoic acid barium salt
  3127. propanoic acid barium salt monohydrate
  3128. propanoic acid butyl ester
  3129. propanoic acid cadmium salt
  3130. propanoic acid calcium salt
  3131. propanoic acid cerium(3+) salt
  3132. propanoic acid cesium salt
  3133. propanoic acid compd. with formamide (1:1)
  3134. propanoic acid compd. with formamide (1:2)
  3135. propanoic acid cyclohexyl ester
  3136. propanoic acid d-1-methylheptyl ester
  3137. propanoic acid erbium(3+) salt
  3138. propanoic acid ethenyl ester
  3139. propanoic acid ethyl ester
  3140. propanoic acid gadolinium(3+) salt
  3141. propanoic acid heptyl ester
  3142. propanoic acid hexyl ester
  3143. propanoic acid lanthanum(3+) salt
  3144. propanoic acid lead(2+) salt
  3145. propanoic acid lithium salt
  3146. propanoic acid magnesium salt
  3147. propanoic acid methyl ester
  3148. propanoic acid neodymium(3+) salt
  3149. propanoic acid nonyl ester
  3150. propanoic acid octyl ester
  3151. propanoic acid pentyl ester
  3152. propanoic acid phenyl ester
  3153. propanoic acid phenylmethyl ester
  3154. propanoic acid potassium salt
  3155. propanoic acid praseodymium(3+) salt
  3156. propanoic acid propyl ester
  3157. propanoic acid rubidium salt
  3158. propanoic acid samarium(3+) salt
  3159. propanoic acid silver(1+) salt
  3160. propanoic acid sodium salt
  3161. propanoic acid thallium(1+) salt
  3162. propanoic acid triethylsilyl ester
  3163. propanoic acid trimethylsilyl ester
  3164. propanoic acid tripropylsilyl ester
  3165. propanoic acid, 2,3-dichloro-
  3166. Propanoic acid, 3,3-dimethylhex-1-en-2-yl ester
  3167. Propanoic acid, 3-ethyl-3-methylpent-1-en-2-yl ester
  3168. propanoic acid, 4-[(4-methoxyphenyl)iminomethyl]phenyl ester
  3169. propanoic-3,3,3-d3 acid methyl ester
  3170. propanoyl bromide
  3171. propanoyl chloride
  3172. propanoyl fluoride
  3173. propanoyl iodide
  3174. Propenyl-δ'-cyclohexenyl-ethynylcarbinol
  3175. Propenyl-δ'-cyclohexenylcarbinol
  3176. Propenyl-isopropenyl-ethynylcarbinol
  3177. Propenyl-isopropenyl-vinylethynylcarbinol
  3178. Propenylisopropenylcarbinol
  3179. propionatepentaamminecobalt(III) bromide
  3180. propionatepentaamminecobalt(III) chloride
  3181. propionatepentaamminecobalt(III) iodide
  3182. propionatepentaamminecobalt(III) nitrate
  3183. propionic acid, p-[(p-butoxybenzylidene)amino]phenyl ester
  3184. propionic acid, p-[(p-ethoxybenzylidene)amino]phenyl ester
  3185. propionic acid, p-[(p-methoxybenzylidene)amino]phenyl ester
  3186. propionic acid, p-[(p-pentoxybenzylidene)amino]phenyl ester
  3187. propionic acid, p-[(p-propoxybenzylidene)amino]phenyl ester
  3188. Propoxy acetamide
  3189. propoxybenzene
  3190. propoxydiethylaluminum dimer
  3191. Propoxymethylbenzene
  3192. propoxypropanol
  3193. propoxypyrazine
  3194. Propyl (2S)-2-hydroxy-2-phenylacetate
  3195. Propyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate
  3196. propyl (E)-3-(phenoxy)prop-2-enoate
  3197. Propyl (E)-4-(2-nitroanilino)-4-oxobut-2-enoate
  3198. Propyl 1,8-dimethylnaphthalene-4-carboxylate
  3199. Propyl 2,5-bis[(4-octoxybenzoyl)oxy]benzoate
  3200. Propyl 2-(2,4-dimethylphenyl)acetate
  3201. Propyl 2-benzyl-4-chlorophenyl carbonate
  3202. Propyl 2-propoxycarbonyloxypropanoate
  3203. Propyl 3,4-dihydroxybenzoate
  3204. Propyl 3,5-dinitrobenzoate
  3205. propyl 3-chloropropanoate
  3206. Propyl 4-(4-butanoylcyclohexyl)benzoate
  3207. Propyl 4-(4-hexanoylcyclohexyl)benzoate
  3208. Propyl 4-(4-octanoylcyclohexyl)benzoate
  3209. Propyl 4-(4-{4-[4-(propoxycarbonyl)phenyl]phenyl}phenyl)benzoate
  3210. Propyl 4-[(4-(4-chlorobenzoyloxy)phenyl)methylideneamino]benzoate
  3211. Propyl 4-[(4-(4-nitrobenzoyloxy)phenyl)methylideneamino]benzoate
  3212. Propyl 4-[(4-{2-[4-(octyloxy)phenyl]ethynyl}phenyl)methoxy]benzoate
  3213. Propyl 4-[4-(4-acetoxybenzoyloxy)benzylideneamino]benzoate
  3214. Propyl 4-[4-(4-cyanobenzoyloxy)benzylideneamino]benzoate
  3215. Propyl 4-[4-(4-methylbenzoyloxy)benzylideneamino]benzoate
  3216. Propyl 4-[[4-(4-methoxybenzoyl)oxyphenyl]methylideneamino]benzoate
  3217. Propyl 4-[[4-[(4-propoxycarbonylphenyl)iminomethyl]phenyl]methylideneamino]benzoate
  3218. Propyl 4-[[4-[2-(2,3,5,6-tetrafluoro-4-octoxyphenyl)ethynyl]phenyl]methoxy]benzoate
  3219. Propyl 5-benzoyl-2-(methoxycarbonylamino)benzimidazole-1-carboxylate
  3220. Propyl 6-benzoyl-2-(methoxycarbonylamino)benzimidazole-1-carboxylate
  3221. propyl hydroperoxide
  3222. propyl N-carbamoylcarbamate
  3223. propyl N-propylcarbamate
  3224. Propyl prop-2-ene-1-sulfinate
  3225. Propyl quinolin-8-yl carbonate
  3226. propyl(1-methoxybutyl)propanedioic acid diethyl ester
  3227. propyl(nitrato-κO)mercury
  3228. propyl-2-propynylcarbamothioic acid S-ethyl ester
  3229. Propyl-cyclohexyl-ethylcarbinol
  3230. Propyl-isobutyl-β-methoxyethylcarbinol
  3231. Propyl-isopropyl-butylcarbinol
  3232. propyl-tris-pentafluorobutanoyloxy-silane
  3233. propyl-tris-pentafluoropropanoyloxy-silane
  3234. propylammonium formate
  3235. Propylammonium hydrogen sulphate
  3236. propylarsonous dichloride
  3237. propylbenzene
  3238. propylbenzenesulfonic acid sodium salt
  3239. Propylboronic acid
  3240. Propylboronic acid diethanolamine ester
  3241. propylcyclohexane
  3242. Propylcyclohexylcarbinol
  3243. propylcyclopentane
  3244. Propyldiammonium iron(II) tetrachloride
  3245. Propyldiborane
  3246. Propyldithiopyrylmethane
  3247. propylferrocene
  3248. propylidenecyclopentane
  3249. propylmercury hydroxide
  3250. propylphosphonic acid dibutyl ester
  3251. propylphosphonic acid diethyl ester
  3252. propylphosphonic acid dipropyl ester
  3253. propylphosphonic dichloride
  3254. propylphosphonous dichloride
  3255. propylpropanedioic acid
  3256. propylpropanedioic acid dibutyl ester
  3257. propylpropanedioic acid diethyl ester
  3258. propylpropanedioic acid dimethyl ester
  3259. propylpropanedioic acid dipropyl ester
  3260. propylselenophosphonic acid diethyl ester
  3261. propylselenophosphonic acid dipropyl ester
  3262. propylsilane
  3263. propylthiophosphonic acid diethyl ester
  3264. propylthiophosphonic acid dipropyl ester
  3265. propylurea
  3266. protactinium iodide (PaI5)
  3267. Protopine
  3268. proustite (Ag3(AsS3))
  3269. pseudo malachite
  3270. pseudowollastonite (Ca(SiO3))
  3271. Ptassium magnesium trihydrogen
  3272. Pterostilbene
  3273. Pumpkinseed oil
  3274. PVE68
  3275. pyran
  3276. pyranthrene
  3277. pyrazinamine
  3278. pyrazine
  3279. Pyrazine-2,3-dicarboxylic acid
  3280. pyrazinecarbonitrile
  3281. pyrazinecarboxamide
  3282. pyrazinecarboxylic acid
  3283. pyrazinecarboxylic acid ethyl ester
  3284. pyrazinecarboxylic acid methyl ester
  3285. pyrene
  3286. pyrene, 1-methyl-
  3287. Pyrethrine I semicarbazone
  3288. Pyrethrolone
  3289. Pyrethrolone acetate
  3290. Pyrex glass
  3291. pyridazine
  3292. pyridin tetrahydrochloride
  3293. Pyridin-1-ium formate
  3294. Pyridin-1-ium propanoate
  3295. Pyridin-3-yl 4-[(4-butoxyphenyl)methylideneamino]benzoate
  3296. Pyridin-3-yl 4-[(4-decoxyphenyl)methylideneamino]benzoate
  3297. Pyridin-3-yl 4-[(4-ethoxyphenyl)methylideneamino]benzoate
  3298. Pyridin-3-yl 4-[(4-heptoxyphenyl)methylideneamino]benzoate
  3299. Pyridin-3-yl 4-[(4-hexoxyphenyl)methylideneamino]benzoate
  3300. Pyridin-3-yl 4-[(4-methoxyphenyl)methylideneamino]benzoate
  3301. Pyridin-3-yl 4-[(4-octoxyphenyl)methylideneamino]benzoate
  3302. Pyridin-3-yl 4-[(4-pentoxyphenyl)methylideneamino]benzoate
  3303. Pyridin-3-yl 4-[(4-propoxyphenyl)methylideneamino]benzoate
  3304. pyridine
  3305. pyridine 1-oxide
  3306. pyridine acetate
  3307. Pyridine bis(acetylacetonato)oxovanadium
  3308. Pyridine borane
  3309. pyridine compd. with 2,4,6-trinitrophenol (1:1)
  3310. pyridine compd. with silicon chloride (SiCl4) (2:1)
  3311. pyridine compd. with sulfur dioxide (1:1)
  3312. pyridine hydrobromide
  3313. pyridine hydrobromide compd. with thiourea (1:2)
  3314. pyridine hydrochloride
  3315. pyridine nitrate
  3316. pyridine perchlorate
  3317. pyridine sulfate (1:1)
  3318. pyridine-2,3-dicarboxylic acid
  3319. Pyridine-3,4-dicarboxylic acid
  3320. pyridine-3-carboxylic acid benzylidenehydrazide
  3321. pyridine-3-carboxylic acid N-oxide
  3322. pyridine-d5
  3323. pyridinium 1-cyano-2-ethoxy-2-oxoethylide
  3324. pyridinium 2-ethoxy-1-(ethoxycarbonyl)-2-oxoethylide
  3325. Pyridinium dibromoiodide
  3326. pyridinium dicyanomethylide
  3327. pyridinium ethoxyethylsulfate
  3328. pyridinium pentafluorotellurate
  3329. Pyridinium pentafluorotellurate(IV)
  3330. Pyrido(2,3-f)(1,7)phenanthroline
  3331. Pyrido(3,2-f)(1,7)phenanthroline
  3332. Pyridoxal benzoyl hydrazone
  3333. Pyridoxal-5-phosphate monohydrate
  3334. Pyrimethamine
  3335. pyrimethanil butanedioic salt
  3336. Pyrimethanil fumaric salt
  3337. Pyrimethanil maleic salt
  3338. pyrimethanil phenoxyacetate
  3339. pyrimidin-5-amine
  3340. pyrimidine
  3341. pyrimidine-2,5-diamine
  3342. pyrimidine-2-carbonitrile
  3343. pyrite (FeS2)
  3344. Pyrope
  3345. pyrosulfuryl fluoride isocyanate
  3346. pyroxene-group minerals
  3347. pyrrolidine
  3348. pyrrolidine acetate
  3349. pyrrolidine heptanoate
  3350. pyrrolidine hexanoate
  3351. pyrrolidine hydrochloride
  3352. pyrrolidine nonanoate
  3353. pyrrolidine octanoate
  3354. pyrrolidine trifluoroacetate
  3355. Pyrrolidine-1-carbonyl chloride
  3356. pyrrolidinium formate
  3357. Pyrrolidinium heptafluorobutyrate
  3358. pyrrolidinium hydrogen sulfate
  3359. pyrrolidinium nitrate
  3360. Pyrrolidonium bisulfate
  3361. Pyruvaldehyde N-aminophthalimide dihydrazone
  3362. Qquinolin-2-ylhydrazine
  3363. quartz (SiO2)
  3364. Quartzite
  3365. Quartzitic sandstone
  3366. quaternary ammonium compounds, tri-C8-10-alkylmethyl, chlorides
  3367. Quetiapine fumarate
  3368. quinazoline
  3369. quinolin-8-yl acetate
  3370. quinoline
  3371. quinoline 1-oxide
  3372. quinoline compd. with hexafluorobenzene (1:1)
  3373. quinoline formate
  3374. quinoline hydrochloride
  3375. quinoline nitrate
  3376. quinoline perchlorate
  3377. quinoline phosphate (1:1)
  3378. quinoline salt with chromic acid (H2CrO4) (1:1)
  3379. quinoline-2,4-dicarboxylic acid
  3380. Quinoline-2-carboxylic acid
  3381. quinoline-8-sulfonamide
  3382. quinoline-8-sulfonic acid anilide
  3383. Quinoline-N-oxide hydrate
  3384. quinolinium dipraseodymium(III) chloride trihydrate
  3385. quinoxaline
  3386. Quinoxaline-2-carboxylic acid
  3387. Quizalofop-p-ethyl
  3388. R-(+)-2-(2,2,3-Trimethylcyclopent-3-en-1-yl)acetonitrile
  3389. R-(+)-Binol
  3390. R-(+)-menthofuran
  3391. R-(2-(2,2,4,6-tetramethyl-1-piperidinyl)ethyl)-R-phenyl-2-pyridineacetamide
  3392. R-(2-(4-methyl-1-piperidinyl)ethyl)-R-phenyl-2-pridineacetamide
  3393. R-(2-(bis(1-methylethyl)amino)ethyl)-N-cyclohexyl-R-phenyl-2-pyridineacetamide
  3394. R-(2-(bis(1-methylethyl)amino)ethyl)-R-(3,4-dimethoxyphenyl)-2-pyridineacetamide
  3395. R-(2-(bis(1-methylethyl)amino)ethyl)-R-(3-methylphenyl)-2-pyridineacetamide
  3396. R-(2-(bis(1-methylethyl)amino)ethyl)-R-(4-chlorophenyl)-2-pyridineacetamide
  3397. R-(2-(bis(1-methylethyl)amino)ethyl)-R-(4-fluorophenyl)-2-pyridineacetamide
  3398. R-(2-(bis(1-methylethyl)amino)ethyl)-R-(4-methylphenyl)-2-pyridineacetamide
  3399. R-(2-(bis(1-methylethyl)amino)ethyl)-R-phenyl-1-naphthaleneacetamide
  3400. R-(2-(bis(1-methylethyl)amino)ethyl)-R-phenyl-2-pyridineacetic acid (1-methylethylidene)hydrazide
  3401. R-(2-(bis(1-methylethyl)amino)ethyl)-R-phenyl-3-pyridineacetamide
  3402. R-(2-(bis(1-methylethyl)amino)ethyl)-R-phenyl-4-pyridineacetamide
  3403. R-(2-(bis(1-methylethyl)amino)ethyl)-R-phenyl-N-2-pyridinyl-2-pyridineacetamide
  3404. R-(2-(bis(2-propenyl)amino)ethyl)-R-phenyl-2-pyridineacetamide
  3405. R-(2-(dimethylamino)ethyl)-R-phenyl-2-pyridineacetamide
  3406. R-(2-(dipropylamino)ethyl)-R-phenyl-2-pyridineacetamide
  3407. R-(2-(methyl(phenylmethyl)amino)ethyl)-R-phenyl-2-pyridineacetamide
  3408. R-(2-Cyclopenta-2,4-dien-1-yl-1-methoxyethyl)benzene
  3409. R-Equol
  3410. R-phenyl-R-2-pyridinyl-3-azabicyclo[3.2.2]nonane-3-butanamide
  3411. R-phenyl-R-2-pyridinyl-3-azabicyclo[3.2.2]nonane-3-pentanamide
  3412. R-phenyl-R-2-pyridinyl-4-morpholinebutanamide
  3413. R-phenyl-R-2-pyridinyl-7-azabicyclo[2.2.1]heptane-7-butanamide
  3414. rabbeth spindle oil
  3415. rac-(1R,2R,5R,6R)-1,2,5,6-Tetrabromocyclooctane
  3416. racemic-2,3-Di-tert-butylsuccinic anhydride
  3417. racemic-2,3-Diethylsuccinonitrile
  3418. racemic-2-Octyl nitrate
  3419. racemic-3,4-Diphenylhexane-2,5-dione
  3420. racemic-Desmotroposantonin
  3421. radium bromide (RaBr2)
  3422. radium chloride (RaCl2)
  3423. radon
  3424. Ramipril
  3425. ramol 350
  3426. rape oil
  3427. rape oil
  3428. rape oil Me ester
  3429. rapeseed oil biodiesel
  3430. Rat fat
  3431. Rebaudioside A
  3432. red oil
  3433. Refined corn oil
  3434. Refined grape seed oil
  3435. refined sunflower oil
  3436. Regorafenib
  3437. rel-((1R)-1-((1R)-1-methylpropoxy)ethyl)benzene
  3438. rel-((1R)-1-((1S)-1-methylpropoxy)ethyl)benzene
  3439. rel-1,1'-((1R,2R)-1,2-dimethyl-1,2-ethanediyl)bisbenzene
  3440. rel-1,1'-((1R,2S)-1,2-dimethyl-1,2-ethanediyl)bisbenzene
  3441. rel-1-((2R)-1-methyl-2-pyrrolidinyl)-3-((2S)-1-methyl-2-pyrrolidinyl)-2-propanone
  3442. rel-2,2-dichloro-N-((1R,2R)-2-hydroxy-1-(hydroxymethyl)-2-(4-nitrophenyl)ethyl)acetamide
  3443. reserpine
  3444. reservoir Fluid
  3445. Resorcinol bis(cyclic 2,2-dimethyl-1,3-propanediol phosphate)
  3446. retinol
  3447. retinol acetate
  3448. retinol hexadecanoate
  3449. Retrorsine
  3450. rhenium
  3451. rhenium chloride (ReCl3)
  3452. rhenium chloride (ReCl5)
  3453. rhenium chloride oxide (ReCl4O)
  3454. rhenium fluoride (ReF4)
  3455. rhenium fluoride (ReF5)
  3456. rhenium fluoride oxide (ReF4O)
  3457. rhenium iodide (ReI3)
  3458. rhenium oxide (Re2O7)
  3459. rhenium silicide (ReSi2)
  3460. rhenium sulfide (ReS2)
  3461. rhenium tribromide
  3462. rhodium
  3463. Rhodium (IV) oxide
  3464. Rhodium antimony
  3465. rhodium chloride (RhCl3)
  3466. rhodium fluoride (RhF3)
  3467. Rhodium triantimony
  3468. Rhodium uranoniobate
  3469. Rhodium(III) 3-dimethylaminomethyl indole bis(salicylaldehydeoxime) chloride
  3470. Rhodium(III) bis(salicylaldehydeoxime) chloride
  3471. Rhodium(III) bis(triethanolamine) trichloride
  3472. Rhodium(III) tris(N-methylcyclohexyl dithiocarbamate)
  3473. ribaric acid
  3474. Ribavirin
  3475. ribitol
  3476. riboflavine
  3477. rice bran oil ethyl ester
  3478. rice wax
  3479. Ricebran biodiesel
  3480. rifampicin
  3481. rifamycin SV
  3482. Riluzole
  3483. Rimantadine hydrochloride
  3484. rivaroxaban
  3485. RL 32H lubricant oil
  3486. RL 68H lubricant oil
  3487. Rock
  3488. Rocket Propellant 1
  3489. Roflumilast
  3490. Rosin amine D acetate
  3491. Rotigotine
  3492. RP 2
  3493. RP-5 jet fuel
  3494. rubber
  3495. rubber
  3496. Rubidate
  3497. rubidium
  3498. rubidium μ-oxodioxo(trioxovanadate)uranate(1-)
  3499. rubidium (orthoarsenato(3-)-κO)dioxouranate(1-)
  3500. rubidium (orthoarsenato(3-)-κO)oxotitanate(1-)
  3501. rubidium (T-4)-rhenate (ReO4(1-))
  3502. rubidium (T-4)-tetrahydroaluminate(1-)
  3503. Rubidium 2-hydroxyethanolate
  3504. rubidium 3-hydroxybenzoate monohydrate
  3505. rubidium 4-hydroxybenzoate monohydrate
  3506. rubidium aluminium selenate dodecahydrate
  3507. rubidium aluminium sulfate dodecahydrate
  3508. rubidium antimonate (O3Sb(1-))
  3509. rubidium antimony (III) chloride monohydrate
  3510. Rubidium antimony fluoride
  3511. rubidium azide (Rb(N3))
  3512. rubidium bis(diethyldithiocarbamodithioato-κS,κS')dioxouranate(1-)
  3513. rubidium borate (BO2(1-))
  3514. rubidium bromide (RbBr)
  3515. rubidium bromochlorobromate(1-)
  3516. rubidium bromochloroiodate(1-)
  3517. rubidium bromoiodochloride monohydrate
  3518. rubidium cadmium fluoride
  3519. Rubidium calcium chloride
  3520. Rubidium calcium fluoride
  3521. rubidium carbonate dihydrate
  3522. rubidium carbonate hexa(hydrogen peroxide)
  3523. rubidium carbonate nonahydrate
  3524. rubidium carbonate octahydrate
  3525. rubidium carbonate tetrahydrate
  3526. rubidium carbonate tri(hydrogen peroxide)
  3527. Rubidium cerium oxide
  3528. rubidium chloride (RbCl)
  3529. rubidium chloride mono(selenium oxychloride)
  3530. rubidium chloromethanedisulfonate
  3531. rubidium chromium chloride
  3532. rubidium chromium(III) sulfate dodecahydrate
  3533. rubidium cobalt chloride dihydrate
  3534. rubidium cobalt fluoride monohydrate
  3535. rubidium cyanide (Rb(CN))
  3536. Rubidium diantimony fluoride
  3537. rubidium dibarium nitrite
  3538. rubidium diberyllium fluoride
  3539. rubidium dibromoiodate(1-)
  3540. Rubidium dicadmium pentachloride monohydrate
  3541. Rubidium dicesium lanthanum(III) hexachloride
  3542. rubidium dichloroiodate(1-)
  3543. Rubidium difluoro vanadium(IV) oxide monohydrate
  3544. rubidium dilithium chloride tetrahydrate
  3545. rubidium dimagnesium sulfate
  3546. rubidium dioxo(phosphato(3-)-κO)uranate(1-)
  3547. Rubidium dioxouranium phosphate trihydrate
  3548. Rubidium ditellurium(IV) oxide
  3549. Rubidium ditin(II) pentafluoride
  3550. rubidium fluoride (Rb(HF2))
  3551. rubidium fluoride (RbF)
  3552. rubidium fluoride (RbF) hydrate (2:3)
  3553. Rubidium fluoride bis(bromine trifluoride)
  3554. rubidium fluoride bis(hydrogen fluoride)
  3555. Rubidium fluoride di(acetic acid)
  3556. rubidium fluoride dihydrate
  3557. Rubidium fluoride mono(acetic acid)
  3558. Rubidium fluoride mono(bromine trifluoride)
  3559. rubidium fluoride tetrahydrate
  3560. rubidium fluoride trihydrate
  3561. rubidium fluoride tris(hydrogen fluoride)
  3562. rubidium formate monohydrate
  3563. rubidium gadolinium(III) chloride tetrahydrate
  3564. rubidium gallium(III) fluoride dihydrate
  3565. rubidium hafnium fluoride monohydrate
  3566. rubidium hexachloro titanate
  3567. rubidium hexafluoroarsenate
  3568. rubidium hexaiodotellurate(IV)
  3569. rubidium hydride (RbH)
  3570. rubidium hydrogen (orthosilicato(4-)-κO)dioxouranate(2-) monohydrate
  3571. rubidium hydrogen oxalate
  3572. rubidium hydrogen sulfate monosulfuric acid
  3573. rubidium hydrogen sulfate trisulfuric acid
  3574. Rubidium hydrogen uranosilicate monohydrate
  3575. rubidium hydrogenselenite
  3576. rubidium hydrogenselenite monoselenious acid
  3577. rubidium hydroxide (Rb(OH))
  3578. rubidium hydroxide (Rb(OH))
  3579. rubidium hydroxide 1/3 hydrate
  3580. rubidium hydroxide monohydrate
  3581. rubidium hydroxide tetrahydrate
  3582. rubidium hydroxide trihydrate
  3583. rubidium indium disulfate trihydrate
  3584. rubidium indium pyrophosphate tetrahydrate
  3585. rubidium indium(III) fluoride dihydrate
  3586. Rubidium indium(III) selenate tetrahydrate
  3587. rubidium iodate bis iodic acid
  3588. rubidium iodide (Rb(I3))
  3589. rubidium iodide (RbI)
  3590. rubidium iodide hexaammonia
  3591. rubidium ion (Rb(1+))
  3592. rubidium iron(II) sulfate hexahydrate
  3593. rubidium lanthanum(III) chloride pentahydrate
  3594. rubidium lanthanum(III) chloride tetrahydrate
  3595. rubidium lithium hexafluorosilicate
  3596. rubidium magnesium bromide
  3597. rubidium magnesium chloride
  3598. rubidium magnesium chloride hexahydrate
  3599. rubidium magnesium nitrite trihydrate
  3600. rubidium magnesium sulfate hexahydrate
  3601. rubidium magnesium sulfate tetrahydrate
  3602. Rubidium mandelate
  3603. Rubidium mandelate monomandelic acid
  3604. Rubidium mandelate trimandelic acid
  3605. rubidium manganese bromide hexahydrate
  3606. rubidium mercury(II)chloride monohydrate
  3607. rubidium methanedisulfonate
  3608. rubidium nickel bromide hexahydrate
  3609. rubidium nickel chloride dihydrate
  3610. rubidium nickel fluoride monohydrate
  3611. rubidium niobate(NbO3(1-))
  3612. rubidium nitrate * Dinitric acid
  3613. rubidium nitrate * Nitric acid
  3614. rubidium oxalate monohydrate
  3615. rubidium pentaborate
  3616. rubidium pentaborate tetrahydrate
  3617. rubidium pentamercury(II)chloride
  3618. rubidium perbromate
  3619. Rubidium phosphide
  3620. Rubidium pivalate
  3621. rubidium salicylate monohydrate
  3622. rubidium samarium(III) chloride tetrahydrate
  3623. Rubidium sulfamate
  3624. rubidium sulfide (Rb2(S2))
  3625. rubidium superoxide (Rb(O2))
  3626. rubidium tantalate(TaO3(1-))
  3627. Rubidium tetraantimony fluoride
  3628. rubidium tetrachloro oxotitanate monohydrate
  3629. rubidium tetrachloroiodate(1-)
  3630. rubidium tetrafluoroborate(1-)
  3631. rubidium tetrahydroborate(1-)
  3632. rubidium tetrahydroxopentaborate(III) dihydrate
  3633. rubidium tetraphenylborate(1-)
  3634. Rubidium titanyl arsenate
  3635. rubidium tri-μ-iododiiodotetraargentate(1-)
  3636. Rubidium triantimony fluoride
  3637. rubidium tribromocadmate(1-)
  3638. rubidium trichlorocadmate(1-)
  3639. rubidium trifluoroberyllate(1-)
  3640. rubidium trifluorocadmate(1-)
  3641. rubidium trifluorocalciate(1-)
  3642. rubidium trifluorocobaltate(1-)
  3643. rubidium trifluoromagnesate(1-)
  3644. rubidium trifluoromanganate(1-)
  3645. rubidium trifluoronickelate(1-)
  3646. rubidium trihydrogen oxalate dihydrate
  3647. rubidium uranium arsenate oxide (RbU(AsO4)O2)
  3648. rubidium uranium arsenate oxide (RbU(AsO4)O2) hydrate (2:1)
  3649. rubidium uranium arsenate oxide (RbU(AsO4)O2) monohydrate
  3650. rubidium uranium arsenate oxide (RbU(AsO4)O2) trihydrate
  3651. rubidium uranium borate oxide (RbU(BO3)O2)
  3652. rubidium uranium borate oxide (RbU(BO3)O2) monohydrate
  3653. rubidium uranyl molybdate
  3654. rubidium vanadate (VO3(1-))
  3655. rubidium vanadium(III) sulfate dodecahydrate
  3656. rubidium ytterbium (III) nitrate trihydrate
  3657. rubidium zinc borophosphate
  3658. rubidium zirconium fluoride monohydrate
  3659. rubidium(+1) cation hydroxide dihydrate
  3660. rubidium(+1) cation tetraborate
  3661. Rubidium(I) difluorobromoacetate
  3662. Rubidium(I) difluorochloroacetate
  3663. Rubidium(I) tetrafluoroiodate
  3664. ruthenium
  3665. Ruthenium diantimony
  3666. ruthenium carbonyl (Ru(CO)5)
  3667. ruthenium fluoride (RuF5)
  3668. ruthenium fluoride oxide (RuF4O)
  3669. ruthenium oxide (RuO2)
  3670. ruthenium strontium oxide (RuSrO3)
  3671. Ruthenium(II) cadmium(II) tris(2,2'-dipyridyl) tetrabromide
  3672. Ruthenium(II) cadmium(II) tris(2,2'-dipyridyl) tetrachloride
  3673. Ruthenium(II) cadmium(II) tris(2,2'-dipyridyl) tetraiodide
  3674. Ruthenium(II) dicadmium(II) tris(2,2'-dipyridyl) hexabromide
  3675. Ruthenium(II) dicadmium(II) tris(2,2'-dipyridyl) hexachloride
  3676. Ruthenium(II) dicadmium(II) tris(2,2'-dipyridyl) hexaiodide
  3677. Ruthenium(II) pentacadmium(II) tris(2,2'-dipyridyl) dodecachloride
  3678. Ruthenium(II) tetracadmium(II) tris(2,2'-dipyridyl) decachloride
  3679. Ruthenium(II) tricadmium(II) tris(2,2'-dipyridyl) octachloride
  3680. Ruthenium(III) bis(6-amino-5-nitrosopyrimidine-2,4-diol) antipyrine chloride
  3681. Ruthenium(III) bis(6-amino-5-nitrosopyrimidine-2,4-diol) chloride
  3682. Ruthenium(III) bis(triethanolamine) trichloride
  3683. Ruthenium(III) tris(N-methylcyclohexyl dithiocarbamate)
  3684. ruthenocene
  3685. S 20 (standard fluid)
  3686. S(+)-Fenfluramine hydrochloride
  3687. S,S'-methylenephosphorodithioic acid O,O,O',O'-tetraethyl ester
  3688. S,S-bis(pentafluoroethyl)sulfoximine
  3689. S,S-bis(trifluoromethyl)-N-((trifluoromethyl)sulfinyl)sulfoximine
  3690. S,S-bis(trifluoromethyl)-N-((trifluoromethyl)thio)sulfoxime
  3691. S,S-bis(trifluoromethyl)-N-(2,2,2-trifluoro-1-(trifluoromethyl)-1-((2,2,2-trifluoro-1-(trifluoromethyl)ethylidene)amino)ethyl)sulfilimine
  3692. S,S-bis(trifluoromethyl)-N-(trimethylsilyl)sulfoximine
  3693. S,S-bis(trifluoromethyl)sulfoximine
  3694. S,S-dichloro-N-(tetrafluoro-1-(trifluoromethyl)ethyl)sulfilimine
  3695. S,S-dichloro-N-heptafluoropropylsulfilimine
  3696. S,S-dipropyl-N-diethylamidodithiophosphite
  3697. S-(((4-chlorophenyl)thio)methyl)phosphorodithioic acid O,O-diethyl ester
  3698. S-(+)-2,6-Dimethyloctane
  3699. S-(-)-2-chloropropanoic acid
  3700. S-(-)-Binol
  3701. S-(1,4-Diphenyl-1,6-dihydro-6-thioxo-1,3,5-triazinyl)mercaptosuccinic acid
  3702. S-(2,4-dichlorobenzenamino) butyl thiocarbonate
  3703. S-(2-acetamido-3-oxobutyl) ethanethioate
  3704. S-(2-Bromo-4-octoxyphenyl) 4-butoxybenzenecarbothioate
  3705. S-(2-Bromo-4-octoxyphenyl) 4-octoxybenzenecarbothioate
  3706. S-(2-Chloro-4-octoxyphenyl) 4-butoxybenzenecarbothioate
  3707. S-(2-Chloro-4-octoxyphenyl) 4-octoxybenzenecarbothioate
  3708. S-(2-Fluoro-4-hexoxyphenyl) 4-cyanobenzenecarbothioate
  3709. S-(2-Fluoro-4-hexoxyphenyl) 4-ethoxybenzenecarbothioate
  3710. S-(2-Fluoro-4-hexoxyphenyl) 4-hexoxybenzenecarbothioate
  3711. S-(2-Fluoro-4-octoxyphenyl) 4-butoxybenzenecarbothioate
  3712. S-(2-Fluoro-4-octoxyphenyl) 4-cyanobenzenecarbothioate
  3713. S-(2-Fluoro-4-octoxyphenyl) 4-decoxybenzenecarbothioate
  3714. S-(2-Fluoro-4-octoxyphenyl) 4-ethoxybenzenecarbothioate
  3715. S-(2-Fluoro-4-octoxyphenyl) 4-hexoxybenzenecarbothioate
  3716. S-(2-Fluoro-4-octoxyphenyl) 4-nitrobenzenecarbothioate
  3717. S-(2-Fluoro-4-octoxyphenyl) 4-octoxybenzenecarbothioate
  3718. S-(2-Methyl-4-octoxyphenyl) 4-butoxybenzenecarbothioate
  3719. S-(2-Methyl-4-octoxyphenyl) 4-octoxybenzenecarbothioate
  3720. S-(2-methylanilino) butyl thiocarbonate
  3721. S-(2-methylbenzoyl)sulfanyl 2-methylbenzenecarbothioate
  3722. S-(2-Methylmercaptophenyl)-N,N-diphenylthiocarbamate
  3723. S-(2-Methylmercaptophenyl)-N-naphthalen-1-ylthiocarbamate
  3724. S-(2-Methylmercaptophenyl)-N-phenylthiocarbamate
  3725. S-(2-methylphenyl) [[(E)-2-[(2-methylphenyl)sulfanylcarbonylamino]ethenyl]amino]methanethioate
  3726. S-(2-trifluoromethylphenyl) benzenecarbothioate
  3727. S-(3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctyl) 3-bromobenzene-1-carbothioate
  3728. S-(3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctyl) 3-nitrobenzene-1-carbothioate
  3729. S-(3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctyl) 4-(4-prop-2-enoxyphenyl)benzenecarbothioate
  3730. S-(3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctyl) 4-(4-undec-10-enoxyphenyl)benzenecarbothioate
  3731. S-(3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctyl) 4-(prop-2-en-1-yloxy)benzene-1-carbothioate
  3732. S-(3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctyl) 4-bromobenzene-1-carbothioate
  3733. S-(3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctyl) 4-nitrobenzene-1-carbothioate
  3734. S-(3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctyl) 4-undec-10-enoxybenzenecarbothioate
  3735. S-(4-chloroanilino) butyl thiocarbonate
  3736. S-(4-Chlorophenyl) 4-butoxybenzenecarbothioate
  3737. S-(4-Chlorophenyl) 4-decoxybenzenecarbothioate
  3738. S-(4-Chlorophenyl) 4-heptoxybenzenecarbothioate
  3739. S-(4-Chlorophenyl) 4-hexadecyloxybenzenecarbothioate
  3740. S-(4-Chlorophenyl) 4-nonoxybenzenecarbothioate
  3741. S-(4-Chlorophenyl) 4-octoxybenzenecarbothioate
  3742. S-(4-Chlorophenyl) 4-pentadecyloxybenzenecarbothioate
  3743. S-(4-Chlorophenyl) 4-tetradecyloxybenzenecarbothioate
  3744. S-(4-Chlorophenyl) 4-undecoxybenzenecarbothioate
  3745. S-(4-cyclohexylamino-anilino) butyl thiocarbononate
  3746. S-(4-Decylphenyl) 4-decoxybenzenecarbothioate
  3747. S-(4-Decylphenyl) 4-decylbenzenecarbothioate
  3748. S-(4-Decylphenyl) 4-dodecoxybenzenecarbothioate
  3749. S-(4-Decylphenyl) 4-dodecylbenzenecarbothioate
  3750. S-(4-Decylphenyl) 4-heptoxybenzenecarbothioate
  3751. S-(4-Decylphenyl) 4-nonylbenzenecarbothioate
  3752. S-(4-Decylphenyl) 4-octoxybenzenecarbothioate
  3753. S-(4-Decylphenyl) 4-tetradecoxybenzenecarbothioate
  3754. S-(4-Dodecylphenyl) 4-octoxybenzenecarbothioate
  3755. S-(4-Heptylphenyl) 4-decoxybenzenecarbothioate
  3756. S-(4-Heptylphenyl) 4-decylbenzenecarbothioate
  3757. S-(4-Heptylphenyl) 4-dodecoxybenzenecarbothioate
  3758. S-(4-Heptylphenyl) 4-dodecylbenzenecarbothioate
  3759. S-(4-Heptylphenyl) 4-heptoxybenzenecarbothioate
  3760. S-(4-Heptylphenyl) 4-heptylbenzenecarbothioate
  3761. S-(4-Heptylphenyl) 4-nonoxybenzenecarbothioate
  3762. S-(4-Heptylphenyl) 4-nonylbenzenecarbothioate
  3763. S-(4-Heptylphenyl) 4-octoxybenzenecarbothioate
  3764. S-(4-Heptylphenyl) 4-octylbenzenecarbothioate
  3765. S-(4-Heptylphenyl) 4-tetradecoxybenzenecarbothioate
  3766. S-(4-Heptylphenyl) 4-undecoxybenzenecarbothioate
  3767. S-(4-Hexylphenyl) 4-decoxybenzenecarbothioate
  3768. S-(4-Hexylphenyl) 4-decylbenzenecarbothioate
  3769. S-(4-Hexylphenyl) 4-dodecoxybenzenecarbothioate
  3770. S-(4-Hexylphenyl) 4-heptoxybenzenecarbothioate
  3771. S-(4-Hexylphenyl) 4-heptylbenzenecarbothioate
  3772. S-(4-Hexylphenyl) 4-hexoxybenzenecarbothioate
  3773. S-(4-Hexylphenyl) 4-nonylbenzenecarbothioate
  3774. S-(4-Hexylphenyl) 4-octoxybenzenecarbothioate
  3775. S-(4-Hexylphenyl) 4-octylbenzenecarbothioate
  3776. S-(4-Hexylphenyl) 4-tetradecoxybenzenecarbothioate
  3777. S-(4-methylbenzenamino) butyl thiocarbonate
  3778. S-(4-methylbenzoyl)sulfanyl 4-methylbenzenecarbothioate
  3779. S-(4-morpholinyl) butyl thiocarbonate
  3780. S-(4-Octoxyphenyl) 4-butoxybenzenecarbothioate
  3781. S-(4-Octoxyphenyl) 4-hexoxybenzenecarbothioate
  3782. S-(4-Octoxyphenyl) 4-octoxybenzenecarbothioate
  3783. S-(4-Octylphenyl) 4-decoxybenzenecarbothioate
  3784. S-(4-Octylphenyl) 4-decylbenzenecarbothioate
  3785. S-(4-Octylphenyl) 4-dodecoxybenzenecarbothioate
  3786. S-(4-Octylphenyl) 4-heptoxybenzenecarbothioate
  3787. S-(4-Octylphenyl) 4-heptylbenzenecarbothioate
  3788. S-(4-Octylphenyl) 4-nonylbenzenecarbothioate
  3789. S-(4-Octylphenyl) 4-octoxybenzenecarbothioate
  3790. S-(4-Octylphenyl) 4-tetradecoxybenzenecarbothioate
  3791. S-(4-Octylphenyl) 4-undecoxybenzenecarbothioate
  3792. S-(4-Pentylphenyl) 4-butoxybenzenecarbothioate
  3793. S-(4-Pentylphenyl) 4-decoxybenzenecarbothioate
  3794. S-(4-Pentylphenyl) 4-decylbenzenecarbothioate
  3795. S-(4-Pentylphenyl) 4-dodecoxybenzenecarbothioate
  3796. S-(4-Pentylphenyl) 4-dodecylbenzenecarbothioate
  3797. S-(4-Pentylphenyl) 4-hexylbenzenecarbothioate
  3798. S-(4-Pentylphenyl) 4-nonoxybenzenecarbothioate
  3799. S-(4-Pentylphenyl) 4-nonylbenzenecarbothioate
  3800. S-(4-Pentylphenyl) 4-octylbenzenecarbothioate
  3801. S-(4-Pentylphenyl) 4-tetradecoxybenzenecarbothioate
  3802. S-(4-Pentylphenyl) 4-tridecoxybenzenecarbothioate
  3803. S-(4-Pentylphenyl) 4-undecoxybenzenecarbothioate
  3804. S-(benzoylsulfanyl) benzenecarbothioate
  3805. S-(carboxydecyl)-2,4-dioxa-3,3-dimethyl-[3.3.0]bicyclooctane-7-sulfonium perchlorate
  3806. S-(carboxydecyl)-2-methyltetrahydrothiophene compd. with perchloric acid
  3807. S-(carboxydecyl)ethylmethylsulfonium perchlorate
  3808. S-(carboxydecyl)methylphenylsulfonium perchlorate
  3809. S-(carboxydecyl)tetrahydro-2H-thiopyran compd. with perchloric acid
  3810. S-(carboxydecyl)tetrahydrothiophene compd. with perchloric acid
  3811. S-(carboxydodecyl)-2-methyltetrahydrothiophene compd. with perchloric acid
  3812. S-(carboxydodecyl)tetrahydro-2H-thiopyran compd. with perchloric acid
  3813. S-(carboxydodecyl)tetrahydrothiophene compd. with perchloric acid
  3814. S-(carboxytetradecyl)diphenylsulfonium perchlorate
  3815. S-(carboxytridecyl)-2-methyltetrahydrothiophene compd. with perchloric acid
  3816. S-(carboxytridecyl)tetrahydro-2H-thiopyran compd. with perchloric acid
  3817. S-(carboxytridecyl)tetrahydrothiophene compd. with perchloric acid
  3818. S-(carboxyundecyl)-2-methyltetrahydrothiophene compd. with perchloric acid
  3819. S-(carboxyundecyl)tetrahydro-2H-thiopyran compd. with perchloric acid
  3820. S-(carboxyundecyl)tetrahydrothiophene compd. with perchloric acid
  3821. S-(pentafluoroethyl)-S-(trifluoromethyl)sulfoximine
  3822. S-(trifluoromethylsulfanyl) 2,2,2-trifluoroethanethioate
  3823. S-(trifluoromethylsulfanyl) 2-fluoro-2-oxoethanethioate
  3824. S-4-Chlorophenyl 4-(hexyloxy)benzene-1-carbothioate
  3825. S-4-Chlorophenyl 4-(pentyloxy)benzene-1-carbothioate
  3826. S-Benzyl O-ethyl carbonodithioate
  3827. S-Benzyloxycarbonyl-2-aminoethanethiol hydrobromide
  3828. S-Benzyloxycarbonyl-2-aminoethanethiol hydrochloride
  3829. S-Benzyloxycarbonyl-2-aminoethanethiol hydroiodide
  3830. S-bis (5,5-dimethyl-1,3-dioxaphosphorinanyl-2-oxy phosphate ester)
  3831. S-butyl (phenylamino)methanethioate
  3832. S-butyl N-pentylcarbamothioate
  3833. S-butyl [[(E)-2-(butylsulfanylcarbonylamino)ethenyl]amino]methanethioate
  3834. S-Butyl-N,N'-bis((S)-1-phenylethyl)thiouronium bis(trifluoromethylsulfonyl)imide
  3835. S-Butyl-N,N'-bis((S)-1-phenylethyl)thiouronium bromide
  3836. S-Butyl-N,N'-bis((S)-1-phenylethyl)thiouronium hexafluorophosphate
  3837. S-Butyl-N,N'-bis((S)-1-phenylethyl)thiouronium iodide
  3838. S-Butyltetrahydrothiophenium iodide
  3839. S-Butyltetrahydrothiophenium tetraphenylborate
  3840. S-Chloro-S-(1-chloro-3-methylbutyl)-N-ethyloxathiaziridine
  3841. S-Chloro-S-3-methylbutyl-N-ethyloxathiaziridine
  3842. S-Chloro-S-butyl-N-ethyloxathiaziridine
  3843. S-Chloro-S-cyclohexyl-N-ethyloxathiaziridine
  3844. S-Decyl-N,N'-bis((S)-1-phenylethyl)thiouronium bis(trifluoromethylsulfonyl)imide
  3845. S-Decyl-N,N'-bis((S)-1-phenylethyl)thiouronium iodide
  3846. S-Decyltetrahydrothiophenium bis(trifluoromethylsulfonyl)imide
  3847. S-Decyltetrahydrothiophenium iodide
  3848. S-Decyltetrahydrothiophenium tetraphenylborate
  3849. S-dodecyl [[(E)-2-(dodecylsulfanylcarbonylamino)ethenyl]amino]methanethioate
  3850. S-Dodecyl-N,N'-bis((S)-1-phenylethyl)thiouronium bis(trifluoromethylsulfonyl)imide
  3851. S-Dodecyl-N,N'-bis((S)-1-phenylethyl)thiouronium iodide
  3852. S-Ethyl benzenecarbothioate
  3853. S-ethyl-N'-(methylbenzenesulfonyl)-N-(1-methylpropyl)carbamimidothioic acid
  3854. S-ethyl-N'-(methylbenzenesulfonyl)-N-(2-methylpropyl)carbamimidothioic acid
  3855. S-ethyl-N'-(methylbenzenesulfonyl)-N-octylcarbamimidothioic acid
  3856. S-ethyl-N'-(methylbenzenesulfonyl)carbamimidothioic acid
  3857. S-Ethyl-N,N'-bis((S)-1-phenylethyl)thiouronium bis(trifluoromethylsulfonyl)imide
  3858. S-Ethyl-N,N'-bis((S)-1-phenylethyl)thiouronium bromide
  3859. S-Ethyl-N,N'-bis((S)-1-phenylethyl)thiouronium iodide
  3860. S-ethyl-N-(1-methylethyl)-N'-(methylbenzenesulfonyl)carbamimidothioic acid
  3861. S-ethyl-N-hexyl-N'-(methylbenzenesulfonyl)carbamimidothioic acid
  3862. S-ethyl-N-methyl-N'-(methylbenzenesulfonyl)carbamimidothioic acid
  3863. S-ethyl-N-propyl-N'-(methylbenzenesulfonyl)carbamimidothioic acid
  3864. S-fluoro-N,S-bis(trifluoromethyl)sulfoximine
  3865. S-Heptyltetrahydrothiophenium bis(trifluoromethylsulfonyl)imide
  3866. S-Heptyltetrahydrothiophenium iodide
  3867. S-Heptyltetrahydrothiophenium tetraphenylborate
  3868. S-Hexadecyl-N,N'-bis((S)-1-phenylethyl)thiouronium bis(trifluoromethylsulfonyl)imide
  3869. S-Hexadecyl-N,N'-bis((S)-1-phenylethyl)thiouronium iodide
  3870. S-hexyl-1,1,3,3-tetramethylthiouronium bis(trifluoromethylsulfonyl)imide
  3871. S-Hexyl-N,N'-bis((S)-1-phenylethyl)thiouronium bis(trifluoromethylsulfonyl)imide
  3872. S-Hexyl-N,N'-bis((S)-1-phenylethyl)thiouronium iodide
  3873. S-Hexyltetrahydrothiophenium bis(trifluoromethylsulfonyl)imide
  3874. S-Hexyltetrahydrothiophenium iodide
  3875. S-Hexyltetrahydrothiophenium tetraphenylborate
  3876. S-isopropyl N-(2,5-Dichlorophenyl)carbamothioate
  3877. S-Methyl dimethylthioformamidium trifluoromethanesulfonate
  3878. S-methyl-N'-(methylbenzenesulfonyl)-N-(1-methylethyl)carbamimidothioic acid
  3879. S-methyl-N'-(methylbenzenesulfonyl)-N-(phenylmethyl)carbamimidothioic acid
  3880. S-methyl-N'-(methylbenzenesulfonyl)-N-octylcarbamimidothioic acid
  3881. S-methyl-N'-(methylbenzenesulfonyl)-N-phenylcarbamimidothioic acid
  3882. S-methyl-N'-(methylbenzenesulfonyl)-N-propylcarbamimidothioic acid
  3883. S-methyl-N'-(methylbenzenesulfonyl)carbamimidothioic acid
  3884. S-Methyl-N,N'-bis((S)-1-phenylethyl)thiouronium bis(trifluoromethylsulfonyl)imide
  3885. S-Methyl-N,N'-bis((S)-1-phenylethyl)thiouronium iodide
  3886. S-Methyl-N,N'-dimethylthiourea trifluoromethanesulfonate
  3887. S-Methyl-N,N,N',N'-tetramethylthiourea trifluoromethanesulfonate
  3888. S-Methyl-N,N,N'-trimethylthiourea trifluoromethanesulfonate
  3889. S-methyl-N-(1,1-dimethylethyl)-N'-(methylbenzenesulfonyl)carbamimidothioic acid
  3890. S-methyl-N-(1-methylpropyl)-N'-(methylbenzenesulfonyl)carbamimidothioic acid
  3891. S-methyl-N-(2-methylpropyl)-N'-(methylbenzenesulfonyl)carbamimidothioic acid
  3892. S-Methyl-N-methylthiourea trifluoromethanesulfonate
  3893. S-methyl-N-pentyl-N'-(methylbenzenesulfonyl)carbamimidothioic acid
  3894. S-Nonyltetrahydrothiophenium bis(trifluoromethylsulfonyl)imide
  3895. S-Nonyltetrahydrothiophenium iodide
  3896. S-Nonyltetrahydrothiophenium tetraphenylborate
  3897. S-octyl-1,1,3,3-tetramethylthiouronium bis(trifluoromethylsulfonyl)imide
  3898. S-Octyl-N,N'-bis((S)-1-phenylethyl)thiouronium bis(trifluoromethylsulfonyl)imide
  3899. S-Octyl-N,N'-bis((S)-1-phenylethyl)thiouronium iodide
  3900. S-Octyltetrahydrothiophenium bis(trifluoromethylsulfonyl)imide
  3901. S-Octyltetrahydrothiophenium iodide
  3902. S-Octyltetrahydrothiophenium tetraphenylborate
  3903. S-Pentyltetrahydrothiophenium iodide
  3904. S-Pentyltetrahydrothiophenium tetraphenylborate
  3905. S-phenyl (pentylamino)methanethioate
  3906. S-phenyl (propan-2-ylamino)methanethioate
  3907. S-phenyl N-2-methylphenylcarbamothioate
  3908. S-phenyl N-3-methylphenylcarbamothioate
  3909. S-phenyl N-4-methylphenylcarbamothioate
  3910. S-phenyl N-di-sec-butylcarbamothioate
  3911. S-phenyl N-diisobutylcarbamothioate
  3912. S-phenyl propylaminomethanethioate
  3913. S-phenyl [[(E)-2-(phenylsulfanylcarbonylamino)ethenyl]amino]methanethioate
  3914. S-Prop-2-enyltetrahydrothiophenium bis(trifluoromethylsulfonyl)imide
  3915. S-Propyl-N,N'-bis((S)-1-phenylethyl)thiouronium bis(trifluoromethylsulfonyl)imide
  3916. S-Propyl-N,N'-bis((S)-1-phenylethyl)thiouronium iodide
  3917. s-triazine-2,4,6-tricarbonitrile
  3918. S-vinyloxybutyl N,N-diethyldithiocarbamate
  3919. S-vinyloxyethyl N,N-diethyldithiocarbamate
  3920. S-[10,13-Dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] butanethioate
  3921. S-[10,13-Dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] decanethioate
  3922. S-[10,13-Dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] dodecanethioate
  3923. S-[10,13-Dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] eicosanethioate
  3924. S-[10,13-Dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] ethanethioate
  3925. S-[10,13-Dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] heptadecanethioate
  3926. S-[10,13-Dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] heptanethioate
  3927. S-[10,13-Dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] hexadecanethioate
  3928. S-[10,13-Dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] hexanethioate
  3929. S-[10,13-Dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] methanethioate
  3930. S-[10,13-Dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] nonadecanethioate
  3931. S-[10,13-Dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] nonanethioate
  3932. S-[10,13-Dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] octadecanethioate
  3933. S-[10,13-Dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] octanethioate
  3934. S-[10,13-Dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] pentadecanethioate
  3935. S-[10,13-Dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] pentanethioate
  3936. S-[10,13-Dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] propanethioate
  3937. S-[10,13-Dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] tetradecanethioate
  3938. S-[10,13-Dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] tridecanethioate
  3939. S-[10,13-Dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] undecanethioate
  3940. S-[4-(4-Decoxyphenyl)phenyl] 4-[(2S)-octan-2-yl]oxybenzenecarbothioate
  3941. S-[4-(4-Dodecoxyphenyl)phenyl] 4-[(2S)-octan-2-yl]oxybenzenecarbothioate
  3942. S-[4-(4-Heptoxyphenyl)phenyl] 4-[(2S)-octan-2-yl]oxybenzenecarbothioate
  3943. S-[4-(4-Nonoxyphenyl)phenyl] 4-[(2S)-octan-2-yl]oxybenzenecarbothioate
  3944. S-[4-(4-Octoxyphenyl)phenyl] 4-[(2S)-octan-2-yl]oxybenzenecarbothioate
  3945. S-[4-(4-Undecoxyphenyl)phenyl] 4-[(2S)-octan-2-yl]oxybenzenecarbothioate
  3946. Saccharose octanitrate
  3947. safflower oil
  3948. sal oil biodiesel (Shorea robusta biodiesel)
  3949. Salad oil
  3950. Salicylalazine
  3951. Salicylaldehyd S-methylisothiosemicarbazone dimethylsulfoxide molybdenum(VI) dioxide
  3952. Salicylaldehyd S-methylisothiosemicarbazone ethanol molybdenum(VI) dioxide
  3953. Salicylaldehyd S-methylisothiosemicarbazone methanol molybdenum(VI) dioxide
  3954. Salicylaldehyd S-methylisothiosemicarbazone molybdenum(VI) dioxide
  3955. Salicylaldehyd S-methylisothiosemicarbazone N,N-dimethylformamide molybdenum(VI) dioxide
  3956. Salicylaldehyd S-methylisothiosemicarbazone pyridine molybdenum(VI) dioxide
  3957. Salicylaldehyde acetylhydrazone
  3958. Salicylaldehyde benzoyl hydrazone
  3959. Salicylaldehyde triacetate
  3960. salicylic acid 1-butoxyethyl ester
  3961. salicylic acid 1-ethoxyethyl ester
  3962. salinazid
  3963. salsoline salsolinodithiocarbamate
  3964. samarium
  3965. samarium (III) chloride tetraethylammonium chloride hexahydrate
  3966. samarium (III) fluorosulfide
  3967. samarium (III) iron garnet
  3968. samarium (III) orthovanadate
  3969. Samarium acetate triurea
  3970. Samarium acetate triurea sesquihydrate
  3971. Samarium barium oxide
  3972. samarium bromide (SmBr3)
  3973. samarium bromide oxide (SmBrO)
  3974. samarium carbide (Sm2C3)
  3975. samarium carbide (SmC2)
  3976. samarium chloride (SmCl2)
  3977. samarium chloride (SmCl3)
  3978. samarium chloride (SmCl3) trihydrate
  3979. samarium chloride bis(acetylcholine chloride) hexahydrate
  3980. samarium chloride oxide (SmClO)
  3981. Samarium chloride tetraacetamide dihydrate
  3982. samarium chloride tris(chlorocholine chloride) pentahydrate
  3983. Samarium chromium tantalate
  3984. Samarium cobalt(III) oxide
  3985. samarium copper oxide
  3986. samarium disulfide
  3987. samarium fluoride (SmF3)
  3988. Samarium hafnate
  3989. samarium hexapyridinium chloride
  3990. Samarium hydrogen uranosilicate
  3991. Samarium hydrogen uranosilicate decahydrate
  3992. samarium iodide (PrI3)
  3993. samarium iodide (SmI2)
  3994. Samarium iron tantalate
  3995. Samarium manganite
  3996. samarium molybdate
  3997. samarium nitrate pentahydrate
  3998. samarium nitrate trihydrate
  3999. samarium nitrate tris(6-methylquinoline nitrate) tetrahydrate
  4000. samarium perchlorate bis(N,N'-diantipyrylthiourea) octahydrate
  4001. samarium phosphide (SmP)
  4002. samarium pyridinium chloride hexahydrate
  4003. samarium pyrostannate
  4004. samarium selenium bromide oxide (SmSe3BrO7)
  4005. samarium silicide (SmSi2)
  4006. samarium sodium sulfate dihydrate
  4007. samarium sulfide (Sm2S3)
  4008. samarium sulfide (SmS)
  4009. Samarium tantalate
  4010. samarium tetra(dimethylammonium) chloride
  4011. Samarium titanate
  4012. samarium tri(trimethylammonium) chloride
  4013. Samarium tris-pivalate
  4014. samarium uranium oxide (Sm6UO12)
  4015. Samarium zirconate hafnate
  4016. samarium(+3) cation trinitrate hexahydrate
  4017. samarium(3+) bis(nicotinate)-8-hydroxyquinolate
  4018. samarium(3+) vanadate (V6O17(4-)) (4:3)
  4019. samarium(3+) vanadate (VO3(1-)) (1:3)
  4020. samarium(II) fluoride
  4021. samarium(III) β-resorcylate monohydrate
  4022. samarium(III) arsenite trihydrate
  4023. Samarium(III) bis(1,10-phenanthroline 1-oxide) trichloride
  4024. samarium(III) bromide hexahydrate
  4025. samarium(III) chloride (SmCl3) hexahydrate
  4026. samarium(III) chloride 3.5-hydrate
  4027. Samarium(III) chloride di(methylenediacetamide) dihydrate
  4028. samarium(III) chloride hexaurea
  4029. samarium(III) chloride tetraurea
  4030. Samarium(III) chromate heptahydrate
  4031. samarium(III) chromate octahydrate
  4032. Samarium(III) dichromate decahydrate
  4033. samarium(III) ethyl sulfate nonahydrate
  4034. samarium(III) hexavanadate 48-hydrate
  4035. Samarium(III) histidine trinitrate monohydrate
  4036. samarium(III) iodate dihydrate
  4037. samarium(III) iodide dithiourea decahydrate
  4038. samarium(III) iodide nonahydrate
  4039. Samarium(III) iodide pentaurea
  4040. samarium(III) iodide tetrahydrate
  4041. samarium(III) laurate
  4042. samarium(III) metaborate hexahydrate
  4043. Samarium(III) nitrate di(methylenediacetamide) dihydrate
  4044. samarium(III) nitrate mono(alanine) hydrate
  4045. samarium(III) nitrate tetra(alanine) hydrate
  4046. samarium(III) nitrate tetrahydrate
  4047. Samarium(III) orthotantalate
  4048. samarium(III) oxide
  4049. Samarium(III) oxyfluoride
  4050. samarium(III) perchlorate bis(4-(2-Chloroacetyl)-antipyrine) hexahydrate
  4051. samarium(III) perchlorate heptahydrate
  4052. samarium(III) perchlorate nonahydrate
  4053. samarium(III) perchlorate triacetylantipyrine dihydrate
  4054. samarium(III) perchlorate tris(4-(2-Chloroacetyl)-antipyrine) octahydrate
  4055. samarium(III) pyrophosphate tetracosahydrate
  4056. samarium(III) selenate octahydrate
  4057. Samarium(III) selenide
  4058. Samarium(III) sodium disulfate
  4059. samarium(III) sulfate heptaurea
  4060. samarium(III) sulfate hexahydrate
  4061. samarium(III) sulfate octahydrate
  4062. samarium(III) sulfosalicylate octadecahydrate
  4063. Samarium(III) tetrakis(5,6-benzoquinoline) trinitrate
  4064. samarium(III) trichloracetate dihydrate
  4065. samarium(III) trichloracetate hexahydrate
  4066. samarium(III) trichloracetate monohydrate
  4067. samarium(III) trichloracetate trihydrate
  4068. Samarium(III) triindium(I)
  4069. Samarium(III) trilead(I)
  4070. Samarium(III) tripotassium hexabromide
  4071. Samarium(III) trirubidium hexabromide
  4072. Samarium(III) trirubidium hexachloride
  4073. Samarium(III) tris(1,4-thioxane-S-oxide trifluoroacetate)
  4074. Samarium(III) tris(2,6-dichlorobenzoic acid)
  4075. Samarium(III) tris(3-bromolawsonemonoxime) dihydrate
  4076. Samarium(III) tris(3-chlorolawsonemonoxime) dihydrate
  4077. Samarium(III) tris(3-iodolawsonemonoxime) heptahydrate
  4078. Samarium(III) tris(3-Methoxybenzoate)
  4079. Samarium(III) tris(3-nitro-1,2,4-triazol-5-onate)
  4080. Samarium(III) tris(3-nitro-1,2,4-triazol-5-onate) heptahydrate
  4081. Samarium(III) tris(N-phenylbenzohydroxamate)
  4082. Samarium(III) tris(salicylidene-β-alanine)
  4083. Samarium(III) tris(salicylidene-β-alanine) trihydrate
  4084. Samarium(III) trithallium(I)
  4085. Samarium(III) trithiocyanate hexahydrate
  4086. Samarium(III) tritin(I)
  4087. Samarium(III) undecaiodide pentaurea decahydrate
  4088. Samarium(III)-2,5-dihydroxybenzoate
  4089. Samarium(III)-tris-(2,2,6,6-tetramethyl-3,5-heptanedionate)
  4090. samarium(III)borohydride bis(tetrahydrofuran)
  4091. samarium(III)borohydride tetrakis(tetrahydrofuran)
  4092. Samarium(III)trifluoromethanesulphonate octa(4-picoline-N-oxide)
  4093. samarum(III) metavanadate tetrahydrate
  4094. sample 2093 cb
  4095. sample 2093 cb-2
  4096. sample 2093 cb-4
  4097. sample 2093 cb-6
  4098. sample 2094 cb
  4099. sample 2128 cb
  4100. sandstone
  4101. sandstone
  4102. Santalyl butanoate
  4103. santotherm 55
  4104. santotherm 66
  4105. Santowax R
  4106. sapphire (Al2O3)
  4107. sarafloxacin
  4108. Sarpogrelate hydrochloride
  4109. Satranidazole
  4110. saxoline
  4111. scandium
  4112. scandium 1,1,1-trifluoro-5,5-dimethyl-2,4-hexanedionate
  4113. scandium 2,2,6,6-tetramethyl-4-fluoro-3,5-heptanedionate
  4114. scandium bromide (ScBr3)
  4115. scandium chloride (ScCl3)
  4116. Scandium diboride
  4117. scandium dihydrogen pentanitrate
  4118. scandium fluoride (ScF3)
  4119. scandium hydrogen selenite
  4120. scandium hydroxide (Sc(OH)3)
  4121. scandium hydroxynitrate (Sc(OH)(NO3)2)
  4122. scandium iodate
  4123. scandium iodate tetraiodic acid octadecahydrate
  4124. scandium iodate octadecahydrate
  4125. scandium iodide (ScI3)
  4126. scandium nitrate dihydrate
  4127. scandium nitrate tetrahydrate
  4128. scandium nitrate trihydrate
  4129. scandium oxide (Sc2O3)
  4130. scandium sulfide (Sc2S3)
  4131. scandium tricyclopentadienide
  4132. scandium vanadium oxide (ScVO4)
  4133. scandium(3+) tris(fluoromethanesulphonate) compd. with 2,6-dimethylpyridine-1-oxide (1:6) hydrate
  4134. scandium(3+) tris(fluoromethanesulphonate) compd. with 2-methylpyridine-1-oxide (1:6)
  4135. scandium(3+) tris(fluoromethanesulphonate) compd. with 3-methylpyridine-1-oxide (1:6)
  4136. scandium(3+) tris(fluoromethanesulphonate) compd. with 4-methylpyridine-1-oxide (1:6)
  4137. scandium(3+) tris(fluoromethanesulphonate) compd. with pyridine-1-oxide (1:6)
  4138. Scandium(III) benzoyltrifluoroacetonate
  4139. scandium(III) bromide pentahydrate
  4140. scandium(III) chloride hexahydrate
  4141. scandium(III) chloride nonahydrate
  4142. scandium(III) hydroxosulfate dihydrate
  4143. scandium(III) hydroxydinitrate trihydrate
  4144. scandium(III) nitrate hexahydrate
  4145. scandium(III) perchlorate heptahydrate
  4146. scandium(III) perchlorate hexahydrate
  4147. scandium(III) perchlorate nonahydrate
  4148. scandium(III) sulfate decaurea
  4149. scandium(III) sulfate disulfuric acid
  4150. scandium(III) sulfate pentahydrate
  4151. scandium(III) sulfate pentaurea
  4152. scandium(III) sulfate tetrahydrate
  4153. scandium(III) sulfate trisulfuric acid
  4154. scapolithe (Na0.34K0.13Ca3.48Fe0.01)(Si6.47Al5.53)O24.01(Cl0.06(CO3)0.91(SO4)0.02)
  4155. scapolithe (Na1.65K0.13Ca2.16Fe0.01)(Si7.51Al4.49)O23.96(Cl0.30(CO3)0.57(SO4)0.14)
  4156. scapolithe (Na2.13K0.09Ca1.75Fe0.01)(Si7.73Al4.27)O23.97(Cl0.42(CO3)0.47(SO4)0.07)
  4157. scapolithe (Na2.62K0.28Ca1.10Fe0.02)(Si8.14Al3.86)O24.00(Cl0.70(CO3)0.23(SO4)0.07)
  4158. scopolamine
  4159. sea water
  4160. sea water
  4161. Sebacic acid bis(1-octoxy-1-oxopropan-2-yl) ester
  4162. sec-Butenylnaphtalene
  4163. sec-Butyl phenylcarbamate
  4164. sec-butyl triallyl orthosilicate
  4165. sec-Butylammonium methanoate
  4166. sec-Butylmesitylene
  4167. sec-octylmercuric bromide
  4168. sec. Butyldecaline
  4169. sec.-Cetylbenzene
  4170. sec.-Nonylbenzene
  4171. Second generation carbosilane dendrimer
  4172. Second generation poly(phenylene-pyridyl) dendrimer
  4173. secondary sodium para-periodate
  4174. Securinine
  4175. sekaninaite (Al4Fe2O3(SiO3)5)
  4176. selenate
  4177. selenic acid
  4178. selenic acid aluminum cesium salt (2:1:1)
  4179. selenic acid aluminum potassium salt (2:1:1)
  4180. selenic acid aluminum rubidium salt (2:1:1)
  4181. selenic acid ammonium magnesium salt (2:2:1)
  4182. selenic acid barium salt (1:1)
  4183. selenic acid cadmium(2+) salt
  4184. selenic acid calcium salt (1:1)
  4185. selenic acid cobalt(2+) salt (1:1)
  4186. selenic acid copper(2+) salt (1:1)
  4187. selenic acid diammonium salt
  4188. selenic acid dicesium salt
  4189. selenic acid dilithium salt
  4190. selenic acid dilithium salt monohydrate
  4191. selenic acid dipotassium salt
  4192. selenic acid dirubidium salt
  4193. selenic acid disodium salt
  4194. selenic acid disodium salt decahydrate
  4195. selenic acid dithallium(1+) salt
  4196. selenic acid europium(3+) salt (3:2)
  4197. selenic acid indium(3+) salt (3:2)
  4198. selenic acid lanthanum(3+) salt (3:2)
  4199. selenic acid magnesium potassium salt (2:1:2)
  4200. selenic acid magnesium salt (1:1)
  4201. selenic acid manganese(2+) salt
  4202. selenic acid mercury(2+) salt
  4203. selenic acid monoammonium salt
  4204. selenic acid monosodium salt
  4205. selenic acid neodymium(3+) salt (3:2)
  4206. selenic acid nickel(2+) salt (1:1)
  4207. selenic acid nickel(2+) salt (1:1) hexahydrate
  4208. selenic acid praseodymium(3+) salt (3:2)
  4209. selenic acid samarium(3+) salt (3:2)
  4210. selenic acid strontium salt (1:1)
  4211. selenic acid ytterbium(3+) salt (3:2)
  4212. selenic acid zinc salt (1:1)
  4213. seleninyl chloride
  4214. seleninyl fluoride
  4215. selenious acid
  4216. selenious acid (H2SeO3) zinc salt (1:1)
  4217. selenious acid ammonium salt (2:1)
  4218. selenious acid barium salt (1:1)
  4219. selenious acid cadmium salt (1:1)
  4220. selenious acid compd. with nitrourea (1:1)
  4221. selenious acid diammonium salt
  4222. selenious acid dicesium salt
  4223. selenious acid dilithium salt
  4224. selenious acid dipotassium salt
  4225. selenious acid dirubidium salt
  4226. selenious acid disodium salt
  4227. selenious acid monopotassium salt
  4228. selenious acid monosodium salt
  4229. selenious acid potassium salt (2:1)
  4230. selenious acid scandium(3+) salt (3:2)
  4231. selenious acid sodium salt (2:1)
  4232. selenious acid zirconium(4+) salt (2:1)
  4233. selenium
  4234. selenium chloride (Se2Cl2)
  4235. Selenium dioxide difluoride
  4236. selenium oxide (SeO2)
  4237. selenium oxide (SeO3)
  4238. selenobismethane
  4239. selenocyanic acid cadmium salt
  4240. selenocyanic acid lead(2+) salt
  4241. selenocyanic acid pentafluoroethyl ester
  4242. selenocyanic acid potassium salt
  4243. selenocyanic acid trifluoromethyl ester
  4244. Selenocyano-n-perfluoropropane
  4245. selenoisocyanic acid trifluoromethyl ester
  4246. selenophene
  4247. selenoseleniumcyanic acid trifluoromethyl ester
  4248. selenosilicic acid (H4SiSe4) copper(1+) mercury(2+) salt (1:2:1)
  4249. Senecionine
  4250. Seneciphylline
  4251. Senkirkine
  4252. separator gas
  4253. Separator liquid
  4254. Sepasolv MPE
  4255. Sertraline hydrochloride
  4256. sesame fats and glyceridic oils
  4257. Seventh generation carbosilane dendrimers
  4258. Shale
  4259. Shale oil
  4260. silacyclopropane
  4261. silane
  4262. silane-d2
  4263. silane-d3
  4264. silane-d4
  4265. silanecarbonitrile
  4266. silanediimine magnesium salt (1:1)
  4267. silanol acetate
  4268. silanol formate
  4269. silica
  4270. silica vitreous
  4271. silicic acid (H2Si2O5) dilithium salt
  4272. silicic acid (H2Si2O5) dipotassium salt
  4273. silicic acid (H2Si2O5) disodium salt
  4274. silicic acid (H2SiO2) barium salt (1:1)
  4275. silicic acid (H2SiO3)
  4276. silicic acid (H2SiO3) aluminum salt
  4277. silicic acid (H2SiO3) barium salt (1:1)
  4278. silicic acid (H2SiO3) cadmium salt (1:1)
  4279. silicic acid (H2SiO3) calcium salt (1:1)
  4280. silicic acid (H2SiO3) dicesium salt
  4281. silicic acid (H2SiO3) dilithium salt
  4282. silicic acid (H2SiO3) dipotassium salt
  4283. silicic acid (H2SiO3) disodium salt
  4284. silicic acid (H2SiO3) iron(2+) salt (1:1)
  4285. silicic acid (H2SiO3) lead(2+) salt (1:1)
  4286. silicic acid (H2SiO3) magnesium salt (1:1)
  4287. silicic acid (H2SiO3) strontium salt (1:1)
  4288. silicic acid (H2SiO3) zinc salt (1:1)
  4289. silicic acid (H4Si2O7) hexakis(2-methylpropyl) ester
  4290. silicic acid (H4SiO4)
  4291. silicic acid (H4SiO4) 2-ethylbutyl tris(2-ethylhexyl) ester
  4292. silicic acid (H4SiO4) aluminum barium salt (2:2:1)
  4293. silicic acid (H4SiO4) aluminum lithium salt (1:1:1)
  4294. silicic acid (H4SiO4) aluminum strontium salt (2:2:1)
  4295. silicic acid (H4SiO4) beryllium salt
  4296. silicic acid (H4SiO4) bis(2-ethylhexyl) bis(1,1-dimethylpropyl) ester
  4297. silicic acid (H4SiO4) butyl tris(1,1-dimethylethyl) ester
  4298. silicic acid (H4SiO4) calcium salt (1:2)
  4299. silicic acid (H4SiO4) disodium salt
  4300. silicic acid (H4SiO4) iron(2+) salt (1:2)
  4301. silicic acid (H4SiO4) lead(2+) salt (1:2)
  4302. silicic acid (H4SiO4) lithium salt
  4303. silicic acid (H4SiO4) magnesium salt (1:2)
  4304. silicic acid (H4SiO4) magnesium strontium salt (2:1:3)
  4305. silicic acid (H4SiO4) tetrabutyl ester
  4306. silicic acid (H4SiO4) tetradodecyl ester
  4307. silicic acid (H4SiO4) tetraethyl ester
  4308. silicic acid (H4SiO4) tetraheptyl ester
  4309. silicic acid (H4SiO4) tetrahexyl ester
  4310. silicic acid (H4SiO4) tetrakis(1,3-dimethylbutyl)ester
  4311. silicic acid (H4SiO4) tetrakis(1-methylbutyl) ester
  4312. silicic acid (H4SiO4) tetrakis(1-methylethyl) ester
  4313. silicic acid (H4SiO4) tetrakis(1-methylheptyl) ester
  4314. silicic acid (H4SiO4) tetrakis(1-methylhexyl) ester
  4315. silicic acid (H4SiO4) tetrakis(1-methylpropyl) ester
  4316. silicic acid (H4SiO4) tetrakis(2,2,3,3,3-pentafluoropropyl) ester
  4317. silicic acid (H4SiO4) tetrakis(2,2,3,3,4,4,4-heptafluorobutyl) ester
  4318. silicic acid (H4SiO4) tetrakis(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorononyl) ester
  4319. silicic acid (H4SiO4) tetrakis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl) ester
  4320. silicic acid (H4SiO4) tetrakis(2,2,3,3,4,4,5,5-octafluoropentyl) ester
  4321. silicic acid (H4SiO4) tetrakis(2,2,3,3-tetrafluoropropyl) ester
  4322. silicic acid (H4SiO4) tetrakis(2,6-dimethylphenyl) ester
  4323. silicic acid (H4SiO4) tetrakis(2-chloroethyl) ester
  4324. silicic acid (H4SiO4) tetrakis(2-ethylbutyl) ester
  4325. silicic acid (H4SiO4) tetrakis(2-ethylhexyl) ester
  4326. silicic acid (H4SiO4) tetrakis(2-methylphenyl) ester
  4327. silicic acid (H4SiO4) tetrakis(2-methylpropyl) ester
  4328. silicic acid (H4SiO4) tetrakis(3-methylbutyl) ester
  4329. silicic acid (H4SiO4) tetrakis(3-methylphenyl) ester
  4330. silicic acid (H4SiO4) tetrakis(4-methoxyphenyl)ester
  4331. silicic acid (H4SiO4) tetrakis(4-methylphenyl) ester
  4332. silicic acid (H4SiO4) tetrakis(4-methylphenyl) ester
  4333. silicic acid (H4SiO4) tetrakis(decyl) ester
  4334. silicic acid (H4SiO4) tetralithium salt
  4335. silicic acid (H4SiO4) tetramethyl ester
  4336. silicic acid (H4SiO4) tetranonyl ester
  4337. silicic acid (H4SiO4) tetraoctyl ester
  4338. silicic acid (H4SiO4) tetrapentyl ester
  4339. silicic acid (H4SiO4) tetraphenyl ester
  4340. silicic acid (H4SiO4) tetrapropyl ester
  4341. silicic acid (H4SiO4) tetrasodium salt
  4342. silicic acid (H4SiO4) tris(1,1-dimethylethyl) 1-methylpropyl ester
  4343. silicic acid (H4SiO4) trisodium salt
  4344. silicic acid (H4SiO4) zinc salt (1:2)
  4345. silicic acid (H4SiO4) zirconium(4+) salt
  4346. silicic acid (H6Si2O7) cerium(3+) salt (1:2)
  4347. silicic acid (H6Si2O7) cerium(3+) salt (1:2)
  4348. silicic acid (H6Si2O7) dysprosium(3+) salt (1:2)
  4349. silicic acid (H6Si2O7) hexakis(1,3-dimethylbutyl) ester
  4350. silicic acid (H6Si2O7) hexakis(1-methylethyl) ester
  4351. silicic acid (H6Si2O7) lanthanum(3+) salt (1:2)
  4352. silicic acid (H6Si2O7) strontium zirconium(4+) salt (1:1:1)
  4353. silicic acid (H6Si2O7) yttrium(3+) salt (1:2)
  4354. Silicic acid tetrakis(1,3-dichloropropan-2-yl) ester
  4355. Silicomolybdic acid
  4356. Silicomolybdic acid hexahydrate
  4357. silicon
  4358. silicon arsenide
  4359. silicon arsenide (SiAs)
  4360. silicon carbide (Si2C)
  4361. silicon carbide (SiC)
  4362. silicon carbide (SiC)
  4363. silicon carbide (SiC)
  4364. silicon carbide (SiC2)
  4365. silicon chloride (SiCl)
  4366. silicon fluoride (SiF2)
  4367. silicon ion (Si(1+))
  4368. silicon nitride (Si2N)
  4369. silicon nitride (Si3N4)
  4370. silicon nitride (Si3N4)
  4371. silicon nitride (SiN)
  4372. silicon oil
  4373. silicon oxide (SiO)
  4374. silicon oxynitride
  4375. silicon phosphide
  4376. silicon sulfide (SiS)
  4377. silicon sulfide (SiS2)
  4378. silicon tetrathiocyanate
  4379. Silicon(IV) tetrachloride tris(acetoacet-m-anisidide)
  4380. Silicon(IV) tetrachloride tris(acetoacet-m-toluidide)
  4381. Silicon(IV) tetrachloride tris(acetoacet-o-anisidide)
  4382. Silicon(IV) tetrachloride tris(acetoacet-o-toluidide)
  4383. Silicon(IV) tetrachloride tris(acetoacet-p-anisidide)
  4384. Silicon(IV) tetrachloride tris(acetoacet-p-toluidide)
  4385. Silicon(IV) tetrachloride tris(acetoacetanilide)
  4386. Silicon(IV) tetrachloride tris(m-chloroacetoacetanilide)
  4387. Silicon(IV) tetrachloride tris(o-chloroacetoacetanilide)
  4388. Silicon(IV) tetrachloride tris(p-bromoacetoacetanilide)
  4389. Silicon(IV) tetrachloride tris(p-chloroacetoacetanilide)
  4390. Silicon(IV) tetrachloride tris(p-fluoroacetoacetanilide)
  4391. Silicon(IV) tetrachloride tris(p-iodoacetoacetanilide)
  4392. Silicotungstic acid
  4393. Silicotungstic acid hexahydrate
  4394. silidyne
  4395. sillimanite (Al2O(SiO4))
  4396. siloxanes and Silicones
  4397. siloxanes and silicones di-Et
  4398. siloxanes and silicones di-Et
  4399. siloxanes and silicones di-Et
  4400. siloxanes and silicones di-Et
  4401. siloxanes and silicones di-Et
  4402. siloxanes and silicones di-Et
  4403. siloxanes and silicones di-Et PES-2
  4404. siloxanes and silicones di-Et PES-3
  4405. siloxanes and silicones di-Et PES-4
  4406. siloxanes and silicones di-Et PES-5
  4407. siloxanes and silicones di-Me 1
  4408. siloxanes and silicones di-Me 2
  4409. siloxanes and silicones di-Me PMS-1.5
  4410. siloxanes and silicones di-Me PMS-10
  4411. siloxanes and silicones Di-Me PMS-100
  4412. siloxanes and silicones Di-Me PMS-100
  4413. siloxanes and silicones Di-Me PMS-1000
  4414. siloxanes and silicones Di-Me PMS-1000
  4415. siloxanes and silicones di-Me PMS-200
  4416. siloxanes and silicones di-Me PMS-400
  4417. siloxanes and silicones Di-Me PMS-476
  4418. siloxanes and silicones Di-Me PMS-476
  4419. siloxanes and silicones Di-Me PMS-5
  4420. siloxanes and silicones Di-Me PMS-5
  4421. siloxanes and silicones Di-Me PMS-50
  4422. siloxanes and silicones Di-Me PMS-50
  4423. siloxanes and silicones Di-Me PMS-50
  4424. siloxanes and silicones Di-Me PMS-700
  4425. siloxanes and silicones Di-Me PMS-700
  4426. siloxanes and silicones Me-Ph PFMS-2-5p
  4427. siloxanes and silicones Me-Ph PFMS-4
  4428. siltherm-800
  4429. silver
  4430. Silver α-nitroso-β-naphthate
  4431. Silver 3-nitro-1,2,4-triazol-5-onate
  4432. silver acetylide (Ag2(C2))
  4433. silver ammonium nitrate
  4434. silver arsenic disulfide
  4435. silver barium thiocyanate dihydrate
  4436. silver bismuth disulfide
  4437. silver bromide (AgBr)
  4438. silver bromide metaphosphate (AgBr0.45(PO3)0.55)
  4439. silver bromide metaphosphate (AgBr0.55(PO3)0.45)
  4440. silver cesium nitrate
  4441. silver chloride (AgCl)
  4442. silver chloride bis(thiourea)
  4443. silver chloride dipyridine
  4444. silver chloride monopyridine
  4445. silver chloride tris(thiourea)
  4446. silver cyanide (Ag(CN))
  4447. silver dihydrogen phosphate
  4448. silver dimolybdate
  4449. silver dipotassium iodide
  4450. silver fluoride (AgF)
  4451. silver fluoride (AgF2)
  4452. silver fluoride di(hydrogen fluoride)
  4453. silver fluoride dihydrate
  4454. silver fluoride mono(hydrogen fluoride)
  4455. silver fluoride monohydrate
  4456. silver fluoride penta(hydrogen fluoride)
  4457. silver fluoride tetrahydrate
  4458. silver fluoride tri(hydrogen fluoride)
  4459. silver hydrogen orthophosphate
  4460. silver hydroxide (Ag(OH))
  4461. silver iodide (AgI)
  4462. silver ion (Ag(1+))
  4463. Silver methanesulfonate
  4464. silver nitrate diurea
  4465. silver nitrate diurea hexahydrate
  4466. silver nitrate diurea tetrahydrate
  4467. silver nitrate hexapyridine
  4468. silver nitrate monodioxanate
  4469. silver nitrate monourea
  4470. silver nitrate tripyridine
  4471. silver oxide (Ag2O)
  4472. silver perchlorate monobenzen
  4473. silver perchlorate monotoluene
  4474. Silver potassium iodide
  4475. silver pyridine nitrate
  4476. silver selenide (Ag2.01Se)
  4477. silver selenide (Ag2Se)
  4478. silver selenide (Ag2Se1.01)
  4479. silver selenide sulfide (Ag4Se&subS;)
  4480. silver sodium bromate
  4481. silver sodium iodide trihydrate
  4482. silver sulfide (Ag2S)
  4483. silver telluride
  4484. silver telluride (Ag2Te)
  4485. silver tellurite
  4486. silver tetrafluoroborate
  4487. silver thallium nitrate
  4488. silver thiocyanate monoammonia
  4489. Silver thiophosphate
  4490. silver tin selenide (Ag33.3Sn16.7Se50)
  4491. silver tin selenide (Ag8SnSe6)
  4492. Silver trifluoromethanesulfonate
  4493. silver tungsten oxide (Ag2WO4)
  4494. silver(1+) (T-4)-rhenate (ReO4(1-))
  4495. silver(1+) (T-4)-tetraiodobismutate(1-)
  4496. silver(1+) compd. with N,N-dimethylbenzamide salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:2:1)
  4497. Silver(I) (2-(2,4,6-trinitroanilino)acetate
  4498. Silver(I) 4-aminophenazone dithiocarbamate
  4499. Silver(I) 8-ethyltheophyline
  4500. Silver(I) 8-isopropyltheophyline
  4501. Silver(I) 8-phenyltheophyline
  4502. Silver(I) 8-propyltheophyline
  4503. Silver(I) aluminum(III) diselenide
  4504. Silver(I) aluminum(III) disulfide
  4505. Silver(I) aluminum(III) ditelluride
  4506. Silver(I) antimony(III) diselenide
  4507. Silver(I) bismuth(III) diselenide
  4508. Silver(I) bismuth(III) ditelluride
  4509. silver(I) cyanate
  4510. Silver(I) diazoaminobenzene
  4511. silver(I) hexacyanocobaltate
  4512. Silver(I) indium(III) disulfide
  4513. Silver(I) iron(III) diselenide
  4514. Silver(I) iron(III) ditelluride
  4515. Silver(I) thallium(III) diselenide
  4516. Silver(I) thallium(III) ditelluride
  4517. Silver(I) theophyllinate
  4518. silver(I)/propylamine bis(trifluoromethylsulfonyl)imide
  4519. Silyl trifluoromethyl selenide
  4520. Silyl Trifluoromethyl Sulfide
  4521. silylene
  4522. Silylenebis(tetracarbonylcobalt)
  4523. silyliumylidene
  4524. Sinitrodil
  4525. Sitostanol
  4526. SL32 POE oil
  4527. slag
  4528. sodalite (Na4(Al3Cl(SiO4)3))
  4529. sodate (NaO(1-))
  4530. sodiotellanylsodium
  4531. sodium
  4532. Sodium (1-(3,3-diethoxypropyl)-3-tosylureido)methanesulfonate
  4533. sodium (1R)-1,2,3,4,5,6-hexadydro-1,5-methano-8H-pyrido(1,2-a)(1,5)diazocin-8-one dithiocarbamate
  4534. sodium (2-carboxylatophenyl)sulfanyl-ethylmercury
  4535. Sodium (3-(3-chlorophenyl)-4-(6-hydroxybenzo[d]-[1,3]dioxol-5-yl)-2-oxotetrahydropyrimidin-1(2H)-yl)methanesulfonate
  4536. Sodium (4-(3-carboxy-2,6-dihydroxyphenyl)-2oxo-3-(m-tolyl)tetrahydropyrimidin-1(2H)-yl)methanesulfonate
  4537. Sodium (4-(4-hydroxy-6-methyl-2-oxo-2H-pyran-3-yl)-2-oxo-3-(m-tolyl)tetrahydropyrimidin-1(2H)-yl)methanesulfonate
  4538. Sodium (4-(4-hydroxy-6-methyl-2-oxo-2H-pyran-3-yl)-2-oxo-3-tosyltetrahydropyrimidin-1(2H)-yl)methanesulfonate
  4539. Sodium (4-(5-chloro-2,4-dihydroxyphenyl)-2-oxo-3-tosyltetrahydropyrimidin-1(2H)-yl)methanesulfonate
  4540. sodium (4R)-4-[(3R,5R,8R,9S,10S,12S,13R,14S,17R)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate
  4541. sodium (6R,7R)-7-[[(2R)-2-formyloxy-2-phenylacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate
  4542. sodium (dioxovanadate)di-mu-oxodioxouranate(1-) dihydrate
  4543. sodium (OC-6-11)-hexachloroniobate(2-)
  4544. sodium (orthoarsenato(3-)-κO)dioxouranate(1-)
  4545. sodium (T-4)-aluminate (Al(OH)4(1-))
  4546. sodium (T-4)-rhenate (ReO4(1-))
  4547. sodium (T-4)-technetate (TcO4(1-))
  4548. sodium (T-4)-tetrachloroaluminate(1-)
  4549. sodium (T-4)-tetrafluoroaluminate(1-)
  4550. sodium (T-4)-tetrafluorolanthanate(1-)
  4551. sodium (T-4)-tetrahydroaluminate(1-)
  4552. sodium 1,3,5-triphenylpentanetrisulfonate
  4553. sodium 1-amino-4-ethylamino-9,10-dioxoanthracene-2-sulfonate
  4554. Sodium 2,2,6,6-tetramethyl-3,5-heptanedione
  4555. sodium 2,3,4-trihydroxy-4-oxobutanoate hydrate
  4556. sodium 2,3-dimercaptopropanesulfonate dihydrate
  4557. Sodium 2,4,6-trinitrophenolate
  4558. Sodium 2-(2,4-dichlorophenoxy)ethyl sulfate
  4559. sodium 2-(phenylsulfonylamino)benzoate
  4560. Sodium 2-hydroxyethanesulfonate
  4561. Sodium 2-keto-L-gulonate monohydrate
  4562. sodium 2-[1-methyl-5-(4-methylbenzoyl)pyrrol-2-yl]acetate
  4563. sodium 3,4-dimethylbenzenesulfonate
  4564. sodium 3-hydroxynaphthalene-2-carboxylate
  4565. Sodium 3-nitro-1,2,4-triazol-5-onate
  4566. Sodium 3-nitro-1,2,4-triazol-5-onate monohydrate
  4567. sodium 3-nitrobenzenesulfonate Sodium 4-nitrobenzenesulfonate (adduct 1:1)
  4568. sodium 4-(dibutylamino)azobenzene-4'-sulfonate
  4569. sodium 4-(diethylamino)azobenzene-4'-sulfonate
  4570. sodium 4-(dipropylamino)azobenzene-4'-sulfonate
  4571. Sodium 4-aminophenazone dithiocarbamate
  4572. sodium 4-bromobenzenesulfonate
  4573. Sodium 4-dodecyloxy-2-hydroxybenzoate
  4574. sodium 4-hydroxybenzoate pentahydrate
  4575. Sodium 4-hydroxybutan-1-olate
  4576. sodium 4-phenylbenzenesulfonate
  4577. sodium 4-phenylbenzoate
  4578. sodium 4-phenylphenolate
  4579. sodium 5,5-di(prop-2-enyl)pyrimidin-3-ide-2,4,6-trione
  4580. sodium 5,5-diethyl-4,6-dioxo-1H-pyrimidin-2-olate
  4581. Sodium 5-chlor-anthraquinone-1-sulfonate
  4582. sodium 5-ethyl-5-(3-methylbutyl)-2,4,6-trioxotetrahydro-2H-pyrimidin-1-ide
  4583. Sodium 8-chlor-anthraquinone-1-sulfonate
  4584. sodium acetate bis(acetic acid)
  4585. sodium acetate diformamide dimethanol
  4586. sodium acetate formamide dipropanol
  4587. sodium acetate monoformamide hexahydrate
  4588. sodium acetate monoformamide tetrahydrate
  4589. sodium acetate semihydrate
  4590. sodium acetic acid acetate
  4591. sodium acetylide (Na(C2H))
  4592. sodium acetylide (Na2(C2))
  4593. sodium alloy base Na 54,K 46
  4594. sodium aluminate (AlO2(1-))
  4595. sodium aluminium oxide 2.5-hydrate (Sodium aluminate 2.5-hydrate)
  4596. sodium aluminium sulfate 24-hydrate
  4597. sodium aluminium sulfate hexahydrate
  4598. sodium aluminium sulfate tetradecahydrate
  4599. Sodium aluminum(III) disilicon oxide monohydrate
  4600. Sodium aluminum(III) trisilicon oxide
  4601. sodium amide (Na(NH2))
  4602. sodium ammonium sulfate dihydrate
  4603. Sodium anthraquinone-1,5-disulfonate
  4604. Sodium anthraquinone-1,7-disulfonate
  4605. Sodium anthraquinone-1,8-disulfonate
  4606. Sodium anthraquinone-2,6-sulfonate
  4607. Sodium antimony(III) diselenium(II)
  4608. sodium arsenate heptasodium hydrogencarbonate
  4609. sodium azide (Na(N3))
  4610. Sodium B-paratungstate
  4611. Sodium B-paratungstate heptacosahydrate
  4612. sodium benzenesulfinate
  4613. Sodium benzyl bis(phenylmethoxy)phosphoryl phosphate
  4614. sodium bis(diethyldithiocarbamodithioato-κS,κS')dioxouranate(1-)
  4615. sodium borate hydrogen peroxide
  4616. sodium borohydride di(dimethylformamide)
  4617. sodium borohydride mono(dimethylformamide)
  4618. sodium borohydride tetra(dimethylformamide)
  4619. sodium bromide (NaBr)
  4620. sodium bromide (NaBr) dihydrate
  4621. sodium bromide chloride
  4622. sodium bromide chloride dihydrate
  4623. sodium bromide diacetamide
  4624. sodium bromide dideuterium oxide
  4625. sodium bromide monourea monohydrate
  4626. sodium bromide pentahydrate
  4627. sodium bromide tetrahydrate
  4628. sodium butane-1-thiolate
  4629. sodium cadmate
  4630. sodium cadmium formate
  4631. sodium cadmium nitrite dihydrate
  4632. sodium calcium nitrite dihydrate
  4633. Sodium calcium pentaborate octahydrate (Ulexite)
  4634. sodium calcium pentaborate pentahydrate (Ulexit)
  4635. sodium carbonate dihydrate
  4636. sodium carbonate dihydrogen peroxidate monohydrate
  4637. sodium carbonate disulfate (Burkeite)
  4638. sodium carbonate hexahydrate
  4639. sodium carbonate hydrogencarbonate dihydrate (Trona)
  4640. sodium carbonate tetrahydrate
  4641. sodium carbonate trihydrate
  4642. sodium carbonate trihydrogencarbonate
  4643. sodium cesium chromate tetrahydrate
  4644. sodium cesium dichromate
  4645. sodium chloride (Na2Cl2)
  4646. sodium chloride (NaCl)
  4647. sodium chloride (NaCl) dihydrate
  4648. sodium chloride diglucose hydrate
  4649. sodium chloride iodide
  4650. sodium chloride monourea monohydrate
  4651. sodium chloride pentaammonia
  4652. sodium chloride sodium metaborate dihydrate
  4653. Sodium chlorite trihydrate
  4654. sodium chloromethanedisulfonate
  4655. sodium chloromethanedisulfonate hydrate
  4656. sodium chromate hexaurea tetrahydrate
  4657. sodium copper chloride dihydrate
  4658. sodium copper heptaborate hydrate
  4659. Sodium copper oxalate
  4660. Sodium copper oxalate dihydrate
  4661. sodium copper(I) cyanide
  4662. sodium cyanate
  4663. sodium cyanide (Na(CN))
  4664. sodium cyanide dihydrate
  4665. sodium cyanide hydroxide
  4666. sodium decane-1-sulfonate
  4667. sodium diammonium nitrate
  4668. sodium diborotrihydroxyglutarate tetrahydrate
  4669. sodium diborotrihydroxyglutarate trihydrate
  4670. sodium dicalcium sulfate trihydrate
  4671. Sodium dicesium cerium(III) hexachloride
  4672. Sodium dicesium dysprosium(III) hexachloride
  4673. Sodium dicesium erbium(III) hexachloride
  4674. Sodium dicesium europium(III) hexachloride
  4675. Sodium dicesium gadolinium(III) hexachloride
  4676. Sodium dicesium holmium(III) hexachloride
  4677. Sodium dicesium lanthanum(III) hexachloride
  4678. Sodium dicesium lutetium(III) hexachloride
  4679. Sodium dicesium neodymium(III) hexachloride
  4680. Sodium dicesium plutonium(III) hexachloride
  4681. Sodium dicesium praseodymium(III) hexachloride
  4682. Sodium dicesium samarium(III) hexachloride
  4683. Sodium dicesium terbium(III) hexachloride
  4684. Sodium dicesium thulium(III) hexachloride
  4685. Sodium dicesium ytterbium(III) hexachloride
  4686. Sodium dicesium yttrium(III) hexachloride
  4687. sodium dichloroargentate(1-)
  4688. Sodium difluorobromoacetate
  4689. Sodium difluorochloroacetate
  4690. sodium dihydrogen arsenate dihydrate
  4691. sodium dihydrogen arsenate monohydrate
  4692. sodium dihydrogen phosphate mono(phosphoric acid)
  4693. sodium dihydroxohexaaluminate pentadecahydrate
  4694. sodium dihydroxy nitrate
  4695. sodium diiodate tribromide decahydrate
  4696. sodium diiodate tribromide pentadecahydrate
  4697. sodium diiodate triiodide decahydrate
  4698. sodium diiodate triiodide eicosahydrate
  4699. sodium diiodate triiodide pentadecahydrate
  4700. sodium diiodide trihydrate
  4701. sodium dimolybdate hexahydrate
  4702. sodium dioxo(phosphato(3-)-κO)uranate(1-)
  4703. Sodium dioxouranium phosphate trihydrate
  4704. sodium disulfite heptahydrate
  4705. sodium disulfite hexa(sodium sulfate)
  4706. sodium disulfite hexahydrate
  4707. sodium ditellurite trihydrate
  4708. sodium dithiomolybdate
  4709. sodium dithionate dihydrate
  4710. sodium dithiotungstate
  4711. sodium dizirconium (IV) orthophosphate
  4712. sodium DL-aspartate
  4713. sodium dodecane-1-sulfonate
  4714. sodium ethanethiol
  4715. sodium fluoride (Na(HF2))
  4716. sodium fluoride (NaF)
  4717. Sodium fluoride acetic acid
  4718. sodium fluoride bis(hydrogen fluoride)
  4719. sodium fluoride compd. with tin fluoride (SnF2) (1:1)
  4720. sodium fluoride compd. with tin fluoride (SnF2) (1:2)
  4721. sodium fluoride compd. with tin fluoride (SnF2) (2:1)
  4722. sodium fluoride sulfate
  4723. sodium fluoride tetrakis(hydrogen fluoride)
  4724. sodium fluoride tris(hydrogen fluoride)
  4725. sodium formate bis(acetic acid)
  4726. sodium formate bis(formic acid)
  4727. sodium formate dihydrate
  4728. sodium formate monoacetic acid
  4729. sodium formate trihydrate
  4730. sodium formic acid formate
  4731. Sodium fusidate
  4732. sodium gadolinium titanate
  4733. sodium hexafluorophosphate(1-)
  4734. sodium hexafluorosilicate potassium hexafluorosilicate
  4735. sodium hexahydroxodialuminate heptahydrate
  4736. sodium hexamethyleniminecarbodithioate dihydrate
  4737. sodium hexavanadate dodecahydrate
  4738. sodium hydride (NaH)
  4739. sodium hydrogen (orthosilicato(4-)-κO)dioxouranate(2-) monohydrate
  4740. sodium hydrogen 2,3,4-trihydroxyglutarate monohydrate
  4741. Sodium hydrogen carbonate tetrakis(trimethylene tetraurea)
  4742. sodium hydrogen oxalate monohydrate
  4743. sodium hydrogen pentaborate dihydrate
  4744. sodium hydrogen pentaborate trihydrate
  4745. sodium hydrogen plumbate hexahydate
  4746. Sodium hydrogen succinate trihydrate
  4747. sodium hydrogen sulfate * Sodium sulfate
  4748. sodium hydrogen sulfate * sulfuric acid
  4749. sodium hydrogen sulfate * sulfuric acid * monohydrate
  4750. sodium hydrogen sulfate hydrate
  4751. sodium hydrogen sulfate sodium sulfate monohydrate
  4752. sodium hydrogen tungstate dihydrate
  4753. sodium hydrogencarbonate dihydrate
  4754. sodium hydrogencarbonate monomethylolurea
  4755. sodium hydrogenselenite tri(selenious acid)
  4756. sodium hydrogenselenite trihydrate
  4757. sodium hydrosulfite dihydrate
  4758. sodium hydroxide (Na(OH))
  4759. sodium hydroxide (Na(OH))
  4760. sodium hydroxide (Na(OH))
  4761. sodium hydroxide (Na2(OH)2)
  4762. sodium hydroxide di(sodium tartrate)
  4763. sodium hydroxide dihydrate
  4764. sodium hydroxide heptahydrate
  4765. sodium hydroxide monohydrate
  4766. sodium hydroxide nitrite (Na(OH)0.5(NO2)0.5)
  4767. sodium hydroxide pentahydrate
  4768. sodium hydroxide tetrahydrate
  4769. sodium hydroxide trihydrate
  4770. sodium hydroxy nitrate
  4771. sodium hydroxyacetate
  4772. sodium hydroxymethanesulfinate dihydrate
  4773. Sodium hypochlorite pentahydrate
  4774. sodium hypophosphite monohydrate
  4775. sodium indium(III) diselenate hexahydrate
  4776. sodium iodate 1.5-hydrate
  4777. sodium iodate bis(iodic acid)
  4778. sodium iodate tetra(sodium sulfate)
  4779. sodium iodate tri(sodium sulfate)
  4780. sodium iodide (NaI)
  4781. sodium iodide (NaI) dihydrate
  4782. sodium iodide dideuterium oxide
  4783. sodium iodide diurea monohydrate
  4784. sodium iodide hexaammonia
  4785. sodium iodide pentahydrate
  4786. sodium iodide triacetone
  4787. sodium iodide trimethanol
  4788. sodium iodide tris (N,N-dimethylformamide)
  4789. sodium iodide tris(2-butanone)
  4790. sodium iodide tris(ethylenediamine)
  4791. sodium iodide trisformamide
  4792. sodium ion (Na(1+))
  4793. sodium L-aspartate
  4794. Sodium lanthanum (III) titanate
  4795. Sodium lanthanum chromate
  4796. sodium lanthanum(III) ethylenediamine tetraacetate nonahydrate
  4797. sodium lanthanum(III) ethylenediamine tetraacetate octahydrate
  4798. sodium lanthanum(III) ethylenediamine tetraacetate trihydrate
  4799. sodium lead bromide (3NaBr.4PbBr2) dodekahydrate
  4800. sodium lithium dioxido(oxo)silane
  4801. sodium lithium hexafluorosilicate
  4802. sodium lutetium molybdate phosphate (Na2Lu(MoO4)(PO4))
  4803. Sodium magnesium chlorocarbonate
  4804. sodium magnesium chromate dihydrate
  4805. sodium magnesium hypophosphite
  4806. sodium magnesium manganese neodymium oxide (Na3Mg3Mn4NdO12)
  4807. sodium mandelate monomandelic acid
  4808. sodium mandelate trimandelic acid
  4809. sodium mercury(II)chloride dihydrate
  4810. sodium metaborate dihydrate
  4811. sodium metaborate monohydrate
  4812. sodium metaborate perborate tetrahydrate
  4813. sodium metaborate sodium hydroxide
  4814. sodium metagermanate heptahydrate
  4815. sodium metathiogermanate decahydrate
  4816. sodium metavanadate (V) dihydrate
  4817. Sodium methanesulfonate octahydrate
  4818. Sodium methyl sulfate
  4819. sodium methylsulfonate
  4820. sodium molybdate decahydrate
  4821. sodium monothiomolybdate
  4822. sodium monothiotungstate
  4823. sodium mu-chlorotetrachlorodimagnesate(1-)
  4824. sodium mu-chlorotetrachlorodimagnesate(1-) dodecahydrate
  4825. sodium mu-chlorotetrachlorodimagnesate(1-) octahydrate
  4826. sodium mu-chlorotetrachlorodimagnesate(1-) tetrahydrate
  4827. sodium N,N'-dicyano-4-chlorobenzamidine
  4828. sodium N,N'-dicyano-4-methylbenzamidine
  4829. sodium N,N'-dicyanobenzamidine
  4830. sodium naphthalene-1-sulfonate
  4831. sodium naphthalene-2-carboxylate
  4832. Sodium neodymium chromate
  4833. sodium neodymium titanate
  4834. sodium neodymium tungstate
  4835. sodium niobate(NbO3(1-))
  4836. sodium nitrate compd. with sodium hydroxide (1:2)
  4837. sodium nitrate monobiuret
  4838. sodium nitrate sodium sulfate dihydrate
  4839. sodium nitrate sodium sulfate monohydrate (Darapskit)
  4840. sodium nitrite semihydrate
  4841. sodium octaoxodimolybdatelanthanate(1-)
  4842. sodium octaoxoditungstateneodymate(1-)
  4843. sodium orthophosphate metaborate octadecahydrate
  4844. sodium orthovanadate decahydrate
  4845. sodium orthovanadate dodecahydrate
  4846. sodium orthovanadate heptahydrate
  4847. sodium orthovanadate octahydrate
  4848. sodium ortothiogermanate pentahydrate
  4849. sodium oxalate hydrogen peroxidate
  4850. sodium oxalate oxalic acid dihydrate
  4851. sodium oxide (Na2O)
  4852. sodium oxide (NaO)
  4853. sodium oxide monohydrate
  4854. sodium oxido-oxoborane
  4855. sodium oxolinate dihydrate
  4856. sodium p-anisole sulfonate
  4857. Sodium p-methylphenolate hydrate
  4858. sodium p-sulfonylphenyl hippurate
  4859. Sodium p-toluenesulfonate dihydrate
  4860. Sodium paratungstate
  4861. Sodium paratungstate octacosahydrate
  4862. sodium pentaborate
  4863. sodium pentaborate dibasic dihydrate
  4864. sodium pentaborate dibasic monohydrate
  4865. sodium pentaborate dibasic tetrahydrate
  4866. sodium pentaborate monohydrate
  4867. sodium pentaborate pentahydrate
  4868. sodium pentathionate dihydrate
  4869. sodium perborate trihydrate
  4870. sodium perchlorate dimethylformamide
  4871. sodium perchlorate diurea
  4872. Sodium perchlorate hydrate
  4873. sodium perchlorate mono(hexamethylene tetramine)
  4874. sodium perchlorate perchloric acid
  4875. sodium perchlorate tris(ethylenediamine)
  4876. sodium periodate trihydrate
  4877. sodium permanganate monohydrate
  4878. sodium permanganate trihydrate
  4879. sodium peroxide (Na2(O2))
  4880. sodium phenol sulfonate dihydrate
  4881. Sodium phosphide
  4882. sodium plumbite
  4883. sodium potassium carbonate dodecahydrate
  4884. sodium potassium carbonate monohydrate
  4885. Sodium potassium hydrogen phosphate pentahydrate
  4886. sodium potassium metavanadate
  4887. Sodium praseodymium chromate
  4888. sodium praseodymium(III) ethylenediamine tetraacetate octahydrate
  4889. sodium pyroiodate
  4890. sodium pyrovanadate ocatdecahydrate
  4891. sodium pyruvate
  4892. sodium rubidium tetraborate (NaRb(B4O5(OH)4)) tetrahydrate
  4893. sodium salicylate hexahydrate
  4894. Sodium samarium chromate
  4895. sodium selenide (Na2(Se2))
  4896. sodium selenide (Na2(Se3))
  4897. sodium selenide (Na2(Se4))
  4898. sodium selenite octahydrate
  4899. sodium selenite pentahydrate
  4900. sodium silicate hexahydrate
  4901. sodium silicate monohydrate
  4902. sodium silicate nonahydrate
  4903. sodium silicate octahydrate
  4904. sodium silicate pentahydrate
  4905. sodium silicate tris(potassium silicate)heptadecahydrate
  4906. sodium silver dinitrite
  4907. sodium silver thiocyanate dihydrate
  4908. sodium silver thiosulfate dihydrate
  4909. sodium stannate deca(hydrogen peroxide)
  4910. sodium strontium orthoborate
  4911. Sodium succinate hexahydrate
  4912. Sodium succinate monohydrate
  4913. sodium sulfamate monohydrate
  4914. Sodium sulfapyridine
  4915. sodium sulfate carbonate potassium chloride(Hanksite)
  4916. sodium sulfate chloride hydroxide
  4917. sodium sulfate decadeuterium oxide
  4918. sodium sulfate diphosphate
  4919. sodium sulfate heptadeuterium oxide
  4920. sodium sulfate sodium hydrogen sulfate pentahydrate
  4921. sodium sulfate sodium hydroxide
  4922. sodium sulfate tetrahydrate
  4923. sodium sulfate tri(hydrogen peroxidate)
  4924. sodium sulfathiazole hexahydrate
  4925. sodium sulfide (Na2(S4))
  4926. sodium sulfide (Na2(S5))
  4927. sodium sulfide (Na2S)
  4928. sodium sulfide (NaSH)
  4929. sodium sulfide decahydrate
  4930. sodium sulfide hexahydrate
  4931. sodium sulfide monohydrate
  4932. sodium sulfide pentahydrate
  4933. sodium sulfide semihydrate
  4934. sodium sulfite decahydrate
  4935. sodium sulfo sulfate
  4936. sodium superoxide (Na(O2))
  4937. sodium tantalate (TaO3(1-))
  4938. sodium taurochenodeoxycholate
  4939. sodium tellurite pentahydrate
  4940. sodium terbium molybdate phosphate
  4941. sodium tetraborate tris (2-hydroxyethylhydrazine) dihydrate
  4942. Sodium tetrachloroferrate (III)
  4943. sodium tetrachlorooxoniobate(1-)
  4944. sodium tetrachromate tetrahydrate
  4945. sodium tetradecane-1-sulfonate
  4946. sodium tetrafluoroborate(1-)
  4947. sodium tetrahydroborate dihydrate
  4948. sodium tetrahydroborate tripyridine
  4949. sodium tetrahydroborate(1-)
  4950. sodium tetraiodoplumbate(2-) hexahydrate
  4951. Sodium tetrametaphosphate
  4952. sodium tetramolybdate heptahydrate
  4953. sodium tetraphenylborate(1-)
  4954. sodium tetratellurite pentahydrate
  4955. sodium tetrathionate dihydrate
  4956. Sodium tetrazolate
  4957. sodium thiocyanate bis(N,N-dimethylacetamide)
  4958. sodium thiocyanate dihydrate
  4959. sodium thiocyanate dimethylformamide
  4960. sodium thiocyanate mono(N,N-dimethylacetamide)
  4961. sodium thiocyanate monoacetonate
  4962. sodium thiocyanate monohydrate
  4963. sodium thiodigermanate undecahydrate
  4964. Sodium thioglycolate
  4965. sodium thiosulfate hexahydrate
  4966. sodium thulium tellurite
  4967. sodium titanium oxide (Na2Ti3O7)
  4968. sodium titanium oxide (Na2Ti6O13)
  4969. sodium triarsenate
  4970. sodium tricesium bromide
  4971. sodium trichromate monohydrate
  4972. sodium trifluoromanganate(1-)
  4973. sodium triiodoplumbate(1-) tetrahydrate
  4974. Sodium trimetaphosphate
  4975. sodium trimethyl-oxidosilane
  4976. Sodium trimolybdate
  4977. sodium trimolybdate heptahydrate
  4978. sodium tripolyphosphate hexahydrate
  4979. sodium tripotassium molybdate
  4980. sodium tris-carbonatocobaltate(III) trihydrate
  4981. sodium trisilver dithiosulfate dihydrate
  4982. sodium tritellurite pentahydrate
  4983. sodium trithallium(I) sulfite
  4984. sodium trithiomolybdate
  4985. sodium trithionate trihydrate
  4986. sodium tungstate bis(sodium 2,3-dimercaptopropanesulfonate) trihydrate
  4987. sodium tungstate decahydrate
  4988. sodium tungstate sodium 2,3-dimercaptopropanesulfonate dihydrate
  4989. sodium tungsten oxide (Na0.49WO3)
  4990. sodium tungsten oxide (Na0.68WO3)
  4991. sodium tungsten oxide (Na0.79WO3)
  4992. sodium tungsten oxide (Na0.7WO3)
  4993. sodium tungsten oxide (Na2W2O7)
  4994. sodium tungsten oxide (Na2W4O13)
  4995. sodium uranate (UO3(1-))
  4996. sodium uranium arsenate oxide (NaU(AsO4)O2)
  4997. sodium uranium arsenate oxide (NaU(AsO4)O2) hydrate (2:3)
  4998. sodium uranium arsenate oxide (NaU(AsO4)O2) monohydrate
  4999. sodium uranium arsenate oxide (NaU(AsO4)O2) trihydrate
  5000. sodium uranium borate oxide (NaU(BO3)O2)
  5001. sodium uranium borate oxide (NaU(BO3)O2) monohydrate
  5002. sodium uranium vanadium oxide (NaUVO6)
  5003. Sodium uranoniobate
  5004. sodium uranyl molybdate
  5005. sodium vanadate (VO3(1-))
  5006. sodium vanadate (VO3(1-))
  5007. sodium vanadium oxide (NaV6O15)
  5008. Sodium warfarinate semi(isopropanol)
  5009. sodium yttrium (III) formate monohydrate
  5010. Sodium yttrium(III) formate
  5011. Sodium yttrium(III) tetra(1,1,1-trifluoro-5,5,5-trimethylacetylacetonate)
  5012. sodium zincate tetrahydrate
  5013. sodium zirconium fluoride monohydrate
  5014. sodium [carbonato(2-)-κO]dioxoneptunate(1-)
  5015. Sodium-2-keto-L-gulonate
  5016. sodium-3-phenylprop-2-enoate
  5017. sodium-potassium alloy
  5018. Sofosbuvir
  5019. solar oil
  5020. sour Natural Gas
  5021. Soya oil 2-Ethylhexyl ester
  5022. soybean oil
  5023. soybean oil
  5024. soybean-oil fatty acids Et esters
  5025. soybean-oil fatty acids Et esters
  5026. spectinomycin dihydrochloride pentahydrate
  5027. Spent coffee grounds biodiesel
  5028. spermaceti
  5029. spindle oil
  5030. spiro(4.5)decan-6-ol
  5031. spiro(bicyclo[6.1.0]nonane-9,1'-cyclopropane)
  5032. spiro(cyclopropane-1,2'-tricyclo(7.1.0.0(1,3))decane)
  5033. spiropentane
  5034. spirophosphorane
  5035. Spirotetramat
  5036. Spiro[1,3,3a,4,5,6,7,7a-octahydroindene-2,2'-1,3-benzodioxole]
  5037. Spiro[1,3-benzodioxole-2,1'-cycloheptane]
  5038. Spiro[1,3-benzodioxole-2,1'-cyclopentane]
  5039. Spiro[1,3-benzodioxole-2,3'-2,4-dihydro-1H-naphthalene]
  5040. Spiro[1,3-benzodioxole-2,4'-2,3-dihydro-1H-naphthalene]
  5041. Spiro[1,3-dithiolane-2,9'-fluorene]
  5042. spiro[2,4,5,6-tetrahydro-1H-indene-3,1'-cyclohexane]-1-one
  5043. spiro[2-Carboxyamidomethyl-1,4,5,6-tetrachlorobicyclo[2.2.1]hept-5-ene-7,2'-(N-2-hydroxyethyl)oxazolidine]
  5044. spiro[2-hydroxymethyl-1,4,5,6-tetrachlorobicyclo[2.2.1]hept-5-ene-7,2'-(N-2-hydroxyethyl)oxazolidine]
  5045. spiro[2-phenyl-1,4,5,6-tetrachlorobicyclo[2.2.1]hept-5-ene-7,2'-(N-2-hydroxyethyl)oxazolidine]
  5046. spiro[2.3]hexane
  5047. Spiro[3H-chromene-2,1'-cyclododecane]-4-one
  5048. spiro[4,5,6,7-tetrahydro-2H-indene-3,1'-cyclohexane]-1-one
  5049. spiro[4-ethyl-2,5-dihydro-5-methyl-1H-imidazole-2,1'-cyclohexane]
  5050. spiro[4.4]nonane
  5051. spiro[4.5]decane
  5052. spiro[5.5]undecan-1-ol
  5053. spiro[5.5]undecane
  5054. Spiro[5.6]dodecan-7-one
  5055. spiro[5.6]dodecane
  5056. spiro[bicyclo[2.2.1]heptane-7,2'-(1,3)dioxolane]
  5057. Spiro[chroman-2,1'-cyclohexan]-4-one
  5058. Spiro[chroman-2,1'-cyclopentan]-4-one
  5059. spiro[cyclopropane-1,6'-tricyclo[3.2.1.0(2,4)]octane]
  5060. spodumene
  5061. Squalene 2,3,22,23-dioxide
  5062. SRC-I naphtha
  5063. SRC-I naphtha
  5064. SRC-II middle distillate
  5065. SRC-II middle distillate
  5066. SRC-II middle distillate sample
  5067. SRC-II naphtha
  5068. SRC-II syncrude
  5069. Stainless Steel Alloy (Type 316L)
  5070. stannane
  5071. Steatite
  5072. steel
  5073. stereoisomer A of 1,2,3,4-tetrahydro-N-methyl-1,4-methanonaphthalen-9-amine
  5074. stereoisomer B of 1,2,3,4-tetrahydro-N-methyl-1,4-methanonaphthalen-9-amin
  5075. stereomer B of 1,2,3,4-tetrahydro-1,4-methanonaphthalen-9-amin
  5076. Sterigmatocystin
  5077. stibine
  5078. Stigmastanol acetate
  5079. stilbene dichloride
  5080. strengite (Fe(PO4).2H2O)
  5081. strontium
  5082. strontium
  5083. Strontium (2+) cation
  5084. strontium (OC-6-11)-hexakis(cyano-κC)ferrate(3-) (3:2)
  5085. strontium (T-4)-molybdate (MoO4(2-)) (1:1)
  5086. strontium (T-4)-tetrafluorostannate(1-)
  5087. strontium (T-4)-tungstate (WO4(2-)) (1:1)
  5088. strontium (T-4)-uranate (UO4(2-)) (1:1)
  5089. Strontium 1-anthraquinonesulfonate
  5090. strontium 2,2',2'',2'''-(1,2-ethanediyldiammonio)tetraacetate
  5091. Strontium 2-anthraquinonesulfonate
  5092. strontium acetate di(acetic acid) dihydrate
  5093. strontium acetate mono(acetic acid)
  5094. strontium acetate monoformamide
  5095. strontium acetate tetrahydrate
  5096. Strontium anthraquinone-1,5-disulfonate
  5097. Strontium anthraquinone-1,8-disulfonate
  5098. Strontium anthraquinone-2,6-sulfonate
  5099. Strontium anthraquinone-2,7-sulfonate
  5100. strontium antimonate (SbO3(1-)) (1:2)
  5101. strontium arsenate dihydrate
  5102. strontium arsenate heptadecahydrate
  5103. strontium azide (Sr(N3)2)
  5104. strontium bis(diethyldithiocarbamodithioato-κS,κS')dioxouranate(1-) (1:2)
  5105. strontium bismuth oxide (SrBi2O4)
  5106. strontium bismuthate (Bi2O5(4-)) (2:1)
  5107. strontium bis[ethanedioato(2-)-κO,κO']oxotitanate(2-) (1:1)
  5108. strontium borohydride
  5109. strontium borohydride di(tetrahydrofuran)
  5110. strontium bromide (SrBr)
  5111. strontium bromide (SrBr2)
  5112. strontium bromide (SrBr2) hexahydrate
  5113. strontium bromide (SrBr2) monohydrate
  5114. strontium bromide hemimethanol
  5115. strontium bromide heptaurea
  5116. Strontium bromide hydroxide
  5117. strontium bromide hydroxide (SrBr(OH))
  5118. strontium bromide monoacetic acid
  5119. strontium bromide sesquimethanol
  5120. strontium bromide tetra (diacetone alcohol)
  5121. strontium bromide triurea
  5122. strontium cadmium chloride pentahydrate
  5123. strontium cerium tellurite
  5124. strontium chloride (SrCl)
  5125. strontium chloride (SrCl2)
  5126. strontium chloride (SrCl2) dihydrate
  5127. strontium chloride (SrCl2) hexahydrate
  5128. strontium chloride (SrCl2) hydrate (2:1)
  5129. strontium chloride (SrCl2) monohydrate
  5130. strontium chloride bis(hexamethylenetetramine) octahydrate
  5131. strontium chloride di(deuterium oxide)
  5132. strontium chloride diurea monohydrate
  5133. strontium chloride hexa(deuterium oxide)
  5134. Strontium chloride hydroxide
  5135. strontium chloride hydroxide (SrCl(OH))
  5136. strontium chloride mono(deuterium oxide)
  5137. strontium chloride tetraurea
  5138. strontium chloride tris(dimethyl sulfoxide)
  5139. strontium chromate (CrO3(2-)) (1:1)
  5140. strontium chromate (SrCrO2)
  5141. Strontium diacetate
  5142. Strontium dicalcium propionate
  5143. strontium diethoxide
  5144. strontium diethoxide diethanol
  5145. strontium diethoxide tetraethanol
  5146. strontium dihydrogen phosphate
  5147. strontium diiodide hexahydrate
  5148. strontium dimandelate dimandelic acid
  5149. strontium diniobium oxide
  5150. strontium dirubidium nitrite
  5151. strontium dirubidium nitrite monohydrate
  5152. strontium dithionate tetrahydrate
  5153. strontium ferrate (SrFeO2)
  5154. strontium fluoride (SrF)
  5155. strontium fluoride (SrF2)
  5156. strontium fluoride di(hydrogen fluoride)
  5157. strontium fluoride mono(acetic acid)
  5158. strontium fluoride mono(hydrogen fluoride)
  5159. strontium fluoride tri(hydrogen fluoride)
  5160. strontium formate dihydrate
  5161. strontium germanate
  5162. strontium hexafluorosilicate dihydrate
  5163. strontium hexafluorosilicate(2-) (1:1)
  5164. strontium hydrogen arsenate monohydrate
  5165. Strontium hydrogen phosphate
  5166. strontium hydrogen selenite
  5167. strontium hydroxide (Sr(OH))
  5168. strontium hydroxide (Sr(OH)2)
  5169. strontium hydroxide (Sr(OH)2) octahydrate
  5170. strontium hydroxide iodide (Sr(OH)I)
  5171. strontium hydroxide monohydrate
  5172. Strontium iodate monodeuterium oxide
  5173. strontium iodide (SrI)
  5174. strontium iodide (SrI2)
  5175. strontium iodide di(methyl isobutyl ketone)
  5176. strontium iodide di(strontium hydroxide) heptahydrate
  5177. strontium iodide dihydrate
  5178. strontium iodide dodecahydrate
  5179. Strontium iodide hydroxide
  5180. strontium iodide tetra(mesityl oxide)
  5181. strontium iodide triurea
  5182. strontium ion (Sr(2+))
  5183. Strontium mercury dioxide
  5184. strontium methanolate
  5185. strontium molybdate (MoO3(2-)) (1:1)
  5186. strontium monoarsenite
  5187. strontium niobate(Nb2O7(4-)) (2:1)
  5188. strontium nitrate dihydrate
  5189. strontium nitrate monohydrate
  5190. strontium nitrite monohydrate
  5191. strontium nitrite tetrahydrate
  5192. strontium oxalate hydrate
  5193. strontium oxide (SrO)
  5194. Strontium pentaoxoditellurate(IV)
  5195. strontium perchlorate bisurea
  5196. strontium perchlorate dihydrate
  5197. strontium perchlorate hexahydrate
  5198. strontium perchlorate hexamethanol
  5199. strontium perchlorate octa-methanol
  5200. strontium perchlorate octahydrate
  5201. strontium perchlorate pentaurea
  5202. strontium perchlorate tetrahydrate
  5203. strontium perchlorate urea monohydrate
  5204. strontium phosphate chloride (Sr10(PO4)6Cl2)
  5205. strontium plumbate (PbO3(2-)) (1:1)
  5206. Strontium selenide
  5207. strontium selenite
  5208. strontium sulfate trihydrate
  5209. Strontium sulfide
  5210. Strontium telluride
  5211. strontium tetrafluoroborate(1-)
  5212. strontium tetrahydrogen diarsenate
  5213. strontium thallium nitrite trihydrate
  5214. strontium titanate (SrTiO4)
  5215. strontium titanium oxide (Sr2TiO4)
  5216. strontium titanium oxide (SrTiO3)
  5217. strontium titanosilicate (Sr2Ti(Si2O7)O)
  5218. strontium trimercury(II) chloride octahydrate
  5219. strontium uranium arsenate oxide (SrU2(AsO4)2O4) octahydrate
  5220. strontium uranium borate oxide (SrU2(BO3)2O4) dihydrate
  5221. strontium uranium oxide (Sr3U11O36)
  5222. strontium uranium oxide (Sr3U2O9)
  5223. strontium uranium oxide phosphate (SrU2O4(PO4)2) octahydrate
  5224. strontium uranyl oxalate tetrahydrate
  5225. strontium vanadate (V2O6(2-)) (1:1)
  5226. strontium zinc chloride pentahydrate
  5227. strontium zirconium oxide (Sr3Zr2O7)
  5228. strontium zirconium oxide (Sr4Zr3O10)
  5229. strontium zirconium oxide (SrZrO3)
  5230. Strontium zirconium phosphate
  5231. Strontium(II) 8-hydroxyquinolinate
  5232. Strontium(II) bis(3-nitro-1,2,4-triazol-5-onate) hexahydrate
  5233. Strontium(II) hydrogen nitrilotriacetate
  5234. Strontium(II) hydrogen nitrilotriacetate dihydrate
  5235. Strontium(II) zirconium(II) silicon oxide
  5236. Strontium-praseodymium oxysilicate
  5237. Strophanthidin
  5238. strychnidin-10-one
  5239. Styryl sulfone
  5240. Succinic acid bicyclo[2.2.1]hept-2-yl ethyl ester
  5241. Succinic acid bicyclo[2.2.1]hept-2-yl heptyl ester
  5242. Succinic acid bicyclo[2.2.1]hept-2-yl isopropyl ester
  5243. succinic acid diurea
  5244. Succinic acid mono-bicyclo[2.2.1]hept-2-yl ester
  5245. Sucrose distearate
  5246. sucrose monopalmitate blend
  5247. sucrose monostearate blend
  5248. Sulfamethazine monohydrate
  5249. Sulfamethazine salicylic acid co-crystal (1:1)
  5250. Sulfamethazine-Saccharin Cocrystal (1:1)
  5251. sulfamic acid
  5252. sulfamic acid barium salt (2:1)
  5253. sulfamic acid cobalt(2+) salt (2:1)
  5254. sulfamic acid lead(2+) salt (2:1)
  5255. sulfamic acid lithium salt
  5256. sulfamic acid magnesium salt (2:1)
  5257. sulfamic acid monoammonium salt
  5258. sulfamic acid monopotassium salt
  5259. sulfamic acid monosodium salt
  5260. sulfamic acid nickel(2+) salt (2:1)
  5261. sulfamic calcium acid salt (2:1)
  5262. sulfamide
  5263. Sulfamonomethoxine monohydrate
  5264. sulfanylidene aluminum
  5265. Sulfanylidene(trifluoromethoxy)amine
  5266. sulfanylideneiron
  5267. sulfate
  5268. Sulfide anion
  5269. sulfinylbis(methane-d3)
  5270. sulfinylbis(trifluoromethane)
  5271. sulfinylbismethane
  5272. Sulfite (2-) Anion
  5273. sulfoacetic acid barium salt (1:1)
  5274. sulfobutanedioic acid 1,4-bis(2,2,3,3,3-pentafluoropropyl)ester sodium salt
  5275. sulfobutanedioic acid 1,4-bis(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl) ester
  5276. sulfobutanedioic acid 1,4-bis(2,2,3,3,4,4,5,5-octafluoropentyl) ester
  5277. sulfobutanedioic acid 1,4-bis(2,2,3,3-tetrafluoropropyl) ester
  5278. sulfobutanedioic acid 1,4-bis(2,2,3,3-tetrafluoropropyl)ester sodium salt
  5279. sulfobutanedioic acid 1,4-bis(2,2,3,4,4,4-hexafluorobutyl)ester sodium salt
  5280. sulfobutanedioic acid 1,4-bis(2-ethylhexyl) ester
  5281. sulfobutanedioic acid 1,4-bis(3,3,4,4,5,5,6,6,6-nonafluorohexyl)ester sodium salt
  5282. sulfobutanedioic acid 1,4-dibutyl ester
  5283. sulfobutanedioic acid 1,4-didecyl ester
  5284. sulfobutanedioic acid 1,4-dihexyl ester
  5285. sulfobutanedioic acid 1,4-dioctyl ester
  5286. sulfonylbis(chloromethane)
  5287. sulfonylbis(dichloromethane)
  5288. sulfonylbis(trichloromethane)
  5289. sulfonylbis-1,3-isobenzofurandione
  5290. sulfonylbismethane
  5291. Sulfonyldiacetic Acid
  5292. sulfur
  5293. sulfur bromide (S2Br2)
  5294. sulfur chloride (S2Cl2)
  5295. sulfur chloride (SCl2)
  5296. sulfur dioxide
  5297. sulfur dioxide-18O
  5298. sulfur fluoride (S2F10)
  5299. sulfur fluoride (S2F2) isomer FS2F
  5300. sulfur fluoride (S2F2) isomer SSF2
  5301. sulfur fluoride (SF)
  5302. sulfur fluoride (SF2)
  5303. sulfur fluoride (SF3)
  5304. sulfur fluoride (SF5)
  5305. sulfur fluoride fluorosulfate (SF4(SFO3)2)
  5306. sulfur oxide (S2O)
  5307. sulfur oxide (SO)
  5308. sulfur(VI) trioxide
  5309. sulfuric acid
  5310. sulfuric acid aluminum ammonium salt (2:1:1)
  5311. sulfuric acid aluminum ammonium salt (2:1:1) dodecahydrate
  5312. sulfuric acid aluminum ammonium salt (4:2:2)
  5313. sulfuric acid aluminum cesium salt (2:1:1)
  5314. sulfuric acid aluminum lithium salt (2:1:1)
  5315. sulfuric acid aluminum magnesium salt (4:2:1)
  5316. sulfuric acid aluminum potassium salt (2:1:1)
  5317. sulfuric acid aluminum potasssium salt (2:1:1) dodecahydrate
  5318. sulfuric acid aluminum rubidium salt (2:1:1)
  5319. sulfuric acid aluminum salt (2:1) compd. with hydrazine (1:1)
  5320. sulfuric acid aluminum salt (2:1) compd. with N-methylmethanamine (1:1) hexahydrate
  5321. sulfuric acid aluminum salt (3:2)
  5322. sulfuric acid aluminum salt (3:2) hydrate (1:16.3)
  5323. sulfuric acid aluminum sodium salt (2:1:1) dodecahydrate
  5324. sulfuric acid aluminum thallium(1+) salt (2:1:1)
  5325. sulfuric acid aluminum zinc(2+) salt (4:2:1)
  5326. sulfuric acid ammonium cadmium salt (2:2:1)
  5327. sulfuric acid ammonium cadmium salt (2:2:1) hexahydrate
  5328. sulfuric acid ammonium cadmium salt (3:2:2)
  5329. sulfuric acid ammonium chromium(3+) salt (2:1:1)
  5330. sulfuric acid ammonium cobalt(2+) salt (2:2:1)
  5331. sulfuric acid ammonium cobalt(2+) salt (2:2:1) hexahydrate
  5332. sulfuric acid ammonium copper(2+) salt (2:2:1)
  5333. sulfuric acid ammonium iron(2+) salt (2:2:1)
  5334. sulfuric acid ammonium iron(2+) salt (2:2:1) hexahydrate
  5335. sulfuric acid ammonium iron(3+) salt (2:1:1)
  5336. sulfuric acid ammonium lithium salt
  5337. sulfuric acid ammonium lithium salt (2:2:2)
  5338. sulfuric acid ammonium magnesium salt (2:2:1)
  5339. sulfuric acid ammonium magnesium salt (2:2:1) hexahydrate
  5340. sulfuric acid ammonium manganese(2+) salt (2:2:1)
  5341. sulfuric acid ammonium manganese(2+) salt (2:2:1) hexahydrate
  5342. sulfuric acid ammonium nickel(2+) salt (2:2:1)
  5343. sulfuric acid ammonium scandium(3+) salt (2:1:1)
  5344. sulfuric acid ammonium vanadium(3+) salt (2:1:1)
  5345. sulfuric acid ammonium zinc salt (2:2:1) hexahydrate
  5346. sulfuric acid ammonium zinc(2+) salt (2:2:1)
  5347. sulfuric acid barium salt (1:1)
  5348. sulfuric acid beryllium salt (1:1)
  5349. sulfuric acid beryllium salt (1:1)
  5350. sulfuric acid beryllium salt (1:1)
  5351. sulfuric acid beryllium salt (1:1)
  5352. sulfuric acid beryllium salt (1:1) dihydrat
  5353. sulfuric acid beryllium salt (1:1) tetrahydrate
  5354. sulfuric acid beryllium salt (1:1)hexahydrat
  5355. sulfuric acid bis(1-methylethyl) ester
  5356. sulfuric acid cadmium cesium salt (2:1:2)
  5357. sulfuric acid cadmium potassium salt (2:1:2)
  5358. sulfuric acid cadmium potassium salt (3:2:2)
  5359. sulfuric acid cadmium salt (1:1)
  5360. sulfuric acid cadmium salt (1:1) hydrate (3:8)
  5361. sulfuric acid cadmium salt (1:1) monohydrate
  5362. sulfuric acid cadmium(2+) rubidium salt (2:1:2)
  5363. sulfuric acid calcium potassium salt (3:2:2)
  5364. sulfuric acid calcium salt (1:1)
  5365. sulfuric acid calcium salt (1:1)
  5366. sulfuric acid calcium salt (1:1) dihydrate
  5367. sulfuric acid calcium salt hydrate (2:2:1)
  5368. sulfuric acid cerium(3+) salt (3:2)
  5369. sulfuric acid cesium chromium(3+) salt (2:1:1)
  5370. sulfuric acid cesium cobalt(2+) salt (2:2:1)
  5371. sulfuric acid cesium copper(2+) salt (2:2:1)
  5372. sulfuric acid cesium indium salt (2:1:1)
  5373. sulfuric acid cesium iron(2+) salt (2:2:1)
  5374. sulfuric acid cesium iron(3+) salt (2:1:1)
  5375. sulfuric acid cesium lithium salt
  5376. sulfuric acid cesium magnesium salt (2:2:1)
  5377. sulfuric acid cesium manganese(2+) salt (2:2:1)
  5378. sulfuric acid cesium nickel(2+) salt (2:2:1)
  5379. sulfuric acid cesium scandium(3+) salt (2:1:1)
  5380. sulfuric acid cesium vanadium(3+) salt (2:1:1)
  5381. sulfuric acid cesium zinc salt (2:2:1)
  5382. sulfuric acid chromium(2+) salt (1:1)
  5383. sulfuric acid chromium(3+) potassium salt (2:1:1)
  5384. sulfuric acid chromium(3+) rubidium salt (2:1:1)
  5385. sulfuric acid chromium(3+) salt (3:2)
  5386. sulfuric acid chromium(3+) salt (3:2) octadecahydrate
  5387. sulfuric acid chromium(3+) thallium(1+) salt (2:1:1)
  5388. sulfuric acid cobalt potassium salt (2:1:2) hexahydrate
  5389. sulfuric acid cobalt(2+) potassium salt (2:1:2)
  5390. sulfuric acid cobalt(2+) rubidium salt (2:1:2)
  5391. sulfuric acid cobalt(2+) salt (1:1)
  5392. sulfuric acid cobalt(2+) salt (1:1) heptahydrate
  5393. sulfuric acid cobalt(2+) salt (1:1) hexahydrate
  5394. sulfuric acid cobalt(2+) salt (1:1) monohydrate
  5395. sulfuric acid copper(2+) potassium salt (2:1:2)
  5396. sulfuric acid copper(2+) potassium salt (2:1:2) hexahydrate
  5397. sulfuric acid copper(2+) rubidium salt (2:1:2)
  5398. sulfuric acid copper(2+) salt (1:1)
  5399. sulfuric acid copper(2+) salt (1:1) pentahydrate
  5400. sulfuric acid copper(2+) salt compd. with L-glutamic acid and L-arginine (1:1:1:1) pentahydrate
  5401. sulfuric acid copper(2+) salt dihydrate
  5402. sulfuric acid copper(2+) thallium(1+) salt (2:1:2)
  5403. sulfuric acid diammonium salt
  5404. sulfuric acid diammonium salt
  5405. sulfuric acid diammonium salt
  5406. sulfuric acid dibutyl ester
  5407. sulfuric acid dicesium salt
  5408. sulfuric acid dicopper(1+) salt
  5409. sulfuric acid diethyl ester
  5410. sulfuric acid diheptyl ester
  5411. sulfuric acid dihexyl ester
  5412. sulfuric acid dihydrate
  5413. sulfuric acid dilithium salt
  5414. sulfuric acid dilithium salt monohydrate
  5415. sulfuric acid dimercury(1+) salt
  5416. sulfuric acid dimethyl ester
  5417. sulfuric acid dipentyl ester
  5418. sulfuric acid dipotassium salt
  5419. sulfuric acid dipropyl ester
  5420. sulfuric acid dirubidium salt
  5421. sulfuric acid disilver(1+) salt
  5422. sulfuric acid disodium manganese salt dihydrate
  5423. sulfuric acid disodium salt
  5424. sulfuric acid disodium salt
  5425. sulfuric acid disodium salt
  5426. sulfuric acid disodium salt
  5427. sulfuric acid disodium salt
  5428. sulfuric acid disodium salt decahydrate
  5429. sulfuric acid disodium salt heptahydrate
  5430. sulfuric acid dithallium(1+) salt
  5431. sulfuric acid dysprosium(3+) salt (3:2)
  5432. sulfuric acid erbium(3+) salt (3:2)
  5433. sulfuric acid europium(2+) salt (1:1)
  5434. sulfuric acid europium(3+) salt (3:2)
  5435. sulfuric acid gadolinium(3+) salt (3:2)
  5436. sulfuric acid gallium(3+) salt (3:2)
  5437. sulfuric acid hafnium(4+) salt (2:1)
  5438. sulfuric acid holmium(3+) salt (3:2)
  5439. sulfuric acid indium(3+) salt (3:2)
  5440. sulfuric acid indium(3+) salt (3:2) nonahydrate
  5441. sulfuric acid iron(2+) potassium salt (2:1:2)
  5442. sulfuric acid iron(2+) rubidium salt (2:1:2)
  5443. sulfuric acid iron(2+) salt (1:1)
  5444. sulfuric acid iron(2+) salt (1:1) heptahydrate
  5445. sulfuric acid iron(2+) salt (1:1) monohydrate
  5446. sulfuric acid iron(2+) salt (1:1) tetrahydrate
  5447. sulfuric acid iron(3+) potassium salt (2:1:1) heptahydrate
  5448. sulfuric acid iron(3+) rubidium salt (2:1:1)
  5449. sulfuric acid iron(3+) rubidium salt (2:1:1) dodecahydrate
  5450. sulfuric acid iron(3+) salt (3:2)
  5451. sulfuric acid iron(3+) salt (3:2) nonahydrate
  5452. sulfuric acid iron(3+) thallium(1+) salt (2:1:1)
  5453. sulfuric acid lanthanum(3+) salt (3:2)
  5454. sulfuric acid lead(2+) salt (1:1)
  5455. sulfuric acid lithium potassium salt
  5456. sulfuric acid lithium potassium salt (2:2:2)
  5457. sulfuric acid lutetium(3+) salt (3:2)
  5458. sulfuric acid magnesium potassium salt (2:1:2)
  5459. sulfuric acid magnesium potassium salt (2:1:2) hexahydrate
  5460. sulfuric acid magnesium rubidium salt (2:1:2)
  5461. sulfuric acid magnesium salt (1:1)
  5462. sulfuric acid magnesium salt (1:1) dodecahydrate
  5463. sulfuric acid magnesium salt (1:1) heptahydrate
  5464. sulfuric acid magnesium salt (1:1) hexahydrate
  5465. sulfuric acid magnesium salt (1:1) hydrate (4:5)
  5466. sulfuric acid magnesium salt (1:1) monohydrate
  5467. sulfuric acid magnesium salt (1:1) pentahydrate
  5468. sulfuric acid magnesium salt (1:1) tetrahydrate
  5469. sulfuric acid magnesium sodium salt (2:1:2)
  5470. sulfuric acid magnesium sodium salt (4:1:6)
  5471. sulfuric acid manganese(2+) potassium salt (2:1:2) tetrahydrate
  5472. sulfuric acid manganese(2+) potassium salt (3:2:2)
  5473. sulfuric acid manganese(2+) rubidium salt (3:2:2)
  5474. sulfuric acid manganese(2+) salt (1:1)
  5475. sulfuric acid manganese(2+) salt (1:1) dihydrate
  5476. sulfuric acid manganese(2+) salt (1:1) monohydrate
  5477. sulfuric acid manganese(2+) salt (1:1) pentahydrate
  5478. sulfuric acid manganese(2+) salt (1:1) tetrahydrate
  5479. sulfuric acid mercury(2+) salt (1:1)
  5480. sulfuric acid mixt. with sulfur trioxide
  5481. sulfuric acid mono(2-butoxyethyl) ester sodium salt
  5482. sulfuric acid mono(2-ethoxyethyl) ester sodium salt
  5483. sulfuric acid mono(2-methoxyethyl) ester sodium salt
  5484. sulfuric acid mono(2-propoxyethyl) ester sodium salt
  5485. sulfuric acid monoammonium salt
  5486. sulfuric acid monocesium salt
  5487. sulfuric acid monodecyl ester sodium salt
  5488. sulfuric acid monododecyl ester sodium salt
  5489. sulfuric acid monoethyl ester
  5490. sulfuric acid monoethyl ester erbium(3+) salt
  5491. sulfuric acid monoethyl ester holmium(3+) salt
  5492. sulfuric acid monoethyl ester lanthanum(3+) salt
  5493. sulfuric acid monoethyl ester neodymium(3+) salt
  5494. sulfuric acid monoethyl ester samarium(3+) salt
  5495. sulfuric acid monoethyl ester yttrium(3+) salt
  5496. sulfuric acid monohydrate
  5497. sulfuric acid monolithium salt
  5498. sulfuric acid monomethyl ester
  5499. sulfuric acid monooctadecyl ester ion(1-)
  5500. sulfuric acid monooctadecyl ester potassium salt
  5501. sulfuric acid monopotassium salt
  5502. sulfuric acid monorubidium salt
  5503. sulfuric acid monosodium salt
  5504. sulfuric acid mono[2-(2-butoxyethoxy)ethyl] ester sodium salt
  5505. sulfuric acid mono[2-(2-methoxyethoxy)ethyl] ester sodium salt
  5506. sulfuric acid neodymium(3+) salt (3:2)
  5507. sulfuric acid nickel sodium salt (2:1:2)
  5508. sulfuric acid nickel(2+) potassium salt (2:1:2)
  5509. sulfuric acid nickel(2+) rubidium salt (2:1:2)
  5510. sulfuric acid nickel(2+) salt (1:1)
  5511. sulfuric acid nickel(2+) salt (1:1) heptahydrate
  5512. sulfuric acid nickel(2+) salt (1:1) hexahydrate
  5513. sulfuric acid nickel(2+) salt (1:1) monohydrate
  5514. sulfuric acid nickel(2+) thallium(1+) salt (2:1:2)
  5515. sulfuric acid phenyl ester barium salt (2:1)
  5516. sulfuric acid potassium scandium(3+) salt (2:1:1)
  5517. sulfuric acid potassium sodium salt (2:3:1)
  5518. sulfuric acid potassium zinc salt (2:2:1)
  5519. sulfuric acid praseodymium(3+) salt (3:2)
  5520. sulfuric acid radium salt (1:1)
  5521. sulfuric acid rubidium scandium(3+) salt (2:1:1)
  5522. sulfuric acid rubidium uranium(4+) salt (3:2:1)
  5523. sulfuric acid rubidium vanadium(3+) salt (2:1:1)
  5524. sulfuric acid rubidium zinc salt (2:2:1)
  5525. sulfuric acid samarium(3+) salt (3:2)
  5526. sulfuric acid scandium(3+) salt (3:2)
  5527. sulfuric acid scandium(3+) sodium salt (3:1:3)
  5528. sulfuric acid sodium yttrium(3+) salt (4:2:2) dihydrate
  5529. sulfuric acid sodium zinc salt (2:2:1)
  5530. sulfuric acid sodium zinc(2+) salt (2:2:1) tetrahydrate
  5531. sulfuric acid strontium salt (1:1)
  5532. sulfuric acid terbium(3+) salt
  5533. sulfuric acid tetrahydrate
  5534. sulfuric acid thallium(1+) vanadium(3+) salt (2:1:1)
  5535. sulfuric acid thallium(1+) zinc salt (2:2:1)
  5536. sulfuric acid thallium(3+) salt (3:2)
  5537. sulfuric acid thorium(4+) salt (2:1)
  5538. sulfuric acid tin(2+) salt (1:1)
  5539. sulfuric acid trihydrate
  5540. sulfuric acid uranium(4+) salt (2:1)
  5541. sulfuric acid ytterbium(3+) salt (3:2)
  5542. sulfuric acid yttrium(3+) salt (3:2)
  5543. sulfuric acid zinc salt (1:1)
  5544. sulfuric acid zinc salt (1:1) heptahydrate
  5545. sulfuric acid zinc salt (1:1) hexahydrate
  5546. sulfuric acid zinc salt (1:1) monohydrate
  5547. sulfuric acid zirconium(4+) salt (2:1)
  5548. sulfuric acid-d2
  5549. sulfuric acid; urea
  5550. sulfurid acid monoammonium salt compd. with nitric acid ammonium salt
  5551. sulfurofluoridic acid fluoride
  5552. sulfurous aci bis(2,3-dichloropropyl) ester
  5553. sulfurous acid
  5554. sulfurous acid 2-(4-(1,1-dimethylethyl)phenoxy)cyclohexyl 2-propynyl ester
  5555. sulfurous acid barium salt (1:1)
  5556. sulfurous acid bis(1-methylethyl) ester
  5557. sulfurous acid bis(2,2,3,3,4,4,5,5-octafluoropentyl) ester
  5558. sulfurous acid bis(2,2-dimethylpropyl) ester
  5559. sulfurous acid bis(2-bromoethyl) ester
  5560. sulfurous acid bis(2-methylpropyl) ester
  5561. sulfurous acid bis(3-chloropropyl) ester
  5562. sulfurous acid bis[1-(1-methylethyl)-2,2-dimethylpropyl] ester
  5563. sulfurous acid cadmium salt (1:1)
  5564. sulfurous acid calcium salt (1:1)
  5565. sulfurous acid diammonium salt
  5566. sulfurous acid dibutyl ester
  5567. sulfurous acid dicesium salt
  5568. sulfurous acid dicyclohexyl ester
  5569. sulfurous acid diethyl ester
  5570. sulfurous acid diheptyl ester
  5571. sulfurous acid dihexyl ester
  5572. sulfurous acid dimethyl ester
  5573. sulfurous acid dipentyl ester
  5574. sulfurous acid diphenyl ester
  5575. sulfurous acid dipotassium salt
  5576. sulfurous acid dipropyl ester
  5577. sulfurous acid dirubidium salt
  5578. sulfurous acid disilver(1+) salt
  5579. sulfurous acid disodium salt
  5580. sulfurous acid disodium salt heptahydrate
  5581. sulfurous acid dithallium(1+) salt
  5582. sulfurous acid ethyl methyl ester
  5583. sulfurous acid magnesium salt (1:1)
  5584. sulfurous acid magnesium salt (2:1)
  5585. sulfurous acid monoammonium salt
  5586. sulfurous acid monopotassium salt
  5587. sulfurous acid monosodium salt
  5588. sulfurous acid zinc salt (1:1)
  5589. sulfurous acid zinc salt (2:1)
  5590. sulfuryl bromide fluoride
  5591. sulfuryl chloride
  5592. sulfuryl chloride fluoride
  5593. sulfuryl fluoride
  5594. sulfuryl fluoride isocyanate
  5595. sunflower oil
  5596. sunflower oil
  5597. sunflower oil
  5598. Sunitinib malate
  5599. superoxide
  5600. swine lard oil biodiesel
  5601. sym-(n-Decyl)-dibenzo-16-crown-5-oxyacetic acid
  5602. sym-(n-Tetradecane)-dibenzo-16-crown-5-oxyacetic acid
  5603. sym-(tetraethyl diallyl disilicate)
  5604. sym-N-trifluoroacetylphenylalanine anhydride
  5605. syn 4,9-bis(Methoxycarbonyl)pagodane
  5606. syn-3-(1-acetylamino-2-methyl-3-oxo-3-phenylpropyl)phenol acetate
  5607. syn-Dechlorane plus
  5608. syn-N-(2-methyl-3-oxo-1,3-diphenylpropyl)acetamide
  5609. syn-N-1-[2-methyl-3-oxo-1-phenylbutyl]acetamide
  5610. syn-N-[1-(4-chlorophenyl)-2-methyl-3-oxo-3-phenylpropyl]acetamide
  5611. syn-N-[2-methyl-1-(4-methylphenyl)-3-oxo-3-phenylpropyl]acetamide
  5612. syn-N-[2-methyl-1-(4-methylphenyl)-3-oxo-butyl]acetamide
  5613. synephrine
  5614. synthetic crude oil
  5615. synthetic Natural Gas Mixture
  5616. synthetic oil
  5617. synthoil distillate
  5618. synthoil distillate
  5619. Syringyl alcohol
  5620. systol T 124
  5621. t-Butyl 3-(carbamoylhydrazinylidene)propanoate
  5622. t-Butyl formylacetate
  5623. t-Butylthiobutenyne
  5624. talc (Mg3H2(SiO3)4)
  5625. Tallium mandelate monomandelic acid
  5626. tallow
  5627. tallow fatty acids Et esters
  5628. tamoxifen
  5629. Tangeritin
  5630. Tanium(IV)(di(2,4-dihydroxybenzly)-benzidine trichloride)
  5631. tantalum
  5632. tantalum boride (TaB2)
  5633. tantalum bromide (TaBr5)
  5634. tantalum carbide
  5635. tantalum chloride (TaCl4)
  5636. tantalum chloride (TaCl5)
  5637. tantalum fluoride (TaF)
  5638. tantalum fluoride (TaF2)
  5639. tantalum fluoride (TaF3)
  5640. tantalum fluoride (TaF4)
  5641. tantalum fluoride (TaF5)
  5642. tantalum hydride (Ta2D)
  5643. tantalum iodide (TaI5)
  5644. tantalum oxide (Ta2O5)
  5645. tantalum oxide (TaO)
  5646. tantalum oxide (TaO2)
  5647. tantalum silicide (TaSi2)
  5648. Tantalum(V) nitrosyl fluoride
  5649. tantalum(V) pentapropoxide
  5650. tar oil
  5651. tar oil
  5652. taranakite (Al5K3H6(PO4)8.xH2O)
  5653. Taraxasterol
  5654. TAS 130
  5655. TAS 155
  5656. TAS 160
  5657. TAS 183s
  5658. TAS 190
  5659. Tb (3+) Cation
  5660. technetium fluoride (TcF5)
  5661. telluric acid (H2Te2O5)
  5662. telluric acid (H2Te2O5) copper(2+) salt (1:1)
  5663. telluric acid (H2Te2O5) magnesium salt (1:1)
  5664. telluric acid (H2Te2O5) manganese(2+) salt (1:1)
  5665. telluric acid (H2TeO3)
  5666. telluric acid (H2TeO3) barium salt (1:1)
  5667. telluric acid (H2TeO3) cadmium magnesium salt (2:1:1)
  5668. telluric acid (H2TeO3) cadmium salt (1:1)
  5669. telluric acid (H2TeO3) calcium cadmium salt (2:1:1)
  5670. telluric acid (H2TeO3) calcium salt (1:1)
  5671. telluric acid (H2TeO3) cerium(4+) salt (2:1)
  5672. telluric acid (H2TeO3) cobalt(2+) salt (1:1)
  5673. telluric acid (H2TeO3) dilithium salt
  5674. telluric acid (H2TeO3) dipotassium salt
  5675. telluric acid (H2TeO3) dirubidium salt
  5676. telluric acid (H2TeO3) disodium salt
  5677. telluric acid (H2TeO3) dysprosium(3+) salt (3:2)
  5678. telluric acid (H2TeO3) erbium(3+) salt (3:2)
  5679. telluric acid (H2TeO3) gadolinium(3+) salt (3:2)
  5680. telluric acid (H2TeO3) gallium salt (3:2)
  5681. telluric acid (H2TeO3) holmium(3+) salt (3:2)
  5682. telluric acid (H2TeO3) indium(3+) salt (3:2)
  5683. telluric acid (H2TeO3) lanthanum(3+) salt (3:2)
  5684. telluric acid (H2TeO3) magnesium salt (1:1)
  5685. telluric acid (H2TeO3) manganese(2+) salt (1:1)
  5686. telluric acid (H2TeO3) strontium salt (1:1)
  5687. telluric acid (H2TeO3) terbium(3+) salt (3:2)
  5688. telluric acid (H2TeO3) thallium(3+) salt
  5689. telluric acid (H2TeO3) thorium(4+) salt (2:1)
  5690. telluric acid (H2TeO3) thulium(3+) salt (3:2)
  5691. telluric acid (H2TeO3) ytterbium(3+) salt (3:2)
  5692. telluric acid (H2TeO3) yttrium(3+) salt (3:2)
  5693. telluric acid (H2TeO3) zinc salt (1:1)
  5694. telluric acid (H2TeO4) dicopper(1+) salt
  5695. telluric acid (H2TeO4) dipotassium salt
  5696. telluric acid (H2TeO4) disodium salt
  5697. telluric acid (H2TeO4) zinc salt (1:1)
  5698. tellurim fluoride (Te2F10)
  5699. tellurium
  5700. tellurium 85, silicium 15 (atomic)
  5701. tellurium alloy base Te 83,Pb 17
  5702. tellurium alloy base Te 85,Bi 15
  5703. tellurium alloy base Te 86,Sn 14
  5704. tellurium alloy base Te 91,Ge 9.1
  5705. tellurium alloy base, Te 89,Sb 11
  5706. tellurium chloride (TeCl2)
  5707. tellurium chloride oxide (Te6Cl2O11)
  5708. tellurium oxide (TeO2)
  5709. tellurium terbium oxide (Te4Tb2O11)
  5710. tellurium thulium oxide (Te4Tm2O11)
  5711. tellurium tin oxide (Te3SnO8)
  5712. tellurium titanium oxide (Te3TiO8)
  5713. tellurium ytterbium oxide (Te4Yb2O11)
  5714. tellurium yttrium oxide (Te4Y2O11)
  5715. tellurium zinc oxide (Te3Zn2O8)
  5716. Tellurium(I) monoiodide
  5717. tellurobismethane
  5718. telluroxo(tetratelluro)zirconium
  5719. Terbinafine hydrochloride
  5720. terbium
  5721. terbium (III) iron garnet
  5722. Terbium (III) nitrate dihydrate
  5723. Terbium (III) nitrate monohydrate
  5724. Terbium (III) nitrate tetrahydrate
  5725. terbium (III) orthovanadate
  5726. Terbium (III) trisulfide
  5727. terbium acetate tetrahydrate
  5728. terbium boride (TbB2)
  5729. terbium bromide (TbBr3)
  5730. terbium chloride (TbCl3)
  5731. terbium chloride oxide (TbClO)
  5732. Terbium cobalt(III) oxide
  5733. terbium cuprate
  5734. terbium ferroborate
  5735. Terbium Hafnate
  5736. Terbium hydrogen uranosilicate
  5737. Terbium hydrogen uranosilicate decahydrate
  5738. terbium hydroxide (Tb(OH)3)
  5739. terbium iodide (TbI3)
  5740. Terbium manganite
  5741. Terbium orthotantalate
  5742. Terbium perchlorate dithiourea decahydrate
  5743. Terbium perchlorate nonahydrate
  5744. terbium propionate
  5745. terbium tetraethylammonium nitrate
  5746. terbium(+3) cation trichloride hexahydrate
  5747. terbium(+3) cation trifluoride
  5748. terbium(+3) cation trinitrate hexahydrate
  5749. terbium(3+) phosphate
  5750. Terbium(III) β-resorcylate
  5751. Terbium(III) bis(1,10-phenanthroline 1-oxide) trichloride
  5752. Terbium(III) bromide hexahydrate
  5753. terbium(III) diquinolinium nitrate trihydrate
  5754. terbium(III) ethylsulfate
  5755. Terbium(III) histidine trinitrate monohydrate
  5756. terbium(III) potassium sulfate dihydrate
  5757. terbium(III) sulfate octahydrate
  5758. Terbium(III) tetrakis(5,6-benzoquinoline) trinitrate
  5759. Terbium(III) triindium(I)
  5760. Terbium(III) triisothiocyanate tris(2,6-Dimethylpicoline-N-oxide)
  5761. Terbium(III) trilead(I)
  5762. Terbium(III) tris(1,4-thioxane-S-oxide trifluoroacetate)
  5763. Terbium(III) tris(2,6-dichlorobenzoic acid)
  5764. Terbium(III) tris(3-Methoxybenzoate)
  5765. Terbium(III) tris(3-nitro-1,2,4-triazol-5-onate)
  5766. Terbium(III) tris(3-nitro-1,2,4-triazol-5-onate) pentahydrate
  5767. Terbium(III) tris(salicylate)
  5768. Terbium(III) trithallium(I)
  5769. Terbium(III)-2,5-dihydroxybenzoate
  5770. Terbium(III)-2,6-dihydroxybenzoate
  5771. Terbium(III)-tris-(2,2,6,6-tetramethyl-3,5-heptanedionate)
  5772. terbium(III)chloride hexa(pyridine) hydrochloride
  5773. terbium(III)iodide bisthiourea decahydrate
  5774. terbium(III)iodide nonahydrate
  5775. Terbium(III)oxide
  5776. Terbium(III)trifluoromethanesulphonate hepta(4-picoline-N-oxide)
  5777. Terbium-2,2-bipyridine tris(3,4-dimethylbenzoate) complex
  5778. Terephthalic acid, bis (p-butoxyphenyl) ester
  5779. Terephthalic acid, bis (p-chlorophenyl) ester
  5780. Terephthalic acid, bis (p-ethoxyphenyl) ester
  5781. Terephthalic acid, bis (p-heptyloxyphenyl) ester
  5782. Terephthalic acid, bis (p-hexyloxyphenyl) ester
  5783. Terephthalic acid, bis (p-methoxyphenyl) ester
  5784. Terephthalic acid, bis (p-propoxyphenyl) ester
  5785. Terephthalodimorpholide
  5786. Terephthalodipiperidide
  5787. Terephthalodipyrrolidide
  5788. termolan
  5789. Terpenylic acid
  5790. Terpenylic acid ethylester
  5791. Terphenyl ethoxyacetate
  5792. terpineol
  5793. terpinol diformate
  5794. tert-amylmercuric bromide
  5795. tert-Butanol dimer
  5796. tert-Butoxycarbonyl-L-proline
  5797. tert-Butyl 1,2,2,2-tetrachloroethyl carbonate
  5798. tert-Butyl 1-methylcyclohex-1-yl peroxide
  5799. tert-Butyl 2,4,5-trimethylfuran-3-carboxylate
  5800. tert-Butyl 2,5-dimethyl-4-propylfuran-3-carboxylate
  5801. tert-Butyl 2-acetyl-3-methylpent-4-ynoate
  5802. tert-butyl 2-cyanoacetate
  5803. tert-Butyl 3,5-dimethyl-2-methylidene-3H-furan-4-carboxylate
  5804. tert-butyl 3,5-dinitrobenzoate
  5805. tert-Butyl 3-methyl-2-methylidene-5-(2-methylpropyl)-3H-furan-4-carboxylate
  5806. tert-Butyl 4,5-dimethyl-2-(2-methylpropyl)furan-3-carboxylate
  5807. tert-Butyl 4-(4-cyano-2-(dimethylamino)-1,3-oxazole-5-yl)piperazine-1-carboxylate
  5808. tert-Butyl 4-(4-cyano-2-(methylamino)-1,3-oxazol-5-yl)piperazine-1-carboxylate
  5809. tert-Butyl 4-tert-butylcyclohexane-1-carboxylate
  5810. tert-Butyl 4-[4-(4-cyanobenzoyloxy)benzylideneamino]benzoate
  5811. tert-Butyl 4-[[4-(4-methoxybenzoyl)oxyphenyl]methylideneamino]benzoate
  5812. tert-Butyl 5-methyl-2-methylidene-3-propyl-3H-furan-4-carboxylate
  5813. tert-Butyl benzenesulfinate
  5814. tert-Butyl diethylacetate
  5815. tert-Butyl hydrogen phthalate
  5816. tert-Butyl imidazole-1-carboxylate
  5817. Tert-butyl N-(2-methoxyethyl)carbamate
  5818. tert-Butyl N-benzylcarbamate
  5819. tert-Butyl pentamethylethyl peroxide
  5820. tert-butyl tert-amyl disulfide
  5821. tert-butyl triallyl orthosilicate
  5822. tert-Butyl(4-(3-{2-[4-(oxan-4-yloxy)phenyl]ethynyl}phenyl)phenoxy)diphenylsilane
  5823. tert-Butyl(cyclohexylmethoxy)dimethylsilane
  5824. tert-Butyl(cyclohexyloxy)silane
  5825. tert-Butyl(imino)dimethylphosphorane
  5826. tert-butyl(propan-2-yl)mercury
  5827. tert-Butyl(trifluorosilyl)amine
  5828. tert-Butyl-(2-diphenylphosphinoselenoylethyl)-selanylidenephosphine
  5829. tert-butyl-(3S)-3-[(1R,2R,3S,5R)-(pinanediyldioxy)boryl]butanoate
  5830. tert-butyl-(oxiran-2-ylmethylidene)amine
  5831. Tert-butyl-2-[N-(tert-butyloxymethyl)-2-picolyamino]acetate
  5832. Tert-butyl-2-[N-octyl-2-picolyamino]acetate
  5833. tert-Butyl-bis(furan-2-ylmethyl)phosphane
  5834. Tert-Butyl-chloro-propan-2-yloxyphosphane
  5835. tert-Butyl-di(propan-2-yloxy)phosphane
  5836. tert-Butyl-dimethyl-prop-2-enylsilane
  5837. tert-Butyl-dimethyl-tribromogermylimino-lambda5-phosphane
  5838. tert-Butyl-dimethyl-trichlorogermylimino-lambda5-phosphane
  5839. Tert-Butyl-oxo-propan-2-yloxyphosphine
  5840. tert-Butyl-trifurfuryl-phosphonium bromide
  5841. tert-Butylchloro(di-tert-butylamino)arsen
  5842. tert-Butylcyanoacetic acid
  5843. tert-Butylcyanoacetic acid methyl ester
  5844. tert-butyliminotantalum; ethyl-methylazanide
  5845. tert-butylmercuric bromide
  5846. tert-butylphenoxyacetic acid
  5847. tert-Butylphthalonitrile
  5848. tert-Butylsulfanyl(hexadecylsulfanyl)methanethione
  5849. tert-Butylsulfanyl(octylsulfanyl)methanethione
  5850. tert-Butyltetralin
  5851. tert-Butyl[2-(diphenylphosphorothioyl)ethyl]sulfanylidenephosphine
  5852. tert-Nitrosobutane dimer
  5853. tert.-Butylboronic acid diethanolamine ester
  5854. tert.-Butylmercapto-(bis-trifluormethyl)phosphin
  5855. Testosterone benzoate
  5856. testosterone buanoate
  5857. testosterone pentanoate
  5858. Testosterone phenylacetate
  5859. Testosterone phenylbutyrate
  5860. Testosterone phenylvalerate
  5861. tetafluorooxirane
  5862. Tetra(1,1,1-Trifluoropentane-2,4-dione) potassium praseodymium(III)
  5863. Tetra(1,1,1-Trifluoropentane-2,4-dione) sodium praseodymium(III)
  5864. Tetra(4-Picoline) cadmium(II) diiodide
  5865. tetra(5,5-dimethyl-1,3-dioxaphosphorinanyl-2-oxy)neopentane
  5866. tetra(ammonium sulfate)monosulfuric acid
  5867. tetra(gadolinium(III) phosphate) phosphoric acid octahydrate
  5868. tetra(oxiran-2-ylmethyl) benzene-1,2,4,5-tetracarboxylate
  5869. Tetra(p-tolyl)antimony (2-carboxy)benzene sulfonate
  5870. Tetra(p-tolyl)antimony 2,4-dimethylbenzene sulfonate
  5871. Tetra(p-tolyl)antimony 3,4-dimethylbenzene sulfonate
  5872. Tetra(para-tolyl)antimony 2,4-dichlorophenoxyacetate
  5873. Tetra(para-tolyl)antimony benzenesulfonate
  5874. Tetra(para-tolyl)antimony cinnamaldoximate
  5875. tetra(potassium hydrogen sulfate) tri(sulfuric acid) dihydrate
  5876. tetra(potassium hydrogen sulfate) tri(sulfuric acid) monohydrate
  5877. tetra(potassium sulfate) mono sulfuric acid monohydrate
  5878. tetra(silver nitrate) succinonitrile
  5879. tetra(sodium phosphate) sodium hydroxide 48-hydrate
  5880. tetra(sodium sulfate) sodium chloride dihydrogen peroxide
  5881. tetra(triphenylgermyl) tricadmium dinickel bis(cyclopentadienyl)
  5882. tetra(undecyl)silane
  5883. tetra(yttrium (III) perchlorate) tris(benzo-15-crown-5) dodecahydrate dodecamethanol
  5884. tetra-μ3-carbonyldodecacarbonyloctahedrohexarhodium
  5885. tetra-(2,2,6,6-tetramethylheptane-3,5-dionato) zirconium
  5886. tetra-2-propenylsilane
  5887. tetra-i-amylammonium bromide Dihydrate
  5888. tetra-i-amylammonium bromide Dotriacontahydrate
  5889. tetra-i-amylammonium bromide Hexacosahydrate
  5890. tetra-i-amylammonium bromide Octatriacontahydrate
  5891. tetra-i-amylammonium chloride dihydrate
  5892. tetra-i-amylammonium chloride dotriacontahydrate
  5893. tetra-i-amylammonium chloride heptacosahydrate
  5894. tetra-i-amylammonium chloride oktatriacontahydrate
  5895. tetra-i-amylammonium iodide Dihydrate
  5896. tetra-i-amylammonium iodide Dotriacontahydrate
  5897. tetra-i-amylammonium iodide Hexatriacontahydrate
  5898. tetra-mu-chlorotetrachloro(tin)dialuminum
  5899. Tetra-N-butylammonium hexanesulfonate
  5900. Tetra-N-butylammonium pentanesulfonate
  5901. Tetra-N-butylammonium propanesulfonate
  5902. Tetra-n-butylarsonium iodide
  5903. Tetra-n-butylphosphonium iodide
  5904. tetra-n-hexylphosphonium iodide
  5905. tetra-n-octylphosphonium iodide
  5906. tetra-N-pyrrolylgermanium
  5907. Tetra-o-cyclohexylphenoxysilane
  5908. Tetra-p-biphenyloxysilane
  5909. Tetra-tert-butylorthothiogermanate
  5910. tetraacetylethylenediamine
  5911. tetraammonium (OC-6-11)-hexabromocadmate(4-)
  5912. tetraammonium (OC-6-11)-hexakis(cyano-C)ferrate(4-)
  5913. tetraammonium calcium thiocyanate dihydrate
  5914. tetraammonium molybdate trinitrate
  5915. tetraammonium thorium sulfate dihydrate
  5916. tetraammonium tricalcium chromate trihydrate
  5917. Tetraaqua tris(4-propyl-1,2,4-triazole) iron(II) bromide
  5918. tetraaqua-L-hexaprolinatopraseodymium(III) perchlorate
  5919. tetraaquabis(mu-(glycinato-κO:κO'))bis(mu-(glycinato-κO:κO,κO'))bis(glycinato-κO)diholmium hexaperchlorate dihydrate
  5920. tetraaquahexa-L-prolinatoerbium(III) perchlorate
  5921. tetraaquahexa-L-prolinegadolinium(III)-perchlorate
  5922. tetraaquahexa-L-prolineneodymium(III)-perchlorate
  5923. Tetraaquahexaglycineerbium(III) diaquadisodiumoctaperchlorate tetrahydrate complex
  5924. tetraaquahexakis(glycinato)digadolinium hexaperchlorate pentahydrate compd. with tetraaquahexakis(glycinato)gadoliniumyttrium hexaperchlorate pentahydrate (1:2)
  5925. tetraaquatetrakis(mu-(glycinato-κO:κO'))bis(glycinato-κO,κO')dilanthanum hexaperchlorate
  5926. tetraaquatetrakis(mu-(glycinato-O:O'))bis(glycinato-O)dierbium hexaperchlorate pentahydrate
  5927. tetraaquatetrakis(mu-(glycinato-O:O'))bis(glycinato-O)dipraseodymium hexaperchlorate pentahydrate
  5928. tetraaquatetrakis(mu-(L-prolinato-κO2:κO2'))bis(L-prolinato-κO2)digadolinium hexaperchlorate
  5929. tetraaquatetrakis(mu-(L-prolinato-κO2:κO2'))bis(L-prolinato-κO2)dineodymium hexaperchlorate
  5930. tetraarsenic tetrasulfide
  5931. tetraarsenic triselenide
  5932. tetraarsenic trisulfide
  5933. tetrabenzo(a,cd,j,lm)perylene
  5934. tetrabenzo(de,hi,op,st)pentacene
  5935. tetrabenzo-24-crown-8
  5936. tetrabenzyltitanium
  5937. tetrabenzylzirconium
  5938. tetraborane(10)
  5939. Tetrabromo 1,2-ethylene bisdiphenylphosphine dimercury
  5940. Tetrabromo 1,4-butylene bisdiphenylphosphine dimercury
  5941. tetrabromoborate(1-)
  5942. Tetrabromocyclohexane
  5943. tetrabromoethene
  5944. tetrabromogermane
  5945. tetrabromomethane
  5946. tetrabromooctadecanoic acid
  5947. Tetrabromopentan-2-one
  5948. tetrabromoplumbane
  5949. tetrabromosilane
  5950. tetrabromostannane
  5951. tetrabromothiophene
  5952. tetrabromotris(triphenylphosphine)diiron
  5953. Tetrabutylammonium β-alaninate
  5954. Tetrabutylammonium 2-(2-(2-methoxyethoxy)ethoxy)acetate
  5955. tetrabutylammonium 2-(bis(2-hydroxyethyl)amino)ethanesulfonate
  5956. Tetrabutylammonium 2-(cyclohexylamino)ethanesulfonate
  5957. Tetrabutylammonium 2-(morpholin-4-yl)ethane-1-sulfonate
  5958. Tetrabutylammonium 2-acrylamido-2-methylpropanesulfonate
  5959. Tetrabutylammonium 2-furoate
  5960. tetrabutylammonium 2-hydroxy-3-morpholinopropanesulfonate
  5961. Tetrabutylammonium 2-[(2-amino-2-oxoethyl)amino]ethanesulfonate
  5962. Tetrabutylammonium 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethane-1-sulfonate
  5963. tetrabutylammonium 3-(cyclohexylamino)-2-hydroxypropanesulfonate
  5964. Tetrabutylammonium 3-{[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino}propane-1-sulfonate
  5965. Tetrabutylammonium acyclovir
  5966. tetrabutylammonium bromide 24-hydrate
  5967. tetrabutylammonium bromide 32-hydrate
  5968. tetrabutylammonium bromide 36-hydrate
  5969. tetrabutylammonium bromide dihydrate
  5970. tetrabutylammonium bromide trihydrate
  5971. Tetrabutylammonium bromoborate
  5972. tetrabutylammonium copper(II) bromide
  5973. Tetrabutylammonium D-phenylalaninate
  5974. Tetrabutylammonium L-alanine
  5975. Tetrabutylammonium L-argininate
  5976. Tetrabutylammonium L-glutamate
  5977. Tetrabutylammonium L-histidinate
  5978. Tetrabutylammonium L-leucinate
  5979. Tetrabutylammonium L-phenylalaninate
  5980. Tetrabutylammonium L-prolinate
  5981. Tetrabutylammonium L-serinate
  5982. Tetrabutylammonium perrhenate
  5983. Tetrabutylammonium R-10-camphor-sulfonate
  5984. Tetrabutylammonium tetracyanoborate
  5985. Tetrabutylammonium tetrahydro-2-furoate
  5986. Tetrabutylammonium thiophene-2-caboxylate
  5987. tetrabutylammonium trifluoro(heptafluoropropyl)borate
  5988. tetrabutylammonium trifluoro(nonafluorobutyl)borate
  5989. tetrabutylammonium trifluoro(pentafluoroethyl)borate
  5990. tetrabutylammonium trifluoro(tridecafluorohexyl)borate
  5991. Tetrabutylammonium trifluoroacetate
  5992. Tetrabutylammonium valinate
  5993. Tetrabutylamonium glycinate
  5994. tetrabutylarsonium salt with 2,4,6-trinitrophenol (1:1)
  5995. tetrabutylazanium acetate
  5996. tetrabutylborate(1-)
  5997. tetrabutylgermane
  5998. tetrabutylhydrazine
  5999. tetrabutylphosphanium chloride
  6000. Tetrabutylphosphonium 2,2-dimethylbutyrate
  6001. tetrabutylphosphonium 2,3,4-trihydroxybutanoate
  6002. tetrabutylphosphonium 2,6-diaminohexanoate
  6003. Tetrabutylphosphonium 2-(2-(2-methoxyethoxy)ethoxy)acetate
  6004. tetrabutylphosphonium 2-(bis(2-hydroxyethyl)amino)ethanesulfonate
  6005. tetrabutylphosphonium 2-amino-3-hydroxypropanoate
  6006. tetrabutylphosphonium 2-amino-3-methylbutanoate
  6007. tetrabutylphosphonium 2-amino-3-sulfanylpropanoate
  6008. tetrabutylphosphonium 2-aminoethanesulfonate
  6009. Tetrabutylphosphonium 2-butyloctanoate
  6010. Tetrabutylphosphonium 2-ethylbutyrate
  6011. Tetrabutylphosphonium 2-ethylhexanoate
  6012. Tetrabutylphosphonium 2-furoate
  6013. Tetrabutylphosphonium 2-hexyldecanoate
  6014. tetrabutylphosphonium 2-hydroxy-3-morpholinopropanesulfonate
  6015. tetrabutylphosphonium 3-(cyclohexylamino)-2-hydroxypropanesulfonate
  6016. Tetrabutylphosphonium 4-ethyloctanoate
  6017. Tetrabutylphosphonium acetate
  6018. Tetrabutylphosphonium acyclovir
  6019. tetrabutylphosphonium bis(2,4,4-trimethylpentyl)phosphinate
  6020. tetrabutylphosphonium bromide
  6021. tetrabutylphosphonium caprylate
  6022. tetrabutylphosphonium formate
  6023. tetrabutylphosphonium glycinate
  6024. tetrabutylphosphonium glycine ion(1-)
  6025. tetrabutylphosphonium hexafluorophosphate(1-)
  6026. Tetrabutylphosphonium isostearate
  6027. tetrabutylphosphonium l-alanine ion(1-)
  6028. tetrabutylphosphonium l-arginine ion(1-)
  6029. tetrabutylphosphonium l-asparagine ion(1-)
  6030. tetrabutylphosphonium l-aspartic acid ion(1-)
  6031. tetrabutylphosphonium l-cysteine ion(1-)
  6032. tetrabutylphosphonium l-glutamic acid ion(1-)
  6033. tetrabutylphosphonium l-histidine ion(1-)
  6034. tetrabutylphosphonium l-isoleucine ion(1-)
  6035. tetrabutylphosphonium L-leucine ion(1-)
  6036. tetrabutylphosphonium l-lysine ion(1-)
  6037. tetrabutylphosphonium l-methionine ion(1-)
  6038. tetrabutylphosphonium l-phenylalanine ion(1-)
  6039. tetrabutylphosphonium l-proline ion(1-)
  6040. tetrabutylphosphonium l-serine ion(1-)
  6041. tetrabutylphosphonium l-threonine ion(1-)
  6042. tetrabutylphosphonium l-valine ion(1-)
  6043. tetrabutylphosphonium N-((trifluoromethyl)sulfonyl)-L-alanine methyl ester ion(1-)
  6044. tetrabutylphosphonium N-((trifluoromethyl)sulfonyl)-L-leucine methyl ester ion(1-)
  6045. tetrabutylphosphonium N-((trifluoromethyl)sulfonyl)-L-valine methyl ester ion(1-)
  6046. Tetrabutylphosphonium N-[tris(hydroxymethyl)methyl]-3-amino-2-hydroxypropanesulfonate
  6047. Tetrabutylphosphonium nitrate
  6048. Tetrabutylphosphonium propionate
  6049. tetrabutylphosphonium pyrrolidine-2-carboxylate
  6050. tetrabutylphosphonium salt with (2E)-2-butenedioic acid (1:1)
  6051. tetrabutylphosphonium salt with (2Z)-2-butenedioic acid (1:1)
  6052. tetrabutylphosphonium salt with 2,4,6-trinitrophenol (1:1)
  6053. tetrabutylphosphonium salt with 4-methylbenzenesulfonic acid (1:1)
  6054. tetrabutylphosphonium salt with alanin
  6055. tetrabutylphosphonium salt with methanesulfonic acid (1:1)
  6056. Tetrabutylphosphonium tetracyanoborate
  6057. tetrabutylphosphonium tetrafluoroborate(1-)
  6058. Tetrabutylphosphonium tetrahydro-2-furoate
  6059. Tetrabutylphosphonium thiophene-2-carboxylate
  6060. Tetrabutylphosphonium trifluoroacetate
  6061. Tetrabutylphosphonium tris(pentafluoroethyl) trifluorophosphate
  6062. Tetrabutylplumbane
  6063. tetrabutylsilane
  6064. tetrabutylstannane
  6065. tetrabutylurea
  6066. tetracadmium cerium(III) chloride dodecahydrate
  6067. tetracadmium cobalt chloride decahydrate
  6068. tetracadmium europium(III) chloride tetradecahydrate
  6069. tetracadmium holmium chloride tetradecahydrate
  6070. tetracadmium lanthanum(III) chloride dodecahydrate
  6071. tetracadmium manganese bromide decahydrate
  6072. tetracadmium manganese chloride decahydrate
  6073. tetracadmium neodymium(III) chloride dodecahydrate
  6074. tetracadmium nickel chloride decahydrate
  6075. tetracadmium praseodymium(III) chloride dodecahydrate
  6076. tetracadmium samarium(III) chloride dodecahydrate
  6077. tetracadmium trisodium chloride tetradecahydrate
  6078. tetracadmium yttrium (III) chloride tridecahydrate
  6079. Tetracalcium aluminium oxide trihydrate
  6080. Tetracalcium decaboron(III) oxide
  6081. tetracalcium hexahydroxide dichlorate dodecahydrate
  6082. tetracalcium phosphate tetrahydrate
  6083. tetracarbonylbis(η5-2,4-cyclopentadien-1-yl)diiron (Fe-Fe)
  6084. tetracarbonylsilylcobalt
  6085. tetracesium (HB-5-22111'1'1''1'')-tris[carbonato(2-)-κO,κO']dioxouranate(4-)
  6086. tetracesium antimony(III) chloride
  6087. tetracesium bismuth chloride
  6088. Tetracesium diiron(III) sulfate dodecahydrate
  6089. Tetracesium disamarium(III) pentaselenate
  6090. tetracesium gadolinium(III) chloride monohydrate
  6091. Tetracesium lead iodide
  6092. tetracesium lithium trihydrogen tetraselenate
  6093. tetracesium lutetium(III) chloride pentahydrate
  6094. tetracesium oxalate trioxalic acid
  6095. tetracesium tricopper(II) chloride dihydrate
  6096. tetracesium ytterbium (III) chloride tetrahydrate
  6097. Tetracesium ytterbium(III) heptachloride
  6098. Tetrachloro 1,2-ethylene bisdiphenylphosphine dimercury
  6099. Tetrachloro 1,4-butylene bisdiphenylphosphine dimercury
  6100. tetrachloro-1,1'-biphenyl
  6101. Tetrachloro-1,3-benzodioxol-2-one
  6102. tetrachlorobis(1,2-ethanediamine)cobalt(2+) chloride
  6103. Tetrachlorobis(n-propylammonium) lead (II)
  6104. tetrachlorobis(pyridine)titanium
  6105. tetrachloroborate(1-)
  6106. tetrachlorocyclopropene
  6107. tetrachlorodecane
  6108. tetrachlorodiborane(4)
  6109. tetrachlorodifluoroethane
  6110. tetrachlorodifluoroethane
  6111. tetrachlorodimethyl sulfide
  6112. tetrachloroethane
  6113. tetrachloroethene
  6114. tetrachlorogermane
  6115. tetrachlorohexadiene
  6116. tetrachloroiodic acid tetrahydrate
  6117. tetrachloromethane
  6118. tetrachloronaphthalene
  6119. tetrachlorooxirane
  6120. tetrachlorophenol
  6121. tetrachloroplumbane (PbCl4)
  6122. tetrachloropyrimidine
  6123. tetrachlorosilane
  6124. tetrachlorostannane
  6125. tetrachlorostannane compd. with benzoic acid (1:2)
  6126. tetrachlorothiophene
  6127. Tetracobaltdodecacarbonyl
  6128. tetracontane
  6129. Tetracontane-17,24-dione
  6130. tetracontastrontium(II) dotriacontairon(III)octaiiron(IV) oxide
  6131. tetracontylbenzene
  6132. tetracontylcyclohexane
  6133. tetracopper(II) hexahydroxo chloride dihydrate
  6134. tetracopper(II) hexahydroxo sulfate monohydrate
  6135. Tetracosa bismut digallium oxide
  6136. tetracosadecanedioic acid bis(2-methylpropyl) ester
  6137. tetracosafluorotetradecahydroanthracene
  6138. tetracosafluorotetradecahydrophenanthrene
  6139. tetracosafluoroundecane
  6140. tetracosamethylcyclododecasiloxane
  6141. tetracosamethylundecasiloxane
  6142. Tetracosan-11-ol
  6143. Tetracosan-12-ol
  6144. Tetracosan-6-ol
  6145. Tetracosan-6-one
  6146. Tetracosan-6-yl acetate
  6147. tetracosan-7-one
  6148. Tetracosan-8-ol
  6149. tetracosanamide
  6150. tetracosanedioic acid bis(1-methylethyl) ester
  6151. tetracosanedioic acid dibutyl ester
  6152. tetracosanedioic acid dipentyl ester
  6153. tetracosanedioic acid dipropyl ester
  6154. tetracosanenitrile
  6155. tetracosanoic acid
  6156. tetracosanoic acid 1-methylethyl ester
  6157. tetracosanoic acid ethyl ester
  6158. tetracosanoic acid methyl ester
  6159. tetracosanoic acid pentyl ester
  6160. tetracosanoic acid propyl ester
  6161. Tetracosanoic anhydride
  6162. Tetracosyl acetate
  6163. tetracosylbenzene
  6164. tetracyanatosilane
  6165. Tetracyclo(4.4.1(2,5).1(7,10).0(1,6))dodec-3-ylacrylate
  6166. tetracyclo(8.1.0.0(1,3).0(3,5))undecane
  6167. tetracyclododecane
  6168. tetracyclododecane
  6169. Tetracyclopentadienyluranium
  6170. tetracyclopropylbutanedinitrile
  6171. tetracyclo[3.2.0.0(2,7).0(4,6)]heptane
  6172. Tetracyclo[6.2.1.13,6.02,7]dodec-2(7)-ene
  6173. Tetradec-1-en-2-ylbenzene
  6174. Tetradec-1-en-3-ylbenzene
  6175. Tetradec-1-en-4-ylbenzene
  6176. Tetradec-1-en-5-ylbenzene
  6177. Tetradec-1-en-6-ylbenzene
  6178. Tetradec-1-en-7-ylbenzene
  6179. tetradec-1-yn-3-ol
  6180. Tetradec-7-yn-6-one
  6181. Tetradeca-1,13-diene
  6182. tetradeca-9,11-dienyl acetate
  6183. tetradecaethylhexasiloxane
  6184. tetradecafluoro-[1,1']azoxypropane
  6185. tetradecafluorohexane
  6186. tetradecahydroanthracene
  6187. tetradecahydrophenanthrene
  6188. tetradecahydrophenanthrene
  6189. tetradecamethylcycloheptasiloxane
  6190. tetradecamethylenimine
  6191. tetradecamethylhexasiloxane
  6192. tetradecan-1-amine hydrochloride
  6193. tetradecan-2-ol
  6194. Tetradecan-2-ylcyclohexane
  6195. tetradecan-4-ol
  6196. tetradecan-5-ol
  6197. tetradecan-6-ol
  6198. Tetradecan-6-one
  6199. tetradecan-7-ol
  6200. tetradecanal
  6201. tetradecanamide
  6202. tetradecane
  6203. Tetradecane-1,2,13,14-tetrol
  6204. Tetradecane-3,12-dione
  6205. tetradecanediamide
  6206. tetradecanedinitrile
  6207. tetradecanedioic acid
  6208. tetradecanedioic acid didocosyl ester
  6209. tetradecanedioic acid diethyl ester
  6210. tetradecanedioic acid dimethyl ester
  6211. tetradecanedioic acid dioctadecyl ester
  6212. tetradecanedioic acid dipropyl ester
  6213. tetradecanenitrile
  6214. tetradecaneperoxoic acid
  6215. tetradecanethioic acid S-decyl ester
  6216. tetradecanethioic acid S-hexadecyl ester
  6217. tetradecanethioic acid S-hexyl ester
  6218. tetradecanethioic acid S-octadecyl ester
  6219. tetradecanethioic acid S-octyl ester
  6220. tetradecanethioic acid S-pentadecyl ester
  6221. tetradecanethioic acid S-tetradecyl ester
  6222. tetradecanethioic acid S-tridecyl ester
  6223. tetradecanethioic acid S-undecyl ester
  6224. tetradecanoic acid
  6225. tetradecanoic acid (1R)-1-((((2,3-dihydroxypropoxy)hydroxyphosphinyl)oxy)methyl)-1,2-ethanediyl ester monosodium salt
  6226. tetradecanoic acid 1,1-dimethylethyl ester
  6227. tetradecanoic acid 1,10-decanediyl ester
  6228. tetradecanoic acid 1,2,3-propanetriyl ester
  6229. tetradecanoic acid 1,2-ethanediyl ester
  6230. tetradecanoic acid 1,3-propanediyl ester
  6231. tetradecanoic acid 1,4-butanediyl ester
  6232. tetradecanoic acid 1,5-pentanediyl ester
  6233. tetradecanoic acid 1,6-hexanediyl ester
  6234. tetradecanoic acid 1,7-heptanediyl ester
  6235. tetradecanoic acid 1,8-octanediyl ester
  6236. tetradecanoic acid 1,9-nonanediyl ester
  6237. tetradecanoic acid 1-methyldecyl ester
  6238. tetradecanoic acid 1-methylethyl ester
  6239. tetradecanoic acid 1-methylheptyl ester
  6240. tetradecanoic acid 1-methylhexyl ester
  6241. tetradecanoic acid 1-methylpentyl ester
  6242. tetradecanoic acid 1-methylpropyl ester
  6243. tetradecanoic acid 2,3-dihydroxypropyl ester
  6244. tetradecanoic acid 2-(hexyloxy)ethyl ester
  6245. Tetradecanoic acid 2-chloroprop-2-enyl ester
  6246. tetradecanoic acid 2-hydroxy-1,3-propanediyl ester
  6247. tetradecanoic acid 2-hydroxy-1-(hydroxymethyl)ethyl ester
  6248. Tetradecanoic acid 2-methylprop-2-enyl ester
  6249. tetradecanoic acid 2-methylpropyl ester
  6250. tetradecanoic acid 2-phenyl-1,3-dioxan-5-yl ester
  6251. tetradecanoic acid 2-phosphonoethyl ester diethyl ester
  6252. tetradecanoic acid 2-propoxyethyl ester
  6253. tetradecanoic acid 3-[(1-oxodecyl)oxy]-2-[(1-oxododecyl)oxy]propyl ester
  6254. tetradecanoic acid 4-methylphenyl ester
  6255. tetradecanoic acid ammonium salt
  6256. Tetradecanoic acid but-3-en-2-yl ester
  6257. tetradecanoic acid butyl ester
  6258. tetradecanoic acid cerium(3+) salt
  6259. tetradecanoic acid chromium(3+) salt
  6260. tetradecanoic acid compd. with 4,6-dimethyl-N-phenyl-2-pyrimidinamine (1:1)
  6261. tetradecanoic acid decyl ester
  6262. tetradecanoic acid docosyl ester
  6263. tetradecanoic acid dodecyl ester
  6264. tetradecanoic acid eicosyl ester
  6265. tetradecanoic acid ethyl ester
  6266. Tetradecanoic acid furan-2-ylmethyl ester
  6267. tetradecanoic acid heneicosyl ester
  6268. tetradecanoic acid heptadecyl ester
  6269. tetradecanoic acid heptyl ester
  6270. tetradecanoic acid hexadecyl ester
  6271. tetradecanoic acid hexyl ester
  6272. tetradecanoic acid lead(2+) salt
  6273. tetradecanoic acid lithium salt
  6274. tetradecanoic acid mercury(2+) salt
  6275. tetradecanoic acid methyl ester
  6276. tetradecanoic acid nonadecyl ester
  6277. tetradecanoic acid nonyl ester
  6278. tetradecanoic acid octadecyl ester
  6279. tetradecanoic acid octyl ester
  6280. tetradecanoic acid pentadecyl ester
  6281. tetradecanoic acid pentyl ester
  6282. tetradecanoic acid phenyl ester
  6283. Tetradecanoic acid prop-2-enyl ester
  6284. tetradecanoic acid propyl ester
  6285. tetradecanoic acid sodium salt
  6286. tetradecanoic acid tetracosyl ester
  6287. tetradecanoic acid tetradecyl ester
  6288. tetradecanoic acid thallium(1+) salt
  6289. tetradecanoic acid tricosyl ester
  6290. tetradecanoic acid tridecyl ester
  6291. tetradecanoic acid undecyl ester
  6292. tetradecanoic acid zinc salt
  6293. tetradecanoyl chloride
  6294. tetradecapotassium dithorium sulfate
  6295. tetradecasamarium (III) tetratungsten (VI) oxide
  6296. Tetradecyl formate
  6297. tetradecylβinium dicyanamide
  6298. tetradecylβinium methanesulfonate
  6299. tetradecylβinium perchlorate
  6300. tetradecylβinium S-lactate monohydrate
  6301. tetradecylβinium tetrafluoroborate
  6302. tetradecylbenzene
  6303. tetradecylcyclohexane
  6304. tetradecylcyclopentane
  6305. tetradecylcyclopropane
  6306. tetradecylpropanedioic acid
  6307. Tetradecylurea
  6308. Tetradeutero ammonium chloride-15N
  6309. Tetradeutero ammonium chloride-35Cl
  6310. Tetradeuteroammonium hexafluorophosphate
  6311. Tetradeuteroammonium periodate
  6312. Tetradeuteroammonium perrhenate
  6313. Tetradeuteroammonium tetrafluoroborate
  6314. tetradodecylphosphonium L-leucine ion(1-)
  6315. tetradodecylsilane
  6316. tetradodecylstannane
  6317. tetraethenylsilane
  6318. tetraethenylstannane
  6319. tetraethoxydiborane(4)
  6320. Tetraethyl 1,3-phenylenebis(phosphoramidate)
  6321. tetraethyl citrate
  6322. Tetraethyl ethane-1,1,2,2-tetracarboxylate
  6323. Tetraethyl pent-1-ene-1,1,3,3-tetracarboxylate
  6324. Tetraethyl pentane-1,1,3,3-tetracarboxylate
  6325. Tetraethyl prop-1-ene-1,1,3,3-tetracarboxylate
  6326. Tetraethyl propane-1,2,2,3-tetracarboxylate
  6327. tetraethyl ranelate
  6328. tetraethyl-μ-oxodialuminum
  6329. Tetraethylammonium β-alaninate
  6330. tetraethylammonium 2,2,2-trifluoro-N-(trifluoromethylsulfonyl)acetamide
  6331. Tetraethylammonium 2-(cyclohexylamino)ethanesulfonate
  6332. Tetraethylammonium 2-acrylamido-2-methylpropanesulfonate
  6333. Tetraethylammonium 2-hydroxy-4-morpholinopropanesulfonate
  6334. Tetraethylammonium 2-[bis(2-hydroxyethyl)amino]ethanesulfonate
  6335. Tetraethylammonium alaninate
  6336. tetraethylammonium chloride tetrahydrate
  6337. Tetraethylammonium cobalt(II) tribromide
  6338. Tetraethylammonium cobalt(II) trichloride
  6339. tetraethylammonium copper(II) bromide
  6340. Tetraethylammonium copper(II) trichloride
  6341. Tetraethylammonium dibromoiodide
  6342. Tetraethylammonium dicobalt(II) pentabromide
  6343. Tetraethylammonium dicobalt(II) pentachloride
  6344. Tetraethylammonium glycinate
  6345. Tetraethylammonium lysinate
  6346. tetraethylammonium pentacyanopropenide
  6347. tetraethylamonium ampicillin
  6348. tetraethylbis(μ-(1H-pyrazolato-κN1:κN2))diboron
  6349. tetraethylbutanedinitrile
  6350. tetraethylbutanedioic acid
  6351. tetraethyldiamidodibutyldithiopyrophosphate
  6352. tetraethyldiamidophosphonylfluoride
  6353. tetraethyldiborane(6)
  6354. tetraethyldistibine
  6355. tetraethylene glycol diacrylate
  6356. Tetraethylenepentamine 2-methoxyphenolate
  6357. Tetraethylenepentamine acetate
  6358. Tetraethylenepentamine phenolate
  6359. tetraethylethanediamide
  6360. tetraethylgermane
  6361. tetraethylhydrazine
  6362. tetraethylmmonium ethanesulfonate
  6363. tetraethylphosphonium 2,2,2-trifluoro-N-(trifluoromethylsulfonyl)acetamide
  6364. Tetraethylphosphonium 2-cyanopyrrolide
  6365. tetraethylphosphonium bis(trifluoromethylsulfonyl)imide
  6366. tetraethylphosphorodiamidous acid
  6367. tetraethylphosphorodiamidous chloride
  6368. tetraethylplumbane
  6369. tetraethylsilane
  6370. tetraethylstannane
  6371. tetraethylsulfamide
  6372. tetraethylsulfurous diamide
  6373. tetraethylurea
  6374. tetraeuropium(III) hexapotassium sulfate octahydrate
  6375. tetrafluoro(1,1,1-trifluoromethanaminato)(trifluoromethyl)sulfur
  6376. tetrafluoro(1,1,2,2,2-pentafluoroethanaminato)(trifluoromethyl)sulfur
  6377. tetrafluoro(2,2,2-trifluoroethanimidoyl chloridato)(trifluoromethyl)sulfur
  6378. tetrafluoro(fluoromethyl)(trifluoromethyl)sulfur
  6379. tetrafluoro(N,1,1,1-tetrafluoromethanaminato)(trifluoromethyl)sulfur
  6380. tetrafluoro(N,1,1,2,2,2-hexafluoroethanaminato)(trifluoromethyl)sulfur
  6381. tetrafluoro(trifluoromethoxy)((trifluoromethyl)dioxy)sulfur
  6382. tetrafluoro-1-propanol
  6383. tetrafluoro-1-propanol carbonate (2:1)
  6384. Tetrafluoro-bis(1,1,2,2,2-pentafluoroethyl)-sulfane
  6385. tetrafluoroborate(1-)
  6386. tetrafluorobutanedioic acid
  6387. tetrafluorobutanedioic acid diethyl ester
  6388. tetrafluorobutanedioic acid dimethyl ester
  6389. tetrafluorodi-μ-oxotritellurium
  6390. tetrafluorodiborane(4)
  6391. tetrafluorodibutanedioic acid monoethylester
  6392. tetrafluoroethene
  6393. tetrafluorogermane
  6394. tetrafluoromethane
  6395. Tetrafluorophenylphosphorane
  6396. tetrafluoroplumbane
  6397. tetrafluoropyrimidine
  6398. tetrafluorosilane
  6399. tetrafluorostannane (SnF4)
  6400. tetrafluorosuccinanilic acid
  6401. Tetrafluoroxyplutonic acid tetrahydrate (H2PuO2F4*4H2O)
  6402. Tetrafurfuryl-phosphonium bromide
  6403. tetraglycinetrinitratoholmium(III) monohydrate
  6404. tetrahafnyl dihydroxo trisulfate dodecahydrate
  6405. tetrahafnyl dihydroxo trisulfate tetradecahydrate
  6406. tetrahdro-2-propyl-4H-pyran-4-one
  6407. tetraheptacontane
  6408. tetraheptylgermane
  6409. Tetraheptylstannane
  6410. tetrahexacontane
  6411. Tetrahexadecylsilane
  6412. tetrahexlammonium oleate
  6413. Tetrahexyl phosphonium hexafluorophosphate
  6414. Tetrahexylammonium bis(trifluoromethylsulfonyl)imide
  6415. tetrahexylammonium chloride
  6416. Tetrahexylammonium hexadecanoate
  6417. Tetrahexylammonium octanoate
  6418. tetrahexylammonium trifluoro(heptafluoropropyl)borate
  6419. tetrahexylammonium trifluoro(nonafluorobutyl)borate
  6420. tetrahexylammonium trifluoro(pentafluoroethyl)borate
  6421. tetrahexylammonium trifluoro(tridecafluorohexyl)borate
  6422. tetrahexylgermane
  6423. tetrahexylphosphonium bromide
  6424. tetrahexylphosphonium L-leucine ion(1-)
  6425. Tetrahexylsilane
  6426. Tetrahexylstannane
  6427. tetrahydro-α,α-dimethyl-2H-pyran-2-methanol
  6428. tetrahydro-α,α-dimethylpyran-2-propanol
  6429. tetrahydro-α,α-diphenylpyran-2-propanol
  6430. tetrahydro-α-methyl-α-phenyl-2-furanmethanol
  6431. tetrahydro-α-methyl-α-phenylpyran-2-methanol
  6432. tetrahydro-α-methyl-2-furanmethanol
  6433. tetrahydro-α-methyl-2H-pyran-2-methanol
  6434. tetrahydro-α-tri-cyclopentadiene
  6435. tetrahydro-β-tri-cyclopentadiene
  6436. tetrahydro-1,3,4,6-tetramethylimidazo(4,5-d)imidazole-2,5(1H,3H)-dione
  6437. tetrahydro-1,3-diethyl-2(1H)-pyrimidinethione
  6438. tetrahydro-1,3-dimethyl-2(1H)-pyrimidinone
  6439. tetrahydro-1,3-dipropyl-2(1H)-pyrimidinethione
  6440. tetrahydro-2(1H)-pyrimidinone
  6441. tetrahydro-2,2,5,5-tetramethylfuran
  6442. tetrahydro-2,2,6,6-tetramethyl-4H-thiopyran-4-one
  6443. tetrahydro-2,2-dimethyl-2H-pyran-4-ol
  6444. tetrahydro-2,2-dimethyl-5-oxo-3-furancarboxylic acid
  6445. tetrahydro-2,3,4-trimethylthiophene
  6446. tetrahydro-2,3,5-trimethylthiophene
  6447. tetrahydro-2,3-dimethylthiophene
  6448. tetrahydro-2,3-dipropyl-2(1H)-pyrimidinone
  6449. tetrahydro-2,4,6-trimethyl-2H-pyran-4-ol
  6450. tetrahydro-2,4-dimethylthiophene
  6451. tetrahydro-2,4-dimethylthiophene 1,1-dioxide
  6452. tetrahydro-2,5-dimethoxyfuran
  6453. tetrahydro-2,5-dimethylfuran
  6454. tetrahydro-2,5-dioxo-N-phenyl-3-furanacetamide
  6455. tetrahydro-2,6-diphenyl-4H-thiopyran-4-one
  6456. tetrahydro-2-(1-methoxy-2-methyl-1-propenyl)furan
  6457. tetrahydro-2-(1-methylethylidene)pyran
  6458. tetrahydro-2-(1-methylpropyl)furan
  6459. tetrahydro-2-(2,2,2-trichloroethoxy)-2H-pyran
  6460. tetrahydro-2-(3-methylbutyl)-2H-pyran
  6461. tetrahydro-2-(3-methylbutyl)furan
  6462. tetrahydro-2-(3-methylpentyl)-2H-pyran
  6463. tetrahydro-2-(methoxyethenyl)furan
  6464. tetrahydro-2-(methylphenylmethylidene)pyran
  6465. tetrahydro-2-(triiodovinyl)furan
  6466. tetrahydro-2-furancarboxaldehyde
  6467. tetrahydro-2-furanmethanamine
  6468. tetrahydro-2-furanmethanol
  6469. tetrahydro-2-furanmethanol acetate
  6470. tetrahydro-2-furanmethanol benzoate
  6471. tetrahydro-2-furanol
  6472. tetrahydro-2-iodoethynylpyran
  6473. tetrahydro-2-methoxy-2H-pyran
  6474. tetrahydro-2-methyl-2-pentylfuran
  6475. tetrahydro-2-methyl-2H-pyran
  6476. tetrahydro-2-methyl-2H-pyran-4-ol
  6477. tetrahydro-2-methyl-2H-thiopyran
  6478. tetrahydro-2-methyl-2H-thiopyran
  6479. tetrahydro-2-methyl-2H-thiopyran 1,1-dioxide
  6480. tetrahydro-2-methyl-4H-pyran-4-one
  6481. tetrahydro-2-methyl-6-(triethylgermyl)-2H-1,2-thiazine 1,1-dioxide
  6482. tetrahydro-2-methylfuran
  6483. tetrahydro-2-methylthiophene
  6484. tetrahydro-2-methylthiophene 1,1-dioxide
  6485. tetrahydro-2-naphthalenol
  6486. tetrahydro-2-phenyl-2H-pyran-4-ol
  6487. tetrahydro-2-phenyl-4H-pyran-4-one
  6488. tetrahydro-2-propyl-2H-pyran
  6489. tetrahydro-2-propyl-2H-pyran-3,4-diol
  6490. tetrahydro-2-propyl-2H-pyran-4-ol
  6491. tetrahydro-2-thiophenecarboxylic acid
  6492. tetrahydro-2H-1,3-oxazin-2-one
  6493. tetrahydro-2H-pyran
  6494. tetrahydro-2H-pyran-2-methanol
  6495. tetrahydro-2H-pyran-2-one
  6496. tetrahydro-2H-pyran-2-one
  6497. tetrahydro-2H-pyran-4-ol
  6498. tetrahydro-2H-pyran-4-ol acetate
  6499. tetrahydro-2H-thiopyran
  6500. tetrahydro-2H-thiopyran 1,1-dioxide
  6501. tetrahydro-2H-thiopyran 1-oxide
  6502. tetrahydro-3-(1-methylethyl)furan
  6503. tetrahydro-3-(1-methylethyl)thiophene
  6504. tetrahydro-3-(1-methylpropyl)furan
  6505. tetrahydro-3-(phenylmethyl)-2H-1,3-thiazine
  6506. tetrahydro-3-iodo-2H-pyran-2-one
  6507. tetrahydro-3-iodofuran
  6508. tetrahydro-3-methoxythiophene 1,1-dioxide
  6509. tetrahydro-3-methyl-2H-pyran
  6510. tetrahydro-3-methyl-2H-pyran-4-ol
  6511. tetrahydro-3-methyl-2H-pyran-4-ol acetate
  6512. tetrahydro-3-methyl-2H-pyran-4-ol benzoate
  6513. tetrahydro-3-methyl-2H-pyran-4-ol butanoat
  6514. tetrahydro-3-methyl-2H-pyran-4-ol chloroacetate
  6515. tetrahydro-3-methyl-2H-thiopyran
  6516. tetrahydro-3-methyl-2H-thiopyran 1,1-dioxide
  6517. tetrahydro-3-methyl-4H-pyran-4-one
  6518. tetrahydro-3-methylfuran
  6519. tetrahydro-3-methylthiophene
  6520. tetrahydro-3-methylthiophene 1,1-dioxide
  6521. tetrahydro-3-pentyl-2H-pyran-4-ol
  6522. tetrahydro-3-pentyl-2H-pyran-4-ol acetate
  6523. tetrahydro-3a,6a-di-2-quinolinylimidazo(4,5-d)imidazole-2,5(1H,3H)-dione
  6524. tetrahydro-4-hydroxy-2H-pyran-3-methanol
  6525. tetrahydro-4-hydroxy-4-methyl-2H-pyran-3-methanol
  6526. tetrahydro-4-methyl-2H-pyran-4-ol
  6527. tetrahydro-4-methyl-2H-thiopyran
  6528. tetrahydro-4-methyl-2H-thiopyran 1,1-dioxide
  6529. tetrahydro-4-methyl-3-furanol
  6530. tetrahydro-4H-pyran-4-one
  6531. tetrahydro-4H-thiopyran-4-one
  6532. tetrahydro-5-methyl-2H-pyran-2-one
  6533. tetrahydro-6-methyl-2H-pyran-2-one
  6534. tetrahydro-6-pentyl-2H-pyran-2-one
  6535. tetrahydro-6-propyl-2H-pyran-2-one
  6536. tetrahydro-d4-furan-d4
  6537. Tetrahydro-tri-cyclopentadiene
  6538. Tetrahydroabietic acid
  6539. tetrahydrobis(μ-(1H-pyrazolato-κN1:κN2))diboron
  6540. tetrahydrofuran
  6541. tetrahydrofuran heptadecahydrate
  6542. Tetrahydrofurfuryl decyl diglycolate
  6543. Tetrahydrofurfuryl decyl phthalate
  6544. Tetrahydrofurfuryl decyl sebacate
  6545. Tetrahydrofurfuryl isooctyl diglycolate
  6546. Tetrahydrofurfuryl isooctyl phthalate
  6547. Tetrahydrofurfuryl isooctyl succinate
  6548. tetrahydrofurfuryl tetrahydro-2-furyl ketone
  6549. Tetrahydrofuryl bromide
  6550. tetrahydroimidazo(4,5-d)imidazole-2,5(1H,3H)-dione
  6551. tetrahydromethyl-1H-indene
  6552. tetrahydromethylene-2H-pyran
  6553. Tetrahydropyrethrolone
  6554. Tetrahydropyrethrone
  6555. Tetrahydropyrethrone Isoxime
  6556. Tetrahydropyrethrone semicarbazone
  6557. tetrahydrothiophene
  6558. tetrahydrothiophene 1,1-dioxide
  6559. tetrahydrothiophene 1-oxide
  6560. Tetrahydroxoborate sodalite
  6561. tetrahydroxodiborane(4)
  6562. Tetraiodo 1,4-butylene bisdiphenylphosphine dimercury
  6563. tetraiodoborate(1-)
  6564. tetraiodogermane
  6565. tetraiodomethane
  6566. tetraiodoplumbane
  6567. tetraiodosilane
  6568. tetraiodostannane
  6569. tetraiodothiophene
  6570. Tetrairidiumdodecacarbonyl
  6571. tetrairon(III) dihydroxo pentasulfate heptadecahydrate(α-Copiapit)
  6572. tetrairon(III) dihydroxo pentasulfate hexadecahydrate
  6573. tetrairon(III) dihydroxo pentasulfate tridecahydrate
  6574. tetraisocyanatogermane
  6575. tetraisocyanatosilane
  6576. Tetraisopropyl 1,3-phenylenebis(phosphoramidate)
  6577. Tetrakis(ε-caprolactam) mercury(II) diiodide
  6578. tetrakis(μ-(acetato-κO:κO'))dicopper
  6579. tetrakis(μ-(L-alaninato-κO:κO'))octaaquadiholmium(3+) hexachloride
  6580. tetrakis(μ-(L-alaninato-κO:κO'))octaaquadiyttrium(2+) stereoisomer diperchlorate tetraperchlorate
  6581. tetrakis(μ-(L-alaninato-κO:κO'))tetraaqua(tetraaquayttrium)erbium(2+) stereoisomer diperchlorate tetraperchlorate
  6582. tetrakis(μ-(L-alaninato-κO:κO'))tetraaqua(tetraaquayttrium)erbium(2+) stereoisomer diperchlorate tetraperchlorate
  6583. tetrakis(μ-(octanoato-κO:κO'))bis(pyridine)dicopper (Cu-Cu)
  6584. tetrakis(1,1,1,2,2,3,3-Heptafluoro-7,7-dimethyloctane-4,6-dione)neptunium(IV)
  6585. tetrakis(1,1,1,2,2,3,3-Heptafluoro-7,7-dimethyloctane-4,6-dione)plutonium(IV)
  6586. tetrakis(1,1,1,2,2,3,3-Heptafluoro-7,7-dimethyloctane-4,6-dione)thorium (IV)
  6587. tetrakis(1,1,1,2,2,3,3-Heptafluoro-7,7-dimethyloctane-4,6-dione)uranium(IV)
  6588. tetrakis(1,1,1,5,5,5-Hexafluoro-2,4-pentanedionato)neptunium(IV)
  6589. tetrakis(1,1,1,5,5,5-Hexafluoro-2,4-pentanedionato)neptunium(IV)-trimethylphospine oxide adduct
  6590. tetrakis(1,1,1-trifluoro-2,4-pentanedionato-O,O')hafnium
  6591. tetrakis(1,1,1-trifluoro-2,4-pentanedionato-O,O')zirconium
  6592. tetrakis(1,1,1-trifluoro-5,5-dimethyl-2,4-hexanedionato-O,O')hafnium
  6593. tetrakis(1,1,1-Trifluoropentane-2,4-dionato)thorium(IV)
  6594. tetrakis(1,1,1-Trimethyl-5,5,5-hexafluoro-2,4-pentanedionato)neptunium(IV)
  6595. tetrakis(1,1-dimethylethyl)germane
  6596. tetrakis(1-methylethyl)benzene
  6597. tetrakis(1-methylethyl)benzene
  6598. tetrakis(1-methylethyl)stannane
  6599. tetrakis(2,2,6,6-Tetramethyl-3,5-heptanedionato)uranium(IV)
  6600. tetrakis(2,2,6,6-tetramethyl-3,5-heptanedionato-O,O')hafnium
  6601. tetrakis(2,2,6,6-Tetramethylheptane-3,5-dionato)thorium(IV)
  6602. tetrakis(2,6,6-Trimethyl-2-methoxy-3,5-heptanedionato)uranium(IV)
  6603. tetrakis(2,6-Dimethyl-2-methoxy-3,5-heptanedionato)uranium(IV)
  6604. tetrakis(2-(hydroxy-κO)benzaldehydato-κO)tetrakis(methanol)tetra-my3-methoxytetranickel
  6605. tetrakis(2-chloro-N-(2,3-dihydro-1,5-dimethyl-3-(oxo-κO)-2-phenyl-1H-pyrazol-4-yl)benzamide-κO)ytterbium(3+) triperchlorate dihydrate
  6606. Tetrakis(2-chloroethoxy)methane
  6607. tetrakis(2-fluoro-2,2-dinitroethyl) propane-1,1,3,3,-tetracarboxylate
  6608. Tetrakis(2-hydroxyethyl)ammonium chloride
  6609. tetrakis(2-methylpropyl)-μ-oxodialuminum
  6610. tetrakis(2-methylpropyl)butanedinitrile
  6611. tetrakis(2-methylpropyl)plumbane
  6612. tetrakis(2-methylpropyl)stannane
  6613. tetrakis(2-phenylethenyl)silane
  6614. Tetrakis(2-phenylethyl)stannane
  6615. tetrakis(2-propenyl)stannane
  6616. tetrakis(3-(methyldi-2-propenylsilyl)propyl)silane
  6617. Tetrakis(3-methyl-2-phenylpyridine) tricobalt hexachloride
  6618. tetrakis(3-methylbutyl) borate(1-)
  6619. tetrakis(3-methylbutyl)germane
  6620. tetrakis(3-methylbutyl)plumbane
  6621. Tetrakis(3-methylbutyl)silane
  6622. Tetrakis(3-Picoline) cobalt(II) diiodide
  6623. tetrakis(4-butylphenoxy)silane
  6624. tetrakis(4-chlorophenoxy)silane
  6625. tetrakis(4-methylphenyl)germane
  6626. tetrakis(4-methylpyridine)bis(thiocyanato-κS)nickel
  6627. tetrakis(4-methylpyridine)bis(thiocyanato-κS)nickel compd. with1,4-dimethylbenzene (1:1)
  6628. tetrakis(4-methylpyridine)bis(thiocyanato-κS)nickel compd. with1,4-dimethylbenzene-d10 (1:1)
  6629. Tetrakis(4-Picoline) cobalt(II) diiodide
  6630. tetrakis(6-Methyl-2-hydroxypyridyl)dichromium(II)
  6631. tetrakis(6-Methyl-2-hydroxypyridyl)dimolybdenum(II)
  6632. Tetrakis(acetonitrile) tetrafluoborate copper(I)
  6633. tetrakis(aqua)hexakis(glycinato-κO,κ-O')dierbium(3+) hexaperchlorate pentahydrate
  6634. tetrakis(bis(trifluoromethyl)phosphinoxy)silane
  6635. tetrakis(boric acid) trisulfuric acid
  6636. tetrakis(cyclohexylsulfanyl)stannane
  6637. tetrakis(diethylamino)hafnium
  6638. Tetrakis(dimethylamino)molybdenum
  6639. tetrakis(dodecylthio)stannane
  6640. tetrakis(heptafluoropropyl)cyclotetraphosphine
  6641. tetrakis(hexyloxy)germane
  6642. Tetrakis(imidazole) copper (II) diperchlorate
  6643. Tetrakis(iron(III) oxide) selenide oxide (4Fe2O3*SeO2)
  6644. tetrakis(isopropylammonium)tricadmium decachloride
  6645. tetrakis(magnesium carbonate) magnesium hydroxide pentahydrate
  6646. tetrakis(magnesium carbonate) magnesium hydroxide tetrahydrate
  6647. tetrakis(methanol)tetra-my3-methoxytetrakis(2,4-pentanedionato-κO,κO')tetranickel stereoisomer
  6648. Tetrakis(methylsulfanyl)stannane
  6649. tetrakis(methylthio)methane
  6650. tetrakis(mu-(2,2-dimethylpropanoato))bis(2,2-dimethylpropanoato)dieuropium
  6651. tetrakis(mu-(2,2-dimethylpropanoato))bis(2,2-dimethylpropanoato)dilanthanum
  6652. tetrakis(mu-(2,2-dimethylpropanoato))bis(2,2-dimethylpropanoato)disamarium
  6653. tetrakis(mu-(alaninato-κO:κO'))octaaquadierbium(2+) stereoisomer diperchlorate tetraperchlorate
  6654. tetrakis(mu-(alaninato-κO:κO'))octaaquadieuropium(2+) stereoisomer diperchlorate tetraperchlorate
  6655. tetrakis(mu-(butane(dithioato)-κS:κS'))iododiplatinum (Pt-Pt)
  6656. tetrakis(mu-(decanoato-κO:κO'))bis(pyridine)dicopper (Cu-Cu)
  6657. tetrakis(mu-(dodecanoato-κO:κO'))bis(pyridine)dicopper (Cu-Cu)
  6658. tetrakis(mu-(ethane(dithioato)-κS:κS'))iododiplatinum (Pt-Pt)
  6659. tetrakis(mu-(heptanoato-κO:κO'))bis(pyridine)dicopper (Cu-Cu)
  6660. tetrakis(mu-(hexanoato-κO:κO'))bis(hexanoato-κO,κO')bis(1,10-phenanthroline-κN1,κN10)dieuropium stereoisomer
  6661. tetrakis(mu-(l-alaninato-κO:κO'))octaaquadiholmium(2+) dichloride tetrahydrochloride
  6662. tetrakis(mu-(nonanoato-κO:κO'))bis(pyridine)dicopper (Cu-Cu)
  6663. tetrakis(N,N-diethylamino)zirconium
  6664. tetrakis(N,N-dimethylamino)zirconium
  6665. tetrakis(N,N-dimethylformamide)tris(2,6-naphthalenedicarboxylato)trimanganese
  6666. tetrakis(neopentyl)hafnium
  6667. tetrakis(neopentyl)titanium
  6668. tetrakis(neopentyl)zirconium
  6669. Tetrakis(p-tolylsulfanyl)germane
  6670. tetrakis(pentafluorophenyl)silane
  6671. tetrakis(pentyloxy)germane
  6672. tetrakis(pentylsulfanyl)stannane
  6673. Tetrakis(perfluoromethyl)pyrazine
  6674. tetrakis(phenylmethyl)germane
  6675. tetrakis(Potassium chloride magnesium sulfate)undecahydrate
  6676. tetrakis(rubidium nitrate) rubidium sodium chloride
  6677. tetrakis(silver nitrate di(succinonitrile)) monohydrate
  6678. tetrakis(sodium oxide) aluminum oxide dodecahydrate
  6679. tetrakis(trifluormethyl)distibane
  6680. tetrakis(trifluoromethyl)tetraphosphetane
  6681. tetrakis(trimethylsilyl)silane
  6682. tetrakis(trimethylsilylmethyl)titanium
  6683. tetrakis(trimethylsilylmethyl)zirconium
  6684. Tetrakis(triphenylarsine)platinum
  6685. Tetrakis(triphenylphosphine) tetrafluoborate copper(I)
  6686. Tetrakis(triphenylphosphine)platinum
  6687. tetrakis-(tetramethylammonium)-molybdene-(IV)-cyanide
  6688. tetrakisdecylphosphonium L-leucine ion(1-)
  6689. Tetrakispotassium calcium phosphate
  6690. tetrakis[μ-methoxo-2,4-pentanedionato(methanol)nickel(2+)]
  6691. Tetrakis[(3-fluorophenyl)methyl]silane
  6692. Tetrakis[(4-bromophenyl)sulfanyl]germane
  6693. Tetrakis[3-(bis(3-(bis(3-(bis(3-(p-1,3-dioxolanylphenyldimethylsilyl)propyl)methylsilyl)propyl)methylsilyl)propyl)methylsilyl)propyl]silane
  6694. Tetrakis[3-(bis(3-(p-1,3-dioxolanylphenyldimethylsilyl)propyl)methylsilyl)propyl]silane
  6695. tetralead (II) divanadium (V) nonaoxide
  6696. tetralead mono-oxy hexacetate trihydrate
  6697. tetralis(cyclohexyloxy)germane
  6698. tetralithium (OC-6-11)-hexachlorocobaltate(4-) decahydrate
  6699. tetralithium (OC-6-11)-hexachloromanganate decahydrat
  6700. tetralithium (OC-6-11)-hexachloronickelate(4-) decahydrate
  6701. tetralithium chloride dimethylacetamide
  6702. tetralithium chloride dimethylformamide
  6703. tetralithium chloride trihydroxide
  6704. Tetralithium diboron pentaoxide
  6705. tetralithium disodium diammonium sulfate tetrahydrate
  6706. tetralithium disodium dipotassium sulfate
  6707. tetralithium titanate (Ti5O12(4-))
  6708. tetralithium triuranyl selenate hexadecahydrate
  6709. tetralithium tungstate (VI)
  6710. tetramanganese(II) acetate triurea dihydrate
  6711. tetramercury(II) hexapotassiumchloride trihydrate
  6712. tetramercury(II) tetrapotassiumchloride trihydrate
  6713. tetramethoxydiborane(4)
  6714. tetramethoxymethane
  6715. Tetramethyl 1,3-phenylenebis(phosphoramidate)
  6716. Tetramethyl 1,4,5,8-naphthalenetetracarboxylate
  6717. tetramethyl benzene-1,2,3,4-tetracarboxylate
  6718. Tetramethyl ethynediyl-bisphosphonate
  6719. Tetramethyl titanate
  6720. tetramethyl-μ-oxodialuminum
  6721. Tetramethyl-2-tetrazene
  6722. Tetramethylammonium β-alaninate
  6723. tetramethylammonium 2,2,2-trifluoro-N-(trifluoromethylsulfonyl)acetamide
  6724. Tetramethylammonium 2-(cyclohexylamino)ethanesulfonate
  6725. Tetramethylammonium 2-acrylamido-2-methylpropanesulfonate
  6726. Tetramethylammonium 2-hydroxy-4-morpholinopropanesulfonate
  6727. Tetramethylammonium 2-[bis(2-hydroxyethyl)amino]ethanesulfonate
  6728. Tetramethylammonium 4-(methylamino)butanoate
  6729. Tetramethylammonium 4-aminobutanoate
  6730. Tetramethylammonium 6-aminohexanoate
  6731. Tetramethylammonium alaninate
  6732. Tetramethylammonium calcium tribromide octahydrate
  6733. Tetramethylammonium dicalcium pentabromide tetradecahydrate
  6734. tetramethylammonium glycinate
  6735. tetramethylammonium hexacyanotrimethylenecyclopropanide
  6736. tetramethylammonium hydrogen selenate monohydrate
  6737. Tetramethylammonium lead iodide
  6738. Tetramethylammonium lysinate
  6739. tetramethylammonium selenate
  6740. tetramethylammonium selenate tetrahydrate
  6741. Tetramethylammonium trifluoroacetate
  6742. Tetramethylammonium valinate
  6743. tetramethylarsonium bis(trifluoromethylsulfonyl)imide
  6744. tetramethylbutanedinitrile
  6745. tetramethylbutanedioic acid
  6746. tetramethyldiborane(6)
  6747. tetramethyldiphosphine
  6748. Tetramethyldiphosphine diborane adduct
  6749. tetramethyldistibine
  6750. tetramethylene glycoldimethyl ether
  6751. tetramethylgermane
  6752. Tetramethylguanidine acetate
  6753. Tetramethylguanidine ethoxyacetate
  6754. Tetramethylguanidine methoxyacetate
  6755. tetramethylguanidinium 4-fluorophenolate
  6756. tetramethylguanidinium 4-methoxyphenolate
  6757. tetramethylguanidinium 4-methylphenolate
  6758. Tetramethylguanidinium bis(perfluoroethylsulfonyl)imide
  6759. Tetramethylguanidinium butanoate
  6760. Tetramethylguanidinium decanoate
  6761. Tetramethylguanidinium heptanoate
  6762. Tetramethylguanidinium hexanoate
  6763. Tetramethylguanidinium laurate
  6764. Tetramethylguanidinium octanoate
  6765. Tetramethylguanidinium pentanoate
  6766. tetramethylguanidinium phenolate
  6767. tetramethylhydrazine
  6768. tetramethylmmonium ethanesulfonate
  6769. tetramethylmmonium methanesulfonate
  6770. tetramethylphosphinous amide
  6771. tetramethylphosphonium bis(trifluoromethylsulfonyl)imide
  6772. tetramethylphosphorodiamidic acid ethyl ester
  6773. tetramethylphosphorodiamidic chloride
  6774. tetramethylphosphorodiamidic fluoride
  6775. tetramethylphosphorodiamidothionic fluoride
  6776. tetramethylphosphorodiamidous chloride
  6777. tetramethylpiperazine
  6778. tetramethylplumbane
  6779. tetramethylpyrazine
  6780. tetramethylpyrazine 1,4-dioxide
  6781. tetramethylpyrazine dihydrate
  6782. tetramethylsilane
  6783. tetramethylstannane
  6784. tetramethylsulfamide
  6785. tetramethylsulfoxylic diamide
  6786. tetramethylsulfurous diamide
  6787. tetramethylthioperoxydicarbonic diamide (((H2N)C(S))2S2)
  6788. tetramethylthiophene
  6789. tetramethylthiourea
  6790. Tetramethylthiourea antimony(III) triiodide
  6791. Tetramethylthiourea bismuth(III) triiodide
  6792. tetramethylurea
  6793. tetramine zinc sulfate
  6794. tetramine zinc sulfate dihydrate
  6795. tetrammine zinc bromide
  6796. tetramminedichoroplatinum
  6797. tetramminezinc iodide monohydrate
  6798. tetrammmonium pyrophosphate monohydrate
  6799. tetrammonium nitrate diammine monohydrate
  6800. tetrammonium nitrate monoammine monohydrate
  6801. tetrammonium pyrophosphate monohydrate
  6802. tetrammonium uranyl oxalate
  6803. tetraneodymium(III) hexapotassium sulfate octahydrate
  6804. Tetranitro-1,3-bishhomocubane
  6805. Tetranitroglycoluril
  6806. tetranitromethane
  6807. tetranitrosotetramethylenetetramine
  6808. tetranonacontane
  6809. tetraoctacontane
  6810. Tetraoctadecylsilane
  6811. Tetraoctylammonium dioctyl-diglycolamate
  6812. tetraoctylammonium oleate
  6813. Tetraoctylammonium tetrafluoroborate
  6814. Tetraoctylammonium-di(2-ethylhexyl)-oxamate
  6815. tetraoctylgermane
  6816. Tetraoctylphosphonium bis{(trifluomethyl)sulfonyl}imide
  6817. tetraoctylphosphonium bromide
  6818. Tetraoctylphosphonium chloride
  6819. tetraoctylphosphonium glycine ion(1-)
  6820. tetraoctylphosphonium L-alanine ion(1-)
  6821. tetraoctylphosphonium L-aspartate (1:1)
  6822. tetraoctylphosphonium L-glutamate (1:1)
  6823. tetraoctylphosphonium L-isoleucine ion(1-)
  6824. tetraoctylphosphonium L-leucine ion(1-)
  6825. tetraoctylphosphonium L-lysine ion(1-)
  6826. tetraoctylphosphonium L-phenylalanine ion(1-)
  6827. tetraoctylphosphonium L-proline ion(1-)
  6828. tetraoctylphosphonium L-serine ion(1-)
  6829. tetraoctylphosphonium L-valine ion(1-)
  6830. Tetraoctylphosphonium nonafluorobutane-1-sulfonate
  6831. tetraoctylstannane
  6832. tetrapalladium selenide
  6833. tetrapalladium sulfide
  6834. tetrapentacontane
  6835. Tetrapentylammonium 4-toluenesulfonate
  6836. tetrapentylammonium picrate
  6837. tetrapentylazanium chloride
  6838. tetrapentylgermane
  6839. tetrapentylphosphonium L-leucine ion(1-)
  6840. Tetrapentylplumbane
  6841. tetrapentylstannane
  6842. tetraphenoxygermane
  6843. Tetraphenyl 1,3-phenylenebis(phosphoramidate)
  6844. tetraphenyl arsonium tetraphenyl borate
  6845. tetraphenyl(4-methylphenyl)phosphorus
  6846. tetraphenyl(trityl)phosphorus
  6847. tetraphenylammonium perchlorate
  6848. Tetraphenylantimony 1-adamantanecarboxylate
  6849. Tetraphenylantimony benzoate
  6850. Tetraphenylantimony phenylpropiolate
  6851. tetraphenylarsonium
  6852. tetraphenylarsonium iodide
  6853. tetraphenylarsonium perchlorate
  6854. tetraphenylarsonium salt with 2,4,6-trinitrophenol (1:1)
  6855. tetraphenylborate(1-)
  6856. tetraphenylgermane
  6857. tetraphenylhydrazine
  6858. tetraphenylphosphonium
  6859. tetraphenylphosphonium (mu-(ethanedioato(2-)-κO1,κO2':κO1',κO2))(ethanedioato(2-)-κO1,κO2)((ethanedioato(2-)-κO1,κO2)manganate)chromate(1-)
  6860. Tetraphenylphosphonium bis(trifluoromethylsulfonyl)imide
  6861. tetraphenylphosphonium bromide
  6862. tetraphenylphosphonium chloride
  6863. tetraphenylphosphonium iodide
  6864. tetraphenylphosphonium perchlorate
  6865. tetraphenylphosphonium phosphorus hexachloride
  6866. tetraphenylphosphonium salt with trifluoromethanesulfonic acid (1:1)
  6867. Tetraphenylphosphonium tetracyanoborate
  6868. tetraphenylphosphonium tribromide
  6869. tetraphenylphosphonium triiodie
  6870. tetraphenylplumbane
  6871. tetraphenylsilane
  6872. tetraphenylstannane
  6873. tetraphenylstibonium
  6874. tetraphenylstibonium salt with N-hydroxy-1,1-diphenylmethanimine (1:1)
  6875. tetraphenylstiboranyl compd with 1-phenylethanone oxime
  6876. tetraphenylthiophene
  6877. tetraphenylurea
  6878. tetraphosphoric acid calcium salt (1:3)
  6879. tetraphosphoric acid dilithium salt
  6880. tetraphosphoric acid hexaammonium salt
  6881. tetraphosphoric acid hexapotassium salt
  6882. tetraphosphoric acid hexasodium salt
  6883. tetraphosphoric acid monoammonium salt
  6884. tetraphosphoric acid monopotassium salt
  6885. tetraphosphorus trisulfide
  6886. tetrapotassium (HB-5-22111'1'1''1'')-tris[carbonato(2-)-κO,κO']dioxouranate(4-)
  6887. tetrapotassium (OC-6-11)-hexakis(cyano-κC)ferrate(4-)
  6888. Tetrapotassium 1,1,2,2-tetranitramidoethane
  6889. Tetrapotassium 1,1,2,2-tetranitramidoethane dihydrate
  6890. tetrapotassium calcium formate
  6891. tetrapotassium calcium nitrate
  6892. tetrapotassium decachlorooxorhenate(4-)
  6893. tetrapotassium heptanickel chloride tetradecahydrate
  6894. tetrapotassium hexaammonium penta(hydrogen sulfate dihydrogen phosphate)
  6895. tetrapotassium hexacyanoferrate trihydrate
  6896. tetrapotassium hydrogen triphosphate
  6897. tetrapotassium hydrogen triphosphate monohydrate
  6898. tetrapotassium hydrogen tripolyphosphate monohydrate
  6899. tetrapotassium iron(III) sulfate 14-hydrate
  6900. tetrapotassium lead(II) selenocyanate
  6901. tetrapotassium nickel manganese sulfate decahydrate
  6902. tetrapotassium nickel nitrite
  6903. tetrapotassium pentamanganese chloride
  6904. tetrapotassium thorium oxalate tetrahydrate
  6905. tetrapotassium thorium sulfate dihydrate
  6906. Tetrapotassium trititanium(IV) oxide
  6907. Tetrapotassium uranyl tricarbonate
  6908. tetrapotassium wolfram (IV) cyanide
  6909. tetrapraseodymium octadecapotassium sulfate
  6910. Tetrapropyl 1,3-phenylenebis(phosphoramidate)
  6911. Tetrapropylammonium 2-(bis(2-hydroxyethyl)amino)ethanesulfonate
  6912. Tetrapropylammonium 2-acrylamido-2-methylpropanesulfonate
  6913. tetrapropylammonium bis(trifluoromethanesulfonyl)imide
  6914. Tetrapropylammonium tetrakis(4,4,4-trifluoro-1-(2-thienyl)-1,3-diphenyl-1,3-butanediono)europium(III)
  6915. tetrapropylbis(μ-(1H-pyrazolato-κN1:κN2))diboron
  6916. tetrapropylgermane
  6917. tetrapropylhydrazine
  6918. tetrapropylplumbane
  6919. tetrapropylsilane
  6920. tetrapropylstannane
  6921. Tetrarhodium dodecacarbonyl
  6922. tetrarubidium (HB-5-22111'1'1''1'')-tris[carbonato(2-)-κO,κO']dioxouranate(4-)
  6923. tetrarubidium (OC-6-11)-hexabromocadmate(4-)
  6924. tetrarubidium (OC-6-11)-hexachlorocadmate(4-)
  6925. Tetrarubidium diiron(III) sulfate dodecahydrate
  6926. tetrasamarium pentasodium sulfate octahydrate
  6927. tetrasilane
  6928. tetrasodium (HB-8-22-111'1'1''1'')-tris(carbonato(2-)-κO,κO')dioxouranate(4-)
  6929. tetrasodium (OC-6-11)-hexakis(cyano-κC)ferrate(4-)
  6930. Tetrasodium 1,1,2,2-tetranitramidoethane monohydrate
  6931. tetrasodium arsenite
  6932. tetrasodium arsenite heptahydrate
  6933. tetrasodium cadmium sulfate
  6934. tetrasodium chromate (CrO5(4-))
  6935. tetrasodium copper(I) cyanide
  6936. tetrasodium dihydroxo plumbate(II) hexadecahydrate
  6937. tetrasodium ethylenediamine tetraacetate dihydrate
  6938. tetrasodium hafnium sulfate dihydrate
  6939. tetrasodium hexacyanoferrate(II) decahydrate
  6940. tetrasodium hypophosphate decahydrate
  6941. tetrasodium phosphonato phosphate decahydrate
  6942. tetrasodium pyrophosphate deca(hydrogen peroxide)
  6943. tetrasodium pyrophosphate hexa(hydrogen peroxide)
  6944. tetrasodium thorium(IV) oxalate hexahydrate
  6945. tetrasodium uranyl carbonate
  6946. Tetrasodium uranyl tricarbonate
  6947. tetrasodium vanadate (V2O7(4-))
  6948. tetrasodium [[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] phosphate
  6949. tetrasodiumchromate tridecahydrate
  6950. tetraspiro[2.0.0.0.2.1.1.1]undecane
  6951. tetraspiro[2.0.2.0.2.0.2.0]dodecane
  6952. tetrastrontium dihydroxy diarsenate
  6953. tetratetracontane
  6954. Tetratetracontane-19,26-dione
  6955. Tetratetracontylfluorobuckminsterfullerene
  6956. Tetratetracontylfluorobuckminsterfullerene oxid
  6957. Tetrathallium manganese hexaiodide
  6958. tetrathionic acid diammonium salt
  6959. tetrathionic acid dipotassium salt
  6960. tetrathionic acid disodium salt
  6961. tetrathorium oxalate chloride 20-hydrate
  6962. tetratriacontafluorohexadecane
  6963. tetratriacontane
  6964. tetratriacontanoic acid
  6965. tetratriacontanoic acid ethyl ester
  6966. tetratriacontanoic acid methyl ester
  6967. Tetratriacontanoyl chloride
  6968. tetraurea tetrahydronitrate calcium nitrate
  6969. Tetravanadium heptoxide
  6970. Tetrayttrium(III) tribarium(II) oxide
  6971. tetrazirconium hexahydroxy decafluoride trihydrate
  6972. tetrazirconium(IV) trisulfate decahydroxide decahydrate
  6973. thalicarpine
  6974. thallium
  6975. thallium (I) hydrogensulfate
  6976. thallium (I) metathiogermanate
  6977. thallium (I) orthothiogermanate
  6978. thallium aluminium sulfate dodecahydrate
  6979. thallium antimony selenide
  6980. thallium antimony telluride
  6981. thallium arsenic diselenide
  6982. thallium arsenic disulfide
  6983. thallium arsenic ditelluride
  6984. thallium azide (Tl(N3))
  6985. thallium bromide (TlBr)
  6986. thallium bromide (TlBr3)
  6987. thallium bromide selenide (Tl5BrSe2)
  6988. thallium bromomethanedisulfonate
  6989. thallium chloride (TlCl)
  6990. thallium chloride (TlCl3)
  6991. thallium chloromethanedisulfonate
  6992. thallium chromium(III) sulfate dodecahydrate
  6993. thallium cyanide (Tl(CN))
  6994. thallium fluoride (Tl(HF2))
  6995. thallium fluoride (TlF)
  6996. thallium fluoride (TlF)
  6997. thallium fluoride (TlF)
  6998. thallium fluoride (TlF3)
  6999. thallium hydroxide (Tl(OH))
  7000. thallium hydroxide (Tl(OH)3)
  7001. thallium indium(III) fluoride dihydrate
  7002. thallium iodide (TlI)
  7003. thallium iodide (TlI3)
  7004. thallium iodide selenide (Tl5ISe2)
  7005. thallium iodide selenide (Tl6I4Se)
  7006. thallium iodide sulfide (Tl6I4S)
  7007. thallium ion (Tl(1+))
  7008. thallium iron(III) sulfate dodecahydrate
  7009. Thallium mandelate
  7010. thallium methanedisulfonate
  7011. thallium natrolite (Tl1.87Na0.05Mg0.03(Al1.98Si3.02O10).2.33H2O)
  7012. thallium nitrate di(nitric acid)
  7013. thallium oxide (Tl2O)
  7014. thallium selenide (Tl2Se)
  7015. Thallium sulfamate
  7016. thallium sulfate hydrogen sulfate
  7017. thallium sulfide (Tl2S)
  7018. thallium telluride
  7019. thallium telluride (Tl2Te)
  7020. thallium vanadium(III) sulfate dodecahydrate
  7021. thallium zirconium sulfide (Tl2ZrS3)
  7022. thallium zirconium sulfide (Tl4ZrS4)
  7023. thallium(+1) cation bromate
  7024. thallium(1+) (OC-6-11)-hexafluoroantimonate(1-)
  7025. thallium(1+) (T-4)-rhenate (ReO4(1-))
  7026. thallium(1+) tetraphenylborate(1-)
  7027. thallium(1+) vanadate (VO3(1-))
  7028. thallium(I) cadmium chloride
  7029. Thallium(I) docosanoate
  7030. thallium(I) ethoxide
  7031. Thallium(I) heptadecanoate
  7032. Thallium(I) neodymium sulfate octahydrate
  7033. Thallium(I) neodymium sulfate trihydrate
  7034. Thallium(I) pentadecanoate
  7035. Thallium(I) pivalate
  7036. Thallium(I) styphnic acid
  7037. Thallium(I) tellurium bromide
  7038. thallium(I) thiomolybdate
  7039. thallium(I) thiosulfate
  7040. thallium(III) chloride tetrahydrate
  7041. thallium(III) dicesium chloride dihydrate
  7042. Thallium(III) glycolate
  7043. thallium(III) hydrogen disulfate
  7044. thallium(III) hydrogen disulfate tetrahydrate
  7045. thallium(III) hydroxosulfate dihydrate
  7046. Thallium(III) lactate
  7047. Thallium(III) mandelate
  7048. Thallium(III) oxide
  7049. Thallium(III) tellurite
  7050. thallium(III) tricesium chloride
  7051. thallium(III) tricesium chloride monohydrate
  7052. thallium(III)bromide thallium(I) bromide
  7053. thallium(III)bromide tris(thallium(I) bromide)
  7054. thallium(III)chloride thallium(I) chloride
  7055. thallium(III)chloride tris(thallium(I) chloride)
  7056. Theophylline-7-acetic acid
  7057. Therminol 55
  7058. therminol 75
  7059. Therminol D12
  7060. Thiamethoxam
  7061. Thian-2-one
  7062. thianthrene
  7063. thianthrene 5,10-dioxide
  7064. thiazole
  7065. Thiazole-4-carboxaldehyde
  7066. Thiazole-5-carboxaldehyde
  7067. thiazyl fluoride ((SN)F)
  7068. thieno(2,3-b)thiophene
  7069. thiepane
  7070. thietane
  7071. thietane 1-oxide
  7072. Thiiran-2-ylmethyl methacrylate
  7073. thiirane
  7074. thiirene
  7075. Thio-bis(difluorophosphine)
  7076. Thioacetamide bismuth(III) triiodide
  7077. Thioacetazone
  7078. thioacetic acid S-trifluoromethyl ester
  7079. thioantimonic acid (H3SbS3) trisodium salt
  7080. thiobis((methylthio)methane)
  7081. thiobis(chloromethane)
  7082. thiobis(dichlorofluoromethane)
  7083. thiobis(dichloromethane)
  7084. thiobis(trichloromethane)
  7085. thiobis(trifluoromethane)
  7086. thiobismethane
  7087. thiobismethane compd. with borane (1:1)
  7088. thioboric acid (H3BS3) tributyl ester
  7089. thioboric acid (H3BS3) trimethyl ester
  7090. thioboric acid (H3BS3) tripentyl ester
  7091. thioboric acid (H3BS3) triphenyl ester
  7092. thioboric acid (H3BS3) tripropyl ester
  7093. thioboric acid (H3BS3) tris(trifluoromethyl) ester
  7094. thiocyanate
  7095. thiocyanic acid
  7096. thiocyanic acid (2-benzothiazolylthio)methyl ester
  7097. thiocyanic acid 1,1,2-trichloro-2-phenoxyethyl ester
  7098. thiocyanic acid 1,2-dichloro-2-(4-chlorophenoxy)ethyl ester
  7099. thiocyanic acid 1,2-dichloro-2-phenoxyethyl ester
  7100. thiocyanic acid 1-chloro-2-(4-chlorophenoxy)ethenyl ester
  7101. thiocyanic acid 1-chloro-2-phenoxyethenyl ester
  7102. thiocyanic acid 2-(2,4,6-trichlorophenoxy)ethenyl ester
  7103. thiocyanic acid 2-(2,4-dichlorophenoxy)ethenyl ester
  7104. thiocyanic acid 2-(phenylthio)ethenyl ester
  7105. thiocyanic acid 2-butene-1,4-diyl ester
  7106. thiocyanic acid 2-butoxyethenyl ester
  7107. thiocyanic acid 2-propenyl ester
  7108. thiocyanic acid 4-chlorophenyl ester
  7109. thiocyanic acid ammonium salt
  7110. thiocyanic acid barium salt
  7111. thiocyanic acid beryllium salt
  7112. thiocyanic acid butyl ester
  7113. thiocyanic acid cadmium salt
  7114. thiocyanic acid calcium salt
  7115. thiocyanic acid cesium salt
  7116. thiocyanic acid cobalt(2+) salt
  7117. thiocyanic acid compd. with 1,2-ethanediamine (2:1)
  7118. thiocyanic acid compd. with guanidine (1:1)
  7119. thiocyanic acid compd. with hydrazine (1:1)
  7120. thiocyanic acid compd. with N,N-dibutyl-1-butanamine (1:1)
  7121. thiocyanic acid compd. with piperazine (1:1)
  7122. thiocyanic acid compd. with piperidine (1:1)
  7123. thiocyanic acid copper(1+) salt
  7124. thiocyanic acid copper(2+) salt
  7125. thiocyanic acid ethyl ester
  7126. thiocyanic acid lead(2+) salt
  7127. thiocyanic acid lithium salt
  7128. thiocyanic acid magnesium salt
  7129. thiocyanic acid mercury(2+) salt
  7130. thiocyanic acid methyl ester
  7131. thiocyanic acid nickel(2+) salt
  7132. thiocyanic acid pentyl ester
  7133. thiocyanic acid phenyl ester
  7134. thiocyanic acid phenylmethyl ester
  7135. thiocyanic acid potassium salt
  7136. thiocyanic acid propyl ester
  7137. thiocyanic acid rubidium salt
  7138. thiocyanic acid silver(1+) salt
  7139. thiocyanic acid sodium salt
  7140. thiocyanic acid strontium salt
  7141. thiocyanic acid thallium(1+) salt
  7142. thiocyanic acid trifluoromethyl ester
  7143. thiocyanic acid zinc salt
  7144. thiodiphosphoric acid (((HO)2P(S))2O) tetraethyl ester
  7145. thiohypophosphoric acid (((HS)2P(S))2) cadmium sodium salt (2:3:2) octahydrate
  7146. thiohypophosphoric acid (((HS)2P(S))2) cadmium sodium salt (2:3:2) tetrahydrate
  7147. thiomorpholine
  7148. thionyl bromide
  7149. thionyl chloride
  7150. thionyl chloride fluoride
  7151. thionyl fluoride
  7152. thioperoxydicarbonic acid (((HO)C(O))2S2) bis(2-methylpropyl) ester
  7153. thioperoxydicarbonic acid (((HO)C(O))2S2) dibutyl ester
  7154. thioperoxydicarbonic acid (((HO)C(O))2S2) diethyl ester
  7155. thioperoxydicarbonic acid (((HO)C(O))2S2) dimethyl ester
  7156. Thiophen-2-ylmethylidenehydrazine
  7157. thiophene
  7158. Thiophene-2-carboxylic acid ethenyl ester
  7159. Thiophene-2-ethylamine
  7160. thiophosphonyl chloride fluoride ((PS)ClF2)
  7161. thiophosphoric acid tris(2-chlorophenyl) ester
  7162. thiophosphoryl bromide
  7163. thiophosphoryl chloride
  7164. thiophosphoryl fluoride
  7165. thiophosporic acid diphenyl (2-methylphenyl) ester
  7166. thiosilicic acid (H4SiS4) tetramethyl ester
  7167. thiosulfuric acid (H2S2O3) barium salt (1:1)
  7168. thiosulfuric acid (H2S2O3) calcium salt (1:1)
  7169. thiosulfuric acid (H2S2O3) diammonium salt
  7170. thiosulfuric acid (H2S2O3) dipotassium salt
  7171. thiosulfuric acid (H2S2O3) disilver(1+) salt
  7172. thiosulfuric acid (H2S2O3) disodium salt
  7173. thiosulfuric acid (H2S2O3) disodium salt dihydrate
  7174. thiosulfuric acid (H2S2O3) disodium salt dihydrate
  7175. thiosulfuric acid (H2S2O3) disodium salt monohydrate
  7176. thiosulfuric acid (H2S2O3) disodium salt pentahydrate
  7177. thiosulfuric acid (H2S2O3) disodium salt pentahydrate
  7178. thiosulfuric acid (H2S2O3) disodium salt tetrahydrate
  7179. thiosulfuric acid (H2S2O3) magnesium salt (1:1)
  7180. thiosulfuric acid (H2S2O3) magnesium salt (1:1) hexahydrate
  7181. thiotelluric acid (H2TeS3) disodium salt
  7182. thiourea
  7183. thiourea compd. with 2,2-dimethylbutane (3:1)
  7184. thiourea compd. with cycloheptane (3:1)
  7185. thiourea compd. with cyclohexane (3:1)
  7186. thiourea compd. with cyclooctane (3:1)
  7187. thiourea compd. with hexachloroethane (59:20)
  7188. thiourea mononitrate
  7189. thioxoborane
  7190. thorium
  7191. Thorium (I) fluoride
  7192. Thorium (II) fluoride
  7193. Thorium (III) fluoride
  7194. thorium bromide (ThBr4)
  7195. thorium chloride (ThCl4)
  7196. Thorium dicarbide
  7197. thorium diliturate eicosahydrate
  7198. thorium disodium sulfate hexahydrate
  7199. thorium fluoride (ThF4)
  7200. thorium fluoride hydrogen fluoride monohydrate
  7201. thorium fluoride tetra(hydrogen fluoride)
  7202. thorium hydride (Th4H15)
  7203. thorium hydride (ThH2)
  7204. thorium iodide (ThI4)
  7205. thorium nitrate pentahydrate
  7206. thorium oxalate hexahydrate
  7207. thorium oxide (ThO2)
  7208. Thorium oxyfluoride
  7209. thorium phosphate diphosphate
  7210. thorium phosphate hydrogenphosphate
  7211. thorium phosphate hydrogenphosphate hydrate
  7212. thorium sulfate octahydrate
  7213. thorium sulfate tetrahydrate
  7214. thorium tetrasodium sulfate tetrahydrate
  7215. thorium uranium oxide (Th0.1U0.9O2)
  7216. thorium uranium oxide (Th0.5U0.5O2)
  7217. thorium uranium oxide (Th0.9U0.1O2)
  7218. Thorium(IV) 4-cyanopyridine-N-oxide tetrabromide
  7219. Thorium(IV) 4-cyanopyridine-N-oxide tetrachloride
  7220. Thorium(IV) 4-cyanopyridine-N-oxide tetranitrate
  7221. Thorium(IV) 4-cyanopyridine-N-oxide tetrathiocyanate
  7222. thorium(IV) acetate
  7223. Thorium(IV) bis(4-cyanopyridine-N-oxide) tetrabromide
  7224. Thorium(IV) bis(4-cyanopyridine-N-oxide) tetrachloride
  7225. Thorium(IV) bis(4-cyanopyridine-N-oxide) tetranitrate
  7226. Thorium(IV) bis(4-cyanopyridine-N-oxide) tetraperchlorate
  7227. Thorium(IV) bis(4-cyanopyridine-N-oxide) tetrathiocyanate
  7228. Thorium(IV) bis(5,6-benzoquinoline) tetrabromide
  7229. Thorium(IV) bis(5,6-benzoquinoline) tetrachloride
  7230. Thorium(IV) bis(5,6-benzoquinoline) tetranitrate
  7231. Thorium(IV) bis(5,6-benzoquinoline) tetrathiocyanate
  7232. thorium(IV) chloride octahydrate
  7233. Thorium(IV) hexakis(5,6-benzoquinoline) tetraperchlorate
  7234. Thorium(IV) N-(2-methoxyphenyl)-1-pyridin-2-ylmethanimine tetranitrate
  7235. Thorium(IV) N-(2-methoxyphenyl)-1-pyridin-2-ylmethanimine tetrathiocyanate
  7236. Thorium(IV) N-(2-methylphenyl)-2-pyridylmethanimine tetranitrate
  7237. Thorium(IV) N-(2-methylphenyl)-2-pyridylmethanimine tetrathiocyanate
  7238. Thorium(IV) N-(3-chlorophenyl)-1-pyridin-2-ylmethanimine tetranitrate
  7239. Thorium(IV) N-(3-methylphenyl)-2-pyridylmethanimine tetranitrate
  7240. Thorium(IV) N-(3-methylphenyl)-2-pyridylmethanimine tetrathiocyanate
  7241. Thorium(IV) N-(4-ethoxyphenyl)-1-pyridin-2-ylmethanimine tetranitrate
  7242. Thorium(IV) N-(4-ethoxyphenyl)-1-pyridin-2-ylmethanimine tetrathiocyanate
  7243. Thorium(IV) N-(4-methoxyphenyl)-1-pyridin-2-ylmethanimine tetranitrate
  7244. Thorium(IV) N-(4-methoxyphenyl)-1-pyridin-2-ylmethanimine tetrathiocyanate
  7245. Thorium(IV) N-(4-methylphenyl)-2-pyridylmethanimine tetranitrate
  7246. Thorium(IV) N-(4-methylphenyl)-2-pyridylmethanimine tetrathiocyanate
  7247. Thorium(IV) N-phenyl-2-pyridylmethanimine tetranitrate
  7248. Thorium(IV) N-phenyl-2-pyridylmethanimine tetrathiocyanate
  7249. Thorium(IV) tetrakis(5,6-benzoquinoline) tetrabromide
  7250. Thorium(IV) tetrakis(5,6-benzoquinoline) tetrachloride
  7251. Thorium(IV) tetrakis(5,6-benzoquinoline) tetrathiocyanate
  7252. Thorium(IV) tetrathiocyanate
  7253. threo-1-isopropyl-1,2-propanediol
  7254. threo-1-t-butyl-1,2-propanediol
  7255. threo-10,11-dihydroxyoctadecanoic acid
  7256. threo-11,12-dihydroxyoctadecanoic acid
  7257. threo-12,13-dihydroxyoctadecanoic acid
  7258. threo-2-bromo-3-fluoro-butane
  7259. threo-3-bromo-2-fluoro-4-methyl-pentane
  7260. threo-3-bromo-4-fluoro-hexane
  7261. threo-3-Hydroxy-2-methyl-3-phenylpropanoic acid methyl ester
  7262. threo-5,5,5-trichloro-4-hydroxy-3-ethylpentan-2-one
  7263. threo-6,7-Dihydroxydodecanedioic acid
  7264. threo-6,7-Dihydroxyoctadecanoic acid
  7265. threo-7,8-dihydroxyoctadecanoic acid
  7266. threo-8,9-dihydroxyoctadecanoic acid
  7267. threo-ethyl 3-(2,4-dichlorophenyl)-5-oxo-4,5-diphenylpentanoate
  7268. threo-ethyl 3-(4-bromophenyl)-5-oxo-4,5-diphenylpentanoate
  7269. threo-ethyl 3-(4-chlorophenyl)-5-oxo-4,5-diphenylpentanoate
  7270. threo-ethyl 3-(4-methylphenyl)-5-oxo-4,5-diphenylpentanoate
  7271. threo-N-(2-hydroxyethyl)-9,10-dihydroxyoctadecanamide
  7272. threo-N-decyl-9,10-dihydroxyoctadecanamide
  7273. threo-N-octadecyl-9,10-dihydroxyoctadecanamide
  7274. threo-N-pentyl-9,10-dihydroxyoctadecanamide
  7275. threonine compd. with sulfuric acid zinc salt hydrate (1:1:1:1)
  7276. thujamenthol
  7277. thujamenthon
  7278. thulium
  7279. thulium (III) orthovanadate
  7280. thulium bromide (TmBr3)
  7281. thulium bromide octahydrate
  7282. thulium chloride (TmCl2)
  7283. thulium chloride (TmCl3)
  7284. Thulium chloride trinicotinamide hexahydrate
  7285. thulium cuprate
  7286. Thulium digermanate
  7287. thulium fluoride (TmF3)
  7288. Thulium hydrogen uranosilicate
  7289. Thulium hydrogen uranosilicate decahydrate
  7290. Thulium indium digermanate
  7291. thulium iodide (TmI3)
  7292. thulium oxide (Tm2O3)
  7293. thulium propionate
  7294. thulium propionate monohydrate
  7295. thulium sulfate decahydrate
  7296. thulium sulfate hexaurea
  7297. thulium sulfide (Tm2S3)
  7298. Thulium titanate
  7299. thulium(+3) cation trisulfate
  7300. Thulium(III) β-resorcylate
  7301. thulium(III) chloride hexahydrate
  7302. thulium(III) ethylsulfate
  7303. Thulium(III) histidine trinitrate monohydrate
  7304. thulium(III) iodate tetrahydrate
  7305. Thulium(III) nitrate dihydrate
  7306. thulium(III) nitrate hexahydrate
  7307. Thulium(III) nitrate pentahydrate
  7308. Thulium(III) nitrate tetrahydrate
  7309. Thulium(III) triindium(I)
  7310. Thulium(III) triisothiocyanate tris(2,6-Dimethylpicoline-N-oxide)
  7311. Thulium(III) trilead(I)
  7312. Thulium(III) tris(1,4-thioxane-S-oxide trifluoroacetate)
  7313. Thulium(III) tris(2,6-dichlorobenzoic acid)
  7314. Thulium(III) tris(3-Methoxybenzoate)
  7315. Thulium(III)-2,5-dihydroxybenzoate
  7316. Thulium(III)-2,6-dihydroxybenzoate
  7317. Thulium(III)-tris-(2,2,6,6-tetramethyl-3,5-heptanedionate)
  7318. Thulium(III)trifluoromethanesulphonate hepta(4-picoline-N-oxide)
  7319. thullium rhodium oxide (TmRhO3)
  7320. thymidine
  7321. Thymoxyacetic Acid
  7322. Tibolone
  7323. Ticagrelor
  7324. Ticlopidine hydrochloride
  7325. Tiglic anhydride
  7326. tin
  7327. tin arsenide (Sn4As3)
  7328. tin bromide (SnBr2)
  7329. tin bromide iodide (SnBrI)
  7330. tin chloride (SnCl2)
  7331. tin chloride (SnCl2) dihydrate
  7332. tin chloride iodide (SnClI)
  7333. tin compd. with titanium (1:3)
  7334. tin diiodide mono(hydrogen iodide)
  7335. tin dioxysulfate
  7336. tin dioxysulfate tetrahydrate
  7337. tin fluoride (SnF2)
  7338. tin hydroxide (Sn(OH)2)
  7339. tin hydroxide (Sn(OH)4)
  7340. tin iodide (SnI2)
  7341. tin oxide (SnO)
  7342. tin oxide (SnO2)
  7343. tin selenide (SnSe)
  7344. tin selenide (SnSe2)
  7345. tin sulfide (SnS)
  7346. tin sulfide (SnS2)
  7347. tin telluride (SnTe)
  7348. tin tetrachloride bis(acetic acid)
  7349. tin tetrachloride di(selenium oxychloride)
  7350. tin(II) chloride hydrogen chloride trihydrate
  7351. Tin(IV) bis(2-dimethylaminopyridine N-oxide) tetrabromide
  7352. Tin(IV) bis(2-dimethylaminopyridine N-oxide) tetrachloride
  7353. Tin(IV) bis(2-methylaminopyridine N-oxide) tetrabromide
  7354. Tin(IV) bis(2-methylaminopyridine N-oxide) tetrachloride
  7355. Tin(IV) bis(aniline) tetrachloride
  7356. Tin(IV) bis(cyclohexylammonium) hexachloride
  7357. Tin(IV) bis(dibutylaminium) hexachloride
  7358. Tin(IV) bis(diethyl ether) tetrachloride
  7359. Tin(IV) bis(diethylaminium) hexachloride
  7360. Tin(IV) bis(diisobutylaminium) hexachloride
  7361. Tin(IV) bis(diisopropylaminium) hexachloride
  7362. Tin(IV) bis(dimethylaminium) hexachloride
  7363. Tin(IV) bis(dipropylaminium) hexachloride
  7364. Tin(IV) bis(ethyl alcohol) tetrachloride
  7365. Tin(IV) bis(ethyl benzoate) tetrachloride
  7366. Tin(IV) bis(ethyl propanoate) tetrachloride
  7367. Tin(IV) bis(isopentylammonium) hexachloride
  7368. Tin(IV) bis(isopropylaminium) hexachloride
  7369. Tin(IV) bis(piperidinium) hexachloride
  7370. Tin(IV) bis(pyrrolidinium) hexachloride
  7371. Tin(IV) bis(sec-butylammonium) hexachloride
  7372. Tin(IV) bis(tert-butylammonium) hexachloride
  7373. Tin(IV) bis(tetrabutylaminium) hexachloride
  7374. Tin(IV) bis(tetraethylaminium) hexachloride
  7375. Tin(IV) bis(tetrapropylaminium) hexachloride
  7376. Tin(IV) bis(tributylaminium) hexachloride
  7377. Tin(IV) bis(triethylaminium) hexachloride
  7378. Tin(IV) bis(trimethylaminium) hexachloride
  7379. Tin(IV) bis(tripropylaminium) hexachloride
  7380. Tin(IV) diethyl adipate tetrachloride
  7381. Tin(IV) diethyl glutarate tetrachloride
  7382. Tin(IV) diethyl malonate tetrachloride
  7383. Tin(IV) diethyl oxalate tetrachloride
  7384. Tin(IV) diethyl sebacate tetrachloride
  7385. Tin(IV) diethyl succinate tetrachloride
  7386. Tin(IV) diselenite
  7387. Tin(IV) sulfide
  7388. Tin(IV) tellurite
  7389. Tioconazole
  7390. Tiopronin
  7391. titanium
  7392. titanium
  7393. titanium
  7394. titanium alloy base Ti 88-91,Al 5.5-6.75,V 3.5-4.5,Fe0-0.40,O 0-0.20,C0-0.10,N 0-0.05,H 0-0.015 (UNS R56400)
  7395. titanium alloy base Ti 92,V 4.4,Al 3.5
  7396. titanium boride (TiB)
  7397. titanium boride (TiB2)
  7398. titanium bromide (TiBr)
  7399. titanium bromide (TiBr2)
  7400. titanium bromide (TiBr3)
  7401. titanium carbide (TiC)
  7402. titanium chloride (TiCl)
  7403. titanium chloride (TiCl2)
  7404. titanium chloride (TiCl3)
  7405. titanium chloride (TiCl4)
  7406. titanium chloride oxide (TiOCl)
  7407. titanium difluoride oxide (TiF2O)
  7408. titanium fluoride (TiF)
  7409. titanium fluoride (TiF2)
  7410. titanium fluoride (TiF3)
  7411. titanium fluoride oxide (TiFO)
  7412. titanium hydride (TiH2)
  7413. titanium hydroxide (Ti(OH)4) tetra(1,1-dimethylethyl) ester
  7414. titanium iodide (TiI)
  7415. titanium iodide (TiI2)
  7416. titanium iodide (TiI3)
  7417. titanium ion (Ti(1+))
  7418. titanium nitride (TiN)
  7419. titanium oxide (Ti2O3)
  7420. titanium oxide (Ti3O5)
  7421. titanium oxide (Ti3O5)
  7422. titanium oxide (Ti3O5)
  7423. titanium oxide (Ti4O7)
  7424. titanium oxide (Ti6O11)
  7425. titanium oxide (TiO)
  7426. titanium oxide (TiO)
  7427. titanium oxide (TiO)
  7428. titanium oxide (TiO2)
  7429. titanium silicide (Ti5Si3)
  7430. titanium silicide (TiSi)
  7431. titanium silicide (TiSi2)
  7432. titanium sulfide (TiS2)
  7433. titanium tetrachloride di(selenium oxychloride)
  7434. titanium trichloride hexahydrate
  7435. titanium uranium oxide (Ti2UO6)
  7436. titanium yttrium oxide (Ti2Y2O7)
  7437. titanium zinc oxide (TiZn2O4)
  7438. titanium zirconium oxide (TiZrO4)
  7439. titanium(+4) cation disulfate
  7440. Titanium(III) trisulfate
  7441. Titanium(IV) oxyhydrate
  7442. Titanium(IV)(bis-(2-hydroxynaphthyl)-o-phenylenedialdimine dichloride)
  7443. titanyl sulfate dihydrate
  7444. titanyl sulfate monohydrate
  7445. titanyl sulfate sulfuric acid
  7446. titanyl sulfate sulfuric acid monohydrate
  7447. TKX-55
  7448. Tl-Natrolite (Tl-exchanged natrolite)
  7449. Toluene-2,4-dicarbamic acid di-isobutyl ester
  7450. Toluene-2,4-dicarbamic acid di-n-butyl ester
  7451. Toluene-4-sulfonic acid 4-allyl-5-oxo-2,5-dihydro-furan-3-yl ester
  7452. Toluene-p-sulphonic anhydride
  7453. topiramate
  7454. toxaphene
  7455. Tranid
  7456. trans,trans-1,2-Bis(prop-1-enyl)benzene
  7457. trans,trans-13,13-dichloro-trans-bicyclo(10.1.0)trideca-4,8-diene
  7458. trans-(±)-11,12-Dimethyl-9,10-Dihydro-9,10-ethanoanthracene
  7459. trans-(±)-9,10-Dihydro-9,10-ethanoanthracene-11,12-bismethanol ditosylate
  7460. trans-(+)-11,12-Dimethyl-9,10-Dihydro-9,10-ethanoanthracene
  7461. trans-(+)-3-carboxy-2,2-dimethylcyclobutaneacetic acid
  7462. trans-(-)-9,10-Dihydro-9,10-ethanoanthracene-11,12-bismethanol ditosylate
  7463. trans-(1,1'-bicyclopentyl)-2-ol
  7464. trans-(1-Diethoxyphosphoryl)-3-methylpent-3-en-1-yne
  7465. trans-(1-Dimethoxyphosphoryl)-3-methylpent-3-en-1-yne
  7466. trans-(2-(trifluoromethyl)cyclopropan)carboxylic acid
  7467. trans-(2-trifluoromethyl)cyclopropanemethanol
  7468. trans-(3S,4S)-3,4-bis(phenylcarbonyl(oxy))tetrahydrofuran
  7469. trans-(3S,4S)-4-(phenylmethoxy)-3-tetrahydrofuranol benzoate
  7470. trans-(4-Hydroxy-4-methylcyclohexyl) benzoate
  7471. trans-(4-tert-Butylcyclohexyl) butanoate
  7472. trans-(4-tert-Butylcyclohexyl) heptanoate
  7473. trans-(4-tert-Butylcyclohexyl) hexanoate
  7474. trans-(4-tert-Butylcyclohexyl) pentanoate
  7475. trans-(4-tert-Butylcyclohexyl)-phenylmethanone
  7476. trans-(S)-(-)-4-Methylbenzenesulfinic acid 2-butenyl ester
  7477. trans-(S)-(-)-4-Methylbenzenesulfinic acid 2-hexenyl ester
  7478. trans-(S)-(-)-4-Methylbenzenesulfinic acid 2-octenyl ester
  7479. trans-(S)-(-)-4-Methylbenzenesulfinic acid 3-phenylprop-2-enyl ester
  7480. trans-1,1'-(1,2-cyclopropanediyl)bisbenzene
  7481. trans-1,1'-bi(cyclohexan)-1'-en-2-ol
  7482. trans-1,1'-vinylenebis[3,3'-(3-methoxypropyl)urea]
  7483. trans-1,1'-vinylenebis[3,3'-(morpholin-4-yl)urea]
  7484. trans-1,1'-vinylenebis[3,3'-(p-nitrophenyl)urea]
  7485. trans-1,1,1,3-Tetrafluoro-2-butene
  7486. trans-1,1,1-Trimethoxybut-2-ene
  7487. trans-1,1,1-Trimethoxypent-2-ene
  7488. trans-1,1,2,2,3,3,3a,4,4,5,5,6,6,7,7,7a-hexadecafluorooctahydro-1H-indene
  7489. trans-1,1,2,4,4,5-hexachlorocyclohexane
  7490. trans-1,1-dichloro-2,3-dimethylcyclopropane
  7491. trans-1,2-bis[(trimethylsilyl)oxy]cyclohexane
  7492. trans-1,2-cyclohexanediol
  7493. trans-1,2-cyclopentanediol
  7494. trans-1,2-dibromocyclohexane
  7495. trans-1,2-dibromocyclopentane
  7496. trans-1,2-dichlorocyclodecane
  7497. trans-1,2-dichlorohexafluorocyclobutane
  7498. trans-1,2-diethenylcyclobutane
  7499. trans-1,2-diethylcyclopentane
  7500. trans-1,2-diethylcyclopropane
  7501. trans-1,2-dihydro-1,2-dimethylacenaphthylene
  7502. trans-1,2-dihydroacenaphthylene-1,2-dicarboxylic acid dimethyl ester
  7503. trans-1,2-dimethyl-1,2-cyclohexanediol
  7504. trans-1,2-Dimethyl-1,2-diphenylcyclobutane
  7505. trans-1,2-dimethyl-1-oxylatopiperidine-1-ium
  7506. trans-1,2-dimethyl-4-cyclohexene-1,2-diol
  7507. trans-1,2-dimethylcyclobutane
  7508. trans-1,2-dimethylcyclohexane
  7509. trans-1,2-dimethylcyclohexanol acetate
  7510. trans-1,2-dimethylcyclopentane
  7511. trans-1,2-dimethylcyclopentanol
  7512. trans-1,2-dimethylcyclopentanol acetate
  7513. trans-1,2-dimethylcyclopropane
  7514. trans-1,2-Dinitrocycloheptane
  7515. trans-1,2-Dinitrocyclohexane
  7516. trans-1,2-heptanediol cyclic sulfite
  7517. trans-1,3,5,7-tetraoxadecahydronaphthalene
  7518. trans-1,3-diiodocyclobutane
  7519. trans-1,3-dimethylcyclobutane
  7520. trans-1,3-dimethylcyclohexane
  7521. trans-1,3-dimethylcyclopentane
  7522. trans-1,3-Dinitrocyclohexane
  7523. trans-1,4-(diethyl acetamidomalonyl)-butene-2
  7524. trans-1,4-cyclohexanediamine
  7525. trans-1,4-Cyclohexanedicarboxylic acid
  7526. trans-1,4-cyclohexanedicarboxylic acid bis(4-methoxyphenyl) ester
  7527. trans-1,4-cyclohexanedimethanol
  7528. trans-1,4-cyclohexyl-bis-4-hexyloxybenzoate
  7529. trans-1,4-cyclohexylene p-butoxybenzoate
  7530. trans-1,4-cyclohexylene p-methoxybenzoate
  7531. trans-1,4-Dibromobut-2-ene
  7532. trans-1,4-Didecylcyclohexane
  7533. trans-1,4-dimethylcyclohexane
  7534. trans-1,4-ditert-Butylcyclohexane
  7535. trans-1,4a-Dimethyldecahydronaphthalene
  7536. trans-1,5-Dichloro-9,10-dihydroanthracene-9,10-diol
  7537. trans-1,6,7,8,9,9a-hexahydro-1,6-dimethyl-4-oxo-4H-pyrido[1,2-a]pyrimidine-3-carboxamide
  7538. trans-1-benzyloxy-2,3-epoxybutane
  7539. trans-1-bromo-2-ethoxycyclopentane
  7540. trans-1-bromo-2-fluorocyclododecane
  7541. trans-1-bromo-2-methoxycyclopentane
  7542. trans-1-Chloro-9,10-dihydro-9,10-ethanoanthracene-11,12-dicarboxylic acid dimethyl ester
  7543. trans-1-ethyl-2-methylcyclohexane
  7544. trans-1-ethyl-2-methylcyclopentane
  7545. trans-1-ethyl-3-methylcyclopentane
  7546. trans-1-ethyl-4-methylcyclohexane
  7547. trans-1-Hexene-1-sulfonyl chloride
  7548. trans-1-Iodo-1-hexene
  7549. trans-1-methyl-1,2-cyclohexanediacetic acid
  7550. trans-1-methyl-2-(dimethylamino)-4-(1-methylethenyl)cyclohexanol
  7551. trans-1-Methyl-2-propylcyclopentan-1-ol
  7552. trans-1-methyl-2-propylcyclopentane
  7553. trans-1-methyl-2-propylcyclopropane
  7554. trans-1-methyl-3-propylcyclopentane
  7555. trans-1-methyl-4-(1-methylethyl)cyclohexane
  7556. trans-1-Octene-1-sulfonyl chloride
  7557. trans-1-Phenylbuta-1,3-diene
  7558. trans-1-[4-(3,4-dimethoxyphenyl)]-4,5-dihydro-5-(4-methoxybenzoyl)-1-(4-methoxyphenyl)ethanone
  7559. trans-1-[5-benzoyl-4,5-dihydro-1,4-bis(4-methoxyphenyl)-1H-pyrazol-3-yl]ethanone
  7560. trans-1-[5-benzoyl-4,5-dihydro-1-(4-methoxyphenyl)-4-phenyl-1H-pyrazol-3-yl]ethanone
  7561. trans-1-[5-benzoyl-4,5-dihydro-1-phenyl-4-phenyl-1H-pyrazol-3-yl]ethanone
  7562. trans-1-[B-benzoyl-4-(4-chlorophenyl)-4,5-dihydro-1-(4-methoxyphenyl)-1H-py razol-3-yl]ethanone
  7563. trans-10-Methoxydec-2-enoic acid methyl ester
  7564. trans-11,11-dibromobicyclo(8.1.0)undec-(Z)-4-ene
  7565. trans-11,11-dibromobicyclo(8.1.0)undecane
  7566. trans-11-bromobicyclo(8.1.0)undecane
  7567. trans-17-Chloroheptadec-7-en-9-yne
  7568. trans-2,2,3,3,5,6-hexafluoro-1,4-dioxane
  7569. trans-2,2,3,5,6,6-hexafluoro-1,4-dioxane
  7570. trans-2,2,4,6-tetramethyl-1,3-dioxane
  7571. trans-2,2-dibromo-1,3-dimethyl-α-methylcyclopropanemethanol
  7572. trans-2,2-Dimethyl-1-(2-methylolcyclopropyl)propan-1-one
  7573. trans-2,2-dimethyl-3-(2-methyl-1-propenyl)cyclopropanecarboxylic acid methyl ester
  7574. trans-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalene-4a-carboxylic acid
  7575. trans-2,3-Dichlorotetrahydrofuran
  7576. trans-2,3-diethylsuccinic anhydride
  7577. trans-2,3-dihydro-1,2-dimethyl-1H-indene
  7578. trans-2,3-dihydro-1,3-dimethyl-1H-indene
  7579. trans-2,3-dimethyloxirane
  7580. trans-2,3-dimethylsuccinic anhydride
  7581. trans-2,3-Diphenylpropenoic acid
  7582. trans-2,3-Epoxyhexyl acetate
  7583. trans-2,4-dimethyl-1,3-dioxolane
  7584. trans-2,5-Bis-(tosyloxymethyl)tetrahydrofuran
  7585. trans-2,5-cyclohexadiene-1,4-dicarboxylic acid
  7586. trans-2,5-Dihydrofuran-2,5-dicarboxylic acid
  7587. trans-2,5-Dimethyloxolane
  7588. trans-2,6-dichlorocyclohexanone
  7589. trans-2,cis-6-nonadien-1-ol
  7590. trans-2-(α,γ-Dimethylallyl)-phenol
  7591. trans-2-(2-Methoxy-2-phenylethyl)butanedinitrile
  7592. trans-2-(2-Methoxycyclohexyl)butanedinitrile
  7593. trans-2-(2-propenyl)decahydronaphthalene
  7594. trans-2-(2-Thienyl)cyclopentanol
  7595. trans-2-(3-Methoxy-3-phenylpropyl)butanedinitrile
  7596. trans-2-(4-methoxyphenyl)cyclopropanecarboxylic acid
  7597. trans-2-(4-methoxyphenyl)cyclopropanecarboxylic acid ethyl ester
  7598. trans-2-(4-nitrophenyl)-1,3-dioxan-5-ol benzoate
  7599. trans-2-(4-nitrophenyl)-1,3-dioxolane-4-methanol 4-nitrobenzoate
  7600. trans-2-(Benzyloxy)cyclohexanol
  7601. trans-2-(bromomethyl)cyclohexanol
  7602. trans-2-(difluoromethyl)-2,3,4,5,5-pentafluorotetrahydrofuran
  7603. trans-2-(Hydroxymethyl)-1-phenylcyclopropane-1-carboxylic acid
  7604. trans-2-(Prop-1-yn-1-yl)cyclohexan-1-ol
  7605. trans-2-(trichloromethyl)-1,3-dioxolane-4-methanol benzoate
  7606. trans-2-(trifluoromethyl)cyclopropaneacetonitrile
  7607. trans-2-Acetyl-3,3-dimethyl-6-(1-methylethyl)cyclohexanone
  7608. trans-2-Benzyl-1,2,3,4,5,6,7,8-octahydronaphthalene
  7609. trans-2-Benzyldecahydronaphthalen-1-ol
  7610. trans-2-Bromo-1-(dibromo-phosphino)cyclohexane
  7611. trans-2-bromo-6-fluorocyclohexanone
  7612. trans-2-bromocyclohexanol nitrate
  7613. trans-2-chloro-2-butenoic acid
  7614. trans-2-Chloro-3-methyl-1-phenylbut-2-en-1-one
  7615. trans-2-chloro-6-fluorocyclohexanone
  7616. trans-2-chlorocyclohexanol
  7617. trans-2-Ethylcyclohexanol
  7618. trans-2-ethylcyclopentan-1-ol
  7619. trans-2-ethyldecalin
  7620. trans-2-Ethynylcyclohexan-1-ol
  7621. trans-2-Ethynylcyclopentanol
  7622. trans-2-hydroxyhexahydrocyclopenta[d][1,3,2]dioxaphosphinine 2-oxide
  7623. trans-2-iodocyclohexanol nitrate
  7624. trans-2-Isopropylcyclohexanol
  7625. trans-2-Methoxycyclohexanol
  7626. trans-2-Methoxycyclopentanol
  7627. trans-2-methylcyclopropanecarboxylic acid methyl ester
  7628. trans-2-Naphthalen-1-yl-3-(2,6-dichlorophenyl)prop-2-enoic acid
  7629. trans-2-Naphthalen-1-yl-3-phenylprop-2-enenitrile
  7630. trans-2-Naphthalen-1-yl-3-phenylprop-2-enoic acid
  7631. trans-2-nonenoic acid
  7632. trans-2-Oxo-4,6-diphenyl-4-prop-2-enyl-3-oxabicyclo[3.1.0]hexane-1-carboxylic acid
  7633. trans-2-Oxo-4,6-diphenyl-4-propyl-3-oxabicyclo[3.1.0]hexane-1-carboxylic acid
  7634. trans-2-phenoxyhexahydrocyclopenta[d][1,3,2]dioxaphosphinine 2-oxide
  7635. trans-2-Phenyl-3-chlorotetrahydrofuran
  7636. trans-2-phenylcyclohexanamine
  7637. trans-2-phenylcyclohexanamine hydrochloride
  7638. trans-2-phenylcyclopropanamine
  7639. trans-2-Prop-1-ynylcycloheptan-1-ol
  7640. trans-2-Propylcyclohexanol
  7641. trans-2-tert-Butyl-5-phenyl-1,3-dioxolan-4-one
  7642. trans-2-[(2-hydroxyethyl)sulfanyl]cyclohexan-1-ol
  7643. trans-2-[(2-Methoxycyclohexyl)methyl]butanedinitrile
  7644. trans-2-[2-(carboxymethyl)cyclohexyl]acetic acid
  7645. trans-2-[2-[Cyano(diphenyl)methyl]-3-methylidenecyclopropyl]-2,2-diphenylacetonitrile
  7646. trans-3,3,3-Trifluoro-N,N-bis-trifluoromethyl-1-propenylamine
  7647. trans-3,3-dimethyl-1,2-cyclopropanedicarboxylic acid diethyl ester
  7648. trans-3,4-dimethylcyclopentene
  7649. trans-3,5-Dibromocyclopentane-1,2-diol
  7650. trans-3,5-Dibromocyclopentene
  7651. trans-3,5-dimethylcyclopentene
  7652. trans-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylic acid (3-phenoxyphenyl)methyl ester
  7653. trans-3-(4-(Methoxycarbonyl)-5-methylfur-2-yl)acryloyl chloride
  7654. trans-3-(4-Hydroxycyclohexyl)propanoic acid
  7655. trans-3-(4-Hydroxycyclohexyl)propanoic acid ethyl ester
  7656. trans-3-(4-Methoxyphenyl)cyclopentane-1,2-diol
  7657. trans-3-Bromo-2-deuteriotetrahydropyran
  7658. trans-3-Chloro-2-butyltetrahydropyran
  7659. trans-3-chloro-2-ethenyltetrahydrofuran
  7660. trans-3-chloro-2-ethyltetrahydropyran
  7661. trans-3-Chloro-2-p-tolyltetrahydrofuran
  7662. trans-3-Chloro-2-p-tolyltetrahydropyran
  7663. trans-3-Chloro-2-phenyltetrahydropyran
  7664. trans-3-Chloro-2-propyltetrahydropyran
  7665. trans-3-chlorotetrahydro-2-(1-methylethyl)furan
  7666. trans-3-chlorotetrahydro-2-(2-propenyl)furan
  7667. trans-3-chlorotetrahydro-2-furancarbonitrile
  7668. trans-3-chlorotetrahydro-2-methyl-2H-pyran
  7669. trans-3-chlorotetrahydro-2-methylfuran
  7670. trans-3-chlorotetrahydro-2-propylfuran
  7671. trans-3-Heptene-2-one
  7672. trans-3-Hydroxycyclohexanecarboxylic acid
  7673. trans-3-Hydroxycyclohexanecarboxylic acid methyl ester
  7674. trans-3-Hydroxymethylcyclohexanol
  7675. trans-3-isopropyl-5-methylcyclohexanol
  7676. trans-3-methyl-5-(propan-2-yl)cyclohexyl acetate
  7677. trans-3-Naphthalen-1-yl-2-phenylprop-2-enenitrile
  7678. trans-3-Octenoic acid
  7679. trans-3-[2-(carboxy)cyclohexyl]propanoic acid
  7680. trans-4,4'-di-n-propyl-1,1'-bicyclohexyl-cis-4-carbonitrile
  7681. trans-4,5-difluoro-1,3-dioxolan-2-one
  7682. trans-4,5-dimethyl-1,3-dioxane
  7683. trans-4,6-dimethyl-1,3-dioxane
  7684. trans-4-(1,1-dimethylethyl)cyclohexanecarboxylic acid methyl ester
  7685. trans-4-(1,1-dimethylethyl)cyclohexanol
  7686. trans-4-(4-Bromophenyl)cyclohexyl (E)-but-2-enoate
  7687. trans-4-(4-Chlorophenyl)cyclohexyl (E)-but-2-enoate
  7688. trans-4-(4-Cyano-3-fluorophenyl)cyclohexyl (E)-but-2-enoate
  7689. trans-4-(4-Cyanophenyl)cyclohexyl (E)-but-2-enoate
  7690. trans-4-(4-Fluorophenyl)cyclohexyl (E)-but-2-enoate
  7691. trans-4-(4-heptylcyclohexyl)benzonitrile
  7692. trans-4-(4-pentylcyclohexyl)benzonitrile
  7693. trans-4-(4-propylcyclohexyl)benzonitrile
  7694. trans-4-(aminomethyl)cyclohexanecarboxylic acid
  7695. trans-4-(methoxymethyl)-2-(4-nitrophenyl)-1,3-dioxolane
  7696. trans-4-Butylcyclohexanol
  7697. trans-4-Chloro-1-methylcyclohexan-1-ol
  7698. trans-4-cyclohexylcyclohexanol
  7699. trans-4-Ethyl-2-oxo-4,6-diphenyl-3-oxabicyclo[3.1.0]hexane-1-carboxylic acid
  7700. trans-4-Ethyl-4'-(4-pentylcyclohexyl)-1,1'-biphenyl
  7701. trans-4-Isopropylcyclohexanol
  7702. trans-4-Methoxy-1-methylcyclohexan-1-ol
  7703. trans-4-Methyl-2-(2-Methylpropyl)tetrahydropyran
  7704. trans-4-Methyl-4-(2-methylprop-2-enyl)-2-oxo-6-phenyl-3-oxabicyclo[3.1.0]hexane-1-carboxylic acid
  7705. trans-4-methylcyclohexanol
  7706. trans-4-tert-Butylcyclohexyl acetate
  7707. trans-4-tert-Butylcyclohexyl isobutyrate
  7708. trans-4-tert-Butylcyclohexyl pivalate
  7709. trans-4-tert-Butylcyclohexyl propionate
  7710. trans-4-[(2-chloroethyl-nitrosocarbamoyl)amino]cyclohexane-1-carboxylic acid
  7711. trans-4-[2-(4-Fluorophenyl)ethyl]cyclohexyl (E)-but-2-enoate
  7712. trans-4-[2-(carboxy)cyclohexyl]butanoic acid
  7713. trans-4-[4-(Trifluoromethoxy)phenyl]cyclohexyl (E)-but-2-enoate
  7714. trans-5,5-Dimethoxy-3,4-dimethyloxolan-3-ol
  7715. trans-5-Butyl-4-methyloxolan-2-one
  7716. trans-5-Chloro-5-nitro-2-phenyl-1,3-dioxane
  7717. trans-5-Hepten-1-ol
  7718. trans-5-Hydroxymethyl-5,6-dihydro-7H-dibenzo[a,c]cyclohepten-6-ol
  7719. trans-5-methoxy-2-(4-nitrophenyl)-1,3-dioxane
  7720. trans-5-methyl-2-(1-methylethyl)cyclohexanone
  7721. trans-5-Octen-1-ol
  7722. trans-6-Octenoic acid
  7723. trans-8-p-Menthene-1,2-diol
  7724. trans-8-p-Menthene-1,2-diol
  7725. trans-9,10-Bis-hydroxymethyl-9,10-dihydrophenanthrene
  7726. trans-9,10-cis-6,10-H-6-benzamido-2-methyldecahydroisoquinoline
  7727. trans-9,10-Dihydro-9,10-ethanoanthracene-11,12-dicarboxylic acid
  7728. trans-9,10-dihydro-9,10-ethanoanthracene-11,12-dicarboxylic acid di-3,5-dimethylpyrazole
  7729. trans-9,10-dihydro-9,10-ethanoanthracene-11,12-dicarboxylic acid dihydrazide
  7730. trans-9,10-dihydro-9,10-ethanoanthracene-11,12-dicarboxylic acid dimethyl ester
  7731. trans-9-Methyldecahydronaphthalene
  7732. trans-9-Phenanthryl-2-(2-pyridyl)ethene
  7733. trans-9-Phenanthryl-2-(3-pyridyl)ethene
  7734. trans-9-Phenanthryl-2-(4-pyridyl)ethene
  7735. trans-9-Styrylphenanthrene
  7736. trans-acetic acid 3,5-dimethylcyclohexyl ester
  7737. trans-acetic acid 3-methylcyclohexyl ester
  7738. trans-bicyclo[2.2.2]octane-2,3-diol
  7739. trans-bicyclo[6.1.0]nonane
  7740. trans-Bis(fluoroxy)tetrafluoroselenium
  7741. trans-Chrysanthemic acid chloride
  7742. trans-Chrysanthemum-dicarboxylic acid dichloride
  7743. trans-Chrysanthemum-dicarboxylic dianilide
  7744. trans-Cinnamyl alcohol
  7745. trans-cyano((2,4,5-trichlorophenyl)hydrazono)acetic acid methyl ester
  7746. trans-cyano[(3,5-bis(trifluoromethyl)phenyl)hydrazono]acetic acid methyl ester
  7747. trans-Cyclohexane-1,4-diol
  7748. trans-cyclopentanol-2-acetic acid methyl ester
  7749. trans-d-3-Carboxy-1,1-dimethylcyclopropane-2-propionic acid
  7750. trans-d-3-Carboxy-1,1-dimethylcyclopropane-2-propionic acid di-nor-d-pseudoephedrine salt monohydrate
  7751. trans-d-3-Carboxy-1,1-dimethylcyclopropane-2-propionic acid di-nor-l-pseudoephedrine salt monohydrate
  7752. trans-d-Caronic acid
  7753. trans-decahydro-1-naphthol
  7754. trans-decahydro-2-methylenenaphthalene
  7755. trans-decahydronaphthalene
  7756. trans-Decahydronaphthalene-2,2-diacetic acid
  7757. trans-Decahydronaphthalene-2,2-diacetic acid diethyl ester
  7758. trans-Decahydronaphthalene-2,2-diacetic acid dimethyl ester
  7759. trans-decahydroquinoline
  7760. trans-decalin-9-carboxamide
  7761. trans-decalin-9-carboxylic acid methyl ester
  7762. trans-Dichloro-tetrakis(thiourea) zinc(II)
  7763. trans-Dichloro-tetrakis(thiourea)cadmium(II)
  7764. trans-Dichloro-tetrakis(thiourea)iron(II)
  7765. trans-Dichloro-tetrakis(thiourea)manganese(II)
  7766. trans-Dichloro-tetrakis(thiourea)mercury(II)
  7767. trans-dichlorobis(methanamine-N)platinum
  7768. trans-Diethyl 2-(2-methoxy-2-phenylethyl)-3-methylbutanedioate
  7769. trans-Diethyl 2-(2-methoxy-2-phenylethyl)butanedioate
  7770. trans-Diethyl 2-(2-methoxycyclohexyl)-3-methylbutanedioate
  7771. trans-Diethyl 2-(2-methoxycyclohexyl)butanedioate
  7772. trans-Diethyl 2-(3-methoxy-3-phenylpropyl)butanedioate
  7773. trans-Diethyl 2-[(2-methoxycyclohexyl)methyl]butanedioate
  7774. trans-diethyl 4-chloro-2-butenyl acetamidomalonate
  7775. trans-dl-Caronic acid
  7776. trans-ethyl 1-oxo-decahydronaphthalene-2-carboxylate
  7777. trans-Ethyl 2-ethyl-4-hydroxy-3,4-dihydro-2H-pyridine-1-carboxylate
  7778. trans-Ethyl 3,3-dimethylhept-5-enoate
  7779. trans-Ethyl 4,6-dimethyl-4-(2-methylprop-2-enyl)-2-oxo-3-oxabicyclo[3.1.0]hexane-1-carboxylate
  7780. trans-Ethyl 4-(2-methylprop-2-enyl)-2-oxo-4,6-diphenyl-3-oxabicyclo[3.1.0]hexane-1-carboxylate
  7781. trans-Ethyl 4-but-3-en-2-yl-2-oxo-4,6-diphenyl-3-oxabicyclo[3.1.0]hexane-1-carboxylate
  7782. trans-Ethyl 4-hydroxy-2-methyl-3,4-dihydro-2H-pyridine-1-carboxylate
  7783. trans-Ethyl 4-methyl-4-(2-methylprop-2-enyl)-2-oxo-6-phenyl-3-oxabicyclo[3.1.0]hexane-1-carboxylate
  7784. trans-Ethyl 4-tert-butylcyclohexane-1-carboxylate
  7785. trans-Ethyl-3-methylhept-5-enoate
  7786. trans-Isopropyl4-tert-butylcyclohexane-1-carboxylate
  7787. trans-l-3-Carboxy-1,1-dimethylcyclopropane-2-propionic acid
  7788. trans-l-Caronic acid
  7789. trans-m-Coumaric Acid
  7790. trans-Methyl 4-hydroxy-4-methylcyclohexane-1-carboxylate
  7791. trans-N,N'-1,2-cyclohexanediylbis(N-(carboxymethyl)glycine)
  7792. trans-n-Butyl 4-tert-butylcyclohexane-1-carboxylate
  7793. trans-n-Hexyl 4-tert-butylcyclohexane-1-carboxylate
  7794. trans-n-Pentyl 4-tert-butylcyclohexane-1-carboxylate
  7795. trans-n-Propyl 4-tert-butylcyclohexane-1-carboxylate
  7796. trans-N-[3-(ethoxycarbonyl)-1-oxo-2-propenyl]morpholine
  7797. trans-Nickel(II) tetrakis(4-Chloro-3-hydroxypyridine) dichloride
  7798. trans-nitrobis(ethylenediamine)amminecobalt(III) bromide
  7799. trans-nitrobis(ethylenediamine)amminecobalt(III) chloride
  7800. trans-nitrobis(ethylenediamine)amminecobalt(III) iodide
  7801. trans-nitrobis(ethylenediamine)amminecobalt(III) nitrate
  7802. trans-nitrogen fluoride (N2F4)
  7803. trans-Non-4-en-1-ol
  7804. trans-octadecafluorodecahydronaphthalene
  7805. trans-octahydro-1(2H)-naphthalenone oxime
  7806. trans-octahydro-1H-2-benzothiopyran
  7807. trans-octahydro-2-methylene-1H-indene
  7808. trans-octahydro-2H-1-benzothiopyran
  7809. trans-octahydro-2H-inden-2-one
  7810. trans-octahydropentalene
  7811. Trans-p-Menth-6-ene-2,8-diol
  7812. trans-Palladium(II) bis(dibenzyl sulfide) dibromide
  7813. trans-Palladium(II) bis(dibenzyl sulfide) dichloride
  7814. trans-Palladium(II) bis(dibenzyl sulfide) diiodide
  7815. trans-Palladium(II) bis(diethyl-phenylphosphine) dichloride
  7816. trans-Palladium(II) bis(diethylselenide) dichloride
  7817. trans-Palladium(II) bis(diethylsulfide) dibromide
  7818. trans-Palladium(II) bis(diethylsulfide) dichloride
  7819. trans-Palladium(II) bis(diethylsulfide) diiodide
  7820. trans-Palladium(II) bis(diethyltelluride) dichloride
  7821. trans-Palladium(II) bis(dipropyl sulfide) dibromide
  7822. trans-Palladium(II) bis(dipropyl sulfide) dichloride
  7823. trans-Palladium(II) bis(dipropyl sulfide) diiodide
  7824. trans-Palladium(II) bis(methyl ethyl sulfide) dibromide
  7825. trans-Palladium(II) bis(methyl ethyl sulfide) dichloride
  7826. trans-Palladium(II) bis(methyl ethyl sulfide) diiodide
  7827. trans-Palladium(II) bis(methyl phenyl sulfide) dibromide
  7828. trans-Palladium(II) bis(methyl phenyl sulfide) dichloride
  7829. trans-Palladium(II) bis(thiacyclopentane) dibromide
  7830. trans-Palladium(II) bis(thiacyclopentane) dichloride
  7831. trans-Palladium(II) bis(thiacyclopentane) diiodide
  7832. trans-Platinum(II) bis(1-hexanamine bromide)
  7833. trans-Platinum(II) bis(1-hexanamine chloride)
  7834. trans-Platinum(II) bis(tributylphosphine) dichloride
  7835. trans-Rhenium(V)-2-methylbenzene dicarbon oxide dibromide
  7836. trans-tetrahydro-2,5-dimethylthiophene
  7837. trans-tetrahydro-2,5-dimethylthiophene 1,1-dioxide
  7838. trans-Tetrahydrofuran-2,5-dicarboxylic acid
  7839. trans-tricyclo(7.1.0.0(1,3))decane
  7840. trans-Undec-2-enoic acid methyl ester
  7841. trans-[(4-trimethylsilyl)cyclohexyloxy]-trimethylsilane
  7842. trans-[2-(4-nitrophenyl)-1,3-dioxan-5-yl] 4-nitrobenzoate
  7843. transcal N
  7844. transformer oil
  7845. travertine
  7846. travertine
  7847. tremolite (Ca2((Mg0.9-1Fe0-0.1)4.5-5Al0-0.5)(Si7.5-8Al0-0.5)(OH)2O22)
  7848. Tri(2-hydroxyethyl)methyl ammonium mefenamate
  7849. tri(ammonium dihydrogen phosphate) phosphoric acid (3:1)
  7850. tri(ammonium tetraborate) ammonium chloride octahydrate
  7851. tri(ammonium tetraborate) ammonium iodide octahydrate
  7852. tri(butan-2-yloxy)-phenylsilane
  7853. tri(calcium phosphate) calcium fluoride (Fluorapatite)
  7854. tri(copper(II) sulfate) copper(II) acetate tri(copper(II) hydroxide)
  7855. tri(ethylene glycol) monohexyl ether
  7856. Tri(glycine) europium(III) tribromide
  7857. Tri(glycine) gadolinium(III) tribromide
  7858. Tri(glycine) samarium(III) tribromide
  7859. tri(hafnyl sulfate) hafnium(IV) hydroxide heptahydrate
  7860. tri(L-α-methionine) zinc dinitrate monohydrate
  7861. tri(potassium sulfate) mono sulfuric acid
  7862. Tri(propan-2-yl)-tribromogermylimino-lambda5-phosphane
  7863. Tri(propan-2-yl)-trichlorogermylimino-lambda5-phosphane
  7864. tri(silver fluoride) di(hydrogen fluoride)
  7865. tri(silver fluoride) pentahydrate
  7866. tri(sodium formate) formic acid
  7867. tri(sodium selenate) di(selenic acid) tetrahydrate
  7868. Tri(tert-butyl) benzene-1,2,4-tricarboxylate
  7869. tri-2-propenylsilane
  7870. Tri-isopropyl(imino)phosphorane
  7871. Tri-n-butyl(2-methoxyethyl)phosphonium 2-(2-methoxyethoxy)ethyl sulfate
  7872. Tri-n-butyl(2-methoxyethyl)phosphonium 2-methoxyethyl sulfate
  7873. Tri-n-butyl(2-methoxyethyl)phosphonium n-hexyl sulfate
  7874. Tri-n-butylmethylammonium hexanesulfonate
  7875. Tri-N-dectylammonium chloride
  7876. tri-n-dodecylammonium picrate
  7877. Tri-N-heptylammoniumchloride
  7878. tri-n-hexyl-n-heptylammonium nitrate
  7879. Tri-n-octylammonium n-butanoate
  7880. Tri-n-octylammonium n-hexanoate
  7881. Tri-n-octylammonium n-octanoate
  7882. Tri-n-octylmethylammonium dodecanoate
  7883. Tri-n-octylmethylammonium n-hexadecanoate
  7884. Tri-n-octylmethylammonium n-hexanoate
  7885. Tri-n-octylmethylammonium octadecanoate
  7886. Tri-o-phenylene diborate
  7887. Tri-t-butyl(imino)phosphorane
  7888. triacontachlorotriacontahydro(5,6)fullerene-C60-Ih
  7889. triacontafluorotetradecane
  7890. triacontane
  7891. triacontanoic acid
  7892. Triacontanoic acid decyl ester
  7893. triacontanoic acid ethyl ester
  7894. triacontanoic acid methyl ester
  7895. Triacontanoic acid octadecyl ester
  7896. Triacontanoic acid pentyl ester
  7897. Triacontanoic acid triacontyl ester
  7898. Triacontanoic anhydride
  7899. triacontylbenzene
  7900. triacontylcyclohexane
  7901. trialkyl(n-C6,n-C10)methanaminium salt with cyanocyanamide (1:1)
  7902. Triallyl phosphate
  7903. trialuminium hexahydroxo phosphate undecahydrate
  7904. triamine zinc chloride monohydrate
  7905. triammonium (OC-6-11)-hexafluoroaluminate(3-)
  7906. triammonium (OC-6-11)-hexafluoroindate(3-)
  7907. triammonium (OC-6-11)-hexafluoroscandate(3-)
  7908. triammonium (PB-7-11-11111)-heptafluorozirconate(3-)
  7909. triammonium antimony chloride
  7910. Triammonium bismuth sulfate
  7911. triammonium copper chloride hexahydrate
  7912. triammonium copper(II) nitrate
  7913. Triammonium dicalcium nitrite pentahydrate
  7914. triammonium dicopper(I)chloride
  7915. triammonium dititanyl chloride tetrahydrate
  7916. triammonium dizinc acetate
  7917. Triammonium fluorooxovanadate(IV)
  7918. triammonium gallium(III) fluoride
  7919. triammonium heptafluorohafnate(3-)
  7920. triammonium hexafluoroferrate(III)
  7921. triammonium hexafluoroindate
  7922. triammonium hydrogen diselenate
  7923. triammonium hydrogen pyrophosphate monohydrate
  7924. triammonium hydrogen pyrophosphate pentahydrate
  7925. triammonium hydrogensulfate sulfate
  7926. triammonium indium trisulfate
  7927. triammonium perchlorate chromate
  7928. triammonium scandium trisulfate
  7929. triammonium uranyl fluoride
  7930. triammonium uranyl fluoride tetrahydrate
  7931. triangulo-dodecacarbonyltriosmium
  7932. Triantipyrine silver perchlorate
  7933. Triantipyrine silver tetrafluoroborate
  7934. triaqua(copper)(mu-((2,2'-((1,2-di(oxo-κO)-1,2-ethanediyl)di(imino-κN))bis(benzoato-κO))(4-)))manganese dihydrate stereoisomer
  7935. triaquabenzoatocalcium monobenzoate
  7936. triarsenic acid pentasodium salt
  7937. triazanium nitrate sulfate
  7938. triazanium zinc pentachloride
  7939. tribarium diarsenite
  7940. Tribarium tungsten(VI) oxide
  7941. Tribasic lead(II) styphnate dihydrate
  7942. tribenzo-18-crown-6
  7943. tribenzo-19-crown-6
  7944. tribenzo-21-crown-7
  7945. Tribenzylphosphine oxide
  7946. Triberyllium(II) pentaiodate hydroxide decahydrate
  7947. Tribismuth pentaborate
  7948. Tribismuth tetraselenide
  7949. tribromo(η5-2,4-cyclopentadien-1-yl)titanium
  7950. tribromo-2,4-cyclopentadien-1-ylgermane
  7951. tribromo-2-pentene
  7952. tribromoacetaldehyde
  7953. tribromoacetic acid
  7954. tribromobis(2-methylpyridine 1-oxide-O)arsenic
  7955. tribromobis(pyridine 1-oxide-O)arsenic
  7956. tribromobismuthine
  7957. tribromoborane
  7958. tribromobutane
  7959. tribromobutane
  7960. tribromochlorogermane
  7961. tribromochloromethane
  7962. tribromochlorosilane
  7963. tribromoethene
  7964. tribromofluorogermane
  7965. tribromofluoromethane
  7966. tribromofluorosilane
  7967. tribromogermane
  7968. tribromoheptylsilane
  7969. tribromohydrogenstannate(1-) compd. with methanamine (1:1)
  7970. tribromoiodogermane
  7971. tribromoiodomethane
  7972. tribromoiodosilane
  7973. tribromoisocyanatomethane
  7974. tribromomethane
  7975. tribromomethane-d
  7976. tribromomethylsilane
  7977. tribromonitromethane
  7978. tribromonitrosomethane
  7979. tribromophenanthrene
  7980. tribromosilane
  7981. tribromostibine
  7982. tributoxy-(3-methylbutyl)silane
  7983. tributoxy-methoxysilane
  7984. tributoxy-phenylsilane
  7985. tributoxyethenylsilane
  7986. tributoxymethylsilane
  7987. tributoxystibine
  7988. tributyl (2-methoxyethoxy)methyl phosphonium 1,2,3-triazolide
  7989. Tributyl 11-phosphonoundecanoate
  7990. tributyl dodecyl phosphonium 1,2,3-triazolide
  7991. Tributyl ethyl phosphonium 2-hexyldecanoate
  7992. tributyl methoxymethyl phosphonium 1,2,3-triazolide
  7993. tributyl octadecyl phosphonium 1,2,3-triazolide
  7994. Tributyl octadecyl phosphonium 2-cyanopyrrolide
  7995. tributyl sulfonium perchlorate
  7996. tributyl trithiophosphite
  7997. Tributyl(2-methoxyethyl)phosphonium bis(trifluoromethanesulfonyl)imide
  7998. tributyl(diethylcarbamoyl)tin
  7999. Tributyl(ethyl)phosphonium benzoate
  8000. Tributyl(ethyl)stannane
  8001. tributyl(iodo)stannane
  8002. Tributyl(methyl)stannane
  8003. tributyl(nitrooxy)stannane
  8004. Tributyl(octyl)phosphonium tetrafluoroborate
  8005. Tributyl(octyl)phosphonium trifluoroacetate
  8006. tributyl(perchloryloxy)stannane
  8007. tributyl(tetradecyl)phosphonium chloride
  8008. Tributyl(tribromogermylimino)-lambda5-phosphane
  8009. tributyl(trichloro)dialuminum
  8010. Tributyl(trichlorogermylimino)-lambda5-phosphane
  8011. tributyl-tributylsilyloxysilane
  8012. Tributylamine boron tribromide
  8013. Tributylammonium bis(trifluoromethanesulphonyl)imide
  8014. Tributylammonium butyrate
  8015. Tributylammonium hexafluorophosphate
  8016. Tributylammonium tetrafluoroborate
  8017. tributylarsine
  8018. tributylazanium acetate
  8019. tributylbismuthine
  8020. tributylborane
  8021. tributylboroxin
  8022. tributylchlorostannane
  8023. Tributylethanolammonium bromide
  8024. Tributylethylphosphonium 2-pyridinolate
  8025. Tributylethylphosphonium 3-pyridinolate
  8026. Tributylethylphosphonium 4-bromoimidazolate
  8027. Tributylethylphosphonium 4-methylimidazolate
  8028. Tributylethylphosphonium 4-pyridinolate
  8029. Tributylethylphosphonium acetate
  8030. Tributylethylphosphonium benzenesulfonate
  8031. Tributylethylphosphonium benzoyltrifluoroacetonate
  8032. Tributylethylphosphonium butanoate
  8033. Tributylethylphosphonium caproate
  8034. tributylethylphosphonium diethyl hydrogen phosphate (1:1)
  8035. Tributylethylphosphonium formate
  8036. Tributylethylphosphonium hexafluoroacetylacetonate
  8037. Tributylethylphosphonium imidazolate
  8038. Tributylethylphosphonium laurate
  8039. Tributylethylphosphonium phenolate
  8040. Tributylethylphosphonium pyridinecarboxylate
  8041. Tributylethylphosphonium pyridinesulfonate
  8042. Tributylethylphosphonium stearate
  8043. Tributylethylphosphonium thenoyltrifluoroacetonate
  8044. tributylgallium
  8045. tributylheptylammonium bis(trifluoromethanesulfonyl)imide
  8046. tributylheptylammonium trifluoromethanesulfonate
  8047. Tributylhexadecylphosphonium bis(trifluoromethanesulfonyl)amide
  8048. tributylhexylammonium hexafluorophosphate
  8049. tributylhexylphosphonium bis(trifluoromethylsulfonyl)imide
  8050. tributylhexylphosphonium hexafluorophosphate
  8051. Tributylhexylphosphonium tetrafluoroborate
  8052. tributylindium
  8053. tributylisocyanatostannane
  8054. tributylmethylammonium bis(pentafluoroethylsulfonyl)imide
  8055. Tributylmethylammonium dicyanamide
  8056. Tributylmethylammonium phenyltrifluoroborate
  8057. tributylmethylphosphonium bis(2,4,4-trimethylpentyl)phosphinate
  8058. tributylmethylphosphonium bis(trifluoromethylsulfonyl)imide
  8059. Tributylmethylphosphonium chloride
  8060. tributylmethylphosphonium dodecylsulfate
  8061. Tributylmethylphosphonium formate
  8062. tributylmethylphosphonium methylsulfate
  8063. tributylmethylphosphonium salt with trifluoromethanesulfonic acid (1:1)
  8064. tributyloctylammonium bis(trifluoromethanesulfonyl)imide
  8065. tributyloctylammonium trifluoromethanesulfonate
  8066. Tributyloctylphosphonium 1,3-diphenylpropane-1,3-dionate
  8067. Tributyloctylphosphonium 5,5-dimethyl-1,3-cyclohexanedionate
  8068. Tributyloctylphosphonium benzotriazolate
  8069. Tributyloctylphosphonium bromide
  8070. tributyloctylphosphonium chloride
  8071. Tributyloctylphosphonium indene-1,3-dionate
  8072. Tributyloctylphosphonium pentane-2,4-dionate
  8073. tributylphenylphosphonium bromide
  8074. tributylphosphine
  8075. tributylphosphine oxide
  8076. tributylphosphonium tetrafluoroborate
  8077. Tributylphosphonolaurate
  8078. tributylpropylsilane
  8079. tributylsilane
  8080. tributylstannane
  8081. tributylstannanylium hydroxide
  8082. tributylstannyl 2-(2,4,5-trichlorophenoxy)propanoate
  8083. tributylstibine
  8084. tributylsulfanium iodide
  8085. tributylsulfonium
  8086. tributylsulfonium bis(trifluoromethylsulfonyl)imide
  8087. tributylsulfonium bromide
  8088. tributylsulfonium chloride
  8089. tributylsulfonium salt with 2,4,6-trinitrophenol (1:1)
  8090. Tributyltetradecylphosphonium bis(trifluoromethanesulfonyl)amide
  8091. tributyltetradecylphosphonium salt with dodecylbenzenesulfonic acid (1:1)
  8092. tributyltin 2-iodobenzoate
  8093. tributyltin 4-chlorobutanoate
  8094. tributyltin 4-iodobenzoate
  8095. tributyl[(dimethylsilyl)methyl]stannane
  8096. tributyl[(ethoxydimethylsilyl)methyl]stannane
  8097. Tributyl[(methylthio)methyl]phosphonium bis(fluorosulfonyl)amide
  8098. Tributyl[(methylthio)methyl]phosphonium bis(trifluoromethylsulfonyl)amide
  8099. Tributyl[(methylthio)methyl]phosphonium tetrafluoroborate
  8100. Tributyl[2-(ethylthio)ethyl]phosphonium bis(fluorosulfonyl)amide
  8101. Tributyl[2-(ethylthio)ethyl]phosphonium bis(trifluoromethylsulfonyl)amide
  8102. Tributyl[2-(ethylthio)ethyl]phosphonium tetrafluoroborate
  8103. Tributyl[2-(methylthio)ethyl]phosphonium bis(fluorosulfonyl)amide
  8104. Tributyl[2-(methylthio)ethyl]phosphonium bis(trifluoromethylsulfonyl)amide
  8105. Tributyl[2-(methylthio)ethyl]phosphonium tetrafluoroborate
  8106. tribuyltetradecylphosphonium salt with 1,1,2,3,3,3-hexafluoropropanesulfonic acid
  8107. tricadmium acetate tetraacetic acid tetrahydrate
  8108. tricadmium diammonium sulfate pentahydrate
  8109. tricadmium dinickel chloride tetradecahydrate
  8110. tricadmium dipotassium sulfate dihydrate
  8111. tricadmium dipotassium sulfate pentahydrate
  8112. tricadmium dithallium sulfate pentahydrate
  8113. tricadmium heptacesium bromide
  8114. tricadmium lutetium chloride tetradecahydrate
  8115. tricadmium potassium bromide (KCd3Br7)
  8116. tricadmium potassium bromide tetrahydrate
  8117. tricadmium potassium chloride tetrahydrate
  8118. tricadmium tetraethylammonium chloride
  8119. tricadmium tetralithium chloride dodecahydrate
  8120. tricadmium tetrapotassium sulfate monohydrate
  8121. tricadmium thulium(III) chloride pentadecahydrate
  8122. tricadmnium chloride dialanine tetrahydrate
  8123. tricalcium bromide tetracalcium hydroxide dodecahydrate
  8124. tricalcium dialuminium oxide hexahydrate
  8125. tricalcium nickel chloride hexadecamethanol
  8126. tricalcium propionate bis(propionic acid) monohydrate
  8127. Tricarballylic acid monoethyl dioctyl ester
  8128. tricarbonyl(η5-2,4-cyclopentadien-1-yl)manganese
  8129. tricarbonyl(η5-2,4-cyclopentadien-1-yl)rhenium
  8130. tricarbonyl((1,2,3,4,5,6-η)-(1-methylethenyl)benzene)chromium
  8131. tricarbonyl((1,2,3,4,5,6-η)-1-ethenyl-4-methylbenzene)chromium
  8132. tricarbonyl((1,2,3,4,5,6-η)-ethenylbenzene)chromium
  8133. tricarbonyl((1,2,3,4,5,6-η)methyl benzoate)chromium
  8134. tricarbonyl(1-((2,3-η)-2-propenyl)-1H-pyrazole-N2)iron
  8135. Tricarbonylbenzene chromium
  8136. tricesium (OC-6-11)-hexabromolanthanate(3-)
  8137. tricesium (OC-6-11)-hexachloroindate(3-)
  8138. tricesium (OC-6-11)-hexafluoroaluminate(3-)
  8139. tricesium (T-4)-chromate (CrO4(3-))
  8140. tricesium antimony (III)chloride
  8141. tricesium bismuth (III) bromide
  8142. tricesium bismuth chloride
  8143. tricesium cobalt bromide
  8144. tricesium copper(I) chloride monohydrate
  8145. tricesium diantimony(III) iodide
  8146. tricesium dibismuth (III) bromide
  8147. tricesium dibismuth chloride
  8148. tricesium dicadmium chloride
  8149. tricesium dicopper(I) chloride
  8150. tricesium dicopper(II) chloride dihydrate
  8151. tricesium dierbium (III) bromide hexadecahydrate
  8152. tricesium dierbium(III) chloride tetradecahydrate
  8153. tricesium dithulium bromide hexadecahydrate
  8154. tricesium dithulium(III) chloride tetradecahydrate
  8155. tricesium erbium(III) chloride hexahydrate
  8156. tricesium fluoride di(molybdenum trioxide)
  8157. tricesium gadolinium chloride dihydrate
  8158. tricesium gadolinium chloride pentahydrate
  8159. Tricesium gadolinium(III) hexachloride
  8160. tricesium gallium(III) fluoride
  8161. Tricesium heptaphosphide
  8162. tricesium hydrogen diselenate
  8163. tricesium indium(III) fluoride
  8164. tricesium iodide di(bismut triiodide)
  8165. Tricesium lanthanum hexachloride trihydrate
  8166. tricesium lanthanum(III) chloride pentahydrate
  8167. Tricesium lanthanum(III) hexachloride
  8168. tricesium mercury(II) chloride
  8169. Tricesium neodymium(III) hexachloride
  8170. tricesium neodymium(III)chloride monohydrate
  8171. tricesium neodymium(III)chloride pentahydrate
  8172. Tricesium nitratocobalt(III) monohydrate
  8173. tricesium pentachlorocobaltate(3-)
  8174. tricesium praseodymium(III) chloride heptahydrate
  8175. Tricesium praseodymium(III) hexachloride
  8176. Tricesium samarium(III) hexachloride
  8177. tricesium scandium(III) sulfate
  8178. Tricesium sodium orthomolybdate
  8179. tricesium sodium perchlorate
  8180. tricesium terbium(III) bromide
  8181. tricesium trioxo trifluoromolybdate
  8182. Tricesium uranium(III) hexabromide
  8183. Tricesium ytterbium(III) hexachloride
  8184. Tricesium(I) cobalt(II) pentabromide
  8185. Tricesium(I) manganese(II) pentaiodide
  8186. trichloro(η5-2,4-cyclopentadien-1-yl)titanium
  8187. trichloro(1,1,2-trimethylpropyl)silane
  8188. trichloro(1,1-dimethylethoxy)silane
  8189. trichloro(1,1-dimethylethyl)silane
  8190. trichloro(1,2-dibromoethyl)silane
  8191. trichloro(1,2-dichloroethyl)silane
  8192. trichloro(1-chloroethyl)silane
  8193. Trichloro(1-methylethyl)silane
  8194. trichloro(1-naphthylmethyl)silane
  8195. trichloro(1-phenylbutyl)silane
  8196. trichloro(2,4,4-trimethylpentyl)silane
  8197. trichloro(2-chloroethyl)silane
  8198. trichloro(2-chlorophenyl)silane
  8199. trichloro(2-chloropropyl)silane
  8200. trichloro(2-dodecylhexadecyl)silane
  8201. trichloro(2-hexyldecyl)silane
  8202. trichloro(2-methylallyloxy)silane
  8203. trichloro(2-methylpropyl)silane
  8204. trichloro(2-phenylethyl)silane
  8205. trichloro(2-propenyl)germane
  8206. trichloro(2-tricyclo[3.3.1.1(3,7)]dec-1-ylethyl)silane
  8207. trichloro(3,3,3-trifluoropropyl)silane
  8208. trichloro(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane
  8209. trichloro(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane
  8210. trichloro(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)silane
  8211. trichloro(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-hexadecafluoro-11-dodecenyl)silane
  8212. trichloro(3,3-dimethylbutyl)silane
  8213. trichloro(3-chlorophenyl)silane
  8214. trichloro(3-chloropropyl)silane
  8215. trichloro(3-phenoxypropyl)silane
  8216. trichloro(4-chlorophenyl)silane
  8217. trichloro(4-ethoxyphenyl)silane
  8218. trichloro(4-ethylphenyl)silane
  8219. trichloro(4-methoxyphenyl)silane
  8220. trichloro(4-methylphenyl)silane
  8221. trichloro(4-phenylbutyl)silane
  8222. trichloro(6-phenylhexyl)silane
  8223. trichloro(chloroethynyl)silane
  8224. trichloro(chloromethoxy)silane
  8225. trichloro(chloromethyl)germane
  8226. trichloro(chloromethyl)silane
  8227. Trichloro(cyanosulfanyl)silane
  8228. trichloro(cyclohexylmethyl)silane
  8229. trichloro(dichloromethyl)germane
  8230. trichloro(dichloromethyl)silane
  8231. trichloro(dichlorophenyl)silane
  8232. trichloro(ethenyl)silane
  8233. trichloro(methyl)silane
  8234. trichloro(methylsulfonyl)methane
  8235. trichloro(methylthio)methane
  8236. trichloro(phenylmethyl)silane
  8237. trichloro(trichloromethyl)silane
  8238. trichloro-(3-methylbutyl)silane
  8239. trichloro-1,1'-biphenyl
  8240. trichloro-2,4-cyclopentadien-1-ylgermane
  8241. trichloro-2,4-dimethyl-3-pentanone
  8242. trichloro-2-propenylsilane
  8243. trichloro-2-thienylsilane
  8244. trichloro-bis(trifluoromethyl)phosphorane
  8245. trichloro-methoxysilane
  8246. trichloro-pentafluoro-cyclopentene
  8247. trichloro-prop-2-enoxysilane
  8248. trichloro-propoxysilane
  8249. trichloro2-[4-(1,1-dimethylethyl)phenyl]ethylsilane
  8250. trichloroacetaldehyde
  8251. trichloroacetaldehyde hemi-hydrate
  8252. trichloroacetamide
  8253. trichloroacetic acid
  8254. trichloroacetic acid 1-methylethyl ester
  8255. trichloroacetic acid 2,2-dimethylpropyl ester
  8256. trichloroacetic acid 2-cyanoethyl ester
  8257. trichloroacetic acid 2-methylbutyl ester
  8258. trichloroacetic acid 2-methylpropyl ester
  8259. trichloroacetic acid 2-phenylcyclohexyl ester
  8260. trichloroacetic acid 3-methyl-2-butenyl ester
  8261. trichloroacetic acid 3-methylbutyl ester
  8262. trichloroacetic acid ammonium salt
  8263. trichloroacetic acid anhydride
  8264. trichloroacetic acid cyclohexyl ester
  8265. trichloroacetic acid erbium(3+) salt
  8266. trichloroacetic acid ethenyl ester
  8267. trichloroacetic acid ethyl ester
  8268. trichloroacetic acid holmium(3+) salt
  8269. trichloroacetic acid lanthanum(3+) salt
  8270. trichloroacetic acid lead salt monohydrate
  8271. trichloroacetic acid lead(2+) salt
  8272. trichloroacetic acid lithium salt
  8273. trichloroacetic acid methyl ester
  8274. trichloroacetic acid neodymium(3+) salt
  8275. trichloroacetic acid potassium salt
  8276. trichloroacetic acid praseodymium(3+) salt
  8277. trichloroacetic acid samarium(3+) salt (3:1)
  8278. trichloroacetic acid sodium salt
  8279. trichloroacetic acid yttrium(3+) salt
  8280. trichloroacetonitrile
  8281. trichloroacetyl bromide
  8282. trichloroacetyl chloride
  8283. trichloroacrylic aldehyde
  8284. trichlorobis(3-methylpyridine 1-oxide-O)arsenic
  8285. trichlorobismuthine
  8286. trichloroborane
  8287. trichloroboroxin
  8288. trichlorocyclohexylsilane
  8289. trichlorocyclooctylsilane
  8290. trichlorocyclopentylsilane
  8291. trichlorodecane
  8292. trichlorodecylsilane
  8293. trichlorodocosylsilane
  8294. trichlorododecylsilane
  8295. trichloroeicosylsilane
  8296. trichloroethane
  8297. trichloroethane
  8298. trichloroethanethioic acid anhydrosulfide
  8299. trichloroethanethioic acid anhydrosulfide with ethanethioic acid
  8300. trichloroethanethioic acid anhydrosulfide with thiohypochlorous acid
  8301. trichloroethene
  8302. trichloroethoxysilane
  8303. trichloroethyl phosphate
  8304. trichloroethylgermane
  8305. trichloroethylsilane
  8306. trichloroethylstannane
  8307. trichlorofluoroethene
  8308. trichlorofluorogermane
  8309. trichlorofluoromethane
  8310. trichlorofluorosilane
  8311. trichlorogermane
  8312. trichloroheptylgermane
  8313. trichloroheptylsilane
  8314. trichlorohexadecylsilane
  8315. trichlorohexylgermane
  8316. trichlorohexylsilane
  8317. trichloroindigane tetrahydrate
  8318. trichloroiodogermane
  8319. trichloroiodomethane
  8320. trichloroiodosilane
  8321. trichloroisocyanatogermane
  8322. trichloroisocyanatomethane
  8323. trichloroisothiocyanatosilane
  8324. trichloromethane
  8325. trichloromethane compd. with pyridine (1:1)
  8326. trichloromethane-d
  8327. trichloromethanesulfenyl chloride
  8328. trichloromethanesulfonyl chloride
  8329. trichloromethoxyethene
  8330. trichloromethoxymethane
  8331. trichloromethyl
  8332. trichloromethyl (4-chlorophenyl)methyl disulfide
  8333. trichloromethyl hexyl disulfide
  8334. trichloromethyl norbornyl disulfide
  8335. trichloromethyl trifluoromethyl disulfide
  8336. trichloromethylgermane
  8337. trichloromethylnitrobenzene
  8338. trichloromethylstannane
  8339. trichloromethylsulfanylbenzene
  8340. trichloronitromethane
  8341. trichloronitrosomethane
  8342. trichlorononylsilane
  8343. trichlorooctadecylsilane
  8344. trichlorooctylsilane
  8345. trichloropentylsilane
  8346. trichlorophenol
  8347. Trichlorophenoxytitanium
  8348. trichlorophenylgermane
  8349. trichlorophenylsilane
  8350. trichlorophenylstannane
  8351. trichloropropane
  8352. trichloropropylgermane
  8353. trichloropropylsilane
  8354. trichlorosilane
  8355. trichlorosilanecarbonitrile
  8356. trichlorosilicon
  8357. Trichlorosilyl 2,2-dimethylpropanoate
  8358. Trichlorosilyl 2-methylpropanoate
  8359. Trichlorosilyl 3-methylbutanoate
  8360. Trichlorosilyl acetate
  8361. Trichlorosilyl butanoate
  8362. Trichlorosilyl hexanoate
  8363. Trichlorosilyl octanoate
  8364. Trichlorosilyl pentanoate
  8365. Trichlorosilyl propanoate
  8366. Trichlorosilyl(trichlorogermyl)mercury
  8367. trichlorostannane
  8368. trichlorostibine
  8369. trichlorotetradecylsilane
  8370. trichlorotrifluoro-2,2,4,4,6,6-hexahydro-1,3,5,2,4,6-triazatriphosphorine
  8371. trichlorotrifluorobenzene
  8372. trichlorotrifluoroethane
  8373. trichlorotrifluoroethane
  8374. trichlorotripropyldialuminium
  8375. trichloroundecylsilane
  8376. trichloroyttrium hexahydrate
  8377. trichloro[(1,1-dimethylpropyl)oxy]silane
  8378. trichloro[(chloromethyl)sulfonyl]methane
  8379. trichloro[(chloromethyl)thio]methane
  8380. trichloro[(dichloromethyl)thio]methane
  8381. trichloro[(trichlorogermyl)methyl]silane
  8382. trichloro[11-(2-methoxyethoxy)undecyl]silane
  8383. trichloro[2-(methyldioctylsilyl)ethyl]silane
  8384. trichloro[3-(4-methoxyphenyl)propyl]silane
  8385. trichloro[3-[1,2,2,2-tetrafluoro-1-(trifluoromethyl)ethoxy]propyl]silane
  8386. trichloro[4-(heptadecafluorooctyl)phenyl]silane
  8387. Trichromium silicide
  8388. triciribine
  8389. Triclabendazole
  8390. tricobalt chloride di(hexamethylene tetramine) hexahydrate
  8391. tricobaltous benzene-1,3,5-tricarboxylate dodecahydrate
  8392. tricopper(I) arsenic trisulfide
  8393. tricopper(II) acetate di(hexamethylenetetramine) hexahydrate
  8394. tricopper(II)trisodium ortophosphate
  8395. Tricos-4-yne
  8396. tricosadecanedioic acid bis(2-methylpropyl) ester
  8397. tricosafluorododecanoic acid compd. with 1-butanamine (1:1)
  8398. Tricosan-10-ol
  8399. Tricosan-11-ol
  8400. Tricosan-7-ol
  8401. Tricosan-8-ol
  8402. Tricosan-9-ol
  8403. tricosane
  8404. tricosanedioic acid bis(1-methylethyl) ester
  8405. tricosanedioic acid dibutyl ester
  8406. tricosanedioic acid dipentyl ester
  8407. tricosanedioic acid dipropyl ester
  8408. tricosanenitrile
  8409. tricosanoic acid
  8410. tricosanoic acid 1,2,3-propanetriyl ester
  8411. tricosanoic acid 1-methylethyl ester
  8412. tricosanoic acid 2-methylpropyl ester
  8413. tricosanoic acid ethyl ester
  8414. tricosanoic acid methyl ester
  8415. tricosanoic acid pentyl ester
  8416. tricosanoic acid propyl ester
  8417. tricyclo(13.2.2.2(3,6))heneicosa-3,5,15,17,18,20-hexaene
  8418. tricyclo(16.2.2.2(8,11))tetracosa-8,10,18,20,21,23-hexaene
  8419. tricyclo(3.3.1.1(3,7))decan-1-ol nitrate
  8420. tricyclo(3.3.1.1(3,7))decane-1,3,5,7-tetrol tetranitrate
  8421. tricyclo(3.3.1.1(3,7))decane-1,3-diol dinitrate
  8422. tricyclo(3.3.1.1(3,7))decane-2,6-dione
  8423. tricyclo(4.2.2.0(2,5))deca-3,7,9-triene
  8424. tricyclo(7.1.0.0(2,4))decane
  8425. tricyclo(8.2.2.2(4,7))hexadecane
  8426. tricyclo(9.2.2.1(4,8))hexadeca-4,6,8(16),11,13,14-hexaene
  8427. tricyclo(9.3.1.1(4,8))hexadeca-1(15),4,6,8(16),11,13-hexaene
  8428. Tricyclohexylamine
  8429. tricyclohexylborane
  8430. Tricyclohexylmethanol
  8431. tricyclohexyloxy-phenylsilane
  8432. Tricyclohexyltin 2-(3-bis((2-oxo-2-((tricyclohexyltin)oxy)ethyl)amino)phenoxy)acetate dimethylate
  8433. Tricyclopentylamine
  8434. tricyclotrimethylenebenzene
  8435. tricyclo[10.2.2.2(5,8)octadeca-5,7,12,14,15,17-hexaene
  8436. Tricyclo[2.2.1.0(2,6)]heptan-3-one
  8437. tricyclo[2.2.1.0(2,6)]heptane
  8438. Tricyclo[2.2.1.0(2,6)]heptane-3,5-diol
  8439. tricyclo[3.1.0.0(2,6)]hex-3-ene
  8440. tricyclo[3.1.0.0(2,6)]hexane
  8441. tricyclo[3.2.1.0(2,4)]oct-6-ene
  8442. tricyclo[3.2.1.0(2,4)]octane
  8443. tricyclo[3.3.0.0(2,6)]octane
  8444. tricyclo[3.3.1.1(3,7)]decan-1-ol
  8445. tricyclo[3.3.1.1(3,7)]decan-2-ol
  8446. tricyclo[3.3.1.1(3,7)]decane
  8447. tricyclo[3.3.1.1(3,7)]decane-1-carbonitrile
  8448. tricyclo[3.3.1.1(3,7)]decane-1-carboxamide
  8449. tricyclo[3.3.1.1(3,7)]decane-1-carboxylic acid
  8450. tricyclo[3.3.1.1(3,7)]decane-1-carboxylic acid methyl ester
  8451. tricyclo[3.3.1.1(3,7)]decane-2-carboxylic acid
  8452. tricyclo[3.3.1.1(3,7)]decanone
  8453. tricyclo[3.3.1.1.1(3,7)]decan-1-amine
  8454. tricyclo[3.3.2.0(2,8)]deca-3,6,9-triene
  8455. tricyclo[4.1.0.0(2,4)]heptane
  8456. Tricyclo[5.2.1.0(2,6)]deca-4,8-dien-3-one
  8457. tricyclo[5.2.1.0(2,6)]decan-2-ol
  8458. tricyclo[5.2.1.0(2,6)]decan-2-yl 4-nitrobenzoate
  8459. Tricyclo[5.4.0.0 (2,6)]undecane-8,11-dione
  8460. Tricyclo[6.5.0.0 (2,7)]tridecane-3,6-dione
  8461. tricyclo[8.2.2.2(4,7)]hexadeca-4,6,10,12,13,15-hexaene
  8462. tricyclo[9.4.0.0(3,8)]pentadeca-1(15),3,5,7,11,13-hexaen-2-ol
  8463. Tridec-4-enol
  8464. Tridec-7-yl N-naphthalen-1-ylcarbamate
  8465. tridecafluorocyclohexaneacetic acid
  8466. tridecafluoroheptanoic acid
  8467. tridecafluoroheptanoyl chloride
  8468. tridecafluoroheptanoyl fluoride
  8469. tridecamethylenimine
  8470. tridecan-1-amine hydrochloride
  8471. tridecan-2-amine
  8472. tridecan-4-ol
  8473. Tridecan-5-ol
  8474. Tridecan-6-ol
  8475. tridecan-7-ol
  8476. tridecanal
  8477. tridecane
  8478. tridecanedioic acid
  8479. tridecanedioic acid dimethyl ester
  8480. tridecanenitrile
  8481. tridecaneperoxoic acid
  8482. tridecanoic acid
  8483. tridecanoic acid 1,10-decanediyl ester
  8484. tridecanoic acid 1,2,3-propanetriyl ester
  8485. tridecanoic acid 1,3-propanediyl ester
  8486. tridecanoic acid 1,4-butanediyl ester
  8487. tridecanoic acid 1,5-pentanediyl ester
  8488. tridecanoic acid 1,6-hexanediyl ester
  8489. tridecanoic acid 1,7-heptanediyl ester
  8490. tridecanoic acid 1,8-octanediyl ester
  8491. tridecanoic acid 1,9-nonanediyl ester
  8492. tridecanoic acid butyl ester
  8493. tridecanoic acid decyl ester
  8494. tridecanoic acid docosyl ester
  8495. tridecanoic acid dodecyl ester
  8496. tridecanoic acid eicosyl ester
  8497. tridecanoic acid ethyl ester
  8498. tridecanoic acid heneicosyl ester
  8499. tridecanoic acid heptadecyl ester
  8500. tridecanoic acid heptanoyloxyhexyl ester
  8501. tridecanoic acid heptyl ester
  8502. tridecanoic acid hexadecyl ester
  8503. tridecanoic acid lithium salt
  8504. tridecanoic acid methyl ester
  8505. tridecanoic acid nonadecyl ester
  8506. tridecanoic acid nonyl ester
  8507. tridecanoic acid octadecyl ester
  8508. tridecanoic acid octyl ester
  8509. tridecanoic acid pentadecyl ester
  8510. tridecanoic acid pentanoyloxydecyl ester
  8511. tridecanoic acid pentanoyloxyhexyl ester
  8512. tridecanoic acid pentanoyloxyoctyl ester
  8513. tridecanoic acid propyl ester
  8514. tridecanoic acid sodium salt
  8515. tridecanoic acid tetradecyl ester
  8516. tridecanoic acid thallium(1+) salt
  8517. tridecanoic acid tridecyl ester
  8518. tridecanoic acid undecyl ester
  8519. Tridecanoyl chloride
  8520. tridecylazanium acetate
  8521. tridecylbenzene
  8522. tridecylcarbamic acid methyl ester
  8523. tridecylcyclohexane
  8524. tridecylcyclopentane
  8525. tridecylpropanedioic acid
  8526. Trideuterocarbonylborane
  8527. tridodecylammonium chloride tetrachloromethane
  8528. Tridodecylmethylammonium chloride
  8529. Tridodecylmethylammonium picrate
  8530. Trietatryne
  8531. Triethanolamine butyrate
  8532. triethanolamine divinyl ether
  8533. Triethanolammonium 3-hydroxypyridazonate-6
  8534. Triethanolammonium bis(trifluoromethylsulfonyl)imide
  8535. Triethanolammonium oleate
  8536. Triethanolammonium stearate
  8537. triethenyl-2-propenylsilane
  8538. triethenylarsine
  8539. triethenylbismuthine
  8540. triethenylborane
  8541. triethenyliodostannane
  8542. triethenylmethylsilane
  8543. triethenylphosphine
  8544. triethenylsilane
  8545. triethenylstibine
  8546. triethoxy(2-methylpropyl)silane
  8547. triethoxy(2-propenyl)silane
  8548. triethoxy(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane
  8549. triethoxy(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)silane
  8550. triethoxy(3-phenoxypropyl)silane
  8551. triethoxy(ethyl)silane
  8552. triethoxy(phenylmethyl)silane
  8553. triethoxy-(3-methylbutyl)silane
  8554. triethoxy-prop-2-enoxysilane
  8555. triethoxy-triethoxysilyloxysilane
  8556. triethoxyfluorosilane
  8557. triethoxyhexadecylsilane
  8558. triethoxyhexylsilane
  8559. triethoxyisocyanatosilane
  8560. triethoxymethylsilane
  8561. triethoxyoctadecylsilane
  8562. triethoxyoctylsilane
  8563. triethoxypentylsilane
  8564. triethoxyphenylsilane
  8565. triethoxypropylsilane
  8566. triethoxysilanamine
  8567. triethoxysilane
  8568. triethoxysilylmethanamine
  8569. triethoxy[2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl]silane
  8570. triethoxy[3-((2-oxiranyl)methoxy)propyl]silane
  8571. triethoxy[4-(2-oxiranyl)butyl]silane
  8572. triethyl (2-(2-methoxyethoxy)ethoxy)ethylammonium acetate
  8573. triethyl (2-methoxyethoxy)ethylammonium acetate
  8574. triethyl (2-methoxyethoxy)methyl phosphonium 1,2,3-triazolide
  8575. triethyl (2-methoxyethoxy)methyl phosphonium 2-methyl-5-nitroimidazolide
  8576. triethyl (2-methoxyethoxy)methyl phosphonium 4-nitropyrazolide
  8577. triethyl (2-methoxyethoxy)methyl phosphonium bis(trifluoromethylsulfonyl)imide
  8578. Triethyl (2-methoxyethyl) phosphonium bis(trifluoromethylsulfonyl)imide
  8579. Triethyl 1,1,2-ethanetricarboxylate
  8580. Triethyl Carboxymalonate
  8581. triethyl ethoxymethyl phosphonium 1,2,3-triazolide
  8582. triethyl furfuryl orthosilicate
  8583. triethyl methallyl orthosilicate
  8584. triethyl methoxymethyl phosphonium 1,2,3-triazolide
  8585. Triethyl phosphonoformate
  8586. Triethyl phosphonopropyonate
  8587. Triethyl phosphonostearate
  8588. triethyl((2-methylphenyl)thio)stannane
  8589. triethyl((2-methylpropyl)thio)stannane
  8590. triethyl((3-methylphenyl)thio)stannane
  8591. triethyl((4-methylphenyl)thio)stannane
  8592. triethyl((phenylmethyl)thio)stannane
  8593. triethyl(1,1-dimethylethylthio)stannane
  8594. triethyl(1-methylethylthio)tin
  8595. Triethyl(2-methoxyethyl)ammonium bis(trifluoromethanesulfonyl)imide
  8596. triethyl(2-methoxyethyl)sulfamide
  8597. Triethyl(2-methylpropoxy)silane
  8598. triethyl(2-methylpropyl)stannane
  8599. triethyl(3-methylbutyl)stannane
  8600. triethyl(3-methylbutylthio)stannane
  8601. triethyl(4-methylphenyloxy)stannane
  8602. triethyl(ethylthio)stannane
  8603. triethyl(heptylthio)stannane
  8604. triethyl(hexylthio)stannane
  8605. triethyl(isocyanato)stannane
  8606. Triethyl(methyl)plumbane
  8607. Triethyl(methyl)stannane
  8608. triethyl(methylthio)stannane
  8609. Triethyl(naphthalen-2-ylsulfanyl)tin
  8610. Triethyl(octyl)phosphonium 3-chloroindazolide
  8611. Triethyl(octyl)phosphonium 3-iodopyrazolide
  8612. Triethyl(octyl)phosphonium 3-thiol-1,2,4-triazolide
  8613. Triethyl(octyl)phosphonium 4-bromo-3-methylpyrazolide
  8614. Triethyl(octyl)phosphonium 4-bromoimidazolide
  8615. Triethyl(octyl)phosphonium 4-bromoindazolide
  8616. Triethyl(octyl)phosphonium 5-bromoindazolide
  8617. Triethyl(octyl)phosphonium 5-methylbenzimidazolide
  8618. Triethyl(octyl)phosphonium 6-bromoindazolide
  8619. Triethyl(octyl)phosphonium 6-cyanoindazolide
  8620. Triethyl(octyl)phosphonium benzotriazolide
  8621. Triethyl(pentyl)stannane
  8622. triethyl(phenylthio)stannane
  8623. Triethyl(propyl)plumbane
  8624. Triethyl(tribromogermylimino)-lambda5-phosphane
  8625. Triethyl(trichlorogermylimino)-lambda5-phosphane
  8626. triethyl-(1,1,2,2,2-pentafluoroethyl)stannane
  8627. Triethyl-11-phosphonoundecanoate
  8628. Triethyl-methylammonium trichloride
  8629. Triethyl-n-pentylphosphonium bis(fluorosulfonyl)imide
  8630. Triethyl-n-pentylphosphonium bis(trifluoromethylsulfonyl)imide
  8631. triethylaluminium comdp. with 1,1'-oxybisethane
  8632. triethylaluminum
  8633. Triethylammonium 6-propyl-4-(furan-2-yl)-3-cyano-5-ethoxycarbonyl-1,4-dihydropyridine-2-thiolate
  8634. Triethylammonium butanoate
  8635. Triethylammonium formate
  8636. Triethylammonium glycolate
  8637. Triethylammonium heptafluorobutyrate
  8638. Triethylammonium methoxyacetate
  8639. Triethylammonium propionate
  8640. Triethylammonium pyruvate
  8641. Triethylammonium tetrafluoroborate
  8642. Triethylammonium trifluoroacetate
  8643. triethylarsine
  8644. triethylarsine bis(3,6-di-tert.-butyl-o-benzosemiquinonato) nickel(II)
  8645. triethylbenzenesulfonyl chloride
  8646. triethylbismuthine
  8647. triethylborane
  8648. triethylboroxin
  8649. triethylbutanedioic acid
  8650. triethylene glycol compd. with dicyclohexylamine (1:2)
  8651. triethylene glycol diacrylate
  8652. Triethylene glycol monoenanthate
  8653. Triethylene glycol monopentyl ether
  8654. triethyleneglycol vinyl ethylether
  8655. Triethylenetetramine 2-methoxyphenolate
  8656. Triethylenetetramine phenolate
  8657. triethylfluorogermane
  8658. triethylfluorosilane
  8659. triethylgallium
  8660. triethylgermanylmethanesulfonic acid trimethylsilyl ester
  8661. triethylheptylsilane
  8662. triethylhexylsilane
  8663. triethylhydrazine
  8664. triethylindium
  8665. triethyliodostannane
  8666. triethylisothiocyanatostannane
  8667. triethylmethoxystannane
  8668. triethylmethylammonium 2,2,2-trifluoro-N-(trifluoromethylsulfonyl)acetamide
  8669. triethylmethylammonium bis-(trifluoromethanesulfonyl)imide
  8670. Triethylmethylammonium dibromoiodide
  8671. Triethylmethylammonium dichlorobromide
  8672. Triethylmethylammonium dichloroiodide
  8673. triethylmethylammonium methyl sulfate (1:1)
  8674. Triethylmethylammonium tribromide
  8675. Triethylmethylammonium triiodide
  8676. triethylmethylpyrazine
  8677. triethylmethylsilane
  8678. triethylmethylsulfamide
  8679. Triethyloctylphosphonium 5-bromobenzimidazolide
  8680. Triethyloctylphosphonium benzimidazolide
  8681. Triethyloctylphosphonium bis(pentafluoroethanesulfonyl)amide
  8682. triethyloctylphosphonium bis(trifluoromethylsulfonyl)imide
  8683. triethyloctylsilane
  8684. Triethylpentylphosphonium bis(pentafluoroethanesulfonyl)amide
  8685. triethylpentylsilane
  8686. triethylphenoxystannane
  8687. triethylphosphine
  8688. triethylphosphine oxide
  8689. triethylpropylsilane
  8690. triethylpropylstannane
  8691. triethylsilane
  8692. triethylsilanol
  8693. triethylsilyl 2,2,2-trifluoroacetate
  8694. triethylsilyl acetate
  8695. triethylsilylmethanesulfonic acid trimethylsilyl ester
  8696. triethylsilylmethylsulfonyl 2,2,2-trifluoroacetate
  8697. triethylstannane
  8698. triethylstibine
  8699. triethylsulfonium
  8700. triethylsulfonium bromide
  8701. triethylsulfonium bromide compd. with aluminum chloride (9:16)
  8702. triethylsulfonium salt with 1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide (1:1)
  8703. triethylthallium
  8704. Triethyltin 2,2-dichloroacetate
  8705. Triethyltin 2-chloroacetate
  8706. Triethyltin acetate
  8707. Triethyltin butanoate
  8708. Triethyltin cyanide
  8709. Triethyltin propanoate
  8710. Triethyltin trifluoroacetate
  8711. Triethyl[(methylthio)methyl]phosphonium bis(fluorosulfonyl)amide
  8712. Triethyl[(methylthio)methyl]phosphonium bis(trifluoromethylsulfonyl)amide
  8713. Triethyl[(methylthio)methyl]phosphonium tetrafluoroborate
  8714. Triethyl[2-(ethylthio)ethyl]phosphonium bis(fluorosulfonyl)amide
  8715. Triethyl[2-(ethylthio)ethyl]phosphonium bis(trifluoromethylsulfonyl)amide
  8716. Triethyl[2-(ethylthio)ethyl]phosphonium tetrafluoroborate
  8717. Triethyl[2-(methylthio)ethyl]phosphonium bis(fluorosulfonyl)amide
  8718. Triethyl[2-(methylthio)ethyl]phosphonium bis(trifluoromethylsulfonyl)amide
  8719. Triethyl[2-(methylthio)ethyl]phosphonium tetrafluoroborate
  8720. trifluormethoxyacetic acid
  8721. Trifluormethylselenyl-chlorfluormethyl-trifluormethyldisulfane
  8722. Trifluormethylselenyl-chlorfluormethyl-trifluormethylselansulfane
  8723. Trifluormethylselenyl-dichlormethyl-trifluormethyldisulfane
  8724. Trifluormethylselenyl-dichlormethyl-trifluormethylselansulfane
  8725. Trifluormethylselenyl-trifluormethylsulfenyl-chlormethyl-trifluormethyldisulfane
  8726. Trifluormethylselenyl-trifluormethylsulfenyl-chlormethyl-trifluormethylselansulfane
  8727. trifluoro(1,1,1,2,3,3,3-heptafluoro-2-propanaminato(2-))(trifluoromethanolato)sulfur
  8728. trifluoro(1,1,1-trifluoromethanaminato(2-))(trifluoromethyl)sulfur
  8729. trifluoro(fluorosulfato-o)(1,1,1,2,3,3,3-heptafluoro-2-propanaminato(2-))sulfur
  8730. trifluoro(methylselen)methane
  8731. trifluoro(methylsulfonyl)
  8732. trifluoro(methylthio)methane
  8733. Trifluoro(nitrososulfanyl)methane
  8734. Trifluoro(propan-2-yl)silane
  8735. Trifluoro(propyl)silane
  8736. trifluoro(trifluoromethoxy)ethene
  8737. trifluoro(trifluoromethyl)oxirane
  8738. Trifluoro(trifluoromethyl)sulfur
  8739. trifluoro({[(fluorosulfonyl)oxy]sulfonyl}oxy)methane
  8740. trifluoro-(trifluoromethyldiselanyl)methane
  8741. trifluoro-(trifluoromethylselanyl)methane
  8742. trifluoro-1-propene
  8743. trifluoro-fluorosulfonyloxymethane
  8744. trifluoro-isocyanatomethane
  8745. trifluoro-nitromethane
  8746. trifluoro-nitrosomethane
  8747. Trifluoro-[sulfinyl(trifluoromethylselanyl)methyl]selanylmethane
  8748. Trifluoro-[sulfinyl(trifluoromethylselanyl)methyl]sulfanylmethane
  8749. trifluoroacetaldehyde
  8750. trifluoroacetic acid
  8751. trifluoroacetic acid (methylnitroamino)methyl ester
  8752. trifluoroacetic acid 1-(chlorodifluoromethyl)-2,2,2-trifluoroethyl ester
  8753. trifluoroacetic acid 1-methylethyl ester
  8754. trifluoroacetic acid 2,2,2-trifluoro-1,1-bis(trifluoromethyl)ethyl ester
  8755. trifluoroacetic acid 2,2,2-trifluoro-1-(trifluoromethyl)ethyl ester
  8756. trifluoroacetic acid 2,2,2-trifluoro-1-methyl-1-(trifluoromethyl)ethyl ester
  8757. trifluoroacetic acid 2,2,2-trifluoroethyl ester
  8758. trifluoroacetic acid 2-bromo-4,4,4-trichlorobutyl ester
  8759. trifluoroacetic acid 2-propenyl ester
  8760. trifluoroacetic acid 3-methyl-3-butenyl ester
  8761. trifluoroacetic acid 3-methylphenyl ester
  8762. trifluoroacetic acid 4,4,4-trichloro-2-butenyl ester
  8763. trifluoroacetic acid 4-methylphenyl ester
  8764. trifluoroacetic acid 4-nitrophenyl ester
  8765. trifluoroacetic acid aluminum salt
  8766. trifluoroacetic acid anhydride
  8767. trifluoroacetic acid anhydride with fluorosulfuric acid
  8768. trifluoroacetic acid barium salt
  8769. trifluoroacetic acid butyl ester
  8770. trifluoroacetic acid cadmium salt
  8771. trifluoroacetic acid calcium salt
  8772. trifluoroacetic acid cerium(3+) salt
  8773. tr